diff --git a/README.md b/README.md
index c165820..7831e57 100644
--- a/README.md
+++ b/README.md
@@ -1,89 +1,89 @@
WriteFreely is a clean, minimalist publishing platform made for writers. Start a blog, share knowledge within your organization, or build a community around the shared act of writing.
![](https://writefreely.org/img/screens/pencil-reader.png)
[Try the writing experience](https://write.as/new)
[Find an instance](https://writefreely.org/instances)
## Features
### Made for writing
Built on a plain, auto-saving editor, WriteFreely gives you a distraction-free writing environment. Once published, your words are front and center, and easy to read.
### A connected community
Start writing together, publicly or privately. Connect with other communities, whether running WriteFreely, [Plume](https://joinplu.me/), or other ActivityPub-powered software. And bring members on board from your existing platforms, thanks to our OAuth 2.0 support.
### Intuitive organization
Categorize articles [with hashtags](https://writefreely.org/docs/latest/writer/hashtags), and create static pages from normal posts by [_pinning_ them](https://writefreely.org/docs/latest/writer/static) to your blog. Create draft posts and publish to multiple blogs from one account.
### International
Blog elements are localized in 20+ languages, and WriteFreely includes first-class support for non-Latin and right-to-left (RTL) script languages.
### Private by default
WriteFreely collects minimal data, and never publicizes more than a writer consents to. Writers can seamlessly create multiple blogs from a single account for different pen names or purposes without publicly revealing their association.
The quickest way to deploy WriteFreely is with [Write.as](https://write.as/writefreely), a hosted service from the team behind WriteFreely. You'll get fully-managed installation, backup, upgrades, and maintenance — and directly fund our free software work ❤️
[**Learn more on Write.as**](https://write.as/writefreely).
## Quick start
WriteFreely deploys as a static binary on any platform and architecture that Go supports. Just use our built-in SQLite support, or add a MySQL database, and you'll be up and running!
For common platforms, start with our [pre-built binaries](https://github.com/writefreely/writefreely/releases/) and head over to our [installation guide](https://writefreely.org/start) to get started.
### Packages
You can also find WriteFreely in these package repositories, thanks to our wonderful community!
* [Arch User Repository](https://aur.archlinux.org/packages/writefreely/)
## Documentation
Read our full [documentation on WriteFreely.org](https://writefreely.org/docs) —️ and help us improve by contributing to the [writefreely/documentation](https://github.com/writefreely/documentation) repo.
## Development
Start hacking on WriteFreely with our [developer setup guide](https://writefreely.org/docs/latest/developer/setup). For Docker support, see our [Docker guide](https://writefreely.org/docs/latest/admin/docker).
## Contributing
We gladly welcome contributions to WriteFreely, whether in the form of [code](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely), [bug reports](https://github.com/writefreely/writefreely/issues/new?template=bug_report.md), [feature requests](https://discuss.write.as/c/feedback/feature-requests), [translations](https://poeditor.com/join/project/TIZ6HFRFdE), or [documentation](https://github.com/writefreely/documentation) improvements.
Before contributing anything, please read our [Contributing Guide](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely). It describes the correct channels for submitting contributions and any potential requirements.
## License
-Copyright © 2018-2021 [A Bunch Tell LLC](https://abunchtell.com) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE).
+Copyright © 2018-2022 [Musing Studio LLC](https://musing.studio) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE).
diff --git a/account.go b/account.go
index 6ab73bd..0f0c0fa 100644
--- a/account.go
+++ b/account.go
@@ -1,1245 +1,1245 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"encoding/json"
"fmt"
"html/template"
"net/http"
"regexp"
"strconv"
"strings"
"sync"
"time"
"github.com/gorilla/csrf"
"github.com/gorilla/mux"
"github.com/gorilla/sessions"
"github.com/guregu/null/zero"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/data"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/author"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/page"
)
type (
userSettings struct {
Username string `schema:"username" json:"username"`
Email string `schema:"email" json:"email"`
NewPass string `schema:"new-pass" json:"new_pass"`
OldPass string `schema:"current-pass" json:"current_pass"`
IsLogOut bool `schema:"logout" json:"logout"`
}
UserPage struct {
page.StaticPage
PageTitle string
Separator template.HTML
IsAdmin bool
CanInvite bool
CollAlias string
}
)
func NewUserPage(app *App, r *http.Request, u *User, title string, flashes []string) *UserPage {
up := &UserPage{
StaticPage: pageForReq(app, r),
PageTitle: title,
}
up.Username = u.Username
up.Flashes = flashes
up.Path = r.URL.Path
up.IsAdmin = u.IsAdmin()
up.CanInvite = canUserInvite(app.cfg, up.IsAdmin)
return up
}
func canUserInvite(cfg *config.Config, isAdmin bool) bool {
return cfg.App.UserInvites != "" &&
(isAdmin || cfg.App.UserInvites != "admin")
}
func (up *UserPage) SetMessaging(u *User) {
// up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID)
}
const (
loginAttemptExpiration = 3 * time.Second
)
var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead")
func apiSignup(app *App, w http.ResponseWriter, r *http.Request) error {
_, err := signup(app, w, r)
return err
}
func signup(app *App, w http.ResponseWriter, r *http.Request) (*AuthUser, error) {
if app.cfg.App.DisablePasswordAuth {
err := ErrDisabledPasswordAuth
return nil, err
}
reqJSON := IsJSON(r)
// Get params
var ur userRegistration
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&ur)
if err != nil {
log.Error("Couldn't parse signup JSON request: %v\n", err)
return nil, ErrBadJSON
}
} else {
// Check if user is already logged in
u := getUserSession(app, r)
if u != nil {
return &AuthUser{User: u}, nil
}
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse signup form request: %v\n", err)
return nil, ErrBadFormData
}
err = app.formDecoder.Decode(&ur, r.PostForm)
if err != nil {
log.Error("Couldn't decode signup form request: %v\n", err)
return nil, ErrBadFormData
}
}
return signupWithRegistration(app, ur, w, r)
}
func signupWithRegistration(app *App, signup userRegistration, w http.ResponseWriter, r *http.Request) (*AuthUser, error) {
reqJSON := IsJSON(r)
// Validate required params (alias)
if signup.Alias == "" {
return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."}
}
if signup.Pass == "" {
return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."}
}
var desiredUsername string
if signup.Normalize {
// With this option we simply conform the username to what we expect
// without complaining. Since they might've done something funny, like
// enter: write.as/Way Out There, we'll use their raw input for the new
// collection name and sanitize for the slug / username.
desiredUsername = signup.Alias
signup.Alias = getSlug(signup.Alias, "")
}
if !author.IsValidUsername(app.cfg, signup.Alias) {
// Ensure the username is syntactically correct.
return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."}
}
// Handle empty optional params
hashedPass, err := auth.HashPass([]byte(signup.Pass))
if err != nil {
return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
// Create struct to insert
u := &User{
Username: signup.Alias,
HashedPass: hashedPass,
HasPass: true,
Email: prepareUserEmail(signup.Email, app.keys.EmailKey),
Created: time.Now().Truncate(time.Second).UTC(),
}
// Create actual user
if err := app.db.CreateUser(app.cfg, u, desiredUsername, signup.Description); err != nil {
return nil, err
}
// Log invite if needed
if signup.InviteCode != "" {
err = app.db.CreateInvitedUser(signup.InviteCode, u.ID)
if err != nil {
return nil, err
}
}
// Add back unencrypted data for response
if signup.Email != "" {
u.Email.String = signup.Email
}
resUser := &AuthUser{
User: u,
}
title := signup.Alias
if signup.Normalize {
title = desiredUsername
}
resUser.Collections = &[]Collection{
{
Alias: signup.Alias,
Title: title,
Description: signup.Description,
},
}
var coll *Collection
if signup.Monetization != "" {
if coll == nil {
coll, err = app.db.GetCollection(signup.Alias)
if err != nil {
log.Error("Unable to get new collection '%s' for monetization on signup: %v", signup.Alias, err)
return nil, err
}
}
err = app.db.SetCollectionAttribute(coll.ID, "monetization_pointer", signup.Monetization)
if err != nil {
log.Error("Unable to add monetization on signup: %v", err)
return nil, err
}
coll.Monetization = signup.Monetization
}
var token string
if reqJSON && !signup.Web {
token, err = app.db.GetAccessToken(u.ID)
if err != nil {
return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
}
resUser.AccessToken = token
} else {
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
// Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144
log.Error("Session: %v; ignoring", err)
}
session.Values[cookieUserVal] = resUser.User.Cookie()
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session: %v", err)
return nil, err
}
}
if reqJSON {
return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated)
}
return resUser, nil
}
func viewLogout(app *App, w http.ResponseWriter, r *http.Request) error {
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
return ErrInternalCookieSession
}
// Ensure user has an email or password set before they go, so they don't
// lose access to their account.
val := session.Values[cookieUserVal]
var u = &User{}
var ok bool
if u, ok = val.(*User); !ok {
log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values)
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session on logout: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
}
return impart.HTTPError{http.StatusFound, "/"}
}
u, err = app.db.GetUserByID(u.ID)
if err != nil && err != ErrUserNotFound {
return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."}
}
session.Options.MaxAge = -1
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session on logout: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
}
return impart.HTTPError{http.StatusFound, "/"}
}
func handleAPILogout(app *App, w http.ResponseWriter, r *http.Request) error {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
t := auth.GetToken(accessToken)
if len(t) == 0 {
return ErrNoAccessToken
}
err := app.db.DeleteToken(t)
if err != nil {
return err
}
return impart.HTTPError{Status: http.StatusNoContent}
}
func viewLogin(app *App, w http.ResponseWriter, r *http.Request) error {
var earlyError string
oneTimeToken := r.FormValue("with")
if oneTimeToken != "" {
log.Info("Calling login with one-time token.")
err := login(app, w, r)
if err != nil {
log.Info("Received error: %v", err)
earlyError = fmt.Sprintf("%s", err)
}
}
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session; ignoring: %v", err)
}
p := &struct {
page.StaticPage
*OAuthButtons
To string
Message template.HTML
Flashes []template.HTML
LoginUsername string
}{
StaticPage: pageForReq(app, r),
OAuthButtons: NewOAuthButtons(app.Config()),
To: r.FormValue("to"),
Message: template.HTML(""),
Flashes: []template.HTML{},
LoginUsername: getTempInfo(app, "login-user", r, w),
}
if earlyError != "" {
p.Flashes = append(p.Flashes, template.HTML(earlyError))
}
// Display any error messages
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
err = pages["login.tmpl"].ExecuteTemplate(w, "base", p)
if err != nil {
log.Error("Unable to render login: %v", err)
return err
}
return nil
}
func webLogin(app *App, w http.ResponseWriter, r *http.Request) error {
err := login(app, w, r)
if err != nil {
username := r.FormValue("alias")
// Login request was unsuccessful; save the error in the session and redirect them
if err, ok := err.(impart.HTTPError); ok {
session, _ := app.sessionStore.Get(r, cookieName)
if session != nil {
session.AddFlash(err.Message)
session.Save(r, w)
}
if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 {
// Retain fixed username recommendation for the login form
username = m[1]
}
}
// Pass along certain information
saveTempInfo(app, "login-user", username, r, w)
// Retain post-login URL if one was given
redirectTo := "/login"
postLoginRedirect := r.FormValue("to")
if postLoginRedirect != "" {
redirectTo += "?to=" + postLoginRedirect
}
log.Error("Unable to login: %v", err)
return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo}
}
return nil
}
var loginAttemptUsers = sync.Map{}
func login(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
oneTimeToken := r.FormValue("with")
verbose := r.FormValue("all") == "true" || r.FormValue("verbose") == "1" || r.FormValue("verbose") == "true" || (reqJSON && oneTimeToken != "")
redirectTo := r.FormValue("to")
if redirectTo == "" {
if app.cfg.App.SingleUser {
redirectTo = "/me/new"
} else {
redirectTo = "/"
}
}
var u *User
var err error
var signin userCredentials
if app.cfg.App.DisablePasswordAuth {
err := ErrDisabledPasswordAuth
return err
}
// Log in with one-time token if one is given
if oneTimeToken != "" {
log.Info("Login: Logging user in via token.")
userID := app.db.GetUserID(oneTimeToken)
if userID == -1 {
log.Error("Login: Got user -1 from token")
err := ErrBadAccessToken
err.Message = "Expired or invalid login code."
return err
}
log.Info("Login: Found user %d.", userID)
u, err = app.db.GetUserByID(userID)
if err != nil {
log.Error("Unable to fetch user on one-time token login: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."}
}
log.Info("Login: Got user via token")
} else {
// Get params
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&signin)
if err != nil {
log.Error("Couldn't parse signin JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse signin form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&signin, r.PostForm)
if err != nil {
log.Error("Couldn't decode signin form request: %v\n", err)
return ErrBadFormData
}
}
log.Info("Login: Attempting login for '%s'", signin.Alias)
// Validate required params (all)
if signin.Alias == "" {
msg := "Parameter `alias` required."
if signin.Web {
msg = "A username is required."
}
return impart.HTTPError{http.StatusBadRequest, msg}
}
if !signin.EmailLogin && signin.Pass == "" {
msg := "Parameter `pass` required."
if signin.Web {
msg = "A password is required."
}
return impart.HTTPError{http.StatusBadRequest, msg}
}
// Prevent excessive login attempts on the same account
// Skip this check in dev environment
if !app.cfg.Server.Dev {
now := time.Now()
attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration))
if att {
if attemptExpTime, ok := attemptExp.(time.Time); ok {
if attemptExpTime.After(now) {
// This user attempted previously, and the period hasn't expired yet
return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."}
} else {
// This user attempted previously, but the time expired; free up space
loginAttemptUsers.Delete(signin.Alias)
}
} else {
log.Error("Unable to cast expiration to time")
}
}
}
// Retrieve password
u, err = app.db.GetUserForAuth(signin.Alias)
if err != nil {
log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err)
if strings.IndexAny(signin.Alias, "@") > 0 {
log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message)
return ErrUserNotFoundEmail
}
return err
}
// Authenticate
if u.Email.String == "" {
// User has no email set, so check if they haven't added a password, either,
// so we can return a more helpful error message.
if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass {
log.Info("Tried logging in to %s, but no password or email.", signin.Alias)
return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."}
}
}
if len(u.HashedPass) == 0 {
return impart.HTTPError{http.StatusUnauthorized, "This user never set a password. Perhaps try logging in via OAuth?"}
}
if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
}
if reqJSON && !signin.Web {
var token string
if r.Header.Get("User-Agent") == "" {
// Get last created token when User-Agent is empty
token = app.db.FetchLastAccessToken(u.ID)
if token == "" {
token, err = app.db.GetAccessToken(u.ID)
}
} else {
token, err = app.db.GetAccessToken(u.ID)
}
if err != nil {
log.Error("Login: Unable to create access token: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
}
resUser := getVerboseAuthUser(app, token, u, verbose)
return impart.WriteSuccess(w, resUser, http.StatusOK)
}
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
log.Error("Login: Session: %v; ignoring", err)
}
// Remove unwanted data
session.Values[cookieUserVal] = u.Cookie()
err = session.Save(r, w)
if err != nil {
log.Error("Login: Couldn't save session: %v", err)
// TODO: return error
}
// Send success
if reqJSON {
return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK)
}
log.Info("Login: Redirecting to %s", redirectTo)
w.Header().Set("Location", redirectTo)
w.WriteHeader(http.StatusFound)
return nil
}
func getVerboseAuthUser(app *App, token string, u *User, verbose bool) *AuthUser {
resUser := &AuthUser{
AccessToken: token,
User: u,
}
// Fetch verbose user data if requested
if verbose {
posts, err := app.db.GetUserPosts(u)
if err != nil {
log.Error("Login: Unable to get user posts: %v", err)
}
colls, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("Login: Unable to get user collections: %v", err)
}
passIsSet, err := app.db.IsUserPassSet(u.ID)
if err != nil {
// TODO: correct error meesage
log.Error("Login: Unable to get user collections: %v", err)
}
resUser.Posts = posts
resUser.Collections = colls
resUser.User.HasPass = passIsSet
}
return resUser
}
func viewExportOptions(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
// Fetch extra user data
p := NewUserPage(app, r, u, "Export", nil)
showUserPage(w, "export", p)
return nil
}
func viewExportPosts(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) {
var filename string
var u = &User{}
reqJSON := IsJSON(r)
if reqJSON {
// Use given Authorization header
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return nil, filename, ErrNoAccessToken
}
userID := app.db.GetUserID(accessToken)
if userID == -1 {
return nil, filename, ErrBadAccessToken
}
var err error
u, err = app.db.GetUserByID(userID)
if err != nil {
return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."}
}
} else {
// Use user cookie
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
log.Error("Session: %v; ignoring", err)
}
val := session.Values[cookieUserVal]
var ok bool
if u, ok = val.(*User); !ok {
return nil, filename, ErrNotLoggedIn
}
}
filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")
// Fetch data we're exporting
var err error
var data []byte
posts, err := app.db.GetUserPosts(u)
if err != nil {
return data, filename, err
}
// Export as CSV
if strings.HasSuffix(r.URL.Path, ".csv") {
data = exportPostsCSV(app.cfg.App.Host, u, posts)
return data, filename, err
}
if strings.HasSuffix(r.URL.Path, ".zip") {
data = exportPostsZip(u, posts)
return data, filename, err
}
if r.FormValue("pretty") == "1" {
data, err = json.MarshalIndent(posts, "", "\t")
} else {
data, err = json.Marshal(posts)
}
return data, filename, err
}
func viewExportFull(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) {
var err error
filename := ""
u := getUserSession(app, r)
if u == nil {
return nil, filename, ErrNotLoggedIn
}
filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")
exportUser := compileFullExport(app, u)
var data []byte
if r.FormValue("pretty") == "1" {
data, err = json.MarshalIndent(exportUser, "", "\t")
} else {
data, err = json.Marshal(exportUser)
}
return data, filename, err
}
func viewMeAPI(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
uObj := struct {
ID int64 `json:"id,omitempty"`
Username string `json:"username,omitempty"`
}{}
var err error
if reqJSON {
_, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization"))
if err != nil {
return err
}
} else {
u := getUserSession(app, r)
if u == nil {
return impart.WriteSuccess(w, uObj, http.StatusOK)
}
uObj.Username = u.Username
}
return impart.WriteSuccess(w, uObj, http.StatusOK)
}
func viewMyPostsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
if !reqJSON {
return ErrBadRequestedType
}
isAnonPosts := r.FormValue("anonymous") == "1"
if isAnonPosts {
pageStr := r.FormValue("page")
pg, err := strconv.Atoi(pageStr)
if err != nil {
log.Error("Error parsing page parameter '%s': %s", pageStr, err)
pg = 1
}
p, err := app.db.GetAnonymousPosts(u, pg)
if err != nil {
return err
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
var err error
p := GetPostsCache(u.ID)
if p == nil {
userPostsCache.Lock()
if userPostsCache.users[u.ID].ready == nil {
userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})}
userPostsCache.Unlock()
p, err = app.db.GetUserPosts(u)
if err != nil {
return err
}
CachePosts(u.ID, p)
} else {
userPostsCache.Unlock()
<-userPostsCache.users[u.ID].ready
p = GetPostsCache(u.ID)
}
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func viewMyCollectionsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
if !reqJSON {
return ErrBadRequestedType
}
p, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
return err
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func viewArticles(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p, err := app.db.GetAnonymousPosts(u, 1)
if err != nil {
log.Error("unable to fetch anon posts: %v", err)
}
// nil-out AnonymousPosts slice for easy detection in the template
if p != nil && len(*p) == 0 {
p = nil
}
f, err := getSessionFlashes(app, w, r, nil)
if err != nil {
log.Error("unable to fetch flashes: %v", err)
}
c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view articles: %v", err)
}
d := struct {
*UserPage
AnonymousPosts *[]PublicPost
Collections *[]Collection
Silenced bool
}{
UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f),
AnonymousPosts: p,
Collections: c,
Silenced: silenced,
}
d.UserPage.SetMessaging(u)
w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT")
showUserPage(w, "articles", d)
return nil
}
func viewCollections(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
c, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
return fmt.Errorf("No collections")
}
f, _ := getSessionFlashes(app, w, r, nil)
uc, _ := app.db.GetUserCollectionCount(u.ID)
// TODO: handle any errors
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view collections %v", err)
return fmt.Errorf("view collections: %v", err)
}
d := struct {
*UserPage
Collections *[]Collection
UsedCollections, TotalCollections int
NewBlogsDisabled bool
Silenced bool
}{
UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f),
Collections: c,
UsedCollections: int(uc),
NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc),
Silenced: silenced,
}
d.UserPage.SetMessaging(u)
showUserPage(w, "collections", d)
return nil
}
func viewEditCollection(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
c, err := app.db.GetCollection(vars["collection"])
if err != nil {
return err
}
if c.OwnerID != u.ID {
return ErrCollectionNotFound
}
// Add collection properties
c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer")
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view edit collection %v", err)
return fmt.Errorf("view edit collection: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, nil)
obj := struct {
*UserPage
*Collection
Silenced bool
}{
UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes),
Collection: c,
Silenced: silenced,
}
obj.UserPage.CollAlias = c.Alias
showUserPage(w, "collection", obj)
return nil
}
func updateSettings(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
var s userSettings
var u *User
var sess *sessions.Session
var err error
if reqJSON {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
u, err = app.db.GetAPIUser(accessToken)
if err != nil {
return ErrBadAccessToken
}
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&s)
if err != nil {
log.Error("Couldn't parse settings JSON request: %v\n", err)
return ErrBadJSON
}
// Prevent all username updates
// TODO: support changing username via JSON API request
s.Username = ""
} else {
u, sess = getUserAndSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse settings form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&s, r.PostForm)
if err != nil {
log.Error("Couldn't decode settings form request: %v\n", err)
return ErrBadFormData
}
}
// Do update
postUpdateReturn := r.FormValue("return")
redirectTo := "/me/settings"
if s.IsLogOut {
redirectTo += "?logout=1"
} else if postUpdateReturn != "" {
redirectTo = postUpdateReturn
}
// Only do updates on values we need
if s.Username != "" && s.Username == u.Username {
// Username hasn't actually changed; blank it out
s.Username = ""
}
err = app.db.ChangeSettings(app, u, &s)
if err != nil {
if reqJSON {
return err
}
if err, ok := err.(impart.HTTPError); ok {
addSessionFlash(app, w, r, err.Message, nil)
}
} else {
// Successful update.
if reqJSON {
return impart.WriteSuccess(w, u, http.StatusOK)
}
if s.IsLogOut {
redirectTo = "/me/logout"
} else {
sess.Values[cookieUserVal] = u.Cookie()
addSessionFlash(app, w, r, "Account updated.", nil)
}
}
w.Header().Set("Location", redirectTo)
w.WriteHeader(http.StatusFound)
return nil
}
func updatePassphrase(app *App, w http.ResponseWriter, r *http.Request) error {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
curPass := r.FormValue("current")
newPass := r.FormValue("new")
// Ensure a new password is given (always required)
if newPass == "" {
return impart.HTTPError{http.StatusBadRequest, "Provide a new password."}
}
userID, sudo := app.db.GetUserIDPrivilege(accessToken)
if userID == -1 {
return ErrBadAccessToken
}
// Ensure a current password is given if the access token doesn't have sudo
// privileges.
if !sudo && curPass == "" {
return impart.HTTPError{http.StatusBadRequest, "Provide current password."}
}
// Hash the new password
hashedPass, err := auth.HashPass([]byte(newPass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
// Do update
err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass)
if err != nil {
return err
}
return impart.WriteSuccess(w, struct{}{}, http.StatusOK)
}
func viewStats(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
var c *Collection
var err error
vars := mux.Vars(r)
alias := vars["collection"]
if alias != "" {
c, err = app.db.GetCollection(alias)
if err != nil {
return err
}
if c.OwnerID != u.ID {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
}
topPosts, err := app.db.GetTopPosts(u, alias, c.hostName)
if err != nil {
log.Error("Unable to get top posts: %v", err)
return err
}
flashes, _ := getSessionFlashes(app, w, r, nil)
titleStats := ""
if c != nil {
titleStats = c.DisplayTitle() + " "
}
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view stats: %v", err)
return err
}
obj := struct {
*UserPage
VisitsBlog string
Collection *Collection
TopPosts *[]PublicPost
APFollowers int
Silenced bool
}{
UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes),
VisitsBlog: alias,
Collection: c,
TopPosts: topPosts,
Silenced: silenced,
}
obj.UserPage.CollAlias = c.Alias
if app.cfg.App.Federation {
folls, err := app.db.GetAPFollowers(c)
if err != nil {
return err
}
obj.APFollowers = len(*folls)
}
showUserPage(w, "stats", obj)
return nil
}
func viewSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
fullUser, err := app.db.GetUserByID(u.ID)
if err != nil {
log.Error("Unable to get user for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
passIsSet, err := app.db.IsUserPassSet(u.ID)
if err != nil {
log.Error("Unable to get isUserPassSet for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
flashes, _ := getSessionFlashes(app, w, r, nil)
enableOauthSlack := app.Config().SlackOauth.ClientID != ""
enableOauthWriteAs := app.Config().WriteAsOauth.ClientID != ""
enableOauthGitLab := app.Config().GitlabOauth.ClientID != ""
enableOauthGeneric := app.Config().GenericOauth.ClientID != ""
enableOauthGitea := app.Config().GiteaOauth.ClientID != ""
oauthAccounts, err := app.db.GetOauthAccounts(r.Context(), u.ID)
if err != nil {
log.Error("Unable to get oauth accounts for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
for idx, oauthAccount := range oauthAccounts {
switch oauthAccount.Provider {
case "slack":
enableOauthSlack = false
case "write.as":
enableOauthWriteAs = false
case "gitlab":
enableOauthGitLab = false
case "generic":
oauthAccounts[idx].DisplayName = app.Config().GenericOauth.DisplayName
oauthAccounts[idx].AllowDisconnect = app.Config().GenericOauth.AllowDisconnect
enableOauthGeneric = false
case "gitea":
enableOauthGitea = false
}
}
displayOauthSection := enableOauthSlack || enableOauthWriteAs || enableOauthGitLab || enableOauthGeneric || enableOauthGitea || len(oauthAccounts) > 0
obj := struct {
*UserPage
Email string
HasPass bool
IsLogOut bool
Silenced bool
CSRFField template.HTML
OauthSection bool
OauthAccounts []oauthAccountInfo
OauthSlack bool
OauthWriteAs bool
OauthGitLab bool
GitLabDisplayName string
OauthGeneric bool
OauthGenericDisplayName string
OauthGitea bool
GiteaDisplayName string
}{
UserPage: NewUserPage(app, r, u, "Account Settings", flashes),
Email: fullUser.EmailClear(app.keys),
HasPass: passIsSet,
IsLogOut: r.FormValue("logout") == "1",
Silenced: fullUser.IsSilenced(),
CSRFField: csrf.TemplateField(r),
OauthSection: displayOauthSection,
OauthAccounts: oauthAccounts,
OauthSlack: enableOauthSlack,
OauthWriteAs: enableOauthWriteAs,
OauthGitLab: enableOauthGitLab,
GitLabDisplayName: config.OrDefaultString(app.Config().GitlabOauth.DisplayName, gitlabDisplayName),
OauthGeneric: enableOauthGeneric,
OauthGenericDisplayName: config.OrDefaultString(app.Config().GenericOauth.DisplayName, genericOauthDisplayName),
OauthGitea: enableOauthGitea,
GiteaDisplayName: config.OrDefaultString(app.Config().GiteaOauth.DisplayName, giteaDisplayName),
}
showUserPage(w, "settings", obj)
return nil
}
func saveTempInfo(app *App, key, val string, r *http.Request, w http.ResponseWriter) error {
session, err := app.sessionStore.Get(r, "t")
if err != nil {
return ErrInternalCookieSession
}
session.Values[key] = val
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err)
}
return err
}
func getTempInfo(app *App, key string, r *http.Request, w http.ResponseWriter) string {
session, err := app.sessionStore.Get(r, "t")
if err != nil {
return ""
}
// Get the information
var s = ""
var ok bool
if s, ok = session.Values[key].(string); !ok {
return ""
}
// Delete cookie
session.Options.MaxAge = -1
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't erase temp data for key %s: %v", key, err)
}
// Return value
return s
}
func handleUserDelete(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
if !app.cfg.App.OpenDeletion {
return impart.HTTPError{http.StatusForbidden, "Open account deletion is disabled on this instance."}
}
confirmUsername := r.PostFormValue("confirm-username")
if u.Username != confirmUsername {
return impart.HTTPError{http.StatusBadRequest, "Confirmation username must match your username exactly."}
}
// Check for account deletion safeguards in place
if u.IsAdmin() {
return impart.HTTPError{http.StatusForbidden, "Cannot delete admin."}
}
err := app.db.DeleteAccount(u.ID)
if err != nil {
log.Error("user delete account: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not delete account: %v", err)}
}
// FIXME: This doesn't ever appear to the user, as (I believe) the value is erased when the session cookie is reset
_ = addSessionFlash(app, w, r, "Thanks for writing with us! You account was deleted successfully.", nil)
return impart.HTTPError{http.StatusFound, "/me/logout"}
}
func removeOauth(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
provider := r.FormValue("provider")
clientID := r.FormValue("client_id")
remoteUserID := r.FormValue("remote_user_id")
err := app.db.RemoveOauth(r.Context(), u.ID, provider, clientID, remoteUserID)
if err != nil {
return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()}
}
return impart.HTTPError{Status: http.StatusFound, Message: "/me/settings"}
}
func prepareUserEmail(input string, emailKey []byte) zero.String {
email := zero.NewString("", input != "")
if len(input) > 0 {
encEmail, err := data.Encrypt(emailKey, input)
if err != nil {
log.Error("Unable to encrypt email: %s\n", err)
} else {
email.String = string(encEmail)
}
}
return email
}
diff --git a/activitypub.go b/activitypub.go
index 720d5c9..efc34f3 100644
--- a/activitypub.go
+++ b/activitypub.go
@@ -1,874 +1,874 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"bytes"
"crypto/sha256"
"database/sql"
"encoding/base64"
"encoding/json"
"fmt"
"io/ioutil"
"net/http"
"net/http/httputil"
"net/url"
"path/filepath"
"strconv"
"time"
"github.com/gorilla/mux"
"github.com/writeas/activity/streams"
"github.com/writeas/httpsig"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitypub"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/id"
"github.com/writeas/web-core/log"
)
const (
// TODO: delete. don't use this!
apCustomHandleDefault = "blog"
apCacheTime = time.Minute
)
var instanceColl *Collection
func initActivityPub(app *App) {
ur, _ := url.Parse(app.cfg.App.Host)
instanceColl = &Collection{
ID: 0,
Alias: ur.Host,
Title: ur.Host,
db: app.db,
hostName: app.cfg.App.Host,
}
}
type RemoteUser struct {
ID int64
ActorID string
Inbox string
SharedInbox string
Handle string
}
func (ru *RemoteUser) AsPerson() *activitystreams.Person {
return &activitystreams.Person{
BaseObject: activitystreams.BaseObject{
Type: "Person",
Context: []interface{}{
activitystreams.Namespace,
},
ID: ru.ActorID,
},
Inbox: ru.Inbox,
Endpoints: activitystreams.Endpoints{
SharedInbox: ru.SharedInbox,
},
}
}
func activityPubClient() *http.Client {
return &http.Client{
Timeout: 15 * time.Second,
}
}
func handleFetchCollectionActivities(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
if alias == "" {
alias = filepath.Base(r.RequestURI)
}
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if alias == r.Host {
c = instanceColl
} else if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
if !c.IsInstanceColl() {
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection activities: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
}
p := c.PersonObject()
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, p, http.StatusOK)
}
func handleFetchCollectionOutbox(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection outbox: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if app.cfg.App.SingleUser {
if alias != c.Alias {
return ErrCollectionNotFound
}
}
res := &CollectionObj{Collection: *c}
app.db.GetPostsCount(res, false)
accountRoot := c.FederatedAccount()
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "outbox", res.TotalPosts)
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "outbox", res.TotalPosts, p)
ocp.OrderedItems = []interface{}{}
posts, err := app.db.GetPosts(app.cfg, c, p, false, true, false)
for _, pp := range *posts {
pp.Collection = res
o := pp.ActivityObject(app)
a := activitystreams.NewCreateActivity(o)
a.Context = nil
ocp.OrderedItems = append(ocp.OrderedItems, *a)
}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionFollowers(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection followers: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
accountRoot := c.FederatedAccount()
folls, err := app.db.GetAPFollowers(c)
if err != nil {
return err
}
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "followers", len(*folls))
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "followers", len(*folls), p)
ocp.OrderedItems = []interface{}{}
/*
for _, f := range *folls {
ocp.OrderedItems = append(ocp.OrderedItems, f.ActorID)
}
*/
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionFollowing(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection following: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
accountRoot := c.FederatedAccount()
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "following", 0)
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "following", 0, p)
ocp.OrderedItems = []interface{}{}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionInbox(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
// TODO: return Reject?
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection inbox: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if debugging {
dump, err := httputil.DumpRequest(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("Rec'd! %q", dump)
}
}
var m map[string]interface{}
if err := json.NewDecoder(r.Body).Decode(&m); err != nil {
return err
}
a := streams.NewAccept()
p := c.PersonObject()
var to *url.URL
var isFollow, isUnfollow bool
fullActor := &activitystreams.Person{}
var remoteUser *RemoteUser
res := &streams.Resolver{
FollowCallback: func(f *streams.Follow) error {
isFollow = true
// 1) Use the Follow concrete type here
// 2) Errors are propagated to res.Deserialize call below
m["@context"] = []string{activitystreams.Namespace}
b, _ := json.Marshal(m)
if debugging {
log.Info("Follow: %s", b)
}
_, followID := f.GetId()
if followID == nil {
log.Error("Didn't resolve follow ID")
} else {
aID := c.FederatedAccount() + "#accept-" + id.GenerateFriendlyRandomString(20)
acceptID, err := url.Parse(aID)
if err != nil {
log.Error("Couldn't parse generated Accept URL '%s': %v", aID, err)
}
a.SetId(acceptID)
}
a.AppendObject(f.Raw())
_, to = f.GetActor(0)
obj := f.Raw().GetObjectIRI(0)
a.AppendActor(obj)
// First get actor information
if to == nil {
return fmt.Errorf("No valid `to` string")
}
fullActor, remoteUser, err = getActor(app, to.String())
if err != nil {
return err
}
return impart.RenderActivityJSON(w, m, http.StatusOK)
},
UndoCallback: func(u *streams.Undo) error {
isUnfollow = true
m["@context"] = []string{activitystreams.Namespace}
b, _ := json.Marshal(m)
if debugging {
log.Info("Undo: %s", b)
}
a.AppendObject(u.Raw())
_, to = u.GetActor(0)
// TODO: get actor from object.object, not object
obj := u.Raw().GetObjectIRI(0)
a.AppendActor(obj)
if to != nil {
// Populate fullActor from DB?
remoteUser, err = getRemoteUser(app, to.String())
if err != nil {
if iErr, ok := err.(*impart.HTTPError); ok {
if iErr.Status == http.StatusNotFound {
log.Error("No remoteuser info for Undo event!")
}
}
return err
} else {
fullActor = remoteUser.AsPerson()
}
} else {
log.Error("No to on Undo!")
}
return impart.RenderActivityJSON(w, m, http.StatusOK)
},
}
if err := res.Deserialize(m); err != nil {
// 3) Any errors from #2 can be handled, or the payload is an unknown type.
log.Error("Unable to resolve Follow: %v", err)
if debugging {
log.Error("Map: %s", m)
}
return err
}
go func() {
if to == nil {
if debugging {
log.Error("No `to` value!")
}
return
}
time.Sleep(2 * time.Second)
am, err := a.Serialize()
if err != nil {
log.Error("Unable to serialize Accept: %v", err)
return
}
am["@context"] = []string{activitystreams.Namespace}
err = makeActivityPost(app.cfg.App.Host, p, fullActor.Inbox, am)
if err != nil {
log.Error("Unable to make activity POST: %v", err)
return
}
if isFollow {
t, err := app.db.Begin()
if err != nil {
log.Error("Unable to start transaction: %v", err)
return
}
var followerID int64
if remoteUser != nil {
followerID = remoteUser.ID
} else {
// Add follower locally, since it wasn't found before
res, err := t.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox) VALUES (?, ?, ?)", fullActor.ID, fullActor.Inbox, fullActor.Endpoints.SharedInbox)
if err != nil {
// if duplicate key, res will be nil and panic on
// res.LastInsertId below
t.Rollback()
log.Error("Couldn't add new remoteuser in DB: %v\n", err)
return
}
followerID, err = res.LastInsertId()
if err != nil {
t.Rollback()
log.Error("no lastinsertid for followers, rolling back: %v", err)
return
}
// Add in key
_, err = t.Exec("INSERT INTO remoteuserkeys (id, remote_user_id, public_key) VALUES (?, ?, ?)", fullActor.PublicKey.ID, followerID, fullActor.PublicKey.PublicKeyPEM)
if err != nil {
if !app.db.isDuplicateKeyErr(err) {
t.Rollback()
log.Error("Couldn't add follower keys in DB: %v\n", err)
return
}
}
}
// Add follow
_, err = t.Exec("INSERT INTO remotefollows (collection_id, remote_user_id, created) VALUES (?, ?, "+app.db.now()+")", c.ID, followerID)
if err != nil {
if !app.db.isDuplicateKeyErr(err) {
t.Rollback()
log.Error("Couldn't add follower in DB: %v\n", err)
return
}
}
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return
}
} else if isUnfollow {
// Remove follower locally
_, err = app.db.Exec("DELETE FROM remotefollows WHERE collection_id = ? AND remote_user_id = (SELECT id FROM remoteusers WHERE actor_id = ?)", c.ID, to.String())
if err != nil {
log.Error("Couldn't remove follower from DB: %v\n", err)
}
}
}()
return nil
}
func makeActivityPost(hostName string, p *activitystreams.Person, url string, m interface{}) error {
log.Info("POST %s", url)
b, err := json.Marshal(m)
if err != nil {
return err
}
r, _ := http.NewRequest("POST", url, bytes.NewBuffer(b))
r.Header.Add("Content-Type", "application/activity+json")
r.Header.Set("User-Agent", ServerUserAgent(hostName))
h := sha256.New()
h.Write(b)
r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil)))
// Sign using the 'Signature' header
privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey())
if err != nil {
return err
}
signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"})
err = signer.SignSigHeader(r)
if err != nil {
log.Error("Can't sign: %v", err)
}
if debugging {
dump, err := httputil.DumpRequestOut(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("%s", dump)
}
}
resp, err := activityPubClient().Do(r)
if err != nil {
return err
}
if resp != nil && resp.Body != nil {
defer resp.Body.Close()
}
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
return err
}
if debugging {
log.Info("Status : %s", resp.Status)
log.Info("Response: %s", body)
}
return nil
}
func resolveIRI(hostName, url string) ([]byte, error) {
log.Info("GET %s", url)
r, _ := http.NewRequest("GET", url, nil)
r.Header.Add("Accept", "application/activity+json")
r.Header.Set("User-Agent", ServerUserAgent(hostName))
p := instanceColl.PersonObject()
h := sha256.New()
h.Write([]byte{})
r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil)))
// Sign using the 'Signature' header
privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey())
if err != nil {
return nil, err
}
signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"})
err = signer.SignSigHeader(r)
if err != nil {
log.Error("Can't sign: %v", err)
}
if debugging {
dump, err := httputil.DumpRequestOut(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("%s", dump)
}
}
resp, err := activityPubClient().Do(r)
if err != nil {
return nil, err
}
if resp != nil && resp.Body != nil {
defer resp.Body.Close()
}
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
return nil, err
}
if debugging {
log.Info("Status : %s", resp.Status)
log.Info("Response: %s", body)
}
return body, nil
}
func deleteFederatedPost(app *App, p *PublicPost, collID int64) error {
if debugging {
log.Info("Deleting federated post!")
}
p.Collection.hostName = app.cfg.App.Host
actor := p.Collection.PersonObject(collID)
na := p.ActivityObject(app)
// Add followers
p.Collection.ID = collID
followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
if err != nil {
log.Error("Couldn't delete post (get followers)! %v", err)
return err
}
inboxes := map[string][]string{}
for _, f := range *followers {
inbox := f.SharedInbox
if inbox == "" {
inbox = f.Inbox
}
if _, ok := inboxes[inbox]; ok {
inboxes[inbox] = append(inboxes[inbox], f.ActorID)
} else {
inboxes[inbox] = []string{f.ActorID}
}
}
for si, instFolls := range inboxes {
na.CC = []string{}
for _, f := range instFolls {
na.CC = append(na.CC, f)
}
da := activitystreams.NewDeleteActivity(na)
// Make the ID unique to ensure it works in Pleroma
// See: https://git.pleroma.social/pleroma/pleroma/issues/1481
da.ID += "#Delete"
err = makeActivityPost(app.cfg.App.Host, actor, si, da)
if err != nil {
log.Error("Couldn't delete post! %v", err)
}
}
return nil
}
func federatePost(app *App, p *PublicPost, collID int64, isUpdate bool) error {
// If app is private, do not federate
if app.cfg.App.Private {
return nil
}
// Do not federate posts from private or protected blogs
if p.Collection.Visibility == CollPrivate || p.Collection.Visibility == CollProtected {
return nil
}
if debugging {
if isUpdate {
log.Info("Federating updated post!")
} else {
log.Info("Federating new post!")
}
}
actor := p.Collection.PersonObject(collID)
na := p.ActivityObject(app)
// Add followers
p.Collection.ID = collID
followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
if err != nil {
log.Error("Couldn't post! %v", err)
return err
}
log.Info("Followers for %d: %+v", collID, followers)
inboxes := map[string][]string{}
for _, f := range *followers {
inbox := f.SharedInbox
if inbox == "" {
inbox = f.Inbox
}
if _, ok := inboxes[inbox]; ok {
// check if we're already sending to this shared inbox
inboxes[inbox] = append(inboxes[inbox], f.ActorID)
} else {
// add the new shared inbox to the list
inboxes[inbox] = []string{f.ActorID}
}
}
var activity *activitystreams.Activity
// for each one of the shared inboxes
for si, instFolls := range inboxes {
// add all followers from that instance
// to the CC field
na.CC = []string{}
for _, f := range instFolls {
na.CC = append(na.CC, f)
}
// create a new "Create" activity
// with our article as object
if isUpdate {
activity = activitystreams.NewUpdateActivity(na)
} else {
activity = activitystreams.NewCreateActivity(na)
activity.To = na.To
activity.CC = na.CC
}
// and post it to that sharedInbox
err = makeActivityPost(app.cfg.App.Host, actor, si, activity)
if err != nil {
log.Error("Couldn't post! %v", err)
}
}
// re-create the object so that the CC list gets reset and has
// the mentioned users. This might seem wasteful but the code is
// cleaner than adding the mentioned users to CC here instead of
// in p.ActivityObject()
na = p.ActivityObject(app)
for _, tag := range na.Tag {
if tag.Type == "Mention" {
activity = activitystreams.NewCreateActivity(na)
activity.To = na.To
activity.CC = na.CC
// This here might be redundant in some cases as we might have already
// sent this to the sharedInbox of this instance above, but we need too
// much logic to catch this at the expense of the odd extra request.
// I don't believe we'd ever have too many mentions in a single post that this
// could become a burden.
remoteUser, err := getRemoteUser(app, tag.HRef)
if err != nil {
log.Error("Unable to find remote user %s. Skipping: %v", tag.HRef, err)
continue
}
err = makeActivityPost(app.cfg.App.Host, actor, remoteUser.Inbox, activity)
if err != nil {
log.Error("Couldn't post! %v", err)
}
}
}
return nil
}
func getRemoteUser(app *App, actorID string) (*RemoteUser, error) {
u := RemoteUser{ActorID: actorID}
var handle sql.NullString
err := app.db.QueryRow("SELECT id, inbox, shared_inbox, handle FROM remoteusers WHERE actor_id = ?", actorID).Scan(&u.ID, &u.Inbox, &u.SharedInbox, &handle)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "No remote user with that ID."}
case err != nil:
log.Error("Couldn't get remote user %s: %v", actorID, err)
return nil, err
}
u.Handle = handle.String
return &u, nil
}
// getRemoteUserFromHandle retrieves the profile page of a remote user
// from the @user@server.tld handle
func getRemoteUserFromHandle(app *App, handle string) (*RemoteUser, error) {
u := RemoteUser{Handle: handle}
err := app.db.QueryRow("SELECT id, actor_id, inbox, shared_inbox FROM remoteusers WHERE handle = ?", handle).Scan(&u.ID, &u.ActorID, &u.Inbox, &u.SharedInbox)
switch {
case err == sql.ErrNoRows:
return nil, ErrRemoteUserNotFound
case err != nil:
log.Error("Couldn't get remote user %s: %v", handle, err)
return nil, err
}
return &u, nil
}
func getActor(app *App, actorIRI string) (*activitystreams.Person, *RemoteUser, error) {
log.Info("Fetching actor %s locally", actorIRI)
actor := &activitystreams.Person{}
remoteUser, err := getRemoteUser(app, actorIRI)
if err != nil {
if iErr, ok := err.(impart.HTTPError); ok {
if iErr.Status == http.StatusNotFound {
// Fetch remote actor
log.Info("Not found; fetching actor %s remotely", actorIRI)
actorResp, err := resolveIRI(app.cfg.App.Host, actorIRI)
if err != nil {
log.Error("Unable to get actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't fetch actor."}
}
if err := unmarshalActor(actorResp, actor); err != nil {
log.Error("Unable to unmarshal actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't parse actor."}
}
} else {
return nil, nil, err
}
} else {
return nil, nil, err
}
} else {
actor = remoteUser.AsPerson()
}
return actor, remoteUser, nil
}
// unmarshal actor normalizes the actor response to conform to
// the type Person from github.com/writeas/web-core/activitysteams
//
// some implementations return different context field types
// this converts any non-slice contexts into a slice
func unmarshalActor(actorResp []byte, actor *activitystreams.Person) error {
// FIXME: Hubzilla has an object for the Actor's url: cannot unmarshal object into Go struct field Person.url of type string
// flexActor overrides the Context field to allow
// all valid representations during unmarshal
flexActor := struct {
activitystreams.Person
Context json.RawMessage `json:"@context,omitempty"`
}{}
if err := json.Unmarshal(actorResp, &flexActor); err != nil {
return err
}
actor.Endpoints = flexActor.Endpoints
actor.Followers = flexActor.Followers
actor.Following = flexActor.Following
actor.ID = flexActor.ID
actor.Icon = flexActor.Icon
actor.Inbox = flexActor.Inbox
actor.Name = flexActor.Name
actor.Outbox = flexActor.Outbox
actor.PreferredUsername = flexActor.PreferredUsername
actor.PublicKey = flexActor.PublicKey
actor.Summary = flexActor.Summary
actor.Type = flexActor.Type
actor.URL = flexActor.URL
func(val interface{}) {
switch val.(type) {
case []interface{}:
// already a slice, do nothing
actor.Context = val.([]interface{})
default:
actor.Context = []interface{}{val}
}
}(flexActor.Context)
return nil
}
func setCacheControl(w http.ResponseWriter, ttl time.Duration) {
w.Header().Set("Cache-Control", fmt.Sprintf("public, max-age=%.0f", ttl.Seconds()))
}
diff --git a/admin.go b/admin.go
index 2b757ca..6408cfe 100644
--- a/admin.go
+++ b/admin.go
@@ -1,675 +1,675 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"fmt"
"net/http"
"runtime"
"strconv"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/passgen"
"github.com/writefreely/writefreely/appstats"
"github.com/writefreely/writefreely/config"
)
var (
appStartTime = time.Now()
sysStatus systemStatus
)
const adminUsersPerPage = 30
type systemStatus struct {
Uptime string
NumGoroutine int
// General statistics.
MemAllocated string // bytes allocated and still in use
MemTotal string // bytes allocated (even if freed)
MemSys string // bytes obtained from system (sum of XxxSys below)
Lookups uint64 // number of pointer lookups
MemMallocs uint64 // number of mallocs
MemFrees uint64 // number of frees
// Main allocation heap statistics.
HeapAlloc string // bytes allocated and still in use
HeapSys string // bytes obtained from system
HeapIdle string // bytes in idle spans
HeapInuse string // bytes in non-idle span
HeapReleased string // bytes released to the OS
HeapObjects uint64 // total number of allocated objects
// Low-level fixed-size structure allocator statistics.
// Inuse is bytes used now.
// Sys is bytes obtained from system.
StackInuse string // bootstrap stacks
StackSys string
MSpanInuse string // mspan structures
MSpanSys string
MCacheInuse string // mcache structures
MCacheSys string
BuckHashSys string // profiling bucket hash table
GCSys string // GC metadata
OtherSys string // other system allocations
// Garbage collector statistics.
