Page MenuHomeMusing Studio

No OneTemporary

This file is larger than 256 KB, so syntax highlighting was skipped.
diff --git a/account.go b/account.go
index 2dcfd27..5dba924 100644
--- a/account.go
+++ b/account.go
@@ -1,1108 +1,1108 @@
/*
* Copyright © 2018-2019 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"encoding/json"
"fmt"
"html/template"
"net/http"
"regexp"
"strings"
"sync"
"time"
"github.com/gorilla/mux"
"github.com/gorilla/sessions"
"github.com/guregu/null/zero"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/data"
"github.com/writeas/web-core/log"
"github.com/writeas/writefreely/author"
"github.com/writeas/writefreely/config"
"github.com/writeas/writefreely/page"
)
type (
userSettings struct {
Username string `schema:"username" json:"username"`
Email string `schema:"email" json:"email"`
NewPass string `schema:"new-pass" json:"new_pass"`
OldPass string `schema:"current-pass" json:"current_pass"`
IsLogOut bool `schema:"logout" json:"logout"`
}
UserPage struct {
page.StaticPage
PageTitle string
Separator template.HTML
IsAdmin bool
CanInvite bool
}
)
func NewUserPage(app *App, r *http.Request, u *User, title string, flashes []string) *UserPage {
up := &UserPage{
StaticPage: pageForReq(app, r),
PageTitle: title,
}
up.Username = u.Username
up.Flashes = flashes
up.Path = r.URL.Path
up.IsAdmin = u.IsAdmin()
up.CanInvite = canUserInvite(app.cfg, up.IsAdmin)
return up
}
func canUserInvite(cfg *config.Config, isAdmin bool) bool {
return cfg.App.UserInvites != "" &&
(isAdmin || cfg.App.UserInvites != "admin")
}
func (up *UserPage) SetMessaging(u *User) {
//up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID)
}
const (
loginAttemptExpiration = 3 * time.Second
)
var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead")
func apiSignup(app *App, w http.ResponseWriter, r *http.Request) error {
_, err := signup(app, w, r)
return err
}
func signup(app *App, w http.ResponseWriter, r *http.Request) (*AuthUser, error) {
reqJSON := IsJSON(r)
// Get params
var ur userRegistration
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&ur)
if err != nil {
log.Error("Couldn't parse signup JSON request: %v\n", err)
return nil, ErrBadJSON
}
} else {
// Check if user is already logged in
u := getUserSession(app, r)
if u != nil {
return &AuthUser{User: u}, nil
}
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse signup form request: %v\n", err)
return nil, ErrBadFormData
}
err = app.formDecoder.Decode(&ur, r.PostForm)
if err != nil {
log.Error("Couldn't decode signup form request: %v\n", err)
return nil, ErrBadFormData
}
}
return signupWithRegistration(app, ur, w, r)
}
func signupWithRegistration(app *App, signup userRegistration, w http.ResponseWriter, r *http.Request) (*AuthUser, error) {
reqJSON := IsJSON(r)
// Validate required params (alias)
if signup.Alias == "" {
return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."}
}
if signup.Pass == "" {
return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."}
}
var desiredUsername string
if signup.Normalize {
// With this option we simply conform the username to what we expect
// without complaining. Since they might've done something funny, like
// enter: write.as/Way Out There, we'll use their raw input for the new
// collection name and sanitize for the slug / username.
desiredUsername = signup.Alias
signup.Alias = getSlug(signup.Alias, "")
}
if !author.IsValidUsername(app.cfg, signup.Alias) {
// Ensure the username is syntactically correct.
return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."}
}
// Handle empty optional params
// TODO: remove this var
createdWithPass := true
hashedPass, err := auth.HashPass([]byte(signup.Pass))
if err != nil {
return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
// Create struct to insert
u := &User{
Username: signup.Alias,
HashedPass: hashedPass,
HasPass: createdWithPass,
Email: prepareUserEmail(signup.Email, app.keys.EmailKey),
Created: time.Now().Truncate(time.Second).UTC(),
}
// Create actual user
if err := app.db.CreateUser(app.cfg, u, desiredUsername); err != nil {
return nil, err
}
// Log invite if needed
if signup.InviteCode != "" {
cu, err := app.db.GetUserForAuth(signup.Alias)
if err != nil {
return nil, err
}
err = app.db.CreateInvitedUser(signup.InviteCode, cu.ID)
if err != nil {
return nil, err
}
}
// Add back unencrypted data for response
if signup.Email != "" {
u.Email.String = signup.Email
}
resUser := &AuthUser{
User: u,
}
if !createdWithPass {
resUser.Password = signup.Pass
}
title := signup.Alias
if signup.Normalize {
title = desiredUsername
}
resUser.Collections = &[]Collection{
{
Alias: signup.Alias,
Title: title,
},
}
var token string
if reqJSON && !signup.Web {
token, err = app.db.GetAccessToken(u.ID)
if err != nil {
return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
}
resUser.AccessToken = token
} else {
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
// Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144
log.Error("Session: %v; ignoring", err)
}
session.Values[cookieUserVal] = resUser.User.Cookie()
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session: %v", err)
return nil, err
}
}
if reqJSON {
return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated)
}
return resUser, nil
}
func viewLogout(app *App, w http.ResponseWriter, r *http.Request) error {
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
return ErrInternalCookieSession
}
// Ensure user has an email or password set before they go, so they don't
// lose access to their account.
val := session.Values[cookieUserVal]
var u = &User{}
var ok bool
if u, ok = val.(*User); !ok {
log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values)
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session on logout: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
}
return impart.HTTPError{http.StatusFound, "/"}
}
u, err = app.db.GetUserByID(u.ID)
if err != nil && err != ErrUserNotFound {
return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."}
}
session.Options.MaxAge = -1
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session on logout: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
}
return impart.HTTPError{http.StatusFound, "/"}
}
func handleAPILogout(app *App, w http.ResponseWriter, r *http.Request) error {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
t := auth.GetToken(accessToken)
if len(t) == 0 {
return ErrNoAccessToken
}
err := app.db.DeleteToken(t)
if err != nil {
return err
}
return impart.HTTPError{Status: http.StatusNoContent}
}
func viewLogin(app *App, w http.ResponseWriter, r *http.Request) error {
var earlyError string
oneTimeToken := r.FormValue("with")
if oneTimeToken != "" {
log.Info("Calling login with one-time token.")
err := login(app, w, r)
if err != nil {
log.Info("Received error: %v", err)
earlyError = fmt.Sprintf("%s", err)
}
}
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session; ignoring: %v", err)
}
p := &struct {
page.StaticPage
To string
Message template.HTML
Flashes []template.HTML
LoginUsername string
OauthSlack bool
OauthWriteAs bool
}{
pageForReq(app, r),
r.FormValue("to"),
template.HTML(""),
[]template.HTML{},
getTempInfo(app, "login-user", r, w),
app.Config().SlackOauth.ClientID != "",
app.Config().WriteAsOauth.ClientID != "",
}
if earlyError != "" {
p.Flashes = append(p.Flashes, template.HTML(earlyError))
}
// Display any error messages
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
err = pages["login.tmpl"].ExecuteTemplate(w, "base", p)
if err != nil {
log.Error("Unable to render login: %v", err)
return err
}
return nil
}
func webLogin(app *App, w http.ResponseWriter, r *http.Request) error {
err := login(app, w, r)
if err != nil {
username := r.FormValue("alias")
// Login request was unsuccessful; save the error in the session and redirect them
if err, ok := err.(impart.HTTPError); ok {
session, _ := app.sessionStore.Get(r, cookieName)
if session != nil {
session.AddFlash(err.Message)
session.Save(r, w)
}
if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 {
// Retain fixed username recommendation for the login form
username = m[1]
}
}
// Pass along certain information
saveTempInfo(app, "login-user", username, r, w)
// Retain post-login URL if one was given
redirectTo := "/login"
postLoginRedirect := r.FormValue("to")
if postLoginRedirect != "" {
redirectTo += "?to=" + postLoginRedirect
}
log.Error("Unable to login: %v", err)
return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo}
}
return nil
}
var loginAttemptUsers = sync.Map{}
func login(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
oneTimeToken := r.FormValue("with")
verbose := r.FormValue("all") == "true" || r.FormValue("verbose") == "1" || r.FormValue("verbose") == "true" || (reqJSON && oneTimeToken != "")
redirectTo := r.FormValue("to")
if redirectTo == "" {
if app.cfg.App.SingleUser {
redirectTo = "/me/new"
} else {
redirectTo = "/"
}
}
var u *User
var err error
var signin userCredentials
// Log in with one-time token if one is given
if oneTimeToken != "" {
log.Info("Login: Logging user in via token.")
userID := app.db.GetUserID(oneTimeToken)
if userID == -1 {
log.Error("Login: Got user -1 from token")
err := ErrBadAccessToken
err.Message = "Expired or invalid login code."
return err
}
log.Info("Login: Found user %d.", userID)
u, err = app.db.GetUserByID(userID)
if err != nil {
log.Error("Unable to fetch user on one-time token login: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."}
}
log.Info("Login: Got user via token")
} else {
// Get params
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&signin)
if err != nil {
log.Error("Couldn't parse signin JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse signin form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&signin, r.PostForm)
if err != nil {
log.Error("Couldn't decode signin form request: %v\n", err)
return ErrBadFormData
}
}
log.Info("Login: Attempting login for '%s'", signin.Alias)
// Validate required params (all)
if signin.Alias == "" {
msg := "Parameter `alias` required."
if signin.Web {
msg = "A username is required."
}
return impart.HTTPError{http.StatusBadRequest, msg}
}
if !signin.EmailLogin && signin.Pass == "" {
msg := "Parameter `pass` required."
if signin.Web {
msg = "A password is required."
}
return impart.HTTPError{http.StatusBadRequest, msg}
}
// Prevent excessive login attempts on the same account
// Skip this check in dev environment
if !app.cfg.Server.Dev {
now := time.Now()
attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration))
if att {
if attemptExpTime, ok := attemptExp.(time.Time); ok {
if attemptExpTime.After(now) {
// This user attempted previously, and the period hasn't expired yet
return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."}
} else {
// This user attempted previously, but the time expired; free up space
loginAttemptUsers.Delete(signin.Alias)
}
} else {
log.Error("Unable to cast expiration to time")
}
}
}
// Retrieve password
u, err = app.db.GetUserForAuth(signin.Alias)
if err != nil {
log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err)
if strings.IndexAny(signin.Alias, "@") > 0 {
log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message)
return ErrUserNotFoundEmail
}
return err
}
// Authenticate
if u.Email.String == "" {
// User has no email set, so check if they haven't added a password, either,
// so we can return a more helpful error message.
if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass {
log.Info("Tried logging in to %s, but no password or email.", signin.Alias)
return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."}
}
}
if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
}
if reqJSON && !signin.Web {
var token string
if r.Header.Get("User-Agent") == "" {
// Get last created token when User-Agent is empty
token = app.db.FetchLastAccessToken(u.ID)
if token == "" {
token, err = app.db.GetAccessToken(u.ID)
}
} else {
token, err = app.db.GetAccessToken(u.ID)
}
if err != nil {
log.Error("Login: Unable to create access token: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
}
resUser := getVerboseAuthUser(app, token, u, verbose)
return impart.WriteSuccess(w, resUser, http.StatusOK)
}
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
log.Error("Login: Session: %v; ignoring", err)
}
// Remove unwanted data
session.Values[cookieUserVal] = u.Cookie()
err = session.Save(r, w)
if err != nil {
log.Error("Login: Couldn't save session: %v", err)
// TODO: return error
}
// Send success
if reqJSON {
return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK)
}
log.Info("Login: Redirecting to %s", redirectTo)
w.Header().Set("Location", redirectTo)
w.WriteHeader(http.StatusFound)
return nil
}
func getVerboseAuthUser(app *App, token string, u *User, verbose bool) *AuthUser {
resUser := &AuthUser{
AccessToken: token,
User: u,
}
// Fetch verbose user data if requested
if verbose {
posts, err := app.db.GetUserPosts(u)
if err != nil {
log.Error("Login: Unable to get user posts: %v", err)
}
colls, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("Login: Unable to get user collections: %v", err)
}
passIsSet, err := app.db.IsUserPassSet(u.ID)
if err != nil {
// TODO: correct error meesage
log.Error("Login: Unable to get user collections: %v", err)
}
resUser.Posts = posts
resUser.Collections = colls
resUser.User.HasPass = passIsSet
}
return resUser
}
func viewExportOptions(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
// Fetch extra user data
p := NewUserPage(app, r, u, "Export", nil)
showUserPage(w, "export", p)
return nil
}
func viewExportPosts(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) {
var filename string
var u = &User{}
reqJSON := IsJSON(r)
if reqJSON {
// Use given Authorization header
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return nil, filename, ErrNoAccessToken
}
userID := app.db.GetUserID(accessToken)
if userID == -1 {
return nil, filename, ErrBadAccessToken
}
var err error
u, err = app.db.GetUserByID(userID)
if err != nil {
return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."}
}
} else {
// Use user cookie
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
log.Error("Session: %v; ignoring", err)
}
val := session.Values[cookieUserVal]
var ok bool
if u, ok = val.(*User); !ok {
return nil, filename, ErrNotLoggedIn
}
}
filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")
// Fetch data we're exporting
var err error
var data []byte
posts, err := app.db.GetUserPosts(u)
if err != nil {
return data, filename, err
}
// Export as CSV
if strings.HasSuffix(r.URL.Path, ".csv") {
data = exportPostsCSV(app.cfg.App.Host, u, posts)
return data, filename, err
}
if strings.HasSuffix(r.URL.Path, ".zip") {
data = exportPostsZip(u, posts)
return data, filename, err
}
if r.FormValue("pretty") == "1" {
data, err = json.MarshalIndent(posts, "", "\t")
} else {
data, err = json.Marshal(posts)
}
return data, filename, err
}
func viewExportFull(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) {
var err error
filename := ""
u := getUserSession(app, r)
if u == nil {
return nil, filename, ErrNotLoggedIn
}
filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")
exportUser := compileFullExport(app, u)
var data []byte
if r.FormValue("pretty") == "1" {
data, err = json.MarshalIndent(exportUser, "", "\t")
} else {
data, err = json.Marshal(exportUser)
}
return data, filename, err
}
func viewMeAPI(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
uObj := struct {
ID int64 `json:"id,omitempty"`
Username string `json:"username,omitempty"`
}{}
var err error
if reqJSON {
_, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization"))
if err != nil {
return err
}
} else {
u := getUserSession(app, r)
if u == nil {
return impart.WriteSuccess(w, uObj, http.StatusOK)
}
uObj.Username = u.Username
}
return impart.WriteSuccess(w, uObj, http.StatusOK)
}
func viewMyPostsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
if !reqJSON {
return ErrBadRequestedType
}
var err error
p := GetPostsCache(u.ID)
if p == nil {
userPostsCache.Lock()
if userPostsCache.users[u.ID].ready == nil {
userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})}
userPostsCache.Unlock()
p, err = app.db.GetUserPosts(u)
if err != nil {
return err
}
CachePosts(u.ID, p)
} else {
userPostsCache.Unlock()
<-userPostsCache.users[u.ID].ready
p = GetPostsCache(u.ID)
}
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func viewMyCollectionsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
if !reqJSON {
return ErrBadRequestedType
}
p, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
return err
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func viewArticles(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p, err := app.db.GetAnonymousPosts(u)
if err != nil {
log.Error("unable to fetch anon posts: %v", err)
}
// nil-out AnonymousPosts slice for easy detection in the template
if p != nil && len(*p) == 0 {
p = nil
}
f, err := getSessionFlashes(app, w, r, nil)
if err != nil {
log.Error("unable to fetch flashes: %v", err)
}
c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
- suspended, err := app.db.IsUserSuspended(u.ID)
+ silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view articles: %v", err)
}
d := struct {
*UserPage
AnonymousPosts *[]PublicPost
Collections *[]Collection
- Suspended bool
+ Silenced bool
}{
UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f),
AnonymousPosts: p,
Collections: c,
- Suspended: suspended,
+ Silenced: silenced,
}
d.UserPage.SetMessaging(u)
w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT")
showUserPage(w, "articles", d)
return nil
}
func viewCollections(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
c, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
return fmt.Errorf("No collections")
}
f, _ := getSessionFlashes(app, w, r, nil)
uc, _ := app.db.GetUserCollectionCount(u.ID)
// TODO: handle any errors
- suspended, err := app.db.IsUserSuspended(u.ID)
+ silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view collections %v", err)
return fmt.Errorf("view collections: %v", err)
}
d := struct {
*UserPage
Collections *[]Collection
UsedCollections, TotalCollections int
NewBlogsDisabled bool
- Suspended bool
+ Silenced bool
}{
UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f),
Collections: c,
UsedCollections: int(uc),
NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc),
- Suspended: suspended,
+ Silenced: silenced,
}
d.UserPage.SetMessaging(u)
showUserPage(w, "collections", d)
return nil
}
func viewEditCollection(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
c, err := app.db.GetCollection(vars["collection"])
if err != nil {
return err
}
if c.OwnerID != u.ID {
return ErrCollectionNotFound
}
- suspended, err := app.db.IsUserSuspended(u.ID)
+ silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view edit collection %v", err)
return fmt.Errorf("view edit collection: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, nil)
obj := struct {
*UserPage
*Collection
- Suspended bool
+ Silenced bool
}{
UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes),
Collection: c,
- Suspended: suspended,
+ Silenced: silenced,
}
showUserPage(w, "collection", obj)
return nil
}
func updateSettings(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
var s userSettings
var u *User
var sess *sessions.Session
var err error
if reqJSON {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
u, err = app.db.GetAPIUser(accessToken)
if err != nil {
return ErrBadAccessToken
}
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&s)
if err != nil {
log.Error("Couldn't parse settings JSON request: %v\n", err)
return ErrBadJSON
}
// Prevent all username updates
// TODO: support changing username via JSON API request
s.Username = ""
} else {
u, sess = getUserAndSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse settings form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&s, r.PostForm)
if err != nil {
log.Error("Couldn't decode settings form request: %v\n", err)
return ErrBadFormData
}
}
// Do update
postUpdateReturn := r.FormValue("return")
redirectTo := "/me/settings"
if s.IsLogOut {
redirectTo += "?logout=1"
} else if postUpdateReturn != "" {
redirectTo = postUpdateReturn
}
// Only do updates on values we need
if s.Username != "" && s.Username == u.Username {
// Username hasn't actually changed; blank it out
s.Username = ""
}
err = app.db.ChangeSettings(app, u, &s)
if err != nil {
if reqJSON {
return err
}
if err, ok := err.(impart.HTTPError); ok {
addSessionFlash(app, w, r, err.Message, nil)
}
} else {
// Successful update.
if reqJSON {
return impart.WriteSuccess(w, u, http.StatusOK)
}
if s.IsLogOut {
redirectTo = "/me/logout"
} else {
sess.Values[cookieUserVal] = u.Cookie()
addSessionFlash(app, w, r, "Account updated.", nil)
}
}
w.Header().Set("Location", redirectTo)
w.WriteHeader(http.StatusFound)
return nil
}
func updatePassphrase(app *App, w http.ResponseWriter, r *http.Request) error {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
curPass := r.FormValue("current")
newPass := r.FormValue("new")
// Ensure a new password is given (always required)
if newPass == "" {
return impart.HTTPError{http.StatusBadRequest, "Provide a new password."}
}
userID, sudo := app.db.GetUserIDPrivilege(accessToken)
if userID == -1 {
return ErrBadAccessToken
}
// Ensure a current password is given if the access token doesn't have sudo
// privileges.
if !sudo && curPass == "" {
return impart.HTTPError{http.StatusBadRequest, "Provide current password."}
}
// Hash the new password
hashedPass, err := auth.HashPass([]byte(newPass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
// Do update
err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass)
if err != nil {
return err
}
return impart.WriteSuccess(w, struct{}{}, http.StatusOK)
}
func viewStats(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
var c *Collection
var err error
vars := mux.Vars(r)
alias := vars["collection"]
if alias != "" {
c, err = app.db.GetCollection(alias)
if err != nil {
return err
}
if c.OwnerID != u.ID {
return ErrCollectionNotFound
}
}
topPosts, err := app.db.GetTopPosts(u, alias)
if err != nil {
log.Error("Unable to get top posts: %v", err)
return err
}
flashes, _ := getSessionFlashes(app, w, r, nil)
titleStats := ""
if c != nil {
titleStats = c.DisplayTitle() + " "
}
- suspended, err := app.db.IsUserSuspended(u.ID)
+ silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view stats: %v", err)
return err
}
obj := struct {
*UserPage
VisitsBlog string
Collection *Collection
TopPosts *[]PublicPost
APFollowers int
- Suspended bool
+ Silenced bool
}{
UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes),
VisitsBlog: alias,
Collection: c,
TopPosts: topPosts,
- Suspended: suspended,
+ Silenced: silenced,
}
if app.cfg.App.Federation {
folls, err := app.db.GetAPFollowers(c)
if err != nil {
return err
}
obj.APFollowers = len(*folls)
}
showUserPage(w, "stats", obj)
return nil
}
func viewSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
fullUser, err := app.db.GetUserByID(u.ID)
if err != nil {
log.Error("Unable to get user for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
passIsSet, err := app.db.IsUserPassSet(u.ID)
if err != nil {
log.Error("Unable to get isUserPassSet for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
flashes, _ := getSessionFlashes(app, w, r, nil)
obj := struct {
*UserPage
- Email string
- HasPass bool
- IsLogOut bool
- Suspended bool
+ Email string
+ HasPass bool
+ IsLogOut bool
+ Silenced bool
}{
- UserPage: NewUserPage(app, r, u, "Account Settings", flashes),
- Email: fullUser.EmailClear(app.keys),
- HasPass: passIsSet,
- IsLogOut: r.FormValue("logout") == "1",
- Suspended: fullUser.IsSilenced(),
+ UserPage: NewUserPage(app, r, u, "Account Settings", flashes),
+ Email: fullUser.EmailClear(app.keys),
+ HasPass: passIsSet,
+ IsLogOut: r.FormValue("logout") == "1",
+ Silenced: fullUser.IsSilenced(),
}
showUserPage(w, "settings", obj)
return nil
}
func saveTempInfo(app *App, key, val string, r *http.Request, w http.ResponseWriter) error {
session, err := app.sessionStore.Get(r, "t")
if err != nil {
return ErrInternalCookieSession
}
session.Values[key] = val
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err)
}
return err
}
func getTempInfo(app *App, key string, r *http.Request, w http.ResponseWriter) string {
session, err := app.sessionStore.Get(r, "t")
if err != nil {
return ""
}
// Get the information
var s = ""
var ok bool
if s, ok = session.Values[key].(string); !ok {
return ""
}
// Delete cookie
session.Options.MaxAge = -1
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't erase temp data for key %s: %v", key, err)
}
// Return value
return s
}
func prepareUserEmail(input string, emailKey []byte) zero.String {
email := zero.NewString("", input != "")
if len(input) > 0 {
encEmail, err := data.Encrypt(emailKey, input)
if err != nil {
log.Error("Unable to encrypt email: %s\n", err)
} else {
email.String = string(encEmail)
}
}
return email
}
diff --git a/activitypub.go b/activitypub.go
index a5b140d..c1574e3 100644
--- a/activitypub.go
+++ b/activitypub.go
@@ -1,803 +1,803 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"bytes"
"crypto/sha256"
"database/sql"
"encoding/base64"
"encoding/json"
"fmt"
"io/ioutil"
"net/http"
"net/http/httputil"
"net/url"
"strconv"
"time"
"github.com/gorilla/mux"
"github.com/writeas/activity/streams"
"github.com/writeas/httpsig"
"github.com/writeas/impart"
"github.com/writeas/nerds/store"
"github.com/writeas/web-core/activitypub"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/log"
)
const (
// TODO: delete. don't use this!
apCustomHandleDefault = "blog"
apCacheTime = time.Minute
)
type RemoteUser struct {
ID int64
ActorID string
Inbox string
SharedInbox string
Handle string
}
func (ru *RemoteUser) AsPerson() *activitystreams.Person {
return &activitystreams.Person{
BaseObject: activitystreams.BaseObject{
Type: "Person",
Context: []interface{}{
activitystreams.Namespace,
},
ID: ru.ActorID,
},
Inbox: ru.Inbox,
Endpoints: activitystreams.Endpoints{
SharedInbox: ru.SharedInbox,
},
}
}
func handleFetchCollectionActivities(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection activities: %v", err)
return ErrInternalGeneral
}
- if suspended {
+ if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
p := c.PersonObject()
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, p, http.StatusOK)
}
func handleFetchCollectionOutbox(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection outbox: %v", err)
return ErrInternalGeneral
}
- if suspended {
+ if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if app.cfg.App.SingleUser {
if alias != c.Alias {
return ErrCollectionNotFound
}
}
res := &CollectionObj{Collection: *c}
app.db.GetPostsCount(res, false)
accountRoot := c.FederatedAccount()
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "outbox", res.TotalPosts)
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "outbox", res.TotalPosts, p)
ocp.OrderedItems = []interface{}{}
posts, err := app.db.GetPosts(app.cfg, c, p, false, true, false)
for _, pp := range *posts {
pp.Collection = res
o := pp.ActivityObject(app)
a := activitystreams.NewCreateActivity(o)
ocp.OrderedItems = append(ocp.OrderedItems, *a)
}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionFollowers(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection followers: %v", err)
return ErrInternalGeneral
}
- if suspended {
+ if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
accountRoot := c.FederatedAccount()
folls, err := app.db.GetAPFollowers(c)
if err != nil {
return err
}
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "followers", len(*folls))
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "followers", len(*folls), p)
ocp.OrderedItems = []interface{}{}
/*
for _, f := range *folls {
ocp.OrderedItems = append(ocp.OrderedItems, f.ActorID)
}
*/
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionFollowing(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection following: %v", err)
return ErrInternalGeneral
}
- if suspended {
+ if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
accountRoot := c.FederatedAccount()
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "following", 0)
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "following", 0, p)
ocp.OrderedItems = []interface{}{}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionInbox(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
// TODO: return Reject?
return err
}
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection inbox: %v", err)
return ErrInternalGeneral
}
- if suspended {
+ if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if debugging {
dump, err := httputil.DumpRequest(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("Rec'd! %q", dump)
}
}
var m map[string]interface{}
if err := json.NewDecoder(r.Body).Decode(&m); err != nil {
return err
}
a := streams.NewAccept()
p := c.PersonObject()
var to *url.URL
var isFollow, isUnfollow bool
fullActor := &activitystreams.Person{}
var remoteUser *RemoteUser
res := &streams.Resolver{
FollowCallback: func(f *streams.Follow) error {
isFollow = true
// 1) Use the Follow concrete type here
// 2) Errors are propagated to res.Deserialize call below
m["@context"] = []string{activitystreams.Namespace}
b, _ := json.Marshal(m)
if debugging {
log.Info("Follow: %s", b)
}
_, followID := f.GetId()
if followID == nil {
log.Error("Didn't resolve follow ID")
} else {
aID := c.FederatedAccount() + "#accept-" + store.GenerateFriendlyRandomString(20)
acceptID, err := url.Parse(aID)
if err != nil {
log.Error("Couldn't parse generated Accept URL '%s': %v", aID, err)
}
a.SetId(acceptID)
}
a.AppendObject(f.Raw())
_, to = f.GetActor(0)
obj := f.Raw().GetObjectIRI(0)
a.AppendActor(obj)
// First get actor information
if to == nil {
return fmt.Errorf("No valid `to` string")
}
fullActor, remoteUser, err = getActor(app, to.String())
if err != nil {
return err
}
return impart.RenderActivityJSON(w, m, http.StatusOK)
},
UndoCallback: func(u *streams.Undo) error {
isUnfollow = true
m["@context"] = []string{activitystreams.Namespace}
b, _ := json.Marshal(m)
if debugging {
log.Info("Undo: %s", b)
}
a.AppendObject(u.Raw())
_, to = u.GetActor(0)
// TODO: get actor from object.object, not object
obj := u.Raw().GetObjectIRI(0)
a.AppendActor(obj)
if to != nil {
// Populate fullActor from DB?
remoteUser, err = getRemoteUser(app, to.String())
if err != nil {
if iErr, ok := err.(*impart.HTTPError); ok {
if iErr.Status == http.StatusNotFound {
log.Error("No remoteuser info for Undo event!")
}
}
return err
} else {
fullActor = remoteUser.AsPerson()
}
} else {
log.Error("No to on Undo!")
}
return impart.RenderActivityJSON(w, m, http.StatusOK)
},
}
if err := res.Deserialize(m); err != nil {
// 3) Any errors from #2 can be handled, or the payload is an unknown type.
log.Error("Unable to resolve Follow: %v", err)
if debugging {
log.Error("Map: %s", m)
}
return err
}
go func() {
time.Sleep(2 * time.Second)
am, err := a.Serialize()
if err != nil {
log.Error("Unable to serialize Accept: %v", err)
return
}
am["@context"] = []string{activitystreams.Namespace}
if to == nil {
log.Error("No to! %v", err)
return
}
err = makeActivityPost(app.cfg.App.Host, p, fullActor.Inbox, am)
if err != nil {
log.Error("Unable to make activity POST: %v", err)
return
}
if isFollow {
t, err := app.db.Begin()
if err != nil {
log.Error("Unable to start transaction: %v", err)
return
}
var followerID int64
if remoteUser != nil {
followerID = remoteUser.ID
} else {
// Add follower locally, since it wasn't found before
res, err := t.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox) VALUES (?, ?, ?)", fullActor.ID, fullActor.Inbox, fullActor.Endpoints.SharedInbox)
if err != nil {
// if duplicate key, res will be nil and panic on
// res.LastInsertId below
t.Rollback()
log.Error("Couldn't add new remoteuser in DB: %v\n", err)
return
}
followerID, err = res.LastInsertId()
if err != nil {
t.Rollback()
log.Error("no lastinsertid for followers, rolling back: %v", err)
return
}
// Add in key
_, err = t.Exec("INSERT INTO remoteuserkeys (id, remote_user_id, public_key) VALUES (?, ?, ?)", fullActor.PublicKey.ID, followerID, fullActor.PublicKey.PublicKeyPEM)
if err != nil {
if !app.db.isDuplicateKeyErr(err) {
t.Rollback()
log.Error("Couldn't add follower keys in DB: %v\n", err)
return
}
}
}
// Add follow
_, err = t.Exec("INSERT INTO remotefollows (collection_id, remote_user_id, created) VALUES (?, ?, "+app.db.now()+")", c.ID, followerID)
if err != nil {
if !app.db.isDuplicateKeyErr(err) {
t.Rollback()
log.Error("Couldn't add follower in DB: %v\n", err)
return
}
}
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return
}
} else if isUnfollow {
// Remove follower locally
_, err = app.db.Exec("DELETE FROM remotefollows WHERE collection_id = ? AND remote_user_id = (SELECT id FROM remoteusers WHERE actor_id = ?)", c.ID, to.String())
if err != nil {
log.Error("Couldn't remove follower from DB: %v\n", err)
}
}
}()
return nil
}
func makeActivityPost(hostName string, p *activitystreams.Person, url string, m interface{}) error {
log.Info("POST %s", url)
b, err := json.Marshal(m)
if err != nil {
return err
}
r, _ := http.NewRequest("POST", url, bytes.NewBuffer(b))
r.Header.Add("Content-Type", "application/activity+json")
r.Header.Set("User-Agent", "Go ("+serverSoftware+"/"+softwareVer+"; +"+hostName+")")
h := sha256.New()
h.Write(b)
r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil)))
// Sign using the 'Signature' header
privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey())
if err != nil {
return err
}
signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"})
err = signer.SignSigHeader(r)
if err != nil {
log.Error("Can't sign: %v", err)
}
if debugging {
dump, err := httputil.DumpRequestOut(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("%s", dump)
}
}
resp, err := http.DefaultClient.Do(r)
if err != nil {
return err
}
if resp != nil && resp.Body != nil {
defer resp.Body.Close()
}
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
return err
}
if debugging {
log.Info("Status : %s", resp.Status)
log.Info("Response: %s", body)
}
return nil
}
func resolveIRI(hostName, url string) ([]byte, error) {
log.Info("GET %s", url)
r, _ := http.NewRequest("GET", url, nil)
r.Header.Add("Accept", "application/activity+json")
r.Header.Set("User-Agent", "Go ("+serverSoftware+"/"+softwareVer+"; +"+hostName+")")
if debugging {
dump, err := httputil.DumpRequestOut(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("%s", dump)
}
}
resp, err := http.DefaultClient.Do(r)
if err != nil {
return nil, err
}
if resp != nil && resp.Body != nil {
defer resp.Body.Close()
}
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
return nil, err
}
if debugging {
log.Info("Status : %s", resp.Status)
log.Info("Response: %s", body)
}
return body, nil
}
func deleteFederatedPost(app *App, p *PublicPost, collID int64) error {
if debugging {
log.Info("Deleting federated post!")
}
p.Collection.hostName = app.cfg.App.Host
actor := p.Collection.PersonObject(collID)
na := p.ActivityObject(app)
// Add followers
p.Collection.ID = collID
followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
if err != nil {
log.Error("Couldn't delete post (get followers)! %v", err)
return err
}
inboxes := map[string][]string{}
for _, f := range *followers {
inbox := f.SharedInbox
if inbox == "" {
inbox = f.Inbox
}
if _, ok := inboxes[inbox]; ok {
inboxes[inbox] = append(inboxes[inbox], f.ActorID)
} else {
inboxes[inbox] = []string{f.ActorID}
}
}
for si, instFolls := range inboxes {
na.CC = []string{}
for _, f := range instFolls {
na.CC = append(na.CC, f)
}
err = makeActivityPost(app.cfg.App.Host, actor, si, activitystreams.NewDeleteActivity(na))
if err != nil {
log.Error("Couldn't delete post! %v", err)
}
}
return nil
}
func federatePost(app *App, p *PublicPost, collID int64, isUpdate bool) error {
if debugging {
if isUpdate {
log.Info("Federating updated post!")
} else {
log.Info("Federating new post!")
}
}
actor := p.Collection.PersonObject(collID)
na := p.ActivityObject(app)
// Add followers
p.Collection.ID = collID
followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
if err != nil {
log.Error("Couldn't post! %v", err)
return err
}
log.Info("Followers for %d: %+v", collID, followers)
inboxes := map[string][]string{}
for _, f := range *followers {
inbox := f.SharedInbox
if inbox == "" {
inbox = f.Inbox
}
if _, ok := inboxes[inbox]; ok {
// check if we're already sending to this shared inbox
inboxes[inbox] = append(inboxes[inbox], f.ActorID)
} else {
// add the new shared inbox to the list
inboxes[inbox] = []string{f.ActorID}
}
}
var activity *activitystreams.Activity
// for each one of the shared inboxes
for si, instFolls := range inboxes {
// add all followers from that instance
// to the CC field
na.CC = []string{}
for _, f := range instFolls {
na.CC = append(na.CC, f)
}
// create a new "Create" activity
// with our article as object
if isUpdate {
activity = activitystreams.NewUpdateActivity(na)
} else {
activity = activitystreams.NewCreateActivity(na)
activity.To = na.To
activity.CC = na.CC
}
// and post it to that sharedInbox
err = makeActivityPost(app.cfg.App.Host, actor, si, activity)
if err != nil {
log.Error("Couldn't post! %v", err)
}
}
// re-create the object so that the CC list gets reset and has
// the mentioned users. This might seem wasteful but the code is
// cleaner than adding the mentioned users to CC here instead of
// in p.ActivityObject()
na = p.ActivityObject(app)
for _, tag := range na.Tag {
if tag.Type == "Mention" {
activity = activitystreams.NewCreateActivity(na)
activity.To = na.To
activity.CC = na.CC
// This here might be redundant in some cases as we might have already
// sent this to the sharedInbox of this instance above, but we need too
// much logic to catch this at the expense of the odd extra request.
// I don't believe we'd ever have too many mentions in a single post that this
// could become a burden.
remoteUser, err := getRemoteUser(app, tag.HRef)
err = makeActivityPost(app.cfg.App.Host, actor, remoteUser.Inbox, activity)
if err != nil {
log.Error("Couldn't post! %v", err)
}
}
}
return nil
}
func getRemoteUser(app *App, actorID string) (*RemoteUser, error) {
u := RemoteUser{ActorID: actorID}
err := app.db.QueryRow("SELECT id, inbox, shared_inbox, handle FROM remoteusers WHERE actor_id = ?", actorID).Scan(&u.ID, &u.Inbox, &u.SharedInbox, &u.Handle)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "No remote user with that ID."}
case err != nil:
log.Error("Couldn't get remote user %s: %v", actorID, err)
return nil, err
}
return &u, nil
}
// getRemoteUserFromHandle retrieves the profile page of a remote user
// from the @user@server.tld handle
func getRemoteUserFromHandle(app *App, handle string) (*RemoteUser, error) {
u := RemoteUser{Handle: handle}
err := app.db.QueryRow("SELECT id, actor_id, inbox, shared_inbox FROM remoteusers WHERE handle = ?", handle).Scan(&u.ID, &u.ActorID, &u.Inbox, &u.SharedInbox)
switch {
case err == sql.ErrNoRows:
return nil, ErrRemoteUserNotFound
case err != nil:
log.Error("Couldn't get remote user %s: %v", handle, err)
return nil, err
}
return &u, nil
}
func getActor(app *App, actorIRI string) (*activitystreams.Person, *RemoteUser, error) {
log.Info("Fetching actor %s locally", actorIRI)
actor := &activitystreams.Person{}
remoteUser, err := getRemoteUser(app, actorIRI)
if err != nil {
if iErr, ok := err.(impart.HTTPError); ok {
if iErr.Status == http.StatusNotFound {
// Fetch remote actor
log.Info("Not found; fetching actor %s remotely", actorIRI)
actorResp, err := resolveIRI(app.cfg.App.Host, actorIRI)
if err != nil {
log.Error("Unable to get actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't fetch actor."}
}
if err := unmarshalActor(actorResp, actor); err != nil {
log.Error("Unable to unmarshal actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't parse actor."}
}
} else {
return nil, nil, err
}
} else {
return nil, nil, err
}
} else {
actor = remoteUser.AsPerson()
}
return actor, remoteUser, nil
}
// unmarshal actor normalizes the actor response to conform to
// the type Person from github.com/writeas/web-core/activitysteams
//
// some implementations return different context field types
// this converts any non-slice contexts into a slice
func unmarshalActor(actorResp []byte, actor *activitystreams.Person) error {
// FIXME: Hubzilla has an object for the Actor's url: cannot unmarshal object into Go struct field Person.url of type string
// flexActor overrides the Context field to allow
// all valid representations during unmarshal
flexActor := struct {
activitystreams.Person
Context json.RawMessage `json:"@context,omitempty"`
}{}
if err := json.Unmarshal(actorResp, &flexActor); err != nil {
return err
}
actor.Endpoints = flexActor.Endpoints
actor.Followers = flexActor.Followers
actor.Following = flexActor.Following
actor.ID = flexActor.ID
actor.Icon = flexActor.Icon
actor.Inbox = flexActor.Inbox
actor.Name = flexActor.Name
actor.Outbox = flexActor.Outbox
actor.PreferredUsername = flexActor.PreferredUsername
actor.PublicKey = flexActor.PublicKey
actor.Summary = flexActor.Summary
actor.Type = flexActor.Type
actor.URL = flexActor.URL
func(val interface{}) {
switch val.(type) {
case []interface{}:
// already a slice, do nothing
actor.Context = val.([]interface{})
default:
actor.Context = []interface{}{val}
}
}(flexActor.Context)
return nil
}
func setCacheControl(w http.ResponseWriter, ttl time.Duration) {
w.Header().Set("Cache-Control", fmt.Sprintf("public, max-age=%.0f", ttl.Seconds()))
}
diff --git a/admin.go b/admin.go
index 83dcc80..5f7d244 100644
--- a/admin.go
+++ b/admin.go
@@ -1,530 +1,530 @@
/*
* Copyright © 2018-2019 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"fmt"
"net/http"
"runtime"
"strconv"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/passgen"
"github.com/writeas/writefreely/appstats"
"github.com/writeas/writefreely/config"
)
var (
appStartTime = time.Now()
sysStatus systemStatus
)
const adminUsersPerPage = 30
type systemStatus struct {
Uptime string
NumGoroutine int
// General statistics.