NextGC string // next run in HeapAlloc time (bytes)
LastGC string // last run in absolute time (ns)
PauseTotalNs string
PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256]
NumGC uint32
}
type inspectedCollection struct {
CollectionObj
Followers int
LastPost string
}
type instanceContent struct {
ID string
Type string
Title sql.NullString
Content string
Updated time.Time
}
type AdminPage struct {
UpdateAvailable bool
}
func NewAdminPage(app *App) *AdminPage {
ap := &AdminPage{}
if app.updates != nil {
ap.UpdateAvailable = app.updates.AreAvailableNoCheck()
}
return ap
}
func (c instanceContent) UpdatedFriendly() string {
/*
// TODO: accept a locale in this method and use that for the format
var loc monday.Locale = monday.LocaleEnUS
return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc)
*/
return c.Updated.Format("January 2, 2006, 3:04 PM")
}
func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Message string
UsersCount, CollectionsCount, PostsCount int64
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
Message: r.FormValue("m"),
}
// Get user stats
p.UsersCount = app.db.GetAllUsersCount()
var err error
p.CollectionsCount, err = app.db.GetTotalCollections()
if err != nil {
return err
}
p.PostsCount, err = app.db.GetTotalPosts()
if err != nil {
return err
}
showUserPage(w, "admin", p)
return nil
}
func handleViewAdminMonitor(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
updateAppStats()
p := struct {
*UserPage
*AdminPage
SysStatus systemStatus
Config config.AppCfg
Message, ConfigMessage string
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
SysStatus: sysStatus,
Config: app.cfg.App,
Message: r.FormValue("m"),
ConfigMessage: r.FormValue("cm"),
}
showUserPage(w, "monitor", p)
return nil
}
func handleViewAdminSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message, ConfigMessage string
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
ConfigMessage: r.FormValue("cm"),
}
showUserPage(w, "app-settings", p)
return nil
}
func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Flashes []string
Users *[]User
CurPage int
TotalUsers int64
TotalPages []int
}{
UserPage: NewUserPage(app, r, u, "Users", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
p.Flashes, _ = getSessionFlashes(app, w, r, nil)
p.TotalUsers = app.db.GetAllUsersCount()
ttlPages := p.TotalUsers / adminUsersPerPage
p.TotalPages = []int{}
for i := 1; i <= int(ttlPages); i++ {
p.TotalPages = append(p.TotalPages, i)
}
var err error
p.CurPage, err = strconv.Atoi(r.FormValue("p"))
if err != nil || p.CurPage < 1 {
p.CurPage = 1
} else if p.CurPage > int(ttlPages) {
p.CurPage = int(ttlPages)
}
p.Users, err = app.db.GetAllUsers(uint(p.CurPage))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)}
}
showUserPage(w, "users", p)
return nil
}
func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
User *User
Colls []inspectedCollection
LastPost string
NewPassword string
TotalPosts int64
ClearEmail string
}{
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
Colls: []inspectedCollection{},
}
var err error
p.User, err = app.db.GetUserForAuth(username)
if err != nil {
if err == ErrUserNotFound {
return err
}
log.Error("Could not get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
if strings.HasPrefix(flash, "SUCCESS: ") {
p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ")
p.ClearEmail = p.User.EmailClear(app.keys)
}
}
p.UserPage = NewUserPage(app, r, u, p.User.Username, nil)
p.TotalPosts = app.db.GetUserPostsCount(p.User.ID)
lp, err := app.db.GetUserLastPostTime(p.User.ID)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)}
}
if lp != nil {
p.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
colls, err := app.db.GetCollections(p.User, app.cfg.App.Host)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)}
}
for _, c := range *colls {
ic := inspectedCollection{
CollectionObj: CollectionObj{Collection: c},
}
if app.cfg.App.Federation {
folls, err := app.db.GetAPFollowers(&c)
if err == nil {
// TODO: handle error here (at least log it)
ic.Followers = len(*folls)
}
}
app.db.GetPostsCount(&ic.CollectionObj, true)
lp, err := app.db.GetCollectionLastPostTime(c.ID)
if err != nil {
log.Error("Didn't get last post time for collection %d: %v", c.ID, err)
}
if lp != nil {
ic.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
p.Colls = append(p.Colls, ic)
}
showUserPage(w, "view-user", p)
return nil
}
func handleAdminDeleteUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
if !u.IsAdmin() {
return impart.HTTPError{http.StatusForbidden, "Administrator privileges required for this action"}
}
vars := mux.Vars(r)
username := vars["username"]
confirmUsername := r.PostFormValue("confirm-username")
if confirmUsername != username {
return impart.HTTPError{http.StatusBadRequest, "Username was not confirmed"}
}
user, err := app.db.GetUserForAuth(username)
if err == ErrUserNotFound {
return impart.HTTPError{http.StatusNotFound, fmt.Sprintf("User '%s' was not found", username)}
} else if err != nil {
log.Error("get user for deletion: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user with username '%s': %v", username, err)}
}
err = app.db.DeleteAccount(user.ID)
if err != nil {
log.Error("delete user %s: %v", user.Username, err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not delete user account for '%s': %v", username, err)}
}
_ = addSessionFlash(app, w, r, fmt.Sprintf("User \"%s\" was deleted successfully.", username), nil)
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
func handleAdminToggleUserStatus(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
user, err := app.db.GetUserForAuth(username)
if err != nil {
log.Error("failed to get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)}
}
if user.IsSilenced() {
err = app.db.SetUserStatus(user.ID, UserActive)
} else {
err = app.db.SetUserStatus(user.ID, UserSilenced)
// reset the cache to removed silence user posts
updateTimelineCache(app.timeline, true)
}
if err != nil {
log.Error("toggle user silenced: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)}
}
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)}
}
func handleAdminResetUserPass(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
// Generate new random password since none supplied
pass := passgen.NewWordish()
hashedPass, err := auth.HashPass([]byte(pass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
userIDVal := r.FormValue("user")
log.Info("ADMIN: Changing user %s password", userIDVal)
id, err := strconv.Atoi(userIDVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)}
}
err = app.db.ChangePassphrase(int64(id), true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
log.Info("ADMIN: Successfully changed.")
addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil)
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)}
}
func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Pages []*instanceContent
}{
UserPage: NewUserPage(app, r, u, "Pages", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
p.Pages, err = app.db.GetInstancePages()
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)}
}
// Add in default pages
var hasAbout, hasPrivacy bool
for i, c := range p.Pages {
if hasAbout && hasPrivacy {
break
}
if c.ID == "about" {
hasAbout = true
if !c.Title.Valid {
p.Pages[i].Title = defaultAboutTitle(app.cfg)
}
} else if c.ID == "privacy" {
hasPrivacy = true
if !c.Title.Valid {
p.Pages[i].Title = defaultPrivacyTitle()
}
}
}
if !hasAbout {
p.Pages = append(p.Pages, &instanceContent{
ID: "about",
Title: defaultAboutTitle(app.cfg),
Content: defaultAboutPage(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
if !hasPrivacy {
p.Pages = append(p.Pages, &instanceContent{
ID: "privacy",
Title: defaultPrivacyTitle(),
Content: defaultPrivacyPolicy(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
showUserPage(w, "pages", p)
return nil
}
func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
if slug == "" {
return impart.HTTPError{http.StatusFound, "/admin/pages"}
}
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Banner *instanceContent
Content *instanceContent
}{
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
// Get pre-defined pages, or select slug
if slug == "about" {
p.Content, err = getAboutPage(app)
} else if slug == "privacy" {
p.Content, err = getPrivacyPage(app)
} else if slug == "landing" {
p.Banner, err = getLandingBanner(app)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
}
p.Content, err = getLandingBody(app)
p.Content.ID = "landing"
} else if slug == "reader" {
p.Content, err = getReaderSection(app)
} else {
p.Content, err = app.db.GetDynamicContent(slug)
}
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)}
}
title := "New page"
if p.Content != nil {
title = "Edit " + p.Content.ID
} else {
p.Content = &instanceContent{}
}
p.UserPage = NewUserPage(app, r, u, title, nil)
showUserPage(w, "view-page", p)
return nil
}
func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
id := vars["page"]
// Validate
if id != "about" && id != "privacy" && id != "landing" && id != "reader" {
return impart.HTTPError{http.StatusNotFound, "No such page."}
}
var err error
m := ""
if id == "landing" {
// Handle special landing page
err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section")
if err != nil {
m = "?m=" + err.Error()
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section")
} else if id == "reader" {
// Update sections with titles
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section")
} else {
// Update page
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page")
}
if err != nil {
m = "?m=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error {
apper.App().cfg.App.SiteName = r.FormValue("site_name")
apper.App().cfg.App.SiteDesc = r.FormValue("site_desc")
apper.App().cfg.App.Landing = r.FormValue("landing")
apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on"
apper.App().cfg.App.OpenDeletion = r.FormValue("open_deletion") == "on"
mul, err := strconv.Atoi(r.FormValue("min_username_len"))
if err == nil {
apper.App().cfg.App.MinUsernameLen = mul
}
mb, err := strconv.Atoi(r.FormValue("max_blogs"))
if err == nil {
apper.App().cfg.App.MaxBlogs = mb
}
apper.App().cfg.App.Federation = r.FormValue("federation") == "on"
apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on"
apper.App().cfg.App.Monetization = r.FormValue("monetization") == "on"
apper.App().cfg.App.Private = r.FormValue("private") == "on"
apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on"
if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil {
log.Info("Initializing local timeline...")
initLocalTimeline(apper.App())
}
apper.App().cfg.App.UserInvites = r.FormValue("user_invites")
if apper.App().cfg.App.UserInvites == "none" {
apper.App().cfg.App.UserInvites = ""
}
apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility")
m := "?cm=Configuration+saved."
err = apper.SaveConfig(apper.App().cfg)
if err != nil {
m = "?cm=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin/settings" + m + "#config"}
}
func updateAppStats() {
sysStatus.Uptime = appstats.TimeSincePro(appStartTime)
m := new(runtime.MemStats)
runtime.ReadMemStats(m)
sysStatus.NumGoroutine = runtime.NumGoroutine()
sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc))
sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc))
sysStatus.MemSys = appstats.FileSize(int64(m.Sys))
sysStatus.Lookups = m.Lookups
sysStatus.MemMallocs = m.Mallocs
sysStatus.MemFrees = m.Frees
sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc))
sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys))
sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle))
sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse))
sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased))
sysStatus.HeapObjects = m.HeapObjects
sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse))
sysStatus.StackSys = appstats.FileSize(int64(m.StackSys))
sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse))
sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys))
sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse))
sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys))
sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys))
sysStatus.GCSys = appstats.FileSize(int64(m.GCSys))
sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys))
sysStatus.NextGC = appstats.FileSize(int64(m.NextGC))
sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000)
sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000)
sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000)
sysStatus.NumGC = m.NumGC
}
func adminResetPassword(app *App, u *User, newPass string) error {
hashedPass, err := auth.HashPass([]byte(newPass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
err = app.db.ChangePassphrase(u.ID, true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
return nil
}
func handleViewAdminUpdates(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
check := r.URL.Query().Get("check")
if check == "now" && app.cfg.App.UpdateChecks {
app.updates.CheckNow()
}
p := struct {
*UserPage
*AdminPage
CurReleaseNotesURL string
LastChecked string
LastChecked8601 string
LatestVersion string
LatestReleaseURL string
LatestReleaseNotesURL string
CheckFailed bool
}{
UserPage: NewUserPage(app, r, u, "Updates", nil),
AdminPage: NewAdminPage(app),
}
p.CurReleaseNotesURL = wfReleaseNotesURL(p.Version)
if app.cfg.App.UpdateChecks {
p.LastChecked = app.updates.lastCheck.Format("January 2, 2006, 3:04 PM")
p.LastChecked8601 = app.updates.lastCheck.Format("2006-01-02T15:04:05Z")
p.LatestVersion = app.updates.LatestVersion()
p.LatestReleaseURL = app.updates.ReleaseURL()
p.LatestReleaseNotesURL = app.updates.ReleaseNotesURL()
p.UpdateAvailable = app.updates.AreAvailable()
p.CheckFailed = app.updates.checkError != nil
}
showUserPage(w, "app-updates", p)
return nil
}
diff --git a/app.go b/app.go
index d6ffec6..5aac3d1 100644
--- a/app.go
+++ b/app.go
@@ -1,934 +1,934 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"crypto/tls"
"database/sql"
"fmt"
"html/template"
"io/ioutil"
"net/http"
"net/url"
"os"
"os/signal"
"path/filepath"
"regexp"
"strings"
"syscall"
"time"
"github.com/gorilla/mux"
"github.com/gorilla/schema"
"github.com/gorilla/sessions"
"github.com/manifoldco/promptui"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/converter"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/author"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/key"
"github.com/writefreely/writefreely/migrations"
"github.com/writefreely/writefreely/page"
"golang.org/x/crypto/acme/autocert"
)
const (
staticDir = "static"
assumedTitleLen = 80
postsPerPage = 10
serverSoftware = "WriteFreely"
softwareURL = "https://writefreely.org"
)
var (
debugging bool
// Software version can be set from git env using -ldflags
softwareVer = "0.13.2"
// DEPRECATED VARS
isSingleUser bool
)
// App holds data and configuration for an individual WriteFreely instance.
type App struct {
router *mux.Router
shttp *http.ServeMux
db *datastore
cfg *config.Config
cfgFile string
keys *key.Keychain
sessionStore sessions.Store
formDecoder *schema.Decoder
updates *updatesCache
timeline *localTimeline
}
// DB returns the App's datastore
func (app *App) DB() *datastore {
return app.db
}
// Router returns the App's router
func (app *App) Router() *mux.Router {
return app.router
}
// Config returns the App's current configuration.
func (app *App) Config() *config.Config {
return app.cfg
}
// SetConfig updates the App's Config to the given value.
func (app *App) SetConfig(cfg *config.Config) {
app.cfg = cfg
}
// SetKeys updates the App's Keychain to the given value.
func (app *App) SetKeys(k *key.Keychain) {
app.keys = k
}
func (app *App) SessionStore() sessions.Store {
return app.sessionStore
}
func (app *App) SetSessionStore(s sessions.Store) {
app.sessionStore = s
}
// Apper is the interface for getting data into and out of a WriteFreely
// instance (or "App").
//
// App returns the App for the current instance.
//
// LoadConfig reads an app configuration into the App, returning any error
// encountered.
//
// SaveConfig persists the current App configuration.
//
// LoadKeys reads the App's encryption keys and loads them into its
// key.Keychain.
type Apper interface {
App() *App
LoadConfig() error
SaveConfig(*config.Config) error
LoadKeys() error
ReqLog(r *http.Request, status int, timeSince time.Duration) string
}
// App returns the App
func (app *App) App() *App {
return app
}
// LoadConfig loads and parses a config file.
func (app *App) LoadConfig() error {
log.Info("Loading %s configuration...", app.cfgFile)
cfg, err := config.Load(app.cfgFile)
if err != nil {
log.Error("Unable to load configuration: %v", err)
os.Exit(1)
return err
}
app.cfg = cfg
return nil
}
// SaveConfig saves the given Config to disk -- namely, to the App's cfgFile.
func (app *App) SaveConfig(c *config.Config) error {
return config.Save(c, app.cfgFile)
}
// LoadKeys reads all needed keys from disk into the App. In order to use the
// configured `Server.KeysParentDir`, you must call initKeyPaths(App) before
// this.
func (app *App) LoadKeys() error {
var err error
app.keys = &key.Keychain{}
if debugging {
log.Info(" %s", emailKeyPath)
}
executable, err := os.Executable()
if err != nil {
executable = "writefreely"
} else {
executable = filepath.Base(executable)
}
app.keys.EmailKey, err = ioutil.ReadFile(emailKeyPath)
if err != nil {
return err
}
if debugging {
log.Info(" %s", cookieAuthKeyPath)
}
app.keys.CookieAuthKey, err = ioutil.ReadFile(cookieAuthKeyPath)
if err != nil {
return err
}
if debugging {
log.Info(" %s", cookieKeyPath)
}
app.keys.CookieKey, err = ioutil.ReadFile(cookieKeyPath)
if err != nil {
return err
}
if debugging {
log.Info(" %s", csrfKeyPath)
}
app.keys.CSRFKey, err = ioutil.ReadFile(csrfKeyPath)
if err != nil {
if os.IsNotExist(err) {
log.Error(`Missing key: %s.
Run this command to generate missing keys:
%s keys generate
`, csrfKeyPath, executable)
}
return err
}
return nil
}
func (app *App) ReqLog(r *http.Request, status int, timeSince time.Duration) string {
return fmt.Sprintf("\"%s %s\" %d %s \"%s\"", r.Method, r.RequestURI, status, timeSince, r.UserAgent())
}
// handleViewHome shows page at root path. It checks the configuration and
// authentication state to show the correct page.
func handleViewHome(app *App, w http.ResponseWriter, r *http.Request) error {
if app.cfg.App.SingleUser {
// Render blog index
return handleViewCollection(app, w, r)
}
// Multi-user instance
forceLanding := r.FormValue("landing") == "1"
if !forceLanding {
// Show correct page based on user auth status and configured landing path
u := getUserSession(app, r)
if app.cfg.App.Chorus {
// This instance is focused on reading, so show Reader on home route if not
// private or a private-instance user is logged in.
if !app.cfg.App.Private || u != nil {
return viewLocalTimeline(app, w, r)
}
}
if u != nil {
// User is logged in, so show the Pad
return handleViewPad(app, w, r)
}
if app.cfg.App.Private {
return viewLogin(app, w, r)
}
if land := app.cfg.App.LandingPath(); land != "/" {
return impart.HTTPError{http.StatusFound, land}
}
}
return handleViewLanding(app, w, r)
}
func handleViewLanding(app *App, w http.ResponseWriter, r *http.Request) error {
forceLanding := r.FormValue("landing") == "1"
p := struct {
page.StaticPage
*OAuthButtons
Flashes []template.HTML
Banner template.HTML
Content template.HTML
ForcedLanding bool
}{
StaticPage: pageForReq(app, r),
OAuthButtons: NewOAuthButtons(app.Config()),
ForcedLanding: forceLanding,
}
banner, err := getLandingBanner(app)
if err != nil {
log.Error("unable to get landing banner: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
}
p.Banner = template.HTML(applyMarkdown([]byte(banner.Content), "", app.cfg))
content, err := getLandingBody(app)
if err != nil {
log.Error("unable to get landing content: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get content: %v", err)}
}
p.Content = template.HTML(applyMarkdown([]byte(content.Content), "", app.cfg))
// Get error messages
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session in handleViewHome; ignoring: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
// Show landing page
return renderPage(w, "landing.tmpl", p)
}
func handleTemplatedPage(app *App, w http.ResponseWriter, r *http.Request, t *template.Template) error {
p := struct {
page.StaticPage
ContentTitle string
Content template.HTML
PlainContent string
Updated string
AboutStats *InstanceStats
}{
StaticPage: pageForReq(app, r),
}
if r.URL.Path == "/about" || r.URL.Path == "/privacy" {
var c *instanceContent
var err error
if r.URL.Path == "/about" {
c, err = getAboutPage(app)
// Fetch stats
p.AboutStats = &InstanceStats{}
p.AboutStats.NumPosts, _ = app.db.GetTotalPosts()
p.AboutStats.NumBlogs, _ = app.db.GetTotalCollections()
} else {
c, err = getPrivacyPage(app)
}
if err != nil {
return err
}
p.ContentTitle = c.Title.String
p.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg))
p.PlainContent = shortPostDescription(stripmd.Strip(c.Content))
if !c.Updated.IsZero() {
p.Updated = c.Updated.Format("January 2, 2006")
}
}
// Serve templated page
err := t.ExecuteTemplate(w, "base", p)
if err != nil {
log.Error("Unable to render page: %v", err)
}
return nil
}
func pageForReq(app *App, r *http.Request) page.StaticPage {
p := page.StaticPage{
AppCfg: app.cfg.App,
Path: r.URL.Path,
Version: "v" + softwareVer,
}
// Add user information, if given
var u *User
accessToken := r.FormValue("t")
if accessToken != "" {
userID := app.db.GetUserID(accessToken)
if userID != -1 {
var err error
u, err = app.db.GetUserByID(userID)
if err == nil {
p.Username = u.Username
}
}
} else {
u = getUserSession(app, r)
if u != nil {
p.Username = u.Username
p.IsAdmin = u != nil && u.IsAdmin()
p.CanInvite = canUserInvite(app.cfg, p.IsAdmin)
}
}
p.CanViewReader = !app.cfg.App.Private || u != nil
return p
}
var fileRegex = regexp.MustCompile("/([^/]*\\.[^/]*)$")
// Initialize loads the app configuration and initializes templates, keys,
// session, route handlers, and the database connection.
func Initialize(apper Apper, debug bool) (*App, error) {
debugging = debug
apper.LoadConfig()
// Load templates
err := InitTemplates(apper.App().Config())
if err != nil {
return nil, fmt.Errorf("load templates: %s", err)
}
// Load keys and set up session
initKeyPaths(apper.App()) // TODO: find a better way to do this, since it's unneeded in all Apper implementations
err = InitKeys(apper)
if err != nil {
return nil, fmt.Errorf("init keys: %s", err)
}
apper.App().InitUpdates()
apper.App().InitSession()
apper.App().InitDecoder()
err = ConnectToDatabase(apper.App())
if err != nil {
return nil, fmt.Errorf("connect to DB: %s", err)
}
initActivityPub(apper.App())
// Handle local timeline, if enabled
if apper.App().cfg.App.LocalTimeline {
log.Info("Initializing local timeline...")
initLocalTimeline(apper.App())
}
return apper.App(), nil
}
func Serve(app *App, r *mux.Router) {
log.Info("Going to serve...")
isSingleUser = app.cfg.App.SingleUser
app.cfg.Server.Dev = debugging
// Handle shutdown
c := make(chan os.Signal, 2)
signal.Notify(c, os.Interrupt, syscall.SIGTERM)
go func() {
<-c
log.Info("Shutting down...")
shutdown(app)
log.Info("Done.")
os.Exit(0)
}()
// Start gopher server
if app.cfg.Server.GopherPort > 0 && !app.cfg.App.Private {
go initGopher(app)
}
// Start web application server
var bindAddress = app.cfg.Server.Bind
if bindAddress == "" {
bindAddress = "localhost"
}
var err error
if app.cfg.IsSecureStandalone() {
if app.cfg.Server.Autocert {
m := &autocert.Manager{
Prompt: autocert.AcceptTOS,
Cache: autocert.DirCache(app.cfg.Server.TLSCertPath),
}
host, err := url.Parse(app.cfg.App.Host)
if err != nil {
log.Error("[WARNING] Unable to parse configured host! %s", err)
log.Error(`[WARNING] ALL hosts are allowed, which can open you to an attack where
clients connect to a server by IP address and pretend to be asking for an
incorrect host name, and cause you to reach the CA's rate limit for certificate
requests. We recommend supplying a valid host name.`)
log.Info("Using autocert on ANY host")
} else {
log.Info("Using autocert on host %s", host.Host)
m.HostPolicy = autocert.HostWhitelist(host.Host)
}
s := &http.Server{
Addr: ":https",
Handler: r,
TLSConfig: &tls.Config{
GetCertificate: m.GetCertificate,
},
}
s.SetKeepAlivesEnabled(false)
go func() {
log.Info("Serving redirects on http://%s:80", bindAddress)
err = http.ListenAndServe(":80", m.HTTPHandler(nil))
log.Error("Unable to start redirect server: %v", err)
}()
log.Info("Serving on https://%s:443", bindAddress)
log.Info("---")
err = s.ListenAndServeTLS("", "")
} else {
go func() {
log.Info("Serving redirects on http://%s:80", bindAddress)
err = http.ListenAndServe(fmt.Sprintf("%s:80", bindAddress), http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
http.Redirect(w, r, app.cfg.App.Host, http.StatusMovedPermanently)
}))
log.Error("Unable to start redirect server: %v", err)
}()
log.Info("Serving on https://%s:443", bindAddress)
log.Info("Using manual certificates")
log.Info("---")
err = http.ListenAndServeTLS(fmt.Sprintf("%s:443", bindAddress), app.cfg.Server.TLSCertPath, app.cfg.Server.TLSKeyPath, r)
}
} else {
log.Info("Serving on http://%s:%d\n", bindAddress, app.cfg.Server.Port)
log.Info("---")
err = http.ListenAndServe(fmt.Sprintf("%s:%d", bindAddress, app.cfg.Server.Port), r)
}
if err != nil {
log.Error("Unable to start: %v", err)
os.Exit(1)
}
}
func (app *App) InitDecoder() {
// TODO: do this at the package level, instead of the App level
// Initialize modules
app.formDecoder = schema.NewDecoder()
app.formDecoder.RegisterConverter(converter.NullJSONString{}, converter.ConvertJSONNullString)
app.formDecoder.RegisterConverter(converter.NullJSONBool{}, converter.ConvertJSONNullBool)
app.formDecoder.RegisterConverter(sql.NullString{}, converter.ConvertSQLNullString)
app.formDecoder.RegisterConverter(sql.NullBool{}, converter.ConvertSQLNullBool)
app.formDecoder.RegisterConverter(sql.NullInt64{}, converter.ConvertSQLNullInt64)
app.formDecoder.RegisterConverter(sql.NullFloat64{}, converter.ConvertSQLNullFloat64)
}
// ConnectToDatabase validates and connects to the configured database, then
// tests the connection.
func ConnectToDatabase(app *App) error {
// Check database configuration
if app.cfg.Database.Type == driverMySQL && (app.cfg.Database.User == "" || app.cfg.Database.Password == "") {
return fmt.Errorf("Database user or password not set.")
}
if app.cfg.Database.Host == "" {
app.cfg.Database.Host = "localhost"
}
if app.cfg.Database.Database == "" {
app.cfg.Database.Database = "writefreely"
}
// TODO: check err
connectToDatabase(app)
// Test database connection
err := app.db.Ping()
if err != nil {
return fmt.Errorf("Database ping failed: %s", err)
}
return nil
}
// FormatVersion constructs the version string for the application
func FormatVersion() string {
return serverSoftware + " " + softwareVer
}
// OutputVersion prints out the version of the application.
func OutputVersion() {
fmt.Println(FormatVersion())
}
// NewApp creates a new app instance.
func NewApp(cfgFile string) *App {
return &App{
cfgFile: cfgFile,
}
}
// CreateConfig creates a default configuration and saves it to the app's cfgFile.
func CreateConfig(app *App) error {
log.Info("Creating configuration...")
c := config.New()
log.Info("Saving configuration %s...", app.cfgFile)
err := config.Save(c, app.cfgFile)
if err != nil {
return fmt.Errorf("Unable to save configuration: %v", err)
}
return nil
}
// DoConfig runs the interactive configuration process.
func DoConfig(app *App, configSections string) {
if configSections == "" {
configSections = "server db app"
}
// let's check there aren't any garbage in the list
configSectionsArray := strings.Split(configSections, " ")
for _, element := range configSectionsArray {
if element != "server" && element != "db" && element != "app" {
log.Error("Invalid argument to --sections. Valid arguments are only \"server\", \"db\" and \"app\"")
os.Exit(1)
}
}
d, err := config.Configure(app.cfgFile, configSections)
if err != nil {
log.Error("Unable to configure: %v", err)
os.Exit(1)
}
app.cfg = d.Config
connectToDatabase(app)
defer shutdown(app)
if !app.db.DatabaseInitialized() {
err = adminInitDatabase(app)
if err != nil {
log.Error(err.Error())
os.Exit(1)
}
} else {
log.Info("Database already initialized.")
}
if d.User != nil {
u := &User{
Username: d.User.Username,
HashedPass: d.User.HashedPass,
Created: time.Now().Truncate(time.Second).UTC(),
}
// Create blog
log.Info("Creating user %s...\n", u.Username)
err = app.db.CreateUser(app.cfg, u, app.cfg.App.SiteName, "")
if err != nil {
log.Error("Unable to create user: %s", err)
os.Exit(1)
}
log.Info("Done!")
}
os.Exit(0)
}
// GenerateKeyFiles creates app encryption keys and saves them into the configured KeysParentDir.
func GenerateKeyFiles(app *App) error {
// Read keys path from config
app.LoadConfig()
// Create keys dir if it doesn't exist yet
fullKeysDir := filepath.Join(app.cfg.Server.KeysParentDir, keysDir)
if _, err := os.Stat(fullKeysDir); os.IsNotExist(err) {
err = os.Mkdir(fullKeysDir, 0700)
if err != nil {
return err
}
}
// Generate keys
initKeyPaths(app)
// TODO: use something like https://github.com/hashicorp/go-multierror to return errors
var keyErrs error
err := generateKey(emailKeyPath)
if err != nil {
keyErrs = err
}
err = generateKey(cookieAuthKeyPath)
if err != nil {
keyErrs = err
}
err = generateKey(cookieKeyPath)
if err != nil {
keyErrs = err
}
err = generateKey(csrfKeyPath)
if err != nil {
keyErrs = err
}
return keyErrs
}
// CreateSchema creates all database tables needed for the application.
func CreateSchema(apper Apper) error {
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
err := adminInitDatabase(apper.App())
if err != nil {
return err
}
return nil
}
// Migrate runs all necessary database migrations.
func Migrate(apper Apper) error {
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
err := migrations.Migrate(migrations.NewDatastore(apper.App().db.DB, apper.App().db.driverName))
if err != nil {
return fmt.Errorf("migrate: %s", err)
}
return nil
}
// ResetPassword runs the interactive password reset process.
func ResetPassword(apper Apper, username string) error {
// Connect to the database
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
// Fetch user
u, err := apper.App().db.GetUserForAuth(username)
if err != nil {
log.Error("Get user: %s", err)
os.Exit(1)
}
// Prompt for new password
prompt := promptui.Prompt{
Templates: &promptui.PromptTemplates{
Success: "{{ . | bold | faint }}: ",
},
Label: "New password",
Mask: '*',
}
newPass, err := prompt.Run()
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
// Do the update
log.Info("Updating...")
err = adminResetPassword(apper.App(), u, newPass)
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
log.Info("Success.")
return nil
}
// DoDeleteAccount runs the confirmation and account delete process.
func DoDeleteAccount(apper Apper, username string) error {
// Connect to the database
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
// check user exists
u, err := apper.App().db.GetUserForAuth(username)
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
userID := u.ID
// do not delete the admin account
// TODO: check for other admins and skip?
if u.IsAdmin() {
log.Error("Can not delete admin account")
os.Exit(1)
}
// confirm deletion, w/ w/out posts
prompt := promptui.Prompt{
Templates: &promptui.PromptTemplates{
Success: "{{ . | bold | faint }}: ",
},
Label: fmt.Sprintf("Really delete user : %s", username),
IsConfirm: true,
}
_, err = prompt.Run()
if err != nil {
log.Info("Aborted...")
os.Exit(0)
}
log.Info("Deleting...")
err = apper.App().db.DeleteAccount(userID)
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
log.Info("Success.")
return nil
}
func connectToDatabase(app *App) {
log.Info("Connecting to %s database...", app.cfg.Database.Type)
var db *sql.DB
var err error
if app.cfg.Database.Type == driverMySQL {
db, err = sql.Open(app.cfg.Database.Type, fmt.Sprintf("%s:%s@tcp(%s:%d)/%s?charset=utf8mb4&parseTime=true&loc=%s&tls=%t", app.cfg.Database.User, app.cfg.Database.Password, app.cfg.Database.Host, app.cfg.Database.Port, app.cfg.Database.Database, url.QueryEscape(time.Local.String()), app.cfg.Database.TLS))
db.SetMaxOpenConns(50)
} else if app.cfg.Database.Type == driverSQLite {
if !SQLiteEnabled {
log.Error("Invalid database type '%s'. Binary wasn't compiled with SQLite3 support.", app.cfg.Database.Type)
os.Exit(1)
}
if app.cfg.Database.FileName == "" {
log.Error("SQLite database filename value in config.ini is empty.")
os.Exit(1)
}
db, err = sql.Open("sqlite3_with_regex", app.cfg.Database.FileName+"?parseTime=true&cached=shared")
db.SetMaxOpenConns(2)
} else {
log.Error("Invalid database type '%s'. Only 'mysql' and 'sqlite3' are supported right now.", app.cfg.Database.Type)
os.Exit(1)
}
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
app.db = &datastore{db, app.cfg.Database.Type}
}
func shutdown(app *App) {
log.Info("Closing database connection...")
app.db.Close()
}
// CreateUser creates a new admin or normal user from the given credentials.
func CreateUser(apper Apper, username, password string, isAdmin bool) error {
// Create an admin user with --create-admin
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
// Ensure an admin / first user doesn't already exist
firstUser, _ := apper.App().db.GetUserByID(1)
if isAdmin {
// Abort if trying to create admin user, but one already exists
if firstUser != nil {
return fmt.Errorf("Admin user already exists (%s). Create a regular user with: writefreely --create-user", firstUser.Username)
}
} else {
// Abort if trying to create regular user, but no admin exists yet
if firstUser == nil {
return fmt.Errorf("No admin user exists yet. Create an admin first with: writefreely --create-admin")
}
}
// Create the user
// Normalize and validate username
desiredUsername := username
username = getSlug(username, "")
usernameDesc := username
if username != desiredUsername {
usernameDesc += " (originally: " + desiredUsername + ")"
}
if !author.IsValidUsername(apper.App().cfg, username) {
return fmt.Errorf("Username %s is invalid, reserved, or shorter than configured minimum length (%d characters).", usernameDesc, apper.App().cfg.App.MinUsernameLen)
}
// Hash the password
hashedPass, err := auth.HashPass([]byte(password))
if err != nil {
return fmt.Errorf("Unable to hash password: %v", err)
}
u := &User{
Username: username,
HashedPass: hashedPass,
Created: time.Now().Truncate(time.Second).UTC(),
}
userType := "user"
if isAdmin {
userType = "admin"
}
log.Info("Creating %s %s...", userType, usernameDesc)
err = apper.App().db.CreateUser(apper.App().Config(), u, desiredUsername, "")
if err != nil {
return fmt.Errorf("Unable to create user: %s", err)
}
log.Info("Done!")
return nil
}
func adminInitDatabase(app *App) error {
schemaFileName := "schema.sql"
if app.cfg.Database.Type == driverSQLite {
schemaFileName = "sqlite.sql"
}
schema, err := Asset(schemaFileName)
if err != nil {
return fmt.Errorf("Unable to load schema file: %v", err)
}
tblReg := regexp.MustCompile("CREATE TABLE (IF NOT EXISTS )?`([a-z_]+)`")
queries := strings.Split(string(schema), ";\n")
for _, q := range queries {
if strings.TrimSpace(q) == "" {
continue
}
parts := tblReg.FindStringSubmatch(q)
if len(parts) >= 3 {
log.Info("Creating table %s...", parts[2])
} else {
log.Info("Creating table ??? (Weird query) No match in: %v", parts)
}
_, err = app.db.Exec(q)
if err != nil {
log.Error("%s", err)
} else {
log.Info("Created.")
}
}
// Set up migrations table
log.Info("Initializing appmigrations table...")
err = migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName))
if err != nil {
return fmt.Errorf("Unable to set initial migrations: %v", err)
}
log.Info("Running migrations...")
err = migrations.Migrate(migrations.NewDatastore(app.db.DB, app.db.driverName))
if err != nil {
return fmt.Errorf("migrate: %s", err)
}
log.Info("Done.")
return nil
}
// ServerUserAgent returns a User-Agent string to use in external requests. The
// hostName parameter may be left empty.
func ServerUserAgent(hostName string) string {
hostUAStr := ""
if hostName != "" {
hostUAStr = "; +" + hostName
}
return "Go (" + serverSoftware + "/" + softwareVer + hostUAStr + ")"
}
diff --git a/auth.go b/auth.go
index fbee601..e871bdd 100644
--- a/auth.go
+++ b/auth.go
@@ -1,28 +1,28 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
// AuthenticateUser ensures a user with the given accessToken is valid. Call
// it before any operations that require authentication or optionally associate
// data with a user account.
// Returns an error if the given accessToken is invalid. Otherwise the
// associated user ID is returned.
func AuthenticateUser(db writestore, accessToken string) (int64, error) {
if accessToken == "" {
return 0, ErrNoAccessToken
}
userID := db.GetUserID(accessToken)
if userID == -1 {
return 0, ErrBadAccessToken
}
return userID, nil
}
diff --git a/author/author.go b/author/author.go
index 7431ac5..9c1fec9 100644
--- a/author/author.go
+++ b/author/author.go
@@ -1,128 +1,128 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package author
import (
"github.com/writefreely/writefreely/config"
"os"
"path/filepath"
"regexp"
)
// Regex pattern for valid usernames
var validUsernameReg = regexp.MustCompile("^[a-zA-Z0-9][a-zA-Z0-9-]*$")
// List of reserved usernames
var reservedUsernames = map[string]bool{
"a": true,
"about": true,
"add": true,
"admin": true,
"administrator": true,
"adminzone": true,
"api": true,
"article": true,
"articles": true,
"auth": true,
"authenticate": true,
"browse": true,
"c": true,
"categories": true,
"category": true,
"changes": true,
"community": true,
"create": true,
"css": true,
"data": true,
"dev": true,
"developers": true,
"draft": true,
"drafts": true,
"edit": true,
"edits": true,
"faq": true,
"feed": true,
"feedback": true,
"guide": true,
"guides": true,
"help": true,
"index": true,
"invite": true,
"js": true,
"login": true,
"logout": true,
"me": true,
"media": true,
"meta": true,
"metadata": true,
"new": true,
"news": true,
"oauth": true,
"post": true,
"posts": true,
"privacy": true,
"publication": true,
"publications": true,
"publish": true,
"random": true,
"read": true,
"reader": true,
"register": true,
"remove": true,
"signin": true,
"signout": true,
"signup": true,
"start": true,
"status": true,
"summary": true,
"support": true,
"tag": true,
"tags": true,
"team": true,
"template": true,
"templates": true,
"terms": true,
"terms-of-service": true,
"termsofservice": true,
"theme": true,
"themes": true,
"tips": true,
"tos": true,
"update": true,
"updates": true,
"user": true,
"users": true,
"yourname": true,
}
// IsValidUsername returns true if a given username is neither reserved nor
// of the correct format.
func IsValidUsername(cfg *config.Config, username string) bool {
// Username has to be above a character limit
if len(username) < cfg.App.MinUsernameLen {
return false
}
// Username is invalid if page with the same name exists. So traverse
// available pages, adding them to reservedUsernames map that'll be checked
// later.
filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, "pages"), func(path string, i os.FileInfo, err error) error {
reservedUsernames[i.Name()] = true
return nil
})
// Username is invalid if it is reserved!
if _, reserved := reservedUsernames[username]; reserved {
return false
}
// TODO: use correct regexp function here
return len(validUsernameReg.FindStringSubmatch(username)) > 0
}
diff --git a/cache.go b/cache.go
index b1b1be9..47cff3a 100644
--- a/cache.go
+++ b/cache.go
@@ -1,69 +1,69 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"sync"
"time"
)
const (
postsCacheTime = 4 * time.Second
)
type (
postsCacheItem struct {
Expire time.Time
Posts *[]PublicPost
ready chan struct{}
}
AuthCache struct {
Alias, Pass, Token string
BadPasses map[string]bool
expire time.Time
}
)
var (
userPostsCache = struct {
sync.RWMutex
users map[int64]postsCacheItem
}{
users: map[int64]postsCacheItem{},
}
)
func CachePosts(userID int64, p *[]PublicPost) {
close(userPostsCache.users[userID].ready)
userPostsCache.Lock()
userPostsCache.users[userID] = postsCacheItem{
Expire: time.Now().Add(postsCacheTime),
Posts: p,
}
userPostsCache.Unlock()
}
func GetPostsCache(userID int64) *[]PublicPost {
userPostsCache.RLock()
pci, ok := userPostsCache.users[userID]
userPostsCache.RUnlock()
if !ok {
return nil
}
if pci.Expire.Before(time.Now()) {
// Cache is expired
return nil
}
return pci.Posts
}
diff --git a/cmd/writefreely/config.go b/cmd/writefreely/config.go
index 32e3801..1c3e769 100644
--- a/cmd/writefreely/config.go
+++ b/cmd/writefreely/config.go
@@ -1,60 +1,60 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package main
import (
"github.com/urfave/cli/v2"
"github.com/writefreely/writefreely"
)
var (
cmdConfig cli.Command = cli.Command{
Name: "config",
Usage: "config management tools",
Subcommands: []*cli.Command{
&cmdConfigGenerate,
&cmdConfigInteractive,
},
}
cmdConfigGenerate cli.Command = cli.Command{
Name: "generate",
Aliases: []string{"gen"},
Usage: "Generate a basic configuration",
Action: genConfigAction,
}
cmdConfigInteractive cli.Command = cli.Command{
Name: "start",
Usage: "Interactive configuration process",
Action: interactiveConfigAction,
Flags: []cli.Flag{
&cli.StringFlag{
Name: "sections",
Value: "server db app",
Usage: "Which sections of the configuration to go through\n" +
"valid values of sections flag are any combination of 'server', 'db' and 'app' \n" +
"example: writefreely config start --sections \"db app\"",
},
},
}
)
func genConfigAction(c *cli.Context) error {
app := writefreely.NewApp(c.String("c"))
return writefreely.CreateConfig(app)
}
func interactiveConfigAction(c *cli.Context) error {
app := writefreely.NewApp(c.String("c"))
writefreely.DoConfig(app, c.String("sections"))
return nil
}
diff --git a/cmd/writefreely/db.go b/cmd/writefreely/db.go
index ccae418..908e163 100644
--- a/cmd/writefreely/db.go
+++ b/cmd/writefreely/db.go
@@ -1,49 +1,49 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package main
import (
"github.com/urfave/cli/v2"
"github.com/writefreely/writefreely"
)
var (
cmdDB cli.Command = cli.Command{
Name: "db",
Usage: "db management tools",
Subcommands: []*cli.Command{
&cmdDBInit,
&cmdDBMigrate,
},
}
cmdDBInit cli.Command = cli.Command{
Name: "init",
Usage: "Initialize Database",
Action: initDBAction,
}
cmdDBMigrate cli.Command = cli.Command{
Name: "migrate",
Usage: "Migrate Database",
Action: migrateDBAction,
}
)
func initDBAction(c *cli.Context) error {
app := writefreely.NewApp(c.String("c"))
return writefreely.CreateSchema(app)
}
func migrateDBAction(c *cli.Context) error {
app := writefreely.NewApp(c.String("c"))
return writefreely.Migrate(app)
}
diff --git a/cmd/writefreely/keys.go b/cmd/writefreely/keys.go
index 680cd4d..2e7cc8e 100644
--- a/cmd/writefreely/keys.go
+++ b/cmd/writefreely/keys.go
@@ -1,38 +1,38 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package main
import (
"github.com/urfave/cli/v2"
"github.com/writefreely/writefreely"
)
var (
cmdKeys cli.Command = cli.Command{
Name: "keys",
Usage: "key management tools",
Subcommands: []*cli.Command{
&cmdGenerateKeys,
},
}
cmdGenerateKeys cli.Command = cli.Command{
Name: "generate",
Aliases: []string{"gen"},
Usage: "Generate encryption and authentication keys",
Action: genKeysAction,
}
)
func genKeysAction(c *cli.Context) error {
app := writefreely.NewApp(c.String("c"))
return writefreely.GenerateKeyFiles(app)
}
diff --git a/cmd/writefreely/main.go b/cmd/writefreely/main.go
index 992d611..cd7ed69 100644
--- a/cmd/writefreely/main.go
+++ b/cmd/writefreely/main.go
@@ -1,183 +1,183 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package main
import (
"fmt"
"os"
"strings"
"github.com/gorilla/mux"
"github.com/urfave/cli/v2"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely"
)
func main() {
cli.VersionPrinter = func(c *cli.Context) {
fmt.Printf("%s\n", c.App.Version)
}
app := &cli.App{
Name: "WriteFreely",
Usage: "A beautifully pared-down blogging platform",
Version: writefreely.FormatVersion(),
Action: legacyActions, // legacy due to use of flags for switching actions
Flags: []cli.Flag{
&cli.BoolFlag{
Name: "create-config",
Value: false,
Usage: "Generate a basic configuration",
Hidden: true,
},
&cli.BoolFlag{
Name: "config",
Value: false,
Usage: "Interactive configuration process",
Hidden: true,
},
&cli.StringFlag{
Name: "sections",
Value: "server db app",
Usage: "Which sections of the configuration to go through (requires --config)\n" +
"valid values are any combination of 'server', 'db' and 'app' \n" +
"example: writefreely --config --sections \"db app\"",
Hidden: true,
},
&cli.BoolFlag{
Name: "gen-keys",
Value: false,
Usage: "Generate encryption and authentication keys",
Hidden: true,
},
&cli.BoolFlag{
Name: "init-db",
Value: false,
Usage: "Initialize app database",
Hidden: true,
},
&cli.BoolFlag{
Name: "migrate",
Value: false,
Usage: "Migrate the database",
Hidden: true,
},
&cli.StringFlag{
Name: "create-admin",
Usage: "Create an admin with the given username:password",
Hidden: true,
},
&cli.StringFlag{
Name: "create-user",
Usage: "Create a regular user with the given username:password",
Hidden: true,
},
&cli.StringFlag{
Name: "delete-user",
Usage: "Delete a user with the given username",
Hidden: true,
},
&cli.StringFlag{
Name: "reset-pass",
Usage: "Reset the given user's password",
Hidden: true,
},
}, // legacy flags (set to hidden to eventually switch to bash-complete compatible format)
}
defaultFlags := []cli.Flag{
&cli.StringFlag{
Name: "c",
Value: "config.ini",
Usage: "Load configuration from `FILE`",
},
&cli.BoolFlag{
Name: "debug",
Value: false,
Usage: "Enables debug logging",
},
}
app.Flags = append(app.Flags, defaultFlags...)