MemAllocated string // bytes allocated and still in use
MemTotal string // bytes allocated (even if freed)
MemSys string // bytes obtained from system (sum of XxxSys below)
Lookups uint64 // number of pointer lookups
MemMallocs uint64 // number of mallocs
MemFrees uint64 // number of frees
// Main allocation heap statistics.
HeapAlloc string // bytes allocated and still in use
HeapSys string // bytes obtained from system
HeapIdle string // bytes in idle spans
HeapInuse string // bytes in non-idle span
HeapReleased string // bytes released to the OS
HeapObjects uint64 // total number of allocated objects
// Low-level fixed-size structure allocator statistics.
// Inuse is bytes used now.
// Sys is bytes obtained from system.
StackInuse string // bootstrap stacks
StackSys string
MSpanInuse string // mspan structures
MSpanSys string
MCacheInuse string // mcache structures
MCacheSys string
BuckHashSys string // profiling bucket hash table
GCSys string // GC metadata
OtherSys string // other system allocations
// Garbage collector statistics.
NextGC string // next run in HeapAlloc time (bytes)
LastGC string // last run in absolute time (ns)
PauseTotalNs string
PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256]
NumGC uint32
}
type inspectedCollection struct {
CollectionObj
Followers int
LastPost string
}
type instanceContent struct {
ID string
Type string
Title sql.NullString
Content string
Updated time.Time
}
func (c instanceContent) UpdatedFriendly() string {
/*
// TODO: accept a locale in this method and use that for the format
var loc monday.Locale = monday.LocaleEnUS
return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc)
*/
return c.Updated.Format("January 2, 2006, 3:04 PM")
}
func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
updateAppStats()
p := struct {
*UserPage
SysStatus systemStatus
Config config.AppCfg
Message, ConfigMessage string
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
SysStatus: sysStatus,
Config: app.cfg.App,
Message: r.FormValue("m"),
ConfigMessage: r.FormValue("cm"),
}
showUserPage(w, "admin", p)
return nil
}
func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
Config config.AppCfg
Message string
Users *[]User
CurPage int
TotalUsers int64
TotalPages []int
}{
UserPage: NewUserPage(app, r, u, "Users", nil),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
p.TotalUsers = app.db.GetAllUsersCount()
ttlPages := p.TotalUsers / adminUsersPerPage
p.TotalPages = []int{}
for i := 1; i <= int(ttlPages); i++ {
p.TotalPages = append(p.TotalPages, i)
}
var err error
p.CurPage, err = strconv.Atoi(r.FormValue("p"))
if err != nil || p.CurPage < 1 {
p.CurPage = 1
} else if p.CurPage > int(ttlPages) {
p.CurPage = int(ttlPages)
}
p.Users, err = app.db.GetAllUsers(uint(p.CurPage))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)}
}
showUserPage(w, "users", p)
return nil
}
func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
p := struct {
*UserPage
Config config.AppCfg
Message string
User *User
Colls []inspectedCollection
LastPost string
NewPassword string
TotalPosts int64
ClearEmail string
}{
Config: app.cfg.App,
Message: r.FormValue("m"),
Colls: []inspectedCollection{},
}
var err error
p.User, err = app.db.GetUserForAuth(username)
if err != nil {
if err == ErrUserNotFound {
return err
}
log.Error("Could not get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
if strings.HasPrefix(flash, "SUCCESS: ") {
p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ")
p.ClearEmail = p.User.EmailClear(app.keys)
}
}
p.UserPage = NewUserPage(app, r, u, p.User.Username, nil)
p.TotalPosts = app.db.GetUserPostsCount(p.User.ID)
lp, err := app.db.GetUserLastPostTime(p.User.ID)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)}
}
if lp != nil {
p.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
colls, err := app.db.GetCollections(p.User, app.cfg.App.Host)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)}
}
for _, c := range *colls {
ic := inspectedCollection{
CollectionObj: CollectionObj{Collection: c},
}
if app.cfg.App.Federation {
folls, err := app.db.GetAPFollowers(&c)
if err == nil {
// TODO: handle error here (at least log it)
ic.Followers = len(*folls)
}
}
app.db.GetPostsCount(&ic.CollectionObj, true)
lp, err := app.db.GetCollectionLastPostTime(c.ID)
if err != nil {
log.Error("Didn't get last post time for collection %d: %v", c.ID, err)
}
if lp != nil {
ic.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
p.Colls = append(p.Colls, ic)
}
showUserPage(w, "view-user", p)
return nil
}
func handleAdminToggleUserStatus(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
user, err := app.db.GetUserForAuth(username)
if err != nil {
log.Error("failed to get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)}
}
if user.IsSilenced() {
err = app.db.SetUserStatus(user.ID, UserActive)
} else {
err = app.db.SetUserStatus(user.ID, UserSilenced)
}
if err != nil {
- log.Error("toggle user suspended: %v", err)
+ log.Error("toggle user silenced: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)}
}
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)}
}
func handleAdminResetUserPass(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
// Generate new random password since none supplied
pass := passgen.NewWordish()
hashedPass, err := auth.HashPass([]byte(pass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
userIDVal := r.FormValue("user")
log.Info("ADMIN: Changing user %s password", userIDVal)
id, err := strconv.Atoi(userIDVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)}
}
err = app.db.ChangePassphrase(int64(id), true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
log.Info("ADMIN: Successfully changed.")
addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil)
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)}
}
func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
Config config.AppCfg
Message string
Pages []*instanceContent
}{
UserPage: NewUserPage(app, r, u, "Pages", nil),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
p.Pages, err = app.db.GetInstancePages()
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)}
}
// Add in default pages
var hasAbout, hasPrivacy bool
for i, c := range p.Pages {
if hasAbout && hasPrivacy {
break
}
if c.ID == "about" {
hasAbout = true
if !c.Title.Valid {
p.Pages[i].Title = defaultAboutTitle(app.cfg)
}
} else if c.ID == "privacy" {
hasPrivacy = true
if !c.Title.Valid {
p.Pages[i].Title = defaultPrivacyTitle()
}
}
}
if !hasAbout {
p.Pages = append(p.Pages, &instanceContent{
ID: "about",
Title: defaultAboutTitle(app.cfg),
Content: defaultAboutPage(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
if !hasPrivacy {
p.Pages = append(p.Pages, &instanceContent{
ID: "privacy",
Title: defaultPrivacyTitle(),
Content: defaultPrivacyPolicy(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
showUserPage(w, "pages", p)
return nil
}
func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
if slug == "" {
return impart.HTTPError{http.StatusFound, "/admin/pages"}
}
p := struct {
*UserPage
Config config.AppCfg
Message string
Banner *instanceContent
Content *instanceContent
}{
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
// Get pre-defined pages, or select slug
if slug == "about" {
p.Content, err = getAboutPage(app)
} else if slug == "privacy" {
p.Content, err = getPrivacyPage(app)
} else if slug == "landing" {
p.Banner, err = getLandingBanner(app)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
}
p.Content, err = getLandingBody(app)
p.Content.ID = "landing"
} else if slug == "reader" {
p.Content, err = getReaderSection(app)
} else {
p.Content, err = app.db.GetDynamicContent(slug)
}
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)}
}
title := "New page"
if p.Content != nil {
title = "Edit " + p.Content.ID
} else {
p.Content = &instanceContent{}
}
p.UserPage = NewUserPage(app, r, u, title, nil)
showUserPage(w, "view-page", p)
return nil
}
func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
id := vars["page"]
// Validate
if id != "about" && id != "privacy" && id != "landing" && id != "reader" {
return impart.HTTPError{http.StatusNotFound, "No such page."}
}
var err error
m := ""
if id == "landing" {
// Handle special landing page
err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section")
if err != nil {
m = "?m=" + err.Error()
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section")
} else if id == "reader" {
// Update sections with titles
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section")
} else {
// Update page
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page")
}
if err != nil {
m = "?m=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error {
apper.App().cfg.App.SiteName = r.FormValue("site_name")
apper.App().cfg.App.SiteDesc = r.FormValue("site_desc")
apper.App().cfg.App.Landing = r.FormValue("landing")
apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on"
mul, err := strconv.Atoi(r.FormValue("min_username_len"))
if err == nil {
apper.App().cfg.App.MinUsernameLen = mul
}
mb, err := strconv.Atoi(r.FormValue("max_blogs"))
if err == nil {
apper.App().cfg.App.MaxBlogs = mb
}
apper.App().cfg.App.Federation = r.FormValue("federation") == "on"
apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on"
apper.App().cfg.App.Private = r.FormValue("private") == "on"
apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on"
if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil {
log.Info("Initializing local timeline...")
initLocalTimeline(apper.App())
}
apper.App().cfg.App.UserInvites = r.FormValue("user_invites")
if apper.App().cfg.App.UserInvites == "none" {
apper.App().cfg.App.UserInvites = ""
}
apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility")
m := "?cm=Configuration+saved."
err = apper.SaveConfig(apper.App().cfg)
if err != nil {
m = "?cm=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin" + m + "#config"}
}
func updateAppStats() {
sysStatus.Uptime = appstats.TimeSincePro(appStartTime)
m := new(runtime.MemStats)
runtime.ReadMemStats(m)
sysStatus.NumGoroutine = runtime.NumGoroutine()
sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc))
sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc))
sysStatus.MemSys = appstats.FileSize(int64(m.Sys))
sysStatus.Lookups = m.Lookups
sysStatus.MemMallocs = m.Mallocs
sysStatus.MemFrees = m.Frees
sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc))
sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys))
sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle))
sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse))
sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased))
sysStatus.HeapObjects = m.HeapObjects
sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse))
sysStatus.StackSys = appstats.FileSize(int64(m.StackSys))
sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse))
sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys))
sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse))
sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys))
sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys))
sysStatus.GCSys = appstats.FileSize(int64(m.GCSys))
sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys))
sysStatus.NextGC = appstats.FileSize(int64(m.NextGC))
sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000)
sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000)
sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000)
sysStatus.NumGC = m.NumGC
}
func adminResetPassword(app *App, u *User, newPass string) error {
hashedPass, err := auth.HashPass([]byte(newPass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
err = app.db.ChangePassphrase(u.ID, true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
return nil
}
diff --git a/collections.go b/collections.go
index 189b4e4..9688ad9 100644
--- a/collections.go
+++ b/collections.go
@@ -1,1152 +1,1152 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"fmt"
"html/template"
"math"
"net/http"
"net/url"
"regexp"
"strconv"
"strings"
"unicode"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/bots"
"github.com/writeas/web-core/log"
waposts "github.com/writeas/web-core/posts"
"github.com/writeas/writefreely/author"
"github.com/writeas/writefreely/config"
"github.com/writeas/writefreely/page"
)
type (
// TODO: add Direction to db
// TODO: add Language to db
Collection struct {
ID int64 `datastore:"id" json:"-"`
Alias string `datastore:"alias" schema:"alias" json:"alias"`
Title string `datastore:"title" schema:"title" json:"title"`
Description string `datastore:"description" schema:"description" json:"description"`
Direction string `schema:"dir" json:"dir,omitempty"`
Language string `schema:"lang" json:"lang,omitempty"`
StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"`
Script string `datastore:"script" schema:"script" json:"script,omitempty"`
Public bool `datastore:"public" json:"public"`
Visibility collVisibility `datastore:"private" json:"-"`
Format string `datastore:"format" json:"format,omitempty"`
Views int64 `json:"views"`
OwnerID int64 `datastore:"owner_id" json:"-"`
PublicOwner bool `datastore:"public_owner" json:"-"`
URL string `json:"url,omitempty"`
db *datastore
hostName string
}
CollectionObj struct {
Collection
TotalPosts int `json:"total_posts"`
Owner *User `json:"owner,omitempty"`
Posts *[]PublicPost `json:"posts,omitempty"`
Format *CollectionFormat
}
DisplayCollection struct {
*CollectionObj
Prefix string
IsTopLevel bool
CurrentPage int
TotalPages int
- Suspended bool
+ Silenced bool
}
SubmittedCollection struct {
// Data used for updating a given collection
ID int64
OwnerID uint64
// Form helpers
PreferURL string `schema:"prefer_url" json:"prefer_url"`
Privacy int `schema:"privacy" json:"privacy"`
Pass string `schema:"password" json:"password"`
MathJax bool `schema:"mathjax" json:"mathjax"`
Handle string `schema:"handle" json:"handle"`
// Actual collection values updated in the DB
Alias *string `schema:"alias" json:"alias"`
Title *string `schema:"title" json:"title"`
Description *string `schema:"description" json:"description"`
StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"`
Script *sql.NullString `schema:"script" json:"script"`
Visibility *int `schema:"visibility" json:"public"`
Format *sql.NullString `schema:"format" json:"format"`
}
CollectionFormat struct {
Format string
}
collectionReq struct {
// Information about the collection request itself
prefix, alias, domain string
isCustomDomain bool
// User-related fields
isCollOwner bool
}
)
func (sc *SubmittedCollection) FediverseHandle() string {
if sc.Handle == "" {
return apCustomHandleDefault
}
return getSlug(sc.Handle, "")
}
// collVisibility represents the visibility level for the collection.
type collVisibility int
// Visibility levels. Values are bitmasks, stored in the database as
// decimal numbers. If adding types, append them to this list. If removing,
// replace the desired visibility with a new value.
const CollUnlisted collVisibility = 0
const (
CollPublic collVisibility = 1 << iota
CollPrivate
CollProtected
)
var collVisibilityStrings = map[string]collVisibility{
"unlisted": CollUnlisted,
"public": CollPublic,
"private": CollPrivate,
"protected": CollProtected,
}
func defaultVisibility(cfg *config.Config) collVisibility {
vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility]
if !ok {
vis = CollUnlisted
}
return vis
}
func (cf *CollectionFormat) Ascending() bool {
return cf.Format == "novel"
}
func (cf *CollectionFormat) ShowDates() bool {
return cf.Format == "blog"
}
func (cf *CollectionFormat) PostsPerPage() int {
if cf.Format == "novel" {
return postsPerPage
}
return postsPerPage
}
// Valid returns whether or not a format value is valid.
func (cf *CollectionFormat) Valid() bool {
return cf.Format == "blog" ||
cf.Format == "novel" ||
cf.Format == "notebook"
}
// NewFormat creates a new CollectionFormat object from the Collection.
func (c *Collection) NewFormat() *CollectionFormat {
cf := &CollectionFormat{Format: c.Format}
// Fill in default format
if cf.Format == "" {
cf.Format = "blog"
}
return cf
}
func (c *Collection) IsUnlisted() bool {
return c.Visibility == 0
}
func (c *Collection) IsPrivate() bool {
return c.Visibility&CollPrivate != 0
}
func (c *Collection) IsProtected() bool {
return c.Visibility&CollProtected != 0
}
func (c *Collection) IsPublic() bool {
return c.Visibility&CollPublic != 0
}
func (c *Collection) FriendlyVisibility() string {
if c.IsPrivate() {
return "Private"
}
if c.IsPublic() {
return "Public"
}
if c.IsProtected() {
return "Password-protected"
}
return "Unlisted"
}
func (c *Collection) ShowFooterBranding() bool {
// TODO: implement this setting
return true
}
// CanonicalURL returns a fully-qualified URL to the collection.
func (c *Collection) CanonicalURL() string {
return c.RedirectingCanonicalURL(false)
}
func (c *Collection) DisplayCanonicalURL() string {
us := c.CanonicalURL()
u, err := url.Parse(us)
if err != nil {
return us
}
p := u.Path
if p == "/" {
p = ""
}
return u.Hostname() + p
}
func (c *Collection) RedirectingCanonicalURL(isRedir bool) string {
if c.hostName == "" {
// If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail
log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writeas/writefreely/issues/new?template=bug_report.md")
}
if isSingleUser {
return c.hostName + "/"
}
return fmt.Sprintf("%s/%s/", c.hostName, c.Alias)
}
// PrevPageURL provides a full URL for the previous page of collection posts,
// returning a /page/N result for pages >1
func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string {
u := ""
if n == 2 {
// Previous page is 1; no need for /page/ prefix
if prefix == "" {
u = "/"
}
// Else leave off trailing slash
} else {
u = fmt.Sprintf("/page/%d", n-1)
}
if tl {
return u
}
return "/" + prefix + c.Alias + u
}
// NextPageURL provides a full URL for the next page of collection posts
func (c *Collection) NextPageURL(prefix string, n int, tl bool) string {
if tl {
return fmt.Sprintf("/page/%d", n+1)
}
return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1)
}
func (c *Collection) DisplayTitle() string {
if c.Title != "" {
return c.Title
}
return c.Alias
}
func (c *Collection) StyleSheetDisplay() template.CSS {
return template.CSS(c.StyleSheet)
}
// ForPublic modifies the Collection for public consumption, such as via
// the API.
func (c *Collection) ForPublic() {
c.URL = c.CanonicalURL()
}
var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString
func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person {
accountRoot := c.FederatedAccount()
p := activitystreams.NewPerson(accountRoot)
p.URL = c.CanonicalURL()
uname := c.Alias
p.PreferredUsername = uname
p.Name = c.DisplayTitle()
p.Summary = c.Description
if p.Name != "" {
if av := c.AvatarURL(); av != "" {
p.Icon = activitystreams.Image{
Type: "Image",
MediaType: "image/png",
URL: av,
}
}
}
collID := c.ID
if len(ids) > 0 {
collID = ids[0]
}
pub, priv := c.db.GetAPActorKeys(collID)
if pub != nil {
p.AddPubKey(pub)
p.SetPrivKey(priv)
}
return p
}
func (c *Collection) AvatarURL() string {
fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0]))
if !isAvatarChar(fl) {
return ""
}
return c.hostName + "/img/avatars/" + fl + ".png"
}
func (c *Collection) FederatedAPIBase() string {
return c.hostName + "/"
}
func (c *Collection) FederatedAccount() string {
accountUser := c.Alias
return c.FederatedAPIBase() + "api/collections/" + accountUser
}
func (c *Collection) RenderMathJax() bool {
return c.db.CollectionHasAttribute(c.ID, "render_mathjax")
}
func newCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
alias := r.FormValue("alias")
title := r.FormValue("title")
var missingParams, accessToken string
var u *User
c := struct {
Alias string `json:"alias" schema:"alias"`
Title string `json:"title" schema:"title"`
Web bool `json:"web" schema:"web"`
}{}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse post update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
// TODO: move form parsing to formDecoder
c.Alias = alias
c.Title = title
}
if c.Alias == "" {
if c.Title != "" {
// If only a title was given, just use it to generate the alias.
c.Alias = getSlug(c.Title, "")
} else {
missingParams += "`alias` "
}
}
if c.Title == "" {
missingParams += "`title` "
}
if missingParams != "" {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)}
}
var userID int64
var err error
if reqJSON && !c.Web {
accessToken = r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
userID = app.db.GetUserID(accessToken)
if userID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
userID = u.ID
}
- suspended, err := app.db.IsUserSuspended(userID)
+ silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("new collection: %v", err)
return ErrInternalGeneral
}
- if suspended {
- return ErrUserSuspended
+ if silenced {
+ return ErrUserSilenced
}
if !author.IsValidUsername(app.cfg, c.Alias) {
return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."}
}
coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID)
if err != nil {
// TODO: handle this
return err
}
res := &CollectionObj{Collection: *coll}
if reqJSON {
return impart.WriteSuccess(w, res, http.StatusCreated)
}
redirectTo := "/me/c/"
// TODO: redirect to pad when necessary
return impart.HTTPError{http.StatusFound, redirectTo}
}
func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) {
accessToken := r.Header.Get("Authorization")
var userID int64 = -1
if accessToken != "" {
userID = app.db.GetUserID(accessToken)
}
isCollOwner := userID == c.OwnerID
if c.IsPrivate() && !isCollOwner {
// Collection is private, but user isn't authenticated
return -1, ErrCollectionNotFound
}
if c.IsProtected() {
// TODO: check access token
return -1, ErrCollectionUnauthorizedRead
}
return userID, nil
}
// fetchCollection handles the API endpoint for retrieving collection data.
func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error {
accept := r.Header.Get("Accept")
if strings.Contains(accept, "application/activity+json") {
return handleFetchCollectionActivities(app, w, r)
}
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: move this logic into a common getCollection function
// Get base Collection data
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Redirect users who aren't requesting JSON
reqJSON := IsJSON(r)
if !reqJSON {
return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
}
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Fetch extra data about the Collection
res := &CollectionObj{Collection: *c}
if c.PublicOwner {
u, err := app.db.GetUserByID(res.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
res.Owner = u
}
}
- // TODO: check suspended
+ // TODO: check status for silenced
app.db.GetPostsCount(res, isCollOwner)
// Strip non-public information
res.Collection.ForPublic()
return impart.WriteSuccess(w, res, http.StatusOK)
}
// fetchCollectionPosts handles an API endpoint for retrieving a collection's
// posts.
func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
alias := vars["alias"]
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Get page
page := 1
if p := r.FormValue("page"); p != "" {
pInt, _ := strconv.Atoi(p)
if pInt > 0 {
page = pInt
}
}
posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false)
if err != nil {
return err
}
coll := &CollectionObj{Collection: *c, Posts: posts}
app.db.GetPostsCount(coll, isCollOwner)
// Strip non-public information
coll.Collection.ForPublic()
// Transform post bodies if needed
if r.FormValue("body") == "html" {
for _, p := range *coll.Posts {
p.Content = waposts.ApplyMarkdown([]byte(p.Content))
}
}
return impart.WriteSuccess(w, coll, http.StatusOK)
}
type CollectionPage struct {
page.StaticPage
*DisplayCollection
IsCustomDomain bool
IsWelcome bool
IsOwner bool
CanPin bool
Username string
Collections *[]Collection
PinnedPosts *[]PublicPost
IsAdmin bool
CanInvite bool
}
func NewCollectionObj(c *Collection) *CollectionObj {
return &CollectionObj{
Collection: *c,
Format: c.NewFormat(),
}
}
func (c *CollectionObj) ScriptDisplay() template.JS {
return template.JS(c.Script)
}
var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$")
func (c *CollectionObj) ExternalScripts() []template.URL {
scripts := []template.URL{}
if c.Script == "" {
return scripts
}
matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1)
for _, m := range matches {
scripts = append(scripts, template.URL(strings.TrimSpace(m[1])))
}
return scripts
}
func (c *CollectionObj) CanShowScript() bool {
return false
}
func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error {
cr.prefix = vars["prefix"]
cr.alias = vars["collection"]
// Normalize the URL, redirecting user to consistent post URL
if cr.alias != strings.ToLower(cr.alias) {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))}
}
return nil
}
// processCollectionPermissions checks the permissions for the given
// collectionReq, returning a Collection if access is granted; otherwise this
// renders any necessary collection pages, for example, if requesting a custom
// domain that doesn't yet have a collection associated, or if a collection
// requires a password. In either case, this will return nil, nil -- thus both
// values should ALWAYS be checked to determine whether or not to continue.
func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) {
// Display collection if this is a collection
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(cr.alias)
}
// TODO: verify we don't reveal the existence of a private collection with redirection
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
if cr.isCustomDomain {
// User is on the site from a custom domain
//tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r))
//if tErr != nil {
//log.Error("Unable to render 404-domain page: %v", err)
//}
return nil, nil
}
if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen {
// Alias is within post ID range, so just be sure this isn't a post
if app.db.PostIDExists(cr.alias) {
// TODO: use StatusFound for vanity post URLs when we implement them
return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias}
}
}
// Redirect if necessary
newAlias := app.db.GetCollectionRedirect(cr.alias)
if newAlias != "" {
return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"}
}
}
}
return nil, err
}
c.hostName = app.cfg.App.Host
// Update CollectionRequest to reflect owner status
cr.isCollOwner = u != nil && u.ID == c.OwnerID
// Check permissions
if !cr.isCollOwner {
if c.IsPrivate() {
return nil, ErrCollectionNotFound
} else if c.IsProtected() {
uname := ""
if u != nil {
uname = u.Username
}
// TODO: move this to all permission checks?
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ suspended, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("process protected collection permissions: %v", err)
return nil, err
}
if suspended {
return nil, ErrCollectionNotFound
}
// See if we've authorized this collection
authd := isAuthorizedForCollection(app, c.Alias, r)
if !authd {
p := struct {
page.StaticPage
*CollectionObj
Username string
Next string
Flashes []template.HTML
}{
StaticPage: pageForReq(app, r),
CollectionObj: &CollectionObj{Collection: *c},
Username: uname,
Next: r.FormValue("g"),
Flashes: []template.HTML{},
}
// Get owner information
p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p)
if err != nil {
log.Error("Unable to render password-collection: %v", err)
return nil, err
}
return nil, nil
}
}
}
return c, nil
}
func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) {
u := getUserSession(app, r)
return u, nil
}
func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection {
coll := &DisplayCollection{
CollectionObj: NewCollectionObj(c),
CurrentPage: page,
Prefix: cr.prefix,
IsTopLevel: isSingleUser,
}
c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner)
return coll
}
func getCollectionPage(vars map[string]string) int {
page := 1
var p int
p, _ = strconv.Atoi(vars["page"])
if p > 0 {
page = p
}
return page
}
// handleViewCollection displays the requested Collection
func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
c.hostName = app.cfg.App.Host
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view collection: %v", err)
return ErrInternalGeneral
}
// Serve ActivityStreams data now, if requested
if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
ac := c.PersonObject()
ac.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ac, http.StatusOK)
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := newDisplayCollection(c, cr, page)
coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage())))
if coll.TotalPages > 0 && page > coll.TotalPages {
redirURL := fmt.Sprintf("/page/%d", coll.TotalPages)
if !app.cfg.App.SingleUser {
redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL)
}
return impart.HTTPError{http.StatusFound, redirURL}
}
coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false)
// Serve collection
displayPage := CollectionPage{
DisplayCollection: coll,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
IsWelcome: r.FormValue("greeting") != "",
}
displayPage.IsAdmin = u != nil && u.IsAdmin()
displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin)
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
}
- if !isOwner && suspended {
+ if !isOwner && silenced {
return ErrCollectionNotFound
}
- displayPage.Suspended = isOwner && suspended
+ displayPage.Silenced = isOwner && silenced
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
collTmpl := "collection"
if app.cfg.App.Chorus {
collTmpl = "chorus-collection"
}
err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage)
if err != nil {
log.Error("Unable to render collection index: %v", err)
}
// Update collection view count
go func() {
// Don't update if owner is viewing the collection.
if u != nil && u.ID == coll.OwnerID {
return
}
// Only update for human views
if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) {
return
}
_, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID)
if err != nil {
log.Error("Unable to update collections count: %v", err)
}
}()
return err
}
func handleViewMention(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
handle := vars["handle"]
remoteUser, err := app.db.GetProfilePageFromHandle(app, handle)
if err != nil || remoteUser == "" {
log.Error("Couldn't find user %s: %v", handle, err)
return ErrRemoteUserNotFound
}
return impart.HTTPError{Status: http.StatusFound, Message: remoteUser}
}
func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
tag := vars["tag"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
coll := newDisplayCollection(c, cr, page)
coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner)
if coll.Posts != nil && len(*coll.Posts) == 0 {
return ErrCollectionPageNotFound
}
// Serve collection
displayPage := struct {
CollectionPage
Tag string
}{
CollectionPage: CollectionPage{
DisplayCollection: coll,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
},
Tag: tag,
}
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
if owner.IsSilenced() {
return ErrCollectionNotFound
}
}
- displayPage.Suspended = owner != nil && owner.IsSilenced()
+ displayPage.Silenced = owner != nil && owner.IsSilenced()
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage)
if err != nil {
log.Error("Unable to render collection tag page: %v", err)
}
return nil
}
func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
// Normalize the URL, redirecting user to consistent post URL
loc := fmt.Sprintf("/%s", slug)
if !app.cfg.App.SingleUser {
loc = fmt.Sprintf("/%s/%s", cr.alias, slug)
}
return impart.HTTPError{http.StatusFound, loc}
}
func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
collAlias := vars["alias"]
isWeb := r.FormValue("web") == "1"
u := &User{}
if reqJSON && !isWeb {
// Ensure an access token was given
accessToken := r.Header.Get("Authorization")
u.ID = app.db.GetUserID(accessToken)
if u.ID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
}
- suspended, err := app.db.IsUserSuspended(u.ID)
+ silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("existing collection: %v", err)
return ErrInternalGeneral
}
- if suspended {
- return ErrUserSuspended
+ if silenced {
+ return ErrUserSilenced
}
if r.Method == "DELETE" {
err := app.db.DeleteCollection(collAlias, u.ID)
if err != nil {
// TODO: if not HTTPError, report error to admin
log.Error("Unable to delete collection: %s", err)
return err
}
addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil)
return impart.HTTPError{Status: http.StatusNoContent}
}
c := SubmittedCollection{OwnerID: uint64(u.ID)}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse collection update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err = r.ParseForm()
if err != nil {
log.Error("Couldn't parse collection update form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&c, r.PostForm)
if err != nil {
log.Error("Couldn't decode collection update form request: %v\n", err)
return ErrBadFormData
}
}
err = app.db.UpdateCollection(&c, collAlias)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if reqJSON {
return err
}
addSessionFlash(app, w, r, err.Message, nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
} else {
log.Error("Couldn't update collection: %v\n", err)
return err
}
}
if reqJSON {
return impart.WriteSuccess(w, struct {
}{}, http.StatusOK)
}
addSessionFlash(app, w, r, "Blog updated!", nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
}
// collectionAliasFromReq takes a request and returns the collection alias
// if it can be ascertained, as well as whether or not the collection uses a
// custom domain.
func collectionAliasFromReq(r *http.Request) string {
vars := mux.Vars(r)
alias := vars["subdomain"]
isSubdomain := alias != ""
if !isSubdomain {
// Fall back to write.as/{collection} since this isn't a custom domain
alias = vars["collection"]
}
return alias
}
func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error {
var readReq struct {
Alias string `schema:"alias" json:"alias"`
Pass string `schema:"password" json:"password"`
Next string `schema:"to" json:"to"`
}
// Get params
if impart.ReqJSON(r) {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&readReq)
if err != nil {
log.Error("Couldn't parse readReq JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse readReq form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&readReq, r.PostForm)
if err != nil {
log.Error("Couldn't decode readReq form request: %v\n", err)
return ErrBadFormData
}
}
if readReq.Alias == "" {
return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."}
}
if readReq.Pass == "" {
return impart.HTTPError{http.StatusBadRequest, "Please supply a password."}
}
var collHashedPass []byte
err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass)
if err != nil {
if err == sql.ErrNoRows {
log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias)
return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."}
}
return err
}
if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
// Success; set cookie
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
session.Values[readReq.Alias] = true
err = session.Save(r, w)
if err != nil {
log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err)
}
}
next := "/" + readReq.Next
if !app.cfg.App.SingleUser {
next = "/" + readReq.Alias + next
}
return impart.HTTPError{http.StatusFound, next}
}
func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool {
authd := false
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
_, authd = session.Values[alias]
}
return authd
}
diff --git a/database.go b/database.go
index e114d3a..cea7a97 100644
--- a/database.go
+++ b/database.go
@@ -1,2642 +1,2642 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"context"
"database/sql"
"fmt"
wf_db "github.com/writeas/writefreely/db"
"net/http"
"strings"
"time"
"github.com/guregu/null"
"github.com/guregu/null/zero"
uuid "github.com/nu7hatch/gouuid"
"github.com/writeas/activityserve"
"github.com/writeas/impart"
"github.com/writeas/nerds/store"
"github.com/writeas/web-core/activitypub"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/data"
"github.com/writeas/web-core/id"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/query"
"github.com/writeas/writefreely/author"
"github.com/writeas/writefreely/config"
"github.com/writeas/writefreely/key"
)
const (
mySQLErrDuplicateKey = 1062
mySQLErrCollationMix = 1267
driverMySQL = "mysql"
driverSQLite = "sqlite3"
)
var (
SQLiteEnabled bool
)
type writestore interface {
CreateUser(*config.Config, *User, string) error
UpdateUserEmail(keys *key.Keychain, userID int64, email string) error
UpdateEncryptedUserEmail(int64, []byte) error
GetUserByID(int64) (*User, error)
GetUserForAuth(string) (*User, error)
GetUserForAuthByID(int64) (*User, error)
GetUserNameFromToken(string) (string, error)
GetUserDataFromToken(string) (int64, string, error)
GetAPIUser(header string) (*User, error)
GetUserID(accessToken string) int64
GetUserIDPrivilege(accessToken string) (userID int64, sudo bool)
DeleteToken(accessToken []byte) error
FetchLastAccessToken(userID int64) string
GetAccessToken(userID int64) (string, error)
GetTemporaryAccessToken(userID int64, validSecs int) (string, error)
GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error)
DeleteAccount(userID int64) error
ChangeSettings(app *App, u *User, s *userSettings) error
ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error
GetCollections(u *User, hostName string) (*[]Collection, error)
GetPublishableCollections(u *User, hostName string) (*[]Collection, error)
GetMeStats(u *User) userMeStats
GetTotalCollections() (int64, error)
GetTotalPosts() (int64, error)
GetTopPosts(u *User, alias string) (*[]PublicPost, error)
GetAnonymousPosts(u *User) (*[]PublicPost, error)
GetUserPosts(u *User) (*[]PublicPost, error)
CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error)
CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error)
UpdateOwnedPost(post *AuthenticatedPost, userID int64) error
GetEditablePost(id, editToken string) (*PublicPost, error)
PostIDExists(id string) bool
GetPost(id string, collectionID int64) (*PublicPost, error)
GetOwnedPost(id string, ownerID int64) (*PublicPost, error)
GetPostProperty(id string, collectionID int64, property string) (interface{}, error)
CreateCollectionFromToken(*config.Config, string, string, string) (*Collection, error)
CreateCollection(*config.Config, string, string, int64) (*Collection, error)
GetCollectionBy(condition string, value interface{}) (*Collection, error)
GetCollection(alias string) (*Collection, error)
GetCollectionForPad(alias string) (*Collection, error)
GetCollectionByID(id int64) (*Collection, error)
UpdateCollection(c *SubmittedCollection, alias string) error
DeleteCollection(alias string, userID int64) error
UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error
GetLastPinnedPostPos(collID int64) int64
GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error)
RemoveCollectionRedirect(t *sql.Tx, alias string) error
GetCollectionRedirect(alias string) (new string)
IsCollectionAttributeOn(id int64, attr string) bool
CollectionHasAttribute(id int64, attr string) bool
CanCollect(cpr *ClaimPostRequest, userID int64) bool
AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error)
DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error)
ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error)
GetPostsCount(c *CollectionObj, includeFuture bool)
GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error)
GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error)
GetAPFollowers(c *Collection) (*[]RemoteUser, error)
GetAPActorKeys(collectionID int64) ([]byte, []byte)
CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error
GetUserInvites(userID int64) (*[]Invite, error)
GetUserInvite(id string) (*Invite, error)
GetUsersInvitedCount(id string) int64
CreateInvitedUser(inviteID string, userID int64) error
GetDynamicContent(id string) (*instanceContent, error)
UpdateDynamicContent(id, title, content, contentType string) error
GetAllUsers(page uint) (*[]User, error)
GetAllUsersCount() int64
GetUserLastPostTime(id int64) (*time.Time, error)
GetCollectionLastPostTime(id int64) (*time.Time, error)
GetIDForRemoteUser(context.Context, string, string, string) (int64, error)
RecordRemoteUserID(context.Context, int64, string, string, string, string) error
ValidateOAuthState(context.Context, string) (string, string, error)
GenerateOAuthState(context.Context, string, string) (string, error)
DatabaseInitialized() bool
}
type datastore struct {
*sql.DB
driverName string
}
var _ writestore = &datastore{}
func (db *datastore) now() string {
if db.driverName == driverSQLite {
return "strftime('%Y-%m-%d %H:%M:%S','now')"
}
return "NOW()"
}
func (db *datastore) clip(field string, l int) string {
if db.driverName == driverSQLite {
return fmt.Sprintf("SUBSTR(%s, 0, %d)", field, l)
}
return fmt.Sprintf("LEFT(%s, %d)", field, l)
}
func (db *datastore) upsert(indexedCols ...string) string {
if db.driverName == driverSQLite {
// NOTE: SQLite UPSERT syntax only works in v3.24.0 (2018-06-04) or later
// Leaving this for whenever we can upgrade and include it in our binary
cc := strings.Join(indexedCols, ", ")
return "ON CONFLICT(" + cc + ") DO UPDATE SET"
}
return "ON DUPLICATE KEY UPDATE"
}
func (db *datastore) dateSub(l int, unit string) string {
if db.driverName == driverSQLite {
return fmt.Sprintf("DATETIME('now', '-%d %s')", l, unit)
}
return fmt.Sprintf("DATE_SUB(NOW(), INTERVAL %d %s)", l, unit)
}
func (db *datastore) CreateUser(cfg *config.Config, u *User, collectionTitle string) error {
if db.PostIDExists(u.Username) {
return impart.HTTPError{http.StatusConflict, "Invalid collection name."}
}
// New users get a `users` and `collections` row.
t, err := db.Begin()
if err != nil {
return err
}
// 1. Add to `users` table
// NOTE: Assumes User's Password is already hashed!
res, err := t.Exec("INSERT INTO users (username, password, email) VALUES (?, ?, ?)", u.Username, u.HashedPass, u.Email)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Rolling back users INSERT: %v\n", err)
return err
}
u.ID, err = res.LastInsertId()
if err != nil {
t.Rollback()
log.Error("Rolling back after LastInsertId: %v\n", err)
return err
}
// 2. Create user's Collection
if collectionTitle == "" {
collectionTitle = u.Username
}
res, err = t.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", u.Username, collectionTitle, "", defaultVisibility(cfg), u.ID, 0)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Rolling back collections INSERT: %v\n", err)
return err
}
db.RemoveCollectionRedirect(t, u.Username)
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return err
}
return nil
}
// FIXME: We're returning errors inconsistently in this file. Do we use Errorf
// for returned value, or impart?
func (db *datastore) UpdateUserEmail(keys *key.Keychain, userID int64, email string) error {
encEmail, err := data.Encrypt(keys.EmailKey, email)
if err != nil {
return fmt.Errorf("Couldn't encrypt email %s: %s\n", email, err)
}
return db.UpdateEncryptedUserEmail(userID, encEmail)
}
func (db *datastore) UpdateEncryptedUserEmail(userID int64, encEmail []byte) error {
_, err := db.Exec("UPDATE users SET email = ? WHERE id = ?", encEmail, userID)
if err != nil {
return fmt.Errorf("Unable to update user email: %s", err)
}
return nil
}
func (db *datastore) CreateCollectionFromToken(cfg *config.Config, alias, title, accessToken string) (*Collection, error) {
userID := db.GetUserID(accessToken)
if userID == -1 {
return nil, ErrBadAccessToken
}
return db.CreateCollection(cfg, alias, title, userID)
}
func (db *datastore) GetUserCollectionCount(userID int64) (uint64, error) {
var collCount uint64
err := db.QueryRow("SELECT COUNT(*) FROM collections WHERE owner_id = ?", userID).Scan(&collCount)
switch {
case err == sql.ErrNoRows:
return 0, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user from database."}
case err != nil:
log.Error("Couldn't get collections count for user %d: %v", userID, err)
return 0, err
}
return collCount, nil
}
func (db *datastore) CreateCollection(cfg *config.Config, alias, title string, userID int64) (*Collection, error) {
if db.PostIDExists(alias) {
return nil, impart.HTTPError{http.StatusConflict, "Invalid collection name."}
}
// All good, so create new collection
res, err := db.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", alias, title, "", defaultVisibility(cfg), userID, 0)
if err != nil {
if db.isDuplicateKeyErr(err) {
return nil, impart.HTTPError{http.StatusConflict, "Collection already exists."}
}
log.Error("Couldn't add to collections: %v\n", err)
return nil, err
}
c := &Collection{
Alias: alias,
Title: title,
OwnerID: userID,
PublicOwner: false,
Public: defaultVisibility(cfg) == CollPublic,
}
c.ID, err = res.LastInsertId()
if err != nil {
log.Error("Couldn't get collection LastInsertId: %v\n", err)
}
return c, nil
}
func (db *datastore) GetUserByID(id int64) (*User, error) {
u := &User{ID: id}
err := db.QueryRow("SELECT username, password, email, created, status FROM users WHERE id = ?", id).Scan(&u.Username, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password: %v", err)
return nil, err
}
return u, nil
}
-// IsUserSuspended returns true if the user account associated with id is
-// currently suspended.
-func (db *datastore) IsUserSuspended(id int64) (bool, error) {
+// IsUserSilenced returns true if the user account associated with id is
+// currently silenced.
+func (db *datastore) IsUserSilenced(id int64) (bool, error) {
u := &User{ID: id}
err := db.QueryRow("SELECT status FROM users WHERE id = ?", id).Scan(&u.Status)
switch {
case err == sql.ErrNoRows:
- return false, fmt.Errorf("is user suspended: %v", ErrUserNotFound)
+ return false, fmt.Errorf("is user silenced: %v", ErrUserNotFound)
case err != nil:
- log.Error("Couldn't SELECT user password: %v", err)
- return false, fmt.Errorf("is user suspended: %v", err)
+ log.Error("Couldn't SELECT user status: %v", err)
+ return false, fmt.Errorf("is user silenced: %v", err)
}
return u.IsSilenced(), nil
}
// DoesUserNeedAuth returns true if the user hasn't provided any methods for
// authenticating with the account, such a passphrase or email address.
// Any errors are reported to admin and silently quashed, returning false as the
// result.
func (db *datastore) DoesUserNeedAuth(id int64) bool {
var pass, email []byte
// Find out if user has an email set first
err := db.QueryRow("SELECT password, email FROM users WHERE id = ?", id).Scan(&pass, &email)
switch {
case err == sql.ErrNoRows:
// ERROR. Don't give false positives on needing auth methods
return false
case err != nil:
// ERROR. Don't give false positives on needing auth methods
log.Error("Couldn't SELECT user %d from users: %v", id, err)
return false
}
// User doesn't need auth if there's an email
return len(email) == 0 && len(pass) == 0
}
func (db *datastore) IsUserPassSet(id int64) (bool, error) {
var pass []byte
err := db.QueryRow("SELECT password FROM users WHERE id = ?", id).Scan(&pass)
switch {
case err == sql.ErrNoRows:
return false, nil
case err != nil:
log.Error("Couldn't SELECT user %d from users: %v", id, err)
return false, err
}
return len(pass) > 0, nil
}
func (db *datastore) GetUserForAuth(username string) (*User, error) {
u := &User{Username: username}
err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE username = ?", username).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
// Check if they've entered the wrong, unnormalized username
username = getSlug(username, "")
if username != u.Username {
err = db.QueryRow("SELECT id FROM users WHERE username = ? LIMIT 1", username).Scan(&u.ID)
if err == nil {
return db.GetUserForAuth(username)
}
}
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password: %v", err)
return nil, err
}
return u, nil
}
func (db *datastore) GetUserForAuthByID(userID int64) (*User, error) {
u := &User{ID: userID}
err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE id = ?", u.ID).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT userForAuthByID: %v", err)
return nil, err
}
return u, nil
}
func (db *datastore) GetUserNameFromToken(accessToken string) (string, error) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return "", ErrNoAccessToken
}
var oneTime bool
var username string
err := db.QueryRow("SELECT username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&username, &oneTime)
switch {
case err == sql.ErrNoRows:
return "", ErrBadAccessToken
case err != nil:
return "", ErrInternalGeneral
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return username, nil
}
func (db *datastore) GetUserDataFromToken(accessToken string) (int64, string, error) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return 0, "", ErrNoAccessToken
}
var userID int64
var oneTime bool
var username string
err := db.QueryRow("SELECT user_id, username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &username, &oneTime)
switch {
case err == sql.ErrNoRows:
return 0, "", ErrBadAccessToken
case err != nil:
return 0, "", ErrInternalGeneral
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return userID, username, nil
}
func (db *datastore) GetAPIUser(header string) (*User, error) {
uID := db.GetUserID(header)
if uID == -1 {
return nil, fmt.Errorf(ErrUserNotFound.Error())
}
return db.GetUserByID(uID)
}
// GetUserID takes a hexadecimal accessToken, parses it into its binary
// representation, and gets any user ID associated with the token. If no user
// is associated, -1 is returned.
func (db *datastore) GetUserID(accessToken string) int64 {
i, _ := db.GetUserIDPrivilege(accessToken)
return i
}
func (db *datastore) GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return -1, false
}
var oneTime bool
err := db.QueryRow("SELECT user_id, sudo, one_time FROM accesstokens WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &sudo, &oneTime)
switch {
case err == sql.ErrNoRows:
return -1, false
case err != nil:
return -1, false
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return
}
func (db *datastore) DeleteToken(accessToken []byte) error {
res, err := db.Exec("DELETE FROM accesstokens WHERE token LIKE ?", accessToken)
if err != nil {
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
return impart.HTTPError{http.StatusNotFound, "Token is invalid or doesn't exist"}
}
return nil
}
// FetchLastAccessToken creates a new non-expiring, valid access token for the given
// userID.
func (db *datastore) FetchLastAccessToken(userID int64) string {
var t []byte
err := db.QueryRow("SELECT token FROM accesstokens WHERE user_id = ? AND (expires IS NULL OR expires > "+db.now()+") ORDER BY created DESC LIMIT 1", userID).Scan(&t)
switch {
case err == sql.ErrNoRows:
return ""
case err != nil:
log.Error("Failed selecting from accesstoken: %v", err)
return ""
}
u, err := uuid.Parse(t)
if err != nil {
return ""
}
return u.String()
}
// GetAccessToken creates a new non-expiring, valid access token for the given
// userID.
func (db *datastore) GetAccessToken(userID int64) (string, error) {
return db.GetTemporaryOneTimeAccessToken(userID, 0, false)
}
// GetTemporaryAccessToken creates a new valid access token for the given
// userID that remains valid for the given time in seconds. If validSecs is 0,
// the access token doesn't automatically expire.
func (db *datastore) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) {
return db.GetTemporaryOneTimeAccessToken(userID, validSecs, false)
}
// GetTemporaryOneTimeAccessToken creates a new valid access token for the given
// userID that remains valid for the given time in seconds and can only be used
// once if oneTime is true. If validSecs is 0, the access token doesn't
// automatically expire.
func (db *datastore) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) {
u, err := uuid.NewV4()
if err != nil {
log.Error("Unable to generate token: %v", err)
return "", err
}
// Insert UUID to `accesstokens`
binTok := u[:]
expirationVal := "NULL"
if validSecs > 0 {
expirationVal = fmt.Sprintf("DATE_ADD("+db.now()+", INTERVAL %d SECOND)", validSecs)
}
_, err = db.Exec("INSERT INTO accesstokens (token, user_id, one_time, expires) VALUES (?, ?, ?, "+expirationVal+")", string(binTok), userID, oneTime)
if err != nil {
log.Error("Couldn't INSERT accesstoken: %v", err)
return "", err
}
return u.String(), nil
}
func (db *datastore) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) {
var userID, collID int64 = -1, -1
var coll *Collection
var err error
if accessToken != "" {
userID = db.GetUserID(accessToken)
if userID == -1 {
return nil, ErrBadAccessToken
}
if collAlias != "" {
coll, err = db.GetCollection(collAlias)
if err != nil {
return nil, err
}
coll.hostName = hostName
if coll.OwnerID != userID {
return nil, ErrForbiddenCollection
}
collID = coll.ID
}
}
rp := &PublicPost{}
rp.Post, err = db.CreatePost(userID, collID, post)
if err != nil {
return rp, err
}
if coll != nil {
coll.ForPublic()
rp.Collection = &CollectionObj{Collection: *coll}
}
return rp, nil
}
func (db *datastore) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) {
idLen := postIDLen
friendlyID := store.GenerateFriendlyRandomString(idLen)
// Handle appearance / font face
appearance := post.Font
if !post.isFontValid() {
appearance = "norm"
}
var err error
ownerID := sql.NullInt64{
Valid: false,
}
ownerCollID := sql.NullInt64{
Valid: false,
}
slug := sql.NullString{"", false}
// If an alias was supplied, we'll add this to the collection as well.
if userID > 0 {
ownerID.Int64 = userID
ownerID.Valid = true
if collID > 0 {
ownerCollID.Int64 = collID
ownerCollID.Valid = true
var slugVal string
if post.Title != nil && *post.Title != "" {
slugVal = getSlug(*post.Title, post.Language.String)
if slugVal == "" {
slugVal = getSlug(*post.Content, post.Language.String)
}
} else {
slugVal = getSlug(*post.Content, post.Language.String)
}
if slugVal == "" {
slugVal = friendlyID
}
slug = sql.NullString{slugVal, true}
}
}
created := time.Now()
if db.driverName == driverSQLite {
// SQLite stores datetimes in UTC, so convert time.Now() to it here
created = created.UTC()
}
if post.Created != nil {
created, err = time.Parse("2006-01-02T15:04:05Z", *post.Created)
if err != nil {
log.Error("Unable to parse Created time '%s': %v", *post.Created, err)
created = time.Now()
if db.driverName == driverSQLite {
// SQLite stores datetimes in UTC, so convert time.Now() to it here
created = created.UTC()
}
}
}
stmt, err := db.Prepare("INSERT INTO posts (id, slug, title, content, text_appearance, language, rtl, privacy, owner_id, collection_id, created, updated, view_count) VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?, ?, " + db.now() + ", ?)")
if err != nil {
return nil, err
}
defer stmt.Close()
_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
if err != nil {
if db.isDuplicateKeyErr(err) {
// Duplicate entry error; try a new slug
// TODO: make this a little more robust
slug = sql.NullString{id.GenSafeUniqueSlug(slug.String), true}
_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
if err != nil {
return nil, handleFailedPostInsert(fmt.Errorf("Retried slug generation, still failed: %v", err))
}
} else {
return nil, handleFailedPostInsert(err)
}
}
// TODO: return Created field in proper format
return &Post{
ID: friendlyID,
Slug: null.NewString(slug.String, slug.Valid),
Font: appearance,
Language: zero.NewString(post.Language.String, post.Language.Valid),
RTL: zero.NewBool(post.IsRTL.Bool, post.IsRTL.Valid),
OwnerID: null.NewInt(userID, true),
CollectionID: null.NewInt(userID, true),
Created: created.Truncate(time.Second).UTC(),
Updated: time.Now().Truncate(time.Second).UTC(),
Title: zero.NewString(*(post.Title), true),
Content: *(post.Content),
}, nil
}
// UpdateOwnedPost updates an existing post with only the given fields in the
// supplied AuthenticatedPost.
func (db *datastore) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error {
params := []interface{}{}
var queryUpdates, sep, authCondition string
if post.Slug != nil && *post.Slug != "" {
queryUpdates += sep + "slug = ?"
sep = ", "
params = append(params, getSlug(*post.Slug, ""))
}
if post.Content != nil {
queryUpdates += sep + "content = ?"
sep = ", "
params = append(params, post.Content)
}
if post.Title != nil {
queryUpdates += sep + "title = ?"
sep = ", "
params = append(params, post.Title)
}
if post.Language.Valid {
queryUpdates += sep + "language = ?"
sep = ", "
params = append(params, post.Language.String)
}
if post.IsRTL.Valid {
queryUpdates += sep + "rtl = ?"
sep = ", "
params = append(params, post.IsRTL.Bool)
}
if post.Font != "" {
queryUpdates += sep + "text_appearance = ?"
sep = ", "
params = append(params, post.Font)
}
if post.Created != nil {
createTime, err := time.Parse(postMetaDateFormat, *post.Created)
if err != nil {
log.Error("Unable to parse Created date: %v", err)
return fmt.Errorf("That's the incorrect format for Created date.")
}
queryUpdates += sep + "created = ?"
sep = ", "
params = append(params, createTime)
}
// WHERE parameters...
// id = ?
params = append(params, post.ID)
// AND owner_id = ?
authCondition = "(owner_id = ?)"
params = append(params, userID)
if queryUpdates == "" {
return ErrPostNoUpdatableVals
}
queryUpdates += sep + "updated = " + db.now()
res, err := db.Exec("UPDATE posts SET "+queryUpdates+" WHERE id = ? AND "+authCondition, params...)
if err != nil {
log.Error("Unable to update owned post: %v", err)
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND "+authCondition, post.ID, params[len(params)-1]).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedEditPost
case err != nil:
log.Error("Failed selecting from posts: %v", err)
}
return nil
}
return nil
}
func (db *datastore) GetCollectionBy(condition string, value interface{}) (*Collection, error) {
c := &Collection{}
// FIXME: change Collection to reflect database values. Add helper functions to get actual values
var styleSheet, script, format zero.String
row := db.QueryRow("SELECT id, alias, title, description, style_sheet, script, format, owner_id, privacy, view_count FROM collections WHERE "+condition, value)
err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &styleSheet, &script, &format, &c.OwnerID, &c.Visibility, &c.Views)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
c.StyleSheet = styleSheet.String
c.Script = script.String
c.Format = format.String
c.Public = c.IsPublic()
c.db = db
return c, nil
}
func (db *datastore) GetCollection(alias string) (*Collection, error) {
return db.GetCollectionBy("alias = ?", alias)
}
func (db *datastore) GetCollectionForPad(alias string) (*Collection, error) {
c := &Collection{Alias: alias}
row := db.QueryRow("SELECT id, alias, title, description, privacy FROM collections WHERE alias = ?", alias)
err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility)
switch {
case err == sql.ErrNoRows:
return c, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return c, ErrInternalGeneral
}
c.Public = c.IsPublic()
return c, nil
}
func (db *datastore) GetCollectionByID(id int64) (*Collection, error) {
return db.GetCollectionBy("id = ?", id)
}
func (db *datastore) GetCollectionFromDomain(host string) (*Collection, error) {
return db.GetCollectionBy("host = ?", host)
}
func (db *datastore) UpdateCollection(c *SubmittedCollection, alias string) error {
q := query.NewUpdate().
SetStringPtr(c.Title, "title").
SetStringPtr(c.Description, "description").
SetNullString(c.StyleSheet, "style_sheet").
SetNullString(c.Script, "script")
if c.Format != nil {
cf := &CollectionFormat{Format: c.Format.String}
if cf.Valid() {
q.SetNullString(c.Format, "format")
}
}
var updatePass bool
if c.Visibility != nil && (collVisibility(*c.Visibility)&CollProtected == 0 || c.Pass != "") {
q.SetIntPtr(c.Visibility, "privacy")
if c.Pass != "" {
updatePass = true
}
}
// WHERE values
q.Where("alias = ? AND owner_id = ?", alias, c.OwnerID)
if q.Updates == "" {
return ErrPostNoUpdatableVals
}
// Find any current domain
var collID int64
var rowsAffected int64
var changed bool
var res sql.Result
err := db.QueryRow("SELECT id FROM collections WHERE alias = ?", alias).Scan(&collID)
if err != nil {
log.Error("Failed selecting from collections: %v. Some things won't work.", err)
}
// Update MathJax value
if c.MathJax {
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", collID, "render_mathjax", "1")
} else {
_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "render_mathjax", "1", "1")
}
if err != nil {
log.Error("Unable to insert render_mathjax value: %v", err)
return err
}
} else {
_, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "render_mathjax")
if err != nil {
log.Error("Unable to delete render_mathjax value: %v", err)
return err
}
}
// Update rest of the collection data
res, err = db.Exec("UPDATE collections SET "+q.Updates+" WHERE "+q.Conditions, q.Params...)
if err != nil {
log.Error("Unable to update collection: %v", err)
return err
}
rowsAffected, _ = res.RowsAffected()
if !changed || rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM collections WHERE alias = ? AND owner_id = ?", alias, c.OwnerID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedEditPost
case err != nil:
log.Error("Failed selecting from collections: %v", err)
}
if !updatePass {
return nil
}
}
if updatePass {
hashedPass, err := auth.HashPass([]byte(c.Pass))
if err != nil {
log.Error("Unable to create hash: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?)", alias, hashedPass)
} else {
_, err = db.Exec("INSERT INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?) "+db.upsert("collection_id")+" password = ?", alias, hashedPass, hashedPass)
}
if err != nil {
return err
}
}
return nil
}
const postCols = "id, slug, text_appearance, language, rtl, privacy, owner_id, collection_id, pinned_position, created, updated, view_count, title, content"
// getEditablePost returns a PublicPost with the given ID only if the given
// edit token is valid for the post.
func (db *datastore) GetEditablePost(id, editToken string) (*PublicPost, error) {
// FIXME: code duplicated from getPost()
// TODO: add slight logic difference to getPost / one func
var ownerName sql.NullString
p := &Post{}
row := db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE id = ? LIMIT 1", id)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
switch {
case err == sql.ErrNoRows:
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
if ownerName.Valid {
res.Owner = &PublicUser{Username: ownerName.String}
}
return &res, nil
}
func (db *datastore) PostIDExists(id string) bool {
var dummy bool
err := db.QueryRow("SELECT 1 FROM posts WHERE id = ?", id).Scan(&dummy)
return err == nil && dummy
}
// GetPost gets a public-facing post object from the database. If collectionID
// is > 0, the post will be retrieved by slug and collection ID, rather than
// post ID.
// TODO: break this into two functions:
// - GetPost(id string)
// - GetCollectionPost(slug string, collectionID int64)
func (db *datastore) GetPost(id string, collectionID int64) (*PublicPost, error) {
var ownerName sql.NullString
p := &Post{}
var row *sql.Row
var where string
params := []interface{}{id}
if collectionID > 0 {
where = "slug = ? AND collection_id = ?"
params = append(params, collectionID)
} else {
where = "id = ?"
}
row = db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE "+where+" LIMIT 1", params...)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
switch {
case err == sql.ErrNoRows:
if collectionID > 0 {
return nil, ErrCollectionPageNotFound
}
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
if ownerName.Valid {
res.Owner = &PublicUser{Username: ownerName.String}
}
return &res, nil
}
// TODO: don't duplicate getPost() functionality
func (db *datastore) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) {
p := &Post{}
var row *sql.Row
where := "id = ? AND owner_id = ?"
params := []interface{}{id, ownerID}
row = db.QueryRow("SELECT "+postCols+" FROM posts WHERE "+where+" LIMIT 1", params...)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
switch {
case err == sql.ErrNoRows:
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
return &res, nil
}
func (db *datastore) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) {
propSelects := map[string]string{
"views": "view_count AS views",
}
selectQuery, ok := propSelects[property]
if !ok {
return nil, impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid property: %s.", property)}
}
var res interface{}
var row *sql.Row
if collectionID != 0 {
row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE slug = ? AND collection_id = ? LIMIT 1", id, collectionID)
} else {
row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE id = ? LIMIT 1", id)
}
err := row.Scan(&res)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "Post not found."}
case err != nil:
log.Error("Failed selecting post: %v", err)
return nil, err
}
return res, nil
}
// GetPostsCount modifies the CollectionObj to include the correct number of
// standard (non-pinned) posts. It will return future posts if `includeFuture`
// is true.
func (db *datastore) GetPostsCount(c *CollectionObj, includeFuture bool) {
var count int64
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND pinned_position IS NULL "+timeCondition, c.ID).Scan(&count)
switch {
case err == sql.ErrNoRows:
c.TotalPosts = 0
case err != nil:
log.Error("Failed selecting from collections: %v", err)
c.TotalPosts = 0
}
c.TotalPosts = int(count)
}
// GetPosts retrieves all posts for the given Collection.
// It will return future posts if `includeFuture` is true.
// It will include only standard (non-pinned) posts unless `includePinned` is true.
// TODO: change includeFuture to isOwner, since that's how it's used
func (db *datastore) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() && !forceRecentFirst {
order = "ASC"
}
pagePosts := cf.PostsPerPage()
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
pinnedCondition := ""
if !includePinned {
pinnedCondition = "AND pinned_position IS NULL"
}
rows, err := db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? "+pinnedCondition+" "+timeCondition+" ORDER BY created "+order+limitStr, collID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
}
defer rows.Close()
// TODO: extract this common row scanning logic for queries using `postCols`
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.formatContent(cfg, c, includeFuture)
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
// GetPostsTagged retrieves all posts on the given Collection that contain the
// given tag.
// It will return future posts if `includeFuture` is true.
// TODO: change includeFuture to isOwner, since that's how it's used
func (db *datastore) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() {
order = "ASC"
}
pagePosts := cf.PostsPerPage()
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
var rows *sql.Rows
var err error
if db.driverName == driverSQLite {
rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, `.*#`+strings.ToLower(tag)+`\b.*`)
} else {
rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, "#"+strings.ToLower(tag)+"[[:>:]]")
}
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
}
defer rows.Close()
// TODO: extract this common row scanning logic for queries using `postCols`
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.formatContent(cfg, c, includeFuture)
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetAPFollowers(c *Collection) (*[]RemoteUser, error) {
rows, err := db.Query("SELECT actor_id, inbox, shared_inbox FROM remotefollows f INNER JOIN remoteusers u ON f.remote_user_id = u.id WHERE collection_id = ?", c.ID)
if err != nil {
log.Error("Failed selecting from followers: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve followers."}
}
defer rows.Close()
followers := []RemoteUser{}
for rows.Next() {
f := RemoteUser{}
err = rows.Scan(&f.ActorID, &f.Inbox, &f.SharedInbox)
followers = append(followers, f)
}
return &followers, nil
}
// CanCollect returns whether or not the given user can add the given post to a
// collection. This is true when a post is already owned by the user.
// NOTE: this is currently only used to potentially add owned posts to a
// collection. This has the SIDE EFFECT of also generating a slug for the post.
// FIXME: make this side effect more explicit (or extract it)
func (db *datastore) CanCollect(cpr *ClaimPostRequest, userID int64) bool {
var title, content string
var lang sql.NullString
err := db.QueryRow("SELECT title, content, language FROM posts WHERE id = ? AND owner_id = ?", cpr.ID, userID).Scan(&title, &content, &lang)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Failed on post CanCollect(%s, %d): %v", cpr.ID, userID, err)
return false
}
// Since we have the post content and the post is collectable, generate the
// post's slug now.
cpr.Slug = getSlugFromPost(title, content, lang.String)
return true
}
func (db *datastore) AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) {
qRes, err := db.Exec(query, params...)
if err != nil {
if db.isDuplicateKeyErr(err) && slugIdx > -1 {
s := id.GenSafeUniqueSlug(p.Slug)
if s == p.Slug {
// Sanity check to prevent infinite recursion
return qRes, fmt.Errorf("GenSafeUniqueSlug generated nothing unique: %s", s)
}
p.Slug = s
params[slugIdx] = p.Slug
return db.AttemptClaim(p, query, params, slugIdx)
}
return qRes, fmt.Errorf("attemptClaim: %s", err)
}
return qRes, nil
}
func (db *datastore) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) {
postClaimReqs := map[string]bool{}
res := []ClaimPostResult{}
for i := range postIDs {
postID := postIDs[i]
r := ClaimPostResult{Code: 0, ErrorMessage: ""}
// Perform post validation
if postID == "" {
r.ErrorMessage = "Missing post ID. "
}
if _, ok := postClaimReqs[postID]; ok {
r.Code = 429
r.ErrorMessage = "You've already tried anonymizing this post."
r.ID = postID
res = append(res, r)
continue
}
postClaimReqs[postID] = true
var err error
// Get full post information to return
var fullPost *PublicPost
fullPost, err = db.GetPost(postID, 0)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
r.ID = postID
res = append(res, r)
continue
} else {
log.Error("Error getting post in dispersePosts: %v", err)
}
}
if fullPost.OwnerID.Int64 != userID {
r.Code = http.StatusConflict
r.ErrorMessage = "Post is already owned by someone else."
r.ID = postID
res = append(res, r)
continue
}
var qRes sql.Result
var query string
var params []interface{}
// Do AND owner_id = ? for sanity.
// This should've been caught and returned with a good error message
// just above.
query = "UPDATE posts SET collection_id = NULL WHERE id = ? AND owner_id = ?"
params = []interface{}{postID, userID}
qRes, err = db.Exec(query, params...)
if err != nil {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "A glitch happened on our end."
r.ID = postID
res = append(res, r)
log.Error("dispersePosts (post %s): %v", postID, err)
continue
}
// Post was successfully dispersed
r.Code = http.StatusOK
r.Post = fullPost
rowsAffected, _ := qRes.RowsAffected()
if rowsAffected == 0 {
// This was already claimed, but return 200
r.Code = http.StatusOK
}
res = append(res, r)
}
return &res, nil
}
func (db *datastore) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) {
postClaimReqs := map[string]bool{}
res := []ClaimPostResult{}
postCollAlias := collAlias
for i := range *posts {
p := (*posts)[i]
if &p == nil {
continue
}
r := ClaimPostResult{Code: 0, ErrorMessage: ""}
// Perform post validation
if p.ID == "" {
r.ErrorMessage = "Missing post ID `id`. "
}
if _, ok := postClaimReqs[p.ID]; ok {
r.Code = 429
r.ErrorMessage = "You've already tried claiming this post."
r.ID = p.ID
res = append(res, r)
continue
}
postClaimReqs[p.ID] = true
canCollect := db.CanCollect(&p, userID)
if !canCollect && p.Token == "" {
// TODO: ensure post isn't owned by anyone else when a valid modify
// token is given.
r.ErrorMessage += "Missing post Edit Token `token`."
}
if r.ErrorMessage != "" {
// Post validate failed
r.Code = http.StatusBadRequest
r.ID = p.ID
res = append(res, r)
continue
}
var err error
var qRes sql.Result
var query string
var params []interface{}
var slugIdx int = -1
var coll *Collection
if collAlias == "" {
// Posts are being claimed at /posts/claim, not
// /collections/{alias}/collect, so use given individual collection
// to associate post with.
postCollAlias = p.CollectionAlias
}
if postCollAlias != "" {
// Associate this post with a collection
if p.CreateCollection {
// This is a new collection
// TODO: consider removing this. This seriously complicates this
// method and adds another (unnecessary?) logic path.
coll, err = db.CreateCollection(cfg, postCollAlias, "", userID)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
} else {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "Unknown error occurred creating collection"
}
r.ID = p.ID
res = append(res, r)
continue
}
} else {
// Attempt to add to existing collection
coll, err = db.GetCollection(postCollAlias)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
// Show obfuscated "forbidden" response, as if attempting to add to an
// unowned blog.
r.Code = ErrForbiddenCollection.Status
r.ErrorMessage = ErrForbiddenCollection.Message
} else {
r.Code = err.Status
r.ErrorMessage = err.Message
}
} else {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "Unknown error occurred claiming post with collection"
}
r.ID = p.ID
res = append(res, r)
continue
}
if coll.OwnerID != userID {
r.Code = ErrForbiddenCollection.Status
r.ErrorMessage = ErrForbiddenCollection.Message
r.ID = p.ID
res = append(res, r)
continue
}
}
if p.Slug == "" {
p.Slug = p.ID
}
if canCollect {
// User already owns this post, so just add it to the given
// collection.
query = "UPDATE posts SET collection_id = ?, slug = ? WHERE id = ? AND owner_id = ?"
params = []interface{}{coll.ID, p.Slug, p.ID, userID}
slugIdx = 1
} else {
query = "UPDATE posts SET owner_id = ?, collection_id = ?, slug = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
params = []interface{}{userID, coll.ID, p.Slug, p.ID, p.Token}
slugIdx = 2
}
} else {
query = "UPDATE posts SET owner_id = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
params = []interface{}{userID, p.ID, p.Token}
}
qRes, err = db.AttemptClaim(&p, query, params, slugIdx)
if err != nil {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "An unknown error occurred."
r.ID = p.ID
res = append(res, r)
log.Error("claimPosts (post %s): %v", p.ID, err)
continue
}
// Get full post information to return
var fullPost *PublicPost
if p.Token != "" {
fullPost, err = db.GetEditablePost(p.ID, p.Token)
} else {
fullPost, err = db.GetPost(p.ID, 0)
}
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
r.ID = p.ID
res = append(res, r)
continue
}
}
if fullPost.OwnerID.Int64 != userID {
r.Code = http.StatusConflict
r.ErrorMessage = "Post is already owned by someone else."
r.ID = p.ID
res = append(res, r)
continue
}
// Post was successfully claimed
r.Code = http.StatusOK
r.Post = fullPost
if coll != nil {
r.Post.Collection = &CollectionObj{Collection: *coll}
}
rowsAffected, _ := qRes.RowsAffected()
if rowsAffected == 0 {
// This was already claimed, but return 200
r.Code = http.StatusOK
}
res = append(res, r)
}
return &res, nil
}
func (db *datastore) UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error {
if pos <= 0 || pos > 20 {
pos = db.GetLastPinnedPostPos(collID) + 1
if pos == -1 {
pos = 1
}
}
var err error
if pinned {
_, err = db.Exec("UPDATE posts SET pinned_position = ? WHERE id = ?", pos, postID)
} else {
_, err = db.Exec("UPDATE posts SET pinned_position = NULL WHERE id = ?", postID)
}
if err != nil {
log.Error("Unable to update pinned post: %v", err)
return err
}
return nil
}
func (db *datastore) GetLastPinnedPostPos(collID int64) int64 {
var lastPos sql.NullInt64
err := db.QueryRow("SELECT MAX(pinned_position) FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL", collID).Scan(&lastPos)
switch {
case err == sql.ErrNoRows:
return -1
case err != nil:
log.Error("Failed selecting from posts: %v", err)
return -1
}
if !lastPos.Valid {
return -1
}
return lastPos.Int64
}
func (db *datastore) GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error) {
// FIXME: sqlite-backed instances don't include ellipsis on truncated titles
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
rows, err := db.Query("SELECT id, slug, title, "+db.clip("content", 80)+", pinned_position FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL "+timeCondition+" ORDER BY pinned_position ASC", coll.ID)
if err != nil {
log.Error("Failed selecting pinned posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve pinned posts."}
}
defer rows.Close()
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Title, &p.Content, &p.PinnedPosition)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
pp := p.processPost()
pp.Collection = coll
posts = append(posts, pp)
}
return &posts, nil
}
func (db *datastore) GetCollections(u *User, hostName string) (*[]Collection, error) {
rows, err := db.Query("SELECT id, alias, title, description, privacy, view_count FROM collections WHERE owner_id = ? ORDER BY id ASC", u.ID)
if err != nil {
log.Error("Failed selecting from collections: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user collections."}
}
defer rows.Close()
colls := []Collection{}
for rows.Next() {
c := Collection{}
err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
c.hostName = hostName
c.URL = c.CanonicalURL()
c.Public = c.IsPublic()
colls = append(colls, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &colls, nil
}
func (db *datastore) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) {
c, err := db.GetCollections(u, hostName)
if err != nil {
return nil, err
}
if len(*c) == 0 {
return nil, impart.HTTPError{http.StatusInternalServerError, "You don't seem to have any blogs; they might've moved to another account. Try logging out and logging into your other account."}
}
return c, nil
}
func (db *datastore) GetMeStats(u *User) userMeStats {
s := userMeStats{}
// User counts
colls, _ := db.GetUserCollectionCount(u.ID)
s.TotalCollections = colls
var articles, collPosts uint64
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NULL", u.ID).Scan(&articles)
if err != nil && err != sql.ErrNoRows {
log.Error("Couldn't get articles count for user %d: %v", u.ID, err)
}
s.TotalArticles = articles
err = db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NOT NULL", u.ID).Scan(&collPosts)
if err != nil && err != sql.ErrNoRows {
log.Error("Couldn't get coll posts count for user %d: %v", u.ID, err)
}
s.CollectionPosts = collPosts
return s
}
func (db *datastore) GetTotalCollections() (collCount int64, err error) {
err = db.QueryRow(`
SELECT COUNT(*)
FROM collections c
LEFT JOIN users u ON u.id = c.owner_id
WHERE u.status = 0`).Scan(&collCount)
if err != nil {
log.Error("Unable to fetch collections count: %v", err)
}
return
}
func (db *datastore) GetTotalPosts() (postCount int64, err error) {
err = db.QueryRow(`
SELECT COUNT(*)
FROM posts p
LEFT JOIN users u ON u.id = p.owner_id
WHERE u.status = 0`).Scan(&postCount)
if err != nil {
log.Error("Unable to fetch posts count: %v", err)
}
return
}
func (db *datastore) GetTopPosts(u *User, alias string) (*[]PublicPost, error) {
params := []interface{}{u.ID}
where := ""
if alias != "" {
where = " AND alias = ?"
params = append(params, alias)
}
rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user top posts."}
}
defer rows.Close()
posts := []PublicPost{}
var gotErr bool
for rows.Next() {
p := Post{}
c := Collection{}
var alias, title, description sql.NullString
var views sql.NullInt64
err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &alias, &title, &description, &views)
if err != nil {
log.Error("Failed scanning User.getPosts() row: %v", err)
gotErr = true
break
}
p.extractData()
pubPost := p.processPost()
if alias.Valid && alias.String != "" {
c.Alias = alias.String
c.Title = title.String
c.Description = description.String
c.Views = views.Int64
pubPost.Collection = &CollectionObj{Collection: c}
}
posts = append(posts, pubPost)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
if gotErr && len(posts) == 0 {
// There were a lot of errors
return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
}
return &posts, nil
}
func (db *datastore) GetAnonymousPosts(u *User) (*[]PublicPost, error) {
rows, err := db.Query("SELECT id, view_count, title, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC", u.ID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user anonymous posts."}
}
defer rows.Close()
posts := []PublicPost{}
for rows.Next() {
p := Post{}
err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetUserPosts(u *User) (*[]PublicPost, error) {
rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.created, p.updated, p.content, p.text_appearance, p.language, p.rtl, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON collection_id = c.id WHERE p.owner_id = ? ORDER BY created ASC", u.ID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."}
}
defer rows.Close()
posts := []PublicPost{}
var gotErr bool
for rows.Next() {
p := Post{}
c := Collection{}
var alias, title, description sql.NullString
var views sql.NullInt64
err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content, &p.Font, &p.Language, &p.RTL, &alias, &title, &description, &views)
if err != nil {
log.Error("Failed scanning User.getPosts() row: %v", err)
gotErr = true
break
}
p.extractData()
pubPost := p.processPost()
if alias.Valid && alias.String != "" {
c.Alias = alias.String
c.Title = title.String
c.Description = description.String
c.Views = views.Int64
pubPost.Collection = &CollectionObj{Collection: c}
}
posts = append(posts, pubPost)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
if gotErr && len(posts) == 0 {
// There were a lot of errors
return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
}
return &posts, nil
}
func (db *datastore) GetUserPostsCount(userID int64) int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ?", userID).Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting posts count for user %d: %v", userID, err)
return 0
}
return count
}
// ChangeSettings takes a User and applies the changes in the given
// userSettings, MODIFYING THE USER with successful changes.
func (db *datastore) ChangeSettings(app *App, u *User, s *userSettings) error {
var errPass error
q := query.NewUpdate()
// Update email if given
if s.Email != "" {
encEmail, err := data.Encrypt(app.keys.EmailKey, s.Email)
if err != nil {
log.Error("Couldn't encrypt email %s: %s\n", s.Email, err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to encrypt email address."}
}
q.SetBytes(encEmail, "email")
// Update the email if something goes awry updating the password
defer func() {
if errPass != nil {
db.UpdateEncryptedUserEmail(u.ID, encEmail)
}
}()
u.Email = zero.StringFrom(s.Email)
}
// Update username if given
var newUsername string
if s.Username != "" {
var ie *impart.HTTPError
newUsername, ie = getValidUsername(app, s.Username, u.Username)
if ie != nil {
// Username is invalid
return *ie
}
if !author.IsValidUsername(app.cfg, newUsername) {
// Ensure the username is syntactically correct.