app.Commands = []*cli.Command{
&cmdUser,
&cmdDB,
&cmdConfig,
&cmdKeys,
&cmdServe,
}
err := app.Run(os.Args)
if err != nil {
log.Error(err.Error())
os.Exit(1)
}
}
func legacyActions(c *cli.Context) error {
app := writefreely.NewApp(c.String("c"))
switch true {
case c.IsSet("create-config"):
return writefreely.CreateConfig(app)
case c.IsSet("config"):
writefreely.DoConfig(app, c.String("sections"))
return nil
case c.IsSet("gen-keys"):
return writefreely.GenerateKeyFiles(app)
case c.IsSet("init-db"):
return writefreely.CreateSchema(app)
case c.IsSet("migrate"):
return writefreely.Migrate(app)
case c.IsSet("create-admin"):
username, password, err := parseCredentials(c.String("create-admin"))
if err != nil {
return err
}
return writefreely.CreateUser(app, username, password, true)
case c.IsSet("create-user"):
username, password, err := parseCredentials(c.String("create-user"))
if err != nil {
return err
}
return writefreely.CreateUser(app, username, password, false)
case c.IsSet("delete-user"):
return writefreely.DoDeleteAccount(app, c.String("delete-user"))
case c.IsSet("reset-pass"):
return writefreely.ResetPassword(app, c.String("reset-pass"))
}
// Initialize the application
var err error
log.Info("Starting %s...", writefreely.FormatVersion())
app, err = writefreely.Initialize(app, c.Bool("debug"))
if err != nil {
return err
}
// Set app routes
r := mux.NewRouter()
writefreely.InitRoutes(app, r)
app.InitStaticRoutes(r)
// Serve the application
writefreely.Serve(app, r)
return nil
}
func parseCredentials(credentialString string) (string, string, error) {
creds := strings.Split(credentialString, ":")
if len(creds) != 2 {
return "", "", fmt.Errorf("invalid format for passed credentials, must be username:password")
}
return creds[0], creds[1], nil
}
diff --git a/cmd/writefreely/user.go b/cmd/writefreely/user.go
index 8429513..2efb4b9 100644
--- a/cmd/writefreely/user.go
+++ b/cmd/writefreely/user.go
@@ -1,96 +1,96 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package main
import (
"fmt"
"github.com/urfave/cli/v2"
"github.com/writefreely/writefreely"
)
var (
cmdUser cli.Command = cli.Command{
Name: "user",
Usage: "user management tools",
Subcommands: []*cli.Command{
&cmdAddUser,
&cmdDelUser,
&cmdResetPass,
// TODO: possibly add a user list command
},
}
cmdAddUser cli.Command = cli.Command{
Name: "create",
Usage: "Add new user",
Aliases: []string{"a", "add"},
Flags: []cli.Flag{
&cli.BoolFlag{
Name: "admin",
Value: false,
Usage: "Create admin user",
},
},
Action: addUserAction,
}
cmdDelUser cli.Command = cli.Command{
Name: "delete",
Usage: "Delete user",
Aliases: []string{"del", "d"},
Action: delUserAction,
}
cmdResetPass cli.Command = cli.Command{
Name: "reset-pass",
Usage: "Reset user's password",
Aliases: []string{"resetpass", "reset"},
Action: resetPassAction,
}
)
func addUserAction(c *cli.Context) error {
credentials := ""
if c.NArg() > 0 {
credentials = c.Args().Get(0)
} else {
return fmt.Errorf("No user passed. Example: writefreely user add [USER]:[PASSWORD]")
}
username, password, err := parseCredentials(credentials)
if err != nil {
return err
}
app := writefreely.NewApp(c.String("c"))
return writefreely.CreateUser(app, username, password, c.Bool("admin"))
}
func delUserAction(c *cli.Context) error {
username := ""
if c.NArg() > 0 {
username = c.Args().Get(0)
} else {
return fmt.Errorf("No user passed. Example: writefreely user delete [USER]")
}
app := writefreely.NewApp(c.String("c"))
return writefreely.DoDeleteAccount(app, username)
}
func resetPassAction(c *cli.Context) error {
username := ""
if c.NArg() > 0 {
username = c.Args().Get(0)
} else {
return fmt.Errorf("No user passed. Example: writefreely user reset-pass [USER]")
}
app := writefreely.NewApp(c.String("c"))
return writefreely.ResetPassword(app, username)
}
diff --git a/cmd/writefreely/web.go b/cmd/writefreely/web.go
index 02ae1c9..b91910c 100644
--- a/cmd/writefreely/web.go
+++ b/cmd/writefreely/web.go
@@ -1,48 +1,48 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package main
import (
"github.com/gorilla/mux"
"github.com/urfave/cli/v2"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely"
)
var (
cmdServe cli.Command = cli.Command{
Name: "serve",
Aliases: []string{"web"},
Usage: "Run web application",
Action: serveAction,
}
)
func serveAction(c *cli.Context) error {
// Initialize the application
app := writefreely.NewApp(c.String("c"))
var err error
log.Info("Starting %s...", writefreely.FormatVersion())
app, err = writefreely.Initialize(app, c.Bool("debug"))
if err != nil {
return err
}
// Set app routes
r := mux.NewRouter()
writefreely.InitRoutes(app, r)
app.InitStaticRoutes(r)
// Serve the application
writefreely.Serve(app, r)
return nil
}
diff --git a/collections.go b/collections.go
index beadf19..6ded4c3 100644
--- a/collections.go
+++ b/collections.go
@@ -1,1229 +1,1229 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"fmt"
"html/template"
"math"
"net/http"
"net/url"
"regexp"
"strconv"
"strings"
"unicode"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/bots"
"github.com/writeas/web-core/log"
waposts "github.com/writeas/web-core/posts"
"github.com/writefreely/writefreely/author"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/page"
"golang.org/x/net/idna"
)
type (
// TODO: add Direction to db
// TODO: add Language to db
Collection struct {
ID int64 `datastore:"id" json:"-"`
Alias string `datastore:"alias" schema:"alias" json:"alias"`
Title string `datastore:"title" schema:"title" json:"title"`
Description string `datastore:"description" schema:"description" json:"description"`
Direction string `schema:"dir" json:"dir,omitempty"`
Language string `schema:"lang" json:"lang,omitempty"`
StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"`
Script string `datastore:"script" schema:"script" json:"script,omitempty"`
Signature string `datastore:"post_signature" schema:"signature" json:"-"`
Public bool `datastore:"public" json:"public"`
Visibility collVisibility `datastore:"private" json:"-"`
Format string `datastore:"format" json:"format,omitempty"`
Views int64 `json:"views"`
OwnerID int64 `datastore:"owner_id" json:"-"`
PublicOwner bool `datastore:"public_owner" json:"-"`
URL string `json:"url,omitempty"`
Monetization string `json:"monetization_pointer,omitempty"`
db *datastore
hostName string
}
CollectionObj struct {
Collection
TotalPosts int `json:"total_posts"`
Owner *User `json:"owner,omitempty"`
Posts *[]PublicPost `json:"posts,omitempty"`
Format *CollectionFormat
}
DisplayCollection struct {
*CollectionObj
Prefix string
IsTopLevel bool
CurrentPage int
TotalPages int
Silenced bool
}
SubmittedCollection struct {
// Data used for updating a given collection
ID int64
OwnerID uint64
// Form helpers
PreferURL string `schema:"prefer_url" json:"prefer_url"`
Privacy int `schema:"privacy" json:"privacy"`
Pass string `schema:"password" json:"password"`
MathJax bool `schema:"mathjax" json:"mathjax"`
Handle string `schema:"handle" json:"handle"`
// Actual collection values updated in the DB
Alias *string `schema:"alias" json:"alias"`
Title *string `schema:"title" json:"title"`
Description *string `schema:"description" json:"description"`
StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"`
Script *sql.NullString `schema:"script" json:"script"`
Signature *sql.NullString `schema:"signature" json:"signature"`
Monetization *string `schema:"monetization_pointer" json:"monetization_pointer"`
Visibility *int `schema:"visibility" json:"public"`
Format *sql.NullString `schema:"format" json:"format"`
}
CollectionFormat struct {
Format string
}
collectionReq struct {
// Information about the collection request itself
prefix, alias, domain string
isCustomDomain bool
// User-related fields
isCollOwner bool
isAuthorized bool
}
)
func (sc *SubmittedCollection) FediverseHandle() string {
if sc.Handle == "" {
return apCustomHandleDefault
}
return getSlug(sc.Handle, "")
}
// collVisibility represents the visibility level for the collection.
type collVisibility int
// Visibility levels. Values are bitmasks, stored in the database as
// decimal numbers. If adding types, append them to this list. If removing,
// replace the desired visibility with a new value.
const CollUnlisted collVisibility = 0
const (
CollPublic collVisibility = 1 << iota
CollPrivate
CollProtected
)
var collVisibilityStrings = map[string]collVisibility{
"unlisted": CollUnlisted,
"public": CollPublic,
"private": CollPrivate,
"protected": CollProtected,
}
func defaultVisibility(cfg *config.Config) collVisibility {
vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility]
if !ok {
vis = CollUnlisted
}
return vis
}
func (cf *CollectionFormat) Ascending() bool {
return cf.Format == "novel"
}
func (cf *CollectionFormat) ShowDates() bool {
return cf.Format == "blog"
}
func (cf *CollectionFormat) PostsPerPage() int {
if cf.Format == "novel" {
return postsPerPage
}
return postsPerPage
}
// Valid returns whether or not a format value is valid.
func (cf *CollectionFormat) Valid() bool {
return cf.Format == "blog" ||
cf.Format == "novel" ||
cf.Format == "notebook"
}
// NewFormat creates a new CollectionFormat object from the Collection.
func (c *Collection) NewFormat() *CollectionFormat {
cf := &CollectionFormat{Format: c.Format}
// Fill in default format
if cf.Format == "" {
cf.Format = "blog"
}
return cf
}
func (c *Collection) IsInstanceColl() bool {
ur, _ := url.Parse(c.hostName)
return c.Alias == ur.Host
}
func (c *Collection) IsUnlisted() bool {
return c.Visibility == 0
}
func (c *Collection) IsPrivate() bool {
return c.Visibility&CollPrivate != 0
}
func (c *Collection) IsProtected() bool {
return c.Visibility&CollProtected != 0
}
func (c *Collection) IsPublic() bool {
return c.Visibility&CollPublic != 0
}
func (c *Collection) FriendlyVisibility() string {
if c.IsPrivate() {
return "Private"
}
if c.IsPublic() {
return "Public"
}
if c.IsProtected() {
return "Password-protected"
}
return "Unlisted"
}
func (c *Collection) ShowFooterBranding() bool {
// TODO: implement this setting
return true
}
// CanonicalURL returns a fully-qualified URL to the collection.
func (c *Collection) CanonicalURL() string {
return c.RedirectingCanonicalURL(false)
}
func (c *Collection) DisplayCanonicalURL() string {
us := c.CanonicalURL()
u, err := url.Parse(us)
if err != nil {
return us
}
p := u.Path
if p == "/" {
p = ""
}
d := u.Hostname()
d, _ = idna.ToUnicode(d)
return d + p
}
// RedirectingCanonicalURL returns the fully-qualified canonical URL for the Collection, with a trailing slash. The
// hostName field needs to be populated for this to work correctly.
func (c *Collection) RedirectingCanonicalURL(isRedir bool) string {
if c.hostName == "" {
// If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail
log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writefreely/writefreely/issues/new?template=bug_report.md")
}
if isSingleUser {
return c.hostName + "/"
}
return fmt.Sprintf("%s/%s/", c.hostName, c.Alias)
}
// PrevPageURL provides a full URL for the previous page of collection posts,
// returning a /page/N result for pages >1
func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string {
u := ""
if n == 2 {
// Previous page is 1; no need for /page/ prefix
if prefix == "" {
u = "/"
}
// Else leave off trailing slash
} else {
u = fmt.Sprintf("/page/%d", n-1)
}
if tl {
return u
}
return "/" + prefix + c.Alias + u
}
// NextPageURL provides a full URL for the next page of collection posts
func (c *Collection) NextPageURL(prefix string, n int, tl bool) string {
if tl {
return fmt.Sprintf("/page/%d", n+1)
}
return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1)
}
func (c *Collection) DisplayTitle() string {
if c.Title != "" {
return c.Title
}
return c.Alias
}
func (c *Collection) StyleSheetDisplay() template.CSS {
return template.CSS(c.StyleSheet)
}
// ForPublic modifies the Collection for public consumption, such as via
// the API.
func (c *Collection) ForPublic() {
c.URL = c.CanonicalURL()
}
var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString
func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person {
accountRoot := c.FederatedAccount()
p := activitystreams.NewPerson(accountRoot)
p.URL = c.CanonicalURL()
uname := c.Alias
p.PreferredUsername = uname
p.Name = c.DisplayTitle()
p.Summary = c.Description
if p.Name != "" {
if av := c.AvatarURL(); av != "" {
p.Icon = activitystreams.Image{
Type: "Image",
MediaType: "image/png",
URL: av,
}
}
}
collID := c.ID
if len(ids) > 0 {
collID = ids[0]
}
pub, priv := c.db.GetAPActorKeys(collID)
if pub != nil {
p.AddPubKey(pub)
p.SetPrivKey(priv)
}
return p
}
func (c *Collection) AvatarURL() string {
fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0]))
if !isAvatarChar(fl) {
return ""
}
return c.hostName + "/img/avatars/" + fl + ".png"
}
func (c *Collection) FederatedAPIBase() string {
return c.hostName + "/"
}
func (c *Collection) FederatedAccount() string {
accountUser := c.Alias
return c.FederatedAPIBase() + "api/collections/" + accountUser
}
func (c *Collection) RenderMathJax() bool {
return c.db.CollectionHasAttribute(c.ID, "render_mathjax")
}
func (c *Collection) MonetizationURL() string {
if c.Monetization == "" {
return ""
}
return strings.Replace(c.Monetization, "$", "https://", 1)
}
func (c CollectionPage) DisplayMonetization() string {
return displayMonetization(c.Monetization, c.Alias)
}
func newCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
alias := r.FormValue("alias")
title := r.FormValue("title")
var missingParams, accessToken string
var u *User
c := struct {
Alias string `json:"alias" schema:"alias"`
Title string `json:"title" schema:"title"`
Web bool `json:"web" schema:"web"`
}{}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse post update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
// TODO: move form parsing to formDecoder
c.Alias = alias
c.Title = title
}
if c.Alias == "" {
if c.Title != "" {
// If only a title was given, just use it to generate the alias.
c.Alias = getSlug(c.Title, "")
} else {
missingParams += "`alias` "
}
}
if c.Title == "" {
missingParams += "`title` "
}
if missingParams != "" {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)}
}
var userID int64
var err error
if reqJSON && !c.Web {
accessToken = r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
userID = app.db.GetUserID(accessToken)
if userID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
userID = u.ID
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("new collection: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrUserSilenced
}
if !author.IsValidUsername(app.cfg, c.Alias) {
return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."}
}
coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID)
if err != nil {
// TODO: handle this
return err
}
res := &CollectionObj{Collection: *coll}
if reqJSON {
return impart.WriteSuccess(w, res, http.StatusCreated)
}
redirectTo := "/me/c/"
// TODO: redirect to pad when necessary
return impart.HTTPError{http.StatusFound, redirectTo}
}
func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) {
accessToken := r.Header.Get("Authorization")
var userID int64 = -1
if accessToken != "" {
userID = app.db.GetUserID(accessToken)
}
isCollOwner := userID == c.OwnerID
if c.IsPrivate() && !isCollOwner {
// Collection is private, but user isn't authenticated
return -1, ErrCollectionNotFound
}
if c.IsProtected() {
// TODO: check access token
return -1, ErrCollectionUnauthorizedRead
}
return userID, nil
}
// fetchCollection handles the API endpoint for retrieving collection data.
func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error {
accept := r.Header.Get("Accept")
if strings.Contains(accept, "application/activity+json") {
return handleFetchCollectionActivities(app, w, r)
}
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: move this logic into a common getCollection function
// Get base Collection data
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Redirect users who aren't requesting JSON
reqJSON := IsJSON(r)
if !reqJSON {
return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
}
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Fetch extra data about the Collection
res := &CollectionObj{Collection: *c}
if c.PublicOwner {
u, err := app.db.GetUserByID(res.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
res.Owner = u
}
}
// TODO: check status for silenced
app.db.GetPostsCount(res, isCollOwner)
// Strip non-public information
res.Collection.ForPublic()
return impart.WriteSuccess(w, res, http.StatusOK)
}
// fetchCollectionPosts handles an API endpoint for retrieving a collection's
// posts.
func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
alias := vars["alias"]
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Get page
page := 1
if p := r.FormValue("page"); p != "" {
pInt, _ := strconv.Atoi(p)
if pInt > 0 {
page = pInt
}
}
posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false)
if err != nil {
return err
}
coll := &CollectionObj{Collection: *c, Posts: posts}
app.db.GetPostsCount(coll, isCollOwner)
// Strip non-public information
coll.Collection.ForPublic()
// Transform post bodies if needed
if r.FormValue("body") == "html" {
for _, p := range *coll.Posts {
p.Content = waposts.ApplyMarkdown([]byte(p.Content))
}
}
return impart.WriteSuccess(w, coll, http.StatusOK)
}
type CollectionPage struct {
page.StaticPage
*DisplayCollection
IsCustomDomain bool
IsWelcome bool
IsOwner bool
IsCollLoggedIn bool
CanPin bool
Username string
Monetization string
Collections *[]Collection
PinnedPosts *[]PublicPost
IsAdmin bool
CanInvite bool
// Helper field for Chorus mode
CollAlias string
}
func NewCollectionObj(c *Collection) *CollectionObj {
return &CollectionObj{
Collection: *c,
Format: c.NewFormat(),
}
}
func (c *CollectionObj) ScriptDisplay() template.JS {
return template.JS(c.Script)
}
var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$")
func (c *CollectionObj) ExternalScripts() []template.URL {
scripts := []template.URL{}
if c.Script == "" {
return scripts
}
matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1)
for _, m := range matches {
scripts = append(scripts, template.URL(strings.TrimSpace(m[1])))
}
return scripts
}
func (c *CollectionObj) CanShowScript() bool {
return false
}
func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error {
cr.prefix = vars["prefix"]
cr.alias = vars["collection"]
// Normalize the URL, redirecting user to consistent post URL
if cr.alias != strings.ToLower(cr.alias) {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))}
}
return nil
}
// processCollectionPermissions checks the permissions for the given
// collectionReq, returning a Collection if access is granted; otherwise this
// renders any necessary collection pages, for example, if requesting a custom
// domain that doesn't yet have a collection associated, or if a collection
// requires a password. In either case, this will return nil, nil -- thus both
// values should ALWAYS be checked to determine whether or not to continue.
func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) {
// Display collection if this is a collection
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(cr.alias)
}
// TODO: verify we don't reveal the existence of a private collection with redirection
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
if cr.isCustomDomain {
// User is on the site from a custom domain
//tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r))
//if tErr != nil {
//log.Error("Unable to render 404-domain page: %v", err)
//}
return nil, nil
}
if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen {
// Alias is within post ID range, so just be sure this isn't a post
if app.db.PostIDExists(cr.alias) {
// TODO: use StatusFound for vanity post URLs when we implement them
return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias}
}
}
// Redirect if necessary
newAlias := app.db.GetCollectionRedirect(cr.alias)
if newAlias != "" {
return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"}
}
}
}
return nil, err
}
c.hostName = app.cfg.App.Host
// Update CollectionRequest to reflect owner status
cr.isCollOwner = u != nil && u.ID == c.OwnerID
// Check permissions
if !cr.isCollOwner {
if c.IsPrivate() {
return nil, ErrCollectionNotFound
} else if c.IsProtected() {
uname := ""
if u != nil {
uname = u.Username
}
// TODO: move this to all permission checks?
suspended, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("process protected collection permissions: %v", err)
return nil, err
}
if suspended {
return nil, ErrCollectionNotFound
}
// See if we've authorized this collection
cr.isAuthorized = isAuthorizedForCollection(app, c.Alias, r)
if !cr.isAuthorized {
p := struct {
page.StaticPage
*CollectionObj
Username string
Next string
Flashes []template.HTML
}{
StaticPage: pageForReq(app, r),
CollectionObj: &CollectionObj{Collection: *c},
Username: uname,
Next: r.FormValue("g"),
Flashes: []template.HTML{},
}
// Get owner information
p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p)
if err != nil {
log.Error("Unable to render password-collection: %v", err)
return nil, err
}
return nil, nil
}
}
}
return c, nil
}
func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) {
u := getUserSession(app, r)
return u, nil
}
func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection {
coll := &DisplayCollection{
CollectionObj: NewCollectionObj(c),
CurrentPage: page,
Prefix: cr.prefix,
IsTopLevel: isSingleUser,
}
c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner)
return coll
}
// getCollectionPage returns the collection page as an int. If the parsed page value is not
// greater than 0 then the default value of 1 is returned.
func getCollectionPage(vars map[string]string) int {
if p, _ := strconv.Atoi(vars["page"]); p > 0 {
return p
}
return 1
}
// handleViewCollection displays the requested Collection
func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
c.hostName = app.cfg.App.Host
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view collection: %v", err)
return ErrInternalGeneral
}
// Serve ActivityStreams data now, if requested
if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
ac := c.PersonObject()
ac.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ac, http.StatusOK)
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := newDisplayCollection(c, cr, page)
coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage())))
if coll.TotalPages > 0 && page > coll.TotalPages {
redirURL := fmt.Sprintf("/page/%d", coll.TotalPages)
if !app.cfg.App.SingleUser {
redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL)
}
return impart.HTTPError{http.StatusFound, redirURL}
}
coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false)
// Serve collection
displayPage := CollectionPage{
DisplayCollection: coll,
IsCollLoggedIn: cr.isAuthorized,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
IsWelcome: r.FormValue("greeting") != "",
CollAlias: c.Alias,
}
displayPage.IsAdmin = u != nil && u.IsAdmin()
displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin)
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
}
if !isOwner && silenced {
return ErrCollectionNotFound
}
displayPage.Silenced = isOwner && silenced
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
collTmpl := "collection"
if app.cfg.App.Chorus {
collTmpl = "chorus-collection"
}
err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage)
if err != nil {
log.Error("Unable to render collection index: %v", err)
}
// Update collection view count
go func() {
// Don't update if owner is viewing the collection.
if u != nil && u.ID == coll.OwnerID {
return
}
// Only update for human views
if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) {
return
}
_, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID)
if err != nil {
log.Error("Unable to update collections count: %v", err)
}
}()
return err
}
func handleViewMention(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
handle := vars["handle"]
remoteUser, err := app.db.GetProfilePageFromHandle(app, handle)
if err != nil || remoteUser == "" {
log.Error("Couldn't find user %s: %v", handle, err)
return ErrRemoteUserNotFound
}
return impart.HTTPError{Status: http.StatusFound, Message: remoteUser}
}
func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
tag := vars["tag"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
coll := newDisplayCollection(c, cr, page)
coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner)
if coll.Posts != nil && len(*coll.Posts) == 0 {
return ErrCollectionPageNotFound
}
// Serve collection
displayPage := struct {
CollectionPage
Tag string
}{
CollectionPage: CollectionPage{
DisplayCollection: coll,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
},
Tag: tag,
}
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
if owner.IsSilenced() {
return ErrCollectionNotFound
}
}
displayPage.Silenced = owner != nil && owner.IsSilenced()
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage)
if err != nil {
log.Error("Unable to render collection tag page: %v", err)
}
return nil
}
func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
// Normalize the URL, redirecting user to consistent post URL
loc := fmt.Sprintf("/%s", slug)
if !app.cfg.App.SingleUser {
loc = fmt.Sprintf("/%s/%s", cr.alias, slug)
}
return impart.HTTPError{http.StatusFound, loc}
}
func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
collAlias := vars["alias"]
isWeb := r.FormValue("web") == "1"
u := &User{}
if reqJSON && !isWeb {
// Ensure an access token was given
accessToken := r.Header.Get("Authorization")
u.ID = app.db.GetUserID(accessToken)
if u.ID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
}
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("existing collection: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrUserSilenced
}
if r.Method == "DELETE" {
err := app.db.DeleteCollection(collAlias, u.ID)
if err != nil {
// TODO: if not HTTPError, report error to admin
log.Error("Unable to delete collection: %s", err)
return err
}
addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil)
return impart.HTTPError{Status: http.StatusNoContent}
}
c := SubmittedCollection{OwnerID: uint64(u.ID)}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse collection update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err = r.ParseForm()
if err != nil {
log.Error("Couldn't parse collection update form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&c, r.PostForm)
if err != nil {
log.Error("Couldn't decode collection update form request: %v\n", err)
return ErrBadFormData
}
}
err = app.db.UpdateCollection(&c, collAlias)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if reqJSON {
return err
}
addSessionFlash(app, w, r, err.Message, nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
} else {
log.Error("Couldn't update collection: %v\n", err)
return err
}
}
if reqJSON {
return impart.WriteSuccess(w, struct {
}{}, http.StatusOK)
}
addSessionFlash(app, w, r, "Blog updated!", nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
}
// collectionAliasFromReq takes a request and returns the collection alias
// if it can be ascertained, as well as whether or not the collection uses a
// custom domain.
func collectionAliasFromReq(r *http.Request) string {
vars := mux.Vars(r)
alias := vars["subdomain"]
isSubdomain := alias != ""
if !isSubdomain {
// Fall back to write.as/{collection} since this isn't a custom domain
alias = vars["collection"]
}
return alias
}
func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error {
var readReq struct {
Alias string `schema:"alias" json:"alias"`
Pass string `schema:"password" json:"password"`
Next string `schema:"to" json:"to"`
}
// Get params
if impart.ReqJSON(r) {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&readReq)
if err != nil {
log.Error("Couldn't parse readReq JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse readReq form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&readReq, r.PostForm)
if err != nil {
log.Error("Couldn't decode readReq form request: %v\n", err)
return ErrBadFormData
}
}
if readReq.Alias == "" {
return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."}
}
if readReq.Pass == "" {
return impart.HTTPError{http.StatusBadRequest, "Please supply a password."}
}
var collHashedPass []byte
err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass)
if err != nil {
if err == sql.ErrNoRows {
log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias)
return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."}
}
return err
}
if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
// Success; set cookie
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
session.Values[readReq.Alias] = true
err = session.Save(r, w)
if err != nil {
log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err)
}
}
next := "/" + readReq.Next
if !app.cfg.App.SingleUser {
next = "/" + readReq.Alias + next
}
return impart.HTTPError{http.StatusFound, next}
}
func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool {
authd := false
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
_, authd = session.Values[alias]
}
return authd
}
func logOutCollection(app *App, alias string, w http.ResponseWriter, r *http.Request) error {
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err != nil {
return err
}
// Remove this from map of blogs logged into
delete(session.Values, alias)
// If not auth'd with any blog, delete entire cookie
if len(session.Values) == 0 {
session.Options.MaxAge = -1
}
return session.Save(r, w)
}
func handleLogOutCollection(app *App, w http.ResponseWriter, r *http.Request) error {
alias := collectionAliasFromReq(r)
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
if !c.IsProtected() {
// Invalid to log out of this collection
return ErrCollectionPageNotFound
}
err = logOutCollection(app, c.Alias, w, r)
if err != nil {
addSessionFlash(app, w, r, "Logging out failed. Try clearing cookies for this site, instead.", nil)
}
return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
}
diff --git a/config/config.go b/config/config.go
index e1aaaaf..2065ddf 100644
--- a/config/config.go
+++ b/config/config.go
@@ -1,295 +1,295 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// Package config holds and assists in the configuration of a writefreely instance.
package config
import (
"net/url"
"strings"
"github.com/go-ini/ini"
"github.com/writeas/web-core/log"
"golang.org/x/net/idna"
)
const (
// FileName is the default configuration file name
FileName = "config.ini"
UserNormal UserType = "user"
UserAdmin = "admin"
)
type (
UserType string
// ServerCfg holds values that affect how the HTTP server runs
ServerCfg struct {
HiddenHost string `ini:"hidden_host"`
Port int `ini:"port"`
Bind string `ini:"bind"`
TLSCertPath string `ini:"tls_cert_path"`
TLSKeyPath string `ini:"tls_key_path"`
Autocert bool `ini:"autocert"`
TemplatesParentDir string `ini:"templates_parent_dir"`
StaticParentDir string `ini:"static_parent_dir"`
PagesParentDir string `ini:"pages_parent_dir"`
KeysParentDir string `ini:"keys_parent_dir"`
HashSeed string `ini:"hash_seed"`
GopherPort int `ini:"gopher_port"`
Dev bool `ini:"-"`
}
// DatabaseCfg holds values that determine how the application connects to a datastore
DatabaseCfg struct {
Type string `ini:"type"`
FileName string `ini:"filename"`
User string `ini:"username"`
Password string `ini:"password"`
Database string `ini:"database"`
Host string `ini:"host"`
Port int `ini:"port"`
TLS bool `ini:"tls"`
}
WriteAsOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
AuthLocation string `ini:"auth_location"`
TokenLocation string `ini:"token_location"`
InspectLocation string `ini:"inspect_location"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
GitlabOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
Host string `ini:"host"`
DisplayName string `ini:"display_name"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
GiteaOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
Host string `ini:"host"`
DisplayName string `ini:"display_name"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
SlackOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
TeamID string `ini:"team_id"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
GenericOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
Host string `ini:"host"`
DisplayName string `ini:"display_name"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
TokenEndpoint string `ini:"token_endpoint"`
InspectEndpoint string `ini:"inspect_endpoint"`
AuthEndpoint string `ini:"auth_endpoint"`
Scope string `ini:"scope"`
AllowDisconnect bool `ini:"allow_disconnect"`
MapUserID string `ini:"map_user_id"`
MapUsername string `ini:"map_username"`
MapDisplayName string `ini:"map_display_name"`
MapEmail string `ini:"map_email"`
}
// AppCfg holds values that affect how the application functions
AppCfg struct {
SiteName string `ini:"site_name"`
SiteDesc string `ini:"site_description"`
Host string `ini:"host"`
// Site appearance
Theme string `ini:"theme"`
Editor string `ini:"editor"`
JSDisabled bool `ini:"disable_js"`
WebFonts bool `ini:"webfonts"`
Landing string `ini:"landing"`
SimpleNav bool `ini:"simple_nav"`
WFModesty bool `ini:"wf_modesty"`
// Site functionality
Chorus bool `ini:"chorus"`
Forest bool `ini:"forest"` // The admin cares about the forest, not the trees. Hide unnecessary technical info.
DisableDrafts bool `ini:"disable_drafts"`
// Users
SingleUser bool `ini:"single_user"`
OpenRegistration bool `ini:"open_registration"`
OpenDeletion bool `ini:"open_deletion"`
MinUsernameLen int `ini:"min_username_len"`
MaxBlogs int `ini:"max_blogs"`
// Options for public instances
// Federation
Federation bool `ini:"federation"`
PublicStats bool `ini:"public_stats"`
Monetization bool `ini:"monetization"`
NotesOnly bool `ini:"notes_only"`
// Access
Private bool `ini:"private"`
// Additional functions
LocalTimeline bool `ini:"local_timeline"`
UserInvites string `ini:"user_invites"`
// Defaults
DefaultVisibility string `ini:"default_visibility"`
// Check for Updates
UpdateChecks bool `ini:"update_checks"`
// Disable password authentication if use only Oauth
DisablePasswordAuth bool `ini:"disable_password_auth"`
}
// Config holds the complete configuration for running a writefreely instance
Config struct {
Server ServerCfg `ini:"server"`
Database DatabaseCfg `ini:"database"`
App AppCfg `ini:"app"`
SlackOauth SlackOauthCfg `ini:"oauth.slack"`
WriteAsOauth WriteAsOauthCfg `ini:"oauth.writeas"`
GitlabOauth GitlabOauthCfg `ini:"oauth.gitlab"`
GiteaOauth GiteaOauthCfg `ini:"oauth.gitea"`
GenericOauth GenericOauthCfg `ini:"oauth.generic"`
}
)
// New creates a new Config with sane defaults
func New() *Config {
c := &Config{
Server: ServerCfg{
Port: 8080,
Bind: "localhost", /* IPV6 support when not using localhost? */
},
App: AppCfg{
Host: "http://localhost:8080",
Theme: "write",
WebFonts: true,
SingleUser: true,
MinUsernameLen: 3,
MaxBlogs: 1,
Federation: true,
PublicStats: true,
},
}
c.UseMySQL(true)
return c
}
// UseMySQL resets the Config's Database to use default values for a MySQL setup.
func (cfg *Config) UseMySQL(fresh bool) {
cfg.Database.Type = "mysql"
if fresh {
cfg.Database.Host = "localhost"
cfg.Database.Port = 3306
}
}
// UseSQLite resets the Config's Database to use default values for a SQLite setup.
func (cfg *Config) UseSQLite(fresh bool) {
cfg.Database.Type = "sqlite3"
if fresh {
cfg.Database.FileName = "writefreely.db"
}
}
// IsSecureStandalone returns whether or not the application is running as a
// standalone server with TLS enabled.
func (cfg *Config) IsSecureStandalone() bool {
return cfg.Server.Port == 443 && cfg.Server.TLSCertPath != "" && cfg.Server.TLSKeyPath != ""
}
func (ac *AppCfg) LandingPath() string {
if !strings.HasPrefix(ac.Landing, "/") {
return "/" + ac.Landing
}
return ac.Landing
}
func (ac AppCfg) SignupPath() string {
if !ac.OpenRegistration {
return ""
}
if ac.Chorus || ac.Private || (ac.Landing != "" && ac.Landing != "/") {
return "/signup"
}
return "/"
}
// Load reads the given configuration file, then parses and returns it as a Config.
func Load(fname string) (*Config, error) {
if fname == "" {
fname = FileName
}
cfg, err := ini.Load(fname)
if err != nil {
return nil, err
}
// Parse INI file
uc := &Config{}
err = cfg.MapTo(uc)
if err != nil {
return nil, err
}
// Do any transformations
u, err := url.Parse(uc.App.Host)
if err != nil {
return nil, err
}
d, err := idna.ToASCII(u.Hostname())
if err != nil {
log.Error("idna.ToASCII for %s: %s", u.Hostname(), err)
return nil, err
}
uc.App.Host = u.Scheme + "://" + d
if u.Port() != "" {
uc.App.Host += ":" + u.Port()
}
return uc, nil
}
// Save writes the given Config to the given file.
func Save(uc *Config, fname string) error {
cfg := ini.Empty()
err := ini.ReflectFrom(cfg, uc)
if err != nil {
return err
}
if fname == "" {
fname = FileName
}
return cfg.SaveTo(fname)
}
diff --git a/config/data.go b/config/data.go
index 1c12fdc..35b61cd 100644
--- a/config/data.go
+++ b/config/data.go
@@ -1,16 +1,16 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package config
type UserCreation struct {
Username string
HashedPass []byte
}
diff --git a/config/funcs.go b/config/funcs.go
index fc8c687..7c6fd4f 100644
--- a/config/funcs.go
+++ b/config/funcs.go
@@ -1,62 +1,62 @@
/*
- * Copyright © 2018, 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2018, 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package config
import (
"github.com/writeas/web-core/log"
"golang.org/x/net/idna"
"net/http"
"net/url"
"strings"
"time"
)
// FriendlyHost returns the app's Host sans any schema
func (ac AppCfg) FriendlyHost() string {
rawHost := ac.Host[strings.Index(ac.Host, "://")+len("://"):]
u, err := url.Parse(ac.Host)
if err != nil {
log.Error("url.Parse failed on %s: %s", ac.Host, err)
return rawHost
}
d, err := idna.ToUnicode(u.Hostname())
if err != nil {
log.Error("idna.ToUnicode failed on %s: %s", ac.Host, err)
return rawHost
}
res := d
if u.Port() != "" {
res += ":" + u.Port()
}
return res
}
func (ac AppCfg) CanCreateBlogs(currentlyUsed uint64) bool {
if ac.MaxBlogs <= 0 {
return true
}
return int(currentlyUsed) < ac.MaxBlogs
}
// OrDefaultString returns input or a default value if input is empty.
func OrDefaultString(input, defaultValue string) string {
if len(input) == 0 {
return defaultValue
}
return input
}
// DefaultHTTPClient returns a sane default HTTP client.
func DefaultHTTPClient() *http.Client {
return &http.Client{Timeout: 10 * time.Second}
}
diff --git a/config/setup.go b/config/setup.go
index 08c479f..9fddd5a 100644
--- a/config/setup.go
+++ b/config/setup.go
@@ -1,382 +1,382 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package config
import (
"fmt"
"github.com/fatih/color"
"github.com/manifoldco/promptui"
"github.com/mitchellh/go-wordwrap"
"github.com/writeas/web-core/auth"
"strconv"
"strings"
)
type SetupData struct {
User *UserCreation
Config *Config
}
func Configure(fname string, configSections string) (*SetupData, error) {
data := &SetupData{}
var err error
if fname == "" {
fname = FileName
}
data.Config, err = Load(fname)
var action string
isNewCfg := false
if err != nil {
fmt.Printf("No %s configuration yet. Creating new.\n", fname)
data.Config = New()
action = "generate"
isNewCfg = true
} else {
fmt.Printf("Loaded configuration %s.\n", fname)
action = "update"
}
title := color.New(color.Bold, color.BgGreen).PrintFunc()
intro := color.New(color.Bold, color.FgWhite).PrintlnFunc()
fmt.Println()
intro(" ✍ WriteFreely Configuration ✍")
fmt.Println()
fmt.Println(wordwrap.WrapString(" This quick configuration process will "+action+" the application's config file, "+fname+".\n\n It validates your input along the way, so you can be sure any future errors aren't caused by a bad configuration. If you'd rather configure your server manually, instead run: writefreely --create-config and edit that file.", 75))
fmt.Println()
tmpls := &promptui.PromptTemplates{
Success: "{{ . | bold | faint }}: ",
}
selTmpls := &promptui.SelectTemplates{
Selected: fmt.Sprintf(`{{.Label}} {{ . | faint }}`),
}
var selPrompt promptui.Select
var prompt promptui.Prompt
if strings.Contains(configSections, "server") {
title(" Server setup ")
fmt.Println()
// Environment selection
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Environment",
Items: []string{"Development", "Production, standalone", "Production, behind reverse proxy"},
}
_, envType, err := selPrompt.Run()
if err != nil {
return data, err
}
isDevEnv := envType == "Development"
isStandalone := envType == "Production, standalone"
data.Config.Server.Dev = isDevEnv
if isDevEnv || !isStandalone {
// Running in dev environment or behind reverse proxy; ask for port
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Local port",
Validate: validatePort,
Default: fmt.Sprintf("%d", data.Config.Server.Port),
}
port, err := prompt.Run()
if err != nil {
return data, err
}
data.Config.Server.Port, _ = strconv.Atoi(port) // Ignore error, as we've already validated number
}
if isStandalone {
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Web server mode",
Items: []string{"Insecure (port 80)", "Secure (port 443), manual certificate", "Secure (port 443), auto certificate"},
}
sel, _, err := selPrompt.Run()
if err != nil {
return data, err
}
if sel == 0 {
data.Config.Server.Autocert = false
data.Config.Server.Port = 80
data.Config.Server.TLSCertPath = ""
data.Config.Server.TLSKeyPath = ""
} else if sel == 1 || sel == 2 {
data.Config.Server.Port = 443
data.Config.Server.Autocert = sel == 2
if sel == 1 {
// Manual certificate configuration
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Certificate path",
Validate: validateNonEmpty,
Default: data.Config.Server.TLSCertPath,
}
data.Config.Server.TLSCertPath, err = prompt.Run()
if err != nil {
return data, err
}
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Key path",
Validate: validateNonEmpty,
Default: data.Config.Server.TLSKeyPath,
}
data.Config.Server.TLSKeyPath, err = prompt.Run()
if err != nil {
return data, err
}
} else {
// Automatic certificate
data.Config.Server.TLSCertPath = "certs"
data.Config.Server.TLSKeyPath = "certs"
}
}
} else {
data.Config.Server.TLSCertPath = ""
data.Config.Server.TLSKeyPath = ""
}
fmt.Println()
}
if strings.Contains(configSections, "db") {
title(" Database setup ")
fmt.Println()
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Database driver",
Items: []string{"MySQL", "SQLite"},
}
sel, _, err := selPrompt.Run()
if err != nil {
return data, err
}
if sel == 0 {
// Configure for MySQL
data.Config.UseMySQL(isNewCfg)
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Username",
Validate: validateNonEmpty,
Default: data.Config.Database.User,
}
data.Config.Database.User, err = prompt.Run()
if err != nil {
return data, err
}
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Password",
Validate: validateNonEmpty,
Default: data.Config.Database.Password,
Mask: '*',
}
data.Config.Database.Password, err = prompt.Run()
if err != nil {
return data, err
}
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Database name",
Validate: validateNonEmpty,
Default: data.Config.Database.Database,
}
data.Config.Database.Database, err = prompt.Run()
if err != nil {
return data, err
}
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Host",
Validate: validateNonEmpty,
Default: data.Config.Database.Host,
}
data.Config.Database.Host, err = prompt.Run()
if err != nil {
return data, err
}
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Port",
Validate: validatePort,
Default: fmt.Sprintf("%d", data.Config.Database.Port),
}
dbPort, err := prompt.Run()
if err != nil {
return data, err
}
data.Config.Database.Port, _ = strconv.Atoi(dbPort) // Ignore error, as we've already validated number
} else if sel == 1 {
// Configure for SQLite
data.Config.UseSQLite(isNewCfg)
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Filename",
Validate: validateNonEmpty,
Default: data.Config.Database.FileName,
}
data.Config.Database.FileName, err = prompt.Run()
if err != nil {
return data, err
}
}
fmt.Println()
}
if strings.Contains(configSections, "app") {
title(" App setup ")
fmt.Println()
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Site type",
Items: []string{"Single user blog", "Multi-user instance"},
}
_, usersType, err := selPrompt.Run()
if err != nil {
return data, err
}
data.Config.App.SingleUser = usersType == "Single user blog"
if data.Config.App.SingleUser {
data.User = &UserCreation{}
// prompt for username
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Admin username",
Validate: validateNonEmpty,
}
data.User.Username, err = prompt.Run()
if err != nil {
return data, err
}
// prompt for password
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Admin password",
Validate: validateNonEmpty,
}
newUserPass, err := prompt.Run()
if err != nil {
return data, err
}
data.User.HashedPass, err = auth.HashPass([]byte(newUserPass))
if err != nil {
return data, err
}
}
siteNameLabel := "Instance name"
if data.Config.App.SingleUser {
siteNameLabel = "Blog name"
}
prompt = promptui.Prompt{
Templates: tmpls,
Label: siteNameLabel,
Validate: validateNonEmpty,
Default: data.Config.App.SiteName,
}
data.Config.App.SiteName, err = prompt.Run()
if err != nil {
return data, err
}
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Public URL",
Validate: validateDomain,
Default: data.Config.App.Host,
}
data.Config.App.Host, err = prompt.Run()
if err != nil {
return data, err
}
if !data.Config.App.SingleUser {
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Registration",
Items: []string{"Open", "Closed"},
}
_, regType, err := selPrompt.Run()
if err != nil {
return data, err
}
data.Config.App.OpenRegistration = regType == "Open"
prompt = promptui.Prompt{
Templates: tmpls,
Label: "Max blogs per user",
Default: fmt.Sprintf("%d", data.Config.App.MaxBlogs),
}
maxBlogs, err := prompt.Run()
if err != nil {
return data, err
}
data.Config.App.MaxBlogs, _ = strconv.Atoi(maxBlogs) // Ignore error, as we've already validated number
}
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Federation",
Items: []string{"Enabled", "Disabled"},
}
_, fedType, err := selPrompt.Run()
if err != nil {
return data, err
}
data.Config.App.Federation = fedType == "Enabled"
if data.Config.App.Federation {
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Usage stats (active users, posts)",
Items: []string{"Public", "Private"},
}
_, fedStatsType, err := selPrompt.Run()
if err != nil {
return data, err
}
data.Config.App.PublicStats = fedStatsType == "Public"
selPrompt = promptui.Select{
Templates: selTmpls,
Label: "Instance metadata privacy",
Items: []string{"Public", "Private"},
}
_, fedStatsType, err = selPrompt.Run()
if err != nil {
return data, err
}
data.Config.App.Private = fedStatsType == "Private"
}
}
return data, Save(data.Config, fname)
}
diff --git a/config/validation.go b/config/validation.go
index 598c9fe..f6b8a14 100644
--- a/config/validation.go
+++ b/config/validation.go
@@ -1,51 +1,51 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package config
import (
"fmt"
"regexp"
"strconv"
)
var (
domainReg = regexp.MustCompile("^https?://")
)
const (
minPort = 80
maxPort = 1<<16 - 1
)
func validateDomain(i string) error {
if !domainReg.MatchString(i) {
return fmt.Errorf("Domain must start with http:// or https://")
}
return nil
}
func validatePort(i string) error {
p, err := strconv.Atoi(i)
if err != nil {
return err
}
if p < minPort || p > maxPort {
return fmt.Errorf("Port must be a number %d - %d", minPort, maxPort)
}
return nil
}
func validateNonEmpty(i string) error {
if i == "" {
return fmt.Errorf("Must not be empty")
}
return nil
}
diff --git a/database-lib.go b/database-lib.go
index 8b28577..87a9dee 100644
--- a/database-lib.go
+++ b/database-lib.go
@@ -1,28 +1,29 @@
+//go:build wflib
// +build wflib
/*
- * Copyright © 2019-2020 A Bunch Tell LLC.
+ * Copyright © 2019-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// This file contains dummy database funcs for when writefreely is used as a
// library.
package writefreely
func (db *datastore) isDuplicateKeyErr(err error) bool {
return false
}
func (db *datastore) isIgnorableError(err error) bool {
return false
}
func (db *datastore) isHighLoadError(err error) bool {
return false
}
diff --git a/database-no-sqlite.go b/database-no-sqlite.go
index f2c7ffc..ef5104e 100644
--- a/database-no-sqlite.go
+++ b/database-no-sqlite.go
@@ -1,52 +1,53 @@
+//go:build !sqlite && !wflib
// +build !sqlite,!wflib
/*
- * Copyright © 2019-2020 A Bunch Tell LLC.
+ * Copyright © 2019-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"github.com/go-sql-driver/mysql"
"github.com/writeas/web-core/log"
)
func (db *datastore) isDuplicateKeyErr(err error) bool {
if db.driverName == driverMySQL {
if mysqlErr, ok := err.(*mysql.MySQLError); ok {
return mysqlErr.Number == mySQLErrDuplicateKey
}
} else {
log.Error("isDuplicateKeyErr: failed check for unrecognized driver '%s'", db.driverName)
}
return false
}
func (db *datastore) isIgnorableError(err error) bool {
if db.driverName == driverMySQL {
if mysqlErr, ok := err.(*mysql.MySQLError); ok {
return mysqlErr.Number == mySQLErrCollationMix
}
} else {
log.Error("isIgnorableError: failed check for unrecognized driver '%s'", db.driverName)
}
return false
}
func (db *datastore) isHighLoadError(err error) bool {
if db.driverName == driverMySQL {
if mysqlErr, ok := err.(*mysql.MySQLError); ok {
return mysqlErr.Number == mySQLErrMaxUserConns || mysqlErr.Number == mySQLErrTooManyConns
}
}
return false
}
diff --git a/database-sqlite.go b/database-sqlite.go
index 10e701e..7d33315 100644
--- a/database-sqlite.go
+++ b/database-sqlite.go
@@ -1,72 +1,73 @@
+//go:build sqlite && !wflib
// +build sqlite,!wflib
/*
- * Copyright © 2019-2020 A Bunch Tell LLC.