return impart.HTTPError{http.StatusPreconditionFailed, "Username isn't valid."}
}
t, err := db.Begin()
if err != nil {
log.Error("Couldn't start username change transaction: %v", err)
return err
}
_, err = t.Exec("UPDATE users SET username = ? WHERE id = ?", newUsername, u.ID)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Unable to update users table: %v", err)
return ErrInternalGeneral
}
_, err = t.Exec("UPDATE collections SET alias = ? WHERE alias = ? AND owner_id = ?", newUsername, u.Username, u.ID)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Unable to update collection: %v", err)
return ErrInternalGeneral
}
// Keep track of name changes for redirection
db.RemoveCollectionRedirect(t, newUsername)
_, err = t.Exec("UPDATE collectionredirects SET new_alias = ? WHERE new_alias = ?", newUsername, u.Username)
if err != nil {
log.Error("Unable to update collectionredirects: %v", err)
}
_, err = t.Exec("INSERT INTO collectionredirects (prev_alias, new_alias) VALUES (?, ?)", u.Username, newUsername)
if err != nil {
log.Error("Unable to add new collectionredirect: %v", err)
}
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return err
}
u.Username = newUsername
}
// Update passphrase if given
if s.NewPass != "" {
// Check if user has already set a password
var err error
u.HasPass, err = db.IsUserPassSet(u.ID)
if err != nil {
errPass = impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data."}
return errPass
}
if u.HasPass {
// Check if currently-set password is correct
hashedPass := u.HashedPass
if len(hashedPass) == 0 {
authUser, err := db.GetUserForAuthByID(u.ID)
if err != nil {
errPass = err
return errPass
}
hashedPass = authUser.HashedPass
}
if !auth.Authenticated(hashedPass, []byte(s.OldPass)) {
errPass = impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
return errPass
}
}
hashedPass, err := auth.HashPass([]byte(s.NewPass))
if err != nil {
errPass = impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
return errPass
}
q.SetBytes(hashedPass, "password")
}
// WHERE values
q.Append(u.ID)
if q.Updates == "" {
if s.Username == "" {
return ErrPostNoUpdatableVals
}
// Nothing to update except username. That was successful, so return now.
return nil
}
res, err := db.Exec("UPDATE users SET "+q.Updates+" WHERE id = ?", q.Params...)
if err != nil {
log.Error("Unable to update collection: %v", err)
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM users WHERE id = ?", u.ID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedGeneral
case err != nil:
log.Error("Failed selecting from users: %v", err)
}
return nil
}
if s.NewPass != "" && !u.HasPass {
u.HasPass = true
}
return nil
}
func (db *datastore) ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error {
var dbPass []byte
err := db.QueryRow("SELECT password FROM users WHERE id = ?", userID).Scan(&dbPass)
switch {
case err == sql.ErrNoRows:
return ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password for change: %v", err)
return err
}
if !sudo && !auth.Authenticated(dbPass, []byte(curPass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
_, err = db.Exec("UPDATE users SET password = ? WHERE id = ?", hashedPass, userID)
if err != nil {
log.Error("Could not update passphrase: %v", err)
return err
}
return nil
}
func (db *datastore) RemoveCollectionRedirect(t *sql.Tx, alias string) error {
_, err := t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ?", alias)
if err != nil {
log.Error("Unable to delete from collectionredirects: %v", err)
return err
}
return nil
}
func (db *datastore) GetCollectionRedirect(alias string) (new string) {
row := db.QueryRow("SELECT new_alias FROM collectionredirects WHERE prev_alias = ?", alias)
err := row.Scan(&new)
if err != nil && err != sql.ErrNoRows {
log.Error("Failed selecting from collectionredirects: %v", err)
}
return
}
func (db *datastore) DeleteCollection(alias string, userID int64) error {
c := &Collection{Alias: alias}
var username string
row := db.QueryRow("SELECT username FROM users WHERE id = ?", userID)
err := row.Scan(&username)
if err != nil {
return err
}
// Ensure user isn't deleting their main blog
if alias == username {
return impart.HTTPError{http.StatusForbidden, "You cannot currently delete your primary blog."}
}
row = db.QueryRow("SELECT id FROM collections WHERE alias = ? AND owner_id = ?", alias, userID)
err = row.Scan(&c.ID)
switch {
case err == sql.ErrNoRows:
return impart.HTTPError{http.StatusNotFound, "Collection doesn't exist or you're not allowed to delete it."}
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return ErrInternalGeneral
}
t, err := db.Begin()
if err != nil {
return err
}
// Float all collection's posts
_, err = t.Exec("UPDATE posts SET collection_id = NULL WHERE collection_id = ? AND owner_id = ?", c.ID, userID)
if err != nil {
t.Rollback()
return err
}
// Remove redirects to or from this collection
_, err = t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ? OR new_alias = ?", alias, alias)
if err != nil {
t.Rollback()
return err
}
// Remove any optional collection password
_, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
return err
}
// Finally, delete collection itself
_, err = t.Exec("DELETE FROM collections WHERE id = ?", c.ID)
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
func (db *datastore) IsCollectionAttributeOn(id int64, attr string) bool {
var v string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SELECT value in isCollectionAttributeOn for attribute '%s': %v", attr, err)
return false
}
return v == "1"
}
func (db *datastore) CollectionHasAttribute(id int64, attr string) bool {
var dummy string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SELECT value in collectionHasAttribute for attribute '%s': %v", attr, err)
return false
}
return true
}
// DeleteAccount will delete the entire account for userID
func (db *datastore) DeleteAccount(userID int64) error {
// Get all collections
rows, err := db.Query("SELECT id, alias FROM collections WHERE owner_id = ?", userID)
if err != nil {
log.Error("Unable to get collections: %v", err)
return err
}
defer rows.Close()
colls := []Collection{}
var c Collection
for rows.Next() {
err = rows.Scan(&c.ID, &c.Alias)
if err != nil {
log.Error("Unable to scan collection cols: %v", err)
return err
}
colls = append(colls, c)
}
// Start transaction
t, err := db.Begin()
if err != nil {
log.Error("Unable to begin: %v", err)
return err
}
// Clean up all collection related information
var res sql.Result
for _, c := range colls {
// Delete tokens
res, err = t.Exec("DELETE FROM collectionattributes WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete attributes on %s: %v", c.Alias, err)
return err
}
rs, _ := res.RowsAffected()
log.Info("Deleted %d for %s from collectionattributes", rs, c.Alias)
// Remove any optional collection password
res, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete passwords on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionpasswords", rs, c.Alias)
// Remove redirects to this collection
res, err = t.Exec("DELETE FROM collectionredirects WHERE new_alias = ?", c.Alias)
if err != nil {
t.Rollback()
log.Error("Unable to delete redirects on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionredirects", rs, c.Alias)
// Remove any collection keys
res, err = t.Exec("DELETE FROM collectionkeys WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete keys on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionkeys", rs, c.Alias)
// TODO: federate delete collection
// Remove remote follows
res, err = t.Exec("DELETE FROM remotefollows WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete remote follows on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from remotefollows", rs, c.Alias)
}
// Delete collections
res, err = t.Exec("DELETE FROM collections WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete collections: %v", err)
return err
}
rs, _ := res.RowsAffected()
log.Info("Deleted %d from collections", rs)
// Delete tokens
res, err = t.Exec("DELETE FROM accesstokens WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete access tokens: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from accesstokens", rs)
// Delete user attributes
res, err = t.Exec("DELETE FROM oauth_users WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete oauth_users: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from oauth_users", rs)
// Delete posts
// TODO: should maybe get each row so we can federate a delete
// if so needs to be outside of transaction like collections
res, err = t.Exec("DELETE FROM posts WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete posts: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from posts", rs)
// Delete user attributes
res, err = t.Exec("DELETE FROM userattributes WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete attributes: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from userattributes", rs)
// Delete user invites
res, err = t.Exec("DELETE FROM userinvites WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete invites: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from userinvites", rs)
// Delete the user
res, err = t.Exec("DELETE FROM users WHERE id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete user: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from users", rs)
// Commit all changes to the database
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Unable to commit: %v", err)
return err
}
// TODO: federate delete actor
return nil
}
func (db *datastore) GetAPActorKeys(collectionID int64) ([]byte, []byte) {
var pub, priv []byte
err := db.QueryRow("SELECT public_key, private_key FROM collectionkeys WHERE collection_id = ?", collectionID).Scan(&pub, &priv)
switch {
case err == sql.ErrNoRows:
// Generate keys
pub, priv = activitypub.GenerateKeys()
_, err = db.Exec("INSERT INTO collectionkeys (collection_id, public_key, private_key) VALUES (?, ?, ?)", collectionID, pub, priv)
if err != nil {
log.Error("Unable to INSERT new activitypub keypair: %v", err)
return nil, nil
}
case err != nil:
log.Error("Couldn't SELECT collectionkeys: %v", err)
return nil, nil
}
return pub, priv
}
func (db *datastore) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error {
_, err := db.Exec("INSERT INTO userinvites (id, owner_id, max_uses, created, expires, inactive) VALUES (?, ?, ?, "+db.now()+", ?, 0)", id, userID, maxUses, expires)
return err
}
func (db *datastore) GetUserInvites(userID int64) (*[]Invite, error) {
rows, err := db.Query("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE owner_id = ? ORDER BY created DESC", userID)
if err != nil {
log.Error("Failed selecting from userinvites: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user invites."}
}
defer rows.Close()
is := []Invite{}
for rows.Next() {
i := Invite{}
err = rows.Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
is = append(is, i)
}
return &is, nil
}
func (db *datastore) GetUserInvite(id string) (*Invite, error) {
var i Invite
err := db.QueryRow("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE id = ?", id).Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
switch {
case err == sql.ErrNoRows, db.isIgnorableError(err):
return nil, impart.HTTPError{http.StatusNotFound, "Invite doesn't exist."}
case err != nil:
log.Error("Failed selecting invite: %v", err)
return nil, err
}
return &i, nil
}
// IsUsersInvite returns true if the user with ID created the invite with code
// and an error other than sql no rows, if any. Will return false in the event
// of an error.
func (db *datastore) IsUsersInvite(code string, userID int64) (bool, error) {
var id string
err := db.QueryRow("SELECT id FROM userinvites WHERE id = ? AND owner_id = ?", code, userID).Scan(&id)
if err != nil && err != sql.ErrNoRows {
log.Error("Failed selecting invite: %v", err)
return false, err
}
return id != "", nil
}
func (db *datastore) GetUsersInvitedCount(id string) int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM usersinvited WHERE invite_id = ?", id).Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting users invited count: %v", err)
return 0
}
return count
}
func (db *datastore) CreateInvitedUser(inviteID string, userID int64) error {
_, err := db.Exec("INSERT INTO usersinvited (invite_id, user_id) VALUES (?, ?)", inviteID, userID)
return err
}
func (db *datastore) GetInstancePages() ([]*instanceContent, error) {
return db.GetAllDynamicContent("page")
}
func (db *datastore) GetAllDynamicContent(t string) ([]*instanceContent, error) {
where := ""
params := []interface{}{}
if t != "" {
where = " WHERE content_type = ?"
params = append(params, t)
}
rows, err := db.Query("SELECT id, title, content, updated, content_type FROM appcontent"+where, params...)
if err != nil {
log.Error("Failed selecting from appcontent: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve instance pages."}
}
defer rows.Close()
pages := []*instanceContent{}
for rows.Next() {
c := &instanceContent{}
err = rows.Scan(&c.ID, &c.Title, &c.Content, &c.Updated, &c.Type)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
pages = append(pages, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return pages, nil
}
func (db *datastore) GetDynamicContent(id string) (*instanceContent, error) {
c := &instanceContent{
ID: id,
}
err := db.QueryRow("SELECT title, content, updated, content_type FROM appcontent WHERE id = ?", id).Scan(&c.Title, &c.Content, &c.Updated, &c.Type)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Couldn't SELECT FROM appcontent for id '%s': %v", id, err)
return nil, err
}
return c, nil
}
func (db *datastore) UpdateDynamicContent(id, title, content, contentType string) error {
var err error
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?)", id, title, content, contentType)
} else {
_, err = db.Exec("INSERT INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?) "+db.upsert("id")+" title = ?, content = ?, updated = "+db.now(), id, title, content, contentType, title, content)
}
if err != nil {
log.Error("Unable to INSERT appcontent for '%s': %v", id, err)
}
return err
}
func (db *datastore) GetAllUsers(page uint) (*[]User, error) {
limitStr := fmt.Sprintf("0, %d", adminUsersPerPage)
if page > 1 {
limitStr = fmt.Sprintf("%d, %d", (page-1)*adminUsersPerPage, adminUsersPerPage)
}
rows, err := db.Query("SELECT id, username, created, status FROM users ORDER BY created DESC LIMIT " + limitStr)
if err != nil {
log.Error("Failed selecting from users: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve all users."}
}
defer rows.Close()
users := []User{}
for rows.Next() {
u := User{}
err = rows.Scan(&u.ID, &u.Username, &u.Created, &u.Status)
if err != nil {
log.Error("Failed scanning GetAllUsers() row: %v", err)
break
}
users = append(users, u)
}
return &users, nil
}
func (db *datastore) GetAllUsersCount() int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM users").Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting all users count: %v", err)
return 0
}
return count
}
func (db *datastore) GetUserLastPostTime(id int64) (*time.Time, error) {
var t time.Time
err := db.QueryRow("SELECT created FROM posts WHERE owner_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Failed selecting last post time from posts: %v", err)
return nil, err
}
return &t, nil
}
// SetUserStatus changes a user's status in the database. see Users.UserStatus
func (db *datastore) SetUserStatus(id int64, status UserStatus) error {
_, err := db.Exec("UPDATE users SET status = ? WHERE id = ?", status, id)
if err != nil {
return fmt.Errorf("failed to update user status: %v", err)
}
return nil
}
func (db *datastore) GetCollectionLastPostTime(id int64) (*time.Time, error) {
var t time.Time
err := db.QueryRow("SELECT created FROM posts WHERE collection_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Failed selecting last post time from posts: %v", err)
return nil, err
}
return &t, nil
}
func (db *datastore) GenerateOAuthState(ctx context.Context, provider, clientID string) (string, error) {
state := store.Generate62RandomString(24)
_, err := db.ExecContext(ctx, "INSERT INTO oauth_client_states (state, provider, client_id, used, created_at) VALUES (?, ?, ?, FALSE, NOW())", state, provider, clientID)
if err != nil {
return "", fmt.Errorf("unable to record oauth client state: %w", err)
}
return state, nil
}
func (db *datastore) ValidateOAuthState(ctx context.Context, state string) (string, string, error) {
var provider string
var clientID string
err := wf_db.RunTransactionWithOptions(ctx, db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
err := tx.QueryRow("SELECT provider, client_id FROM oauth_client_states WHERE state = ? AND used = FALSE", state).Scan(&provider, &clientID)
if err != nil {
return err
}
res, err := tx.ExecContext(ctx, "UPDATE oauth_client_states SET used = TRUE WHERE state = ?", state)
if err != nil {
return err
}
rowsAffected, err := res.RowsAffected()
if err != nil {
return err
}
if rowsAffected != 1 {
return fmt.Errorf("state not found")
}
return nil
})
if err != nil {
return "", "", nil
}
return provider, clientID, nil
}
func (db *datastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error {
var err error
if db.driverName == driverSQLite {
_, err = db.ExecContext(ctx, "INSERT OR REPLACE INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?)", localUserID, remoteUserID, provider, clientID, accessToken)
} else {
_, err = db.ExecContext(ctx, "INSERT INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?) "+db.upsert("user")+" access_token = ?", localUserID, remoteUserID, provider, clientID, accessToken, accessToken)
}
if err != nil {
log.Error("Unable to INSERT oauth_users for '%d': %v", localUserID, err)
}
return err
}
// GetIDForRemoteUser returns a user ID associated with a remote user ID.
func (db *datastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) {
var userID int64 = -1
err := db.
QueryRowContext(ctx, "SELECT user_id FROM oauth_users WHERE remote_user_id = ? AND provider = ? AND client_id = ?", remoteUserID, provider, clientID).
Scan(&userID)
// Not finding a record is OK.
if err != nil && err != sql.ErrNoRows {
return -1, err
}
return userID, nil
}
// DatabaseInitialized returns whether or not the current datastore has been
// initialized with the correct schema.
// Currently, it checks to see if the `users` table exists.
func (db *datastore) DatabaseInitialized() bool {
var dummy string
var err error
if db.driverName == driverSQLite {
err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = 'users'").Scan(&dummy)
} else {
err = db.QueryRow("SHOW TABLES LIKE 'users'").Scan(&dummy)
}
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SHOW TABLES: %v", err)
return false
}
return true
}
func stringLogln(log *string, s string, v ...interface{}) {
*log += fmt.Sprintf(s+"\n", v...)
}
func handleFailedPostInsert(err error) error {
log.Error("Couldn't insert into posts: %v", err)
return err
}
func (db *datastore) GetProfilePageFromHandle(app *App, handle string) (string, error) {
actorIRI := ""
remoteUser, err := getRemoteUserFromHandle(app, handle)
if err != nil {
// can't find using handle in the table but the table may already have this user without
// handle from a previous version
// TODO: Make this determination. We should know whether a user exists without a handle, or doesn't exist at all
actorIRI = RemoteLookup(handle)
_, errRemoteUser := getRemoteUser(app, actorIRI)
// if it exists then we need to update the handle
if errRemoteUser == nil {
_, err := app.db.Exec("UPDATE remoteusers SET handle = ? WHERE actor_id = ?", handle, actorIRI)
if err != nil {
log.Error("Can't update handle (" + handle + ") in database for user " + actorIRI)
}
} else {
// this probably means we don't have the user in the table so let's try to insert it
// here we need to ask the server for the inboxes
remoteActor, err := activityserve.NewRemoteActor(actorIRI)
if err != nil {
log.Error("Couldn't fetch remote actor", err)
}
if debugging {
log.Info("%s %s %s %s", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
}
_, err = app.db.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, handle) VALUES(?, ?, ?, ?)", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
if err != nil {
log.Error("Can't insert remote user in database", err)
return "", err
}
}
} else {
actorIRI = remoteUser.ActorID
}
return actorIRI, nil
}
diff --git a/errors.go b/errors.go
index 1da713a..b62fc9e 100644
--- a/errors.go
+++ b/errors.go
@@ -1,58 +1,58 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"net/http"
"github.com/writeas/impart"
)
// Commonly returned HTTP errors
var (
ErrBadFormData = impart.HTTPError{http.StatusBadRequest, "Expected valid form data."}
ErrBadJSON = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON object."}
ErrBadJSONArray = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON array."}
ErrBadAccessToken = impart.HTTPError{http.StatusUnauthorized, "Invalid access token."}
ErrNoAccessToken = impart.HTTPError{http.StatusBadRequest, "Authorization token required."}
ErrNotLoggedIn = impart.HTTPError{http.StatusUnauthorized, "Not logged in."}
ErrForbiddenCollection = impart.HTTPError{http.StatusForbidden, "You don't have permission to add to this collection."}
ErrForbiddenEditPost = impart.HTTPError{http.StatusForbidden, "You don't have permission to update this post."}
ErrUnauthorizedEditPost = impart.HTTPError{http.StatusUnauthorized, "Invalid editing credentials."}
ErrUnauthorizedGeneral = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to do that."}
ErrBadRequestedType = impart.HTTPError{http.StatusNotAcceptable, "Bad requested Content-Type."}
ErrCollectionUnauthorizedRead = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to access this collection."}
ErrNoPublishableContent = impart.HTTPError{http.StatusBadRequest, "Supply something to publish."}
ErrInternalGeneral = impart.HTTPError{http.StatusInternalServerError, "The humans messed something up. They've been notified."}
ErrInternalCookieSession = impart.HTTPError{http.StatusInternalServerError, "Could not get cookie session."}
ErrCollectionNotFound = impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
ErrCollectionGone = impart.HTTPError{http.StatusGone, "This blog was unpublished."}
ErrCollectionPageNotFound = impart.HTTPError{http.StatusNotFound, "Collection page doesn't exist."}
ErrPostNotFound = impart.HTTPError{Status: http.StatusNotFound, Message: "Post not found."}
ErrPostBanned = impart.HTTPError{Status: http.StatusGone, Message: "Post removed."}
ErrPostUnpublished = impart.HTTPError{Status: http.StatusGone, Message: "Post unpublished by author."}
ErrPostFetchError = impart.HTTPError{Status: http.StatusInternalServerError, Message: "We encountered an error getting the post. The humans have been alerted."}
ErrUserNotFound = impart.HTTPError{http.StatusNotFound, "User doesn't exist."}
ErrRemoteUserNotFound = impart.HTTPError{http.StatusNotFound, "Remote user not found."}
ErrUserNotFoundEmail = impart.HTTPError{http.StatusNotFound, "Please enter your username instead of your email address."}
- ErrUserSuspended = impart.HTTPError{http.StatusForbidden, "Account is silenced."}
+ ErrUserSilenced = impart.HTTPError{http.StatusForbidden, "Account is silenced."}
)
// Post operation errors
var (
ErrPostNoUpdatableVals = impart.HTTPError{http.StatusBadRequest, "Supply some properties to update."}
)
diff --git a/feed.go b/feed.go
index 44bb331..4e1f612 100644
--- a/feed.go
+++ b/feed.go
@@ -1,121 +1,121 @@
/*
* Copyright © 2018-2019 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"fmt"
"net/http"
"time"
. "github.com/gorilla/feeds"
"github.com/gorilla/mux"
stripmd "github.com/writeas/go-strip-markdown"
"github.com/writeas/web-core/log"
)
func ViewFeed(app *App, w http.ResponseWriter, req *http.Request) error {
alias := collectionAliasFromReq(req)
// Display collection if this is a collection
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return nil
}
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view feed: get user: %v", err)
return ErrInternalGeneral
}
- if suspended {
+ if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if c.IsPrivate() || c.IsProtected() {
return ErrCollectionNotFound
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := &DisplayCollection{CollectionObj: &CollectionObj{Collection: *c}}
if c.PublicOwner {
u, err := app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
coll.Owner = u
}
}
tag := mux.Vars(req)["tag"]
if tag != "" {
coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, 1, false)
} else {
coll.Posts, _ = app.db.GetPosts(app.cfg, c, 1, false, true, false)
}
author := ""
if coll.Owner != nil {
author = coll.Owner.Username
}
collectionTitle := coll.DisplayTitle()
if tag != "" {
collectionTitle = tag + " &mdash; " + collectionTitle
}
baseUrl := coll.CanonicalURL()
basePermalinkUrl := baseUrl
siteURL := baseUrl
if tag != "" {
siteURL += "tag:" + tag
}
feed := &Feed{
Title: collectionTitle,
Link: &Link{Href: siteURL},
Description: coll.Description,
Author: &Author{author, ""},
Created: time.Now(),
}
var title, permalink string
for _, p := range *coll.Posts {
title = p.PlainDisplayTitle()
permalink = fmt.Sprintf("%s%s", baseUrl, p.Slug.String)
feed.Items = append(feed.Items, &Item{
Id: fmt.Sprintf("%s%s", basePermalinkUrl, p.Slug.String),
Title: title,
Link: &Link{Href: permalink},
Description: "<![CDATA[" + stripmd.Strip(p.Content) + "]]>",
Content: applyMarkdown([]byte(p.Content), "", app.cfg),
Author: &Author{author, ""},
Created: p.Created,
Updated: p.Updated,
})
}
rss, err := feed.ToRss()
if err != nil {
return err
}
fmt.Fprint(w, rss)
return nil
}
diff --git a/invites.go b/invites.go
index e39ec3b..d5d024a 100644
--- a/invites.go
+++ b/invites.go
@@ -1,186 +1,186 @@
/*
* Copyright © 2019 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"html/template"
"net/http"
"strconv"
"time"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/nerds/store"
"github.com/writeas/web-core/log"
"github.com/writeas/writefreely/page"
)
type Invite struct {
ID string
MaxUses sql.NullInt64
Created time.Time
Expires *time.Time
Inactive bool
uses int64
}
func (i Invite) Uses() int64 {
return i.uses
}
func (i Invite) Expired() bool {
return i.Expires != nil && i.Expires.Before(time.Now())
}
func (i Invite) ExpiresFriendly() string {
return i.Expires.Format("January 2, 2006, 3:04 PM")
}
func handleViewUserInvites(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
// Don't show page if instance doesn't allow it
if !(app.cfg.App.UserInvites != "" && (u.IsAdmin() || app.cfg.App.UserInvites != "admin")) {
return impart.HTTPError{http.StatusNotFound, ""}
}
f, _ := getSessionFlashes(app, w, r, nil)
p := struct {
*UserPage
- Invites *[]Invite
- Suspended bool
+ Invites *[]Invite
+ Silenced bool
}{
UserPage: NewUserPage(app, r, u, "Invite People", f),
}
var err error
- p.Suspended, err = app.db.IsUserSuspended(u.ID)
+ p.Silenced, err = app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view invites: %v", err)
}
p.Invites, err = app.db.GetUserInvites(u.ID)
if err != nil {
return err
}
for i := range *p.Invites {
(*p.Invites)[i].uses = app.db.GetUsersInvitedCount((*p.Invites)[i].ID)
}
showUserPage(w, "invite", p)
return nil
}
func handleCreateUserInvite(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
muVal := r.FormValue("uses")
expVal := r.FormValue("expires")
if u.IsSilenced() {
- return ErrUserSuspended
+ return ErrUserSilenced
}
var err error
var maxUses int
if muVal != "0" {
maxUses, err = strconv.Atoi(muVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'max_uses'"}
}
}
var expDate *time.Time
var expires int
if expVal != "0" {
expires, err = strconv.Atoi(expVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'expires'"}
}
ed := time.Now().Add(time.Duration(expires) * time.Minute)
expDate = &ed
}
inviteID := store.GenerateRandomString("0123456789BCDFGHJKLMNPQRSTVWXYZbcdfghjklmnpqrstvwxyz", 6)
err = app.db.CreateUserInvite(inviteID, u.ID, maxUses, expDate)
if err != nil {
return err
}
return impart.HTTPError{http.StatusFound, "/me/invites"}
}
func handleViewInvite(app *App, w http.ResponseWriter, r *http.Request) error {
inviteCode := mux.Vars(r)["code"]
i, err := app.db.GetUserInvite(inviteCode)
if err != nil {
return err
}
expired := i.Expired()
if !expired && i.MaxUses.Valid && i.MaxUses.Int64 > 0 {
// Invite has a max-use number, so check if we're past that limit
i.uses = app.db.GetUsersInvitedCount(inviteCode)
expired = i.uses >= i.MaxUses.Int64
}
if u := getUserSession(app, r); u != nil {
// check if invite belongs to another user
// error can be ignored as not important in this case
if ownInvite, _ := app.db.IsUsersInvite(inviteCode, u.ID); !ownInvite {
addSessionFlash(app, w, r, "You're already registered and logged in.", nil)
// show homepage
return impart.HTTPError{http.StatusFound, "/me/settings"}
}
// show invite instructions
p := struct {
*UserPage
Invite *Invite
Expired bool
}{
UserPage: NewUserPage(app, r, u, "Invite to "+app.cfg.App.SiteName, nil),
Invite: i,
Expired: expired,
}
showUserPage(w, "invite-help", p)
return nil
}
p := struct {
page.StaticPage
Error string
Flashes []template.HTML
Invite string
}{
StaticPage: pageForReq(app, r),
Invite: inviteCode,
}
if expired {
p.Error = "This invite link has expired."
}
// Get error messages
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session in handleViewInvite; ignoring: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
// Show landing page
return renderPage(w, "signup.tmpl", p)
}
diff --git a/pad.go b/pad.go
index 3b0f1c2..0354cd3 100644
--- a/pad.go
+++ b/pad.go
@@ -1,188 +1,188 @@
/*
* Copyright © 2018-2019 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"net/http"
"strings"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"github.com/writeas/writefreely/page"
)
func handleViewPad(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
action := vars["action"]
slug := vars["slug"]
collAlias := vars["collection"]
if app.cfg.App.SingleUser {
// TODO: refactor all of this, especially for single-user blogs
c, err := app.db.GetCollectionByID(1)
if err != nil {
return err
}
collAlias = c.Alias
}
appData := &struct {
page.StaticPage
- Post *RawPost
- User *User
- Blogs *[]Collection
- Suspended bool
+ Post *RawPost
+ User *User
+ Blogs *[]Collection
+ Silenced bool
Editing bool // True if we're modifying an existing post
EditCollection *Collection // Collection of the post we're editing, if any
}{
StaticPage: pageForReq(app, r),
Post: &RawPost{Font: "norm"},
User: getUserSession(app, r),
}
var err error
if appData.User != nil {
appData.Blogs, err = app.db.GetPublishableCollections(appData.User, app.cfg.App.Host)
if err != nil {
log.Error("Unable to get user's blogs for Pad: %v", err)
}
- appData.Suspended, err = app.db.IsUserSuspended(appData.User.ID)
+ appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID)
if err != nil {
- log.Error("Unable to get users suspension status for Pad: %v", err)
+ log.Error("Unable to get user status for Pad: %v", err)
}
}
padTmpl := app.cfg.App.Editor
if templates[padTmpl] == nil {
if padTmpl != "" {
log.Info("No template '%s' found. Falling back to default 'pad' template.", padTmpl)
}
padTmpl = "pad"
}
if action == "" && slug == "" {
// Not editing any post; simply render the Pad
if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil {
log.Error("Unable to execute template: %v", err)
}
return nil
}
// Retrieve post information for editing
appData.Editing = true
// Make sure this isn't cached, so user doesn't accidentally lose data
w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT")
if slug != "" {
// TODO: refactor all of this, especially for single-user blogs
appData.Post = getRawCollectionPost(app, slug, collAlias)
if appData.Post.OwnerID != appData.User.ID {
// TODO: add ErrForbiddenEditPost message to flashes
return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/edit")]}
}
appData.EditCollection, err = app.db.GetCollectionForPad(collAlias)
if err != nil {
return err
}
appData.EditCollection.hostName = app.cfg.App.Host
} else {
// Editing a floating article
appData.Post = getRawPost(app, action)
appData.Post.Id = action
}
if appData.Post.Gone {
return ErrPostUnpublished
} else if appData.Post.Found && appData.Post.Content != "" {
// Got the post
} else if appData.Post.Found {
return ErrPostFetchError
} else {
return ErrPostNotFound
}
if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil {
log.Error("Unable to execute template: %v", err)
}
return nil
}
func handleViewMeta(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
action := vars["action"]
slug := vars["slug"]
collAlias := vars["collection"]
appData := &struct {
page.StaticPage
Post *RawPost
User *User
EditCollection *Collection // Collection of the post we're editing, if any
Flashes []string
NeedsToken bool
- Suspended bool
+ Silenced bool
}{
StaticPage: pageForReq(app, r),
Post: &RawPost{Font: "norm"},
User: getUserSession(app, r),
}
var err error
- appData.Suspended, err = app.db.IsUserSuspended(appData.User.ID)
+ appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID)
if err != nil {
- log.Error("view meta: get user suspended status: %v", err)
+ log.Error("view meta: get user status: %v", err)
return ErrInternalGeneral
}
if action == "" && slug == "" {
return ErrPostNotFound
}
// Make sure this isn't cached, so user doesn't accidentally lose data
w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
w.Header().Set("Expires", "Thu, 28 Jul 1989 12:00:00 GMT")
if slug != "" {
appData.Post = getRawCollectionPost(app, slug, collAlias)
if appData.Post.OwnerID != appData.User.ID {
// TODO: add ErrForbiddenEditPost message to flashes
return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/meta")]}
}
if app.cfg.App.SingleUser {
// TODO: optimize this query just like we do in GetCollectionForPad (?)
appData.EditCollection, err = app.db.GetCollectionByID(1)
} else {
appData.EditCollection, err = app.db.GetCollectionForPad(collAlias)
}
if err != nil {
return err
}
appData.EditCollection.hostName = app.cfg.App.Host
} else {
// Editing a floating article
appData.Post = getRawPost(app, action)
appData.Post.Id = action
}
appData.NeedsToken = appData.User == nil || appData.User.ID != appData.Post.OwnerID
if appData.Post.Gone {
return ErrPostUnpublished
} else if appData.Post.Found && appData.Post.Content != "" {
// Got the post
} else if appData.Post.Found {
return ErrPostFetchError
} else {
return ErrPostNotFound
}
appData.Flashes, _ = getSessionFlashes(app, w, r, nil)
if err = templates["edit-meta"].ExecuteTemplate(w, "edit-meta", appData); err != nil {
log.Error("Unable to execute template: %v", err)
}
return nil
}
diff --git a/posts.go b/posts.go
index a918531..a0e4588 100644
--- a/posts.go
+++ b/posts.go
@@ -1,1562 +1,1562 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"fmt"
"html/template"
"net/http"
"regexp"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/guregu/null"
"github.com/guregu/null/zero"
"github.com/kylemcc/twitter-text-go/extract"
"github.com/microcosm-cc/bluemonday"
stripmd "github.com/writeas/go-strip-markdown"
"github.com/writeas/impart"
"github.com/writeas/monday"
"github.com/writeas/slug"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/bots"
"github.com/writeas/web-core/converter"
"github.com/writeas/web-core/i18n"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/tags"
"github.com/writeas/writefreely/page"
"github.com/writeas/writefreely/parse"
)
const (
// Post ID length bounds
minIDLen = 10
maxIDLen = 10
userPostIDLen = 10
postIDLen = 10
postMetaDateFormat = "2006-01-02 15:04:05"
)
type (
AnonymousPost struct {
ID string
Content string
HTMLContent template.HTML
Font string
Language string
Direction string
Title string
GenTitle string
Description string
Author string
Views int64
IsPlainText bool
IsCode bool
IsLinkable bool
}
AuthenticatedPost struct {
ID string `json:"id" schema:"id"`
Web bool `json:"web" schema:"web"`
*SubmittedPost
}
// SubmittedPost represents a post supplied by a client for publishing or
// updating. Since Title and Content can be updated to "", they are
// pointers that can be easily tested to detect changes.
SubmittedPost struct {
Slug *string `json:"slug" schema:"slug"`
Title *string `json:"title" schema:"title"`
Content *string `json:"body" schema:"body"`
Font string `json:"font" schema:"font"`
IsRTL converter.NullJSONBool `json:"rtl" schema:"rtl"`
Language converter.NullJSONString `json:"lang" schema:"lang"`
Created *string `json:"created" schema:"created"`
}
// Post represents a post as found in the database.
Post struct {
ID string `db:"id" json:"id"`
Slug null.String `db:"slug" json:"slug,omitempty"`
Font string `db:"text_appearance" json:"appearance"`
Language zero.String `db:"language" json:"language"`
RTL zero.Bool `db:"rtl" json:"rtl"`
Privacy int64 `db:"privacy" json:"-"`
OwnerID null.Int `db:"owner_id" json:"-"`
CollectionID null.Int `db:"collection_id" json:"-"`
PinnedPosition null.Int `db:"pinned_position" json:"-"`
Created time.Time `db:"created" json:"created"`
Updated time.Time `db:"updated" json:"updated"`
ViewCount int64 `db:"view_count" json:"-"`
Title zero.String `db:"title" json:"title"`
HTMLTitle template.HTML `db:"title" json:"-"`
Content string `db:"content" json:"body"`
HTMLContent template.HTML `db:"content" json:"-"`
HTMLExcerpt template.HTML `db:"content" json:"-"`
Tags []string `json:"tags"`
Images []string `json:"images,omitempty"`
OwnerName string `json:"owner,omitempty"`
}
// PublicPost holds properties for a publicly returned post, i.e. a post in
// a context where the viewer may not be the owner. As such, sensitive
// metadata for the post is hidden and properties supporting the display of
// the post are added.
PublicPost struct {
*Post
IsSubdomain bool `json:"-"`
IsTopLevel bool `json:"-"`
DisplayDate string `json:"-"`
Views int64 `json:"views"`
Owner *PublicUser `json:"-"`
IsOwner bool `json:"-"`
Collection *CollectionObj `json:"collection,omitempty"`
}
RawPost struct {
Id, Slug string
Title string
Content string
Views int64
Font string
Created time.Time
IsRTL sql.NullBool
Language sql.NullString
OwnerID int64
CollectionID sql.NullInt64
Found bool
Gone bool
}
AnonymousAuthPost struct {
ID string `json:"id"`
Token string `json:"token"`
}
ClaimPostRequest struct {
*AnonymousAuthPost
CollectionAlias string `json:"collection"`
CreateCollection bool `json:"create_collection"`
// Generated properties
Slug string `json:"-"`
}
ClaimPostResult struct {
ID string `json:"id,omitempty"`
Code int `json:"code,omitempty"`
ErrorMessage string `json:"error_msg,omitempty"`
Post *PublicPost `json:"post,omitempty"`
}
)
func (p *Post) Direction() string {
if p.RTL.Valid {
if p.RTL.Bool {
return "rtl"
}
return "ltr"
}
return "auto"
}
// DisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) DisplayTitle() string {
if p.Title.String != "" {
return p.Title.String
}
t := friendlyPostTitle(p.Content, p.ID)
return t
}
// PlainDisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) PlainDisplayTitle() string {
if t := stripmd.Strip(p.DisplayTitle()); t != "" {
return t
}
return p.ID
}
// FormattedDisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) FormattedDisplayTitle() template.HTML {
if p.HTMLTitle != "" {
return p.HTMLTitle
}
return template.HTML(p.DisplayTitle())
}
// Summary gives a shortened summary of the post based on the post's title,
// especially for display in a longer list of posts. It extracts a summary for
// posts in the Title\n\nBody format, returning nothing if the entire was short
// enough that the extracted title == extracted summary.
func (p Post) Summary() string {
if p.Content == "" {
return ""
}
// Strip out HTML
p.Content = bluemonday.StrictPolicy().Sanitize(p.Content)
// and Markdown
p.Content = stripmd.Strip(p.Content)
title := p.Title.String
var desc string
if title == "" {
// No title, so generate one
title = friendlyPostTitle(p.Content, p.ID)
desc = postDescription(p.Content, title, p.ID)
if desc == title {
return ""
}
return desc
}
return shortPostDescription(p.Content)
}
func (p Post) SummaryHTML() template.HTML {
return template.HTML(p.Summary())
}
// Excerpt shows any text that comes before a (more) tag.
// TODO: use HTMLExcerpt in templates instead of this method
func (p *Post) Excerpt() template.HTML {
return p.HTMLExcerpt
}
func (p *Post) CreatedDate() string {
return p.Created.Format("2006-01-02")
}
func (p *Post) Created8601() string {
return p.Created.Format("2006-01-02T15:04:05Z")
}
func (p *Post) IsScheduled() bool {
return p.Created.After(time.Now())
}
func (p *Post) HasTag(tag string) bool {
// Regexp looks for tag and has a non-capturing group at the end looking
// for the end of the word.
// Assisted by: https://stackoverflow.com/a/35192941/1549194
hasTag, _ := regexp.MatchString("#"+tag+`(?:[[:punct:]]|\s|\z)`, p.Content)
return hasTag
}
func (p *Post) HasTitleLink() bool {
if p.Title.String == "" {
return false
}
hasLink, _ := regexp.MatchString(`([^!]+|^)\[.+\]\(.+\)`, p.Title.String)
return hasLink
}
func handleViewPost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
friendlyID := vars["post"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw() and viewCollectionPost()
isJSON := strings.HasSuffix(friendlyID, ".json")
isXML := strings.HasSuffix(friendlyID, ".xml")
isCSS := strings.HasSuffix(friendlyID, ".css")
isMarkdown := strings.HasSuffix(friendlyID, ".md")
isRaw := strings.HasSuffix(friendlyID, ".txt") || isJSON || isXML || isCSS || isMarkdown
// Display reserved page if that is requested resource
if t, ok := pages[r.URL.Path[1:]+".tmpl"]; ok {
return handleTemplatedPage(app, w, r, t)
} else if (strings.Contains(r.URL.Path, ".") && !isRaw && !isMarkdown) || r.URL.Path == "/robots.txt" || r.URL.Path == "/manifest.json" {
// Serve static file
app.shttp.ServeHTTP(w, r)
return nil
}
// Display collection if this is a collection
c, _ := app.db.GetCollection(friendlyID)
if c != nil {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", friendlyID)}
}
// Normalize the URL, redirecting user to consistent post URL
if friendlyID != strings.ToLower(friendlyID) {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s", strings.ToLower(friendlyID))}
}
ext := ""
if isRaw {
parts := strings.Split(friendlyID, ".")
friendlyID = parts[0]
if len(parts) > 1 {
ext = "." + parts[1]
}
}
var ownerID sql.NullInt64
var title string
var content string
var font string
var language []byte
var rtl []byte
var views int64
var post *AnonymousPost
var found bool
var gone bool
fixedID := slug.Make(friendlyID)
if fixedID != friendlyID {
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/%s%s", fixedID, ext)}
}
err := app.db.QueryRow(fmt.Sprintf("SELECT owner_id, title, content, text_appearance, view_count, language, rtl FROM posts WHERE id = ?"), friendlyID).Scan(&ownerID, &title, &content, &font, &views, &language, &rtl)
switch {
case err == sql.ErrNoRows:
found = false
// Output the error in the correct format
if isJSON {
content = "{\"error\": \"Post not found.\"}"
} else if isRaw {
content = "Post not found."
} else {
return ErrPostNotFound
}
case err != nil:
found = false
log.Error("Post loading err: %s\n", err)
return ErrInternalGeneral
default:
found = true
var d string
if len(rtl) == 0 {
d = "auto"
} else if rtl[0] == 49 {
// TODO: find a cleaner way to get this (possibly NULL) value
d = "rtl"
} else {
d = "ltr"
}
generatedTitle := friendlyPostTitle(content, friendlyID)
sanitizedContent := content
if font != "code" {
sanitizedContent = template.HTMLEscapeString(content)
}
var desc string
if title == "" {
desc = postDescription(content, title, friendlyID)
} else {
desc = shortPostDescription(content)
}
post = &AnonymousPost{
ID: friendlyID,
Content: sanitizedContent,
Title: title,
GenTitle: generatedTitle,
Description: desc,
Author: "",
Font: font,
IsPlainText: isRaw,
IsCode: font == "code",
IsLinkable: font != "code",
Views: views,
Language: string(language),
Direction: d,
}
if !isRaw {
post.HTMLContent = template.HTML(applyMarkdown([]byte(content), "", app.cfg))
}
}
- var suspended bool
+ var silenced bool
if found {
- suspended, err = app.db.IsUserSuspended(ownerID.Int64)
+ silenced, err = app.db.IsUserSilenced(ownerID.Int64)
if err != nil {
log.Error("view post: %v", err)
}
}
// Check if post has been unpublished
if content == "" {
gone = true
if isJSON {
content = "{\"error\": \"Post was unpublished.\"}"
} else if isCSS {
content = ""
} else if isRaw {
content = "Post was unpublished."
} else {
return ErrPostUnpublished
}
}
var u = &User{}
if isRaw {
contentType := "text/plain"
if isJSON {
contentType = "application/json"
} else if isCSS {
contentType = "text/css"
} else if isXML {
contentType = "application/xml"
} else if isMarkdown {
contentType = "text/markdown"
}
w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
if isMarkdown && post.Title != "" {
fmt.Fprintf(w, "%s\n", post.Title)
for i := 1; i <= len(post.Title); i++ {
fmt.Fprintf(w, "=")
}
fmt.Fprintf(w, "\n\n")
}
fmt.Fprint(w, content)
if !found {
return ErrPostNotFound
} else if gone {
return ErrPostUnpublished
}
} else {
var err error
page := struct {
*AnonymousPost
page.StaticPage
- Username string
- IsOwner bool
- SiteURL string
- Suspended bool
+ Username string
+ IsOwner bool
+ SiteURL string
+ Silenced bool
}{
AnonymousPost: post,
StaticPage: pageForReq(app, r),
SiteURL: app.cfg.App.Host,
}
if u = getUserSession(app, r); u != nil {
page.Username = u.Username
page.IsOwner = ownerID.Valid && ownerID.Int64 == u.ID
}
- if !page.IsOwner && suspended {
+ if !page.IsOwner && silenced {
return ErrPostNotFound
}
- page.Suspended = suspended
+ page.Silenced = silenced
err = templates["post"].ExecuteTemplate(w, "post", page)
if err != nil {
log.Error("Post template execute error: %v", err)
}
}
go func() {
if u != nil && ownerID.Valid && ownerID.Int64 == u.ID {
// Post is owned by someone; skip view increment since that person is viewing this post.
return
}
// Update stats for non-raw post views
if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE id = ?", friendlyID)
if err != nil {
log.Error("Unable to update posts count: %v", err)
}
}
}()
return nil
}
// API v2 funcs
// newPost creates a new post with or without an owning Collection.
//
// Endpoints:
// /posts
// /posts?collection={alias}
// ? /collections/{alias}/posts
func newPost(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
collAlias := vars["alias"]
if collAlias == "" {
collAlias = r.FormValue("collection")
}
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
// TODO: remove this
accessToken = r.FormValue("access_token")
}
// FIXME: determine web submission with Content-Type header
var u *User
var userID int64 = -1
var username string
if accessToken == "" {
u = getUserSession(app, r)
if u != nil {
userID = u.ID
username = u.Username
}
} else {
userID = app.db.GetUserID(accessToken)
}
- suspended, err := app.db.IsUserSuspended(userID)
+ silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("new post: %v", err)
}
- if suspended {
- return ErrUserSuspended
+ if silenced {
+ return ErrUserSilenced
}
if userID == -1 {
return ErrNotLoggedIn
}
if accessToken == "" && u == nil && collAlias != "" {
return impart.HTTPError{http.StatusBadRequest, "Parameter `access_token` required."}
}
// Get post data
var p *SubmittedPost
if reqJSON {
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&p)
if err != nil {
log.Error("Couldn't parse new post JSON request: %v\n", err)
return ErrBadJSON
}
if p.Title == nil {
t := ""
p.Title = &t
}
if strings.TrimSpace(*(p.Content)) == "" {
return ErrNoPublishableContent
}
} else {
post := r.FormValue("body")
appearance := r.FormValue("font")
title := r.FormValue("title")
rtlValue := r.FormValue("rtl")
langValue := r.FormValue("lang")
if strings.TrimSpace(post) == "" {
return ErrNoPublishableContent
}
var isRTL, rtlValid bool
if rtlValue == "auto" && langValue != "" {
isRTL = i18n.LangIsRTL(langValue)
rtlValid = true
} else {
isRTL = rtlValue == "true"
rtlValid = rtlValue != "" && langValue != ""
}
// Create a new post
p = &SubmittedPost{
Title: &title,
Content: &post,
Font: appearance,
IsRTL: converter.NullJSONBool{sql.NullBool{Bool: isRTL, Valid: rtlValid}},
Language: converter.NullJSONString{sql.NullString{String: langValue, Valid: langValue != ""}},
}
}
if !p.isFontValid() {
p.Font = "norm"
}
var newPost *PublicPost = &PublicPost{}
var coll *Collection
if accessToken != "" {
newPost, err = app.db.CreateOwnedPost(p, accessToken, collAlias, app.cfg.App.Host)
} else {
//return ErrNotLoggedIn
// TODO: verify user is logged in
var collID int64
if collAlias != "" {
coll, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
coll.hostName = app.cfg.App.Host
if coll.OwnerID != u.ID {
return ErrForbiddenCollection
}
collID = coll.ID
}
// TODO: return PublicPost from createPost
newPost.Post, err = app.db.CreatePost(userID, collID, p)
}
if err != nil {
return err
}
if coll != nil {
coll.ForPublic()
newPost.Collection = &CollectionObj{Collection: *coll}
}
newPost.extractData()
newPost.OwnerName = username
// Write success now
response := impart.WriteSuccess(w, newPost, http.StatusCreated)
if newPost.Collection != nil && !app.cfg.App.Private && app.cfg.App.Federation && !newPost.Created.After(time.Now()) {
go federatePost(app, newPost, newPost.Collection.ID, false)
}
return response
}
func existingPost(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
postID := vars["post"]
p := AuthenticatedPost{ID: postID}
var err error
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&p)
if err != nil {
log.Error("Couldn't parse post update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err = r.ParseForm()
if err != nil {
log.Error("Couldn't parse post update form request: %v\n", err)
return ErrBadFormData
}
// Can't decode to a nil SubmittedPost property, so create instance now
p.SubmittedPost = &SubmittedPost{}
err = app.formDecoder.Decode(&p, r.PostForm)
if err != nil {
log.Error("Couldn't decode post update form request: %v\n", err)
return ErrBadFormData
}
}
if p.Web {
p.IsRTL.Valid = true
}
if p.SubmittedPost == nil {
return ErrPostNoUpdatableVals
}
// Ensure an access token was given
accessToken := r.Header.Get("Authorization")
// Get user's cookie session if there's no token
var u *User
//var username string
if accessToken == "" {
u = getUserSession(app, r)
if u != nil {
//username = u.Username
}
}
if u == nil && accessToken == "" {
return ErrNoAccessToken
}
// Get user ID from current session or given access token, if one was given.
var userID int64
if u != nil {
userID = u.ID
} else if accessToken != "" {
userID, err = AuthenticateUser(app.db, accessToken)
if err != nil {
return err
}
}
- suspended, err := app.db.IsUserSuspended(userID)
+ silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("existing post: %v", err)
}
- if suspended {
- return ErrUserSuspended
+ if silenced {
+ return ErrUserSilenced
}
// Modify post struct
p.ID = postID
err = app.db.UpdateOwnedPost(&p, userID)
if err != nil {
if reqJSON {
return err
}
if err, ok := err.(impart.HTTPError); ok {
addSessionFlash(app, w, r, err.Message, nil)
} else {
addSessionFlash(app, w, r, err.Error(), nil)
}
}
var pRes *PublicPost
pRes, err = app.db.GetPost(p.ID, 0)
if reqJSON {
if err != nil {
return err
}
pRes.extractData()
}
if pRes.CollectionID.Valid {
coll, err := app.db.GetCollectionBy("id = ?", pRes.CollectionID.Int64)
if err == nil && !app.cfg.App.Private && app.cfg.App.Federation {
coll.hostName = app.cfg.App.Host
pRes.Collection = &CollectionObj{Collection: *coll}
go federatePost(app, pRes, pRes.Collection.ID, true)
}
}
// Write success now
if reqJSON {
return impart.WriteSuccess(w, pRes, http.StatusOK)
}
addSessionFlash(app, w, r, "Changes saved.", nil)
collectionAlias := vars["alias"]
redirect := "/" + postID + "/meta"
if collectionAlias != "" {
collPre := "/" + collectionAlias
if app.cfg.App.SingleUser {
collPre = ""
}
redirect = collPre + "/" + pRes.Slug.String + "/edit/meta"
} else {
if app.cfg.App.SingleUser {
redirect = "/d" + redirect
}
}
w.Header().Set("Location", redirect)
w.WriteHeader(http.StatusFound)
return nil
}
func deletePost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
friendlyID := vars["post"]
editToken := r.FormValue("token")
var ownerID int64
var u *User
accessToken := r.Header.Get("Authorization")
if accessToken == "" && editToken == "" {
u = getUserSession(app, r)
if u == nil {
return ErrNoAccessToken
}
}
var res sql.Result
var t *sql.Tx
var err error
var collID sql.NullInt64
var coll *Collection
var pp *PublicPost
if editToken != "" {
// TODO: SELECT owner_id, as well, and return appropriate error if NULL instead of running two queries
var dummy int64
err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ?", friendlyID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return impart.HTTPError{http.StatusNotFound, "Post not found."}
}
err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND owner_id IS NULL", friendlyID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
// Post already has an owner. This could provide a bad experience
// for the user, but it's more important to ensure data isn't lost
// unexpectedly. So prevent deletion via token.
return impart.HTTPError{http.StatusConflict, "This post belongs to some user (hopefully yours). Please log in and delete it from that user's account."}
}
res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND modify_token = ? AND owner_id IS NULL", friendlyID, editToken)
} else if accessToken != "" || u != nil {
// Caller provided some way to authenticate; assume caller expects the
// post to be deleted based on a specific post owner, thus we should
// return corresponding errors.
if accessToken != "" {
ownerID = app.db.GetUserID(accessToken)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
ownerID = u.ID
}
// TODO: don't make two queries
var realOwnerID sql.NullInt64
err = app.db.QueryRow("SELECT collection_id, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&collID, &realOwnerID)
if err != nil {
return err
}
if !collID.Valid {
// There's no collection; simply delete the post
res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
} else {
// Post belongs to a collection; do any additional clean up
coll, err = app.db.GetCollectionBy("id = ?", collID.Int64)
if err != nil {
log.Error("Unable to get collection: %v", err)
return err
}
if app.cfg.App.Federation {
// First fetch full post for federation
pp, err = app.db.GetOwnedPost(friendlyID, ownerID)
if err != nil {
log.Error("Unable to get owned post: %v", err)
return err
}
collObj := &CollectionObj{Collection: *coll}
pp.Collection = collObj
}
t, err = app.db.Begin()
if err != nil {
log.Error("No begin: %v", err)
return err
}
res, err = t.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
}
} else {
return impart.HTTPError{http.StatusBadRequest, "No authenticated user or post token given."}
}
if err != nil {
return err
}
affected, err := res.RowsAffected()
if err != nil {
if t != nil {
t.Rollback()
log.Error("Rows affected err! Rolling back")
}
return err
} else if affected == 0 {
if t != nil {
t.Rollback()
log.Error("No rows affected! Rolling back")
}
return impart.HTTPError{http.StatusForbidden, "Post not found, or you're not the owner."}
}
if t != nil {
t.Commit()
}
if coll != nil && !app.cfg.App.Private && app.cfg.App.Federation {
go deleteFederatedPost(app, pp, collID.Int64)
}
return impart.HTTPError{Status: http.StatusNoContent}
}
// addPost associates a post with the authenticated user.
func addPost(app *App, w http.ResponseWriter, r *http.Request) error {
var ownerID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
ownerID = app.db.GetUserID(at)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
ownerID = u.ID
}
- suspended, err := app.db.IsUserSuspended(ownerID)
+ silenced, err := app.db.IsUserSilenced(ownerID)
if err != nil {
log.Error("add post: %v", err)
}
- if suspended {
- return ErrUserSuspended
+ if silenced {
+ return ErrUserSilenced
}
// Parse claimed posts in format:
// [{"id": "...", "token": "..."}]
var claims *[]ClaimPostRequest
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&claims)
if err != nil {
return ErrBadJSONArray
}
vars := mux.Vars(r)
collAlias := vars["alias"]
// Update all given posts
res, err := app.db.ClaimPosts(app.cfg, ownerID, collAlias, claims)
if err != nil {
return err
}
if !app.cfg.App.Private && app.cfg.App.Federation {
for _, pRes := range *res {
if pRes.Code != http.StatusOK {
continue
}
if !pRes.Post.Created.After(time.Now()) {
pRes.Post.Collection.hostName = app.cfg.App.Host
go federatePost(app, pRes.Post, pRes.Post.Collection.ID, false)
}
}
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
func dispersePost(app *App, w http.ResponseWriter, r *http.Request) error {
var ownerID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
ownerID = app.db.GetUserID(at)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
ownerID = u.ID
}
// Parse posts in format:
// ["..."]
var postIDs []string
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&postIDs)
if err != nil {
return ErrBadJSONArray
}
// Update all given posts
res, err := app.db.DispersePosts(ownerID, postIDs)
if err != nil {
return err
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
type (
PinPostResult struct {
ID string `json:"id,omitempty"`
Code int `json:"code,omitempty"`
ErrorMessage string `json:"error_msg,omitempty"`
}
)
// pinPost pins a post to a blog
func pinPost(app *App, w http.ResponseWriter, r *http.Request) error {
var userID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
userID = app.db.GetUserID(at)
if userID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
userID = u.ID
}
- suspended, err := app.db.IsUserSuspended(userID)
+ silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("pin post: %v", err)
}
- if suspended {
- return ErrUserSuspended
+ if silenced {
+ return ErrUserSilenced
}
// Parse request
var posts []struct {
ID string `json:"id"`
Position int64 `json:"position"`
}
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&posts)
if err != nil {
return ErrBadJSONArray
}
// Validate data
vars := mux.Vars(r)
collAlias := vars["alias"]
coll, err := app.db.GetCollection(collAlias)
if err != nil {
return err
}
if coll.OwnerID != userID {
return ErrForbiddenCollection
}
// Do (un)pinning
isPinning := r.URL.Path[strings.LastIndex(r.URL.Path, "/"):] == "/pin"
res := []PinPostResult{}
for _, p := range posts {
err = app.db.UpdatePostPinState(isPinning, p.ID, coll.ID, userID, p.Position)
ppr := PinPostResult{ID: p.ID}
if err != nil {
ppr.Code = http.StatusInternalServerError
// TODO: set error messsage
} else {
ppr.Code = http.StatusOK
}
res = append(res, ppr)
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
func fetchPost(app *App, w http.ResponseWriter, r *http.Request) error {
var collID int64
var coll *Collection
var err error
vars := mux.Vars(r)
if collAlias := vars["alias"]; collAlias != "" {
// Fetch collection information, since an alias is provided
coll, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
collID = coll.ID
}
p, err := app.db.GetPost(vars["post"], collID)
if err != nil {
return err
}
if coll == nil && p.CollectionID.Valid {
// Collection post is getting fetched by post ID, not coll alias + post slug, so get coll info now.
coll, err = app.db.GetCollectionByID(p.CollectionID.Int64)
if err != nil {
return err
}
}
if coll != nil {
coll.hostName = app.cfg.App.Host
_, err = apiCheckCollectionPermissions(app, r, coll)
if err != nil {
return err
}
}
- suspended, err := app.db.IsUserSuspended(p.OwnerID.Int64)
+ silenced, err := app.db.IsUserSilenced(p.OwnerID.Int64)
if err != nil {
log.Error("fetch post: %v", err)
}
- if suspended {
+ if silenced {
return ErrPostNotFound
}
p.extractData()
accept := r.Header.Get("Accept")
if strings.Contains(accept, "application/activity+json") {
if coll == nil {
// This is a draft post; 404 for now
// TODO: return ActivityObject
return impart.HTTPError{http.StatusNotFound, ""}
}
p.Collection = &CollectionObj{Collection: *coll}
po := p.ActivityObject(app)
po.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, po, http.StatusOK)
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func fetchPostProperty(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
p, err := app.db.GetPostProperty(vars["post"], 0, vars["property"])
if err != nil {
return err
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func (p *Post) processPost() PublicPost {
res := &PublicPost{Post: p, Views: 0}
res.Views = p.ViewCount
// TODO: move to own function
loc := monday.FuzzyLocale(p.Language.String)
res.DisplayDate = monday.Format(p.Created, monday.LongFormatsByLocale[loc], loc)
return *res
}
func (p *PublicPost) CanonicalURL(hostName string) string {
if p.Collection == nil || p.Collection.Alias == "" {
return hostName + "/" + p.ID
}
return p.Collection.CanonicalURL() + p.Slug.String
}
func (p *PublicPost) ActivityObject(app *App) *activitystreams.Object {
cfg := app.cfg
o := activitystreams.NewArticleObject()
o.ID = p.Collection.FederatedAPIBase() + "api/posts/" + p.ID
o.Published = p.Created
o.URL = p.CanonicalURL(cfg.App.Host)
o.AttributedTo = p.Collection.FederatedAccount()
o.CC = []string{
p.Collection.FederatedAccount() + "/followers",
}
o.Name = p.DisplayTitle()
if p.HTMLContent == template.HTML("") {
p.formatContent(cfg, false)
}
o.Content = string(p.HTMLContent)
if p.Language.Valid {
o.ContentMap = map[string]string{
p.Language.String: string(p.HTMLContent),
}
}
if len(p.Tags) == 0 {
o.Tag = []activitystreams.Tag{}
} else {
var tagBaseURL string
if isSingleUser {
tagBaseURL = p.Collection.CanonicalURL() + "tag:"
} else {
if cfg.App.Chorus {
tagBaseURL = fmt.Sprintf("%s/read/t/", p.Collection.hostName)
} else {
tagBaseURL = fmt.Sprintf("%s/%s/tag:", p.Collection.hostName, p.Collection.Alias)
}
}
for _, t := range p.Tags {
o.Tag = append(o.Tag, activitystreams.Tag{
Type: activitystreams.TagHashtag,
HRef: tagBaseURL + t,
Name: "#" + t,
})
}
}
// Find mentioned users
mentionedUsers := make(map[string]string)
stripper := bluemonday.StrictPolicy()
content := stripper.Sanitize(p.Content)
mentionRegex := regexp.MustCompile(`@[A-Za-z0-9._%+-]+@[A-Za-z0-9.-]+\.[A-Za-z]+\b`)
mentions := mentionRegex.FindAllString(content, -1)
for _, handle := range mentions {
actorIRI, err := app.db.GetProfilePageFromHandle(app, handle)
if err != nil {
log.Info("Can't find this user either in the database nor in the remote instance")
return nil
}
mentionedUsers[handle] = actorIRI
}
for handle, iri := range mentionedUsers {
o.CC = append(o.CC, iri)
o.Tag = append(o.Tag, activitystreams.Tag{Type: "Mention", HRef: iri, Name: handle})
}
return o
}
// TODO: merge this into getSlugFromPost or phase it out
func getSlug(title, lang string) string {
return getSlugFromPost("", title, lang)
}
func getSlugFromPost(title, body, lang string) string {
if title == "" {
title = postTitle(body, body)
}
title = parse.PostLede(title, false)
// Truncate lede if needed
title, _ = parse.TruncToWord(title, 80)
var s string
if lang != "" && len(lang) == 2 {
s = slug.MakeLang(title, lang)
} else {
s = slug.Make(title)
}
// Transliteration may cause the slug to expand past the limit, so truncate again
s, _ = parse.TruncToWord(s, 80)
return strings.TrimFunc(s, func(r rune) bool {
// TruncToWord doesn't respect words in a slug, since spaces are replaced
// with hyphens. So remove any trailing hyphens.
return r == '-'
})
}
// isFontValid returns whether or not the submitted post's appearance is valid.
func (p *SubmittedPost) isFontValid() bool {
validFonts := map[string]bool{
"norm": true,
"sans": true,
"mono": true,
"wrap": true,
"code": true,
}
_, valid := validFonts[p.Font]
return valid
}
func getRawPost(app *App, friendlyID string) *RawPost {
var content, font, title string
var isRTL sql.NullBool
var lang sql.NullString
var ownerID sql.NullInt64
var created time.Time
err := app.db.QueryRow("SELECT title, content, text_appearance, language, rtl, created, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&title, &content, &font, &lang, &isRTL, &created, &ownerID)
switch {
case err == sql.ErrNoRows:
return &RawPost{Content: "", Found: false, Gone: false}
case err != nil:
return &RawPost{Content: "", Found: true, Gone: false}
}
return &RawPost{Title: title, Content: content, Font: font, Created: created, IsRTL: isRTL, Language: lang, OwnerID: ownerID.Int64, Found: true, Gone: content == ""}
}
// TODO; return a Post!
func getRawCollectionPost(app *App, slug, collAlias string) *RawPost {
var id, title, content, font string
var isRTL sql.NullBool
var lang sql.NullString
var created time.Time
var ownerID null.Int
var views int64
var err error
if app.cfg.App.SingleUser {
err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, owner_id FROM posts WHERE slug = ? AND collection_id = 1", slug).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &ownerID)
} else {
err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, owner_id FROM posts WHERE slug = ? AND collection_id = (SELECT id FROM collections WHERE alias = ?)", slug, collAlias).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &ownerID)
}
switch {
case err == sql.ErrNoRows:
return &RawPost{Content: "", Found: false, Gone: false}
case err != nil:
return &RawPost{Content: "", Found: true, Gone: false}
}
return &RawPost{
Id: id,
Slug: slug,
Title: title,
Content: content,
Font: font,
Created: created,
IsRTL: isRTL,
Language: lang,
OwnerID: ownerID.Int64,
Found: true,
Gone: content == "",
Views: views,
}
}
func isRaw(r *http.Request) bool {
vars := mux.Vars(r)
slug := vars["slug"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw in viewCollectionPost() and handleViewPost()
isJSON := strings.HasSuffix(slug, ".json")
isXML := strings.HasSuffix(slug, ".xml")
isMarkdown := strings.HasSuffix(slug, ".md")
return strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown
}
func viewCollectionPost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw() and handleViewPost()
isJSON := strings.HasSuffix(slug, ".json")
isXML := strings.HasSuffix(slug, ".xml")
isMarkdown := strings.HasSuffix(slug, ".md")
isRaw := strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
// Check for hellbanned users
u, err := checkUserForCollection(app, cr, r, true)
if err != nil {
return err
}
// Normalize the URL, redirecting user to consistent post URL
if slug != strings.ToLower(slug) {
loc := fmt.Sprintf("/%s", strings.ToLower(slug))
if !app.cfg.App.SingleUser {
loc = "/" + cr.alias + loc
}
return impart.HTTPError{http.StatusMovedPermanently, loc}
}
// Display collection if this is a collection
var c *Collection
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(cr.alias)
}
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
// Redirect if necessary
newAlias := app.db.GetCollectionRedirect(cr.alias)
if newAlias != "" {
return impart.HTTPError{http.StatusFound, "/" + newAlias + "/" + slug}
}
}
}
return err
}
c.hostName = app.cfg.App.Host
- suspended, err := app.db.IsUserSuspended(c.OwnerID)
+ silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view collection post: %v", err)
}
// Check collection permissions
if c.IsPrivate() && (u == nil || u.ID != c.OwnerID) {
return ErrPostNotFound
}
if c.IsProtected() && (u == nil || u.ID != c.OwnerID) {
- if suspended {
+ if silenced {
return ErrPostNotFound
} else if !isAuthorizedForCollection(app, c.Alias, r) {
return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/?g=" + slug}
}
}
cr.isCollOwner = u != nil && c.OwnerID == u.ID
if isRaw {
slug = strings.Split(slug, ".")[0]
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := NewCollectionObj(c)
owner, err := app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
coll.Owner = owner
}
postFound := true
p, err := app.db.GetPost(slug, coll.ID)
if err != nil {
if err == ErrCollectionPageNotFound {
postFound = false
if slug == "feed" {
// User tried to access blog feed without a trailing slash, and
// there's no post with a slug "feed"
return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/feed/"}
}
po := &Post{
Slug: null.NewString(slug, true),
Font: "norm",
Language: zero.NewString("en", true),
RTL: zero.NewBool(false, true),
Content: `<p class="msg">This page is missing.</p>
Are you sure it was ever here?`,
}
pp := po.processPost()
p = &pp
} else {
return err
}
}
p.IsOwner = owner != nil && p.OwnerID.Valid && owner.ID == p.OwnerID.Int64
p.Collection = coll
p.IsTopLevel = app.cfg.App.SingleUser
- if !p.IsOwner && suspended {
+ if !p.IsOwner && silenced {
return ErrPostNotFound
}
// Check if post has been unpublished
if p.Content == "" && p.Title.String == "" {
return impart.HTTPError{http.StatusGone, "Post was unpublished."}
}
// Serve collection post
if isRaw {
contentType := "text/plain"
if isJSON {
contentType = "application/json"
} else if isXML {
contentType = "application/xml"
} else if isMarkdown {
contentType = "text/markdown"
}
w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
if !postFound {
w.WriteHeader(http.StatusNotFound)
fmt.Fprintf(w, "Post not found.")
// TODO: return error instead, so status is correctly reflected in logs
return nil
}
if isMarkdown && p.Title.String != "" {
fmt.Fprintf(w, "# %s\n\n", p.Title.String)
}
fmt.Fprint(w, p.Content)
} else if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
if !postFound {
return ErrCollectionPageNotFound
}
p.extractData()
ap := p.ActivityObject(app)
ap.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ap, http.StatusOK)
} else {
p.extractData()
p.Content = strings.Replace(p.Content, "<!--more-->", "", 1)
// TODO: move this to function
p.formatContent(app.cfg, cr.isCollOwner)
tp := struct {
*PublicPost
page.StaticPage
IsOwner bool
IsPinned bool
IsCustomDomain bool
PinnedPosts *[]PublicPost
IsFound bool
IsAdmin bool
CanInvite bool
- Suspended bool
+ Silenced bool
}{
PublicPost: p,
StaticPage: pageForReq(app, r),
IsOwner: cr.isCollOwner,
IsCustomDomain: cr.isCustomDomain,
IsFound: postFound,
- Suspended: suspended,
+ Silenced: silenced,
}
tp.IsAdmin = u != nil && u.IsAdmin()
tp.CanInvite = canUserInvite(app.cfg, tp.IsAdmin)
tp.PinnedPosts, _ = app.db.GetPinnedPosts(coll, p.IsOwner)
tp.IsPinned = len(*tp.PinnedPosts) > 0 && PostsContains(tp.PinnedPosts, p)
if !postFound {
w.WriteHeader(http.StatusNotFound)
}
postTmpl := "collection-post"
if app.cfg.App.Chorus {
postTmpl = "chorus-collection-post"
}
if err := templates[postTmpl].ExecuteTemplate(w, "post", tp); err != nil {
log.Error("Error in collection-post template: %v", err)
}
}
go func() {
if p.OwnerID.Valid {
// Post is owned by someone. Don't update stats if owner is viewing the post.
if u != nil && p.OwnerID.Int64 == u.ID {
return
}
}
// Update stats for non-raw post views
if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE slug = ? AND collection_id = ?", slug, coll.ID)
if err != nil {
log.Error("Unable to update posts count: %v", err)
}
}
}()
return nil
}
// TODO: move this to utils after making it more generic
func PostsContains(sl *[]PublicPost, s *PublicPost) bool {
for _, e := range *sl {
if e.ID == s.ID {
return true
}
}
return false
}
func (p *Post) extractData() {
p.Tags = tags.Extract(p.Content)
p.extractImages()
}
func (rp *RawPost) UserFacingCreated() string {
return rp.Created.Format(postMetaDateFormat)
}
func (rp *RawPost) Created8601() string {
return rp.Created.Format("2006-01-02T15:04:05Z")
}
var imageURLRegex = regexp.MustCompile(`(?i)^https?:\/\/[^ ]*\.(gif|png|jpg|jpeg|image)$`)
func (p *Post) extractImages() {
matches := extract.ExtractUrls(p.Content)
urls := map[string]bool{}
for i := range matches {
u := matches[i].Text
if !imageURLRegex.MatchString(u) {
continue
}
urls[u] = true
}
resURLs := make([]string, 0)
for k := range urls {
resURLs = append(resURLs, k)
}
p.Images = resURLs
}
diff --git a/templates.go b/templates.go
index 968845d..c15c79b 100644
--- a/templates.go
+++ b/templates.go
@@ -1,201 +1,201 @@
/*
* Copyright © 2018 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"html/template"
"io"
"io/ioutil"
"net/http"
"os"
"path/filepath"
"strings"
"github.com/dustin/go-humanize"
"github.com/writeas/web-core/l10n"
"github.com/writeas/web-core/log"
"github.com/writeas/writefreely/config"
)
var (
templates = map[string]*template.Template{}
pages = map[string]*template.Template{}
userPages = map[string]*template.Template{}
funcMap = template.FuncMap{
"largeNumFmt": largeNumFmt,
"pluralize": pluralize,
"isRTL": isRTL,
"isLTR": isLTR,
"localstr": localStr,
"localhtml": localHTML,
"tolower": strings.ToLower,
}
)
const (
templatesDir = "templates"
pagesDir = "pages"
)
func showUserPage(w http.ResponseWriter, name string, obj interface{}) {
if obj == nil {
log.Error("showUserPage: data is nil!")
return
}
if err := userPages[filepath.Join("user", name+".tmpl")].ExecuteTemplate(w, name, obj); err != nil {
log.Error("Error parsing %s: %v", name, err)
}
}
func initTemplate(parentDir, name string) {
if debugging {
log.Info(" " + filepath.Join(parentDir, templatesDir, name+".tmpl"))
}
files := []string{
filepath.Join(parentDir, templatesDir, name+".tmpl"),
filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "base.tmpl"),
- filepath.Join(parentDir, templatesDir, "user", "include", "suspended.tmpl"),
+ filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
}
if name == "collection" || name == "collection-tags" || name == "chorus-collection" {
// These pages list out collection posts, so we also parse templatesDir + "include/posts.tmpl"
files = append(files, filepath.Join(parentDir, templatesDir, "include", "posts.tmpl"))
}
if name == "chorus-collection" || name == "chorus-collection-post" {
files = append(files, filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"))
}
if name == "collection" || name == "collection-tags" || name == "collection-post" || name == "post" || name == "chorus-collection" || name == "chorus-collection-post" {
files = append(files, filepath.Join(parentDir, templatesDir, "include", "post-render.tmpl"))
}
templates[name] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...))
}
func initPage(parentDir, path, key string) {
if debugging {
log.Info(" [%s] %s", key, path)
}
pages[key] = template.Must(template.New("").Funcs(funcMap).ParseFiles(
path,
filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "base.tmpl"),
- filepath.Join(parentDir, templatesDir, "user", "include", "suspended.tmpl"),
+ filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
))
}
func initUserPage(parentDir, path, key string) {
if debugging {
log.Info(" [%s] %s", key, path)
}
userPages[key] = template.Must(template.New(key).Funcs(funcMap).ParseFiles(
path,
filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "footer.tmpl"),
- filepath.Join(parentDir, templatesDir, "user", "include", "suspended.tmpl"),
+ filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
))
}
// InitTemplates loads all template files from the configured parent dir.
func InitTemplates(cfg *config.Config) error {
log.Info("Loading templates...")
tmplFiles, err := ioutil.ReadDir(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir))
if err != nil {
return err
}
for _, f := range tmplFiles {
if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
parts := strings.Split(f.Name(), ".")
key := parts[0]
initTemplate(cfg.Server.TemplatesParentDir, key)
}
}
log.Info("Loading pages...")
// Initialize all static pages that use the base template
filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, pagesDir), func(path string, i os.FileInfo, err error) error {
if !i.IsDir() && !strings.HasPrefix(i.Name(), ".") {
key := i.Name()
initPage(cfg.Server.PagesParentDir, path, key)
}
return nil
})
log.Info("Loading user pages...")
// Initialize all user pages that use base templates
filepath.Walk(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir, "user"), func(path string, f os.FileInfo, err error) error {
if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
corePath := path
if cfg.Server.TemplatesParentDir != "" {
corePath = corePath[len(cfg.Server.TemplatesParentDir)+1:]
}
parts := strings.Split(corePath, string(filepath.Separator))
key := f.Name()
if len(parts) > 2 {
key = filepath.Join(parts[1], f.Name())
}
initUserPage(cfg.Server.TemplatesParentDir, path, key)
}
return nil
})
return nil
}
// renderPage retrieves the given template and renders it to the given io.Writer.