+ * Copyright © 2019-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"github.com/go-sql-driver/mysql"
"github.com/mattn/go-sqlite3"
"github.com/writeas/web-core/log"
"regexp"
)
func init() {
SQLiteEnabled = true
regex := func(re, s string) (bool, error) {
return regexp.MatchString(re, s)
}
sql.Register("sqlite3_with_regex", &sqlite3.SQLiteDriver{
ConnectHook: func(conn *sqlite3.SQLiteConn) error {
return conn.RegisterFunc("regexp", regex, true)
},
})
}
func (db *datastore) isDuplicateKeyErr(err error) bool {
if db.driverName == driverSQLite {
if err, ok := err.(sqlite3.Error); ok {
return err.Code == sqlite3.ErrConstraint
}
} else if db.driverName == driverMySQL {
if mysqlErr, ok := err.(*mysql.MySQLError); ok {
return mysqlErr.Number == mySQLErrDuplicateKey
}
} else {
log.Error("isDuplicateKeyErr: failed check for unrecognized driver '%s'", db.driverName)
}
return false
}
func (db *datastore) isIgnorableError(err error) bool {
if db.driverName == driverMySQL {
if mysqlErr, ok := err.(*mysql.MySQLError); ok {
return mysqlErr.Number == mySQLErrCollationMix
}
} else {
log.Error("isIgnorableError: failed check for unrecognized driver '%s'", db.driverName)
}
return false
}
func (db *datastore) isHighLoadError(err error) bool {
if db.driverName == driverMySQL {
if mysqlErr, ok := err.(*mysql.MySQLError); ok {
return mysqlErr.Number == mySQLErrMaxUserConns || mysqlErr.Number == mySQLErrTooManyConns
}
}
return false
}
diff --git a/database.go b/database.go
index a981dd5..2927443 100644
--- a/database.go
+++ b/database.go
@@ -1,2815 +1,2815 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"context"
"database/sql"
"fmt"
"github.com/writeas/web-core/silobridge"
wf_db "github.com/writefreely/writefreely/db"
"net/http"
"strings"
"time"
"github.com/guregu/null"
"github.com/guregu/null/zero"
uuid "github.com/nu7hatch/gouuid"
"github.com/writeas/activityserve"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitypub"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/data"
"github.com/writeas/web-core/id"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/query"
"github.com/writefreely/writefreely/author"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/key"
)
const (
mySQLErrDuplicateKey = 1062
mySQLErrCollationMix = 1267
mySQLErrTooManyConns = 1040
mySQLErrMaxUserConns = 1203
driverMySQL = "mysql"
driverSQLite = "sqlite3"
)
var (
SQLiteEnabled bool
)
type writestore interface {
CreateUser(*config.Config, *User, string, string) error
UpdateUserEmail(keys *key.Keychain, userID int64, email string) error
UpdateEncryptedUserEmail(int64, []byte) error
GetUserByID(int64) (*User, error)
GetUserForAuth(string) (*User, error)
GetUserForAuthByID(int64) (*User, error)
GetUserNameFromToken(string) (string, error)
GetUserDataFromToken(string) (int64, string, error)
GetAPIUser(header string) (*User, error)
GetUserID(accessToken string) int64
GetUserIDPrivilege(accessToken string) (userID int64, sudo bool)
DeleteToken(accessToken []byte) error
FetchLastAccessToken(userID int64) string
GetAccessToken(userID int64) (string, error)
GetTemporaryAccessToken(userID int64, validSecs int) (string, error)
GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error)
DeleteAccount(userID int64) error
ChangeSettings(app *App, u *User, s *userSettings) error
ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error
GetCollections(u *User, hostName string) (*[]Collection, error)
GetPublishableCollections(u *User, hostName string) (*[]Collection, error)
GetMeStats(u *User) userMeStats
GetTotalCollections() (int64, error)
GetTotalPosts() (int64, error)
GetTopPosts(u *User, alias string, hostName string) (*[]PublicPost, error)
GetAnonymousPosts(u *User, page int) (*[]PublicPost, error)
GetUserPosts(u *User) (*[]PublicPost, error)
CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error)
CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error)
UpdateOwnedPost(post *AuthenticatedPost, userID int64) error
GetEditablePost(id, editToken string) (*PublicPost, error)
PostIDExists(id string) bool
GetPost(id string, collectionID int64) (*PublicPost, error)
GetOwnedPost(id string, ownerID int64) (*PublicPost, error)
GetPostProperty(id string, collectionID int64, property string) (interface{}, error)
CreateCollectionFromToken(*config.Config, string, string, string) (*Collection, error)
CreateCollection(*config.Config, string, string, int64) (*Collection, error)
GetCollectionBy(condition string, value interface{}) (*Collection, error)
GetCollection(alias string) (*Collection, error)
GetCollectionForPad(alias string) (*Collection, error)
GetCollectionByID(id int64) (*Collection, error)
UpdateCollection(c *SubmittedCollection, alias string) error
DeleteCollection(alias string, userID int64) error
UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error
GetLastPinnedPostPos(collID int64) int64
GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error)
RemoveCollectionRedirect(t *sql.Tx, alias string) error
GetCollectionRedirect(alias string) (new string)
IsCollectionAttributeOn(id int64, attr string) bool
CollectionHasAttribute(id int64, attr string) bool
CanCollect(cpr *ClaimPostRequest, userID int64) bool
AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error)
DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error)
ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error)
GetPostsCount(c *CollectionObj, includeFuture bool)
GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error)
GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error)
GetAPFollowers(c *Collection) (*[]RemoteUser, error)
GetAPActorKeys(collectionID int64) ([]byte, []byte)
CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error
GetUserInvites(userID int64) (*[]Invite, error)
GetUserInvite(id string) (*Invite, error)
GetUsersInvitedCount(id string) int64
CreateInvitedUser(inviteID string, userID int64) error
GetDynamicContent(id string) (*instanceContent, error)
UpdateDynamicContent(id, title, content, contentType string) error
GetAllUsers(page uint) (*[]User, error)
GetAllUsersCount() int64
GetUserLastPostTime(id int64) (*time.Time, error)
GetCollectionLastPostTime(id int64) (*time.Time, error)
GetIDForRemoteUser(context.Context, string, string, string) (int64, error)
RecordRemoteUserID(context.Context, int64, string, string, string, string) error
ValidateOAuthState(context.Context, string) (string, string, int64, string, error)
GenerateOAuthState(context.Context, string, string, int64, string) (string, error)
GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error)
RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error
DatabaseInitialized() bool
}
type datastore struct {
*sql.DB
driverName string
}
var _ writestore = &datastore{}
func (db *datastore) now() string {
if db.driverName == driverSQLite {
return "strftime('%Y-%m-%d %H:%M:%S','now')"
}
return "NOW()"
}
func (db *datastore) clip(field string, l int) string {
if db.driverName == driverSQLite {
return fmt.Sprintf("SUBSTR(%s, 0, %d)", field, l)
}
return fmt.Sprintf("LEFT(%s, %d)", field, l)
}
func (db *datastore) upsert(indexedCols ...string) string {
if db.driverName == driverSQLite {
// NOTE: SQLite UPSERT syntax only works in v3.24.0 (2018-06-04) or later
// Leaving this for whenever we can upgrade and include it in our binary
cc := strings.Join(indexedCols, ", ")
return "ON CONFLICT(" + cc + ") DO UPDATE SET"
}
return "ON DUPLICATE KEY UPDATE"
}
func (db *datastore) dateSub(l int, unit string) string {
if db.driverName == driverSQLite {
return fmt.Sprintf("DATETIME('now', '-%d %s')", l, unit)
}
return fmt.Sprintf("DATE_SUB(NOW(), INTERVAL %d %s)", l, unit)
}
// CreateUser creates a new user in the database from the given User, UPDATING it in the process with the user's ID.
func (db *datastore) CreateUser(cfg *config.Config, u *User, collectionTitle string, collectionDesc string) error {
if db.PostIDExists(u.Username) {
return impart.HTTPError{http.StatusConflict, "Invalid collection name."}
}
// New users get a `users` and `collections` row.
t, err := db.Begin()
if err != nil {
return err
}
// 1. Add to `users` table
// NOTE: Assumes User's Password is already hashed!
res, err := t.Exec("INSERT INTO users (username, password, email) VALUES (?, ?, ?)", u.Username, u.HashedPass, u.Email)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Rolling back users INSERT: %v\n", err)
return err
}
u.ID, err = res.LastInsertId()
if err != nil {
t.Rollback()
log.Error("Rolling back after LastInsertId: %v\n", err)
return err
}
// 2. Create user's Collection
if collectionTitle == "" {
collectionTitle = u.Username
}
res, err = t.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", u.Username, collectionTitle, collectionDesc, defaultVisibility(cfg), u.ID, 0)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Rolling back collections INSERT: %v\n", err)
return err
}
db.RemoveCollectionRedirect(t, u.Username)
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return err
}
return nil
}
// FIXME: We're returning errors inconsistently in this file. Do we use Errorf
// for returned value, or impart?
func (db *datastore) UpdateUserEmail(keys *key.Keychain, userID int64, email string) error {
encEmail, err := data.Encrypt(keys.EmailKey, email)
if err != nil {
return fmt.Errorf("Couldn't encrypt email %s: %s\n", email, err)
}
return db.UpdateEncryptedUserEmail(userID, encEmail)
}
func (db *datastore) UpdateEncryptedUserEmail(userID int64, encEmail []byte) error {
_, err := db.Exec("UPDATE users SET email = ? WHERE id = ?", encEmail, userID)
if err != nil {
return fmt.Errorf("Unable to update user email: %s", err)
}
return nil
}
func (db *datastore) CreateCollectionFromToken(cfg *config.Config, alias, title, accessToken string) (*Collection, error) {
userID := db.GetUserID(accessToken)
if userID == -1 {
return nil, ErrBadAccessToken
}
return db.CreateCollection(cfg, alias, title, userID)
}
func (db *datastore) GetUserCollectionCount(userID int64) (uint64, error) {
var collCount uint64
err := db.QueryRow("SELECT COUNT(*) FROM collections WHERE owner_id = ?", userID).Scan(&collCount)
switch {
case err == sql.ErrNoRows:
return 0, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user from database."}
case err != nil:
log.Error("Couldn't get collections count for user %d: %v", userID, err)
return 0, err
}
return collCount, nil
}
func (db *datastore) CreateCollection(cfg *config.Config, alias, title string, userID int64) (*Collection, error) {
if db.PostIDExists(alias) {
return nil, impart.HTTPError{http.StatusConflict, "Invalid collection name."}
}
// All good, so create new collection
res, err := db.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", alias, title, "", defaultVisibility(cfg), userID, 0)
if err != nil {
if db.isDuplicateKeyErr(err) {
return nil, impart.HTTPError{http.StatusConflict, "Collection already exists."}
}
log.Error("Couldn't add to collections: %v\n", err)
return nil, err
}
c := &Collection{
Alias: alias,
Title: title,
OwnerID: userID,
PublicOwner: false,
Public: defaultVisibility(cfg) == CollPublic,
}
c.ID, err = res.LastInsertId()
if err != nil {
log.Error("Couldn't get collection LastInsertId: %v\n", err)
}
return c, nil
}
func (db *datastore) GetUserByID(id int64) (*User, error) {
u := &User{ID: id}
err := db.QueryRow("SELECT username, password, email, created, status FROM users WHERE id = ?", id).Scan(&u.Username, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password: %v", err)
return nil, err
}
return u, nil
}
// IsUserSilenced returns true if the user account associated with id is
// currently silenced.
func (db *datastore) IsUserSilenced(id int64) (bool, error) {
u := &User{ID: id}
err := db.QueryRow("SELECT status FROM users WHERE id = ?", id).Scan(&u.Status)
switch {
case err == sql.ErrNoRows:
return false, fmt.Errorf("is user silenced: %v", ErrUserNotFound)
case err != nil:
log.Error("Couldn't SELECT user status: %v", err)
return false, fmt.Errorf("is user silenced: %v", err)
}
return u.IsSilenced(), nil
}
// DoesUserNeedAuth returns true if the user hasn't provided any methods for
// authenticating with the account, such a passphrase or email address.
// Any errors are reported to admin and silently quashed, returning false as the
// result.
func (db *datastore) DoesUserNeedAuth(id int64) bool {
var pass, email []byte
// Find out if user has an email set first
err := db.QueryRow("SELECT password, email FROM users WHERE id = ?", id).Scan(&pass, &email)
switch {
case err == sql.ErrNoRows:
// ERROR. Don't give false positives on needing auth methods
return false
case err != nil:
// ERROR. Don't give false positives on needing auth methods
log.Error("Couldn't SELECT user %d from users: %v", id, err)
return false
}
// User doesn't need auth if there's an email
return len(email) == 0 && len(pass) == 0
}
func (db *datastore) IsUserPassSet(id int64) (bool, error) {
var pass []byte
err := db.QueryRow("SELECT password FROM users WHERE id = ?", id).Scan(&pass)
switch {
case err == sql.ErrNoRows:
return false, nil
case err != nil:
log.Error("Couldn't SELECT user %d from users: %v", id, err)
return false, err
}
return len(pass) > 0, nil
}
func (db *datastore) GetUserForAuth(username string) (*User, error) {
u := &User{Username: username}
err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE username = ?", username).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
// Check if they've entered the wrong, unnormalized username
username = getSlug(username, "")
if username != u.Username {
err = db.QueryRow("SELECT id FROM users WHERE username = ? LIMIT 1", username).Scan(&u.ID)
if err == nil {
return db.GetUserForAuth(username)
}
}
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password: %v", err)
return nil, err
}
return u, nil
}
func (db *datastore) GetUserForAuthByID(userID int64) (*User, error) {
u := &User{ID: userID}
err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE id = ?", u.ID).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT userForAuthByID: %v", err)
return nil, err
}
return u, nil
}
func (db *datastore) GetUserNameFromToken(accessToken string) (string, error) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return "", ErrNoAccessToken
}
var oneTime bool
var username string
err := db.QueryRow("SELECT username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&username, &oneTime)
switch {
case err == sql.ErrNoRows:
return "", ErrBadAccessToken
case err != nil:
return "", ErrInternalGeneral
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return username, nil
}
func (db *datastore) GetUserDataFromToken(accessToken string) (int64, string, error) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return 0, "", ErrNoAccessToken
}
var userID int64
var oneTime bool
var username string
err := db.QueryRow("SELECT user_id, username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &username, &oneTime)
switch {
case err == sql.ErrNoRows:
return 0, "", ErrBadAccessToken
case err != nil:
return 0, "", ErrInternalGeneral
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return userID, username, nil
}
func (db *datastore) GetAPIUser(header string) (*User, error) {
uID := db.GetUserID(header)
if uID == -1 {
return nil, fmt.Errorf(ErrUserNotFound.Error())
}
return db.GetUserByID(uID)
}
// GetUserID takes a hexadecimal accessToken, parses it into its binary
// representation, and gets any user ID associated with the token. If no user
// is associated, -1 is returned.
func (db *datastore) GetUserID(accessToken string) int64 {
i, _ := db.GetUserIDPrivilege(accessToken)
return i
}
func (db *datastore) GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return -1, false
}
var oneTime bool
err := db.QueryRow("SELECT user_id, sudo, one_time FROM accesstokens WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &sudo, &oneTime)
switch {
case err == sql.ErrNoRows:
return -1, false
case err != nil:
return -1, false
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return
}
func (db *datastore) DeleteToken(accessToken []byte) error {
res, err := db.Exec("DELETE FROM accesstokens WHERE token LIKE ?", accessToken)
if err != nil {
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
return impart.HTTPError{http.StatusNotFound, "Token is invalid or doesn't exist"}
}
return nil
}
// FetchLastAccessToken creates a new non-expiring, valid access token for the given
// userID.
func (db *datastore) FetchLastAccessToken(userID int64) string {
var t []byte
err := db.QueryRow("SELECT token FROM accesstokens WHERE user_id = ? AND (expires IS NULL OR expires > "+db.now()+") ORDER BY created DESC LIMIT 1", userID).Scan(&t)
switch {
case err == sql.ErrNoRows:
return ""
case err != nil:
log.Error("Failed selecting from accesstoken: %v", err)
return ""
}
u, err := uuid.Parse(t)
if err != nil {
return ""
}
return u.String()
}
// GetAccessToken creates a new non-expiring, valid access token for the given
// userID.
func (db *datastore) GetAccessToken(userID int64) (string, error) {
return db.GetTemporaryOneTimeAccessToken(userID, 0, false)
}
// GetTemporaryAccessToken creates a new valid access token for the given
// userID that remains valid for the given time in seconds. If validSecs is 0,
// the access token doesn't automatically expire.
func (db *datastore) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) {
return db.GetTemporaryOneTimeAccessToken(userID, validSecs, false)
}
// GetTemporaryOneTimeAccessToken creates a new valid access token for the given
// userID that remains valid for the given time in seconds and can only be used
// once if oneTime is true. If validSecs is 0, the access token doesn't
// automatically expire.
func (db *datastore) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) {
u, err := uuid.NewV4()
if err != nil {
log.Error("Unable to generate token: %v", err)
return "", err
}
// Insert UUID to `accesstokens`
binTok := u[:]
expirationVal := "NULL"
if validSecs > 0 {
expirationVal = fmt.Sprintf("DATE_ADD("+db.now()+", INTERVAL %d SECOND)", validSecs)
}
_, err = db.Exec("INSERT INTO accesstokens (token, user_id, one_time, expires) VALUES (?, ?, ?, "+expirationVal+")", string(binTok), userID, oneTime)
if err != nil {
log.Error("Couldn't INSERT accesstoken: %v", err)
return "", err
}
return u.String(), nil
}
func (db *datastore) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) {
var userID, collID int64 = -1, -1
var coll *Collection
var err error
if accessToken != "" {
userID = db.GetUserID(accessToken)
if userID == -1 {
return nil, ErrBadAccessToken
}
if collAlias != "" {
coll, err = db.GetCollection(collAlias)
if err != nil {
return nil, err
}
coll.hostName = hostName
if coll.OwnerID != userID {
return nil, ErrForbiddenCollection
}
collID = coll.ID
}
}
rp := &PublicPost{}
rp.Post, err = db.CreatePost(userID, collID, post)
if err != nil {
return rp, err
}
if coll != nil {
coll.ForPublic()
rp.Collection = &CollectionObj{Collection: *coll}
}
return rp, nil
}
func (db *datastore) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) {
idLen := postIDLen
friendlyID := id.GenerateFriendlyRandomString(idLen)
// Handle appearance / font face
appearance := post.Font
if !post.isFontValid() {
appearance = "norm"
}
var err error
ownerID := sql.NullInt64{
Valid: false,
}
ownerCollID := sql.NullInt64{
Valid: false,
}
slug := sql.NullString{"", false}
// If an alias was supplied, we'll add this to the collection as well.
if userID > 0 {
ownerID.Int64 = userID
ownerID.Valid = true
if collID > 0 {
ownerCollID.Int64 = collID
ownerCollID.Valid = true
var slugVal string
if post.Slug != nil && *post.Slug != "" {
slugVal = *post.Slug
} else {
if post.Title != nil && *post.Title != "" {
slugVal = getSlug(*post.Title, post.Language.String)
if slugVal == "" {
slugVal = getSlug(*post.Content, post.Language.String)
}
} else {
slugVal = getSlug(*post.Content, post.Language.String)
}
}
if slugVal == "" {
slugVal = friendlyID
}
slug = sql.NullString{slugVal, true}
}
}
created := time.Now()
if db.driverName == driverSQLite {
// SQLite stores datetimes in UTC, so convert time.Now() to it here
created = created.UTC()
}
if post.Created != nil && *post.Created != "" {
created, err = time.Parse("2006-01-02T15:04:05Z", *post.Created)
if err != nil {
log.Error("Unable to parse Created time '%s': %v", *post.Created, err)
created = time.Now()
if db.driverName == driverSQLite {
// SQLite stores datetimes in UTC, so convert time.Now() to it here
created = created.UTC()
}
}
}
stmt, err := db.Prepare("INSERT INTO posts (id, slug, title, content, text_appearance, language, rtl, privacy, owner_id, collection_id, created, updated, view_count) VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?, ?, " + db.now() + ", ?)")
if err != nil {
return nil, err
}
defer stmt.Close()
_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
if err != nil {
if db.isDuplicateKeyErr(err) {
// Duplicate entry error; try a new slug
// TODO: make this a little more robust
slug = sql.NullString{id.GenSafeUniqueSlug(slug.String), true}
_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
if err != nil {
return nil, handleFailedPostInsert(fmt.Errorf("Retried slug generation, still failed: %v", err))
}
} else {
return nil, handleFailedPostInsert(err)
}
}
// TODO: return Created field in proper format
return &Post{
ID: friendlyID,
Slug: null.NewString(slug.String, slug.Valid),
Font: appearance,
Language: zero.NewString(post.Language.String, post.Language.Valid),
RTL: zero.NewBool(post.IsRTL.Bool, post.IsRTL.Valid),
OwnerID: null.NewInt(userID, true),
CollectionID: null.NewInt(userID, true),
Created: created.Truncate(time.Second).UTC(),
Updated: time.Now().Truncate(time.Second).UTC(),
Title: zero.NewString(*(post.Title), true),
Content: *(post.Content),
}, nil
}
// UpdateOwnedPost updates an existing post with only the given fields in the
// supplied AuthenticatedPost.
func (db *datastore) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error {
params := []interface{}{}
var queryUpdates, sep, authCondition string
if post.Slug != nil && *post.Slug != "" {
queryUpdates += sep + "slug = ?"
sep = ", "
params = append(params, getSlug(*post.Slug, ""))
}
if post.Content != nil {
queryUpdates += sep + "content = ?"
sep = ", "
params = append(params, post.Content)
}
if post.Title != nil {
queryUpdates += sep + "title = ?"
sep = ", "
params = append(params, post.Title)
}
if post.Language.Valid {
queryUpdates += sep + "language = ?"
sep = ", "
params = append(params, post.Language.String)
}
if post.IsRTL.Valid {
queryUpdates += sep + "rtl = ?"
sep = ", "
params = append(params, post.IsRTL.Bool)
}
if post.Font != "" {
queryUpdates += sep + "text_appearance = ?"
sep = ", "
params = append(params, post.Font)
}
if post.Created != nil {
createTime, err := time.Parse(postMetaDateFormat, *post.Created)
if err != nil {
log.Error("Unable to parse Created date: %v", err)
return fmt.Errorf("That's the incorrect format for Created date.")
}
queryUpdates += sep + "created = ?"
sep = ", "
params = append(params, createTime)
}
// WHERE parameters...
// id = ?
params = append(params, post.ID)
// AND owner_id = ?
authCondition = "(owner_id = ?)"
params = append(params, userID)
if queryUpdates == "" {
return ErrPostNoUpdatableVals
}
queryUpdates += sep + "updated = " + db.now()
res, err := db.Exec("UPDATE posts SET "+queryUpdates+" WHERE id = ? AND "+authCondition, params...)
if err != nil {
log.Error("Unable to update owned post: %v", err)
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND "+authCondition, post.ID, params[len(params)-1]).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedEditPost
case err != nil:
log.Error("Failed selecting from posts: %v", err)
}
return nil
}
return nil
}
func (db *datastore) GetCollectionBy(condition string, value interface{}) (*Collection, error) {
c := &Collection{}
// FIXME: change Collection to reflect database values. Add helper functions to get actual values
var styleSheet, script, signature, format zero.String
row := db.QueryRow("SELECT id, alias, title, description, style_sheet, script, post_signature, format, owner_id, privacy, view_count FROM collections WHERE "+condition, value)
err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &styleSheet, &script, &signature, &format, &c.OwnerID, &c.Visibility, &c.Views)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
case db.isHighLoadError(err):
return nil, ErrUnavailable
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
c.StyleSheet = styleSheet.String
c.Script = script.String
c.Signature = signature.String
c.Format = format.String
c.Public = c.IsPublic()
c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")
c.db = db
return c, nil
}
func (db *datastore) GetCollection(alias string) (*Collection, error) {
return db.GetCollectionBy("alias = ?", alias)
}
func (db *datastore) GetCollectionForPad(alias string) (*Collection, error) {
c := &Collection{Alias: alias}
row := db.QueryRow("SELECT id, alias, title, description, privacy FROM collections WHERE alias = ?", alias)
err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility)
switch {
case err == sql.ErrNoRows:
return c, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return c, ErrInternalGeneral
}
c.Public = c.IsPublic()
return c, nil
}
func (db *datastore) GetCollectionByID(id int64) (*Collection, error) {
return db.GetCollectionBy("id = ?", id)
}
func (db *datastore) GetCollectionFromDomain(host string) (*Collection, error) {
return db.GetCollectionBy("host = ?", host)
}
func (db *datastore) UpdateCollection(c *SubmittedCollection, alias string) error {
q := query.NewUpdate().
SetStringPtr(c.Title, "title").
SetStringPtr(c.Description, "description").
SetNullString(c.StyleSheet, "style_sheet").
SetNullString(c.Script, "script").
SetNullString(c.Signature, "post_signature")
if c.Format != nil {
cf := &CollectionFormat{Format: c.Format.String}
if cf.Valid() {
q.SetNullString(c.Format, "format")
}
}
var updatePass bool
if c.Visibility != nil && (collVisibility(*c.Visibility)&CollProtected == 0 || c.Pass != "") {
q.SetIntPtr(c.Visibility, "privacy")
if c.Pass != "" {
updatePass = true
}
}
// WHERE values
q.Where("alias = ? AND owner_id = ?", alias, c.OwnerID)
if q.Updates == "" && c.Monetization == nil {
return ErrPostNoUpdatableVals
}
// Find any current domain
var collID int64
var rowsAffected int64
var changed bool
var res sql.Result
err := db.QueryRow("SELECT id FROM collections WHERE alias = ?", alias).Scan(&collID)
if err != nil {
log.Error("Failed selecting from collections: %v. Some things won't work.", err)
}
// Update MathJax value
if c.MathJax {
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", collID, "render_mathjax", "1")
} else {
_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "render_mathjax", "1", "1")
}
if err != nil {
log.Error("Unable to insert render_mathjax value: %v", err)
return err
}
} else {
_, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "render_mathjax")
if err != nil {
log.Error("Unable to delete render_mathjax value: %v", err)
return err
}
}
// Update Monetization value
if c.Monetization != nil {
skipUpdate := false
if *c.Monetization != "" {
// Strip away any excess spaces
trimmed := strings.TrimSpace(*c.Monetization)
// Only update value when it starts with "$", per spec: https://paymentpointers.org
if strings.HasPrefix(trimmed, "$") {
c.Monetization = &trimmed
} else {
// Value appears invalid, so don't update
skipUpdate = true
}
}
if !skipUpdate {
_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "monetization_pointer", *c.Monetization, *c.Monetization)
if err != nil {
log.Error("Unable to insert monetization_pointer value: %v", err)
return err
}
}
}
// Update rest of the collection data
if q.Updates != "" {
res, err = db.Exec("UPDATE collections SET "+q.Updates+" WHERE "+q.Conditions, q.Params...)
if err != nil {
log.Error("Unable to update collection: %v", err)
return err
}
}
rowsAffected, _ = res.RowsAffected()
if !changed || rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM collections WHERE alias = ? AND owner_id = ?", alias, c.OwnerID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedEditPost
case err != nil:
log.Error("Failed selecting from collections: %v", err)
}
if !updatePass {
return nil
}
}
if updatePass {
hashedPass, err := auth.HashPass([]byte(c.Pass))
if err != nil {
log.Error("Unable to create hash: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?)", alias, hashedPass)
} else {
_, err = db.Exec("INSERT INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?) "+db.upsert("collection_id")+" password = ?", alias, hashedPass, hashedPass)
}
if err != nil {
return err
}
}
return nil
}
const postCols = "id, slug, text_appearance, language, rtl, privacy, owner_id, collection_id, pinned_position, created, updated, view_count, title, content"
// getEditablePost returns a PublicPost with the given ID only if the given
// edit token is valid for the post.
func (db *datastore) GetEditablePost(id, editToken string) (*PublicPost, error) {
// FIXME: code duplicated from getPost()
// TODO: add slight logic difference to getPost / one func
var ownerName sql.NullString
p := &Post{}
row := db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE id = ? LIMIT 1", id)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
switch {
case err == sql.ErrNoRows:
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
if ownerName.Valid {
res.Owner = &PublicUser{Username: ownerName.String}
}
return &res, nil
}
func (db *datastore) PostIDExists(id string) bool {
var dummy bool
err := db.QueryRow("SELECT 1 FROM posts WHERE id = ?", id).Scan(&dummy)
return err == nil && dummy
}
// GetPost gets a public-facing post object from the database. If collectionID
// is > 0, the post will be retrieved by slug and collection ID, rather than
// post ID.
// TODO: break this into two functions:
// - GetPost(id string)
// - GetCollectionPost(slug string, collectionID int64)
func (db *datastore) GetPost(id string, collectionID int64) (*PublicPost, error) {
var ownerName sql.NullString
p := &Post{}
var row *sql.Row
var where string
params := []interface{}{id}
if collectionID > 0 {
where = "slug = ? AND collection_id = ?"
params = append(params, collectionID)
} else {
where = "id = ?"
}
row = db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE "+where+" LIMIT 1", params...)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
switch {
case err == sql.ErrNoRows:
if collectionID > 0 {
return nil, ErrCollectionPageNotFound
}
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
if ownerName.Valid {
res.Owner = &PublicUser{Username: ownerName.String}
}
return &res, nil
}
// TODO: don't duplicate getPost() functionality
func (db *datastore) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) {
p := &Post{}
var row *sql.Row
where := "id = ? AND owner_id = ?"
params := []interface{}{id, ownerID}
row = db.QueryRow("SELECT "+postCols+" FROM posts WHERE "+where+" LIMIT 1", params...)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
switch {
case err == sql.ErrNoRows:
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
return &res, nil
}
func (db *datastore) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) {
propSelects := map[string]string{
"views": "view_count AS views",
}
selectQuery, ok := propSelects[property]
if !ok {
return nil, impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid property: %s.", property)}
}
var res interface{}
var row *sql.Row
if collectionID != 0 {
row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE slug = ? AND collection_id = ? LIMIT 1", id, collectionID)
} else {
row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE id = ? LIMIT 1", id)
}
err := row.Scan(&res)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "Post not found."}
case err != nil:
log.Error("Failed selecting post: %v", err)
return nil, err
}
return res, nil
}
// GetPostsCount modifies the CollectionObj to include the correct number of
// standard (non-pinned) posts. It will return future posts if `includeFuture`
// is true.
func (db *datastore) GetPostsCount(c *CollectionObj, includeFuture bool) {
var count int64
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND pinned_position IS NULL "+timeCondition, c.ID).Scan(&count)
switch {
case err == sql.ErrNoRows:
c.TotalPosts = 0
case err != nil:
log.Error("Failed selecting from collections: %v", err)
c.TotalPosts = 0
}
c.TotalPosts = int(count)
}
// GetPosts retrieves all posts for the given Collection.
// It will return future posts if `includeFuture` is true.
// It will include only standard (non-pinned) posts unless `includePinned` is true.
// TODO: change includeFuture to isOwner, since that's how it's used
func (db *datastore) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() && !forceRecentFirst {
order = "ASC"
}
pagePosts := cf.PostsPerPage()
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
pinnedCondition := ""
if !includePinned {
pinnedCondition = "AND pinned_position IS NULL"
}
rows, err := db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? "+pinnedCondition+" "+timeCondition+" ORDER BY created "+order+limitStr, collID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
}
defer rows.Close()
// TODO: extract this common row scanning logic for queries using `postCols`
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.augmentContent(c)
p.formatContent(cfg, c, includeFuture, false)
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
// GetPostsTagged retrieves all posts on the given Collection that contain the
// given tag.
// It will return future posts if `includeFuture` is true.
// TODO: change includeFuture to isOwner, since that's how it's used
func (db *datastore) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() {
order = "ASC"
}
pagePosts := cf.PostsPerPage()
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
var rows *sql.Rows
var err error
if db.driverName == driverSQLite {
rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, `.*#`+strings.ToLower(tag)+`\b.*`)
} else {
rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, "#"+strings.ToLower(tag)+"[[:>:]]")
}
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
}
defer rows.Close()
// TODO: extract this common row scanning logic for queries using `postCols`
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.augmentContent(c)
p.formatContent(cfg, c, includeFuture, false)
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetAPFollowers(c *Collection) (*[]RemoteUser, error) {
rows, err := db.Query("SELECT actor_id, inbox, shared_inbox FROM remotefollows f INNER JOIN remoteusers u ON f.remote_user_id = u.id WHERE collection_id = ?", c.ID)
if err != nil {
log.Error("Failed selecting from followers: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve followers."}
}
defer rows.Close()
followers := []RemoteUser{}
for rows.Next() {
f := RemoteUser{}
err = rows.Scan(&f.ActorID, &f.Inbox, &f.SharedInbox)
followers = append(followers, f)
}
return &followers, nil
}
// CanCollect returns whether or not the given user can add the given post to a
// collection. This is true when a post is already owned by the user.
// NOTE: this is currently only used to potentially add owned posts to a
// collection. This has the SIDE EFFECT of also generating a slug for the post.
// FIXME: make this side effect more explicit (or extract it)
func (db *datastore) CanCollect(cpr *ClaimPostRequest, userID int64) bool {
var title, content string
var lang sql.NullString
err := db.QueryRow("SELECT title, content, language FROM posts WHERE id = ? AND owner_id = ?", cpr.ID, userID).Scan(&title, &content, &lang)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Failed on post CanCollect(%s, %d): %v", cpr.ID, userID, err)
return false
}
// Since we have the post content and the post is collectable, generate the
// post's slug now.
cpr.Slug = getSlugFromPost(title, content, lang.String)
return true
}
func (db *datastore) AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) {
qRes, err := db.Exec(query, params...)
if err != nil {
if db.isDuplicateKeyErr(err) && slugIdx > -1 {
s := id.GenSafeUniqueSlug(p.Slug)
if s == p.Slug {
// Sanity check to prevent infinite recursion
return qRes, fmt.Errorf("GenSafeUniqueSlug generated nothing unique: %s", s)
}
p.Slug = s
params[slugIdx] = p.Slug
return db.AttemptClaim(p, query, params, slugIdx)
}
return qRes, fmt.Errorf("attemptClaim: %s", err)
}
return qRes, nil
}
func (db *datastore) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) {
postClaimReqs := map[string]bool{}
res := []ClaimPostResult{}
for i := range postIDs {
postID := postIDs[i]
r := ClaimPostResult{Code: 0, ErrorMessage: ""}
// Perform post validation
if postID == "" {
r.ErrorMessage = "Missing post ID. "
}
if _, ok := postClaimReqs[postID]; ok {
r.Code = 429
r.ErrorMessage = "You've already tried anonymizing this post."
r.ID = postID
res = append(res, r)
continue
}
postClaimReqs[postID] = true
var err error
// Get full post information to return
var fullPost *PublicPost
fullPost, err = db.GetPost(postID, 0)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
r.ID = postID
res = append(res, r)
continue
} else {
log.Error("Error getting post in dispersePosts: %v", err)
}
}
if fullPost.OwnerID.Int64 != userID {
r.Code = http.StatusConflict
r.ErrorMessage = "Post is already owned by someone else."
r.ID = postID
res = append(res, r)
continue
}
var qRes sql.Result
var query string
var params []interface{}
// Do AND owner_id = ? for sanity.
// This should've been caught and returned with a good error message
// just above.
query = "UPDATE posts SET collection_id = NULL WHERE id = ? AND owner_id = ?"
params = []interface{}{postID, userID}
qRes, err = db.Exec(query, params...)
if err != nil {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "A glitch happened on our end."
r.ID = postID
res = append(res, r)
log.Error("dispersePosts (post %s): %v", postID, err)
continue
}
// Post was successfully dispersed
r.Code = http.StatusOK
r.Post = fullPost
rowsAffected, _ := qRes.RowsAffected()
if rowsAffected == 0 {
// This was already claimed, but return 200
r.Code = http.StatusOK
}
res = append(res, r)
}
return &res, nil
}
func (db *datastore) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) {
postClaimReqs := map[string]bool{}
res := []ClaimPostResult{}
postCollAlias := collAlias
for i := range *posts {
p := (*posts)[i]
if &p == nil {
continue
}
r := ClaimPostResult{Code: 0, ErrorMessage: ""}
// Perform post validation
if p.ID == "" {
r.ErrorMessage = "Missing post ID `id`. "
}
if _, ok := postClaimReqs[p.ID]; ok {
r.Code = 429
r.ErrorMessage = "You've already tried claiming this post."
r.ID = p.ID
res = append(res, r)
continue
}
postClaimReqs[p.ID] = true
canCollect := db.CanCollect(&p, userID)
if !canCollect && p.Token == "" {
// TODO: ensure post isn't owned by anyone else when a valid modify
// token is given.
r.ErrorMessage += "Missing post Edit Token `token`."
}
if r.ErrorMessage != "" {
// Post validate failed
r.Code = http.StatusBadRequest
r.ID = p.ID
res = append(res, r)
continue
}
var err error
var qRes sql.Result
var query string
var params []interface{}
var slugIdx int = -1
var coll *Collection
if collAlias == "" {
// Posts are being claimed at /posts/claim, not
// /collections/{alias}/collect, so use given individual collection
// to associate post with.
postCollAlias = p.CollectionAlias
}
if postCollAlias != "" {
// Associate this post with a collection
if p.CreateCollection {
// This is a new collection
// TODO: consider removing this. This seriously complicates this
// method and adds another (unnecessary?) logic path.
coll, err = db.CreateCollection(cfg, postCollAlias, "", userID)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
} else {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "Unknown error occurred creating collection"
}
r.ID = p.ID
res = append(res, r)
continue
}
} else {
// Attempt to add to existing collection
coll, err = db.GetCollection(postCollAlias)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
// Show obfuscated "forbidden" response, as if attempting to add to an
// unowned blog.
r.Code = ErrForbiddenCollection.Status
r.ErrorMessage = ErrForbiddenCollection.Message
} else {
r.Code = err.Status
r.ErrorMessage = err.Message
}
} else {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "Unknown error occurred claiming post with collection"
}
r.ID = p.ID
res = append(res, r)
continue
}
if coll.OwnerID != userID {
r.Code = ErrForbiddenCollection.Status
r.ErrorMessage = ErrForbiddenCollection.Message
r.ID = p.ID
res = append(res, r)
continue
}
}
if p.Slug == "" {
p.Slug = p.ID
}
if canCollect {
// User already owns this post, so just add it to the given
// collection.
query = "UPDATE posts SET collection_id = ?, slug = ? WHERE id = ? AND owner_id = ?"
params = []interface{}{coll.ID, p.Slug, p.ID, userID}
slugIdx = 1
} else {
query = "UPDATE posts SET owner_id = ?, collection_id = ?, slug = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
params = []interface{}{userID, coll.ID, p.Slug, p.ID, p.Token}
slugIdx = 2
}
} else {
query = "UPDATE posts SET owner_id = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
params = []interface{}{userID, p.ID, p.Token}
}
qRes, err = db.AttemptClaim(&p, query, params, slugIdx)
if err != nil {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "An unknown error occurred."
r.ID = p.ID
res = append(res, r)
log.Error("claimPosts (post %s): %v", p.ID, err)
continue
}
// Get full post information to return
var fullPost *PublicPost
if p.Token != "" {
fullPost, err = db.GetEditablePost(p.ID, p.Token)
} else {
fullPost, err = db.GetPost(p.ID, 0)
}
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
r.ID = p.ID
res = append(res, r)
continue
}
}
if fullPost.OwnerID.Int64 != userID {
r.Code = http.StatusConflict
r.ErrorMessage = "Post is already owned by someone else."
r.ID = p.ID
res = append(res, r)
continue
}
// Post was successfully claimed
r.Code = http.StatusOK
r.Post = fullPost
if coll != nil {
r.Post.Collection = &CollectionObj{Collection: *coll}
}
rowsAffected, _ := qRes.RowsAffected()
if rowsAffected == 0 {
// This was already claimed, but return 200
r.Code = http.StatusOK
}
res = append(res, r)
}
return &res, nil
}
func (db *datastore) UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error {
if pos <= 0 || pos > 20 {
pos = db.GetLastPinnedPostPos(collID) + 1
if pos == -1 {
pos = 1
}
}
var err error
if pinned {
_, err = db.Exec("UPDATE posts SET pinned_position = ? WHERE id = ?", pos, postID)
} else {
_, err = db.Exec("UPDATE posts SET pinned_position = NULL WHERE id = ?", postID)
}
if err != nil {
log.Error("Unable to update pinned post: %v", err)
return err
}
return nil
}
func (db *datastore) GetLastPinnedPostPos(collID int64) int64 {
var lastPos sql.NullInt64
err := db.QueryRow("SELECT MAX(pinned_position) FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL", collID).Scan(&lastPos)
switch {
case err == sql.ErrNoRows:
return -1
case err != nil:
log.Error("Failed selecting from posts: %v", err)
return -1
}
if !lastPos.Valid {
return -1
}
return lastPos.Int64
}
func (db *datastore) GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error) {
// FIXME: sqlite-backed instances don't include ellipsis on truncated titles
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
rows, err := db.Query("SELECT id, slug, title, "+db.clip("content", 80)+", pinned_position FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL "+timeCondition+" ORDER BY pinned_position ASC", coll.ID)
if err != nil {
log.Error("Failed selecting pinned posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve pinned posts."}
}
defer rows.Close()
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Title, &p.Content, &p.PinnedPosition)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.augmentContent(&coll.Collection)
pp := p.processPost()
pp.Collection = coll
posts = append(posts, pp)
}
return &posts, nil
}
func (db *datastore) GetCollections(u *User, hostName string) (*[]Collection, error) {
rows, err := db.Query("SELECT id, alias, title, description, privacy, view_count FROM collections WHERE owner_id = ? ORDER BY id ASC", u.ID)
if err != nil {
log.Error("Failed selecting from collections: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user collections."}
}
defer rows.Close()
colls := []Collection{}
for rows.Next() {
c := Collection{}
err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
c.hostName = hostName
c.URL = c.CanonicalURL()
c.Public = c.IsPublic()
/*
// NOTE: future functionality
if visibility != nil { // TODO: && visibility == CollPublic {
// Add Monetization info when retrieving all public collections
c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")
}
*/
colls = append(colls, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &colls, nil
}
func (db *datastore) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) {
c, err := db.GetCollections(u, hostName)
if err != nil {
return nil, err
}
if len(*c) == 0 {
return nil, impart.HTTPError{http.StatusInternalServerError, "You don't seem to have any blogs; they might've moved to another account. Try logging out and logging into your other account."}
}
return c, nil
}
func (db *datastore) GetPublicCollections(hostName string) (*[]Collection, error) {
rows, err := db.Query(`SELECT c.id, alias, title, description, privacy, view_count
FROM collections c
LEFT JOIN users u ON u.id = c.owner_id
WHERE c.privacy = 1 AND u.status = 0
ORDER BY title ASC`)
if err != nil {
log.Error("Failed selecting public collections: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve public collections."}
}
defer rows.Close()
colls := []Collection{}
for rows.Next() {
c := Collection{}
err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
c.hostName = hostName
c.URL = c.CanonicalURL()
c.Public = c.IsPublic()
// Add Monetization information
c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")
colls = append(colls, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &colls, nil
}
func (db *datastore) GetMeStats(u *User) userMeStats {
s := userMeStats{}
// User counts
colls, _ := db.GetUserCollectionCount(u.ID)
s.TotalCollections = colls
var articles, collPosts uint64
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NULL", u.ID).Scan(&articles)
if err != nil && err != sql.ErrNoRows {
log.Error("Couldn't get articles count for user %d: %v", u.ID, err)
}
s.TotalArticles = articles
err = db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NOT NULL", u.ID).Scan(&collPosts)
if err != nil && err != sql.ErrNoRows {
log.Error("Couldn't get coll posts count for user %d: %v", u.ID, err)
}
s.CollectionPosts = collPosts
return s
}
func (db *datastore) GetTotalCollections() (collCount int64, err error) {
err = db.QueryRow(`
SELECT COUNT(*)
FROM collections c
LEFT JOIN users u ON u.id = c.owner_id
WHERE u.status = 0`).Scan(&collCount)
if err != nil {
log.Error("Unable to fetch collections count: %v", err)
}
return
}
func (db *datastore) GetTotalPosts() (postCount int64, err error) {
err = db.QueryRow(`
SELECT COUNT(*)
FROM posts p
LEFT JOIN users u ON u.id = p.owner_id
WHERE u.status = 0`).Scan(&postCount)
if err != nil {
log.Error("Unable to fetch posts count: %v", err)
}
return
}
func (db *datastore) GetTopPosts(u *User, alias string, hostName string) (*[]PublicPost, error) {
params := []interface{}{u.ID}
where := ""
if alias != "" {
where = " AND alias = ?"
params = append(params, alias)
}
rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user top posts."}
}
defer rows.Close()
posts := []PublicPost{}
var gotErr bool
for rows.Next() {
p := Post{}
c := Collection{}
var alias, title, description sql.NullString
var views sql.NullInt64
err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &alias, &title, &description, &views)
if err != nil {
log.Error("Failed scanning User.getPosts() row: %v", err)
gotErr = true
break
}
p.extractData()
pubPost := p.processPost()
if alias.Valid && alias.String != "" {
c.Alias = alias.String
c.Title = title.String
c.Description = description.String
c.Views = views.Int64
c.hostName = hostName
pubPost.Collection = &CollectionObj{Collection: c}
}
posts = append(posts, pubPost)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
if gotErr && len(posts) == 0 {
// There were a lot of errors
return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
}
return &posts, nil
}
func (db *datastore) GetAnonymousPosts(u *User, page int) (*[]PublicPost, error) {
pagePosts := 10
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
rows, err := db.Query("SELECT id, view_count, title, language, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC"+limitStr, u.ID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user anonymous posts."}
}
defer rows.Close()
posts := []PublicPost{}
for rows.Next() {
p := Post{}
err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Language, &p.Created, &p.Updated, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetUserPosts(u *User) (*[]PublicPost, error) {
rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.created, p.updated, p.content, p.text_appearance, p.language, p.rtl, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON collection_id = c.id WHERE p.owner_id = ? ORDER BY created ASC", u.ID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."}
}
defer rows.Close()
posts := []PublicPost{}
var gotErr bool
for rows.Next() {
p := Post{}
c := Collection{}
var alias, title, description sql.NullString
var views sql.NullInt64
err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content, &p.Font, &p.Language, &p.RTL, &alias, &title, &description, &views)
if err != nil {
log.Error("Failed scanning User.getPosts() row: %v", err)
gotErr = true
break
}
p.extractData()
pubPost := p.processPost()
if alias.Valid && alias.String != "" {
c.Alias = alias.String
c.Title = title.String
c.Description = description.String
c.Views = views.Int64
pubPost.Collection = &CollectionObj{Collection: c}
}
posts = append(posts, pubPost)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
if gotErr && len(posts) == 0 {
// There were a lot of errors
return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
}
return &posts, nil
}
func (db *datastore) GetUserPostsCount(userID int64) int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ?", userID).Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting posts count for user %d: %v", userID, err)
return 0
}
return count
}
// ChangeSettings takes a User and applies the changes in the given
// userSettings, MODIFYING THE USER with successful changes.
func (db *datastore) ChangeSettings(app *App, u *User, s *userSettings) error {
var errPass error
q := query.NewUpdate()
// Update email if given
if s.Email != "" {
encEmail, err := data.Encrypt(app.keys.EmailKey, s.Email)
if err != nil {
log.Error("Couldn't encrypt email %s: %s\n", s.Email, err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to encrypt email address."}
}
q.SetBytes(encEmail, "email")
// Update the email if something goes awry updating the password
defer func() {
if errPass != nil {
db.UpdateEncryptedUserEmail(u.ID, encEmail)
}
}()
u.Email = zero.StringFrom(s.Email)
}
// Update username if given
var newUsername string
if s.Username != "" {
var ie *impart.HTTPError
newUsername, ie = getValidUsername(app, s.Username, u.Username)
if ie != nil {
// Username is invalid
return *ie
}
if !author.IsValidUsername(app.cfg, newUsername) {
// Ensure the username is syntactically correct.
return impart.HTTPError{http.StatusPreconditionFailed, "Username isn't valid."}
}
t, err := db.Begin()
if err != nil {
log.Error("Couldn't start username change transaction: %v", err)
return err
}
_, err = t.Exec("UPDATE users SET username = ? WHERE id = ?", newUsername, u.ID)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Unable to update users table: %v", err)
return ErrInternalGeneral
}
_, err = t.Exec("UPDATE collections SET alias = ? WHERE alias = ? AND owner_id = ?", newUsername, u.Username, u.ID)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Unable to update collection: %v", err)
return ErrInternalGeneral
}
// Keep track of name changes for redirection
db.RemoveCollectionRedirect(t, newUsername)
_, err = t.Exec("UPDATE collectionredirects SET new_alias = ? WHERE new_alias = ?", newUsername, u.Username)
if err != nil {
log.Error("Unable to update collectionredirects: %v", err)
}
_, err = t.Exec("INSERT INTO collectionredirects (prev_alias, new_alias) VALUES (?, ?)", u.Username, newUsername)
if err != nil {
log.Error("Unable to add new collectionredirect: %v", err)
}
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return err
}
u.Username = newUsername
}
// Update passphrase if given
if s.NewPass != "" {
// Check if user has already set a password
var err error
u.HasPass, err = db.IsUserPassSet(u.ID)
if err != nil {
errPass = impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data."}
return errPass
}
if u.HasPass {
// Check if currently-set password is correct
hashedPass := u.HashedPass
if len(hashedPass) == 0 {
authUser, err := db.GetUserForAuthByID(u.ID)
if err != nil {
errPass = err
return errPass
}
hashedPass = authUser.HashedPass
}
if !auth.Authenticated(hashedPass, []byte(s.OldPass)) {
errPass = impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
return errPass
}
}
hashedPass, err := auth.HashPass([]byte(s.NewPass))
if err != nil {
errPass = impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
return errPass
}
q.SetBytes(hashedPass, "password")
}
// WHERE values
q.Append(u.ID)
if q.Updates == "" {
if s.Username == "" {
return ErrPostNoUpdatableVals
}
// Nothing to update except username. That was successful, so return now.
return nil
}
res, err := db.Exec("UPDATE users SET "+q.Updates+" WHERE id = ?", q.Params...)