// If something goes wrong, the error is logged and returned.
func renderPage(w io.Writer, tmpl string, data interface{}) error {
err := pages[tmpl].ExecuteTemplate(w, "base", data)
if err != nil {
log.Error("%v", err)
}
return err
}
func largeNumFmt(n int64) string {
return humanize.Comma(n)
}
func pluralize(singular, plural string, n int64) string {
if n == 1 {
return singular
}
return plural
}
func isRTL(d string) bool {
return d == "rtl"
}
func isLTR(d string) bool {
return d == "ltr" || d == "auto"
}
func localStr(term, lang string) string {
s := l10n.Strings(lang)[term]
if s == "" {
s = l10n.Strings("")[term]
}
return s
}
func localHTML(term, lang string) template.HTML {
s := l10n.Strings(lang)[term]
if s == "" {
s = l10n.Strings("")[term]
}
s = strings.Replace(s, "write.as", "<a href=\"https://writefreely.org\">writefreely</a>", 1)
return template.HTML(s)
}
diff --git a/templates/chorus-collection-post.tmpl b/templates/chorus-collection-post.tmpl
index f88e334..0418767 100644
--- a/templates/chorus-collection-post.tmpl
+++ b/templates/chorus-collection-post.tmpl
@@ -1,144 +1,144 @@
{{define "post"}}<!DOCTYPE HTML>
<html {{if .Language.Valid}}lang="{{.Language.String}}"{{end}} dir="{{.Direction}}">
<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
<meta charset="utf-8">
<title>{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{.Collection.DisplayTitle}}</title>
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<link rel="shortcut icon" href="/favicon.ico" />
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<link rel="canonical" href="{{.CanonicalURL .Host}}" />
<meta name="generator" content="WriteFreely">
<meta name="title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
<meta name="description" content="{{.Summary}}">
{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
<meta name="author" content="{{.Collection.Title}}" />
<meta itemprop="description" content="{{.Summary}}">
<meta itemprop="datePublished" content="{{.CreatedDate}}" />
<meta name="twitter:card" content="summary">
<meta name="twitter:description" content="{{.Summary}}">
<meta name="twitter:title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
{{if gt (len .Images) 0}}<meta name="twitter:image" content="{{index .Images 0}}">{{else}}<meta name="twitter:image" content="{{.Collection.AvatarURL}}">{{end}}
<meta property="og:title" content="{{.PlainDisplayTitle}}" />
<meta property="og:description" content="{{.Summary}}" />
<meta property="og:site_name" content="{{.Collection.DisplayTitle}}" />
<meta property="og:type" content="article" />
<meta property="og:url" content="{{.CanonicalURL .Host}}" />
<meta property="og:updated_time" content="{{.Created8601}}" />
{{range .Images}}<meta property="og:image" content="{{.}}" />{{else}}<meta property="og:image" content="{{.Collection.AvatarURL}}">{{end}}
<meta property="article:published_time" content="{{.Created8601}}">
{{if .Collection.StyleSheet}}<style type="text/css">{{.Collection.StyleSheetDisplay}}</style>{{end}}
<style type="text/css">
body footer {
max-width: 40rem;
margin: 0 auto;
}
body#post header {
padding: 1em 1rem;
}
</style>
{{if .Collection.RenderMathJax}}
<!-- Add mathjax logic -->
{{template "mathjax" . }}
{{end}}
<!-- Add highlighting logic -->
{{template "highlighting" .}}
</head>
<body id="post">
<div id="overlay"></div>
{{template "user-navigation" .}}
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<article id="post-body" class="{{.Font}} h-entry">{{if .IsScheduled}}<p class="badge">Scheduled</p>{{end}}{{if .Title.String}}<h2 id="title" class="p-name{{if $.Collection.Format.ShowDates}} dated{{end}}">{{.FormattedDisplayTitle}}</h2>{{end}}{{if $.Collection.Format.ShowDates}}<time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}">{{.DisplayDate}}</time>{{end}}<div class="e-content">{{.HTMLContent}}</div></article>
{{ if .Collection.ShowFooterBranding }}
<footer dir="ltr">
<p style="text-align: left">Published by <a rel="author" href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a>
{{ if .IsOwner }} &middot; <span class="views" dir="ltr"><strong>{{largeNumFmt .Views}}</strong> {{pluralize "view" "views" .Views}}</span>
&middot; <a class="xtra-feature" href="/{{if not .SingleUser}}{{.Collection.Alias}}/{{end}}{{.Slug.String}}/edit" dir="{{.Direction}}">Edit</a>
{{if .IsPinned}} &middot; <a class="xtra-feature unpin" href="/{{.Collection.Alias}}/{{.Slug.String}}/unpin" dir="{{.Direction}}" onclick="unpinPost(event, '{{.ID}}')">Unpin</a>{{end}}
{{ end }}
</p>
<nav>
{{if .PinnedPosts}}
{{range .PinnedPosts}}<a class="pinned{{if eq .Slug.String $.Slug.String}} selected{{end}}" href="{{if not $.SingleUser}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}
{{end}}
</nav>
<hr>
<nav><p style="font-size: 0.9em">{{localhtml "published with write.as" .Language.String}}</p></nav>
</footer>
{{ end }}
</body>
{{if .Collection.CanShowScript}}
{{range .Collection.ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
{{if .Collection.Script}}<script type="text/javascript">{{.Collection.ScriptDisplay}}</script>{{end}}
{{end}}
<script src="/js/localdate.js"></script>
<script type="text/javascript">
var pinning = false;
function unpinPost(e, postID) {
e.preventDefault();
if (pinning) {
return;
}
pinning = true;
var $footer = document.getElementsByTagName('footer')[0];
var callback = function() {
// Hide current page
var $pinnedNavLink = $footer.getElementsByTagName('nav')[0].querySelector('.pinned.selected');
$pinnedNavLink.style.display = 'none';
};
var $pinBtn = $footer.getElementsByClassName('unpin')[0];
$pinBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Collection.Alias}}/unpin";
var params = [ { "id": postID } ];
http.open("POST", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
pinning = false;
if (http.status == 200) {
callback();
$pinBtn.style.display = 'none';
$pinBtn.innerHTML = 'Pin';
} else if (http.status == 409) {
$pinBtn.innerHTML = 'Unpin';
} else {
$pinBtn.innerHTML = 'Unpin';
alert("Failed to unpin." + (http.status>=500?" Please try again.":""));
}
}
}
http.send(JSON.stringify(params));
};
try { // Fonts
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
(function() {
var wf = document.createElement('script');
wf.src = '/js/webfont.js';
wf.type = 'text/javascript';
wf.async = 'true';
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) { /* ¯\_(ツ)_/¯ */ }
</script>
</html>{{end}}
diff --git a/templates/chorus-collection.tmpl b/templates/chorus-collection.tmpl
index f555c2f..1f89471 100644
--- a/templates/chorus-collection.tmpl
+++ b/templates/chorus-collection.tmpl
@@ -1,234 +1,234 @@
{{define "collection"}}<!DOCTYPE HTML>
<html {{if .Language}}lang="{{.Language}}"{{end}} dir="{{.Direction}}">
<head>
<meta charset="utf-8">
<title>{{.DisplayTitle}}{{if not .SingleUser}} &mdash; {{.SiteName}}{{end}}</title>
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<link rel="shortcut icon" href="/favicon.ico" />
<link rel="canonical" href="{{.CanonicalURL}}">
{{if gt .CurrentPage 1}}<link rel="prev" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
{{if lt .CurrentPage .TotalPages}}<link rel="next" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
{{if not .IsPrivate}}<link rel="alternate" type="application/rss+xml" title="{{.DisplayTitle}} &raquo; Feed" href="{{.CanonicalURL}}feed/" />{{end}}
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<meta name="generator" content="WriteFreely">
<meta name="description" content="{{.Description}}">
<meta itemprop="name" content="{{.DisplayTitle}}">
<meta itemprop="description" content="{{.Description}}">
<meta name="twitter:card" content="summary">
<meta name="twitter:title" content="{{.DisplayTitle}}">
<meta name="twitter:image" content="{{.AvatarURL}}">
<meta name="twitter:description" content="{{.Description}}">
<meta property="og:title" content="{{.DisplayTitle}}" />
<meta property="og:site_name" content="{{.DisplayTitle}}" />
<meta property="og:type" content="article" />
<meta property="og:url" content="{{.CanonicalURL}}" />
<meta property="og:description" content="{{.Description}}" />
<meta property="og:image" content="{{.AvatarURL}}">
{{if .StyleSheet}}<style type="text/css">{{.StyleSheetDisplay}}</style>{{end}}
<style type="text/css">
body#collection header {
max-width: 40em;
margin: 1em auto;
text-align: left;
padding: 0;
}
body#collection header.multiuser {
max-width: 100%;
margin: 1em;
}
body#collection header nav:not(.pinned-posts) {
display: inline;
}
body#collection header nav.dropdown-nav,
body#collection header nav.tabs,
body#collection header nav.tabs a:first-child {
margin: 0 0 0 1em;
}
</style>
{{if .RenderMathJax}}
<!-- Add mathjax logic -->
{{template "mathjax" .}}
{{end}}
<!-- Add highlighting logic -->
{{template "highlighting" . }}
</head>
<body id="collection" itemscope itemtype="http://schema.org/WebPage">
{{template "user-navigation" .}}
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<header>
<h1 dir="{{.Direction}}" id="blog-title"><a href="/{{if .IsTopLevel}}{{else}}{{.Prefix}}{{.Alias}}/{{end}}" class="h-card p-author u-url" rel="me author">{{.DisplayTitle}}</a></h1>
{{if .Description}}<p class="description p-note">{{.Description}}</p>{{end}}
{{/*if not .Public/*}}
<!--p class="meta-note"><span>Private collection</span>. Only you can see this page.</p-->
{{/*end*/}}
{{if .PinnedPosts}}<nav class="pinned-posts">
{{range .PinnedPosts}}<a class="pinned" href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}</nav>
{{end}}
</header>
{{if .Posts}}<section id="wrapper" itemscope itemtype="http://schema.org/Blog">{{else}}<div id="wrapper">{{end}}
{{if .IsWelcome}}
<div id="welcome">
<h2>Welcome, <strong>{{.Username}}</strong>!</h2>
<p>This is your new blog.</p>
<p><a class="simple-cta" href="/#{{.Alias}}">Start writing</a>, or <a class="simple-cta" href="/me/c/{{.Alias}}">customize</a> your blog.</p>
<p>Check out our <a class="simple-cta" href="https://guides.write.as/writing/?pk_campaign=welcome">writing guide</a> to see what else you can do, and <a class="simple-cta" href="/contact">get in touch</a> anytime with questions or feedback.</p>
</div>
{{end}}
{{template "posts" .}}
{{if gt .TotalPages 1}}<nav id="paging" class="content-container clearfix">
{{if or (and .Format.Ascending (lt .CurrentPage .TotalPages)) (isRTL .Direction)}}
{{if gt .CurrentPage 1}}<a href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">&#8672; {{if and .Format.Ascending (lt .CurrentPage .TotalPages)}}Previous{{else}}Newer{{end}}</a>{{end}}
{{if lt .CurrentPage .TotalPages}}<a style="float:right;" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{if and .Format.Ascending (lt .CurrentPage .TotalPages)}}Next{{else}}Older{{end}} &#8674;</a>{{end}}
{{else}}
{{if lt .CurrentPage .TotalPages}}<a href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">&#8672; Older</a>{{end}}
{{if gt .CurrentPage 1}}<a style="float:right;" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">Newer &#8674;</a>{{end}}
{{end}}
</nav>{{end}}
{{if .Posts}}</section>{{else}}</div>{{end}}
{{if .ShowFooterBranding }}
<footer>
<hr />
<nav dir="ltr">
{{if not .SingleUser}}<a class="home pubd" href="/">{{.SiteName}}</a> &middot; {{end}}powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a>
</nav>
</footer>
{{ end }}
</body>
{{if .CanShowScript}}
{{range .ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
{{if .Script}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
{{end}}
<script src="/js/h.js"></script>
<script src="/js/localdate.js"></script>
<script src="/js/postactions.js"></script>
<script type="text/javascript">
var deleting = false;
function delPost(e, id, owned) {
e.preventDefault();
if (deleting) {
return;
}
// TODO: UNDO!
if (window.confirm('Are you sure you want to delete this post?')) {
// AJAX
deletePost(id, "", function() {
// Remove post from list
var $postEl = document.getElementById('post-' + id);
$postEl.parentNode.removeChild($postEl);
// TODO: add next post from this collection at the bottom
});
}
}
var deletePost = function(postID, token, callback) {
deleting = true;
var $delBtn = document.getElementById('post-' + postID).getElementsByClassName('delete action')[0];
$delBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/posts/" + postID;
http.open("DELETE", url, true);
http.onreadystatechange = function() {
if (http.readyState == 4) {
deleting = false;
if (http.status == 204) {
callback();
} else if (http.status == 409) {
$delBtn.innerHTML = 'delete';
alert("Post is synced to another account. Delete the post from that account instead.");
// TODO: show "remove" button instead of "delete" now
// Persist that state.
// Have it remove the post locally only.
} else {
$delBtn.innerHTML = 'delete';
alert("Failed to delete." + (http.status>=500?" Please try again.":""));
}
}
}
http.send();
};
var pinning = false;
function pinPost(e, postID, slug, title) {
e.preventDefault();
if (pinning) {
return;
}
pinning = true;
var callback = function() {
// Visibly remove post from collection
var $postEl = document.getElementById('post-' + postID);
$postEl.parentNode.removeChild($postEl);
var $header = document.querySelector('header:not(.multiuser)');
var $pinnedNavs = $header.getElementsByTagName('nav');
// Add link to nav
var link = '<a class="pinned" href="/{{.Alias}}/'+slug+'">'+title+'</a>';
if ($pinnedNavs.length == 0) {
$header.insertAdjacentHTML("beforeend", '<nav>'+link+'</nav>');
} else {
$pinnedNavs[0].insertAdjacentHTML("beforeend", link);
}
};
var $pinBtn = document.getElementById('post-' + postID).getElementsByClassName('pin action')[0];
$pinBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Alias}}/pin";
var params = [ { "id": postID } ];
http.open("POST", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
pinning = false;
if (http.status == 200) {
callback();
} else if (http.status == 409) {
$pinBtn.innerHTML = 'pin';
alert("Post is synced to another account. Delete the post from that account instead.");
// TODO: show "remove" button instead of "delete" now
// Persist that state.
// Have it remove the post locally only.
} else {
$pinBtn.innerHTML = 'pin';
alert("Failed to pin." + (http.status>=500?" Please try again.":""));
}
}
}
http.send(JSON.stringify(params));
};
try {
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
(function() {
var wf = document.createElement('script');
wf.src = '/js/webfont.js';
wf.type = 'text/javascript';
wf.async = 'true';
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) {}
</script>
</html>{{end}}
diff --git a/templates/collection-post.tmpl b/templates/collection-post.tmpl
index a8c105b..83c7874 100644
--- a/templates/collection-post.tmpl
+++ b/templates/collection-post.tmpl
@@ -1,134 +1,134 @@
{{define "post"}}<!DOCTYPE HTML>
<html {{if .Language.Valid}}lang="{{.Language.String}}"{{end}} dir="{{.Direction}}">
<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
<meta charset="utf-8">
<title>{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{.Collection.DisplayTitle}}</title>
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<link rel="shortcut icon" href="/favicon.ico" />
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
{{ if .IsFound }}
<link rel="canonical" href="{{.CanonicalURL .Host}}" />
<meta name="generator" content="WriteFreely">
<meta name="title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
<meta name="description" content="{{.Summary}}">
{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
<meta name="author" content="{{.Collection.Title}}" />
<meta itemprop="description" content="{{.Summary}}">
<meta itemprop="datePublished" content="{{.CreatedDate}}" />
<meta name="twitter:card" content="summary">
<meta name="twitter:description" content="{{.Summary}}">
<meta name="twitter:title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
{{if gt (len .Images) 0}}<meta name="twitter:image" content="{{index .Images 0}}">{{else}}<meta name="twitter:image" content="{{.Collection.AvatarURL}}">{{end}}
<meta property="og:title" content="{{.PlainDisplayTitle}}" />
<meta property="og:description" content="{{.Summary}}" />
<meta property="og:site_name" content="{{.Collection.DisplayTitle}}" />
<meta property="og:type" content="article" />
<meta property="og:url" content="{{.CanonicalURL .Host}}" />
<meta property="og:updated_time" content="{{.Created8601}}" />
{{range .Images}}<meta property="og:image" content="{{.}}" />{{else}}<meta property="og:image" content="{{.Collection.AvatarURL}}">{{end}}
<meta property="article:published_time" content="{{.Created8601}}">
{{ end }}
{{if .Collection.StyleSheet}}<style type="text/css">{{.Collection.StyleSheetDisplay}}</style>{{end}}
{{if .Collection.RenderMathJax}}
<!-- Add mathjax logic -->
{{template "mathjax" . }}
{{end}}
<!-- Add highlighting logic -->
{{template "highlighting" .}}
</head>
<body id="post">
<div id="overlay"></div>
<header>
<h1 dir="{{.Direction}}" id="blog-title"><a rel="author" href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a></h1>
<nav>
{{if .PinnedPosts}}
{{range .PinnedPosts}}<a class="pinned{{if eq .Slug.String $.Slug.String}} selected{{end}}" href="{{if not $.SingleUser}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}
{{end}}
{{ if and .IsOwner .IsFound }}<span class="views" dir="ltr"><strong>{{largeNumFmt .Views}}</strong> {{pluralize "view" "views" .Views}}</span>
<a class="xtra-feature" href="/{{if not .SingleUser}}{{.Collection.Alias}}/{{end}}{{.Slug.String}}/edit" dir="{{.Direction}}">Edit</a>
{{if .IsPinned}}<a class="xtra-feature unpin" href="/{{.Collection.Alias}}/{{.Slug.String}}/unpin" dir="{{.Direction}}" onclick="unpinPost(event, '{{.ID}}')">Unpin</a>{{end}}
{{ end }}
</nav>
</header>
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<article id="post-body" class="{{.Font}} h-entry {{if not .IsFound}}error-page{{end}}">{{if .IsScheduled}}<p class="badge">Scheduled</p>{{end}}{{if .Title.String}}<h2 id="title" class="p-name{{if $.Collection.Format.ShowDates}} dated{{end}}">{{.FormattedDisplayTitle}}</h2>{{end}}{{if $.Collection.Format.ShowDates}}<time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}">{{.DisplayDate}}</time>{{end}}<div class="e-content">{{.HTMLContent}}</div></article>
{{ if .Collection.ShowFooterBranding }}
<footer dir="ltr"><hr><nav><p style="font-size: 0.9em">{{localhtml "published with write.as" .Language.String}}</p></nav></footer>
{{ end }}
</body>
{{if .Collection.CanShowScript}}
{{range .Collection.ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
{{if .Collection.Script}}<script type="text/javascript">{{.Collection.ScriptDisplay}}</script>{{end}}
{{end}}
<script src="/js/localdate.js"></script>
<script type="text/javascript">
var pinning = false;
function unpinPost(e, postID) {
e.preventDefault();
if (pinning) {
return;
}
pinning = true;
var $header = document.getElementsByTagName('header')[0];
var callback = function() {
// Hide current page
var $pinnedNavLink = $header.getElementsByTagName('nav')[0].querySelector('.pinned.selected');
$pinnedNavLink.style.display = 'none';
};
var $pinBtn = $header.getElementsByClassName('unpin')[0];
$pinBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Collection.Alias}}/unpin";
var params = [ { "id": postID } ];
http.open("POST", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
pinning = false;
if (http.status == 200) {
callback();
$pinBtn.style.display = 'none';
$pinBtn.innerHTML = 'Pin';
} else if (http.status == 409) {
$pinBtn.innerHTML = 'Unpin';
} else {
$pinBtn.innerHTML = 'Unpin';
alert("Failed to unpin." + (http.status>=500?" Please try again.":""));
}
}
}
http.send(JSON.stringify(params));
};
try { // Fonts
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
(function() {
var wf = document.createElement('script');
wf.src = '/js/webfont.js';
wf.type = 'text/javascript';
wf.async = 'true';
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) { /* ¯\_(ツ)_/¯ */ }
</script>
</html>{{end}}
diff --git a/templates/collection-tags.tmpl b/templates/collection-tags.tmpl
index 93cd7e0..b7c92c8 100644
--- a/templates/collection-tags.tmpl
+++ b/templates/collection-tags.tmpl
@@ -1,198 +1,198 @@
{{define "collection-tags"}}<!DOCTYPE HTML>
<html>
<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
<meta charset="utf-8">
<title>{{.Tag}} &mdash; {{.Collection.DisplayTitle}}</title>
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<link rel="shortcut icon" href="/favicon.ico" />
{{if not .Collection.IsPrivate}}<link rel="alternate" type="application/rss+xml" title="{{.Tag}} posts on {{.DisplayTitle}}" href="{{.CanonicalURL}}tag:{{.Tag}}/feed/" />{{end}}
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<link rel="canonical" href="{{.CanonicalURL}}tag:{{.Tag | tolower}}" />
<meta name="generator" content="Write.as">
<meta name="title" content="{{.Tag}} &mdash; {{.Collection.DisplayTitle}}">
<meta name="description" content="{{.Tag}} posts on {{.Collection.DisplayTitle}}">
<meta name="application-name" content="Write.as">
<meta name="application-url" content="https://write.as">
{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
<meta itemprop="name" content="{{.Collection.DisplayTitle}}">
<meta itemprop="description" content="{{.Tag}} posts on {{.Collection.DisplayTitle}}">
<meta name="twitter:card" content="summary">
<meta name="twitter:site" content="@writeas__">
<meta name="twitter:description" content="{{.Tag}} posts on {{.Collection.DisplayTitle}}">
<meta name="twitter:title" content="{{.Tag}} &mdash; {{.Collection.DisplayTitle}}">
<meta name="twitter:image" content="{{.Collection.AvatarURL}}">
<meta property="og:title" content="{{.Tag}} &mdash; {{.Collection.DisplayTitle}}" />
<meta property="og:site_name" content="{{.DisplayTitle}}" />
<meta property="og:type" content="article" />
<meta property="og:url" content="{{.CanonicalURL}}tag:{{.Tag}}" />
<meta property="og:image" content="{{.Collection.AvatarURL}}">
{{if .Collection.StyleSheet}}<style type="text/css">{{.Collection.StyleSheetDisplay}}</style>{{end}}
{{if .Collection.RenderMathJax}}
<!-- Add mathjax logic -->
{{template "mathjax" .}}
{{end}}
<!-- Add highlighting logic -->
{{template "highlighting" . }}
</head>
<body id="subpage">
<div id="overlay"></div>
<header>
<h1 dir="{{.Direction}}" id="blog-title"><a href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a></h1>
<nav>
{{if .PinnedPosts}}
{{range .PinnedPosts}}<a class="pinned" href="{{if not $.SingleUser}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.DisplayTitle}}</a>{{end}}
{{end}}
</nav>
</header>
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
{{if .Posts}}<section id="wrapper" itemscope itemtype="http://schema.org/Blog">{{else}}<div id="wrapper">{{end}}
<h1>{{.Tag}}</h1>
{{template "posts" .}}
{{if .Posts}}</section>{{else}}</div>{{end}}
{{ if .Collection.ShowFooterBranding }}
<footer dir="ltr">
<hr>
<nav>
<p style="font-size: 0.9em"><a class="home pubd" href="/">{{.SiteName}}</a> &middot; powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a></p>
</nav>
</footer>
{{ end }}
</body>
{{if .CanShowScript}}
{{range .ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
{{if .Collection.Script}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
{{end}}
<script src="/js/localdate.js"></script>
{{if .IsOwner}}
<script src="/js/h.js"></script>
<script src="/js/postactions.js"></script>
{{end}}
<script type="text/javascript">
{{if .IsOwner}}
var deleting = false;
function delPost(e, id, owned) {
e.preventDefault();
if (deleting) {
return;
}
// TODO: UNDO!
if (window.confirm('Are you sure you want to delete this post?')) {
// AJAX
deletePost(id, "", function() {
// Remove post from list
var $postEl = document.getElementById('post-' + id);
$postEl.parentNode.removeChild($postEl);
// TODO: add next post from this collection at the bottom
});
}
}
var deletePost = function(postID, token, callback) {
deleting = true;
var $delBtn = document.getElementById('post-' + postID).getElementsByClassName('delete action')[0];
$delBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/posts/" + postID;
http.open("DELETE", url, true);
http.onreadystatechange = function() {
if (http.readyState == 4) {
deleting = false;
if (http.status == 204) {
callback();
} else if (http.status == 409) {
$delBtn.innerHTML = 'delete';
alert("Post is synced to another account. Delete the post from that account instead.");
// TODO: show "remove" button instead of "delete" now
// Persist that state.
// Have it remove the post locally only.
} else {
$delBtn.innerHTML = 'delete';
alert("Failed to delete." + (http.status>=500?" Please try again.":""));
}
}
}
http.send();
};
var pinning = false;
function pinPost(e, postID, slug, title) {
e.preventDefault();
if (pinning) {
return;
}
pinning = true;
var callback = function() {
// Visibly remove post from collection
var $postEl = document.getElementById('post-' + postID);
$postEl.parentNode.removeChild($postEl);
var $header = document.getElementsByTagName('header')[0];
var $pinnedNavs = $header.getElementsByTagName('nav');
// Add link to nav
var link = '<a class="pinned" href="{{if not .SingleUser}}/{{.Alias}}/{{end}}'+slug+'">'+title+'</a>';
if ($pinnedNavs.length == 0) {
$header.insertAdjacentHTML("beforeend", '<nav>'+link+'</nav>');
} else {
$pinnedNavs[0].insertAdjacentHTML("beforeend", link);
}
};
var $pinBtn = document.getElementById('post-' + postID).getElementsByClassName('pin action')[0];
$pinBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Alias}}/pin";
var params = [ { "id": postID } ];
http.open("POST", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
pinning = false;
if (http.status == 200) {
callback();
} else if (http.status == 409) {
$pinBtn.innerHTML = 'pin';
alert("Post is synced to another account. Delete the post from that account instead.");
// TODO: show "remove" button instead of "delete" now
// Persist that state.
// Have it remove the post locally only.
} else {
$pinBtn.innerHTML = 'pin';
alert("Failed to pin." + (http.status>=500?" Please try again.":""));
}
}
}
http.send(JSON.stringify(params));
};
{{end}}
try { // Fonts
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
(function() {
var wf = document.createElement('script');
wf.src = '/js/webfont.js';
wf.type = 'text/javascript';
wf.async = 'true';
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) { /* ¯\_(ツ)_/¯ */ }
</script>
</html>{{end}}
diff --git a/templates/collection.tmpl b/templates/collection.tmpl
index 2d66a8d..89e2e21 100644
--- a/templates/collection.tmpl
+++ b/templates/collection.tmpl
@@ -1,234 +1,234 @@
{{define "collection"}}<!DOCTYPE HTML>
<html {{if .Language}}lang="{{.Language}}"{{end}} dir="{{.Direction}}">
<head>
<meta charset="utf-8">
<title>{{.DisplayTitle}}{{if not .SingleUser}} &mdash; {{.SiteName}}{{end}}</title>
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<link rel="shortcut icon" href="/favicon.ico" />
<link rel="canonical" href="{{.CanonicalURL}}">
{{if gt .CurrentPage 1}}<link rel="prev" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
{{if lt .CurrentPage .TotalPages}}<link rel="next" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
{{if not .IsPrivate}}<link rel="alternate" type="application/rss+xml" title="{{.DisplayTitle}} &raquo; Feed" href="{{.CanonicalURL}}feed/" />{{end}}
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<meta name="generator" content="WriteFreely">
<meta name="description" content="{{.Description}}">
<meta itemprop="name" content="{{.DisplayTitle}}">
<meta itemprop="description" content="{{.Description}}">
<meta name="twitter:card" content="summary">
<meta name="twitter:title" content="{{.DisplayTitle}}">
<meta name="twitter:image" content="{{.AvatarURL}}">
<meta name="twitter:description" content="{{.Description}}">
<meta property="og:title" content="{{.DisplayTitle}}" />
<meta property="og:site_name" content="{{.DisplayTitle}}" />
<meta property="og:type" content="article" />
<meta property="og:url" content="{{.CanonicalURL}}" />
<meta property="og:description" content="{{.Description}}" />
<meta property="og:image" content="{{.AvatarURL}}">
{{if .StyleSheet}}<style type="text/css">{{.StyleSheetDisplay}}</style>{{end}}
{{if .RenderMathJax}}
<!-- Add mathjax logic -->
{{template "mathjax" .}}
{{end}}
<!-- Add highlighting logic -->
{{template "highlighting" . }}
</head>
<body id="collection" itemscope itemtype="http://schema.org/WebPage">
{{if or .IsOwner .SingleUser}}<nav id="manage"><ul>
<li><a onclick="void(0)">&#9776; Menu</a>
<ul>
{{ if .IsOwner }}
{{if .SingleUser}}
<li><a href="/me/new">New Post</a></li>
{{else}}
<li><a href="/#{{.Alias}}" class="write">{{.SiteName}}</a></li>
{{end}}
{{if .SimpleNav}}<li><a href="/new#{{.Alias}}">New Post</a></li>{{end}}
<li><a href="/me/c/{{.Alias}}">Customize</a></li>
<li><a href="/me/c/{{.Alias}}/stats">Stats</a></li>
<li class="separator"><hr /></li>
{{if not .SingleUser}}<li><a href="/me/c/"><img class="ic-18dp" src="/img/ic_blogs_dark@2x.png" /> View Blogs</a></li>{{end}}
<li><a href="/me/posts/"><img class="ic-18dp" src="/img/ic_list_dark@2x.png" /> View Drafts</a></li>
{{ else }}
<li><a href="/login">Log in</a></li>
{{ end }}
</ul>
</li>
</ul></nav>{{end}}
<header>
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<h1 dir="{{.Direction}}" id="blog-title">{{if .Posts}}{{else}}<span class="writeas-prefix"><a href="/">write.as</a></span> {{end}}<a href="/{{if .IsTopLevel}}{{else}}{{.Prefix}}{{.Alias}}/{{end}}" class="h-card p-author u-url" rel="me author">{{.DisplayTitle}}</a></h1>
{{if .Description}}<p class="description p-note">{{.Description}}</p>{{end}}
{{/*if not .Public/*}}
<!--p class="meta-note"><span>Private collection</span>. Only you can see this page.</p-->
{{/*end*/}}
{{if .PinnedPosts}}<nav>
{{range .PinnedPosts}}<a class="pinned" href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}</nav>
{{end}}
</header>
{{if .Posts}}<section id="wrapper" itemscope itemtype="http://schema.org/Blog">{{else}}<div id="wrapper">{{end}}
{{if .IsWelcome}}
<div id="welcome">
<h2>Welcome, <strong>{{.Username}}</strong>!</h2>
<p>This is your new blog.</p>
<p><a class="simple-cta" href="/#{{.Alias}}">Start writing</a>, or <a class="simple-cta" href="/me/c/{{.Alias}}">customize</a> your blog.</p>
<p>Check out our <a class="simple-cta" href="https://guides.write.as/writing/?pk_campaign=welcome">writing guide</a> to see what else you can do, and <a class="simple-cta" href="/contact">get in touch</a> anytime with questions or feedback.</p>
</div>
{{end}}
{{template "posts" .}}
{{if gt .TotalPages 1}}<nav id="paging" class="content-container clearfix">
{{if or (and .Format.Ascending (lt .CurrentPage .TotalPages)) (isRTL .Direction)}}
{{if gt .CurrentPage 1}}<a href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">&#8672; {{if and .Format.Ascending (lt .CurrentPage .TotalPages)}}Previous{{else}}Newer{{end}}</a>{{end}}
{{if lt .CurrentPage .TotalPages}}<a style="float:right;" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{if and .Format.Ascending (lt .CurrentPage .TotalPages)}}Next{{else}}Older{{end}} &#8674;</a>{{end}}
{{else}}
{{if lt .CurrentPage .TotalPages}}<a href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">&#8672; Older</a>{{end}}
{{if gt .CurrentPage 1}}<a style="float:right;" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">Newer &#8674;</a>{{end}}
{{end}}
</nav>{{end}}
{{if .Posts}}</section>{{else}}</div>{{end}}
{{if .ShowFooterBranding }}
<footer>
<hr />
<nav dir="ltr">
{{if not .SingleUser}}<a class="home pubd" href="/">{{.SiteName}}</a> &middot; {{end}}powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a>
</nav>
</footer>
{{ end }}
</body>
{{if .CanShowScript}}
{{range .ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
{{if .Script}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
{{end}}
<script src="/js/h.js"></script>
<script src="/js/postactions.js"></script>
<script src="/js/localdate.js"></script>
<script type="text/javascript">
var deleting = false;
function delPost(e, id, owned) {
e.preventDefault();
if (deleting) {
return;
}
// TODO: UNDO!
if (window.confirm('Are you sure you want to delete this post?')) {
// AJAX
deletePost(id, "", function() {
// Remove post from list
var $postEl = document.getElementById('post-' + id);
$postEl.parentNode.removeChild($postEl);
// TODO: add next post from this collection at the bottom
});
}
}
var deletePost = function(postID, token, callback) {
deleting = true;
var $delBtn = document.getElementById('post-' + postID).getElementsByClassName('delete action')[0];
$delBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/posts/" + postID;
http.open("DELETE", url, true);
http.onreadystatechange = function() {
if (http.readyState == 4) {
deleting = false;
if (http.status == 204) {
callback();
} else if (http.status == 409) {
$delBtn.innerHTML = 'delete';
alert("Post is synced to another account. Delete the post from that account instead.");
// TODO: show "remove" button instead of "delete" now
// Persist that state.
// Have it remove the post locally only.
} else {
$delBtn.innerHTML = 'delete';
alert("Failed to delete." + (http.status>=500?" Please try again.":""));
}
}
}
http.send();
};
var pinning = false;
function pinPost(e, postID, slug, title) {
e.preventDefault();
if (pinning) {
return;
}
pinning = true;
var callback = function() {
// Visibly remove post from collection
var $postEl = document.getElementById('post-' + postID);
$postEl.parentNode.removeChild($postEl);
var $header = document.getElementsByTagName('header')[0];
var $pinnedNavs = $header.getElementsByTagName('nav');
// Add link to nav
var link = '<a class="pinned" href="{{if not .SingleUser}}/{{.Alias}}/{{end}}'+slug+'">'+title+'</a>';
if ($pinnedNavs.length == 0) {
$header.insertAdjacentHTML("beforeend", '<nav>'+link+'</nav>');
} else {
$pinnedNavs[0].insertAdjacentHTML("beforeend", link);
}
};
var $pinBtn = document.getElementById('post-' + postID).getElementsByClassName('pin action')[0];
$pinBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Alias}}/pin";
var params = [ { "id": postID } ];
http.open("POST", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
pinning = false;
if (http.status == 200) {
callback();
} else if (http.status == 409) {
$pinBtn.innerHTML = 'pin';
alert("Post is synced to another account. Delete the post from that account instead.");
// TODO: show "remove" button instead of "delete" now
// Persist that state.
// Have it remove the post locally only.
} else {
$pinBtn.innerHTML = 'pin';
alert("Failed to pin." + (http.status>=500?" Please try again.":""));
}
}
}
http.send(JSON.stringify(params));
};
try {
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
(function() {
var wf = document.createElement('script');
wf.src = '/js/webfont.js';
wf.type = 'text/javascript';
wf.async = 'true';
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) {}
</script>
</html>{{end}}
diff --git a/templates/edit-meta.tmpl b/templates/edit-meta.tmpl
index 49c7781..9f7faed 100644
--- a/templates/edit-meta.tmpl
+++ b/templates/edit-meta.tmpl
@@ -1,374 +1,374 @@
{{define "edit-meta"}}<!DOCTYPE HTML>
<html>
<head>
<title>Edit metadata: {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}} &mdash; {{.SiteName}}</title>
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<style type="text/css">
dt {
width: 8em;
}
.error {
display: none;
}
.mono {
font-style: normal;
}
#set-now {
font-style: italic;
margin-left: 0.25rem;
}
.content-container h2 a {
font-size: .6em;
font-weight: normal;
margin-left: 1em;
}
.content-container h2 a:link, .content-container h2 a:visited {
color: blue;
}
.content-container h2 a:hover {
text-decoration: underline;
}
</style>
</head>
<body id="pad-sub" class="light">
<header id="tools">
<div id="clip">
<h1><a href="/me/c/" title="View blogs"><img class="ic-24dp" src="/img/ic_blogs_dark@2x.png" /></a></h1>
<nav id="target" class=""><ul>
<li>{{if .EditCollection}}<a href="{{.EditCollection.CanonicalURL}}">{{.EditCollection.Title}}</a>{{else}}<a>Draft</a>{{end}}</li>
</ul></nav>
</div>
<div id="belt">
<div class="tool if-room"><a href="{{if .EditCollection}}{{.EditCollection.CanonicalURL}}{{.Post.Slug}}/edit{{else}}/{{.Post.Id}}/edit{{end}}" title="Edit post" id="edit"><img class="ic-24dp" src="/img/ic_edit_dark@2x.png" /></a></div>
<div class="tool if-room room-2"><a href="#theme" title="Toggle theme" id="toggle-theme"><img class="ic-24dp" src="/img/ic_brightness_dark@2x.png" /></a></div>
<div class="tool if-room room-1"><a href="/me/posts/" title="View posts" id="view-posts"><img class="ic-24dp" src="/img/ic_list_dark@2x.png" /></a></div>
</div>
</header>
<div class="content-container tight">
<form action="/api/{{if .EditCollection}}collections/{{.EditCollection.Alias}}/{{end}}posts/{{.Post.Id}}" method="post" onsubmit="return updateMeta()">
<h2>Edit metadata: {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}} <a href="/{{if .EditCollection}}{{if not .SingleUser}}{{.EditCollection.Alias}}/{{end}}{{.Post.Slug}}{{else}}{{if .SingleUser}}d/{{end}}{{.Post.Id}}{{end}}">view post</a></h2>
{{if .Flashes}}<ul class="errors">
{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
</ul>{{end}}
<dl class="dl-horizontal">
{{if .EditCollection}}
<dt><label for="slug">Slug</label></dt>
<dd><input type="text" id="slug" name="slug" value="{{.Post.Slug}}" /></dd>
{{end}}
<dt><label for="lang">Language</label></dt>
<dd>
<select name="lang" id="lang" dir="auto">
<option value=""></option>
<option value="ab"{{if eq "ab" .Post.Language.String}} selected="selected"{{end}}>аҧсуа бызшәа, аҧсшәа</option>
<option value="aa"{{if eq "aa" .Post.Language.String}} selected="selected"{{end}}>Afaraf</option>
<option value="af"{{if eq "af" .Post.Language.String}} selected="selected"{{end}}>Afrikaans</option>
<option value="ak"{{if eq "ak" .Post.Language.String}} selected="selected"{{end}}>Akan</option>
<option value="sq"{{if eq "sq" .Post.Language.String}} selected="selected"{{end}}>Shqip</option>
<option value="am"{{if eq "am" .Post.Language.String}} selected="selected"{{end}}>አማርኛ</option>
<option dir="rtl" value="ar"{{if eq "ar" .Post.Language.String}} selected="selected"{{end}}>العربية</option>
<option value="an"{{if eq "an" .Post.Language.String}} selected="selected"{{end}}>aragonés</option>
<option value="hy"{{if eq "hy" .Post.Language.String}} selected="selected"{{end}}>Հայերեն</option>
<option value="as"{{if eq "as" .Post.Language.String}} selected="selected"{{end}}>অসমীয়া</option>
<option value="av"{{if eq "av" .Post.Language.String}} selected="selected"{{end}}>авар мацӀ, магӀарул мацӀ</option>
<option value="ae"{{if eq "ae" .Post.Language.String}} selected="selected"{{end}}>avesta</option>
<option value="ay"{{if eq "ay" .Post.Language.String}} selected="selected"{{end}}>aymar aru</option>
<option value="az"{{if eq "az" .Post.Language.String}} selected="selected"{{end}}>azərbaycan dili</option>
<option value="bm"{{if eq "bm" .Post.Language.String}} selected="selected"{{end}}>bamanankan</option>
<option value="ba"{{if eq "ba" .Post.Language.String}} selected="selected"{{end}}>башҡорт теле</option>
<option value="eu"{{if eq "eu" .Post.Language.String}} selected="selected"{{end}}>euskara, euskera</option>
<option value="be"{{if eq "be" .Post.Language.String}} selected="selected"{{end}}>беларуская мова</option>
<option value="bn"{{if eq "bn" .Post.Language.String}} selected="selected"{{end}}>বাংলা</option>
<option value="bh"{{if eq "bh" .Post.Language.String}} selected="selected"{{end}}>भोजपुरी</option>
<option value="bi"{{if eq "bi" .Post.Language.String}} selected="selected"{{end}}>Bislama</option>
<option value="bs"{{if eq "bs" .Post.Language.String}} selected="selected"{{end}}>bosanski jezik</option>
<option value="br"{{if eq "br" .Post.Language.String}} selected="selected"{{end}}>brezhoneg</option>
<option value="bg"{{if eq "bg" .Post.Language.String}} selected="selected"{{end}}>български език</option>
<option value="my"{{if eq "my" .Post.Language.String}} selected="selected"{{end}}>ဗမာစာ</option>
<option value="ca"{{if eq "ca" .Post.Language.String}} selected="selected"{{end}}>català</option>
<option value="ch"{{if eq "ch" .Post.Language.String}} selected="selected"{{end}}>Chamoru</option>
<option value="ce"{{if eq "ce" .Post.Language.String}} selected="selected"{{end}}>нохчийн мотт</option>
<option value="ny"{{if eq "ny" .Post.Language.String}} selected="selected"{{end}}>chiCheŵa, chinyanja</option>
<option value="zh"{{if eq "zh" .Post.Language.String}} selected="selected"{{end}}>中文 (Zhōngwén), 汉语, 漢語</option>
<option value="cv"{{if eq "cv" .Post.Language.String}} selected="selected"{{end}}>чӑваш чӗлхи</option>
<option value="kw"{{if eq "kw" .Post.Language.String}} selected="selected"{{end}}>Kernewek</option>
<option value="co"{{if eq "co" .Post.Language.String}} selected="selected"{{end}}>corsu, lingua corsa</option>
<option value="cr"{{if eq "cr" .Post.Language.String}} selected="selected"{{end}}>ᓀᐦᐃᔭᐍᐏᐣ</option>
<option value="hr"{{if eq "hr" .Post.Language.String}} selected="selected"{{end}}>hrvatski jezik</option>
<option value="cs"{{if eq "cs" .Post.Language.String}} selected="selected"{{end}}>čeština, český jazyk</option>
<option value="da"{{if eq "da" .Post.Language.String}} selected="selected"{{end}}>dansk</option>
<option dir="rtl" value="dv"{{if eq "dv" .Post.Language.String}} selected="selected"{{end}}>ދިވެހި</option>
<option value="nl"{{if eq "nl" .Post.Language.String}} selected="selected"{{end}}>Nederlands, Vlaams</option>
<option value="dz"{{if eq "dz" .Post.Language.String}} selected="selected"{{end}}>རྫོང་ཁ</option>
<option value="en"{{if eq "en" .Post.Language.String}} selected="selected"{{end}}>English</option>
<option value="eo"{{if eq "eo" .Post.Language.String}} selected="selected"{{end}}>Esperanto</option>
<option value="et"{{if eq "et" .Post.Language.String}} selected="selected"{{end}}>eesti, eesti keel</option>
<option value="ee"{{if eq "ee" .Post.Language.String}} selected="selected"{{end}}>Eʋegbe</option>
<option value="fo"{{if eq "fo" .Post.Language.String}} selected="selected"{{end}}>føroyskt</option>
<option value="fj"{{if eq "fj" .Post.Language.String}} selected="selected"{{end}}>vosa Vakaviti</option>
<option value="fi"{{if eq "fi" .Post.Language.String}} selected="selected"{{end}}>suomi, suomen kieli</option>
<option value="fr"{{if eq "fr" .Post.Language.String}} selected="selected"{{end}}>français, langue française</option>
<option value="ff"{{if eq "ff" .Post.Language.String}} selected="selected"{{end}}>Fulfulde, Pulaar, Pular</option>
<option value="gl"{{if eq "gl" .Post.Language.String}} selected="selected"{{end}}>Galego</option>
<option value="ka"{{if eq "ka" .Post.Language.String}} selected="selected"{{end}}>ქართული</option>
<option value="de"{{if eq "de" .Post.Language.String}} selected="selected"{{end}}>Deutsch</option>
<option value="el"{{if eq "el" .Post.Language.String}} selected="selected"{{end}}>ελληνικά</option>
<option value="gn"{{if eq "gn" .Post.Language.String}} selected="selected"{{end}}>Avañe'ẽ</option>
<option value="gu"{{if eq "gu" .Post.Language.String}} selected="selected"{{end}}>ગુજરાતી</option>
<option value="ht"{{if eq "ht" .Post.Language.String}} selected="selected"{{end}}>Kreyòl ayisyen</option>
<option dir="rtl" value="ha"{{if eq "ha" .Post.Language.String}} selected="selected"{{end}}>(Hausa) هَوُسَ</option>
<option dir="rtl" value="he"{{if eq "he" .Post.Language.String}} selected="selected"{{end}}>עברית</option>
<option value="hz"{{if eq "hz" .Post.Language.String}} selected="selected"{{end}}>Otjiherero</option>
<option value="hi"{{if eq "hi" .Post.Language.String}} selected="selected"{{end}}>हिन्दी, हिंदी</option>
<option value="ho"{{if eq "ho" .Post.Language.String}} selected="selected"{{end}}>Hiri Motu</option>
<option value="hu"{{if eq "hu" .Post.Language.String}} selected="selected"{{end}}>magyar</option>
<option value="ia"{{if eq "ia" .Post.Language.String}} selected="selected"{{end}}>Interlingua</option>
<option value="id"{{if eq "id" .Post.Language.String}} selected="selected"{{end}}>Bahasa Indonesia</option>
<option value="ie"{{if eq "ie" .Post.Language.String}} selected="selected"{{end}}>Interlingue</option>
<option value="ga"{{if eq "ga" .Post.Language.String}} selected="selected"{{end}}>Gaeilge</option>
<option value="ig"{{if eq "ig" .Post.Language.String}} selected="selected"{{end}}>Asụsụ Igbo</option>
<option value="ik"{{if eq "ik" .Post.Language.String}} selected="selected"{{end}}>Iñupiaq, Iñupiatun</option>
<option value="io"{{if eq "io" .Post.Language.String}} selected="selected"{{end}}>Ido</option>
<option value="is"{{if eq "is" .Post.Language.String}} selected="selected"{{end}}>Íslenska</option>
<option value="it"{{if eq "it" .Post.Language.String}} selected="selected"{{end}}>Italiano</option>
<option value="iu"{{if eq "iu" .Post.Language.String}} selected="selected"{{end}}>ᐃᓄᒃᑎᑐᑦ</option>
<option value="ja"{{if eq "ja" .Post.Language.String}} selected="selected"{{end}}>日本語 (にほんご)</option>
<option value="jv"{{if eq "jv" .Post.Language.String}} selected="selected"{{end}}>ꦧꦱꦗꦮ, Basa Jawa</option>
<option value="kl"{{if eq "kl" .Post.Language.String}} selected="selected"{{end}}>kalaallisut, kalaallit oqaasii</option>
<option value="kn"{{if eq "kn" .Post.Language.String}} selected="selected"{{end}}>ಕನ್ನಡ</option>
<option value="kr"{{if eq "kr" .Post.Language.String}} selected="selected"{{end}}>Kanuri</option>
<option value="ks"{{if eq "ks" .Post.Language.String}} selected="selected"{{end}}>कश्मीरी, كشميري‎</option>
<option value="kk"{{if eq "kk" .Post.Language.String}} selected="selected"{{end}}>қазақ тілі</option>
<option value="km"{{if eq "km" .Post.Language.String}} selected="selected"{{end}}>ខ្មែរ, ខេមរភាសា, ភាសាខ្មែរ</option>
<option value="ki"{{if eq "ki" .Post.Language.String}} selected="selected"{{end}}>Gĩkũyũ</option>
<option value="rw"{{if eq "rw" .Post.Language.String}} selected="selected"{{end}}>Ikinyarwanda</option>
<option value="ky"{{if eq "ky" .Post.Language.String}} selected="selected"{{end}}>Кыргызча, Кыргыз тили</option>
<option value="kv"{{if eq "kv" .Post.Language.String}} selected="selected"{{end}}>коми кыв</option>
<option value="kg"{{if eq "kg" .Post.Language.String}} selected="selected"{{end}}>Kikongo</option>
<option value="ko"{{if eq "ko" .Post.Language.String}} selected="selected"{{end}}>한국어</option>
<option value="ku"{{if eq "ku" .Post.Language.String}} selected="selected"{{end}}>Kurdî, كوردی‎</option>
<option value="kj"{{if eq "kj" .Post.Language.String}} selected="selected"{{end}}>Kuanyama</option>
<option value="la"{{if eq "la" .Post.Language.String}} selected="selected"{{end}}>latine, lingua latina</option>
<option value="lb"{{if eq "lb" .Post.Language.String}} selected="selected"{{end}}>Lëtzebuergesch</option>
<option value="lg"{{if eq "lg" .Post.Language.String}} selected="selected"{{end}}>Luganda</option>
<option value="li"{{if eq "li" .Post.Language.String}} selected="selected"{{end}}>Limburgs</option>
<option value="ln"{{if eq "ln" .Post.Language.String}} selected="selected"{{end}}>Lingála</option>
<option value="lo"{{if eq "lo" .Post.Language.String}} selected="selected"{{end}}>ພາສາລາວ</option>
<option value="lt"{{if eq "lt" .Post.Language.String}} selected="selected"{{end}}>lietuvių kalba</option>
<option value="lu"{{if eq "lu" .Post.Language.String}} selected="selected"{{end}}>Kiluba</option>
<option value="lv"{{if eq "lv" .Post.Language.String}} selected="selected"{{end}}>Latviešu Valoda</option>
<option value="gv"{{if eq "gv" .Post.Language.String}} selected="selected"{{end}}>Gaelg, Gailck</option>
<option value="mk"{{if eq "mk" .Post.Language.String}} selected="selected"{{end}}>македонски јазик</option>
<option value="mg"{{if eq "mg" .Post.Language.String}} selected="selected"{{end}}>fiteny malagasy</option>
<option value="ms"{{if eq "ms" .Post.Language.String}} selected="selected"{{end}}>Bahasa Melayu, بهاس ملايو‎</option>
<option value="ml"{{if eq "ml" .Post.Language.String}} selected="selected"{{end}}>മലയാളം</option>
<option value="mt"{{if eq "mt" .Post.Language.String}} selected="selected"{{end}}>Malti</option>
<option value="mi"{{if eq "mi" .Post.Language.String}} selected="selected"{{end}}>te reo Māori</option>
<option value="mr"{{if eq "mr" .Post.Language.String}} selected="selected"{{end}}>मराठी</option>
<option value="mh"{{if eq "mh" .Post.Language.String}} selected="selected"{{end}}>Kajin M̧ajeļ</option>
<option value="mn"{{if eq "mn" .Post.Language.String}} selected="selected"{{end}}>Монгол хэл</option>
<option value="na"{{if eq "na" .Post.Language.String}} selected="selected"{{end}}>Dorerin Naoero</option>
<option value="nv"{{if eq "nv" .Post.Language.String}} selected="selected"{{end}}>Diné bizaad</option>
<option value="nd"{{if eq "nd" .Post.Language.String}} selected="selected"{{end}}>isiNdebele</option>
<option value="ne"{{if eq "ne" .Post.Language.String}} selected="selected"{{end}}>नेपाली</option>
<option value="ng"{{if eq "ng" .Post.Language.String}} selected="selected"{{end}}>Owambo</option>
<option value="nb"{{if eq "nb" .Post.Language.String}} selected="selected"{{end}}>Norsk Bokmål</option>
<option value="nn"{{if eq "nn" .Post.Language.String}} selected="selected"{{end}}>Norsk Nynorsk</option>
<option value="no"{{if eq "no" .Post.Language.String}} selected="selected"{{end}}>Norsk</option>
<option value="ii"{{if eq "ii" .Post.Language.String}} selected="selected"{{end}}>ꆈꌠ꒿ Nuosuhxop</option>
<option value="nr"{{if eq "nr" .Post.Language.String}} selected="selected"{{end}}>isiNdebele</option>
<option value="oc"{{if eq "oc" .Post.Language.String}} selected="selected"{{end}}>occitan, lenga d'òc</option>
<option value="oj"{{if eq "oj" .Post.Language.String}} selected="selected"{{end}}>ᐊᓂᔑᓈᐯᒧᐎᓐ</option>
<option value="cu"{{if eq "cu" .Post.Language.String}} selected="selected"{{end}}>ѩзыкъ словѣньскъ</option>
<option value="om"{{if eq "om" .Post.Language.String}} selected="selected"{{end}}>Afaan Oromoo</option>
<option value="or"{{if eq "or" .Post.Language.String}} selected="selected"{{end}}>ଓଡ଼ିଆ</option>
<option value="os"{{if eq "os" .Post.Language.String}} selected="selected"{{end}}>ирон æвзаг</option>
<option value="pa"{{if eq "pa" .Post.Language.String}} selected="selected"{{end}}>ਪੰਜਾਬੀ</option>
<option value="pi"{{if eq "pi" .Post.Language.String}} selected="selected"{{end}}>पाऴि</option>
<option dir="rtl" value="fa"{{if eq "fa" .Post.Language.String}} selected="selected"{{end}}>فارسی</option>
<option value="pl"{{if eq "pl" .Post.Language.String}} selected="selected"{{end}}>Język Polski, Polszczyzna</option>
<option dir="rtl" value="ps"{{if eq "ps" .Post.Language.String}} selected="selected"{{end}}>پښتو</option>
<option value="pt"{{if eq "pt" .Post.Language.String}} selected="selected"{{end}}>Português</option>
<option value="qu"{{if eq "qu" .Post.Language.String}} selected="selected"{{end}}>Runa Simi, Kichwa</option>
<option value="rm"{{if eq "rm" .Post.Language.String}} selected="selected"{{end}}>Rumantsch Grischun</option>
<option value="rn"{{if eq "rn" .Post.Language.String}} selected="selected"{{end}}>Ikirundi</option>
<option value="ro"{{if eq "ro" .Post.Language.String}} selected="selected"{{end}}>Română</option>
<option value="ru"{{if eq "ru" .Post.Language.String}} selected="selected"{{end}}>Русский</option>
<option value="sa"{{if eq "sa" .Post.Language.String}} selected="selected"{{end}}>संस्कृतम्</option>
<option value="sc"{{if eq "sc" .Post.Language.String}} selected="selected"{{end}}>sardu</option>
<option value="sd"{{if eq "sd" .Post.Language.String}} selected="selected"{{end}}>सिन्धी, سنڌي، سندھی‎</option>
<option value="se"{{if eq "se" .Post.Language.String}} selected="selected"{{end}}>Davvisámegiella</option>
<option value="sm"{{if eq "sm" .Post.Language.String}} selected="selected"{{end}}>gagana fa'a Samoa</option>
<option value="sg"{{if eq "sg" .Post.Language.String}} selected="selected"{{end}}>yângâ tî sängö</option>
<option value="sr"{{if eq "sr" .Post.Language.String}} selected="selected"{{end}}>српски језик</option>
<option value="gd"{{if eq "gd" .Post.Language.String}} selected="selected"{{end}}>Gàidhlig</option>
<option value="sn"{{if eq "sn" .Post.Language.String}} selected="selected"{{end}}>chiShona</option>
<option value="si"{{if eq "si" .Post.Language.String}} selected="selected"{{end}}>සිංහල</option>
<option value="sk"{{if eq "sk" .Post.Language.String}} selected="selected"{{end}}>Slovenčina, Slovenský Jazyk</option>
<option value="sl"{{if eq "sl" .Post.Language.String}} selected="selected"{{end}}>Slovenski Jezik, Slovenščina</option>
<option value="so"{{if eq "so" .Post.Language.String}} selected="selected"{{end}}>Soomaaliga, af Soomaali</option>
<option value="st"{{if eq "st" .Post.Language.String}} selected="selected"{{end}}>Sesotho</option>
<option value="es"{{if eq "es" .Post.Language.String}} selected="selected"{{end}}>Español</option>
<option value="su"{{if eq "su" .Post.Language.String}} selected="selected"{{end}}>Basa Sunda</option>
<option value="sw"{{if eq "sw" .Post.Language.String}} selected="selected"{{end}}>Kiswahili</option>
<option value="ss"{{if eq "ss" .Post.Language.String}} selected="selected"{{end}}>SiSwati</option>
<option value="sv"{{if eq "sv" .Post.Language.String}} selected="selected"{{end}}>Svenska</option>
<option value="ta"{{if eq "ta" .Post.Language.String}} selected="selected"{{end}}>தமிழ்</option>
<option value="te"{{if eq "te" .Post.Language.String}} selected="selected"{{end}}>తెలుగు</option>
<option value="tg"{{if eq "tg" .Post.Language.String}} selected="selected"{{end}}>тоҷикӣ, toçikī, تاجیکی‎</option>
<option value="th"{{if eq "th" .Post.Language.String}} selected="selected"{{end}}>ไทย</option>
<option value="ti"{{if eq "ti" .Post.Language.String}} selected="selected"{{end}}>ትግርኛ</option>
<option value="bo"{{if eq "bo" .Post.Language.String}} selected="selected"{{end}}>བོད་ཡིག</option>
<option value="tk"{{if eq "tk" .Post.Language.String}} selected="selected"{{end}}>Türkmen, Түркмен</option>
<option value="tl"{{if eq "tl" .Post.Language.String}} selected="selected"{{end}}>Wikang Tagalog</option>
<option value="tn"{{if eq "tn" .Post.Language.String}} selected="selected"{{end}}>Setswana</option>
<option value="to"{{if eq "to" .Post.Language.String}} selected="selected"{{end}}>Faka Tonga</option>
<option value="tr"{{if eq "tr" .Post.Language.String}} selected="selected"{{end}}>Türkçe</option>
<option value="ts"{{if eq "ts" .Post.Language.String}} selected="selected"{{end}}>Xitsonga</option>
<option value="tt"{{if eq "tt" .Post.Language.String}} selected="selected"{{end}}>татар теле, tatar tele</option>
<option value="tw"{{if eq "tw" .Post.Language.String}} selected="selected"{{end}}>Twi</option>
<option value="ty"{{if eq "ty" .Post.Language.String}} selected="selected"{{end}}>Reo Tahiti</option>
<option value="ug"{{if eq "ug" .Post.Language.String}} selected="selected"{{end}}>ئۇيغۇرچە‎, Uyghurche</option>
<option value="uk"{{if eq "uk" .Post.Language.String}} selected="selected"{{end}}>Українська</option>
<option dir="rtl" value="ur"{{if eq "ur" .Post.Language.String}} selected="selected"{{end}}>اردو</option>
<option value="uz"{{if eq "uz" .Post.Language.String}} selected="selected"{{end}}>Oʻzbek, Ўзбек, أۇزبېك‎</option>
<option value="ve"{{if eq "ve" .Post.Language.String}} selected="selected"{{end}}>Tshivenḓa</option>
<option value="vi"{{if eq "vi" .Post.Language.String}} selected="selected"{{end}}>Tiếng Việt</option>
<option value="vo"{{if eq "vo" .Post.Language.String}} selected="selected"{{end}}>Volapük</option>
<option value="wa"{{if eq "wa" .Post.Language.String}} selected="selected"{{end}}>Walon</option>
<option value="cy"{{if eq "cy" .Post.Language.String}} selected="selected"{{end}}>Cymraeg</option>
<option value="wo"{{if eq "wo" .Post.Language.String}} selected="selected"{{end}}>Wollof</option>
<option value="fy"{{if eq "fy" .Post.Language.String}} selected="selected"{{end}}>Frysk</option>
<option value="xh"{{if eq "xh" .Post.Language.String}} selected="selected"{{end}}>isiXhosa</option>
<option dir="rtl" value="yi"{{if eq "yi" .Post.Language.String}} selected="selected"{{end}}>ייִדיש</option>
<option value="yo"{{if eq "yo" .Post.Language.String}} selected="selected"{{end}}>Yorùbá</option>
<option value="za"{{if eq "za" .Post.Language.String}} selected="selected"{{end}}>Saɯ cueŋƅ, Saw cuengh</option>
<option value="zu"{{if eq "zu" .Post.Language.String}} selected="selected"{{end}}>isiZulu</option>
</select>
</dd>
<dt><label for="rtl">Direction</label></dt>
<dd><input type="checkbox" id="rtl" name="rtl" {{if .Post.IsRTL.Bool}}checked="checked"{{end}} /><label for="rtl"> right-to-left</label></dd>
<dt><label for="created">Created</label></dt>
<dd>
<input type="text" id="created" name="created" value="{{.Post.UserFacingCreated}}" data-time="{{.Post.Created8601}}" placeholder="YYYY-MM-DD HH:MM:SS" maxlength="19" /> <span id="tz">UTC</span> <a href="#" id="set-now">now</a>
<p class="error" id="create-error">Date format should be: <span class="mono"><abbr title="The full year">YYYY</abbr>-<abbr title="The numeric month of the year, where January = 1, with a zero in front if less than 10">MM</abbr>-<abbr title="The day of the month, with a zero in front if less than 10">DD</abbr> <abbr title="The hour (00-23), with a zero in front if less than 10.">HH</abbr>:<abbr title="The minute of the hour (00-59), with a zero in front if less than 10.">MM</abbr>:<abbr title="The seconds (00-59), with a zero in front if less than 10.">SS</abbr></span></p>
</dd>
<dt>&nbsp;</dt><dd><input type="submit" value="Save changes" /></dd>
</dl>
<input type="hidden" name="web" value="true" />
</form>
</div>
<script src="/js/h.js"></script>
<script>
function updateMeta() {
- if ({{.Suspended}}) {
+ if ({{.Silenced}}) {
alert("Your account is silenced, so you can't edit posts.");
return
}
document.getElementById('create-error').style.display = 'none';
var $created = document.getElementById('created');
var dateStr = $created.value.trim();
var m = dateStr.match(/^[0-9]{4}-[0-9]{1,2}-[0-9]{1,2}( [0-9]{1,2}:[0-9]{1,2}(:[0-9]{1,2})?)?$/);
if (!m) {
document.getElementById('create-error').style.display = 'block';
return false;
}
// Break up the date and parse. This ensures cross-browser compatibility
var p = dateStr.split(/[^0-9]/);
var d = new Date(p[0], p[1]-1, p[2], p[3] ? p[3] : 0, p[4] ? p[4] : 0, p[5] ? p[5] : 0);
$created.value = d.getUTCFullYear() + '-' + ('0' + (d.getUTCMonth()+1)).slice(-2) + '-' + ('0' + d.getUTCDate()).slice(-2)+' '+('0'+d.getUTCHours()).slice(-2)+':'+('0'+d.getUTCMinutes()).slice(-2)+':'+('0'+d.getUTCSeconds()).slice(-2);
var $tz = document.getElementById('tz');
$tz.style.display = "inline";
var $submit = document.querySelector('input[type=submit]');
$submit.value = "Saving...";
$submit.disabled = true;
return true;
}
function dateToStr(d) {
return d.getFullYear() + '-' + ('0' + (d.getMonth()+1)).slice(-2) + '-' + ('0' + d.getDate()).slice(-2)+' '+('0'+d.getHours()).slice(-2)+':'+('0'+d.getMinutes()).slice(-2)+':'+('0'+d.getSeconds()).slice(-2);
}
function setLocalTime() {
var $created = document.getElementById('created');
var d = new Date($created.getAttribute('data-time'));
$created.value = dateToStr(d);
var $tz = document.getElementById('tz');
$tz.style.display = "none";
}
setLocalTime();
function setToNow() {
var $created = document.getElementById('created');
$created.value = dateToStr(new Date());
}
H.getEl('set-now').on('click', function(e) {
e.preventDefault();
setToNow();
});
function toggleTheme() {
var btns = Array.prototype.slice.call(document.getElementById('tools').querySelectorAll('a img'));
if (document.body.className == 'light') {
document.body.className = 'dark';
for (var i=0; i<btns.length; i++) {
btns[i].src = btns[i].src.replace('_dark@2x.png', '@2x.png');
}
} else {
document.body.className = 'light';
for (var i=0; i<btns.length; i++) {
btns[i].src = btns[i].src.replace('@2x.png', '_dark@2x.png');
}
}
H.set('padTheme', document.body.className);
}
if (H.get('padTheme', 'light') != 'light') {
toggleTheme();
}
var setButtonStates = function() {
if (!canPublish) {
$btnPublish.el.className = 'disabled';
return;
}
if ($writer.el.value.length === 0 || (draftDoc != 'lastDoc' && $writer.el.value == origDoc)) {
$btnPublish.el.className = 'disabled';
} else {
$btnPublish.el.className = '';
}
};
H.getEl('toggle-theme').on('click', function(e) {
e.preventDefault();
try {
var newTheme = 'light';
if (document.body.className == 'light') {
newTheme = 'dark';
}
} catch(e) {}
toggleTheme();
});
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
try {
(function() {
var wf=document.createElement('script');
wf.src = '/js/webfont.js';
wf.type='text/javascript';
wf.async='true';
var s=document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) {
// whatevs
}
</script>
<link href="/css/icons.css" rel="stylesheet">
</body>
</html>{{end}}
diff --git a/templates/pad.tmpl b/templates/pad.tmpl
index a8fca98..d55c549 100644
--- a/templates/pad.tmpl
+++ b/templates/pad.tmpl
@@ -1,367 +1,367 @@
{{define "pad"}}<!DOCTYPE HTML>
<html>
<head>
<title>{{if .Editing}}Editing {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}}{{else}}New Post{{end}} &mdash; {{.SiteName}}</title>
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<meta name="google" value="notranslate">
</head>
<body id="pad" class="light">
<div id="overlay"></div>
<textarea id="writer" placeholder="Write..." class="{{.Post.Font}}" autofocus>{{if .Post.Title}}# {{.Post.Title}}
{{end}}{{.Post.Content}}</textarea>
<header id="tools">
<div id="clip">
{{if not .SingleUser}}<h1><a href="/me/c/" title="View blogs"><img class="ic-24dp" src="/img/ic_blogs_dark@2x.png" /></a></h1>{{end}}
<nav id="target" {{if .SingleUser}}style="margin-left:0"{{end}}><ul>
{{if .Editing}}<li>{{if .EditCollection}}<a href="{{.EditCollection.CanonicalURL}}">{{.EditCollection.Title}}</a>{{else}}<a>Draft</a>{{end}}</li>
{{else}}<li><a id="publish-to"><span id="target-name">Draft</span> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /></a>
<ul>
<li class="menu-heading">Publish to...</li>
{{if .Blogs}}{{range $idx, $el := .Blogs}}
<li class="target{{if eq $idx 0}} selected{{end}}" id="blog-{{$el.Alias}}"><a href="#{{$el.Alias}}"><i class="material-icons md-18">public</i> {{if $el.Title}}{{$el.Title}}{{else}}{{$el.Alias}}{{end}}</a></li>
{{end}}{{end}}
<li class="target" id="blog-anonymous"><a href="#anonymous"><i class="material-icons md-18">description</i> <em>Draft</em></a></li>
<li id="user-separator" class="separator"><hr /></li>
{{ if .SingleUser }}
<li><a href="/"><i class="material-icons md-18">launch</i> View Blog</a></li>
<li><a href="/me/c/{{.Username}}"><i class="material-icons md-18">palette</i> Customize</a></li>
<li><a href="/me/c/{{.Username}}/stats"><i class="material-icons md-18">trending_up</i> Stats</a></li>
{{ else }}
<li><a href="/me/c/"><i class="material-icons md-18">library_books</i> View Blogs</a></li>
{{ end }}
<li><a href="/me/posts/"><i class="material-icons md-18">view_list</i> View Drafts</a></li>
<li><a href="/me/logout"><i class="material-icons md-18">power_settings_new</i> Log out</a></li>
</ul>
</li>{{end}}
</ul></nav>
<nav id="font-picker" class="if-room room-3 hidden" style="margin-left:-1em"><ul>
<li><a href="#" id="" onclick="return false"><img class="ic-24dp" src="/img/ic_font_dark@2x.png" /> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /></a>
<ul style="text-align: center">
<li class="menu-heading">Font</li>
<li class="selected"><a class="font norm" href="#norm">Serif</a></li>
<li><a class="font sans" href="#sans">Sans-serif</a></li>
<li><a class="font wrap" href="#wrap">Monospace</a></li>
</ul>
</li>
</ul></nav>
<span id="wc" class="hidden if-room room-4">0 words</span>
</div>
<noscript style="margin-left: 2em;"><strong>NOTE</strong>: for now, you'll need Javascript enabled to post.</noscript>
<div id="belt">
{{if .Editing}}<div class="tool hidden if-room"><a href="{{if .EditCollection}}{{.EditCollection.CanonicalURL}}{{.Post.Slug}}/edit/meta{{else}}/{{if .SingleUser}}d/{{end}}{{.Post.Id}}/meta{{end}}" title="Edit post metadata" id="edit-meta"><img class="ic-24dp" src="/img/ic_info_dark@2x.png" /></a></div>{{end}}
<div class="tool hidden if-room room-2"><a href="#theme" title="Toggle theme" id="toggle-theme"><img class="ic-24dp" src="/img/ic_brightness_dark@2x.png" /></a></div>
<div class="tool if-room room-1"><a href="{{if not .User}}/pad/posts{{else}}/me/posts/{{end}}" title="View posts" id="view-posts"><img class="ic-24dp" src="/img/ic_list_dark@2x.png" /></a></div>
<div class="tool"><a href="#publish" title="Publish" id="publish"><img class="ic-24dp" src="/img/ic_send_dark@2x.png" /></a></div>
</div>
</header>
<script src="/js/h.js"></script>
<script>
function toggleTheme() {
var btns = Array.prototype.slice.call(document.getElementById('tools').querySelectorAll('a img'));
var newTheme = '';
if (document.body.classList.contains('light')) {
newTheme = 'dark';
document.body.className = document.body.className.replace(/(?:^|\s)light(?!\S)/g, newTheme);
for (var i=0; i<btns.length; i++) {
btns[i].src = btns[i].src.replace('_dark@2x.png', '@2x.png');
}
} else {
newTheme = 'light';
document.body.className = document.body.className.replace(/(?:^|\s)dark(?!\S)/g, newTheme);
for (var i=0; i<btns.length; i++) {
btns[i].src = btns[i].src.replace('@2x.png', '_dark@2x.png');
}
}
H.set('padTheme', newTheme);
}
if (H.get('padTheme', 'light') != 'light') {
toggleTheme();
}
var $writer = H.getEl('writer');
var $btnPublish = H.getEl('publish');
var $wc = H.getEl("wc");
var updateWordCount = function() {
var words = 0;
var val = $writer.el.value.trim();
if (val != '') {
words = $writer.el.value.trim().replace(/\s+/gi, ' ').split(' ').length;
}
$wc.el.innerText = words + " word" + (words != 1 ? "s" : "");
};
var setButtonStates = function() {
if (!canPublish) {
$btnPublish.el.className = 'disabled';
return;
}
if ($writer.el.value.length === 0 || (draftDoc != 'lastDoc' && $writer.el.value == origDoc)) {
$btnPublish.el.className = 'disabled';
} else {
$btnPublish.el.className = '';
}
};
{{if .Post.Id}}var draftDoc = 'draft{{.Post.Id}}';
var origDoc = '{{.Post.Content}}';{{else}}var draftDoc = 'lastDoc';{{end}}
H.load($writer, draftDoc, true);
updateWordCount();
var typingTimer;
var doneTypingInterval = 200;
var posts;
{{if and .Post.Id (not .Post.Slug)}}
var token = null;
var curPostIdx;
posts = JSON.parse(H.get('posts', '[]'));
for (var i=0; i<posts.length; i++) {
if (posts[i].id == "{{.Post.Id}}") {
token = posts[i].token;
break;
}
}
var canPublish = token != null;
{{else}}var canPublish = true;{{end}}
var publishing = false;
var justPublished = false;
- var suspended = {{.Suspended}};
+ var silenced = {{.Silenced}};
var publish = function(content, font) {
- if (suspended === true) {
+ if (silenced === true) {
alert("Your account is silenced, so you can't publish or update posts.");
return;
}
{{if and (and .Post.Id (not .Post.Slug)) (not .User)}}
if (!token) {
alert("You don't have permission to update this post.");
return;
}
if ($btnPublish.el.className == 'disabled') {
return;
}
{{end}}
$btnPublish.el.children[0].textContent = 'more_horiz';
publishing = true;
var xpostTarg = H.get('crosspostTarget', '[]');
var http = new XMLHttpRequest();
var lang = navigator.languages ? navigator.languages[0] : (navigator.language || navigator.userLanguage);
lang = lang.substring(0, 2);
var post = H.getTitleStrict(content);
var params = {
body: post.content,
title: post.title,
font: font,
lang: lang
};
{{ if .Post.Slug }}
var url = "/api/collections/{{.EditCollection.Alias}}/posts/{{.Post.Id}}";
{{ else if .Post.Id }}
var url = "/api/posts/{{.Post.Id}}";
if (typeof token === 'undefined' || !token) {
token = "";
}
params.token = token;
{{ else }}
var url = "/api/posts";
var postTarget = H.get('postTarget', 'anonymous');
if (postTarget != 'anonymous') {
url = "/api/collections/" + postTarget + "/posts";
}
params.crosspost = JSON.parse(xpostTarg);
{{ end }}
http.open("POST", url, true);
// Send the proper header information along with the request
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
publishing = false;
if (http.status == 200 || http.status == 201) {
data = JSON.parse(http.responseText);
id = data.data.id;
nextURL = '{{if .SingleUser}}/d{{end}}/'+id;
{{ if not .Post.Id }}
// Post created
if (postTarget != 'anonymous') {
nextURL = {{if not .SingleUser}}'/'+postTarget+{{end}}'/'+data.data.slug;
}
editToken = data.data.token;
{{ if not .User }}if (postTarget == 'anonymous') {
// Save the data
var posts = JSON.parse(H.get('posts', '[]'));
{{if .Post.Id}}var newPost = H.createPost("{{.Post.Id}}", token, content);
for (var i=0; i<posts.length; i++) {
if (posts[i].id == "{{.Post.Id}}") {
posts[i].title = newPost.title;
posts[i].summary = newPost.summary;
break;
}
}
nextURL = "/pad/posts";{{else}}posts.push(H.createPost(id, editToken, content));{{end}}
H.set('posts', JSON.stringify(posts));
}
{{ end }}
{{ end }}
justPublished = true;
if (draftDoc != 'lastDoc') {
H.remove(draftDoc);
{{if .Editing}}H.remove('draft{{.Post.Id}}font');{{end}}
} else {
H.set(draftDoc, '');
}
{{if .EditCollection}}
window.location = '{{.EditCollection.CanonicalURL}}{{.Post.Slug}}';
{{else}}
window.location = nextURL;
{{end}}
} else {
$btnPublish.el.children[0].textContent = 'send';
alert("Failed to post. Please try again.");
}
}
}
http.send(JSON.stringify(params));
};
setButtonStates();
$writer.on('keyup input', function() {
setButtonStates();
clearTimeout(typingTimer);
typingTimer = setTimeout(doneTyping, doneTypingInterval);
}, false);
$writer.on('keydown', function(e) {
clearTimeout(typingTimer);
if (e.keyCode == 13 && (e.metaKey || e.ctrlKey)) {
$btnPublish.el.click();
}
});
$btnPublish.on('click', function(e) {
e.preventDefault();
if (!publishing && $writer.el.value) {
var content = $writer.el.value;
publish(content, selectedFont);
}
});
H.getEl('toggle-theme').on('click', function(e) {
e.preventDefault();
var newTheme = 'light';
if (document.body.className == 'light') {
newTheme = 'dark';
}
toggleTheme();
});
var targets = document.querySelectorAll('#target li.target a');
for (var i=0; i<targets.length; i++) {
targets[i].addEventListener('click', function(e) {
e.preventDefault();
var targetName = this.href.substring(this.href.indexOf('#')+1);
H.set('postTarget', targetName);
document.querySelector('#target li.target.selected').classList.remove('selected');
this.parentElement.classList.add('selected');
var newText = this.innerText.split(' ');
newText.shift();
document.getElementById('target-name').innerText = newText.join(' ');
});
}
var postTarget = H.get('postTarget', '{{if .Blogs}}{{$blog := index .Blogs 0}}{{$blog.Alias}}{{else}}anonymous{{end}}');
if (location.hash != '') {
postTarget = location.hash.substring(1);
// TODO: pushState to /pad (or whatever the URL is) so we live on a clean URL
location.hash = '';
}
var pte = document.querySelector('#target li.target#blog-'+postTarget+' a');
if (pte != null) {
pte.click();
} else {
postTarget = 'anonymous';
H.set('postTarget', postTarget);
}
var sansLoaded = false;
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
var loadSans = function() {
if (sansLoaded) return;
sansLoaded = true;
WebFontConfig.custom.families.push('Open+Sans:400,700:latin');
try {
(function() {
var wf=document.createElement('script');
wf.src = '/js/webfont.js';
wf.type='text/javascript';
wf.async='true';
var s=document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) {}
};
var fonts = document.querySelectorAll('nav#font-picker a.font');
for (var i=0; i<fonts.length; i++) {
fonts[i].addEventListener('click', function(e) {
e.preventDefault();
selectedFont = this.href.substring(this.href.indexOf('#')+1);
$writer.el.className = selectedFont;
document.querySelector('nav#font-picker li.selected').classList.remove('selected');
this.parentElement.classList.add('selected');
H.set('{{if .Editing}}draft{{.Post.Id}}font{{else}}padFont{{end}}', selectedFont);
if (selectedFont == 'sans') {
loadSans();
}