if err != nil {
log.Error("Unable to update collection: %v", err)
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM users WHERE id = ?", u.ID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedGeneral
case err != nil:
log.Error("Failed selecting from users: %v", err)
}
return nil
}
if s.NewPass != "" && !u.HasPass {
u.HasPass = true
}
return nil
}
func (db *datastore) ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error {
var dbPass []byte
err := db.QueryRow("SELECT password FROM users WHERE id = ?", userID).Scan(&dbPass)
switch {
case err == sql.ErrNoRows:
return ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password for change: %v", err)
return err
}
if !sudo && !auth.Authenticated(dbPass, []byte(curPass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
_, err = db.Exec("UPDATE users SET password = ? WHERE id = ?", hashedPass, userID)
if err != nil {
log.Error("Could not update passphrase: %v", err)
return err
}
return nil
}
func (db *datastore) RemoveCollectionRedirect(t *sql.Tx, alias string) error {
_, err := t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ?", alias)
if err != nil {
log.Error("Unable to delete from collectionredirects: %v", err)
return err
}
return nil
}
func (db *datastore) GetCollectionRedirect(alias string) (new string) {
row := db.QueryRow("SELECT new_alias FROM collectionredirects WHERE prev_alias = ?", alias)
err := row.Scan(&new)
if err != nil && err != sql.ErrNoRows && !db.isIgnorableError(err) {
log.Error("Failed selecting from collectionredirects: %v", err)
}
return
}
func (db *datastore) DeleteCollection(alias string, userID int64) error {
c := &Collection{Alias: alias}
var username string
row := db.QueryRow("SELECT username FROM users WHERE id = ?", userID)
err := row.Scan(&username)
if err != nil {
return err
}
// Ensure user isn't deleting their main blog
if alias == username {
return impart.HTTPError{http.StatusForbidden, "You cannot currently delete your primary blog."}
}
row = db.QueryRow("SELECT id FROM collections WHERE alias = ? AND owner_id = ?", alias, userID)
err = row.Scan(&c.ID)
switch {
case err == sql.ErrNoRows:
return impart.HTTPError{http.StatusNotFound, "Collection doesn't exist or you're not allowed to delete it."}
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return ErrInternalGeneral
}
t, err := db.Begin()
if err != nil {
return err
}
// Float all collection's posts
_, err = t.Exec("UPDATE posts SET collection_id = NULL WHERE collection_id = ? AND owner_id = ?", c.ID, userID)
if err != nil {
t.Rollback()
return err
}
// Remove redirects to or from this collection
_, err = t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ? OR new_alias = ?", alias, alias)
if err != nil {
t.Rollback()
return err
}
// Remove any optional collection password
_, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
return err
}
// Finally, delete collection itself
_, err = t.Exec("DELETE FROM collections WHERE id = ?", c.ID)
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
func (db *datastore) IsCollectionAttributeOn(id int64, attr string) bool {
var v string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SELECT value in isCollectionAttributeOn for attribute '%s': %v", attr, err)
return false
}
return v == "1"
}
func (db *datastore) CollectionHasAttribute(id int64, attr string) bool {
var dummy string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SELECT value in collectionHasAttribute for attribute '%s': %v", attr, err)
return false
}
return true
}
func (db *datastore) GetCollectionAttribute(id int64, attr string) string {
var v string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v)
switch {
case err == sql.ErrNoRows:
return ""
case err != nil:
log.Error("Couldn't SELECT value in getCollectionAttribute for attribute '%s': %v", attr, err)
return ""
}
return v
}
func (db *datastore) SetCollectionAttribute(id int64, attr, v string) error {
_, err := db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", id, attr, v)
if err != nil {
log.Error("Unable to INSERT into collectionattributes: %v", err)
return err
}
return nil
}
// DeleteAccount will delete the entire account for userID
func (db *datastore) DeleteAccount(userID int64) error {
// Get all collections
rows, err := db.Query("SELECT id, alias FROM collections WHERE owner_id = ?", userID)
if err != nil {
log.Error("Unable to get collections: %v", err)
return err
}
defer rows.Close()
colls := []Collection{}
var c Collection
for rows.Next() {
err = rows.Scan(&c.ID, &c.Alias)
if err != nil {
log.Error("Unable to scan collection cols: %v", err)
return err
}
colls = append(colls, c)
}
// Start transaction
t, err := db.Begin()
if err != nil {
log.Error("Unable to begin: %v", err)
return err
}
// Clean up all collection related information
var res sql.Result
for _, c := range colls {
// Delete tokens
res, err = t.Exec("DELETE FROM collectionattributes WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete attributes on %s: %v", c.Alias, err)
return err
}
rs, _ := res.RowsAffected()
log.Info("Deleted %d for %s from collectionattributes", rs, c.Alias)
// Remove any optional collection password
res, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete passwords on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionpasswords", rs, c.Alias)
// Remove redirects to this collection
res, err = t.Exec("DELETE FROM collectionredirects WHERE new_alias = ?", c.Alias)
if err != nil {
t.Rollback()
log.Error("Unable to delete redirects on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionredirects", rs, c.Alias)
// Remove any collection keys
res, err = t.Exec("DELETE FROM collectionkeys WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete keys on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionkeys", rs, c.Alias)
// TODO: federate delete collection
// Remove remote follows
res, err = t.Exec("DELETE FROM remotefollows WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete remote follows on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from remotefollows", rs, c.Alias)
}
// Delete collections
res, err = t.Exec("DELETE FROM collections WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete collections: %v", err)
return err
}
rs, _ := res.RowsAffected()
log.Info("Deleted %d from collections", rs)
// Delete tokens
res, err = t.Exec("DELETE FROM accesstokens WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete access tokens: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from accesstokens", rs)
// Delete user attributes
res, err = t.Exec("DELETE FROM oauth_users WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete oauth_users: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from oauth_users", rs)
// Delete posts
// TODO: should maybe get each row so we can federate a delete
// if so needs to be outside of transaction like collections
res, err = t.Exec("DELETE FROM posts WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete posts: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from posts", rs)
// Delete user attributes
res, err = t.Exec("DELETE FROM userattributes WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete attributes: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from userattributes", rs)
// Delete user invites
res, err = t.Exec("DELETE FROM userinvites WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete invites: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from userinvites", rs)
// Delete the user
res, err = t.Exec("DELETE FROM users WHERE id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete user: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from users", rs)
// Commit all changes to the database
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Unable to commit: %v", err)
return err
}
// TODO: federate delete actor
return nil
}
func (db *datastore) GetAPActorKeys(collectionID int64) ([]byte, []byte) {
var pub, priv []byte
err := db.QueryRow("SELECT public_key, private_key FROM collectionkeys WHERE collection_id = ?", collectionID).Scan(&pub, &priv)
switch {
case err == sql.ErrNoRows:
// Generate keys
pub, priv = activitypub.GenerateKeys()
_, err = db.Exec("INSERT INTO collectionkeys (collection_id, public_key, private_key) VALUES (?, ?, ?)", collectionID, pub, priv)
if err != nil {
log.Error("Unable to INSERT new activitypub keypair: %v", err)
return nil, nil
}
case err != nil:
log.Error("Couldn't SELECT collectionkeys: %v", err)
return nil, nil
}
return pub, priv
}
func (db *datastore) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error {
_, err := db.Exec("INSERT INTO userinvites (id, owner_id, max_uses, created, expires, inactive) VALUES (?, ?, ?, "+db.now()+", ?, 0)", id, userID, maxUses, expires)
return err
}
func (db *datastore) GetUserInvites(userID int64) (*[]Invite, error) {
rows, err := db.Query("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE owner_id = ? ORDER BY created DESC", userID)
if err != nil {
log.Error("Failed selecting from userinvites: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user invites."}
}
defer rows.Close()
is := []Invite{}
for rows.Next() {
i := Invite{}
err = rows.Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
is = append(is, i)
}
return &is, nil
}
func (db *datastore) GetUserInvite(id string) (*Invite, error) {
var i Invite
err := db.QueryRow("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE id = ?", id).Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
switch {
case err == sql.ErrNoRows, db.isIgnorableError(err):
return nil, impart.HTTPError{http.StatusNotFound, "Invite doesn't exist."}
case err != nil:
log.Error("Failed selecting invite: %v", err)
return nil, err
}
return &i, nil
}
// IsUsersInvite returns true if the user with ID created the invite with code
// and an error other than sql no rows, if any. Will return false in the event
// of an error.
func (db *datastore) IsUsersInvite(code string, userID int64) (bool, error) {
var id string
err := db.QueryRow("SELECT id FROM userinvites WHERE id = ? AND owner_id = ?", code, userID).Scan(&id)
if err != nil && err != sql.ErrNoRows {
log.Error("Failed selecting invite: %v", err)
return false, err
}
return id != "", nil
}
func (db *datastore) GetUsersInvitedCount(id string) int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM usersinvited WHERE invite_id = ?", id).Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting users invited count: %v", err)
return 0
}
return count
}
func (db *datastore) CreateInvitedUser(inviteID string, userID int64) error {
_, err := db.Exec("INSERT INTO usersinvited (invite_id, user_id) VALUES (?, ?)", inviteID, userID)
return err
}
func (db *datastore) GetInstancePages() ([]*instanceContent, error) {
return db.GetAllDynamicContent("page")
}
func (db *datastore) GetAllDynamicContent(t string) ([]*instanceContent, error) {
where := ""
params := []interface{}{}
if t != "" {
where = " WHERE content_type = ?"
params = append(params, t)
}
rows, err := db.Query("SELECT id, title, content, updated, content_type FROM appcontent"+where, params...)
if err != nil {
log.Error("Failed selecting from appcontent: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve instance pages."}
}
defer rows.Close()
pages := []*instanceContent{}
for rows.Next() {
c := &instanceContent{}
err = rows.Scan(&c.ID, &c.Title, &c.Content, &c.Updated, &c.Type)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
pages = append(pages, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return pages, nil
}
func (db *datastore) GetDynamicContent(id string) (*instanceContent, error) {
c := &instanceContent{
ID: id,
}
err := db.QueryRow("SELECT title, content, updated, content_type FROM appcontent WHERE id = ?", id).Scan(&c.Title, &c.Content, &c.Updated, &c.Type)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Couldn't SELECT FROM appcontent for id '%s': %v", id, err)
return nil, err
}
return c, nil
}
func (db *datastore) UpdateDynamicContent(id, title, content, contentType string) error {
var err error
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?)", id, title, content, contentType)
} else {
_, err = db.Exec("INSERT INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?) "+db.upsert("id")+" title = ?, content = ?, updated = "+db.now(), id, title, content, contentType, title, content)
}
if err != nil {
log.Error("Unable to INSERT appcontent for '%s': %v", id, err)
}
return err
}
func (db *datastore) GetAllUsers(page uint) (*[]User, error) {
limitStr := fmt.Sprintf("0, %d", adminUsersPerPage)
if page > 1 {
limitStr = fmt.Sprintf("%d, %d", (page-1)*adminUsersPerPage, adminUsersPerPage)
}
rows, err := db.Query("SELECT id, username, created, status FROM users ORDER BY created DESC LIMIT " + limitStr)
if err != nil {
log.Error("Failed selecting from users: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve all users."}
}
defer rows.Close()
users := []User{}
for rows.Next() {
u := User{}
err = rows.Scan(&u.ID, &u.Username, &u.Created, &u.Status)
if err != nil {
log.Error("Failed scanning GetAllUsers() row: %v", err)
break
}
users = append(users, u)
}
return &users, nil
}
func (db *datastore) GetAllUsersCount() int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM users").Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting all users count: %v", err)
return 0
}
return count
}
func (db *datastore) GetUserLastPostTime(id int64) (*time.Time, error) {
var t time.Time
err := db.QueryRow("SELECT created FROM posts WHERE owner_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Failed selecting last post time from posts: %v", err)
return nil, err
}
return &t, nil
}
// SetUserStatus changes a user's status in the database. see Users.UserStatus
func (db *datastore) SetUserStatus(id int64, status UserStatus) error {
_, err := db.Exec("UPDATE users SET status = ? WHERE id = ?", status, id)
if err != nil {
return fmt.Errorf("failed to update user status: %v", err)
}
return nil
}
func (db *datastore) GetCollectionLastPostTime(id int64) (*time.Time, error) {
var t time.Time
err := db.QueryRow("SELECT created FROM posts WHERE collection_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Failed selecting last post time from posts: %v", err)
return nil, err
}
return &t, nil
}
func (db *datastore) GenerateOAuthState(ctx context.Context, provider string, clientID string, attachUser int64, inviteCode string) (string, error) {
state := id.Generate62RandomString(24)
attachUserVal := sql.NullInt64{Valid: attachUser > 0, Int64: attachUser}
inviteCodeVal := sql.NullString{Valid: inviteCode != "", String: inviteCode}
_, err := db.ExecContext(ctx, "INSERT INTO oauth_client_states (state, provider, client_id, used, created_at, attach_user_id, invite_code) VALUES (?, ?, ?, FALSE, "+db.now()+", ?, ?)", state, provider, clientID, attachUserVal, inviteCodeVal)
if err != nil {
return "", fmt.Errorf("unable to record oauth client state: %w", err)
}
return state, nil
}
func (db *datastore) ValidateOAuthState(ctx context.Context, state string) (string, string, int64, string, error) {
var provider string
var clientID string
var attachUserID sql.NullInt64
var inviteCode sql.NullString
err := wf_db.RunTransactionWithOptions(ctx, db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
err := tx.
QueryRowContext(ctx, "SELECT provider, client_id, attach_user_id, invite_code FROM oauth_client_states WHERE state = ? AND used = FALSE", state).
Scan(&provider, &clientID, &attachUserID, &inviteCode)
if err != nil {
return err
}
res, err := tx.ExecContext(ctx, "UPDATE oauth_client_states SET used = TRUE WHERE state = ?", state)
if err != nil {
return err
}
rowsAffected, err := res.RowsAffected()
if err != nil {
return err
}
if rowsAffected != 1 {
return fmt.Errorf("state not found")
}
return nil
})
if err != nil {
return "", "", 0, "", nil
}
return provider, clientID, attachUserID.Int64, inviteCode.String, nil
}
func (db *datastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error {
var err error
if db.driverName == driverSQLite {
_, err = db.ExecContext(ctx, "INSERT OR REPLACE INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?)", localUserID, remoteUserID, provider, clientID, accessToken)
} else {
_, err = db.ExecContext(ctx, "INSERT INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?) "+db.upsert("user")+" access_token = ?", localUserID, remoteUserID, provider, clientID, accessToken, accessToken)
}
if err != nil {
log.Error("Unable to INSERT oauth_users for '%d': %v", localUserID, err)
}
return err
}
// GetIDForRemoteUser returns a user ID associated with a remote user ID.
func (db *datastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) {
var userID int64 = -1
err := db.
QueryRowContext(ctx, "SELECT user_id FROM oauth_users WHERE remote_user_id = ? AND provider = ? AND client_id = ?", remoteUserID, provider, clientID).
Scan(&userID)
// Not finding a record is OK.
if err != nil && err != sql.ErrNoRows {
return -1, err
}
return userID, nil
}
type oauthAccountInfo struct {
Provider string
ClientID string
RemoteUserID string
DisplayName string
AllowDisconnect bool
}
func (db *datastore) GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error) {
rows, err := db.QueryContext(ctx, "SELECT provider, client_id, remote_user_id FROM oauth_users WHERE user_id = ? ", userID)
if err != nil {
log.Error("Failed selecting from oauth_users: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user oauth accounts."}
}
defer rows.Close()
var records []oauthAccountInfo
for rows.Next() {
info := oauthAccountInfo{}
err = rows.Scan(&info.Provider, &info.ClientID, &info.RemoteUserID)
if err != nil {
log.Error("Failed scanning GetAllUsers() row: %v", err)
break
}
records = append(records, info)
}
return records, nil
}
// DatabaseInitialized returns whether or not the current datastore has been
// initialized with the correct schema.
// Currently, it checks to see if the `users` table exists.
func (db *datastore) DatabaseInitialized() bool {
var dummy string
var err error
if db.driverName == driverSQLite {
err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = 'users'").Scan(&dummy)
} else {
err = db.QueryRow("SHOW TABLES LIKE 'users'").Scan(&dummy)
}
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SHOW TABLES: %v", err)
return false
}
return true
}
func (db *datastore) RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error {
_, err := db.ExecContext(ctx, `DELETE FROM oauth_users WHERE user_id = ? AND provider = ? AND client_id = ? AND remote_user_id = ?`, userID, provider, clientID, remoteUserID)
return err
}
func stringLogln(log *string, s string, v ...interface{}) {
*log += fmt.Sprintf(s+"\n", v...)
}
func handleFailedPostInsert(err error) error {
log.Error("Couldn't insert into posts: %v", err)
return err
}
func (db *datastore) GetProfilePageFromHandle(app *App, handle string) (string, error) {
handle = strings.TrimLeft(handle, "@")
actorIRI := ""
parts := strings.Split(handle, "@")
if len(parts) != 2 {
return "", fmt.Errorf("invalid handle format")
}
domain := parts[1]
// Check non-AP instances
if siloProfileURL := silobridge.Profile(parts[0], domain); siloProfileURL != "" {
return siloProfileURL, nil
}
remoteUser, err := getRemoteUserFromHandle(app, handle)
if err != nil {
// can't find using handle in the table but the table may already have this user without
// handle from a previous version
// TODO: Make this determination. We should know whether a user exists without a handle, or doesn't exist at all
actorIRI = RemoteLookup(handle)
_, errRemoteUser := getRemoteUser(app, actorIRI)
// if it exists then we need to update the handle
if errRemoteUser == nil {
_, err := app.db.Exec("UPDATE remoteusers SET handle = ? WHERE actor_id = ?", handle, actorIRI)
if err != nil {
log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI)
}
} else {
// this probably means we don't have the user in the table so let's try to insert it
// here we need to ask the server for the inboxes
remoteActor, err := activityserve.NewRemoteActor(actorIRI)
if err != nil {
log.Error("Couldn't fetch remote actor: %v", err)
}
if debugging {
log.Info("%s %s %s %s", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
}
_, err = app.db.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, handle) VALUES(?, ?, ?, ?)", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
if err != nil {
log.Error("Couldn't insert remote user: %v", err)
return "", err
}
}
} else {
actorIRI = remoteUser.ActorID
}
return actorIRI, nil
}
diff --git a/db/create.go b/db/create.go
index 648f93a..8728d5d 100644
--- a/db/create.go
+++ b/db/create.go
@@ -1,266 +1,266 @@
/*
- * Copyright © 2019-2020 A Bunch Tell LLC.
+ * Copyright © 2019-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package db
import (
"fmt"
"strings"
)
type ColumnType int
type OptionalInt struct {
Set bool
Value int
}
type OptionalString struct {
Set bool
Value string
}
type SQLBuilder interface {
ToSQL() (string, error)
}
type Column struct {
Dialect DialectType
Name string
Nullable bool
Default OptionalString
Type ColumnType
Size OptionalInt
PrimaryKey bool
}
type CreateTableSqlBuilder struct {
Dialect DialectType
Name string
IfNotExists bool
ColumnOrder []string
Columns map[string]*Column
Constraints []string
}
const (
ColumnTypeBool ColumnType = iota
ColumnTypeSmallInt ColumnType = iota
ColumnTypeInteger ColumnType = iota
ColumnTypeChar ColumnType = iota
ColumnTypeVarChar ColumnType = iota
ColumnTypeText ColumnType = iota
ColumnTypeDateTime ColumnType = iota
)
var _ SQLBuilder = &CreateTableSqlBuilder{}
var UnsetSize OptionalInt = OptionalInt{Set: false, Value: 0}
var UnsetDefault OptionalString = OptionalString{Set: false, Value: ""}
func (d ColumnType) Format(dialect DialectType, size OptionalInt) (string, error) {
if dialect != DialectMySQL && dialect != DialectSQLite {
return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size)
}
switch d {
case ColumnTypeSmallInt:
{
if dialect == DialectSQLite {
return "INTEGER", nil
}
mod := ""
if size.Set {
mod = fmt.Sprintf("(%d)", size.Value)
}
return "SMALLINT" + mod, nil
}
case ColumnTypeInteger:
{
if dialect == DialectSQLite {
return "INTEGER", nil
}
mod := ""
if size.Set {
mod = fmt.Sprintf("(%d)", size.Value)
}
return "INT" + mod, nil
}
case ColumnTypeChar:
{
if dialect == DialectSQLite {
return "TEXT", nil
}
mod := ""
if size.Set {
mod = fmt.Sprintf("(%d)", size.Value)
}
return "CHAR" + mod, nil
}
case ColumnTypeVarChar:
{
if dialect == DialectSQLite {
return "TEXT", nil
}
mod := ""
if size.Set {
mod = fmt.Sprintf("(%d)", size.Value)
}
return "VARCHAR" + mod, nil
}
case ColumnTypeBool:
{
if dialect == DialectSQLite {
return "INTEGER", nil
}
return "TINYINT(1)", nil
}
case ColumnTypeDateTime:
return "DATETIME", nil
case ColumnTypeText:
return "TEXT", nil
}
return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size)
}
func (c *Column) SetName(name string) *Column {
c.Name = name
return c
}
func (c *Column) SetNullable(nullable bool) *Column {
c.Nullable = nullable
return c
}
func (c *Column) SetPrimaryKey(pk bool) *Column {
c.PrimaryKey = pk
return c
}
func (c *Column) SetDefault(value string) *Column {
c.Default = OptionalString{Set: true, Value: value}
return c
}
func (c *Column) SetDefaultCurrentTimestamp() *Column {
def := "NOW()"
if c.Dialect == DialectSQLite {
def = "CURRENT_TIMESTAMP"
}
c.Default = OptionalString{Set: true, Value: def}
return c
}
func (c *Column) SetType(t ColumnType) *Column {
c.Type = t
return c
}
func (c *Column) SetSize(size int) *Column {
c.Size = OptionalInt{Set: true, Value: size}
return c
}
func (c *Column) String() (string, error) {
var str strings.Builder
str.WriteString(c.Name)
str.WriteString(" ")
typeStr, err := c.Type.Format(c.Dialect, c.Size)
if err != nil {
return "", err
}
str.WriteString(typeStr)
if !c.Nullable {
str.WriteString(" NOT NULL")
}
if c.Default.Set {
str.WriteString(" DEFAULT ")
val := c.Default.Value
if val == "" {
val = "''"
}
str.WriteString(val)
}
if c.PrimaryKey {
str.WriteString(" PRIMARY KEY")
}
return str.String(), nil
}
func (b *CreateTableSqlBuilder) Column(column *Column) *CreateTableSqlBuilder {
if b.Columns == nil {
b.Columns = make(map[string]*Column)
}
b.Columns[column.Name] = column
b.ColumnOrder = append(b.ColumnOrder, column.Name)
return b
}
func (b *CreateTableSqlBuilder) UniqueConstraint(columns ...string) *CreateTableSqlBuilder {
for _, column := range columns {
if _, ok := b.Columns[column]; !ok {
// This fails silently.
return b
}
}
b.Constraints = append(b.Constraints, fmt.Sprintf("UNIQUE(%s)", strings.Join(columns, ",")))
return b
}
func (b *CreateTableSqlBuilder) SetIfNotExists(ine bool) *CreateTableSqlBuilder {
b.IfNotExists = ine
return b
}
func (b *CreateTableSqlBuilder) ToSQL() (string, error) {
var str strings.Builder
str.WriteString("CREATE TABLE ")
if b.IfNotExists {
str.WriteString("IF NOT EXISTS ")
}
str.WriteString(b.Name)
var things []string
for _, columnName := range b.ColumnOrder {
column, ok := b.Columns[columnName]
if !ok {
return "", fmt.Errorf("column not found: %s", columnName)
}
columnStr, err := column.String()
if err != nil {
return "", err
}
things = append(things, columnStr)
}
for _, constraint := range b.Constraints {
things = append(things, constraint)
}
if thingLen := len(things); thingLen > 0 {
str.WriteString(" ( ")
for i, thing := range things {
str.WriteString(thing)
if i < thingLen-1 {
str.WriteString(", ")
}
}
str.WriteString(" )")
}
return str.String(), nil
}
diff --git a/errors.go b/errors.go
index cf52df1..f0d3099 100644
--- a/errors.go
+++ b/errors.go
@@ -1,62 +1,62 @@
/*
- * Copyright © 2018-2020 A Bunch Tell LLC.
+ * Copyright © 2018-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"net/http"
"github.com/writeas/impart"
)
// Commonly returned HTTP errors
var (
ErrBadFormData = impart.HTTPError{http.StatusBadRequest, "Expected valid form data."}
ErrBadJSON = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON object."}
ErrBadJSONArray = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON array."}
ErrBadAccessToken = impart.HTTPError{http.StatusUnauthorized, "Invalid access token."}
ErrNoAccessToken = impart.HTTPError{http.StatusBadRequest, "Authorization token required."}
ErrNotLoggedIn = impart.HTTPError{http.StatusUnauthorized, "Not logged in."}
ErrForbiddenCollection = impart.HTTPError{http.StatusForbidden, "You don't have permission to add to this collection."}
ErrForbiddenEditPost = impart.HTTPError{http.StatusForbidden, "You don't have permission to update this post."}
ErrUnauthorizedEditPost = impart.HTTPError{http.StatusUnauthorized, "Invalid editing credentials."}
ErrUnauthorizedGeneral = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to do that."}
ErrBadRequestedType = impart.HTTPError{http.StatusNotAcceptable, "Bad requested Content-Type."}
ErrCollectionUnauthorizedRead = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to access this collection."}
ErrNoPublishableContent = impart.HTTPError{http.StatusBadRequest, "Supply something to publish."}
ErrInternalGeneral = impart.HTTPError{http.StatusInternalServerError, "The humans messed something up. They've been notified."}
ErrInternalCookieSession = impart.HTTPError{http.StatusInternalServerError, "Could not get cookie session."}
ErrUnavailable = impart.HTTPError{http.StatusServiceUnavailable, "Service temporarily unavailable due to high load."}
ErrCollectionNotFound = impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
ErrCollectionGone = impart.HTTPError{http.StatusGone, "This blog was unpublished."}
ErrCollectionPageNotFound = impart.HTTPError{http.StatusNotFound, "Collection page doesn't exist."}
ErrPostNotFound = impart.HTTPError{Status: http.StatusNotFound, Message: "Post not found."}
ErrPostBanned = impart.HTTPError{Status: http.StatusGone, Message: "Post removed."}
ErrPostUnpublished = impart.HTTPError{Status: http.StatusGone, Message: "Post unpublished by author."}
ErrPostFetchError = impart.HTTPError{Status: http.StatusInternalServerError, Message: "We encountered an error getting the post. The humans have been alerted."}
ErrUserNotFound = impart.HTTPError{http.StatusNotFound, "User doesn't exist."}
ErrRemoteUserNotFound = impart.HTTPError{http.StatusNotFound, "Remote user not found."}
ErrUserNotFoundEmail = impart.HTTPError{http.StatusNotFound, "Please enter your username instead of your email address."}
ErrUserSilenced = impart.HTTPError{http.StatusForbidden, "Account is silenced."}
ErrDisabledPasswordAuth = impart.HTTPError{http.StatusForbidden, "Password authentication is disabled."}
)
// Post operation errors
var (
ErrPostNoUpdatableVals = impart.HTTPError{http.StatusBadRequest, "Supply some properties to update."}
)
diff --git a/export.go b/export.go
index bdfd7c4..e6a09c1 100644
--- a/export.go
+++ b/export.go
@@ -1,132 +1,132 @@
/*
- * Copyright © 2018-2019 A Bunch Tell LLC.
+ * Copyright © 2018-2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"archive/zip"
"bytes"
"encoding/csv"
"strings"
"time"
"github.com/writeas/web-core/log"
)
func exportPostsCSV(hostName string, u *User, posts *[]PublicPost) []byte {
var b bytes.Buffer
r := [][]string{
{"id", "slug", "blog", "url", "created", "title", "body"},
}
for _, p := range *posts {
var blog string
if p.Collection != nil {
blog = p.Collection.Alias
p.Collection.hostName = hostName
}
f := []string{p.ID, p.Slug.String, blog, p.CanonicalURL(hostName), p.Created8601(), p.Title.String, strings.Replace(p.Content, "\n", "\\n", -1)}
r = append(r, f)
}
w := csv.NewWriter(&b)
w.WriteAll(r) // calls Flush internally
if err := w.Error(); err != nil {
log.Info("error writing csv: %v", err)
}
return b.Bytes()
}
type exportedTxt struct {
Name, Title, Body string
Mod time.Time
}
func exportPostsZip(u *User, posts *[]PublicPost) []byte {
// Create a buffer to write our archive to.
b := new(bytes.Buffer)
// Create a new zip archive.
w := zip.NewWriter(b)
// Add some files to the archive.
var filename string
files := []exportedTxt{}
for _, p := range *posts {
filename = ""
if p.Collection != nil {
filename += p.Collection.Alias + "/"
}
if p.Slug.String != "" {
filename += p.Slug.String + "_"
}
filename += p.ID + ".txt"
files = append(files, exportedTxt{filename, p.Title.String, p.Content, p.Created})
}
for _, file := range files {
head := &zip.FileHeader{Name: file.Name}
head.SetModTime(file.Mod)
f, err := w.CreateHeader(head)
if err != nil {
log.Error("export zip header: %v", err)
}
var fullPost string
if file.Title != "" {
fullPost = "# " + file.Title + "\n\n"
}
fullPost += file.Body
_, err = f.Write([]byte(fullPost))
if err != nil {
log.Error("export zip write: %v", err)
}
}
// Make sure to check the error on Close.
err := w.Close()
if err != nil {
log.Error("export zip close: %v", err)
}
return b.Bytes()
}
func compileFullExport(app *App, u *User) *ExportUser {
exportUser := &ExportUser{
User: u,
}
colls, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
posts, err := app.db.GetAnonymousPosts(u, 0)
if err != nil {
log.Error("unable to fetch anon posts: %v", err)
}
exportUser.AnonymousPosts = *posts
var collObjs []CollectionObj
for _, c := range *colls {
co := &CollectionObj{Collection: c}
co.Posts, err = app.db.GetPosts(app.cfg, &c, 0, true, false, true)
if err != nil {
log.Error("unable to get collection posts: %v", err)
}
app.db.GetPostsCount(co, true)
collObjs = append(collObjs, *co)
}
exportUser.Collections = &collObjs
return exportUser
}
diff --git a/feed.go b/feed.go
index 21e1302..68dd2c0 100644
--- a/feed.go
+++ b/feed.go
@@ -1,125 +1,125 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"fmt"
"net/http"
"time"
"github.com/gorilla/feeds"
"github.com/gorilla/mux"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/web-core/log"
)
func ViewFeed(app *App, w http.ResponseWriter, req *http.Request) error {
alias := collectionAliasFromReq(req)
// Display collection if this is a collection
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return nil
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view feed: get user: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if c.IsPrivate() || c.IsProtected() {
return ErrCollectionNotFound
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := &DisplayCollection{CollectionObj: &CollectionObj{Collection: *c}}
if c.PublicOwner {
u, err := app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
coll.Owner = u
}
}
tag := mux.Vars(req)["tag"]
if tag != "" {
coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, 1, false)
} else {
coll.Posts, _ = app.db.GetPosts(app.cfg, c, 1, false, true, false)
}
author := ""
if coll.Owner != nil {
author = coll.Owner.Username
}
collectionTitle := coll.DisplayTitle()
if tag != "" {
collectionTitle = tag + " — " + collectionTitle
}
baseUrl := coll.CanonicalURL()
basePermalinkUrl := baseUrl
siteURL := baseUrl
if tag != "" {
siteURL += "tag:" + tag
}
feed := &feeds.Feed{
Title: collectionTitle,
Link: &feeds.Link{Href: siteURL},
Description: coll.Description,
Author: &feeds.Author{author, ""},
Created: time.Now(),
}
var title, permalink string
for _, p := range *coll.Posts {
// Add necessary path back to the web browser for Web Monetization if needed
p.Collection = coll.CollectionObj // augmentReadingDestination requires a populated Collection field
p.augmentReadingDestination()
// Create the item for the feed
title = p.PlainDisplayTitle()
permalink = fmt.Sprintf("%s%s", baseUrl, p.Slug.String)
feed.Items = append(feed.Items, &feeds.Item{
Id: fmt.Sprintf("%s%s", basePermalinkUrl, p.Slug.String),
Title: title,
Link: &feeds.Link{Href: permalink},
Description: "",
Content: string(p.HTMLContent),
Author: &feeds.Author{author, ""},
Created: p.Created,
Updated: p.Updated,
})
}
rss, err := feed.ToRss()
if err != nil {
return err
}
fmt.Fprint(w, rss)
return nil
}
diff --git a/gopher.go b/gopher.go
index 66d94e9..2ac1590 100644
--- a/gopher.go
+++ b/gopher.go
@@ -1,167 +1,167 @@
/*
- * Copyright © 2020 A Bunch Tell LLC.
+ * Copyright © 2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"bytes"
"fmt"
"io"
"net/url"
"regexp"
"strings"
"github.com/writeas/web-core/log"
"github.com/writefreely/go-gopher"
)
func initGopher(apper Apper) {
handler := NewWFHandler(apper)
gopher.HandleFunc("/", handler.Gopher(handleGopher))
log.Info("Serving on gopher://localhost:%d", apper.App().Config().Server.GopherPort)
gopher.ListenAndServe(fmt.Sprintf(":%d", apper.App().Config().Server.GopherPort), nil)
}
// Utility function to strip the URL from the hostname provided by app.cfg.App.Host
func stripHostProtocol(app *App) string {
u, err := url.Parse(app.cfg.App.Host)
if err != nil {
// Fall back to host, with scheme stripped
return string(regexp.MustCompile("^.*://").ReplaceAll([]byte(app.cfg.App.Host), []byte("")))
}
return u.Hostname()
}
func handleGopher(app *App, w gopher.ResponseWriter, r *gopher.Request) error {
parts := strings.Split(r.Selector, "/")
if app.cfg.App.SingleUser {
if parts[1] != "" {
return handleGopherCollectionPost(app, w, r)
}
return handleGopherCollection(app, w, r)
}
// Show all public collections (a gopher Reader view, essentially)
if len(parts) == 3 {
return handleGopherCollection(app, w, r)
}
w.WriteInfo(fmt.Sprintf("Welcome to %s", app.cfg.App.SiteName))
colls, err := app.db.GetPublicCollections(app.cfg.App.Host)
if err != nil {
return err
}
for _, c := range *colls {
w.WriteItem(&gopher.Item{
Host: stripHostProtocol(app),
Port: app.cfg.Server.GopherPort,
Type: gopher.DIRECTORY,
Description: c.DisplayTitle(),
Selector: "/" + c.Alias + "/",
})
}
return w.End()
}
func handleGopherCollection(app *App, w gopher.ResponseWriter, r *gopher.Request) error {
var collAlias, slug string
var c *Collection
var err error
var baseSel = "/"
parts := strings.Split(r.Selector, "/")
if app.cfg.App.SingleUser {
// sanity check
slug = parts[1]
if slug != "" {
return handleGopherCollectionPost(app, w, r)
}
c, err = app.db.GetCollectionByID(1)
if err != nil {
return err
}
} else {
collAlias = parts[1]
slug = parts[2]
if slug != "" {
return handleGopherCollectionPost(app, w, r)
}
c, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
baseSel = "/" + c.Alias + "/"
}
c.hostName = app.cfg.App.Host
w.WriteInfo(c.DisplayTitle())
if c.Description != "" {
w.WriteInfo(c.Description)
}
posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false)
if err != nil {
return err
}
for _, p := range *posts {
w.WriteItem(&gopher.Item{
Port: app.cfg.Server.GopherPort,
Host: stripHostProtocol(app),
Type: gopher.FILE,
Description: p.CreatedDate() + " - " + p.DisplayTitle(),
Selector: baseSel + p.Slug.String,
})
}
return w.End()
}
func handleGopherCollectionPost(app *App, w gopher.ResponseWriter, r *gopher.Request) error {
var collAlias, slug string
var c *Collection
var err error
parts := strings.Split(r.Selector, "/")
if app.cfg.App.SingleUser {
slug = parts[1]
c, err = app.db.GetCollectionByID(1)
if err != nil {
return err
}
} else {
collAlias = parts[1]
slug = parts[2]
c, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
}
c.hostName = app.cfg.App.Host
p, err := app.db.GetPost(slug, c.ID)
if err != nil {
return err
}
b := bytes.Buffer{}
if p.Title.String != "" {
b.WriteString(p.Title.String + "\n")
}
b.WriteString(p.DisplayDate + "\n\n")
b.WriteString(p.Content)
io.Copy(w, &b)
return w.End()
}
diff --git a/handle.go b/handle.go
index a6f2ef6..3408725 100644
--- a/handle.go
+++ b/handle.go
@@ -1,1007 +1,1007 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"fmt"
"html/template"
"net/http"
"net/url"
"runtime/debug"
"strconv"
"strings"
"time"
"github.com/gorilla/sessions"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"github.com/writefreely/go-gopher"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/page"
)
// UserLevel represents the required user level for accessing an endpoint
type UserLevel int
const (
UserLevelNoneType UserLevel = iota // user or not -- ignored
UserLevelOptionalType // user or not -- object fetched if user
UserLevelNoneRequiredType // non-user (required)
UserLevelUserType // user (required)
)
func UserLevelNone(cfg *config.Config) UserLevel {
return UserLevelNoneType
}
func UserLevelOptional(cfg *config.Config) UserLevel {
return UserLevelOptionalType
}
func UserLevelNoneRequired(cfg *config.Config) UserLevel {
return UserLevelNoneRequiredType
}
func UserLevelUser(cfg *config.Config) UserLevel {
return UserLevelUserType
}
// UserLevelReader returns the permission level required for any route where
// users can read published content.
func UserLevelReader(cfg *config.Config) UserLevel {
if cfg.App.Private {
return UserLevelUserType
}
return UserLevelOptionalType
}
type (
handlerFunc func(app *App, w http.ResponseWriter, r *http.Request) error
gopherFunc func(app *App, w gopher.ResponseWriter, r *gopher.Request) error
userHandlerFunc func(app *App, u *User, w http.ResponseWriter, r *http.Request) error
userApperHandlerFunc func(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error
dataHandlerFunc func(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error)
authFunc func(app *App, r *http.Request) (*User, error)
UserLevelFunc func(cfg *config.Config) UserLevel
)
type Handler struct {
errors *ErrorPages
sessionStore sessions.Store
app Apper
}
// ErrorPages hold template HTML error pages for displaying errors to the user.
// In each, there should be a defined template named "base".
type ErrorPages struct {
NotFound *template.Template
Gone *template.Template
InternalServerError *template.Template
UnavailableError *template.Template
Blank *template.Template
}
// NewHandler returns a new Handler instance, using the given StaticPage data,
// and saving alias to the application's CookieStore.
func NewHandler(apper Apper) *Handler {
h := &Handler{
errors: &ErrorPages{
NotFound: template.Must(template.New("").Parse("{{define \"base\"}}404 Not found.
{{end}}")),
Gone: template.Must(template.New("").Parse("{{define \"base\"}}410 Gone.
{{end}}")),
InternalServerError: template.Must(template.New("").Parse("{{define \"base\"}}500 Internal server error.
{{end}}")),
UnavailableError: template.Must(template.New("").Parse("{{define \"base\"}}503 Service is temporarily unavailable.
{{end}}")),
Blank: template.Must(template.New("").Parse("{{define \"base\"}}{{.Title}} {{.Content}}
{{end}}")),
},
sessionStore: apper.App().SessionStore(),
app: apper,
}
return h
}
// NewWFHandler returns a new Handler instance, using WriteFreely template files.
// You MUST call writefreely.InitTemplates() before this.
func NewWFHandler(apper Apper) *Handler {
h := NewHandler(apper)
h.SetErrorPages(&ErrorPages{
NotFound: pages["404-general.tmpl"],
Gone: pages["410.tmpl"],
InternalServerError: pages["500.tmpl"],
UnavailableError: pages["503.tmpl"],
Blank: pages["blank.tmpl"],
})
return h
}
// SetErrorPages sets the given set of ErrorPages as templates for any errors
// that come up.
func (h *Handler) SetErrorPages(e *ErrorPages) {
h.errors = e
}
// User handles requests made in the web application by the authenticated user.
// This provides user-friendly HTML pages and actions that work in the browser.
func (h *Handler) User(f userHandlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleHTTPError(w, r, func() error {
var status int
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s: %s", e, debug.Stack())
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = http.StatusInternalServerError
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
u := getUserSession(h.app.App(), r)
if u == nil {
err := ErrNotLoggedIn
status = err.Status
return err
}
err := f(h.app.App(), u, w, r)
if err == nil {
status = http.StatusOK
} else if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = http.StatusInternalServerError
}
return err
}())
}
}
// Admin handles requests on /admin routes
func (h *Handler) Admin(f userHandlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleHTTPError(w, r, func() error {
var status int
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s: %s", e, debug.Stack())
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = http.StatusInternalServerError
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
u := getUserSession(h.app.App(), r)
if u == nil || !u.IsAdmin() {
err := impart.HTTPError{http.StatusNotFound, ""}
status = err.Status
return err
}
err := f(h.app.App(), u, w, r)
if err == nil {
status = http.StatusOK
} else if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = http.StatusInternalServerError
}
return err
}())
}
}
// AdminApper handles requests on /admin routes that require an Apper.
func (h *Handler) AdminApper(f userApperHandlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleHTTPError(w, r, func() error {
var status int
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s: %s", e, debug.Stack())
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = http.StatusInternalServerError
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
u := getUserSession(h.app.App(), r)
if u == nil || !u.IsAdmin() {
err := impart.HTTPError{http.StatusNotFound, ""}
status = err.Status
return err
}
err := f(h.app, u, w, r)
if err == nil {
status = http.StatusOK
} else if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = http.StatusInternalServerError
}
return err
}())
}
}
func apiAuth(app *App, r *http.Request) (*User, error) {
// Authorize user from Authorization header
t := r.Header.Get("Authorization")
if t == "" {
return nil, ErrNoAccessToken
}
u := &User{ID: app.db.GetUserID(t)}
if u.ID == -1 {
return nil, ErrBadAccessToken
}
return u, nil
}
// optionaAPIAuth is used for endpoints that accept authenticated requests via
// Authorization header or cookie, unlike apiAuth. It returns a different err
// in the case where no Authorization header is present.
func optionalAPIAuth(app *App, r *http.Request) (*User, error) {
// Authorize user from Authorization header
t := r.Header.Get("Authorization")
if t == "" {
return nil, ErrNotLoggedIn
}
u := &User{ID: app.db.GetUserID(t)}
if u.ID == -1 {
return nil, ErrBadAccessToken
}
return u, nil
}
func webAuth(app *App, r *http.Request) (*User, error) {
u := getUserSession(app, r)
if u == nil {
return nil, ErrNotLoggedIn
}
return u, nil
}
// UserAPI handles requests made in the API by the authenticated user.
// This provides user-friendly HTML pages and actions that work in the browser.
func (h *Handler) UserAPI(f userHandlerFunc) http.HandlerFunc {
return h.UserAll(false, f, apiAuth)
}
// UserWebAPI handles endpoints that accept a user authorized either via the web (cookies) or an Authorization header.
func (h *Handler) UserWebAPI(f userHandlerFunc) http.HandlerFunc {
return h.UserAll(false, f, func(app *App, r *http.Request) (*User, error) {
// Authorize user via cookies
u := getUserSession(app, r)
if u != nil {
return u, nil
}
// Fall back to access token, since user isn't logged in via web
var err error
u, err = apiAuth(app, r)
if err != nil {
return nil, err
}
return u, nil
})
}
func (h *Handler) UserAll(web bool, f userHandlerFunc, a authFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
handleFunc := func() error {
var status int
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s: %s", e, debug.Stack())
impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
status = 500
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
u, err := a(h.app.App(), r)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
return err
}
err = f(h.app.App(), u, w, r)
if err == nil {
status = 200
} else if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
return err
}
if web {
h.handleHTTPError(w, r, handleFunc())
} else {
h.handleError(w, r, handleFunc())
}
}
}
func (h *Handler) RedirectOnErr(f handlerFunc, loc string) handlerFunc {
return func(app *App, w http.ResponseWriter, r *http.Request) error {
err := f(app, w, r)
if err != nil {
if ie, ok := err.(impart.HTTPError); ok {
// Override default redirect with returned error's, if it's a
// redirect error.
if ie.Status == http.StatusFound {
return ie
}
}
return impart.HTTPError{http.StatusFound, loc}
}
return nil
}
}
func (h *Handler) Page(n string) http.HandlerFunc {
return h.Web(func(app *App, w http.ResponseWriter, r *http.Request) error {
t, ok := pages[n]
if !ok {
return impart.HTTPError{http.StatusNotFound, "Page not found."}
}
sp := pageForReq(app, r)
err := t.ExecuteTemplate(w, "base", sp)
if err != nil {
log.Error("Unable to render page: %v", err)
}
return err
}, UserLevelOptional)
}
func (h *Handler) WebErrors(f handlerFunc, ul UserLevelFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
// TODO: factor out this logic shared with Web()
h.handleHTTPError(w, r, func() error {
var status int
start := time.Now()
defer func() {
if e := recover(); e != nil {
u := getUserSession(h.app.App(), r)
username := "None"
if u != nil {
username = u.Username
}
log.Error("User: %s\n\n%s: %s", username, e, debug.Stack())
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = 500
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
var session *sessions.Session
var err error
if ul(h.app.App().cfg) != UserLevelNoneType {
session, err = h.sessionStore.Get(r, cookieName)
if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) {
// Cookie is required, but we can ignore this error
log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err)
}
_, gotUser := session.Values[cookieUserVal].(*User)
if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser {
to := correctPageFromLoginAttempt(r)
log.Info("Handler: Required NO user, but got one. Redirecting to %s", to)
err := impart.HTTPError{http.StatusFound, to}
status = err.Status
return err
} else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser {
log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.")
err := ErrNotLoggedIn
status = err.Status
return err
}
}
// TODO: pass User object to function
err = f(h.app.App(), w, r)
if err == nil {
status = 200
} else if httpErr, ok := err.(impart.HTTPError); ok {
status = httpErr.Status
if status < 300 || status > 399 {
addSessionFlash(h.app.App(), w, r, httpErr.Message, session)
return impart.HTTPError{http.StatusFound, r.Referer()}
}
} else {
e := fmt.Sprintf("[Web handler] 500: %v", err)
if !strings.HasSuffix(e, "write: broken pipe") {
log.Error(e)
} else {
log.Error(e)
}
log.Info("Web handler internal error render")
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = 500
}
return err
}())
}
}
func (h *Handler) CollectionPostOrStatic(w http.ResponseWriter, r *http.Request) {
if strings.Contains(r.URL.Path, ".") && !isRaw(r) {
start := time.Now()
status := 200
defer func() {
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
// Serve static file
h.app.App().shttp.ServeHTTP(w, r)
return
}
h.Web(viewCollectionPost, UserLevelReader)(w, r)
}
// Web handles requests made in the web application. This provides user-
// friendly HTML pages and actions that work in the browser.
func (h *Handler) Web(f handlerFunc, ul UserLevelFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleHTTPError(w, r, func() error {
var status int
start := time.Now()
defer func() {
if e := recover(); e != nil {
u := getUserSession(h.app.App(), r)
username := "None"
if u != nil {
username = u.Username
}
log.Error("User: %s\n\n%s: %s", username, e, debug.Stack())
log.Info("Web deferred internal error render")
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = 500
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
if ul(h.app.App().cfg) != UserLevelNoneType {
session, err := h.sessionStore.Get(r, cookieName)
if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) {
// Cookie is required, but we can ignore this error
log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err)
}
_, gotUser := session.Values[cookieUserVal].(*User)
if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser {
to := correctPageFromLoginAttempt(r)
log.Info("Handler: Required NO user, but got one. Redirecting to %s", to)
err := impart.HTTPError{http.StatusFound, to}
status = err.Status
return err
} else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser {
log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.")
err := ErrNotLoggedIn
status = err.Status
return err
}
}
// TODO: pass User object to function
err := f(h.app.App(), w, r)
if err == nil {
status = 200
} else if httpErr, ok := err.(impart.HTTPError); ok {
status = httpErr.Status
} else {
e := fmt.Sprintf("[Web handler] 500: %v", err)
log.Error(e)
log.Info("Web internal error render")
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = 500
}
return err
}())
}
}
func (h *Handler) All(f handlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleError(w, r, func() error {
// TODO: return correct "success" status
status := 200
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s:\n%s", e, debug.Stack())
impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
status = 500
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
// TODO: do any needed authentication
err := f(h.app.App(), w, r)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
}
return err
}())
}
}
func (h *Handler) PlainTextAPI(f handlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleTextError(w, r, func() error {
// TODO: return correct "success" status
status := 200
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s:\n%s", e, debug.Stack())
status = http.StatusInternalServerError
w.WriteHeader(status)
fmt.Fprintf(w, "Something didn't work quite right. The robots have alerted the humans.")