});
}
var selectedFont = H.get('{{if .Editing}}draft{{.Post.Id}}font{{else}}padFont{{end}}', '{{.Post.Font}}');
var sfe = document.querySelector('nav#font-picker a.font.'+selectedFont);
if (sfe != null) {
sfe.click();
}
var doneTyping = function() {
if (draftDoc == 'lastDoc' || $writer.el.value != origDoc) {
H.save($writer, draftDoc);
updateWordCount();
}
};
window.addEventListener('beforeunload', function(e) {
if (draftDoc != 'lastDoc' && $writer.el.value == origDoc) {
H.remove(draftDoc);
} else if (!justPublished) {
doneTyping();
}
});
try {
(function() {
var wf=document.createElement('script');
wf.src = '/js/webfont.js';
wf.type='text/javascript';
wf.async='true';
var s=document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) {
// whatevs
}
</script>
<link href="/css/icons.css" rel="stylesheet">
</body>
</html>{{end}}
diff --git a/templates/post.tmpl b/templates/post.tmpl
index 52d53a9..e9edfed 100644
--- a/templates/post.tmpl
+++ b/templates/post.tmpl
@@ -1,101 +1,101 @@
{{define "post"}}<!DOCTYPE HTML>
<html {{if .Language}}lang="{{.Language}}"{{end}} dir="{{.Direction}}">
<head prefix="og: http://ogp.me/ns#">
<meta charset="utf-8">
<title>{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}} {{localhtml "title dash" .Language}} {{.SiteName}}</title>
{{if .IsCode}}
<link rel="stylesheet" href="/css/lib/mono-blue.min.css">
{{end}}
<link rel="stylesheet" type="text/css" href="/css/write.css" />
<link rel="shortcut icon" href="/favicon.ico" />
<link rel="canonical" href="{{.Host}}/{{if .SingleUser}}d/{{end}}{{.ID}}" />
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<meta name="generator" content="{{.SiteName}}">
<meta name="title" content="{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}}">
<meta name="description" content="{{.Description}}">
<meta itemprop="name" content="{{.SiteName}}">
<meta itemprop="description" content="{{.Description}}">
<meta name="twitter:card" content="summary">
<meta name="twitter:title" content="{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}}">
<meta name="twitter:description" content="{{.Description}}">
{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
<meta name="twitter:image" content="{{.Host}}/img/wf-sq.png">
<meta property="og:title" content="{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}}" />
<meta property="og:site_name" content="{{.SiteName}}" />
<meta property="og:type" content="article" />
<meta property="og:url" content="{{.Host}}/{{if .SingleUser}}d/{{end}}{{.ID}}" />
<meta property="og:description" content="{{.Description}}" />
<meta property="og:image" content="{{.Host}}/img/wf-sq.png">
{{if .Author}}<meta property="article:author" content="https://{{.Author}}" />{{end}}
<!-- Add highlighting logic -->
{{template "highlighting" .}}
</head>
<body id="post">
<header>
<h1 dir="{{.Direction}}"><a href="/">{{.SiteName}}</a></h1>
<nav>
<span class="views{{if not .IsOwner}} owner-visible{{end}}" dir="ltr"><strong>{{largeNumFmt .Views}}</strong> {{pluralize "view" "views" .Views}}</span>
{{if .IsCode}}<a href="/{{.ID}}.txt" rel="noindex" dir="{{.Direction}}">View raw</a>{{end}}
{{ if .Username }}
{{if .IsOwner}}
<a href="/{{if .SingleUser}}d/{{end}}{{.ID}}/edit" dir="{{.Direction}}">Edit</a>
{{end}}
<a class="xtra-feature dash-nav" href="/me/posts/" dir="{{.Direction}}">Drafts</a>
{{ end }}
</nav>
</header>
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<article class="{{.Font}} h-entry">{{if .Title}}<h2 id="title" class="p-name">{{.Title}}</h2>{{end}}{{ if .IsPlainText }}<p id="post-body" class="e-content">{{.Content}}</p>{{ else }}<div id="post-body" class="e-content">{{.HTMLContent}}</div>{{ end }}</article>
<footer dir="ltr"><hr><nav><p style="font-size: 0.9em">{{localhtml "published with write.as" .Language}}</p></nav></footer>
</body>
{{if .IsCode}}
<script src="/js/highlight.min.js"></script>
<script>
hljs.highlightBlock(document.getElementById('post-body'));
</script>
{{else}}
<script src="/js/h.js"></script>
{{if .IsPlainText}}<script src="/js/twitter-text.min.js"></script>{{end}}
{{end}}
<script type="text/javascript">
try {
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin'{{if eq .Font "sans"}}, 'Open+Sans:400,700:latin'{{end}} ], urls: [ '/css/fonts.css' ] }
};
(function() {
var wf = document.createElement('script');
wf.src = '/js/webfont.js';
wf.type = 'text/javascript';
wf.async = 'true';
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) { /* ¯\_(ツ)_/¯ */ }
var posts = localStorage.getItem('posts');
if (posts != null) {
posts = JSON.parse(posts);
var $nav = document.getElementsByTagName('nav')[0];
for (var i=0; i<posts.length; i++) {
if (posts[i].id == "{{.ID}}") {
$nav.innerHTML = $nav.innerHTML + '<a class="xtra-feature" href="/edit/{{.ID}}" dir="{{.Direction}}">Edit</a>';
var $ownerVis = document.querySelectorAll('.owner-visible');
for (var i=0; i<$ownerVis.length; i++) {
$ownerVis[i].classList.remove('owner-visible');
}
break;
}
}
}
</script>
</html>{{end}}
diff --git a/templates/user/admin/view-user.tmpl b/templates/user/admin/view-user.tmpl
index 7a7446c..8e5d87b 100644
--- a/templates/user/admin/view-user.tmpl
+++ b/templates/user/admin/view-user.tmpl
@@ -1,160 +1,160 @@
{{define "view-user"}}
{{template "header" .}}
<style>
table.classy th {
text-align: left;
}
h3 {
font-weight: normal;
}
-td.active-suspend {
+td.active-silence {
display: flex;
align-items: center;
}
-td.active-suspend > input[type="submit"] {
+td.active-silence > input[type="submit"] {
margin-left: auto;
margin-right: 5%;
}
@media only screen and (max-width: 500px) {
- td.active-suspend {
+ td.active-silence {
flex-wrap: wrap;
}
- td.active-suspend > input[type="submit"] {
+ td.active-silence > input[type="submit"] {
margin: auto;
}
}
input.copy-text {
text-align: center;
font-size: 1.2em;
color: #555;
width: 100%;
box-sizing: border-box;
}
</style>
<div class="snug content-container">
{{template "admin-header" .}}
<h2 id="posts-header">{{.User.Username}}</h2>
{{if .NewPassword}}<div class="alert success">
<p>This user's password has been reset to:</p>
<p><input type="text" class="copy-text" value="{{.NewPassword}}" onfocus="if (this.select) this.select(); else this.setSelectionRange(0, this.value.length);" readonly /></p>
<p>They can use this new password to log in to their account. <strong>This will only be shown once</strong>, so be sure to copy it and send it to them now.</p>
{{if .ClearEmail}}<p>Their email address is: <a href="mailto:{{.ClearEmail}}">{{.ClearEmail}}</a></p>{{end}}
</div>
{{end}}
<table class="classy export">
<tr>
<th>No.</th>
<td>{{.User.ID}}</td>
</tr>
<tr>
<th>Type</th>
<td>{{if .User.IsAdmin}}Admin{{else}}User{{end}}</td>
</tr>
<tr>
<th>Username</th>
<td>{{.User.Username}}</td>
</tr>
<tr>
<th>Joined</th>
<td>{{.User.CreatedFriendly}}</td>
</tr>
<tr>
<th>Total Posts</th>
<td>{{.TotalPosts}}</td>
</tr>
<tr>
<th>Last Post</th>
<td>{{if .LastPost}}{{.LastPost}}{{else}}Never{{end}}</td>
</tr>
<tr>
<form action="/admin/user/{{.User.Username}}/status" method="POST" {{if not .User.IsSilenced}}onsubmit="return confirmSilence()"{{end}}>
<a id="status"/>
<th>Status</th>
- <td class="active-suspend">
+ <td class="active-silence">
{{if .User.IsSilenced}}
<p>Silenced</p>
<input type="submit" value="Unsilence"/>
{{else}}
<p>Active</p>
<input class="danger" type="submit" value="Silence" {{if .User.IsAdmin}}disabled{{end}}/>
{{end}}
</td>
</form>
</tr>
<tr>
<th>Password</th>
<td>
{{if ne .Username .User.Username}}
<form id="reset-form" action="/admin/user/{{.User.Username}}/passphrase" method="post" autocomplete="false">
<input type="hidden" name="user" value="{{.User.ID}}"/>
<button type="submit">Reset</button>
</form>
{{else}}
<a href="/me/settings" title="Go to reset password page">Change your password</a>
{{end}}
</td>
</tr>
</table>
<h2>Blogs</h2>
{{range .Colls}}
<h3><a href="/{{.Alias}}/">{{.Title}}</a></h3>
<table class="classy export">
<tr>
<th>Alias</th>
<td>{{.Alias}}</td>
</tr>
<tr>
<th>Title</th>
<td>{{.Title}}</td>
</tr>
<tr>
<th>Description</th>
<td>{{.Description}}</td>
</tr>
<tr>
<th>Visibility</th>
<td>{{.FriendlyVisibility}}</td>
</tr>
<tr>
<th>Views</th>
<td>{{.Views}}</td>
</tr>
<tr>
<th>Posts</th>
<td>{{.TotalPosts}}</td>
</tr>
<tr>
<th>Last Post</th>
<td>{{if .LastPost}}{{.LastPost}}{{else}}Never{{end}}</td>
</tr>
{{if $.Config.Federation}}
<tr>
<th>Fediverse Followers</th>
<td>{{.Followers}}</td>
</tr>
{{end}}
</table>
{{end}}
</div>
<script type="text/javascript">
function confirmSilence() {
return confirm("Silence this user? They'll still be able to log in and access their posts, but no one else will be able to see them anymore. You can reverse this decision at any time.");
}
form = document.getElementById("reset-form");
form.addEventListener('submit', function(e) {
e.preventDefault();
agreed = confirm("Reset this user's password? This will generate a new temporary password that you'll need to share with them, and invalidate their old one.");
if (agreed === true) {
form.submit();
}
});
</script>
{{template "footer" .}}
{{end}}
diff --git a/templates/user/articles.tmpl b/templates/user/articles.tmpl
index 16fb4e3..be80cc7 100644
--- a/templates/user/articles.tmpl
+++ b/templates/user/articles.tmpl
@@ -1,152 +1,152 @@
{{define "articles"}}
{{template "header" .}}
<div class="snug content-container">
{{if .Flashes}}<ul class="errors">
{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
</ul>{{end}}
-{{if .Suspended}}
- {{template "user-suspended"}}
+{{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<h2 id="posts-header">drafts</h2>
{{ if .AnonymousPosts }}
<p>These are your draft posts. You can share them individually (without a blog) or move them to your blog when you're ready.</p>
<div class="atoms posts">
{{ range $el := .AnonymousPosts }}<div id="post-{{.ID}}" class="post">
<h3><a href="/{{if $.SingleUser}}d/{{end}}{{.ID}}" itemprop="url">{{.DisplayTitle}}</a></h3>
<h4>
<date datetime="{{.Created}}" pubdate itemprop="datePublished" content="{{.Created}}">{{.DisplayDate}}</date>
<a class="action" href="/{{if $.SingleUser}}d/{{end}}{{.ID}}/edit">edit</a>
<a class="delete action" href="/{{.ID}}" onclick="delPost(event, '{{.ID}}', true)">delete</a>
{{ if $.Collections }}
{{if gt (len $.Collections) 1}}<div class="action flat-select">
<select id="move-{{.ID}}" onchange="postActions.multiMove(this, '{{.ID}}', {{if $.SingleUser}}true{{else}}false{{end}})" title="Move this post to one of your blogs">
<option style="display:none"></option>
{{range $.Collections}}<option value="{{.Alias}}">{{.DisplayTitle}}</option>{{end}}
</select>
<label for="move-{{.ID}}">move to...</label>
<img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" />
</div>{{else}}
{{range $.Collections}}
<a class="action" href="/{{$el.ID}}" title="Publish this post to your blog '{{.DisplayTitle}}'" onclick="postActions.move(this, '{{$el.ID}}', '{{.Alias}}', {{if $.SingleUser}}true{{else}}false{{end}});return false">move to {{.DisplayTitle}}</a>
{{end}}
{{end}}
{{ end }}
</h4>
{{if .Summary}}<p>{{.SummaryHTML}}</p>{{end}}
</div>{{end}}
</div>{{ else }}<div id="no-posts-published">
<p>Your anonymous and draft posts will show up here once you've published some. You'll be able to share them individually (without a blog) or move them to a blog when you're ready.</p>
{{if not .SingleUser}}<p>Alternatively, see your blogs and their posts on your <a href="/me/c/">Blogs</a> page.</p>{{end}}
<p class="text-cta"><a href="{{if .SingleUser}}/me/new{{else}}/{{end}}">Start writing</a></p></div>{{ end }}
<div id="moving"></div>
<h2 id="unsynced-posts-header" style="display: none">unsynced posts</h2>
<div id="unsynced-posts-info" style="margin-top: 1em"></div>
<div id="unsynced-posts" class="atoms"></div>
</div>
<script src="/js/h.js"></script>
<script src="/js/postactions.js"></script>
<script>
var auth = true;
function postsLoaded(n) {
if (n == 0) {
return;
}
document.getElementById('unsynced-posts-header').style.display = 'block';
var syncing = false;
var $pInfo = document.getElementById('unsynced-posts-info');
$pInfo.className = 'alert info';
var plural = n != 1;
$pInfo.innerHTML = '<p>You have <strong>'+n+'</strong> post'+(plural?'s that aren\'t':' that isn\'t')+' synced to your account yet. <a href="#" id="btn-sync">Sync '+(plural?'them':'it')+' now</a>.</p>';
var $noPosts = document.getElementById('no-posts-published');
if ($noPosts != null) {
$noPosts.style.display = 'none';
document.getElementById('posts-header').style.display = 'none';
}
H.getEl('btn-sync').on('click', function(e) {
e.preventDefault();
if (syncing) {
return;
}
var http = new XMLHttpRequest();
var params = [];
var posts = JSON.parse(H.get('posts', '[]'));
if (posts.length > 0) {
for (var i=0; i<posts.length; i++) {
params.push({id: posts[i].id, token: posts[i].token});
}
}
this.style.fontWeight = 'bold';
this.innerText = 'Syncing '+(plural?'them':'it')+' now...';
http.open("POST", "/api/posts/claim", true);
// Send the proper header information along with the request
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
syncing = false;
this.innerText = 'Importing '+(plural?'them':'it')+' now...';
if (http.status == 200) {
var res = JSON.parse(http.responseText);
if (res.data.length > 0) {
if (res.data.length != posts.length) {
// TODO: handle something that royally fucked up
console.error("Request and result array length didn't match!");
return;
}
for (var i=0; i<res.data.length; i++) {
if (res.data[i].code == 200) {
// Post successfully claimed.
for (var j=0; j<posts.length; j++) {
// Find post in local store
if (posts[j].id == res.data[i].post.id) {
// Remove this post
posts.splice(j, 1);
break;
}
}
} else {
for (var j=0; j<posts.length; j++) {
// Find post in local store
if (posts[j].id == res.data[i].id) {
// Note the error in the local post
posts[j].error = res.data[i].error_msg;
break;
}
}
}
}
H.set('posts', JSON.stringify(posts));
location.reload();
}
} else {
// TODO: handle error visually (option to retry)
console.error("Didn't work at all, man.");
this.style.fontWeight = 'normal';
this.innerText = 'Sync '+(plural?'them':'it')+' now';
}
}
}
http.send(JSON.stringify(params));
syncing = true;
});
}
</script>
<script src="/js/posts.js"></script>
{{template "footer" .}}
{{end}}
diff --git a/templates/user/collection.tmpl b/templates/user/collection.tmpl
index edd06c1..5afe421 100644
--- a/templates/user/collection.tmpl
+++ b/templates/user/collection.tmpl
@@ -1,241 +1,241 @@
{{define "upgrade"}}
<p><a href="/me/plan?to=/me/c/{{.Alias}}">Upgrade</a> for <span>$40 / year</span> to edit.</p>
{{end}}
{{define "collection"}}
{{template "header" .}}
<div class="content-container snug">
<div id="overlay"></div>
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<h2>Customize {{.DisplayTitle}} <a href="{{if .SingleUser}}/{{else}}/{{.Alias}}/{{end}}">view blog</a></h2>
{{if .Flashes}}<ul class="errors">
{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
</ul>{{end}}
<form name="customize-form" action="/api/collections/{{.Alias}}" method="post" onsubmit="return disableSubmit()">
<div id="collection-options">
<div style="text-align:center">
<h1><input type="text" name="title" id="title" value="{{.DisplayTitle}}" placeholder="Title" /></h1>
<p><input type="text" name="description" id="description" value="{{.Description}}" placeholder="Description" /></p>
</div>
<div class="option">
<h2><a name="preferred-url"></a>URL</h2>
<div class="section">
{{if eq .Alias .Username}}<p style="font-size: 0.8em">This blog uses your username in its URL{{if .Federation}} and fediverse handle{{end}}. You can change it in your <a href="/me/settings">Account Settings</a>.</p>{{end}}
<ul style="list-style:none">
<li>
{{.FriendlyHost}}/<strong>{{.Alias}}</strong>/
</li>
<li>
<strong id="normal-handle-env" class="fedi-handle" {{if not .Federation}}style="display:none"{{end}}>@<span id="fedi-handle">{{.Alias}}</span>@<span id="fedi-domain">{{.FriendlyHost}}</span></strong>
</li>
</ul>
</div>
</div>
<div class="option">
<h2>Publicity</h2>
<div class="section">
<ul style="list-style:none">
<li>
<label><input type="radio" name="visibility" id="visibility-unlisted" value="0" {{if .IsUnlisted}}checked="checked"{{end}} />
Unlisted
</label>
<p>This blog is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.</p>
</li>
<li>
<label class="option-text"><input type="radio" name="visibility" id="visibility-private" value="2" {{if .IsPrivate}}checked="checked"{{end}} />
Private
</label>
<p>Only you may read this blog (while you're logged in).</p>
</li>
<li>
<label class="option-text"><input type="radio" name="visibility" id="visibility-protected" value="4" {{if .IsProtected}}checked="checked"{{end}} />
Password-protected: <input type="password" class="low-profile" name="password" id="collection-pass" autocomplete="new-password" placeholder="{{if .IsProtected}}xxxxxxxxxxxxxxxx{{else}}a memorable password{{end}}" />
</label>
<p>A password is required to read this blog.</p>
</li>
{{if not .SingleUser}}
<li>
<label class="option-text{{if not .LocalTimeline}} disabled{{end}}"><input type="radio" name="visibility" id="visibility-public" value="1" {{if .IsPublic}}checked="checked"{{end}} {{if not .LocalTimeline}}disabled="disabled"{{end}} />
Public
</label>
{{if .LocalTimeline}}<p>This blog is displayed on the public <a href="/read">reader</a>, and is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.</p>
{{else}}<p>The public reader is currently turned off for this community.</p>{{end}}
</li>
{{end}}
</ul>
</div>
</div>
<div class="option">
<h2>Display Format</h2>
<div class="section">
<p class="explain">Customize how your posts display on your page.
</p>
<ul style="list-style:none">
<li>
<label><input type="radio" name="format" id="format-blog" value="blog" {{if or (not .Format) (eq .Format "blog")}}checked="checked"{{end}} />
Blog
</label>
<p>Dates are shown. Latest posts listed first.</p>
</li>
<li>
<label class="option-text"><input type="radio" name="format" id="format-novel" value="novel" {{if eq .Format "novel"}}checked="checked"{{end}} />
Novel
</label>
<p>No dates shown. Oldest posts first.</p>
</li>
<li>
<label class="option-text"><input type="radio" name="format" id="format-notebook" value="notebook" {{if eq .Format "notebook"}}checked="checked"{{end}} />
Notebook
</label>
<p>No dates shown. Latest posts first.</p>
</li>
</ul>
</div>
</div>
<div class="option">
<h2>Text Rendering</h2>
<div class="section">
<p class="explain">Customize how plain text renders on your blog.</p>
<ul style="list-style:none">
<li>
<label class="option-text disabled"><input type="checkbox" name="markdown" checked="checked" disabled />
Markdown
</label>
</li>
<li>
<label><input type="checkbox" name="mathjax" {{if .RenderMathJax}}checked="checked"{{end}} />
MathJax
</label>
</li>
</ul>
</div>
</div>
<div class="option">
<h2>Custom CSS</h2>
<div class="section">
<textarea id="css-editor" class="section codable" name="style_sheet">{{.StyleSheet}}</textarea>
<p class="explain">See our guide on <a href="https://guides.write.as/customizing/#custom-css">customization</a>.</p>
</div>
</div>
<div class="option" style="text-align: center; margin-top: 4em;">
<input type="submit" id="save-changes" value="Save changes" />
<p><a href="{{if .SingleUser}}/{{else}}/{{.Alias}}/{{end}}">View Blog</a></p>
{{if ne .Alias .Username}}<p><a class="danger" href="#modal-delete" onclick="promptDelete();">Delete Blog...</a></p>{{end}}
</div>
</div>
</form>
</div>
<div id="modal-delete" class="modal">
<h2>Are you sure you want to delete this blog?</h2>
<div class="body short">
<p style="text-align:left">This will permanently erase <strong>{{.DisplayTitle}}</strong> ({{.FriendlyHost}}/{{.Alias}}) from the internet. Any posts on this blog will be saved and made into drafts (found on your <a href="/me/posts/">Drafts</a> page).</p>
<p>If you're sure you want to delete this blog, enter its name in the box below and press <strong>Delete</strong>.</p>
<ul id="delete-errors" class="errors"></ul>
<input id="confirm-text" placeholder="{{.Alias}}" type="text" class="boxy" style="margin-top: 0.5em;" />
<div style="text-align:right; margin-top: 1em;">
<a id="cancel-delete" style="margin-right:2em" href="#">Cancel</a>
<button id="btn-delete" class="danger" onclick="deleteBlog(); return false;">Delete</button>
</div>
</div>
</div>
<script src="/js/h.js"></script>
<script src="/js/ace.js" type="text/javascript" charset="utf-8"></script>
<script>
// Begin shared modal code
function showModal(id) {
document.getElementById('overlay').style.display = 'block';
document.getElementById('modal-'+id).style.display = 'block';
}
var closeModals = function(e) {
e.preventDefault();
document.getElementById('overlay').style.display = 'none';
var modals = document.querySelectorAll('.modal');
for (var i=0; i<modals.length; i++) {
modals[i].style.display = 'none';
}
};
H.getEl('overlay').on('click', closeModals);
H.getEl('cancel-delete').on('click', closeModals);
// end
var deleteBlog = function(e) {
if (document.getElementById('confirm-text').value != '{{.Alias}}') {
document.getElementById('delete-errors').innerHTML = '<li class="urgent">Enter <strong>{{.Alias}}</strong> in the box below.</li>';
return;
}
// Clear errors
document.getElementById('delete-errors').innerHTML = '';
document.getElementById('btn-delete').innerHTML = 'Deleting...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Alias}}?web=1";
http.open("DELETE", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
if (http.status == 204) {
window.location = '/me/c/';
} else {
var data = JSON.parse(http.responseText);
document.getElementById('delete-errors').innerHTML = '<li class="urgent">'+data.error_msg+'</li>';
document.getElementById('btn-delete').innerHTML = 'Delete';
}
}
};
http.send(null);
};
function createHidden(theForm, key, value) {
var input = document.createElement('input');
input.type = 'hidden';
input.name = key;
input.value = value;
theForm.appendChild(input);
}
function disableSubmit() {
var $form = document.forms['customize-form'];
createHidden($form, 'style_sheet', cssEditor.getSession().getValue());
var $btn = document.getElementById("save-changes");
$btn.value = "Saving changes...";
$btn.disabled = true;
return true;
}
function promptDelete() {
showModal("delete");
}
var $fediDomain = document.getElementById('fedi-domain');
var $fediCustomDomain = document.getElementById('fedi-custom-domain');
var $customDomain = document.getElementById('domain-alias');
var $customHandleEnv = document.getElementById('custom-handle-env');
var $normalHandleEnv = document.getElementById('normal-handle-env');
var opt = {
showLineNumbers: false,
showPrintMargin: 0,
};
var theme = "ace/theme/chrome";
var cssEditor = ace.edit("css-editor");
cssEditor.setTheme(theme);
cssEditor.session.setMode("ace/mode/css");
cssEditor.setOptions(opt);
</script>
{{template "footer" .}}
{{end}}
diff --git a/templates/user/collections.tmpl b/templates/user/collections.tmpl
index 7f6e83c..da68dcc 100644
--- a/templates/user/collections.tmpl
+++ b/templates/user/collections.tmpl
@@ -1,114 +1,114 @@
{{define "collections"}}
{{template "header" .}}
<div class="snug content-container">
{{if .Flashes}}<ul class="errors">
{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
</ul>{{end}}
-{{if .Suspended}}
- {{template "user-suspended"}}
+{{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<h2>blogs</h2>
<ul class="atoms collections">
{{range $i, $el := .Collections}}<li class="collection"><h3>
<a class="title" href="/{{.Alias}}/">{{if .Title}}{{.Title}}{{else}}{{.Alias}}{{end}}</a>
</h3>
<h4>
<a class="action new-post" href="{{if $.Chorus}}/new{{else}}/{{end}}#{{.Alias}}">new post</a>
<a class="action" href="/me/c/{{.Alias}}">customize</a>
<a class="action" href="/me/c/{{.Alias}}/stats">stats</a>
</h4>
{{if .Description}}<p class="description">{{.Description}}</p>{{end}}
</li>{{end}}
<li id="create-collection">
{{if not .NewBlogsDisabled}}
<form method="POST" action="/api/collections" id="new-collection-form" onsubmit="return createCollection()">
<h4>
<input type="text" name="title" placeholder="Blog name" id="blog-name">
<input type="hidden" name="web" value="true" />
<input type="submit" value="Create" id="create-collection-btn">
</h4>
</form>
{{end}}
</li>
</ul>
{{if not .NewBlogsDisabled}}<p style="margin-top:0"><a id="new-collection" href="#new-collection">New blog</a></p>{{end}}
</div>
{{template "foot" .}}
<script src="/js/h.js"></script>
<script>
function createCollection() {
var input = He.get('blog-name');
if (input.value == "") {
return false;
}
var form = He.get('new-collection-form');
var submit = He.get('create-collection-btn');
submit.value = "Creating...";
submit.disabled = "disabled";
He.postJSON("/api/collections", {
title: input.value,
web: true
}, function(code, data) {
if (data.code == 201) {
location.reload();
} else {
var $createColl = document.getElementById('create-collection');
var $submit = $createColl.querySelector('input[type=submit]');
$submit.value = "Create";
$submit.disabled = "";
var $err = $createColl.querySelector('.error');
if (data.code == 409) {
if ($err === null) {
var url = He.create('span');
url.className = "error";
url.innerText = "This name is taken.";
$createColl.appendChild(url);
} else {
$err.innerText = "This name is taken.";
}
} else {
if ($err === null) {
var url = He.create('span');
url.className = "error";
url.innerText = data.error_msg;
$createColl.appendChild(url);
} else {
$err.innerText = "This name is taken.";
}
}
}
});
return false;
};
(function() {
H.getEl('new-collection').on('click', function(e) {
e.preventDefault();
var collForm = He.get('create-collection');
if (collForm.style.display == '' || collForm.style.display == 'none') {
// Show form
this.textContent = "Cancel";
collForm.style.display = 'list-item';
collForm.querySelector('input[type=text]').focus();
return;
}
// Hide form
this.textContent = "New blog";
collForm.style.display = 'none';
});
if (location.hash == '#new-collection' || location.hash == '#new') {
var collForm = He.get('create-collection');
collForm.style.display = 'list-item';
collForm.querySelector('input[type=text]').focus();
He.get('new-collection').textContent = "Cancel";
}
}());
</script>
{{template "body-end" .}}
{{end}}
diff --git a/templates/user/include/suspended.tmpl b/templates/user/include/silenced.tmpl
similarity index 86%
rename from templates/user/include/suspended.tmpl
rename to templates/user/include/silenced.tmpl
index 76906de..3b2f3dc 100644
--- a/templates/user/include/suspended.tmpl
+++ b/templates/user/include/silenced.tmpl
@@ -1,5 +1,5 @@
-{{define "user-suspended"}}
+{{define "user-silenced"}}
<div class="alert info">
<p><strong>Your account has been silenced.</strong> You can still access all of your posts and blogs, but no one else can currently see them.</p>
</div>
{{end}}
diff --git a/templates/user/invite.tmpl b/templates/user/invite.tmpl
index 3d94392..ea22f22 100644
--- a/templates/user/invite.tmpl
+++ b/templates/user/invite.tmpl
@@ -1,84 +1,84 @@
{{define "invite"}}
{{template "header" .}}
<style>
.half {
margin-right: 0.5em;
}
.half + .half {
margin-left: 0.5em;
margin-right: 0;
}
table.classy {
width: 100%;
}
table.classy.export a {
text-transform: initial;
}
table td {
font-size: 0.86em;
}
</style>
<div class="snug content-container">
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<h1>Invite people</h1>
<p>Invite others to join <em>{{.SiteName}}</em> by generating and sharing invite links below.</p>
<form style="margin: 2em 0" class="prominent" action="/api/me/invites" method="post">
<div class="row">
<div class="half">
<label for="uses">Maximum number of uses:</label>
- <select id="uses" name="uses" {{if .Suspended}}disabled{{end}}>
+ <select id="uses" name="uses" {{if .Silenced}}disabled{{end}}>
<option value="0">No limit</option>
<option value="1">1 use</option>
<option value="5">5 uses</option>
<option value="10">10 uses</option>
<option value="25">25 uses</option>
<option value="50">50 uses</option>
<option value="100">100 uses</option>
</select>
</div>
<div class="half">
<label for="expires">Expire after:</label>
- <select id="expires" name="expires" {{if .Suspended}}disabled{{end}}>
+ <select id="expires" name="expires" {{if .Silenced}}disabled{{end}}>
<option value="0">Never</option>
<option value="30">30 minutes</option>
<option value="60">1 hour</option>
<option value="360">6 hours</option>
<option value="720">12 hours</option>
<option value="1440">1 day</option>
<option value="4320">3 days</option>
<option value="10080">1 week</option>
</select>
</div>
</div>
<div class="row">
- <input type="submit" value="Generate" {{if .Suspended}}disabled title="You cannot generate invites while your account is silenced."{{end}} />
+ <input type="submit" value="Generate" {{if .Silenced}}disabled title="You cannot generate invites while your account is silenced."{{end}} />
</div>
</form>
<table class="classy export">
<tr>
<th>Link</th>
<th>Uses</th>
<th>Expires</th>
</tr>
{{range .Invites}}
<tr>
<td><a href="{{$.Host}}/invite/{{.ID}}">{{$.Host}}/invite/{{.ID}}</a></td>
<td>{{.Uses}}{{if gt .MaxUses.Int64 0}} / {{.MaxUses.Int64}}{{end}}</td>
<td>{{ if .Expires }}{{if .Expired}}Expired{{else}}{{.ExpiresFriendly}}{{end}}{{ else }}&infin;{{ end }}</td>
</tr>
{{else}}
<tr>
<td colspan="3">No invites generated yet.</td>
</tr>
{{end}}
</table>
</div>
{{template "footer" .}}
{{end}}
diff --git a/templates/user/settings.tmpl b/templates/user/settings.tmpl
index d5cc33d..ab60705 100644
--- a/templates/user/settings.tmpl
+++ b/templates/user/settings.tmpl
@@ -1,86 +1,86 @@
{{define "settings"}}
{{template "header" .}}
<style type="text/css">
.option { margin: 2em 0em; }
h3 { font-weight: normal; }
.section > *:not(input) { font-size: 0.86em; }
</style>
<div class="content-container snug regular">
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<h2>{{if .IsLogOut}}Before you go...{{else}}Account Settings {{if .IsAdmin}}<a href="/admin">admin settings</a>{{end}}{{end}}</h2>
{{if .Flashes}}<ul class="errors">
{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
</ul>{{end}}
{{ if .IsLogOut }}
<div class="alert info">
<p class="introduction">Please add an <strong>email address</strong> and/or <strong>passphrase</strong> so you can log in again later.</p>
</div>
{{ else }}
<div class="option">
<p>Change your account settings here.</p>
</div>
<form method="post" action="/api/me/self" autocomplete="false">
<div class="option">
<h3>Username</h3>
<div class="section">
<input type="text" name="username" value="{{.Username}}" tabindex="1" />
<input type="submit" value="Update" style="margin-left: 1em;" />
</div>
</div>
</form>
{{ end }}
<form method="post" action="/api/me/self" autocomplete="false">
<input type="hidden" name="logout" value="{{.IsLogOut}}" />
<div class="option">
<h3>Passphrase</h3>
<div class="section">
{{if and (not .HasPass) (not .IsLogOut)}}<div class="alert info"><p>Add a passphrase to easily log in to your account.</p></div>{{end}}
{{if .HasPass}}<p>Current passphrase</p>
<input type="password" name="current-pass" placeholder="Current passphrase" tabindex="1" /> <input class="show" type="checkbox" id="show-cur-pass" /><label for="show-cur-pass"> Show</label>
<p>New passphrase</p>
{{end}}
{{if .IsLogOut}}<input type="text" value="{{.Username}}" style="display:none" />{{end}}
<input type="password" name="new-pass" autocomplete="new-password" placeholder="New passphrase" tabindex="{{if .IsLogOut}}1{{else}}2{{end}}" /> <input class="show" type="checkbox" id="show-new-pass" /><label for="show-new-pass"> Show</label>
</div>
</div>
<div class="option">
<h3>Email</h3>
<div class="section">
{{if and (not .Email) (not .IsLogOut)}}<div class="alert info"><p>Add your email to get:</p>
<ul>
<li>No-passphrase login</li>
<li>Account recovery if you forget your passphrase</li>
</ul></div>{{end}}
<input type="email" name="email" style="letter-spacing: 1px" placeholder="Email address" value="{{.Email}}" size="40" tabindex="{{if .IsLogOut}}2{{else}}3{{end}}" />
</div>
</div>
<div class="option" style="text-align: center; margin-top: 4em;">
<input type="submit" value="Save changes" tabindex="4" />
</div>
</form>
</div>
<script>
var showChecks = document.querySelectorAll('input.show');
for (var i=0; i<showChecks.length; i++) {
showChecks[i].addEventListener('click', function() {
var prevEl = this.previousElementSibling;
if (prevEl.type == "password") {
prevEl.type = "text";
} else {
prevEl.type = "password";
}
});
}
</script>
{{template "footer" .}}
{{end}}
diff --git a/templates/user/stats.tmpl b/templates/user/stats.tmpl
index 705f1e0..19cc33b 100644
--- a/templates/user/stats.tmpl
+++ b/templates/user/stats.tmpl
@@ -1,56 +1,56 @@
{{define "stats"}}
{{template "header" .}}
<style>
table.classy th { text-align: left }
table.classy th.num { text-align: right }
td + td {
padding-left: 0.5em;
padding-right: 0.5em;
}
td.num {
text-align: right;
}
table.classy.export a { text-transform: inherit; }
td.none {
font-style: italic;
}
</style>
<div class="content-container snug">
- {{if .Suspended}}
- {{template "user-suspended"}}
+ {{if .Silenced}}
+ {{template "user-silenced"}}
{{end}}
<h2 id="posts-header">{{if .Collection}}{{.Collection.DisplayTitle}} {{end}}Stats</h2>
<p>Stats for all time.</p>
{{if .Federation}}
<h3>Fediverse stats</h3>
<table id="fediverse" class="classy export">
<tr>
<th>Followers</th>
</tr>
<tr>
<td>{{.APFollowers}}</td>
</tr>
</table>
{{end}}
<h3>Top {{len .TopPosts}} posts</h3>
<table class="classy export">
<tr>
<th>Post</th>
{{if not .Collection}}<th>Blog</th>{{end}}
<th class="num">Total Views</th>
</tr>
{{range .TopPosts}}<tr>
<td style="word-break: break-all;"><a href="{{if .Collection}}{{.Collection.CanonicalURL}}{{.Slug.String}}{{else}}/{{.ID}}{{end}}">{{if ne .Title.String ""}}{{.Title.String}}{{else}}<em>{{.ID}}</em>{{end}}</a></td>
{{ if not $.Collection }}<td>{{if .Collection}}<a href="{{.Collection.CanonicalURL}}">{{.Collection.Title}}</a>{{else}}<em>Draft</em>{{end}}</td>{{ end }}
<td class="num">{{.ViewCount}}</td>
</tr>{{end}}
</table>
</div>
{{template "footer" .}}
{{end}}
diff --git a/webfinger.go b/webfinger.go
index d9976f9..61f6867 100644
--- a/webfinger.go
+++ b/webfinger.go
@@ -1,140 +1,140 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"encoding/json"
"io/ioutil"
"net/http"
"strings"
"github.com/writeas/go-webfinger"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"github.com/writeas/writefreely/config"
)
type wfResolver struct {
db *datastore
cfg *config.Config
}
var wfUserNotFoundErr = impart.HTTPError{http.StatusNotFound, "User not found."}
func (wfr wfResolver) FindUser(username string, host, requestHost string, r []webfinger.Rel) (*webfinger.Resource, error) {
var c *Collection
var err error
if wfr.cfg.App.SingleUser {
c, err = wfr.db.GetCollectionByID(1)
} else {
c, err = wfr.db.GetCollection(username)
}
if err != nil {
log.Error("Unable to get blog: %v", err)
return nil, err
}
- suspended, err := wfr.db.IsUserSuspended(c.OwnerID)
+ silenced, err := wfr.db.IsUserSilenced(c.OwnerID)
if err != nil {
- log.Error("webfinger find user: check is suspended: %v", err)
+ log.Error("webfinger find user: check is silenced: %v", err)
return nil, err
}
- if suspended {
+ if silenced {
return nil, wfUserNotFoundErr
}
c.hostName = wfr.cfg.App.Host
if wfr.cfg.App.SingleUser {
// Ensure handle matches user-chosen one on single-user blogs
if username != c.Alias {
log.Info("Username '%s' is not handle '%s'", username, c.Alias)
return nil, wfUserNotFoundErr
}
}
// Only return information if site has federation enabled.
// TODO: enable two levels of federation? Unlisted or Public on timelines?
if !wfr.cfg.App.Federation {
return nil, wfUserNotFoundErr
}
res := webfinger.Resource{
Subject: "acct:" + username + "@" + host,
Aliases: []string{
c.CanonicalURL(),
c.FederatedAccount(),
},
Links: []webfinger.Link{
{
HRef: c.CanonicalURL(),
Type: "text/html",
Rel: "https://webfinger.net/rel/profile-page",
},
{
HRef: c.FederatedAccount(),
Type: "application/activity+json",
Rel: "self",
},
},
}
return &res, nil
}
func (wfr wfResolver) DummyUser(username string, hostname string, r []webfinger.Rel) (*webfinger.Resource, error) {
return nil, wfUserNotFoundErr
}
func (wfr wfResolver) IsNotFoundError(err error) bool {
return err == wfUserNotFoundErr
}
// RemoteLookup looks up a user by handle at a remote server
// and returns the actor URL
func RemoteLookup(handle string) string {
handle = strings.TrimLeft(handle, "@")
// let's take the server part of the handle
parts := strings.Split(handle, "@")
resp, err := http.Get("https://" + parts[1] + "/.well-known/webfinger?resource=acct:" + handle)
if err != nil {
log.Error("Error performing webfinger request", err)
return ""
}
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
log.Error("Error reading webfinger response", err)
return ""
}
var result webfinger.Resource
err = json.Unmarshal(body, &result)
if err != nil {
log.Error("Unsupported webfinger response received: %v", err)
return ""
}
var href string
// iterate over webfinger links and find the one with
// a self "rel"
for _, link := range result.Links {
if link.Rel == "self" {
href = link.HRef
}
}
// if we didn't find it with the above then
// try using aliases
if href == "" {
// take the last alias because mastodon has the
// https://instance.tld/@user first which
// doesn't work as an href
href = result.Aliases[len(result.Aliases)-1]
}
return href
}

File Metadata

Mime Type
text/x-diff
Expires
Sat, Nov 23, 3:43 PM (1 d, 5 h)
Storage Engine
blob
Storage Format
Raw Data
Storage Handle
3104592

Event Timeline