}
log.Info(fmt.Sprintf("\"%s %s\" %d %s \"%s\" \"%s\"", r.Method, r.RequestURI, status, time.Since(start), r.UserAgent(), r.Host))
}()
err := f(h.app.App(), w, r)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = http.StatusInternalServerError
}
}
return err
}())
}
}
func (h *Handler) OAuth(f handlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleOAuthError(w, r, func() error {
// TODO: return correct "success" status
status := 200
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s:\n%s", e, debug.Stack())
impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
status = 500
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
err := f(h.app.App(), w, r)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
}
return err
}())
}
}
func (h *Handler) AllReader(f handlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleError(w, r, func() error {
status := 200
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s:\n%s", e, debug.Stack())
impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
status = 500
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
// Allow any origin, as public endpoints are handled in here
w.Header().Set("Access-Control-Allow-Origin", "*")
if h.app.App().cfg.App.Private {
// This instance is private, so ensure it's being accessed by a valid user
// Check if authenticated with an access token
_, apiErr := optionalAPIAuth(h.app.App(), r)
if apiErr != nil {
if err, ok := apiErr.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
if apiErr == ErrNotLoggedIn {
// Fall back to web auth since there was no access token given
_, err := webAuth(h.app.App(), r)
if err != nil {
if err, ok := apiErr.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
return err
}
} else {
return apiErr
}
}
}
err := f(h.app.App(), w, r)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
}
return err
}())
}
}
func (h *Handler) Download(f dataHandlerFunc, ul UserLevelFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleHTTPError(w, r, func() error {
var status int
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("%s: %s", e, debug.Stack())
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = 500
}
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
data, filename, err := f(h.app.App(), w, r)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
return err
}
ext := ".json"
ct := "application/json"
if strings.HasSuffix(r.URL.Path, ".csv") {
ext = ".csv"
ct = "text/csv"
} else if strings.HasSuffix(r.URL.Path, ".zip") {
ext = ".zip"
ct = "application/zip"
}
w.Header().Set("Content-Disposition", fmt.Sprintf("attachment; filename=%s%s", filename, ext))
w.Header().Set("Content-Type", ct)
w.Header().Set("Content-Length", strconv.Itoa(len(data)))
fmt.Fprint(w, string(data))
status = 200
return nil
}())
}
}
func (h *Handler) Redirect(url string, ul UserLevelFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleHTTPError(w, r, func() error {
start := time.Now()
var status int
if ul(h.app.App().cfg) != UserLevelNoneType {
session, err := h.sessionStore.Get(r, cookieName)
if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) {
// Cookie is required, but we can ignore this error
log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err)
}
_, gotUser := session.Values[cookieUserVal].(*User)
if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser {
to := correctPageFromLoginAttempt(r)
log.Info("Handler: Required NO user, but got one. Redirecting to %s", to)
err := impart.HTTPError{http.StatusFound, to}
status = err.Status
return err
} else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser {
log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.")
err := ErrNotLoggedIn
status = err.Status
return err
}
}
status = sendRedirect(w, http.StatusFound, url)
log.Info(h.app.ReqLog(r, status, time.Since(start)))
return nil
}())
}
}
func (h *Handler) handleHTTPError(w http.ResponseWriter, r *http.Request, err error) {
if err == nil {
return
}
if err, ok := err.(impart.HTTPError); ok {
if err.Status >= 300 && err.Status < 400 {
sendRedirect(w, err.Status, err.Message)
return
} else if err.Status == http.StatusUnauthorized {
q := ""
if r.URL.RawQuery != "" {
q = url.QueryEscape("?" + r.URL.RawQuery)
}
sendRedirect(w, http.StatusFound, "/login?to="+r.URL.Path+q)
return
} else if err.Status == http.StatusGone {
w.WriteHeader(err.Status)
p := &struct {
page.StaticPage
Content *template.HTML
}{
StaticPage: pageForReq(h.app.App(), r),
}
if err.Message != "" {
co := template.HTML(err.Message)
p.Content = &co
}
h.errors.Gone.ExecuteTemplate(w, "base", p)
return
} else if err.Status == http.StatusNotFound {
w.WriteHeader(err.Status)
if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
// This is a fediverse request; simply return the header
return
}
h.errors.NotFound.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
return
} else if err.Status == http.StatusInternalServerError {
w.WriteHeader(err.Status)
log.Info("handleHTTPErorr internal error render")
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
return
} else if err.Status == http.StatusServiceUnavailable {
w.WriteHeader(err.Status)
h.errors.UnavailableError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
return
} else if err.Status == http.StatusAccepted {
impart.WriteSuccess(w, "", err.Status)
return
} else {
p := &struct {
page.StaticPage
Title string
Content template.HTML
}{
pageForReq(h.app.App(), r),
fmt.Sprintf("Uh oh (%d)", err.Status),
template.HTML(fmt.Sprintf("%s
", err.Message)),
}
h.errors.Blank.ExecuteTemplate(w, "base", p)
return
}
impart.WriteError(w, err)
return
}
impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."})
}
func (h *Handler) handleError(w http.ResponseWriter, r *http.Request, err error) {
if err == nil {
return
}
if err, ok := err.(impart.HTTPError); ok {
if err.Status >= 300 && err.Status < 400 {
sendRedirect(w, err.Status, err.Message)
return
}
// if strings.Contains(r.Header.Get("Accept"), "text/html") {
impart.WriteError(w, err)
// }
return
}
if IsJSON(r) {
impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."})
return
}
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
}
func (h *Handler) handleTextError(w http.ResponseWriter, r *http.Request, err error) {
if err == nil {
return
}
if err, ok := err.(impart.HTTPError); ok {
if err.Status >= 300 && err.Status < 400 {
sendRedirect(w, err.Status, err.Message)
return
}
w.WriteHeader(err.Status)
fmt.Fprintf(w, http.StatusText(err.Status))
return
}
w.WriteHeader(http.StatusInternalServerError)
fmt.Fprintf(w, "This is an unhelpful error message for a miscellaneous internal error.")
}
func (h *Handler) handleOAuthError(w http.ResponseWriter, r *http.Request, err error) {
if err == nil {
return
}
if err, ok := err.(impart.HTTPError); ok {
if err.Status >= 300 && err.Status < 400 {
sendRedirect(w, err.Status, err.Message)
return
}
impart.WriteOAuthError(w, err)
return
}
impart.WriteOAuthError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."})
return
}
func correctPageFromLoginAttempt(r *http.Request) string {
to := r.FormValue("to")
if to == "" {
to = "/"
} else if !strings.HasPrefix(to, "/") {
to = "/" + to
}
return to
}
func (h *Handler) LogHandlerFunc(f http.HandlerFunc) http.HandlerFunc {
return func(w http.ResponseWriter, r *http.Request) {
h.handleHTTPError(w, r, func() error {
status := 200
start := time.Now()
defer func() {
if e := recover(); e != nil {
log.Error("Handler.LogHandlerFunc\n\n%s: %s", e, debug.Stack())
h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
status = 500
}
// TODO: log actual status code returned
log.Info(h.app.ReqLog(r, status, time.Since(start)))
}()
if h.app.App().cfg.App.Private {
// This instance is private, so ensure it's being accessed by a valid user
// Check if authenticated with an access token
_, apiErr := optionalAPIAuth(h.app.App(), r)
if apiErr != nil {
if err, ok := apiErr.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
if apiErr == ErrNotLoggedIn {
// Fall back to web auth since there was no access token given
_, err := webAuth(h.app.App(), r)
if err != nil {
if err, ok := apiErr.(impart.HTTPError); ok {
status = err.Status
} else {
status = 500
}
return err
}
} else {
return apiErr
}
}
}
f(w, r)
return nil
}())
}
}
func (h *Handler) Gopher(f gopherFunc) gopher.HandlerFunc {
return func(w gopher.ResponseWriter, r *gopher.Request) {
defer func() {
if e := recover(); e != nil {
log.Error("%s: %s", e, debug.Stack())
w.WriteError("An internal error occurred")
}
log.Info("gopher: %s", r.Selector)
}()
err := f(h.app.App(), w, r)
if err != nil {
log.Error("failed: %s", err)
w.WriteError("the page failed for some reason (see logs)")
}
}
}
func sendRedirect(w http.ResponseWriter, code int, location string) int {
w.Header().Set("Location", location)
w.WriteHeader(code)
return code
}
func cacheControl(next http.Handler) http.Handler {
return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
w.Header().Set("Cache-Control", "public, max-age=604800, immutable")
next.ServeHTTP(w, r)
})
}
diff --git a/hostmeta.go b/hostmeta.go
index 4f452c3..9152bec 100644
--- a/hostmeta.go
+++ b/hostmeta.go
@@ -1,29 +1,29 @@
/*
- * Copyright © 2018-2019 A Bunch Tell LLC.
+ * Copyright © 2018-2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"fmt"
"net/http"
)
func handleViewHostMeta(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
w.Header().Set("Content-Type", "application/xrd+xml; charset=utf-8")
meta := `
`
fmt.Fprintf(w, meta)
return nil
}
diff --git a/instance.go b/instance.go
index 6805a6e..bc6e063 100644
--- a/instance.go
+++ b/instance.go
@@ -1,16 +1,16 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
type InstanceStats struct {
NumPosts int64
NumBlogs int64
}
diff --git a/invites.go b/invites.go
index 4024634..7118375 100644
--- a/invites.go
+++ b/invites.go
@@ -1,203 +1,203 @@
/*
- * Copyright © 2019-2021 A Bunch Tell LLC.
+ * Copyright © 2019-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"html/template"
"net/http"
"strconv"
"time"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/id"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/page"
)
type Invite struct {
ID string
MaxUses sql.NullInt64
Created time.Time
Expires *time.Time
Inactive bool
uses int64
}
func (i Invite) Uses() int64 {
return i.uses
}
func (i Invite) Expired() bool {
return i.Expires != nil && i.Expires.Before(time.Now())
}
func (i Invite) Active(db *datastore) bool {
if i.Expired() {
return false
}
if i.MaxUses.Valid && i.MaxUses.Int64 > 0 {
if c := db.GetUsersInvitedCount(i.ID); c >= i.MaxUses.Int64 {
return false
}
}
return true
}
func (i Invite) ExpiresFriendly() string {
return i.Expires.Format("January 2, 2006, 3:04 PM")
}
func handleViewUserInvites(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
// Don't show page if instance doesn't allow it
if !(app.cfg.App.UserInvites != "" && (u.IsAdmin() || app.cfg.App.UserInvites != "admin")) {
return impart.HTTPError{http.StatusNotFound, ""}
}
f, _ := getSessionFlashes(app, w, r, nil)
p := struct {
*UserPage
Invites *[]Invite
Silenced bool
}{
UserPage: NewUserPage(app, r, u, "Invite People", f),
}
var err error
p.Silenced, err = app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view invites: %v", err)
}
p.Invites, err = app.db.GetUserInvites(u.ID)
if err != nil {
return err
}
for i := range *p.Invites {
(*p.Invites)[i].uses = app.db.GetUsersInvitedCount((*p.Invites)[i].ID)
}
showUserPage(w, "invite", p)
return nil
}
func handleCreateUserInvite(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
muVal := r.FormValue("uses")
expVal := r.FormValue("expires")
if u.IsSilenced() {
return ErrUserSilenced
}
var err error
var maxUses int
if muVal != "0" {
maxUses, err = strconv.Atoi(muVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'max_uses'"}
}
}
var expDate *time.Time
var expires int
if expVal != "0" {
expires, err = strconv.Atoi(expVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'expires'"}
}
ed := time.Now().Add(time.Duration(expires) * time.Minute)
expDate = &ed
}
inviteID := id.GenerateRandomString("0123456789BCDFGHJKLMNPQRSTVWXYZbcdfghjklmnpqrstvwxyz", 6)
err = app.db.CreateUserInvite(inviteID, u.ID, maxUses, expDate)
if err != nil {
return err
}
return impart.HTTPError{http.StatusFound, "/me/invites"}
}
func handleViewInvite(app *App, w http.ResponseWriter, r *http.Request) error {
inviteCode := mux.Vars(r)["code"]
i, err := app.db.GetUserInvite(inviteCode)
if err != nil {
return err
}
expired := i.Expired()
if !expired && i.MaxUses.Valid && i.MaxUses.Int64 > 0 {
// Invite has a max-use number, so check if we're past that limit
i.uses = app.db.GetUsersInvitedCount(inviteCode)
expired = i.uses >= i.MaxUses.Int64
}
if u := getUserSession(app, r); u != nil {
// check if invite belongs to another user
// error can be ignored as not important in this case
if ownInvite, _ := app.db.IsUsersInvite(inviteCode, u.ID); !ownInvite {
addSessionFlash(app, w, r, "You're already registered and logged in.", nil)
// show homepage
return impart.HTTPError{http.StatusFound, "/me/settings"}
}
// show invite instructions
p := struct {
*UserPage
Invite *Invite
Expired bool
}{
UserPage: NewUserPage(app, r, u, "Invite to "+app.cfg.App.SiteName, nil),
Invite: i,
Expired: expired,
}
showUserPage(w, "invite-help", p)
return nil
}
p := struct {
page.StaticPage
*OAuthButtons
Error string
Flashes []template.HTML
Invite string
}{
StaticPage: pageForReq(app, r),
OAuthButtons: NewOAuthButtons(app.cfg),
Invite: inviteCode,
}
if expired {
p.Error = "This invite link has expired."
}
// Tell search engines not to index invite links
w.Header().Set("X-Robots-Tag", "noindex")
// Get error messages
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session in handleViewInvite; ignoring: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
// Show landing page
return renderPage(w, "signup.tmpl", p)
}
diff --git a/key/key.go b/key/key.go
index 25490ca..1fa5625 100644
--- a/key/key.go
+++ b/key/key.go
@@ -1,69 +1,69 @@
/*
- * Copyright © 2019, 2021 A Bunch Tell LLC.
+ * Copyright © 2019, 2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// Package key holds application keys and utilities around generating them.
package key
import (
"crypto/rand"
)
const (
EncKeysBytes = 32
)
type Keychain struct {
EmailKey, CookieAuthKey, CookieKey, CSRFKey []byte
}
// GenerateKeys generates necessary keys for the app on the given Keychain,
// skipping any that already exist.
func (keys *Keychain) GenerateKeys() error {
// Generate keys only if they don't already exist
// TODO: use something like https://github.com/hashicorp/go-multierror to return errors
var err, keyErrs error
if len(keys.EmailKey) == 0 {
keys.EmailKey, err = GenerateBytes(EncKeysBytes)
if err != nil {
keyErrs = err
}
}
if len(keys.CookieAuthKey) == 0 {
keys.CookieAuthKey, err = GenerateBytes(EncKeysBytes)
if err != nil {
keyErrs = err
}
}
if len(keys.CookieKey) == 0 {
keys.CookieKey, err = GenerateBytes(EncKeysBytes)
if err != nil {
keyErrs = err
}
}
if len(keys.CSRFKey) == 0 {
keys.CSRFKey, err = GenerateBytes(EncKeysBytes)
if err != nil {
keyErrs = err
}
}
return keyErrs
}
// GenerateBytes returns securely generated random bytes.
func GenerateBytes(n int) ([]byte, error) {
b := make([]byte, n)
_, err := rand.Read(b)
if err != nil {
return nil, err
}
return b, nil
}
diff --git a/keys.go b/keys.go
index 1b43d0b..98ff13f 100644
--- a/keys.go
+++ b/keys.go
@@ -1,75 +1,75 @@
/*
- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/key"
"io/ioutil"
"os"
"path/filepath"
)
const (
keysDir = "keys"
)
var (
emailKeyPath = filepath.Join(keysDir, "email.aes256")
cookieAuthKeyPath = filepath.Join(keysDir, "cookies_auth.aes256")
cookieKeyPath = filepath.Join(keysDir, "cookies_enc.aes256")
csrfKeyPath = filepath.Join(keysDir, "csrf.aes256")
)
// InitKeys loads encryption keys into memory via the given Apper interface
func InitKeys(apper Apper) error {
log.Info("Loading encryption keys...")
err := apper.LoadKeys()
if err != nil {
return err
}
return nil
}
func initKeyPaths(app *App) {
emailKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, emailKeyPath)
cookieAuthKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, cookieAuthKeyPath)
cookieKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, cookieKeyPath)
csrfKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, csrfKeyPath)
}
// generateKey generates a key at the given path used for the encryption of
// certain user data. Because user data becomes unrecoverable without these
// keys, this won't overwrite any existing key, and instead outputs a message.
func generateKey(path string) error {
// Check if key file exists
if _, err := os.Stat(path); err == nil {
log.Info("%s already exists. rm the file if you understand the consquences.", path)
return nil
} else if !os.IsNotExist(err) {
log.Error("%s", err)
return err
}
log.Info("Generating %s.", path)
b, err := key.GenerateBytes(key.EncKeysBytes)
if err != nil {
log.Error("FAILED. %s. Run writefreely --gen-keys again.", err)
return err
}
err = ioutil.WriteFile(path, b, 0600)
if err != nil {
log.Error("FAILED writing file: %s", err)
return err
}
log.Info("Success.")
return nil
}
diff --git a/less/login.less b/less/login.less
index fefeb12..df6f246 100644
--- a/less/login.less
+++ b/less/login.less
@@ -1,91 +1,91 @@
/*
- * Copyright © 2020 A Bunch Tell LLC.
+ * Copyright © 2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
.row.signinbtns {
justify-content: center;
font-size: 1em;
margin-top: 2em;
margin-bottom: 1em;
flex-wrap: wrap;
.loginbtn {
height: 40px;
margin: 0.5em;
&.btn {
box-sizing: border-box;
font-size: 17px;
white-space: nowrap;
img {
height: 1.5em;
vertical-align: middle;
}
}
writeas-login, slack-login {
img {
margin-top: -0.2em;
}
}
gitlab-login {
background-color: #fc6d26;
border-color: #fc6d26;
&:hover {
background-color: darken(#fc6d26, 5%);
border-color: darken(#fc6d26, 5%);
}
}
gitea-login {
background-color: #2ecc71;
border-color: #2ecc71;
&:hover {
background-color: #2cc26b;
border-color: #2cc26b;
}
}
slack-login, gitlab-login, gitea-login, generic-oauth-login {
font-size: 0.86em;
font-family: @sansFont;
}
slack-login, generic-oauth-login {
color: @lightTextColor;
background-color: @lightNavBG;
border-color: @lightNavBorder;
&:hover {
background-color: @lightNavHoverBG;
}
}
}
}
.or {
text-align: center;
margin-bottom: 3.5em;
p {
display: inline-block;
background-color: white;
padding: 0 1em;
}
hr {
margin-top: -1.6em;
margin-bottom: 0;
}
hr.short {
max-width: 30rem;
}
}
\ No newline at end of file
diff --git a/migrations/drivers.go b/migrations/drivers.go
index 1399411..967ee97 100644
--- a/migrations/drivers.go
+++ b/migrations/drivers.go
@@ -1,87 +1,87 @@
/*
- * Copyright © 2019 A Bunch Tell LLC.
+ * Copyright © 2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
import (
"fmt"
)
// TODO: use now() from writefreely pkg
func (db *datastore) now() string {
if db.driverName == driverSQLite {
return "strftime('%Y-%m-%d %H:%M:%S','now')"
}
return "NOW()"
}
func (db *datastore) typeInt() string {
if db.driverName == driverSQLite {
return "INTEGER"
}
return "INT"
}
func (db *datastore) typeSmallInt() string {
if db.driverName == driverSQLite {
return "INTEGER"
}
return "SMALLINT"
}
func (db *datastore) typeText() string {
return "TEXT"
}
func (db *datastore) typeChar(l int) string {
if db.driverName == driverSQLite {
return "TEXT"
}
return fmt.Sprintf("CHAR(%d)", l)
}
func (db *datastore) typeVarChar(l int) string {
if db.driverName == driverSQLite {
return "TEXT"
}
return fmt.Sprintf("VARCHAR(%d)", l)
}
func (db *datastore) typeBool() string {
if db.driverName == driverSQLite {
return "INTEGER"
}
return "TINYINT(1)"
}
func (db *datastore) typeDateTime() string {
return "DATETIME"
}
func (db *datastore) collateMultiByte() string {
if db.driverName == driverSQLite {
return ""
}
return " COLLATE utf8_bin"
}
func (db *datastore) engine() string {
if db.driverName == driverSQLite {
return ""
}
return " ENGINE = InnoDB"
}
func (db *datastore) after(colName string) string {
if db.driverName == driverSQLite {
return ""
}
return " AFTER " + colName
}
diff --git a/migrations/migrations.go b/migrations/migrations.go
index b3ebcc0..310590b 100644
--- a/migrations/migrations.go
+++ b/migrations/migrations.go
@@ -1,145 +1,145 @@
/*
- * Copyright © 2019 A Bunch Tell LLC.
+ * Copyright © 2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// Package migrations contains database migrations for WriteFreely
package migrations
import (
"database/sql"
"github.com/writeas/web-core/log"
)
// TODO: refactor to use the datastore struct from writefreely pkg
type datastore struct {
*sql.DB
driverName string
}
func NewDatastore(db *sql.DB, dn string) *datastore {
return &datastore{db, dn}
}
// TODO: use these consts from writefreely pkg
const (
driverMySQL = "mysql"
driverSQLite = "sqlite3"
)
type Migration interface {
Description() string
Migrate(db *datastore) error
}
type migration struct {
description string
migrate func(db *datastore) error
}
func New(d string, fn func(db *datastore) error) Migration {
return &migration{d, fn}
}
func (m *migration) Description() string {
return m.description
}
func (m *migration) Migrate(db *datastore) error {
return m.migrate(db)
}
var migrations = []Migration{
New("support user invites", supportUserInvites), // -> V1 (v0.8.0)
New("support dynamic instance pages", supportInstancePages), // V1 -> V2 (v0.9.0)
New("support users suspension", supportUserStatus), // V2 -> V3 (v0.11.0)
New("support oauth", oauth), // V3 -> V4
New("support slack oauth", oauthSlack), // V4 -> v5
New("support ActivityPub mentions", supportActivityPubMentions), // V5 -> V6
New("support oauth attach", oauthAttach), // V6 -> V7
New("support oauth via invite", oauthInvites), // V7 -> V8 (v0.12.0)
New("optimize drafts retrieval", optimizeDrafts), // V8 -> V9
New("support post signatures", supportPostSignatures), // V9 -> V10
}
// CurrentVer returns the current migration version the application is on
func CurrentVer() int {
return len(migrations)
}
func SetInitialMigrations(db *datastore) error {
// Included schema files represent changes up to V1, so note that in the database
_, err := db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", 1, "")
if err != nil {
return err
}
return nil
}
func Migrate(db *datastore) error {
var version int
var err error
if db.tableExists("appmigrations") {
err = db.QueryRow("SELECT MAX(version) FROM appmigrations").Scan(&version)
if err != nil {
return err
}
} else {
log.Info("Initializing appmigrations table...")
version = 0
_, err = db.Exec(`CREATE TABLE appmigrations (
version ` + db.typeInt() + ` NOT NULL,
migrated ` + db.typeDateTime() + ` NOT NULL,
result ` + db.typeText() + ` NOT NULL
) ` + db.engine() + `;`)
if err != nil {
return err
}
}
if len(migrations[version:]) > 0 {
for i, m := range migrations[version:] {
curVer := version + i + 1
log.Info("Migrating to V%d: %s", curVer, m.Description())
err = m.Migrate(db)
if err != nil {
return err
}
// Update migrations table
_, err = db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", curVer, "")
if err != nil {
return err
}
}
} else {
log.Info("Database up-to-date. No migrations to run.")
}
return nil
}
func (db *datastore) tableExists(t string) bool {
var dummy string
var err error
if db.driverName == driverSQLite {
err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = ?", t).Scan(&dummy)
} else {
err = db.QueryRow("SHOW TABLES LIKE '" + t + "'").Scan(&dummy)
}
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SHOW TABLES: %v", err)
return false
}
return true
}
diff --git a/migrations/v1.go b/migrations/v1.go
index ef3a579..dcc956d 100644
--- a/migrations/v1.go
+++ b/migrations/v1.go
@@ -1,49 +1,49 @@
/*
- * Copyright © 2019 A Bunch Tell LLC.
+ * Copyright © 2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
func supportUserInvites(db *datastore) error {
t, err := db.Begin()
if err != nil {
return err
}
_, err = t.Exec(`CREATE TABLE userinvites (
id ` + db.typeChar(6) + ` NOT NULL ,
owner_id ` + db.typeInt() + ` NOT NULL ,
max_uses ` + db.typeSmallInt() + ` NULL ,
created ` + db.typeDateTime() + ` NOT NULL ,
expires ` + db.typeDateTime() + ` NULL ,
inactive ` + db.typeBool() + ` NOT NULL ,
PRIMARY KEY (id)
) ` + db.engine() + `;`)
if err != nil {
t.Rollback()
return err
}
_, err = t.Exec(`CREATE TABLE usersinvited (
invite_id ` + db.typeChar(6) + ` NOT NULL ,
user_id ` + db.typeInt() + ` NOT NULL ,
PRIMARY KEY (invite_id, user_id)
) ` + db.engine() + `;`)
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
diff --git a/migrations/v10.go b/migrations/v10.go
index 9c84a01..25a4a28 100644
--- a/migrations/v10.go
+++ b/migrations/v10.go
@@ -1,33 +1,33 @@
/*
- * Copyright © 2020 A Bunch Tell LLC.
+ * Copyright © 2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
func supportPostSignatures(db *datastore) error {
t, err := db.Begin()
if err != nil {
t.Rollback()
return err
}
_, err = t.Exec(`ALTER TABLE collections ADD COLUMN post_signature ` + db.typeText() + db.collateMultiByte() + ` NULL` + db.after("script"))
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
diff --git a/migrations/v2.go b/migrations/v2.go
index d282ec7..fb742b5 100644
--- a/migrations/v2.go
+++ b/migrations/v2.go
@@ -1,38 +1,38 @@
/*
- * Copyright © 2019 A Bunch Tell LLC.
+ * Copyright © 2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
func supportInstancePages(db *datastore) error {
t, err := db.Begin()
if err != nil {
return err
}
_, err = t.Exec(`ALTER TABLE appcontent ADD COLUMN title ` + db.typeVarChar(255) + db.collateMultiByte() + ` NULL`)
if err != nil {
t.Rollback()
return err
}
_, err = t.Exec(`ALTER TABLE appcontent ADD COLUMN content_type ` + db.typeVarChar(36) + ` DEFAULT 'page' NOT NULL`)
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
diff --git a/migrations/v3.go b/migrations/v3.go
index e36b9d0..6236ae3 100644
--- a/migrations/v3.go
+++ b/migrations/v3.go
@@ -1,32 +1,32 @@
/*
- * Copyright © 2019 A Bunch Tell LLC.
+ * Copyright © 2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
func supportUserStatus(db *datastore) error {
t, err := db.Begin()
if err != nil {
return err
}
_, err = t.Exec(`ALTER TABLE users ADD COLUMN status ` + db.typeInt() + ` DEFAULT '0' NOT NULL`)
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
diff --git a/migrations/v4.go b/migrations/v4.go
index c69dce1..4ae267d 100644
--- a/migrations/v4.go
+++ b/migrations/v4.go
@@ -1,54 +1,54 @@
/*
- * Copyright © 2019-2021 A Bunch Tell LLC.
+ * Copyright © 2019-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
import (
"context"
"database/sql"
wf_db "github.com/writefreely/writefreely/db"
)
func oauth(db *datastore) error {
dialect := wf_db.DialectMySQL
if db.driverName == driverSQLite {
dialect = wf_db.DialectSQLite
}
return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
createTableUsersOauth, err := dialect.
Table("oauth_users").
SetIfNotExists(false).
Column(dialect.Column("user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)).
Column(dialect.Column("remote_user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)).
ToSQL()
if err != nil {
return err
}
createTableOauthClientState, err := dialect.
Table("oauth_client_states").
SetIfNotExists(false).
Column(dialect.Column("state", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 255})).
Column(dialect.Column("used", wf_db.ColumnTypeBool, wf_db.UnsetSize)).
Column(dialect.Column("created_at", wf_db.ColumnTypeDateTime, wf_db.UnsetSize).SetDefaultCurrentTimestamp()).
UniqueConstraint("state").
ToSQL()
if err != nil {
return err
}
for _, table := range []string{createTableUsersOauth, createTableOauthClientState} {
if _, err := tx.ExecContext(ctx, table); err != nil {
return err
}
}
return nil
})
}
diff --git a/migrations/v5.go b/migrations/v5.go
index 1fe3e30..db18fa1 100644
--- a/migrations/v5.go
+++ b/migrations/v5.go
@@ -1,88 +1,88 @@
/*
- * Copyright © 2019-2021 A Bunch Tell LLC.
+ * Copyright © 2019-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
import (
"context"
"database/sql"
wf_db "github.com/writefreely/writefreely/db"
)
func oauthSlack(db *datastore) error {
dialect := wf_db.DialectMySQL
if db.driverName == driverSQLite {
dialect = wf_db.DialectSQLite
}
return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
builders := []wf_db.SQLBuilder{
dialect.
AlterTable("oauth_client_states").
AddColumn(dialect.
Column(
"provider",
wf_db.ColumnTypeVarChar,
wf_db.OptionalInt{Set: true, Value: 24}).SetDefault("")),
dialect.
AlterTable("oauth_client_states").
AddColumn(dialect.
Column(
"client_id",
wf_db.ColumnTypeVarChar,
wf_db.OptionalInt{Set: true, Value: 128}).SetDefault("")),
dialect.
AlterTable("oauth_users").
AddColumn(dialect.
Column(
"provider",
wf_db.ColumnTypeVarChar,
wf_db.OptionalInt{Set: true, Value: 24}).SetDefault("")),
dialect.
AlterTable("oauth_users").
AddColumn(dialect.
Column(
"client_id",
wf_db.ColumnTypeVarChar,
wf_db.OptionalInt{Set: true, Value: 128}).SetDefault("")),
dialect.
AlterTable("oauth_users").
AddColumn(dialect.
Column(
"access_token",
wf_db.ColumnTypeVarChar,
wf_db.OptionalInt{Set: true, Value: 512}).SetDefault("")),
dialect.CreateUniqueIndex("oauth_users_uk", "oauth_users", "user_id", "provider", "client_id"),
}
if dialect != wf_db.DialectSQLite {
// This updates the length of the `remote_user_id` column. It isn't needed for SQLite databases.
builders = append(builders, dialect.
AlterTable("oauth_users").
ChangeColumn("remote_user_id",
dialect.
Column(
"remote_user_id",
wf_db.ColumnTypeVarChar,
wf_db.OptionalInt{Set: true, Value: 128})))
}
for _, builder := range builders {
query, err := builder.ToSQL()
if err != nil {
return err
}
if _, err := tx.ExecContext(ctx, query); err != nil {
return err
}
}
return nil
})
}
diff --git a/migrations/v6.go b/migrations/v6.go
index 074f446..885d445 100644
--- a/migrations/v6.go
+++ b/migrations/v6.go
@@ -1,32 +1,32 @@
/*
- * Copyright © 2019-2020 A Bunch Tell LLC.
+ * Copyright © 2019-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
func supportActivityPubMentions(db *datastore) error {
t, err := db.Begin()
if err != nil {
return err
}
_, err = t.Exec(`ALTER TABLE remoteusers ADD COLUMN handle ` + db.typeVarChar(255) + ` NULL`)
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
diff --git a/migrations/v7.go b/migrations/v7.go
index 5737b21..2056aa0 100644
--- a/migrations/v7.go
+++ b/migrations/v7.go
@@ -1,46 +1,46 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
import (
"context"
"database/sql"
wf_db "github.com/writefreely/writefreely/db"
)
func oauthAttach(db *datastore) error {
dialect := wf_db.DialectMySQL
if db.driverName == driverSQLite {
dialect = wf_db.DialectSQLite
}
return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
builders := []wf_db.SQLBuilder{
dialect.
AlterTable("oauth_client_states").
AddColumn(dialect.
Column(
"attach_user_id",
wf_db.ColumnTypeInteger,
wf_db.OptionalInt{Set: true, Value: 24}).SetNullable(true)),
}
for _, builder := range builders {
query, err := builder.ToSQL()
if err != nil {
return err
}
if _, err := tx.ExecContext(ctx, query); err != nil {
return err
}
}
return nil
})
}
diff --git a/migrations/v8.go b/migrations/v8.go
index 28af523..36001af 100644
--- a/migrations/v8.go
+++ b/migrations/v8.go
@@ -1,45 +1,45 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
import (
"context"
"database/sql"
wf_db "github.com/writefreely/writefreely/db"
)
func oauthInvites(db *datastore) error {
dialect := wf_db.DialectMySQL
if db.driverName == driverSQLite {
dialect = wf_db.DialectSQLite
}
return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
builders := []wf_db.SQLBuilder{
dialect.
AlterTable("oauth_client_states").
AddColumn(dialect.Column("invite_code", wf_db.ColumnTypeChar, wf_db.OptionalInt{
Set: true,
Value: 6,
}).SetNullable(true)),
}
for _, builder := range builders {
query, err := builder.ToSQL()
if err != nil {
return err
}
if _, err := tx.ExecContext(ctx, query); err != nil {
return err
}
}
return nil
})
}
diff --git a/migrations/v9.go b/migrations/v9.go
index c6b832e..f542189 100644
--- a/migrations/v9.go
+++ b/migrations/v9.go
@@ -1,37 +1,37 @@
/*
- * Copyright © 2020 A Bunch Tell LLC.
+ * Copyright © 2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package migrations
func optimizeDrafts(db *datastore) error {
t, err := db.Begin()
if err != nil {
t.Rollback()
return err
}
if db.driverName == driverSQLite {
_, err = t.Exec(`CREATE INDEX key_owner_post_id ON posts (owner_id, id)`)
} else {
_, err = t.Exec(`ALTER TABLE posts ADD INDEX(owner_id, id)`)
}
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
diff --git a/monetization.go b/monetization.go
index 92375c2..3bb4fcf 100644
--- a/monetization.go
+++ b/monetization.go
@@ -1,160 +1,160 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"bytes"
"fmt"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"io/ioutil"
"net/http"
"net/url"
"os"
"strings"
)
func displayMonetization(monetization, alias string) string {
if monetization == "" {
return ""
}
ptrURL, err := url.Parse(strings.Replace(monetization, "$", "https://", 1))
if err == nil {
if strings.HasSuffix(ptrURL.Host, ".xrptipbot.com") {
// xrp tip bot doesn't support stream receipts, so return plain pointer
return monetization
}
}
u := os.Getenv("PAYMENT_HOST")
if u == "" {
return "$webmonetization.org/api/receipts/" + url.PathEscape(monetization)
}
u += "/" + alias
return u
}
func handleSPSPEndpoint(app *App, w http.ResponseWriter, r *http.Request) error {
idStr := r.FormValue("id")
id, err := url.QueryUnescape(idStr)
if err != nil {
log.Error("Unable to unescape: %s", err)
return err
}
var c *Collection
if strings.IndexRune(id, '.') > 0 && app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(id)
}
if err != nil {
return err
}
pointer := c.Monetization
if pointer == "" {
err := impart.HTTPError{http.StatusNotFound, "No monetization pointer."}
return err
}
fmt.Fprintf(w, pointer)
return nil
}
func handleGetSplitContent(app *App, w http.ResponseWriter, r *http.Request) error {
var collID int64
var collLookupID string
var coll *Collection
var err error
vars := mux.Vars(r)
if collAlias := vars["alias"]; collAlias != "" {
// Fetch collection information, since an alias is provided
coll, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
collID = coll.ID
collLookupID = coll.Alias
}
p, err := app.db.GetPost(vars["post"], collID)
if err != nil {
return err
}
receipt := r.FormValue("receipt")
if receipt == "" {
return impart.HTTPError{http.StatusBadRequest, "No `receipt` given."}
}
err = verifyReceipt(receipt, collLookupID)
if err != nil {
return err
}
d := struct {
Content string `json:"body"`
HTMLContent string `json:"html_body"`
}{}
if exc := strings.Index(p.Content, shortCodePaid); exc > -1 {
baseURL := ""
if coll != nil {
baseURL = coll.CanonicalURL()
}
d.Content = p.Content[exc+len(shortCodePaid):]
d.HTMLContent = applyMarkdown([]byte(d.Content), baseURL, app.cfg)
}
return impart.WriteSuccess(w, d, http.StatusOK)
}
func verifyReceipt(receipt, id string) error {
receiptsHost := os.Getenv("RECEIPTS_HOST")
if receiptsHost == "" {
receiptsHost = "https://webmonetization.org/api/receipts/verify?id=" + id
} else {
receiptsHost = fmt.Sprintf("%s/receipts?id=%s", receiptsHost, id)
}
log.Info("Verifying receipt %s at %s", receipt, receiptsHost)
r, err := http.NewRequest("POST", receiptsHost, bytes.NewBufferString(receipt))
if err != nil {
log.Error("Unable to create new request to %s: %s", receiptsHost, err)
return err
}
resp, err := http.DefaultClient.Do(r)
if err != nil {
log.Error("Unable to Do() request to %s: %s", receiptsHost, err)
return err
}
if resp != nil && resp.Body != nil {
defer resp.Body.Close()
}
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
log.Error("Unable to read %s response body: %s", receiptsHost, err)
return err
}
log.Info("Status : %s", resp.Status)
log.Info("Response: %s", body)
if resp.StatusCode != http.StatusOK {
log.Error("Bad response from %s:\nStatus: %d\n%s", receiptsHost, resp.StatusCode, string(body))
return impart.HTTPError{resp.StatusCode, string(body)}
}
return nil
}
diff --git a/nodeinfo.go b/nodeinfo.go
index f0c0b5e..4902c42 100644
--- a/nodeinfo.go
+++ b/nodeinfo.go
@@ -1,115 +1,115 @@
/*
- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"github.com/writeas/web-core/log"
"github.com/writefreely/go-nodeinfo"
"github.com/writefreely/writefreely/config"
"strings"
)
type nodeInfoResolver struct {
cfg *config.Config
db *datastore
}
func nodeInfoConfig(db *datastore, cfg *config.Config) *nodeinfo.Config {
name := cfg.App.SiteName
desc := cfg.App.SiteDesc
if desc == "" {
desc = "Minimal, federated blogging platform."
}
if cfg.App.SingleUser {
// Fetch blog information, instead
coll, err := db.GetCollectionByID(1)
if err == nil {
desc = coll.Description
}
}
return &nodeinfo.Config{
BaseURL: cfg.App.Host,
InfoURL: "/api/nodeinfo",
Metadata: nodeinfo.Metadata{
NodeName: name,
NodeDescription: desc,
Private: cfg.App.Private,
Software: nodeinfo.SoftwareMeta{
HomePage: softwareURL,
GitHub: "https://github.com/writefreely/writefreely",
Follow: "https://writing.exchange/@write_as",
},
MaxBlogs: cfg.App.MaxBlogs,
PublicReader: cfg.App.LocalTimeline,
Invites: cfg.App.UserInvites != "",
},
Protocols: []nodeinfo.NodeProtocol{
nodeinfo.ProtocolActivityPub,
},
Services: nodeinfo.Services{
Inbound: []nodeinfo.NodeService{},
Outbound: []nodeinfo.NodeService{
nodeinfo.ServiceRSS,
},
},
Software: nodeinfo.SoftwareInfo{
Name: strings.ToLower(serverSoftware),
Version: softwareVer,
},
}
}
func (r nodeInfoResolver) IsOpenRegistration() (bool, error) {
return r.cfg.App.OpenRegistration, nil
}
func (r nodeInfoResolver) Usage() (nodeinfo.Usage, error) {
var collCount, postCount int64
var activeHalfYear, activeMonth int
var err error
collCount, err = r.db.GetTotalCollections()
if err != nil {
collCount = 0
}
postCount, err = r.db.GetTotalPosts()
if err != nil {
log.Error("Unable to fetch post counts: %v", err)
}
if r.cfg.App.PublicStats {
// Display bi-yearly / monthly stats
err = r.db.QueryRow(`SELECT COUNT(*) FROM (
SELECT DISTINCT collection_id
FROM posts
INNER JOIN collections c
ON collection_id = c.id
WHERE collection_id IS NOT NULL
AND updated > DATE_SUB(NOW(), INTERVAL 6 MONTH)) co`).Scan(&activeHalfYear)
err = r.db.QueryRow(`SELECT COUNT(*) FROM (
SELECT DISTINCT collection_id
FROM posts
INNER JOIN FROM collections c
ON collection_id = c.id
WHERE collection_id IS NOT NULL
AND updated > DATE_SUB(NOW(), INTERVAL 1 MONTH)) co`).Scan(&activeMonth)
}
return nodeinfo.Usage{
Users: nodeinfo.UsageUsers{
Total: int(collCount),
ActiveHalfYear: activeHalfYear,
ActiveMonth: activeMonth,
},
LocalPosts: int(postCount),
}, nil
}
diff --git a/oauth.go b/oauth.go
index c0fbfa7..ee08740 100644
--- a/oauth.go
+++ b/oauth.go
@@ -1,473 +1,473 @@
/*
- * Copyright © 2019-2021 A Bunch Tell LLC.
+ * Copyright © 2019-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"context"
"encoding/json"
"fmt"
"io"
"io/ioutil"
"net/http"
"net/url"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/gorilla/sessions"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/config"
)
// OAuthButtons holds display information for different OAuth providers we support.
type OAuthButtons struct {
SlackEnabled bool
WriteAsEnabled bool
GitLabEnabled bool
GitLabDisplayName string
GiteaEnabled bool
GiteaDisplayName string
GenericEnabled bool
GenericDisplayName string
}
// NewOAuthButtons creates a new OAuthButtons struct based on our app configuration.
func NewOAuthButtons(cfg *config.Config) *OAuthButtons {
return &OAuthButtons{
SlackEnabled: cfg.SlackOauth.ClientID != "",
WriteAsEnabled: cfg.WriteAsOauth.ClientID != "",
GitLabEnabled: cfg.GitlabOauth.ClientID != "",
GitLabDisplayName: config.OrDefaultString(cfg.GitlabOauth.DisplayName, gitlabDisplayName),
GiteaEnabled: cfg.GiteaOauth.ClientID != "",
GiteaDisplayName: config.OrDefaultString(cfg.GiteaOauth.DisplayName, giteaDisplayName),
GenericEnabled: cfg.GenericOauth.ClientID != "",
GenericDisplayName: config.OrDefaultString(cfg.GenericOauth.DisplayName, genericOauthDisplayName),
}
}
// TokenResponse contains data returned when a token is created either
// through a code exchange or using a refresh token.
type TokenResponse struct {
AccessToken string `json:"access_token"`
ExpiresIn int `json:"expires_in"`
RefreshToken string `json:"refresh_token"`
TokenType string `json:"token_type"`
Error string `json:"error"`
}
// InspectResponse contains data returned when an access token is inspected.
type InspectResponse struct {
ClientID string `json:"client_id"`
UserID string `json:"user_id"`
ExpiresAt time.Time `json:"expires_at"`
Username string `json:"username"`
DisplayName string `json:"-"`
Email string `json:"email"`
Error string `json:"error"`
}
// tokenRequestMaxLen is the most bytes that we'll read from the /oauth/token
// endpoint. One megabyte is plenty.
const tokenRequestMaxLen = 1000000
// infoRequestMaxLen is the most bytes that we'll read from the
// /oauth/inspect endpoint.
const infoRequestMaxLen = 1000000
// OAuthDatastoreProvider provides a minimal interface of data store, config,
// and session store for use with the oauth handlers.
type OAuthDatastoreProvider interface {
DB() OAuthDatastore
Config() *config.Config
SessionStore() sessions.Store
}
// OAuthDatastore provides a minimal interface of data store methods used in
// oauth functionality.
type OAuthDatastore interface {
GetIDForRemoteUser(context.Context, string, string, string) (int64, error)
RecordRemoteUserID(context.Context, int64, string, string, string, string) error
ValidateOAuthState(context.Context, string) (string, string, int64, string, error)
GenerateOAuthState(context.Context, string, string, int64, string) (string, error)
CreateUser(*config.Config, *User, string, string) error
GetUserByID(int64) (*User, error)
}
type HttpClient interface {
Do(req *http.Request) (*http.Response, error)
}
type oauthClient interface {
GetProvider() string
GetClientID() string
GetCallbackLocation() string
buildLoginURL(state string) (string, error)
exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error)
inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error)
}
type callbackProxyClient struct {
server string
callbackLocation string
httpClient HttpClient
}
type oauthHandler struct {
Config *config.Config
DB OAuthDatastore
Store sessions.Store
EmailKey []byte
oauthClient oauthClient
callbackProxy *callbackProxyClient
}
func (h oauthHandler) viewOauthInit(app *App, w http.ResponseWriter, r *http.Request) error {
ctx := r.Context()
var attachUser int64
if attach := r.URL.Query().Get("attach"); attach == "t" {
user, _ := getUserAndSession(app, r)
if user == nil {
return impart.HTTPError{http.StatusInternalServerError, "cannot attach auth to user: user not found in session"}
}
attachUser = user.ID
}
state, err := h.DB.GenerateOAuthState(ctx, h.oauthClient.GetProvider(), h.oauthClient.GetClientID(), attachUser, r.FormValue("invite_code"))
if err != nil {
log.Error("viewOauthInit error: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"}
}
if h.callbackProxy != nil {
if err := h.callbackProxy.register(ctx, state); err != nil {
log.Error("viewOauthInit error: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "could not register state server"}
}
}
location, err := h.oauthClient.buildLoginURL(state)
if err != nil {
log.Error("viewOauthInit error: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"}
}
return impart.HTTPError{http.StatusTemporaryRedirect, location}
}
func configureSlackOauth(parentHandler *Handler, r *mux.Router, app *App) {
if app.Config().SlackOauth.ClientID != "" {
callbackLocation := app.Config().App.Host + "/oauth/callback/slack"
var stateRegisterClient *callbackProxyClient = nil
if app.Config().SlackOauth.CallbackProxyAPI != "" {
stateRegisterClient = &callbackProxyClient{
server: app.Config().SlackOauth.CallbackProxyAPI,
callbackLocation: app.Config().App.Host + "/oauth/callback/slack",
httpClient: config.DefaultHTTPClient(),
}
callbackLocation = app.Config().SlackOauth.CallbackProxy
}
oauthClient := slackOauthClient{
ClientID: app.Config().SlackOauth.ClientID,
ClientSecret: app.Config().SlackOauth.ClientSecret,
TeamID: app.Config().SlackOauth.TeamID,
HttpClient: config.DefaultHTTPClient(),
CallbackLocation: callbackLocation,
}
configureOauthRoutes(parentHandler, r, app, oauthClient, stateRegisterClient)
}
}
func configureWriteAsOauth(parentHandler *Handler, r *mux.Router, app *App) {
if app.Config().WriteAsOauth.ClientID != "" {
callbackLocation := app.Config().App.Host + "/oauth/callback/write.as"
var callbackProxy *callbackProxyClient = nil
if app.Config().WriteAsOauth.CallbackProxy != "" {
callbackProxy = &callbackProxyClient{
server: app.Config().WriteAsOauth.CallbackProxyAPI,
callbackLocation: app.Config().App.Host + "/oauth/callback/write.as",
httpClient: config.DefaultHTTPClient(),
}
callbackLocation = app.Config().WriteAsOauth.CallbackProxy
}
oauthClient := writeAsOauthClient{
ClientID: app.Config().WriteAsOauth.ClientID,
ClientSecret: app.Config().WriteAsOauth.ClientSecret,
ExchangeLocation: config.OrDefaultString(app.Config().WriteAsOauth.TokenLocation, writeAsExchangeLocation),
InspectLocation: config.OrDefaultString(app.Config().WriteAsOauth.InspectLocation, writeAsIdentityLocation),
AuthLocation: config.OrDefaultString(app.Config().WriteAsOauth.AuthLocation, writeAsAuthLocation),
HttpClient: config.DefaultHTTPClient(),
CallbackLocation: callbackLocation,
}
configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
}
}
func configureGitlabOauth(parentHandler *Handler, r *mux.Router, app *App) {
if app.Config().GitlabOauth.ClientID != "" {
callbackLocation := app.Config().App.Host + "/oauth/callback/gitlab"
var callbackProxy *callbackProxyClient = nil
if app.Config().GitlabOauth.CallbackProxy != "" {
callbackProxy = &callbackProxyClient{
server: app.Config().GitlabOauth.CallbackProxyAPI,
callbackLocation: app.Config().App.Host + "/oauth/callback/gitlab",
httpClient: config.DefaultHTTPClient(),
}
callbackLocation = app.Config().GitlabOauth.CallbackProxy
}
address := config.OrDefaultString(app.Config().GitlabOauth.Host, gitlabHost)
oauthClient := gitlabOauthClient{
ClientID: app.Config().GitlabOauth.ClientID,
ClientSecret: app.Config().GitlabOauth.ClientSecret,
ExchangeLocation: address + "/oauth/token",
InspectLocation: address + "/api/v4/user",
AuthLocation: address + "/oauth/authorize",
HttpClient: config.DefaultHTTPClient(),
CallbackLocation: callbackLocation,
}
configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
}
}
func configureGenericOauth(parentHandler *Handler, r *mux.Router, app *App) {
if app.Config().GenericOauth.ClientID != "" {
callbackLocation := app.Config().App.Host + "/oauth/callback/generic"
var callbackProxy *callbackProxyClient = nil
if app.Config().GenericOauth.CallbackProxy != "" {
callbackProxy = &callbackProxyClient{
server: app.Config().GenericOauth.CallbackProxyAPI,
callbackLocation: app.Config().App.Host + "/oauth/callback/generic",
httpClient: config.DefaultHTTPClient(),
}
callbackLocation = app.Config().GenericOauth.CallbackProxy
}
oauthClient := genericOauthClient{
ClientID: app.Config().GenericOauth.ClientID,
ClientSecret: app.Config().GenericOauth.ClientSecret,
ExchangeLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.TokenEndpoint,
InspectLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.InspectEndpoint,
AuthLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.AuthEndpoint,
HttpClient: config.DefaultHTTPClient(),
CallbackLocation: callbackLocation,
Scope: config.OrDefaultString(app.Config().GenericOauth.Scope, "read_user"),
MapUserID: config.OrDefaultString(app.Config().GenericOauth.MapUserID, "user_id"),
MapUsername: config.OrDefaultString(app.Config().GenericOauth.MapUsername, "username"),
MapDisplayName: config.OrDefaultString(app.Config().GenericOauth.MapDisplayName, "-"),
MapEmail: config.OrDefaultString(app.Config().GenericOauth.MapEmail, "email"),
}
configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
}
}
func configureGiteaOauth(parentHandler *Handler, r *mux.Router, app *App) {
if app.Config().GiteaOauth.ClientID != "" {
callbackLocation := app.Config().App.Host + "/oauth/callback/gitea"
var callbackProxy *callbackProxyClient = nil
if app.Config().GiteaOauth.CallbackProxy != "" {
callbackProxy = &callbackProxyClient{
server: app.Config().GiteaOauth.CallbackProxyAPI,
callbackLocation: app.Config().App.Host + "/oauth/callback/gitea",
httpClient: config.DefaultHTTPClient(),
}
callbackLocation = app.Config().GiteaOauth.CallbackProxy
}
oauthClient := giteaOauthClient{
ClientID: app.Config().GiteaOauth.ClientID,
ClientSecret: app.Config().GiteaOauth.ClientSecret,
ExchangeLocation: app.Config().GiteaOauth.Host + "/login/oauth/access_token",
InspectLocation: app.Config().GiteaOauth.Host + "/login/oauth/userinfo",
AuthLocation: app.Config().GiteaOauth.Host + "/login/oauth/authorize",
HttpClient: config.DefaultHTTPClient(),
CallbackLocation: callbackLocation,
Scope: "openid profile email",
MapUserID: "sub",
MapUsername: "login",
MapDisplayName: "full_name",
MapEmail: "email",
}
configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
}
}
func configureOauthRoutes(parentHandler *Handler, r *mux.Router, app *App, oauthClient oauthClient, callbackProxy *callbackProxyClient) {
handler := &oauthHandler{
Config: app.Config(),
DB: app.DB(),
Store: app.SessionStore(),
oauthClient: oauthClient,
EmailKey: app.keys.EmailKey,
callbackProxy: callbackProxy,
}
r.HandleFunc("/oauth/"+oauthClient.GetProvider(), parentHandler.OAuth(handler.viewOauthInit)).Methods("GET")
r.HandleFunc("/oauth/callback/"+oauthClient.GetProvider(), parentHandler.OAuth(handler.viewOauthCallback)).Methods("GET")
r.HandleFunc("/oauth/signup", parentHandler.OAuth(handler.viewOauthSignup)).Methods("POST")
}
func (h oauthHandler) viewOauthCallback(app *App, w http.ResponseWriter, r *http.Request) error {
ctx := r.Context()
code := r.FormValue("code")
state := r.FormValue("state")
provider, clientID, attachUserID, inviteCode, err := h.DB.ValidateOAuthState(ctx, state)
if err != nil {
log.Error("Unable to ValidateOAuthState: %s", err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
tokenResponse, err := h.oauthClient.exchangeOauthCode(ctx, code)
if err != nil {
log.Error("Unable to exchangeOauthCode: %s", err)
// TODO: show user friendly message if needed
// TODO: show NO message for cases like user pressing "Cancel" on authorize step
addSessionFlash(app, w, r, err.Error(), nil)
if attachUserID > 0 {
return impart.HTTPError{http.StatusFound, "/me/settings"}
}
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
// Now that we have the access token, let's use it real quick to make sure
// it really really works.
tokenInfo, err := h.oauthClient.inspectOauthAccessToken(ctx, tokenResponse.AccessToken)
if err != nil {
log.Error("Unable to inspectOauthAccessToken: %s", err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
localUserID, err := h.DB.GetIDForRemoteUser(ctx, tokenInfo.UserID, provider, clientID)
if err != nil {
log.Error("Unable to GetIDForRemoteUser: %s", err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
if localUserID != -1 && attachUserID > 0 {
if err = addSessionFlash(app, w, r, "This OAuth account is already attached to another user.", nil); err != nil {
return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()}
}
return impart.HTTPError{http.StatusFound, "/me/settings"}
}
if localUserID != -1 {
// Existing user, so log in now
user, err := h.DB.GetUserByID(localUserID)
if err != nil {
log.Error("Unable to GetUserByID %d: %s", localUserID, err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
if err = loginOrFail(h.Store, w, r, user); err != nil {
log.Error("Unable to loginOrFail %d: %s", localUserID, err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
return nil
}
if attachUserID > 0 {
log.Info("attaching to user %d", attachUserID)
log.Info("OAuth userid: %s", tokenInfo.UserID)
err = h.DB.RecordRemoteUserID(r.Context(), attachUserID, tokenInfo.UserID, provider, clientID, tokenResponse.AccessToken)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
return impart.HTTPError{http.StatusFound, "/me/settings"}
}
// New user registration below.
// First, verify that user is allowed to register
if inviteCode != "" {
// Verify invite code is valid
i, err := app.db.GetUserInvite(inviteCode)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
if !i.Active(app.db) {
return impart.HTTPError{http.StatusNotFound, "Invite link has expired."}
}
} else if !app.cfg.App.OpenRegistration {
addSessionFlash(app, w, r, ErrUserNotFound.Error(), nil)
return impart.HTTPError{http.StatusFound, "/login"}
}
displayName := tokenInfo.DisplayName
if len(displayName) == 0 {
displayName = tokenInfo.Username
}
tp := &oauthSignupPageParams{
AccessToken: tokenResponse.AccessToken,
TokenUsername: tokenInfo.Username,
TokenAlias: tokenInfo.DisplayName,
TokenEmail: tokenInfo.Email,
TokenRemoteUser: tokenInfo.UserID,
Provider: provider,
ClientID: clientID,
InviteCode: inviteCode,
}
tp.TokenHash = tp.HashTokenParams(h.Config.Server.HashSeed)
return h.showOauthSignupPage(app, w, r, tp, nil)
}
func (r *callbackProxyClient) register(ctx context.Context, state string) error {
form := url.Values{}
form.Add("state", state)
form.Add("location", r.callbackLocation)
req, err := http.NewRequestWithContext(ctx, "POST", r.server, strings.NewReader(form.Encode()))
if err != nil {
return err
}
req.Header.Set("User-Agent", ServerUserAgent(""))
req.Header.Set("Accept", "application/json")
req.Header.Set("Content-Type", "application/x-www-form-urlencoded")
resp, err := r.httpClient.Do(req)
if err != nil {
return err
}
if resp.StatusCode != http.StatusCreated {
return fmt.Errorf("unable register state location: %d", resp.StatusCode)
}
return nil
}
func limitedJsonUnmarshal(body io.ReadCloser, n int, thing interface{}) error {
lr := io.LimitReader(body, int64(n+1))
data, err := ioutil.ReadAll(lr)
if err != nil {
return err
}
if len(data) == n+1 {
return fmt.Errorf("content larger than max read allowance: %d", n)
}
return json.Unmarshal(data, thing)
}
func loginOrFail(store sessions.Store, w http.ResponseWriter, r *http.Request, user *User) error {
// An error may be returned, but a valid session should always be returned.
session, _ := store.Get(r, cookieName)
session.Values[cookieUserVal] = user.Cookie()
if err := session.Save(r, w); err != nil {
fmt.Println("error saving session", err)
return err
}
http.Redirect(w, r, "/", http.StatusTemporaryRedirect)
return nil
}
diff --git a/oauth_generic.go b/oauth_generic.go
index ccf6a0f..25c162b 100644
--- a/oauth_generic.go
+++ b/oauth_generic.go
@@ -1,142 +1,142 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC and respective authors.
+ * Copyright © 2020-2021 Musing Studio LLC and respective authors.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"context"
"errors"
"fmt"
"github.com/writeas/web-core/log"
"net/http"
"net/url"
"strings"
)
type genericOauthClient struct {
ClientID string
ClientSecret string
AuthLocation string
ExchangeLocation string
InspectLocation string
CallbackLocation string
Scope string
MapUserID string
MapUsername string
MapDisplayName string
MapEmail string
HttpClient HttpClient
}
var _ oauthClient = genericOauthClient{}
const (
genericOauthDisplayName = "OAuth"
)
func (c genericOauthClient) GetProvider() string {
return "generic"
}
func (c genericOauthClient) GetClientID() string {
return c.ClientID
}
func (c genericOauthClient) GetCallbackLocation() string {
return c.CallbackLocation
}
func (c genericOauthClient) buildLoginURL(state string) (string, error) {
u, err := url.Parse(c.AuthLocation)
if err != nil {
return "", err
}
q := u.Query()
q.Set("client_id", c.ClientID)
q.Set("redirect_uri", c.CallbackLocation)
q.Set("response_type", "code")
q.Set("state", state)
q.Set("scope", c.Scope)
u.RawQuery = q.Encode()
return u.String(), nil
}
func (c genericOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) {
form := url.Values{}
form.Add("grant_type", "authorization_code")
form.Add("redirect_uri", c.CallbackLocation)
form.Add("scope", c.Scope)
form.Add("code", code)
req, err := http.NewRequest("POST", c.ExchangeLocation, strings.NewReader(form.Encode()))
if err != nil {
return nil, err
}
req.WithContext(ctx)
req.Header.Set("User-Agent", ServerUserAgent(""))
req.Header.Set("Accept", "application/json")
req.Header.Set("Content-Type", "application/x-www-form-urlencoded")
req.SetBasicAuth(c.ClientID, c.ClientSecret)
resp, err := c.HttpClient.Do(req)
if err != nil {
return nil, err
}
if resp.StatusCode != http.StatusOK {
return nil, errors.New("unable to exchange code for access token")
}
var tokenResponse TokenResponse
if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil {
return nil, err
}
if tokenResponse.Error != "" {
return nil, errors.New(tokenResponse.Error)
}
return &tokenResponse, nil
}
func (c genericOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) {
req, err := http.NewRequest("GET", c.InspectLocation, nil)
if err != nil {
return nil, err
}
req.WithContext(ctx)
req.Header.Set("User-Agent", ServerUserAgent(""))
req.Header.Set("Accept", "application/json")
req.Header.Set("Authorization", "Bearer "+accessToken)
resp, err := c.HttpClient.Do(req)
if err != nil {
return nil, err
}
if resp.StatusCode != http.StatusOK {
return nil, errors.New("unable to inspect access token")
}
// since we don't know what the JSON from the server will look like, we create a
// generic interface and then map manually to values set in the config
var genericInterface map[string]interface{}
if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &genericInterface); err != nil {
return nil, err
}
// map each relevant field in inspectResponse to the mapped field from the config
var inspectResponse InspectResponse
inspectResponse.UserID, _ = genericInterface[c.MapUserID].(string)
if inspectResponse.UserID == "" {
log.Error("[CONFIGURATION ERROR] Generic OAuth provider returned empty UserID value (`%s`).\n Do you need to configure a different `map_user_id` value for this provider?", c.MapUserID)
return nil, fmt.Errorf("no UserID (`%s`) value returned", c.MapUserID)
}
inspectResponse.Username, _ = genericInterface[c.MapUsername].(string)
inspectResponse.DisplayName, _ = genericInterface[c.MapDisplayName].(string)
inspectResponse.Email, _ = genericInterface[c.MapEmail].(string)
return &inspectResponse, nil
}
diff --git a/oauth_signup.go b/oauth_signup.go
index 8dff416..b9b52c5 100644
--- a/oauth_signup.go
+++ b/oauth_signup.go
@@ -1,231 +1,231 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"crypto/sha256"
"encoding/hex"
"fmt"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/page"
"html/template"
"net/http"
"strings"
"time"
)
type viewOauthSignupVars struct {
page.StaticPage
To string
Message template.HTML
Flashes []template.HTML
AccessToken string
TokenUsername string
TokenAlias string // TODO: rename this to match the data it represents: the collection title
TokenEmail string
TokenRemoteUser string
Provider string
ClientID string
TokenHash string
InviteCode string
LoginUsername string
Alias string // TODO: rename this to match the data it represents: the collection title
Email string
}
const (
oauthParamAccessToken = "access_token"
oauthParamTokenUsername = "token_username"
oauthParamTokenAlias = "token_alias"
oauthParamTokenEmail = "token_email"
oauthParamTokenRemoteUserID = "token_remote_user"
oauthParamClientID = "client_id"
oauthParamProvider = "provider"
oauthParamHash = "signature"
oauthParamUsername = "username"
oauthParamAlias = "alias"
oauthParamEmail = "email"
oauthParamPassword = "password"
oauthParamInviteCode = "invite_code"
)
type oauthSignupPageParams struct {
AccessToken string
TokenUsername string
TokenAlias string // TODO: rename this to match the data it represents: the collection title
TokenEmail string
TokenRemoteUser string
ClientID string
Provider string
TokenHash string
InviteCode string
}
func (p oauthSignupPageParams) HashTokenParams(key string) string {
hasher := sha256.New()
hasher.Write([]byte(key))
hasher.Write([]byte(p.AccessToken))
hasher.Write([]byte(p.TokenUsername))
hasher.Write([]byte(p.TokenAlias))
hasher.Write([]byte(p.TokenEmail))
hasher.Write([]byte(p.TokenRemoteUser))
hasher.Write([]byte(p.ClientID))
hasher.Write([]byte(p.Provider))
return hex.EncodeToString(hasher.Sum(nil))
}
func (h oauthHandler) viewOauthSignup(app *App, w http.ResponseWriter, r *http.Request) error {
tp := &oauthSignupPageParams{
AccessToken: r.FormValue(oauthParamAccessToken),
TokenUsername: r.FormValue(oauthParamTokenUsername),
TokenAlias: r.FormValue(oauthParamTokenAlias),
TokenEmail: r.FormValue(oauthParamTokenEmail),
TokenRemoteUser: r.FormValue(oauthParamTokenRemoteUserID),
ClientID: r.FormValue(oauthParamClientID),
Provider: r.FormValue(oauthParamProvider),
InviteCode: r.FormValue(oauthParamInviteCode),
}
if tp.HashTokenParams(h.Config.Server.HashSeed) != r.FormValue(oauthParamHash) {
return impart.HTTPError{Status: http.StatusBadRequest, Message: "Request has been tampered with."}
}
tp.TokenHash = tp.HashTokenParams(h.Config.Server.HashSeed)
if err := h.validateOauthSignup(r); err != nil {
return h.showOauthSignupPage(app, w, r, tp, err)
}
var err error
hashedPass := []byte{}
clearPass := r.FormValue(oauthParamPassword)
hasPass := clearPass != ""
if hasPass {
hashedPass, err = auth.HashPass([]byte(clearPass))
if err != nil {
return h.showOauthSignupPage(app, w, r, tp, fmt.Errorf("unable to hash password"))
}
}
newUser := &User{
Username: r.FormValue(oauthParamUsername),
HashedPass: hashedPass,
HasPass: hasPass,
Email: prepareUserEmail(r.FormValue(oauthParamEmail), h.EmailKey),
Created: time.Now().Truncate(time.Second).UTC(),
}
displayName := r.FormValue(oauthParamAlias)
if len(displayName) == 0 {
displayName = r.FormValue(oauthParamUsername)
}
err = h.DB.CreateUser(h.Config, newUser, displayName, "")
if err != nil {
return h.showOauthSignupPage(app, w, r, tp, err)
}
// Log invite if needed
if tp.InviteCode != "" {
err = app.db.CreateInvitedUser(tp.InviteCode, newUser.ID)
if err != nil {
return err
}
}
err = h.DB.RecordRemoteUserID(r.Context(), newUser.ID, r.FormValue(oauthParamTokenRemoteUserID), r.FormValue(oauthParamProvider), r.FormValue(oauthParamClientID), r.FormValue(oauthParamAccessToken))
if err != nil {
return h.showOauthSignupPage(app, w, r, tp, err)
}
if err := loginOrFail(h.Store, w, r, newUser); err != nil {
return h.showOauthSignupPage(app, w, r, tp, err)
}
return nil
}
func (h oauthHandler) validateOauthSignup(r *http.Request) error {
username := r.FormValue(oauthParamUsername)
if len(username) < h.Config.App.MinUsernameLen {
return impart.HTTPError{Status: http.StatusBadRequest, Message: "Username is too short."}
}
if len(username) > 100 {
return impart.HTTPError{Status: http.StatusBadRequest, Message: "Username is too long."}
}
collTitle := r.FormValue(oauthParamAlias)
if len(collTitle) == 0 {
collTitle = username
}
email := r.FormValue(oauthParamEmail)
if len(email) > 0 {
parts := strings.Split(email, "@")
if len(parts) != 2 || (len(parts[0]) < 1 || len(parts[1]) < 1) {
return impart.HTTPError{Status: http.StatusBadRequest, Message: "Invalid email address"}
}
}
return nil
}
func (h oauthHandler) showOauthSignupPage(app *App, w http.ResponseWriter, r *http.Request, tp *oauthSignupPageParams, errMsg error) error {
username := tp.TokenUsername
collTitle := tp.TokenAlias
email := tp.TokenEmail
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session; ignoring: %v", err)
}
if tmpValue := r.FormValue(oauthParamUsername); len(tmpValue) > 0 {
username = tmpValue
}
if tmpValue := r.FormValue(oauthParamAlias); len(tmpValue) > 0 {
collTitle = tmpValue
}
if tmpValue := r.FormValue(oauthParamEmail); len(tmpValue) > 0 {
email = tmpValue
}
p := &viewOauthSignupVars{
StaticPage: pageForReq(app, r),
To: r.FormValue("to"),
Flashes: []template.HTML{},
AccessToken: tp.AccessToken,
TokenUsername: tp.TokenUsername,
TokenAlias: tp.TokenAlias,
TokenEmail: tp.TokenEmail,
TokenRemoteUser: tp.TokenRemoteUser,
Provider: tp.Provider,
ClientID: tp.ClientID,
TokenHash: tp.TokenHash,
InviteCode: tp.InviteCode,
LoginUsername: username,
Alias: collTitle,
Email: email,
}
// Display any error messages
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
if errMsg != nil {
p.Flashes = append(p.Flashes, template.HTML(errMsg.Error()))
}
err = pages["signup-oauth.tmpl"].ExecuteTemplate(w, "base", p)
if err != nil {
log.Error("Unable to render signup-oauth: %v", err)
return err
}
return nil
}
diff --git a/oauth_slack.go b/oauth_slack.go
index bad3775..a2752db 100644
--- a/oauth_slack.go
+++ b/oauth_slack.go
@@ -1,178 +1,178 @@
/*
- * Copyright © 2019-2020 A Bunch Tell LLC.
+ * Copyright © 2019-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"context"
"errors"
"github.com/writeas/slug"
"net/http"
"net/url"
"strings"
)
type slackOauthClient struct {
ClientID string
ClientSecret string
TeamID string
CallbackLocation string
HttpClient HttpClient
}
type slackExchangeResponse struct {
OK bool `json:"ok"`
AccessToken string `json:"access_token"`
Scope string `json:"scope"`
TeamName string `json:"team_name"`
TeamID string `json:"team_id"`
Error string `json:"error"`
}
type slackIdentity struct {
Name string `json:"name"`
ID string `json:"id"`
Email string `json:"email"`
}
type slackTeam struct {
Name string `json:"name"`
ID string `json:"id"`
}
type slackUserIdentityResponse struct {
OK bool `json:"ok"`
User slackIdentity `json:"user"`
Team slackTeam `json:"team"`
Error string `json:"error"`
}
const (
slackAuthLocation = "https://slack.com/oauth/authorize"
slackExchangeLocation = "https://slack.com/api/oauth.access"
slackIdentityLocation = "https://slack.com/api/users.identity"
)
var _ oauthClient = slackOauthClient{}
func (c slackOauthClient) GetProvider() string {
return "slack"
}
func (c slackOauthClient) GetClientID() string {
return c.ClientID
}
func (c slackOauthClient) GetCallbackLocation() string {
return c.CallbackLocation
}
func (c slackOauthClient) buildLoginURL(state string) (string, error) {
u, err := url.Parse(slackAuthLocation)
if err != nil {
return "", err
}
q := u.Query()
q.Set("client_id", c.ClientID)
q.Set("scope", "identity.basic identity.email identity.team")
q.Set("redirect_uri", c.CallbackLocation)
q.Set("state", state)
// If this param is not set, the user can select which team they
// authenticate through and then we'd have to match the configured team
// against the profile get. That is extra work in the post-auth phase
// that we don't want to do.
q.Set("team", c.TeamID)
// The Slack OAuth docs don't explicitly list this one, but it is part of
// the spec, so we include it anyway.
q.Set("response_type", "code")
u.RawQuery = q.Encode()
return u.String(), nil
}
func (c slackOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) {
form := url.Values{}
// The oauth.access documentation doesn't explicitly mention this
// parameter, but it is part of the spec, so we include it anyway.
// https://api.slack.com/methods/oauth.access
form.Add("grant_type", "authorization_code")
form.Add("redirect_uri", c.CallbackLocation)
form.Add("code", code)
req, err := http.NewRequest("POST", slackExchangeLocation, strings.NewReader(form.Encode()))
if err != nil {
return nil, err
}
req.WithContext(ctx)
req.Header.Set("User-Agent", ServerUserAgent(""))
req.Header.Set("Accept", "application/json")
req.Header.Set("Content-Type", "application/x-www-form-urlencoded")
req.SetBasicAuth(c.ClientID, c.ClientSecret)
resp, err := c.HttpClient.Do(req)
if err != nil {
return nil, err
}
if resp.StatusCode != http.StatusOK {
return nil, errors.New("unable to exchange code for access token")
}
var tokenResponse slackExchangeResponse
if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil {
return nil, err
}
if !tokenResponse.OK {
return nil, errors.New(tokenResponse.Error)
}
return tokenResponse.TokenResponse(), nil
}
func (c slackOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) {
req, err := http.NewRequest("GET", slackIdentityLocation, nil)
if err != nil {
return nil, err
}
req.WithContext(ctx)
req.Header.Set("User-Agent", ServerUserAgent(""))
req.Header.Set("Accept", "application/json")
req.Header.Set("Authorization", "Bearer "+accessToken)
resp, err := c.HttpClient.Do(req)
if err != nil {
return nil, err
}
if resp.StatusCode != http.StatusOK {
return nil, errors.New("unable to inspect access token")
}
var inspectResponse slackUserIdentityResponse
if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &inspectResponse); err != nil {
return nil, err
}
if !inspectResponse.OK {
return nil, errors.New(inspectResponse.Error)
}
return inspectResponse.InspectResponse(), nil
}
func (resp slackUserIdentityResponse) InspectResponse() *InspectResponse {
return &InspectResponse{
UserID: resp.User.ID,
Username: slug.Make(resp.User.Name),
DisplayName: resp.User.Name,
Email: resp.User.Email,
}
}
func (resp slackExchangeResponse) TokenResponse() *TokenResponse {
return &TokenResponse{
AccessToken: resp.AccessToken,
}
}
diff --git a/oauth_test.go b/oauth_test.go
index 553c1cb..1bd0bfc 100644
--- a/oauth_test.go
+++ b/oauth_test.go
@@ -1,261 +1,261 @@
/*
- * Copyright © 2019-2021 A Bunch Tell LLC.
+ * Copyright © 2019-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"context"
"fmt"
"github.com/gorilla/sessions"
"github.com/stretchr/testify/assert"
"github.com/writeas/impart"
"github.com/writeas/web-core/id"
"github.com/writefreely/writefreely/config"
"net/http"
"net/http/httptest"
"net/url"
"strings"
"testing"
)
type MockOAuthDatastoreProvider struct {
DoDB func() OAuthDatastore
DoConfig func() *config.Config
DoSessionStore func() sessions.Store
}
type MockOAuthDatastore struct {
DoGenerateOAuthState func(context.Context, string, string, int64, string) (string, error)
DoValidateOAuthState func(context.Context, string) (string, string, int64, string, error)
DoGetIDForRemoteUser func(context.Context, string, string, string) (int64, error)
DoCreateUser func(*config.Config, *User, string) error
DoRecordRemoteUserID func(context.Context, int64, string, string, string, string) error
DoGetUserByID func(int64) (*User, error)
}
var _ OAuthDatastore = &MockOAuthDatastore{}
type StringReadCloser struct {
*strings.Reader
}
func (src *StringReadCloser) Close() error {
return nil
}
type MockHTTPClient struct {
DoDo func(req *http.Request) (*http.Response, error)
}
func (m *MockHTTPClient) Do(req *http.Request) (*http.Response, error) {
if m.DoDo != nil {
return m.DoDo(req)
}
return &http.Response{}, nil
}
func (m *MockOAuthDatastoreProvider) SessionStore() sessions.Store {
if m.DoSessionStore != nil {
return m.DoSessionStore()
}
return sessions.NewCookieStore([]byte("secret-key"))
}
func (m *MockOAuthDatastoreProvider) DB() OAuthDatastore {
if m.DoDB != nil {
return m.DoDB()
}
return &MockOAuthDatastore{}
}
func (m *MockOAuthDatastoreProvider) Config() *config.Config {
if m.DoConfig != nil {
return m.DoConfig()
}
cfg := config.New()
cfg.UseSQLite(true)
cfg.WriteAsOauth = config.WriteAsOauthCfg{
ClientID: "development",
ClientSecret: "development",
AuthLocation: "https://write.as/oauth/login",
TokenLocation: "https://write.as/oauth/token",
InspectLocation: "https://write.as/oauth/inspect",
}
cfg.SlackOauth = config.SlackOauthCfg{
ClientID: "development",
ClientSecret: "development",
TeamID: "development",
}
return cfg
}
func (m *MockOAuthDatastore) ValidateOAuthState(ctx context.Context, state string) (string, string, int64, string, error) {
if m.DoValidateOAuthState != nil {
return m.DoValidateOAuthState(ctx, state)
}
return "", "", 0, "", nil
}
func (m *MockOAuthDatastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) {
if m.DoGetIDForRemoteUser != nil {
return m.DoGetIDForRemoteUser(ctx, remoteUserID, provider, clientID)
}
return -1, nil
}
func (m *MockOAuthDatastore) CreateUser(cfg *config.Config, u *User, username, description string) error {
if m.DoCreateUser != nil {
return m.DoCreateUser(cfg, u, username)
}
u.ID = 1
return nil
}
func (m *MockOAuthDatastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error {
if m.DoRecordRemoteUserID != nil {
return m.DoRecordRemoteUserID(ctx, localUserID, remoteUserID, provider, clientID, accessToken)
}
return nil
}
func (m *MockOAuthDatastore) GetUserByID(userID int64) (*User, error) {
if m.DoGetUserByID != nil {
return m.DoGetUserByID(userID)
}
user := &User{}
return user, nil
}
func (m *MockOAuthDatastore) GenerateOAuthState(ctx context.Context, provider string, clientID string, attachUserID int64, inviteCode string) (string, error) {
if m.DoGenerateOAuthState != nil {
return m.DoGenerateOAuthState(ctx, provider, clientID, attachUserID, inviteCode)
}
return id.Generate62RandomString(14), nil
}
func TestViewOauthInit(t *testing.T) {
t.Run("success", func(t *testing.T) {
app := &MockOAuthDatastoreProvider{}
h := oauthHandler{
Config: app.Config(),
DB: app.DB(),
Store: app.SessionStore(),
EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd},
oauthClient: writeAsOauthClient{
ClientID: app.Config().WriteAsOauth.ClientID,
ClientSecret: app.Config().WriteAsOauth.ClientSecret,
ExchangeLocation: app.Config().WriteAsOauth.TokenLocation,
InspectLocation: app.Config().WriteAsOauth.InspectLocation,
AuthLocation: app.Config().WriteAsOauth.AuthLocation,
CallbackLocation: "http://localhost/oauth/callback",
HttpClient: nil,
},
}
req, err := http.NewRequest("GET", "/oauth/client", nil)
assert.NoError(t, err)
rr := httptest.NewRecorder()
err = h.viewOauthInit(nil, rr, req)
assert.NotNil(t, err)
httpErr, ok := err.(impart.HTTPError)
assert.True(t, ok)
assert.Equal(t, http.StatusTemporaryRedirect, httpErr.Status)
assert.NotEmpty(t, httpErr.Message)
locURI, err := url.Parse(httpErr.Message)
assert.NoError(t, err)
assert.Equal(t, "/oauth/login", locURI.Path)
assert.Equal(t, "development", locURI.Query().Get("client_id"))
assert.Equal(t, "http://localhost/oauth/callback", locURI.Query().Get("redirect_uri"))
assert.Equal(t, "code", locURI.Query().Get("response_type"))
assert.NotEmpty(t, locURI.Query().Get("state"))
})
t.Run("state failure", func(t *testing.T) {
app := &MockOAuthDatastoreProvider{
DoDB: func() OAuthDatastore {
return &MockOAuthDatastore{
DoGenerateOAuthState: func(ctx context.Context, provider, clientID string, attachUserID int64, inviteCode string) (string, error) {
return "", fmt.Errorf("pretend unable to write state error")
},
}
},
}
h := oauthHandler{
Config: app.Config(),
DB: app.DB(),
Store: app.SessionStore(),
EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd},
oauthClient: writeAsOauthClient{
ClientID: app.Config().WriteAsOauth.ClientID,
ClientSecret: app.Config().WriteAsOauth.ClientSecret,
ExchangeLocation: app.Config().WriteAsOauth.TokenLocation,
InspectLocation: app.Config().WriteAsOauth.InspectLocation,
AuthLocation: app.Config().WriteAsOauth.AuthLocation,
CallbackLocation: "http://localhost/oauth/callback",
HttpClient: nil,
},
}
req, err := http.NewRequest("GET", "/oauth/client", nil)
assert.NoError(t, err)
rr := httptest.NewRecorder()
err = h.viewOauthInit(nil, rr, req)
httpErr, ok := err.(impart.HTTPError)
assert.True(t, ok)
assert.NotEmpty(t, httpErr.Message)
assert.Equal(t, http.StatusInternalServerError, httpErr.Status)
assert.Equal(t, "could not prepare oauth redirect url", httpErr.Message)
})
}
func TestViewOauthCallback(t *testing.T) {
t.Run("success", func(t *testing.T) {
app := &MockOAuthDatastoreProvider{}
h := oauthHandler{
Config: app.Config(),
DB: app.DB(),
Store: app.SessionStore(),
EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd},
oauthClient: writeAsOauthClient{
ClientID: app.Config().WriteAsOauth.ClientID,
ClientSecret: app.Config().WriteAsOauth.ClientSecret,
ExchangeLocation: app.Config().WriteAsOauth.TokenLocation,
InspectLocation: app.Config().WriteAsOauth.InspectLocation,
AuthLocation: app.Config().WriteAsOauth.AuthLocation,
CallbackLocation: "http://localhost/oauth/callback",
HttpClient: &MockHTTPClient{
DoDo: func(req *http.Request) (*http.Response, error) {
switch req.URL.String() {
case "https://write.as/oauth/token":
return &http.Response{
StatusCode: 200,
Body: &StringReadCloser{strings.NewReader(`{"access_token": "access_token", "expires_in": 1000, "refresh_token": "refresh_token", "token_type": "access"}`)},
}, nil
case "https://write.as/oauth/inspect":
return &http.Response{
StatusCode: 200,
Body: &StringReadCloser{strings.NewReader(`{"client_id": "development", "user_id": "1", "expires_at": "2019-12-19T11:42:01Z", "username": "nick", "email": "nick@testing.write.as"}`)},
}, nil
}
return &http.Response{
StatusCode: http.StatusNotFound,
}, nil
},
},
},
}
req, err := http.NewRequest("GET", "/oauth/callback", nil)
assert.NoError(t, err)
rr := httptest.NewRecorder()
err = h.viewOauthCallback(&App{cfg: app.Config(), sessionStore: app.SessionStore()}, rr, req)
assert.NoError(t, err)
assert.Equal(t, http.StatusTemporaryRedirect, rr.Code)
})
}
diff --git a/pad.go b/pad.go
index d150334..1d64a8c 100644
--- a/pad.go
+++ b/pad.go
@@ -1,190 +1,190 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"net/http"
"strings"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/page"
)
func handleViewPad(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
action := vars["action"]
slug := vars["slug"]
collAlias := vars["collection"]
if app.cfg.App.SingleUser {
// TODO: refactor all of this, especially for single-user blogs
c, err := app.db.GetCollectionByID(1)
if err != nil {
return err
}
collAlias = c.Alias
}
appData := &struct {
page.StaticPage
Post *RawPost
User *User
Blogs *[]Collection
Silenced bool
Editing bool // True if we're modifying an existing post
EditCollection *Collection // Collection of the post we're editing, if any
}{
StaticPage: pageForReq(app, r),
Post: &RawPost{Font: "norm"},
User: getUserSession(app, r),
}
var err error
if appData.User != nil {
appData.Blogs, err = app.db.GetPublishableCollections(appData.User, app.cfg.App.Host)
if err != nil {
log.Error("Unable to get user's blogs for Pad: %v", err)
}
appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID)
if err != nil {
log.Error("Unable to get user status for Pad: %v", err)
}
}
padTmpl := app.cfg.App.Editor
if templates[padTmpl] == nil {
if padTmpl != "" {
log.Info("No template '%s' found. Falling back to default 'pad' template.", padTmpl)
}
padTmpl = "pad"
}
if action == "" && slug == "" {
// Not editing any post; simply render the Pad
if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil {
log.Error("Unable to execute template: %v", err)
}
return nil
}
// Retrieve post information for editing
appData.Editing = true
// Make sure this isn't cached, so user doesn't accidentally lose data
w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT")
if slug != "" {
// TODO: refactor all of this, especially for single-user blogs
appData.Post = getRawCollectionPost(app, slug, collAlias)
if appData.Post.OwnerID != appData.User.ID {
// TODO: add ErrForbiddenEditPost message to flashes
return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/edit")]}
}
appData.EditCollection, err = app.db.GetCollectionForPad(collAlias)
if err != nil {
log.Error("Unable to GetCollectionForPad: %s", err)
return err
}
appData.EditCollection.hostName = app.cfg.App.Host
} else {
// Editing a floating article
appData.Post = getRawPost(app, action)
appData.Post.Id = action
}
if appData.Post.Gone {
return ErrPostUnpublished
} else if appData.Post.Found && (appData.Post.Title != "" || appData.Post.Content != "") {
// Got the post
} else if appData.Post.Found {
log.Error("Found post, but other conditions failed.")
return ErrPostFetchError
} else {
return ErrPostNotFound
}
if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil {
log.Error("Unable to execute template: %v", err)
}
return nil
}
func handleViewMeta(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
action := vars["action"]
slug := vars["slug"]
collAlias := vars["collection"]
appData := &struct {
page.StaticPage
Post *RawPost
User *User
EditCollection *Collection // Collection of the post we're editing, if any
Flashes []string
NeedsToken bool
Silenced bool
}{
StaticPage: pageForReq(app, r),
Post: &RawPost{Font: "norm"},
User: getUserSession(app, r),
}
var err error
appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID)
if err != nil {
log.Error("view meta: get user status: %v", err)
return ErrInternalGeneral
}
if action == "" && slug == "" {
return ErrPostNotFound
}
// Make sure this isn't cached, so user doesn't accidentally lose data
w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
w.Header().Set("Expires", "Thu, 28 Jul 1989 12:00:00 GMT")
if slug != "" {
appData.Post = getRawCollectionPost(app, slug, collAlias)
if appData.Post.OwnerID != appData.User.ID {
// TODO: add ErrForbiddenEditPost message to flashes
return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/meta")]}
}
if app.cfg.App.SingleUser {
// TODO: optimize this query just like we do in GetCollectionForPad (?)
appData.EditCollection, err = app.db.GetCollectionByID(1)
} else {
appData.EditCollection, err = app.db.GetCollectionForPad(collAlias)
}
if err != nil {
return err
}
appData.EditCollection.hostName = app.cfg.App.Host
} else {
// Editing a floating article
appData.Post = getRawPost(app, action)
appData.Post.Id = action
}
appData.NeedsToken = appData.User == nil || appData.User.ID != appData.Post.OwnerID
if appData.Post.Gone {
return ErrPostUnpublished
} else if appData.Post.Found && appData.Post.Content != "" {
// Got the post
} else if appData.Post.Found {
return ErrPostFetchError
} else {
return ErrPostNotFound
}
appData.Flashes, _ = getSessionFlashes(app, w, r, nil)
if err = templates["edit-meta"].ExecuteTemplate(w, "edit-meta", appData); err != nil {
log.Error("Unable to execute template: %v", err)
}
return nil
}
diff --git a/page/page.go b/page/page.go
index 2cfb6cc..3112270 100644
--- a/page/page.go
+++ b/page/page.go
@@ -1,47 +1,47 @@
/*
- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// package page provides mechanisms and data for generating a WriteFreely page.
package page
import (
"github.com/writefreely/writefreely/config"
"strings"
)
type StaticPage struct {
// App configuration
config.AppCfg
Version string
HeaderNav bool
// Request values
Path string
Username string
Values map[string]string
Flashes []string
CanViewReader bool
IsAdmin bool
CanInvite bool
}
// SanitizeHost alters the StaticPage to contain a real hostname. This is
// especially important for the Tor hidden service, as it can be served over
// proxies, messing up the apparent hostname.
func (sp *StaticPage) SanitizeHost(cfg *config.Config) {
if cfg.Server.HiddenHost != "" && strings.HasPrefix(sp.Host, cfg.Server.HiddenHost) {
sp.Host = cfg.Server.HiddenHost
}
}
func (sp StaticPage) OfficialVersion() string {
p := strings.Split(sp.Version, "-")
return p[0]
}
diff --git a/pages.go b/pages.go
index f871882..8b3a987 100644
--- a/pages.go
+++ b/pages.go
@@ -1,164 +1,164 @@
/*
- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"github.com/writefreely/writefreely/config"
"time"
)
var defaultPageUpdatedTime = time.Date(2018, 11, 8, 12, 0, 0, 0, time.Local)
func getAboutPage(app *App) (*instanceContent, error) {
c, err := app.db.GetDynamicContent("about")
if err != nil {
return nil, err
}
if c == nil {
c = &instanceContent{
ID: "about",
Type: "page",
Content: defaultAboutPage(app.cfg),
}
}
if !c.Title.Valid {
c.Title = defaultAboutTitle(app.cfg)
}
return c, nil
}
func defaultAboutTitle(cfg *config.Config) sql.NullString {
return sql.NullString{String: "About " + cfg.App.SiteName, Valid: true}
}
func getPrivacyPage(app *App) (*instanceContent, error) {
c, err := app.db.GetDynamicContent("privacy")
if err != nil {
return nil, err
}
if c == nil {
c = &instanceContent{
ID: "privacy",
Type: "page",
Content: defaultPrivacyPolicy(app.cfg),
Updated: defaultPageUpdatedTime,
}
}
if !c.Title.Valid {
c.Title = defaultPrivacyTitle()
}
return c, nil
}
func defaultPrivacyTitle() sql.NullString {
return sql.NullString{String: "Privacy Policy", Valid: true}
}
func defaultAboutPage(cfg *config.Config) string {
if cfg.App.Federation {
return `_` + cfg.App.SiteName + `_ is an interconnected place for you to write and publish, powered by [WriteFreely](https://writefreely.org) and ActivityPub.`
}
return `_` + cfg.App.SiteName + `_ is a place for you to write and publish, powered by [WriteFreely](https://writefreely.org).`
}
func defaultPrivacyPolicy(cfg *config.Config) string {
return `[WriteFreely](https://writefreely.org), the software that powers this site, is built to enforce your right to privacy by default.
It retains as little data about you as possible, not even requiring an email address to sign up. However, if you _do_ give us your email address, it is stored encrypted in our database. We salt and hash your account's password.
We store log files, or data about what happens on our servers. We also use cookies to keep you logged in to your account.
Beyond this, it's important that you trust whoever runs **` + cfg.App.SiteName + `**. Software can only do so much to protect you -- your level of privacy protections will ultimately fall on the humans that run this particular service.`
}
func getLandingBanner(app *App) (*instanceContent, error) {
c, err := app.db.GetDynamicContent("landing-banner")
if err != nil {
return nil, err
}
if c == nil {
c = &instanceContent{
ID: "landing-banner",
Type: "section",
Content: defaultLandingBanner(app.cfg),
Updated: defaultPageUpdatedTime,
}
}
return c, nil
}
func getLandingBody(app *App) (*instanceContent, error) {
c, err := app.db.GetDynamicContent("landing-body")
if err != nil {
return nil, err
}
if c == nil {
c = &instanceContent{
ID: "landing-body",
Type: "section",
Content: defaultLandingBody(app.cfg),
Updated: defaultPageUpdatedTime,
}
}
return c, nil
}
func defaultLandingBanner(cfg *config.Config) string {
if cfg.App.Federation {
return "# Start your blog in the fediverse"
}
return "# Start your blog"
}
func defaultLandingBody(cfg *config.Config) string {
if cfg.App.Federation {
return `## Join the Fediverse
The fediverse is a large network of platforms that all speak a common language. Imagine if you could reply to Instagram posts from Twitter, or interact with your favorite Medium blogs from Facebook -- federated alternatives like [PixelFed](https://pixelfed.org), [Mastodon](https://joinmastodon.org), and WriteFreely enable you to do these types of things.
## Write More Socially
WriteFreely can communicate with other federated platforms like Mastodon, so people can follow your blogs, bookmark their favorite posts, and boost them to their followers. Sign up above to create a blog and join the fediverse.`
}
return ""
}
func getReaderSection(app *App) (*instanceContent, error) {
c, err := app.db.GetDynamicContent("reader")
if err != nil {
return nil, err
}
if c == nil {
c = &instanceContent{
ID: "reader",
Type: "section",
Content: defaultReaderBanner(app.cfg),
Updated: defaultPageUpdatedTime,
}
}
if !c.Title.Valid {
c.Title = defaultReaderTitle(app.cfg)
}
return c, nil
}
func defaultReaderTitle(cfg *config.Config) sql.NullString {
return sql.NullString{String: "Reader", Valid: true}
}
func defaultReaderBanner(cfg *config.Config) string {
return "Read the latest posts from " + cfg.App.SiteName + "."
}
diff --git a/parse/posts.go b/parse/posts.go
index f660e08..6a9a910 100644
--- a/parse/posts.go
+++ b/parse/posts.go
@@ -1,82 +1,82 @@
/*
- * Copyright © 2018-2020 A Bunch Tell LLC.
+ * Copyright © 2018-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// Package parse assists in the parsing of plain text posts
package parse
import (
"github.com/writeas/web-core/stringmanip"
"regexp"
"strings"
)
var (
titleElementReg = regexp.MustCompile("?p>")
urlReg = regexp.MustCompile("https?://")
imgReg = regexp.MustCompile(`!\[([^]]+)\]\([^)]+\)`)
)
// PostLede attempts to extract the first thought of the given post, generally
// contained within the first line or sentence of text.
func PostLede(t string, includePunc bool) string {
// Adjust where we truncate if we want to include punctuation
iAdj := 0
if includePunc {
iAdj = 1
}
// Find lede within first line of text
nl := strings.IndexRune(t, '\n')
if nl > -1 {
t = t[:nl]
}
// Strip certain HTML tags
t = titleElementReg.ReplaceAllString(t, "")
// Strip URL protocols
t = urlReg.ReplaceAllString(t, "")
// Strip image URL, leaving only alt text
t = imgReg.ReplaceAllString(t, " $1 ")
// Find lede within first sentence
punc := strings.Index(t, ". ")
if punc > -1 {
t = t[:punc+iAdj]
}
punc = stringmanip.IndexRune(t, '。')
if punc > -1 {
c := []rune(t)
t = string(c[:punc+iAdj])
}
punc = stringmanip.IndexRune(t, '?')
if punc > -1 {
c := []rune(t)
t = string(c[:punc+iAdj])
}
return t
}
// TruncToWord truncates the given text to the provided limit.
func TruncToWord(s string, l int) (string, bool) {
truncated := false
c := []rune(s)
if len(c) > l {
truncated = true
s = string(c[:l])
spaceIdx := strings.LastIndexByte(s, ' ')
if spaceIdx > -1 {
s = s[:spaceIdx]
}
}
return s, truncated
}
diff --git a/parse/posts_test.go b/parse/posts_test.go
index 8f0d8b3..c377f57 100644
--- a/parse/posts_test.go
+++ b/parse/posts_test.go
@@ -1,55 +1,55 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package parse
import "testing"
func TestPostLede(t *testing.T) {
text := map[string]string{
"早安。跨出舒適圈,才能前往": "早安。",
"早安。This is my post. It is great.": "早安。",
"Hello. 早安。": "Hello.",
"Sup? Everyone says punctuation is punctuation.": "Sup?",
"Humans are humans, and society is full of good and bad actors. Technology, at the most fundamental level, is a neutral tool that can be used by either to meet any ends. ": "Humans are humans, and society is full of good and bad actors.",
`Online Domino Is Must For Everyone
Do you want to understand how to play poker online?`: "Online Domino Is Must For Everyone",
`おはようございます
私は日本から帰ったばかりです。`: "おはようございます",
"Hello, we say, おはよう. We say \"good morning\"": "Hello, we say, おはよう.",
}
c := 1
for i, o := range text {
if s := PostLede(i, true); s != o {
t.Errorf("#%d: Got '%s' from '%s'; expected '%s'", c, s, i, o)
}
c++
}
}
func TestTruncToWord(t *testing.T) {
text := map[string]string{
"Можливо, ми можемо використовувати інтернет-інструменти, щоб виготовити якийсь текст, який би міг бути і на, і в кінцевому підсумку, буде скорочено, тому що це тривало так довго.": "Можливо, ми можемо використовувати інтернет-інструменти, щоб виготовити якийсь",
"早安。This is my post. It is great. It is a long post that is great that is a post that is great.": "早安。This is my post. It is great. It is a long post that is great that is a post",
"Sup? Everyone says punctuation is punctuation.": "Sup? Everyone says punctuation is punctuation.",
"I arrived in Japan six days ago. Tired from a 10-hour flight after a night-long layover in Calgary, I wandered wide-eyed around Narita airport looking for an ATM.": "I arrived in Japan six days ago. Tired from a 10-hour flight after a night-long",
}
c := 1
for i, o := range text {
if s, _ := TruncToWord(i, 80); s != o {
t.Errorf("#%d: Got '%s' from '%s'; expected '%s'", c, s, i, o)
}
c++
}
}
diff --git a/postrender.go b/postrender.go
index b200a59..5be8d0c 100644
--- a/postrender.go
+++ b/postrender.go
@@ -1,361 +1,361 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"bytes"
"encoding/json"
"fmt"
"html"
"html/template"
"net/http"
"net/url"
"regexp"
"strings"
"unicode"
"unicode/utf8"
"github.com/microcosm-cc/bluemonday"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/impart"
blackfriday "github.com/writeas/saturday"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/stringmanip"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/parse"
)
var (
blockReg = regexp.MustCompile("<(ul|ol|blockquote)>\n")
endBlockReg = regexp.MustCompile("([a-z]+)>\n(ul|ol|blockquote)>")
youtubeReg = regexp.MustCompile("(https?://www.youtube.com/embed/[a-zA-Z0-9\\-_]+)(\\?[^\t\n\f\r \"']+)?")
titleElementReg = regexp.MustCompile("?h[1-6]>")
hashtagReg = regexp.MustCompile(`{{\[\[\|\|([^|]+)\|\|\]\]}}`)
markeddownReg = regexp.MustCompile("(.+)
")
mentionReg = regexp.MustCompile(`@([A-Za-z0-9._%+-]+)(@[A-Za-z0-9.-]+\.[A-Za-z]+)\b`)
)
func (p *Post) handlePremiumContent(c *Collection, isOwner, postPage bool, cfg *config.Config) {
if c.Monetization != "" {
// User has Web Monetization enabled, so split content if it exists
spl := strings.Index(p.Content, shortCodePaid)
p.IsPaid = spl > -1
if postPage {
// We're viewing the individual post
if isOwner {
p.Content = strings.Replace(p.Content, shortCodePaid, "\n\n"+`Your subscriber content begins here.
`+"\n\n", 1)
} else {
if spl > -1 {
p.Content = p.Content[:spl+len(shortCodePaid)]
p.Content = strings.Replace(p.Content, shortCodePaid, "\n\n"+`Continue reading with a Coil membership.
`+"\n\n", 1)
}
}
} else {
// We've viewing the post on the collection landing
if spl > -1 {
baseURL := c.CanonicalURL()
if isOwner {
baseURL = "/" + c.Alias + "/"
}
p.Content = p.Content[:spl+len(shortCodePaid)]
p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:spl]), baseURL, cfg))
}
}
}
}
func (p *Post) formatContent(cfg *config.Config, c *Collection, isOwner bool, isPostPage bool) {
baseURL := c.CanonicalURL()
// TODO: redundant
if !isSingleUser {
baseURL = "/" + c.Alias + "/"
}
p.handlePremiumContent(c, isOwner, isPostPage, cfg)
p.Content = strings.Replace(p.Content, "<!--paid-->", "", 1)
p.HTMLTitle = template.HTML(applyBasicMarkdown([]byte(p.Title.String)))
p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), baseURL, cfg))
if exc := strings.Index(string(p.Content), ""); exc > -1 {
p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:exc]), baseURL, cfg))
}
}
func (p *PublicPost) formatContent(cfg *config.Config, isOwner bool, isPostPage bool) {
p.Post.formatContent(cfg, &p.Collection.Collection, isOwner, isPostPage)
}
func (p *Post) augmentContent(c *Collection) {
if p.PinnedPosition.Valid {
// Don't augment posts that are pinned
return
}
if strings.Index(p.Content, "") > -1 {
// Don't augment posts with the special "nosig" shortcode
return
}
// Add post signatures
if c.Signature != "" {
p.Content += "\n\n" + c.Signature
}
}
func (p *PublicPost) augmentContent() {
p.Post.augmentContent(&p.Collection.Collection)
}
func (p *PublicPost) augmentReadingDestination() {
if p.IsPaid {
p.HTMLContent += template.HTML("\n\n" + `` + localStr("Read more...", p.Language.String) + ` ($)
`)
}
}
func applyMarkdown(data []byte, baseURL string, cfg *config.Config) string {
return applyMarkdownSpecial(data, false, baseURL, cfg)
}
func disableYoutubeAutoplay(outHTML string) string {
for _, match := range youtubeReg.FindAllString(outHTML, -1) {
u, err := url.Parse(match)
if err != nil {
continue
}
u.RawQuery = html.UnescapeString(u.RawQuery)
q := u.Query()
// Set Youtube autoplay url parameter, if any, to 0
if len(q["autoplay"]) == 1 {
q.Set("autoplay", "0")
}
u.RawQuery = q.Encode()
cleanURL := u.String()
outHTML = strings.Replace(outHTML, match, cleanURL, 1)
}
return outHTML
}
func applyMarkdownSpecial(data []byte, skipNoFollow bool, baseURL string, cfg *config.Config) string {
mdExtensions := 0 |
blackfriday.EXTENSION_TABLES |
blackfriday.EXTENSION_FENCED_CODE |
blackfriday.EXTENSION_AUTOLINK |
blackfriday.EXTENSION_STRIKETHROUGH |
blackfriday.EXTENSION_SPACE_HEADERS |
blackfriday.EXTENSION_AUTO_HEADER_IDS
htmlFlags := 0 |
blackfriday.HTML_USE_SMARTYPANTS |
blackfriday.HTML_SMARTYPANTS_DASHES
if baseURL != "" {
htmlFlags |= blackfriday.HTML_HASHTAGS
}
// Generate Markdown
md := blackfriday.Markdown([]byte(data), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions)
if baseURL != "" {
// Replace special text generated by Markdown parser
tagPrefix := baseURL + "tag:"
if cfg.App.Chorus {
tagPrefix = "/read/t/"
}
md = []byte(hashtagReg.ReplaceAll(md, []byte("# $1 ")))
handlePrefix := cfg.App.Host + "/@/"
md = []byte(mentionReg.ReplaceAll(md, []byte("@$1$2 ")))
}
// Strip out bad HTML
policy := getSanitizationPolicy()
policy.RequireNoFollowOnLinks(!skipNoFollow)
outHTML := string(policy.SanitizeBytes(md))
// Strip newlines on certain block elements that render with them
outHTML = blockReg.ReplaceAllString(outHTML, "<$1>")
outHTML = endBlockReg.ReplaceAllString(outHTML, "$1>$2>")
outHTML = disableYoutubeAutoplay(outHTML)
return outHTML
}
func applyBasicMarkdown(data []byte) string {
if len(bytes.TrimSpace(data)) == 0 {
return ""
}
mdExtensions := 0 |
blackfriday.EXTENSION_STRIKETHROUGH |
blackfriday.EXTENSION_SPACE_HEADERS |
blackfriday.EXTENSION_HEADER_IDS
htmlFlags := 0 |
blackfriday.HTML_SKIP_HTML |
blackfriday.HTML_USE_SMARTYPANTS |
blackfriday.HTML_SMARTYPANTS_DASHES
// Generate Markdown
// This passes the supplied title into blackfriday.Markdown() as an H1 header, so we only render HTML that
// belongs in an H1.
md := blackfriday.Markdown(append([]byte("# "), data...), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions)
// Remove H1 markup
md = bytes.TrimSpace(md) // blackfriday.Markdown adds a newline at the end of the
if len(md) == 0 {
return ""
}
md = md[len("") : len(md)-len(" ")]
// Strip out bad HTML
policy := bluemonday.UGCPolicy()
policy.AllowAttrs("class", "id").Globally()
outHTML := string(policy.SanitizeBytes(md))
outHTML = markeddownReg.ReplaceAllString(outHTML, "$1")
outHTML = strings.TrimRightFunc(outHTML, unicode.IsSpace)
return outHTML
}
func postTitle(content, friendlyId string) string {
const maxTitleLen = 80
content = stripHTMLWithoutEscaping(content)
content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace)
eol := strings.IndexRune(content, '\n')
blankLine := strings.Index(content, "\n\n")
if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen {
return strings.TrimSpace(content[:blankLine])
} else if utf8.RuneCountInString(content) <= maxTitleLen {
return content
}
return friendlyId
}
// TODO: fix duplicated code from postTitle. postTitle is a widely used func we
// don't have time to investigate right now.
func friendlyPostTitle(content, friendlyId string) string {
const maxTitleLen = 80
content = stripHTMLWithoutEscaping(content)
content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace)
eol := strings.IndexRune(content, '\n')
blankLine := strings.Index(content, "\n\n")
if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen {
return strings.TrimSpace(content[:blankLine])
} else if eol == -1 && utf8.RuneCountInString(content) <= maxTitleLen {
return content
}
title, truncd := parse.TruncToWord(parse.PostLede(content, true), maxTitleLen)
if truncd {
title += "..."
}
return title
}
// Strip HTML tags with bluemonday's StrictPolicy, then unescape the HTML
// entities added in by sanitizing the content.
func stripHTMLWithoutEscaping(content string) string {
return html.UnescapeString(bluemonday.StrictPolicy().Sanitize(content))
}
func getSanitizationPolicy() *bluemonday.Policy {
policy := bluemonday.UGCPolicy()
policy.AllowAttrs("src", "style").OnElements("iframe", "video", "audio")
policy.AllowAttrs("src", "type").OnElements("source")
policy.AllowAttrs("frameborder", "width", "height").Matching(bluemonday.Integer).OnElements("iframe")
policy.AllowAttrs("allowfullscreen").OnElements("iframe")
policy.AllowAttrs("controls", "loop", "muted", "autoplay").OnElements("video")
policy.AllowAttrs("controls", "loop", "muted", "autoplay", "preload").OnElements("audio")
policy.AllowAttrs("target").OnElements("a")
policy.AllowAttrs("title").OnElements("abbr")
policy.AllowAttrs("style", "class", "id").Globally()
policy.AllowElements("header", "footer")
policy.AllowURLSchemes("http", "https", "mailto", "xmpp")
return policy
}
func sanitizePost(content string) string {
return strings.Replace(content, "<", "<", -1)
}
// postDescription generates a description based on the given post content,
// title, and post ID. This doesn't consider a V2 post field, `title` when
// choosing what to generate. In case a post has a title, this function will
// fail, and logic should instead be implemented to skip this when there's no
// title, like so:
// var desc string
// if title == "" {
// desc = postDescription(content, title, friendlyId)
// } else {
// desc = shortPostDescription(content)
// }
func postDescription(content, title, friendlyId string) string {
maxLen := 140
if content == "" {
content = "WriteFreely is a painless, simple, federated blogging platform."
} else {
fmtStr := "%s"
truncation := 0
if utf8.RuneCountInString(content) > maxLen {
// Post is longer than the max description, so let's show a better description
fmtStr = "%s..."
truncation = 3
}
if title == friendlyId {
// No specific title was found; simply truncate the post, starting at the beginning
content = fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1))
} else {
// There was a title, so return a real description
blankLine := strings.Index(content, "\n\n")
if blankLine < 0 {
blankLine = 0
}
truncd := stringmanip.Substring(content, blankLine, blankLine+maxLen-truncation)
contentNoNL := strings.Replace(truncd, "\n", " ", -1)
content = strings.TrimSpace(fmt.Sprintf(fmtStr, contentNoNL))
}
}
return content
}
func shortPostDescription(content string) string {
maxLen := 140
fmtStr := "%s"
truncation := 0
if utf8.RuneCountInString(content) > maxLen {
// Post is longer than the max description, so let's show a better description
fmtStr = "%s..."
truncation = 3
}
return strings.TrimSpace(fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1)))
}
func handleRenderMarkdown(app *App, w http.ResponseWriter, r *http.Request) error {
if !IsJSON(r) {
return impart.HTTPError{Status: http.StatusUnsupportedMediaType, Message: "Markdown API only supports JSON requests"}
}
in := struct {
CollectionURL string `json:"collection_url"`
RawBody string `json:"raw_body"`
}{}
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&in)
if err != nil {
log.Error("Couldn't parse markdown JSON request: %v", err)
return ErrBadJSON
}
out := struct {
Body string `json:"body"`
}{
Body: applyMarkdown([]byte(in.RawBody), in.CollectionURL, app.cfg),
}
return impart.WriteSuccess(w, out, http.StatusOK)
}
diff --git a/postrender_test.go b/postrender_test.go
index 531c0f1..ec6bbdd 100644
--- a/postrender_test.go
+++ b/postrender_test.go
@@ -1,43 +1,43 @@
/*
- * Copyright © 2021 A Bunch Tell LLC.
+ * Copyright © 2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import "testing"
func TestApplyBasicMarkdown(t *testing.T) {
tests := []struct {
name string
in string
result string
}{
{"empty", "", ""},
{"empty spaces", " ", ""},
{"empty tabs", "\t", ""},
{"empty newline", "\n", ""},
{"nums", "123", "123"},
{"dot", ".", "."},
{"dash", "-", "-"},
{"plain", "Hello, World!", "Hello, World!"},
{"multibyte", "こんにちは", `こんにちは`},
{"bold", "**안녕하세요**", `안녕하세요 `},
{"link", "[WriteFreely](https://writefreely.org)", `WriteFreely `},
{"date", "12. April", `12. April`},
{"table", "| Hi | There |", `| Hi | There |`},
}
for _, test := range tests {
t.Run(test.name, func(t *testing.T) {
res := applyBasicMarkdown([]byte(test.in))
if res != test.result {
t.Errorf("%s: wanted %s, got %s", test.name, test.result, res)
}
})
}
}
diff --git a/posts.go b/posts.go
index ed3f5e4..e95532e 100644
--- a/posts.go
+++ b/posts.go
@@ -1,1641 +1,1641 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"fmt"
"html/template"
"net/http"
"net/url"
"regexp"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/guregu/null"
"github.com/guregu/null/zero"
"github.com/kylemcc/twitter-text-go/extract"
"github.com/microcosm-cc/bluemonday"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/impart"
"github.com/writeas/monday"
"github.com/writeas/slug"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/bots"
"github.com/writeas/web-core/converter"
"github.com/writeas/web-core/i18n"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/tags"
"github.com/writefreely/writefreely/page"
"github.com/writefreely/writefreely/parse"
)
const (
// Post ID length bounds
minIDLen = 10
maxIDLen = 10
userPostIDLen = 10
postIDLen = 10
postMetaDateFormat = "2006-01-02 15:04:05"
shortCodePaid = ""
)
type (
AnonymousPost struct {
ID string
Content string
HTMLContent template.HTML
Font string
Language string
Direction string
Title string
GenTitle string
Description string
Author string
Views int64
Images []string
IsPlainText bool
IsCode bool
IsLinkable bool
}
AuthenticatedPost struct {
ID string `json:"id" schema:"id"`
Web bool `json:"web" schema:"web"`
*SubmittedPost
}
// SubmittedPost represents a post supplied by a client for publishing or
// updating. Since Title and Content can be updated to "", they are
// pointers that can be easily tested to detect changes.
SubmittedPost struct {
Slug *string `json:"slug" schema:"slug"`
Title *string `json:"title" schema:"title"`
Content *string `json:"body" schema:"body"`
Font string `json:"font" schema:"font"`
IsRTL converter.NullJSONBool `json:"rtl" schema:"rtl"`
Language converter.NullJSONString `json:"lang" schema:"lang"`
Created *string `json:"created" schema:"created"`
}
// Post represents a post as found in the database.
Post struct {
ID string `db:"id" json:"id"`
Slug null.String `db:"slug" json:"slug,omitempty"`
Font string `db:"text_appearance" json:"appearance"`
Language zero.String `db:"language" json:"language"`
RTL zero.Bool `db:"rtl" json:"rtl"`
Privacy int64 `db:"privacy" json:"-"`
OwnerID null.Int `db:"owner_id" json:"-"`
CollectionID null.Int `db:"collection_id" json:"-"`
PinnedPosition null.Int `db:"pinned_position" json:"-"`
Created time.Time `db:"created" json:"created"`
Updated time.Time `db:"updated" json:"updated"`
ViewCount int64 `db:"view_count" json:"-"`
Title zero.String `db:"title" json:"title"`
HTMLTitle template.HTML `db:"title" json:"-"`
Content string `db:"content" json:"body"`
HTMLContent template.HTML `db:"content" json:"-"`
HTMLExcerpt template.HTML `db:"content" json:"-"`
Tags []string `json:"tags"`
Images []string `json:"images,omitempty"`
IsPaid bool `json:"paid"`
OwnerName string `json:"owner,omitempty"`
}
// PublicPost holds properties for a publicly returned post, i.e. a post in
// a context where the viewer may not be the owner. As such, sensitive
// metadata for the post is hidden and properties supporting the display of
// the post are added.
PublicPost struct {
*Post
IsSubdomain bool `json:"-"`
IsTopLevel bool `json:"-"`
DisplayDate string `json:"-"`
Views int64 `json:"views"`
Owner *PublicUser `json:"-"`
IsOwner bool `json:"-"`
URL string `json:"url,omitempty"`
Collection *CollectionObj `json:"collection,omitempty"`
}
CollectionPostPage struct {
*PublicPost
page.StaticPage
IsOwner bool
IsPinned bool
IsCustomDomain bool
Monetization string
PinnedPosts *[]PublicPost
IsFound bool
IsAdmin bool
CanInvite bool
Silenced bool
// Helper field for Chorus mode
CollAlias string
}
RawPost struct {
Id, Slug string
Title string
Content string
Views int64
Font string
Created time.Time
Updated time.Time
IsRTL sql.NullBool
Language sql.NullString
OwnerID int64
CollectionID sql.NullInt64
Found bool
Gone bool
}
AnonymousAuthPost struct {
ID string `json:"id"`
Token string `json:"token"`
}
ClaimPostRequest struct {
*AnonymousAuthPost
CollectionAlias string `json:"collection"`
CreateCollection bool `json:"create_collection"`
// Generated properties
Slug string `json:"-"`
}
ClaimPostResult struct {
ID string `json:"id,omitempty"`
Code int `json:"code,omitempty"`
ErrorMessage string `json:"error_msg,omitempty"`
Post *PublicPost `json:"post,omitempty"`
}
)
func (p *Post) Direction() string {
if p.RTL.Valid {
if p.RTL.Bool {
return "rtl"
}
return "ltr"
}
return "auto"
}
// DisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) DisplayTitle() string {
if p.Title.String != "" {
return p.Title.String
}
t := friendlyPostTitle(p.Content, p.ID)
return t
}
// PlainDisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) PlainDisplayTitle() string {
if t := stripmd.Strip(p.DisplayTitle()); t != "" {
return t
}
return p.ID
}
// FormattedDisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) FormattedDisplayTitle() template.HTML {
if p.HTMLTitle != "" {
return p.HTMLTitle
}
return template.HTML(p.DisplayTitle())
}
// Summary gives a shortened summary of the post based on the post's title,
// especially for display in a longer list of posts. It extracts a summary for
// posts in the Title\n\nBody format, returning nothing if the entire was short
// enough that the extracted title == extracted summary.
func (p Post) Summary() string {
if p.Content == "" {
return ""
}
p.Content = stripHTMLWithoutEscaping(p.Content)
// and Markdown
p.Content = stripmd.StripOptions(p.Content, stripmd.Options{SkipImages: true})
title := p.Title.String
var desc string
if title == "" {
// No title, so generate one
title = friendlyPostTitle(p.Content, p.ID)
desc = postDescription(p.Content, title, p.ID)
if desc == title {
return ""
}
return desc
}
return shortPostDescription(p.Content)
}
func (p Post) SummaryHTML() template.HTML {
return template.HTML(p.Summary())
}
// Excerpt shows any text that comes before a (more) tag.
// TODO: use HTMLExcerpt in templates instead of this method
func (p *Post) Excerpt() template.HTML {
return p.HTMLExcerpt
}
func (p *Post) CreatedDate() string {
return p.Created.Format("2006-01-02")
}
func (p *Post) Created8601() string {
return p.Created.Format("2006-01-02T15:04:05Z")
}
func (p *Post) IsScheduled() bool {
return p.Created.After(time.Now())
}
func (p *Post) HasTag(tag string) bool {
// Regexp looks for tag and has a non-capturing group at the end looking
// for the end of the word.
// Assisted by: https://stackoverflow.com/a/35192941/1549194
hasTag, _ := regexp.MatchString("#"+tag+`(?:[[:punct:]]|\s|\z)`, p.Content)
return hasTag
}
func (p *Post) HasTitleLink() bool {
if p.Title.String == "" {
return false
}
hasLink, _ := regexp.MatchString(`([^!]+|^)\[.+\]\(.+\)`, p.Title.String)
return hasLink
}
func (c CollectionPostPage) DisplayMonetization() string {
if c.Collection == nil {
log.Info("CollectionPostPage.DisplayMonetization: c.Collection is nil")
return ""
}
return displayMonetization(c.Monetization, c.Collection.Alias)
}
func handleViewPost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
friendlyID := vars["post"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw() and viewCollectionPost()
isJSON := strings.HasSuffix(friendlyID, ".json")
isXML := strings.HasSuffix(friendlyID, ".xml")
isCSS := strings.HasSuffix(friendlyID, ".css")
isMarkdown := strings.HasSuffix(friendlyID, ".md")
isRaw := strings.HasSuffix(friendlyID, ".txt") || isJSON || isXML || isCSS || isMarkdown
// Display reserved page if that is requested resource
if t, ok := pages[r.URL.Path[1:]+".tmpl"]; ok {
return handleTemplatedPage(app, w, r, t)
} else if (strings.Contains(r.URL.Path, ".") && !isRaw && !isMarkdown) || r.URL.Path == "/robots.txt" || r.URL.Path == "/manifest.json" {
// Serve static file
app.shttp.ServeHTTP(w, r)
return nil
}
// Display collection if this is a collection
c, _ := app.db.GetCollection(friendlyID)
if c != nil {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", friendlyID)}
}
// Normalize the URL, redirecting user to consistent post URL
if friendlyID != strings.ToLower(friendlyID) {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s", strings.ToLower(friendlyID))}
}
ext := ""
if isRaw {
parts := strings.Split(friendlyID, ".")
friendlyID = parts[0]
if len(parts) > 1 {
ext = "." + parts[1]
}
}
var ownerID sql.NullInt64
var title string
var content string
var font string
var language []byte
var rtl []byte
var views int64
var post *AnonymousPost
var found bool
var gone bool
fixedID := slug.Make(friendlyID)
if fixedID != friendlyID {
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/%s%s", fixedID, ext)}
}
err := app.db.QueryRow(fmt.Sprintf("SELECT owner_id, title, content, text_appearance, view_count, language, rtl FROM posts WHERE id = ?"), friendlyID).Scan(&ownerID, &title, &content, &font, &views, &language, &rtl)
switch {
case err == sql.ErrNoRows:
found = false
// Output the error in the correct format
if isJSON {
content = "{\"error\": \"Post not found.\"}"
} else if isRaw {
content = "Post not found."
} else {
return ErrPostNotFound
}
case err != nil:
found = false
log.Error("Post loading err: %s\n", err)
return ErrInternalGeneral
default:
found = true
var d string
if len(rtl) == 0 {
d = "auto"
} else if rtl[0] == 49 {
// TODO: find a cleaner way to get this (possibly NULL) value
d = "rtl"
} else {
d = "ltr"
}
generatedTitle := friendlyPostTitle(content, friendlyID)
sanitizedContent := content
if font != "code" {
sanitizedContent = template.HTMLEscapeString(content)
}
var desc string
if title == "" {
desc = postDescription(content, title, friendlyID)
} else {
desc = shortPostDescription(content)
}
post = &AnonymousPost{
ID: friendlyID,
Content: sanitizedContent,
Title: title,
GenTitle: generatedTitle,
Description: desc,
Author: "",
Font: font,
IsPlainText: isRaw,
IsCode: font == "code",
IsLinkable: font != "code",
Views: views,
Language: string(language),
Direction: d,
}
if !isRaw {
post.HTMLContent = template.HTML(applyMarkdown([]byte(content), "", app.cfg))
post.Images = extractImages(post.Content)
}
}
var silenced bool
if found {
silenced, err = app.db.IsUserSilenced(ownerID.Int64)
if err != nil {
log.Error("view post: %v", err)
}
}
// Check if post has been unpublished
if title == "" && content == "" {
gone = true
if isJSON {
content = "{\"error\": \"Post was unpublished.\"}"
} else if isCSS {
content = ""
} else if isRaw {
content = "Post was unpublished."
} else {
return ErrPostUnpublished
}
}
var u = &User{}
if isRaw {
contentType := "text/plain"
if isJSON {
contentType = "application/json"
} else if isCSS {
contentType = "text/css"
} else if isXML {
contentType = "application/xml"
} else if isMarkdown {
contentType = "text/markdown"
}
w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
if isMarkdown && post.Title != "" {
fmt.Fprintf(w, "%s\n", post.Title)
for i := 1; i <= len(post.Title); i++ {
fmt.Fprintf(w, "=")
}
fmt.Fprintf(w, "\n\n")
}
fmt.Fprint(w, content)
if !found {
return ErrPostNotFound
} else if gone {
return ErrPostUnpublished
}
} else {
var err error
page := struct {
*AnonymousPost
page.StaticPage
Username string
IsOwner bool
SiteURL string
Silenced bool
}{
AnonymousPost: post,
StaticPage: pageForReq(app, r),
SiteURL: app.cfg.App.Host,
}
if u = getUserSession(app, r); u != nil {
page.Username = u.Username
page.IsOwner = ownerID.Valid && ownerID.Int64 == u.ID
}
if !page.IsOwner && silenced {
return ErrPostNotFound
}
page.Silenced = silenced
err = templates["post"].ExecuteTemplate(w, "post", page)
if err != nil {
log.Error("Post template execute error: %v", err)
}
}
go func() {
if u != nil && ownerID.Valid && ownerID.Int64 == u.ID {
// Post is owned by someone; skip view increment since that person is viewing this post.
return
}
// Update stats for non-raw post views
if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE id = ?", friendlyID)
if err != nil {
log.Error("Unable to update posts count: %v", err)
}
}
}()
return nil
}
// API v2 funcs
// newPost creates a new post with or without an owning Collection.
//
// Endpoints:
// /posts
// /posts?collection={alias}
// ? /collections/{alias}/posts
func newPost(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
collAlias := vars["alias"]
if collAlias == "" {
collAlias = r.FormValue("collection")
}
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
// TODO: remove this
accessToken = r.FormValue("access_token")
}
// FIXME: determine web submission with Content-Type header
var u *User
var userID int64 = -1
var username string
if accessToken == "" {
u = getUserSession(app, r)
if u != nil {
userID = u.ID
username = u.Username
}
} else {
userID = app.db.GetUserID(accessToken)
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("new post: %v", err)
}
if silenced {
return ErrUserSilenced
}
if userID == -1 {
return ErrNotLoggedIn
}
if accessToken == "" && u == nil && collAlias != "" {
return impart.HTTPError{http.StatusBadRequest, "Parameter `access_token` required."}
}
// Get post data
var p *SubmittedPost
if reqJSON {
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&p)
if err != nil {
log.Error("Couldn't parse new post JSON request: %v\n", err)
return ErrBadJSON
}
if p.Title == nil {
t := ""
p.Title = &t
}
if strings.TrimSpace(*(p.Title)) == "" && (p.Content == nil || strings.TrimSpace(*(p.Content)) == "") {
return ErrNoPublishableContent
}
if p.Content == nil {
c := ""
p.Content = &c
}
} else {
post := r.FormValue("body")
appearance := r.FormValue("font")
title := r.FormValue("title")
rtlValue := r.FormValue("rtl")
langValue := r.FormValue("lang")
if strings.TrimSpace(post) == "" {
return ErrNoPublishableContent
}
var isRTL, rtlValid bool
if rtlValue == "auto" && langValue != "" {
isRTL = i18n.LangIsRTL(langValue)
rtlValid = true
} else {
isRTL = rtlValue == "true"
rtlValid = rtlValue != "" && langValue != ""
}
// Create a new post
p = &SubmittedPost{
Title: &title,
Content: &post,
Font: appearance,
IsRTL: converter.NullJSONBool{sql.NullBool{Bool: isRTL, Valid: rtlValid}},
Language: converter.NullJSONString{sql.NullString{String: langValue, Valid: langValue != ""}},
}
}
if !p.isFontValid() {
p.Font = "norm"
}
var newPost *PublicPost = &PublicPost{}
var coll *Collection
if accessToken != "" {
newPost, err = app.db.CreateOwnedPost(p, accessToken, collAlias, app.cfg.App.Host)
} else {
//return ErrNotLoggedIn
// TODO: verify user is logged in
var collID int64
if collAlias != "" {
coll, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
coll.hostName = app.cfg.App.Host
if coll.OwnerID != u.ID {
return ErrForbiddenCollection
}
collID = coll.ID
}
// TODO: return PublicPost from createPost
newPost.Post, err = app.db.CreatePost(userID, collID, p)
}
if err != nil {
return err
}
if coll != nil {
coll.ForPublic()
newPost.Collection = &CollectionObj{Collection: *coll}
}
newPost.extractData()
newPost.OwnerName = username
newPost.URL = newPost.CanonicalURL(app.cfg.App.Host)
// Write success now
response := impart.WriteSuccess(w, newPost, http.StatusCreated)
if newPost.Collection != nil && !app.cfg.App.Private && app.cfg.App.Federation && !newPost.Created.After(time.Now()) {
go federatePost(app, newPost, newPost.Collection.ID, false)
}
return response
}
func existingPost(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
postID := vars["post"]
p := AuthenticatedPost{ID: postID}
var err error
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&p)
if err != nil {
log.Error("Couldn't parse post update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err = r.ParseForm()
if err != nil {
log.Error("Couldn't parse post update form request: %v\n", err)
return ErrBadFormData
}
// Can't decode to a nil SubmittedPost property, so create instance now
p.SubmittedPost = &SubmittedPost{}
err = app.formDecoder.Decode(&p, r.PostForm)
if err != nil {
log.Error("Couldn't decode post update form request: %v\n", err)
return ErrBadFormData
}
}
if p.Web {
p.IsRTL.Valid = true
}
if p.SubmittedPost == nil {
return ErrPostNoUpdatableVals
}
// Ensure an access token was given
accessToken := r.Header.Get("Authorization")
// Get user's cookie session if there's no token
var u *User
//var username string
if accessToken == "" {
u = getUserSession(app, r)
if u != nil {
//username = u.Username
}
}
if u == nil && accessToken == "" {
return ErrNoAccessToken
}
// Get user ID from current session or given access token, if one was given.
var userID int64
if u != nil {
userID = u.ID
} else if accessToken != "" {
userID, err = AuthenticateUser(app.db, accessToken)
if err != nil {
return err
}
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("existing post: %v", err)
}
if silenced {
return ErrUserSilenced
}
// Modify post struct
p.ID = postID
err = app.db.UpdateOwnedPost(&p, userID)
if err != nil {
if reqJSON {
return err
}
if err, ok := err.(impart.HTTPError); ok {
addSessionFlash(app, w, r, err.Message, nil)
} else {
addSessionFlash(app, w, r, err.Error(), nil)
}
}
var pRes *PublicPost
pRes, err = app.db.GetPost(p.ID, 0)
if reqJSON {
if err != nil {
return err
}
pRes.extractData()
}
if pRes.CollectionID.Valid {
coll, err := app.db.GetCollectionBy("id = ?", pRes.CollectionID.Int64)
if err == nil && !app.cfg.App.Private && app.cfg.App.Federation {
coll.hostName = app.cfg.App.Host
pRes.Collection = &CollectionObj{Collection: *coll}
go federatePost(app, pRes, pRes.Collection.ID, true)
}
}
// Write success now
if reqJSON {
return impart.WriteSuccess(w, pRes, http.StatusOK)
}
addSessionFlash(app, w, r, "Changes saved.", nil)
collectionAlias := vars["alias"]
redirect := "/" + postID + "/meta"
if collectionAlias != "" {
collPre := "/" + collectionAlias
if app.cfg.App.SingleUser {
collPre = ""
}
redirect = collPre + "/" + pRes.Slug.String + "/edit/meta"
} else {
if app.cfg.App.SingleUser {
redirect = "/d" + redirect
}
}
w.Header().Set("Location", redirect)
w.WriteHeader(http.StatusFound)
return nil
}
func deletePost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
friendlyID := vars["post"]
editToken := r.FormValue("token")
var ownerID int64
var u *User
accessToken := r.Header.Get("Authorization")
if accessToken == "" && editToken == "" {
u = getUserSession(app, r)
if u == nil {
return ErrNoAccessToken
}
}
var res sql.Result
var t *sql.Tx
var err error
var collID sql.NullInt64
var coll *Collection
var pp *PublicPost
if editToken != "" {
// TODO: SELECT owner_id, as well, and return appropriate error if NULL instead of running two queries
var dummy int64
err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ?", friendlyID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return impart.HTTPError{http.StatusNotFound, "Post not found."}
}
err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND owner_id IS NULL", friendlyID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
// Post already has an owner. This could provide a bad experience
// for the user, but it's more important to ensure data isn't lost
// unexpectedly. So prevent deletion via token.
return impart.HTTPError{http.StatusConflict, "This post belongs to some user (hopefully yours). Please log in and delete it from that user's account."}
}
res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND modify_token = ? AND owner_id IS NULL", friendlyID, editToken)
} else if accessToken != "" || u != nil {
// Caller provided some way to authenticate; assume caller expects the
// post to be deleted based on a specific post owner, thus we should
// return corresponding errors.
if accessToken != "" {
ownerID = app.db.GetUserID(accessToken)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
ownerID = u.ID
}
// TODO: don't make two queries
var realOwnerID sql.NullInt64
err = app.db.QueryRow("SELECT collection_id, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&collID, &realOwnerID)
if err != nil {
return err
}
if !collID.Valid {
// There's no collection; simply delete the post
res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
} else {
// Post belongs to a collection; do any additional clean up
coll, err = app.db.GetCollectionBy("id = ?", collID.Int64)
if err != nil {
log.Error("Unable to get collection: %v", err)
return err
}
if app.cfg.App.Federation {
// First fetch full post for federation
pp, err = app.db.GetOwnedPost(friendlyID, ownerID)
if err != nil {
log.Error("Unable to get owned post: %v", err)
return err
}
collObj := &CollectionObj{Collection: *coll}
pp.Collection = collObj
}
t, err = app.db.Begin()
if err != nil {
log.Error("No begin: %v", err)
return err
}
res, err = t.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
}
} else {
return impart.HTTPError{http.StatusBadRequest, "No authenticated user or post token given."}
}
if err != nil {
return err
}
affected, err := res.RowsAffected()
if err != nil {
if t != nil {
t.Rollback()
log.Error("Rows affected err! Rolling back")
}
return err
} else if affected == 0 {
if t != nil {
t.Rollback()
log.Error("No rows affected! Rolling back")
}
return impart.HTTPError{http.StatusForbidden, "Post not found, or you're not the owner."}
}
if t != nil {
t.Commit()
}
if coll != nil && !app.cfg.App.Private && app.cfg.App.Federation {
go deleteFederatedPost(app, pp, collID.Int64)
}
return impart.HTTPError{Status: http.StatusNoContent}
}
// addPost associates a post with the authenticated user.
func addPost(app *App, w http.ResponseWriter, r *http.Request) error {
var ownerID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
ownerID = app.db.GetUserID(at)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
ownerID = u.ID
}
silenced, err := app.db.IsUserSilenced(ownerID)
if err != nil {
log.Error("add post: %v", err)
}
if silenced {
return ErrUserSilenced
}
// Parse claimed posts in format:
// [{"id": "...", "token": "..."}]
var claims *[]ClaimPostRequest
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&claims)
if err != nil {
return ErrBadJSONArray
}
vars := mux.Vars(r)
collAlias := vars["alias"]
// Update all given posts
res, err := app.db.ClaimPosts(app.cfg, ownerID, collAlias, claims)
if err != nil {
return err
}
if !app.cfg.App.Private && app.cfg.App.Federation {
for _, pRes := range *res {
if pRes.Code != http.StatusOK {
continue
}
if !pRes.Post.Created.After(time.Now()) {
pRes.Post.Collection.hostName = app.cfg.App.Host
go federatePost(app, pRes.Post, pRes.Post.Collection.ID, false)
}
}
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
func dispersePost(app *App, w http.ResponseWriter, r *http.Request) error {
var ownerID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
ownerID = app.db.GetUserID(at)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
ownerID = u.ID
}
// Parse posts in format:
// ["..."]
var postIDs []string
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&postIDs)
if err != nil {
return ErrBadJSONArray
}
// Update all given posts
res, err := app.db.DispersePosts(ownerID, postIDs)
if err != nil {
return err
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
type (
PinPostResult struct {
ID string `json:"id,omitempty"`
Code int `json:"code,omitempty"`
ErrorMessage string `json:"error_msg,omitempty"`
}
)
// pinPost pins a post to a blog
func pinPost(app *App, w http.ResponseWriter, r *http.Request) error {
var userID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
userID = app.db.GetUserID(at)
if userID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
userID = u.ID
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("pin post: %v", err)
}
if silenced {
return ErrUserSilenced
}
// Parse request
var posts []struct {
ID string `json:"id"`
Position int64 `json:"position"`
}
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&posts)
if err != nil {
return ErrBadJSONArray
}
// Validate data
vars := mux.Vars(r)
collAlias := vars["alias"]
coll, err := app.db.GetCollection(collAlias)
if err != nil {
return err
}
if coll.OwnerID != userID {
return ErrForbiddenCollection
}
// Do (un)pinning
isPinning := r.URL.Path[strings.LastIndex(r.URL.Path, "/"):] == "/pin"
res := []PinPostResult{}
for _, p := range posts {
err = app.db.UpdatePostPinState(isPinning, p.ID, coll.ID, userID, p.Position)
ppr := PinPostResult{ID: p.ID}
if err != nil {
ppr.Code = http.StatusInternalServerError
// TODO: set error messsage
} else {
ppr.Code = http.StatusOK
}
res = append(res, ppr)
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
func fetchPost(app *App, w http.ResponseWriter, r *http.Request) error {
var collID int64
var coll *Collection
var err error
vars := mux.Vars(r)
if collAlias := vars["alias"]; collAlias != "" {
// Fetch collection information, since an alias is provided
coll, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
collID = coll.ID
}
p, err := app.db.GetPost(vars["post"], collID)
if err != nil {
return err
}
if coll == nil && p.CollectionID.Valid {
// Collection post is getting fetched by post ID, not coll alias + post slug, so get coll info now.
coll, err = app.db.GetCollectionByID(p.CollectionID.Int64)
if err != nil {
return err
}
}
if coll != nil {
coll.hostName = app.cfg.App.Host
_, err = apiCheckCollectionPermissions(app, r, coll)
if err != nil {
return err
}
}
silenced, err := app.db.IsUserSilenced(p.OwnerID.Int64)
if err != nil {
log.Error("fetch post: %v", err)
}
if silenced {
return ErrPostNotFound
}
p.extractData()
accept := r.Header.Get("Accept")
if strings.Contains(accept, "application/activity+json") {
if coll == nil {
// This is a draft post; 404 for now
// TODO: return ActivityObject
return impart.HTTPError{http.StatusNotFound, ""}
}
p.Collection = &CollectionObj{Collection: *coll}
po := p.ActivityObject(app)
po.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, po, http.StatusOK)
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func fetchPostProperty(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
p, err := app.db.GetPostProperty(vars["post"], 0, vars["property"])
if err != nil {
return err
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func (p *Post) processPost() PublicPost {
res := &PublicPost{Post: p, Views: 0}
res.Views = p.ViewCount
// TODO: move to own function
loc := monday.FuzzyLocale(p.Language.String)
res.DisplayDate = monday.Format(p.Created, monday.LongFormatsByLocale[loc], loc)
return *res
}
func (p *PublicPost) CanonicalURL(hostName string) string {
if p.Collection == nil || p.Collection.Alias == "" {
return hostName + "/" + p.ID + ".md"
}
return p.Collection.CanonicalURL() + p.Slug.String
}
func (p *PublicPost) ActivityObject(app *App) *activitystreams.Object {
cfg := app.cfg
var o *activitystreams.Object
if cfg.App.NotesOnly || strings.Index(p.Content, "\n\n") == -1 {
o = activitystreams.NewNoteObject()
} else {
o = activitystreams.NewArticleObject()
}
o.ID = p.Collection.FederatedAPIBase() + "api/posts/" + p.ID
o.Published = p.Created
o.URL = p.CanonicalURL(cfg.App.Host)
o.AttributedTo = p.Collection.FederatedAccount()
o.CC = []string{
p.Collection.FederatedAccount() + "/followers",
}
o.Name = p.DisplayTitle()
p.augmentContent()
if p.HTMLContent == template.HTML("") {
p.formatContent(cfg, false, false)
p.augmentReadingDestination()
}
o.Content = string(p.HTMLContent)
if p.Language.Valid {
o.ContentMap = map[string]string{
p.Language.String: string(p.HTMLContent),
}
}
if len(p.Tags) == 0 {
o.Tag = []activitystreams.Tag{}
} else {
var tagBaseURL string
if isSingleUser {
tagBaseURL = p.Collection.CanonicalURL() + "tag:"
} else {
if cfg.App.Chorus {
tagBaseURL = fmt.Sprintf("%s/read/t/", p.Collection.hostName)
} else {
tagBaseURL = fmt.Sprintf("%s/%s/tag:", p.Collection.hostName, p.Collection.Alias)
}
}
for _, t := range p.Tags {
o.Tag = append(o.Tag, activitystreams.Tag{
Type: activitystreams.TagHashtag,
HRef: tagBaseURL + t,
Name: "#" + t,
})
}
}
if len(p.Images) > 0 {
for _, i := range p.Images {
o.Attachment = append(o.Attachment, activitystreams.NewImageAttachment(i))
}
}
// Find mentioned users
mentionedUsers := make(map[string]string)
stripper := bluemonday.StrictPolicy()
content := stripper.Sanitize(p.Content)
mentions := mentionReg.FindAllString(content, -1)
for _, handle := range mentions {
actorIRI, err := app.db.GetProfilePageFromHandle(app, handle)
if err != nil {
log.Info("Couldn't find user '%s' locally or remotely", handle)
continue
}
mentionedUsers[handle] = actorIRI
}
for handle, iri := range mentionedUsers {
o.CC = append(o.CC, iri)
o.Tag = append(o.Tag, activitystreams.Tag{Type: "Mention", HRef: iri, Name: handle})
}
return o
}
// TODO: merge this into getSlugFromPost or phase it out
func getSlug(title, lang string) string {
return getSlugFromPost("", title, lang)
}
func getSlugFromPost(title, body, lang string) string {
if title == "" {
// Remove Markdown, so e.g. link URLs and image alt text don't make it into the slug
body = strings.TrimSpace(stripmd.StripOptions(body, stripmd.Options{SkipImages: true}))
title = postTitle(body, body)
}
title = parse.PostLede(title, false)
// Truncate lede if needed
title, _ = parse.TruncToWord(title, 80)
var s string
if lang != "" && len(lang) == 2 {
s = slug.MakeLang(title, lang)
} else {
s = slug.Make(title)
}
// Transliteration may cause the slug to expand past the limit, so truncate again
s, _ = parse.TruncToWord(s, 80)
return strings.TrimFunc(s, func(r rune) bool {
// TruncToWord doesn't respect words in a slug, since spaces are replaced
// with hyphens. So remove any trailing hyphens.
return r == '-'
})
}
// isFontValid returns whether or not the submitted post's appearance is valid.
func (p *SubmittedPost) isFontValid() bool {
validFonts := map[string]bool{
"norm": true,
"sans": true,
"mono": true,
"wrap": true,
"code": true,
}
_, valid := validFonts[p.Font]
return valid
}
func getRawPost(app *App, friendlyID string) *RawPost {
var content, font, title string
var isRTL sql.NullBool
var lang sql.NullString
var ownerID sql.NullInt64
var created, updated time.Time
err := app.db.QueryRow("SELECT title, content, text_appearance, language, rtl, created, updated, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&title, &content, &font, &lang, &isRTL, &created, &updated, &ownerID)
switch {
case err == sql.ErrNoRows:
return &RawPost{Content: "", Found: false, Gone: false}
case err != nil:
log.Error("Unable to fetch getRawPost: %s", err)
return &RawPost{Content: "", Found: true, Gone: false}
}
return &RawPost{
Title: title,
Content: content,
Font: font,
Created: created,
Updated: updated,
IsRTL: isRTL,
Language: lang,
OwnerID: ownerID.Int64,
Found: true,
Gone: content == "" && title == "",
}
}
// TODO; return a Post!
func getRawCollectionPost(app *App, slug, collAlias string) *RawPost {
var id, title, content, font string
var isRTL sql.NullBool
var lang sql.NullString
var created, updated time.Time
var ownerID null.Int
var views int64
var err error
if app.cfg.App.SingleUser {
err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = 1", slug).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID)
} else {
err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = (SELECT id FROM collections WHERE alias = ?)", slug, collAlias).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID)
}
switch {
case err == sql.ErrNoRows:
return &RawPost{Content: "", Found: false, Gone: false}
case err != nil:
log.Error("Unable to fetch getRawCollectionPost: %s", err)
return &RawPost{Content: "", Found: true, Gone: false}
}
return &RawPost{
Id: id,
Slug: slug,
Title: title,
Content: content,
Font: font,
Created: created,
Updated: updated,
IsRTL: isRTL,
Language: lang,
OwnerID: ownerID.Int64,
Found: true,
Gone: content == "" && title == "",
Views: views,
}
}
func isRaw(r *http.Request) bool {
vars := mux.Vars(r)
slug := vars["slug"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw in viewCollectionPost() and handleViewPost()
isJSON := strings.HasSuffix(slug, ".json")
isXML := strings.HasSuffix(slug, ".xml")
isMarkdown := strings.HasSuffix(slug, ".md")
return strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown
}
func viewCollectionPost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw() and handleViewPost()
isJSON := strings.HasSuffix(slug, ".json")
isXML := strings.HasSuffix(slug, ".xml")
isMarkdown := strings.HasSuffix(slug, ".md")
isRaw := strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
// Check for hellbanned users
u, err := checkUserForCollection(app, cr, r, true)
if err != nil {
return err
}
// Normalize the URL, redirecting user to consistent post URL
if slug != strings.ToLower(slug) {
loc := fmt.Sprintf("/%s", strings.ToLower(slug))
if !app.cfg.App.SingleUser {
loc = "/" + cr.alias + loc
}
return impart.HTTPError{http.StatusMovedPermanently, loc}
}
// Display collection if this is a collection
var c *Collection
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(cr.alias)
}
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
// Redirect if necessary
newAlias := app.db.GetCollectionRedirect(cr.alias)
if newAlias != "" {
return impart.HTTPError{http.StatusFound, "/" + newAlias + "/" + slug}
}
}
}
return err
}
c.hostName = app.cfg.App.Host
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view collection post: %v", err)
}
// Check collection permissions
if c.IsPrivate() && (u == nil || u.ID != c.OwnerID) {
return ErrPostNotFound
}
if c.IsProtected() && (u == nil || u.ID != c.OwnerID) {
if silenced {
return ErrPostNotFound
} else if !isAuthorizedForCollection(app, c.Alias, r) {
return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/?g=" + slug}
}
}
cr.isCollOwner = u != nil && c.OwnerID == u.ID
if isRaw {
slug = strings.Split(slug, ".")[0]
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := NewCollectionObj(c)
owner, err := app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
coll.Owner = owner
}
postFound := true
p, err := app.db.GetPost(slug, coll.ID)
if err != nil {
if err == ErrCollectionPageNotFound {
postFound = false
if slug == "feed" {
// User tried to access blog feed without a trailing slash, and
// there's no post with a slug "feed"
return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "feed/"}
}
po := &Post{
Slug: null.NewString(slug, true),
Font: "norm",
Language: zero.NewString("en", true),
RTL: zero.NewBool(false, true),
Content: ` This page is missing.
Are you sure it was ever here?`,
}
pp := po.processPost()
p = &pp
} else {
return err
}
}
// Check if the authenticated user is the post owner
p.IsOwner = u != nil && u.ID == p.OwnerID.Int64
p.Collection = coll
p.IsTopLevel = app.cfg.App.SingleUser
// Only allow a post owner or admin to view a post for silenced collections
if silenced && !p.IsOwner && (u == nil || !u.IsAdmin()) {
return ErrPostNotFound
}
// Check if post has been unpublished
if p.Content == "" && p.Title.String == "" {
return impart.HTTPError{http.StatusGone, "Post was unpublished."}
}
p.augmentContent()
// Serve collection post
if isRaw {
contentType := "text/plain"
if isJSON {
contentType = "application/json"
} else if isXML {
contentType = "application/xml"
} else if isMarkdown {
contentType = "text/markdown"
}
w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
if !postFound {
w.WriteHeader(http.StatusNotFound)
fmt.Fprintf(w, "Post not found.")
// TODO: return error instead, so status is correctly reflected in logs
return nil
}
if isMarkdown && p.Title.String != "" {
fmt.Fprintf(w, "# %s\n\n", p.Title.String)
}
fmt.Fprint(w, p.Content)
} else if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
if !postFound {
return ErrCollectionPageNotFound
}
p.extractData()
ap := p.ActivityObject(app)
ap.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ap, http.StatusOK)
} else {
p.extractData()
p.Content = strings.Replace(p.Content, "", "", 1)
// TODO: move this to function
p.formatContent(app.cfg, cr.isCollOwner, true)
tp := CollectionPostPage{
PublicPost: p,
StaticPage: pageForReq(app, r),
IsOwner: cr.isCollOwner,
IsCustomDomain: cr.isCustomDomain,
IsFound: postFound,
Silenced: silenced,
CollAlias: c.Alias,
}
tp.IsAdmin = u != nil && u.IsAdmin()
tp.CanInvite = canUserInvite(app.cfg, tp.IsAdmin)
tp.PinnedPosts, _ = app.db.GetPinnedPosts(coll, p.IsOwner)
tp.IsPinned = len(*tp.PinnedPosts) > 0 && PostsContains(tp.PinnedPosts, p)
tp.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
if !postFound {
w.WriteHeader(http.StatusNotFound)
}
postTmpl := "collection-post"
if app.cfg.App.Chorus {
postTmpl = "chorus-collection-post"
}
if err := templates[postTmpl].ExecuteTemplate(w, "post", tp); err != nil {
log.Error("Error in %s template: %v", postTmpl, err)
}
}
go func() {
if p.OwnerID.Valid {
// Post is owned by someone. Don't update stats if owner is viewing the post.
if u != nil && p.OwnerID.Int64 == u.ID {
return
}
}
// Update stats for non-raw post views
if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE slug = ? AND collection_id = ?", slug, coll.ID)
if err != nil {
log.Error("Unable to update posts count: %v", err)
}
}
}()
return nil
}
// TODO: move this to utils after making it more generic
func PostsContains(sl *[]PublicPost, s *PublicPost) bool {
for _, e := range *sl {
if e.ID == s.ID {
return true
}
}
return false
}
func (p *Post) extractData() {
p.Tags = tags.Extract(p.Content)
p.extractImages()
}
func (rp *RawPost) UserFacingCreated() string {
return rp.Created.Format(postMetaDateFormat)
}
func (rp *RawPost) Created8601() string {
return rp.Created.Format("2006-01-02T15:04:05Z")
}
func (rp *RawPost) Updated8601() string {
if rp.Updated.IsZero() {
return ""
}
return rp.Updated.Format("2006-01-02T15:04:05Z")
}
var imageURLRegex = regexp.MustCompile(`(?i)[^ ]+\.(gif|png|jpg|jpeg|image)$`)
func (p *Post) extractImages() {
p.Images = extractImages(p.Content)
}
func extractImages(content string) []string {
matches := extract.ExtractUrls(content)
urls := map[string]bool{}
for i := range matches {
uRaw := matches[i].Text
// Parse the extracted text so we can examine the path
u, err := url.Parse(uRaw)
if err != nil {
continue
}
// Ensure the path looks like it leads to an image file
if !imageURLRegex.MatchString(u.Path) {
continue
}
urls[uRaw] = true
}
resURLs := make([]string, 0)
for k := range urls {
resURLs = append(resURLs, k)
}
return resURLs
}
diff --git a/posts_test.go b/posts_test.go
index 0c9bc95..612c178 100644
--- a/posts_test.go
+++ b/posts_test.go
@@ -1,45 +1,45 @@
/*
- * Copyright © 2020-2021 A Bunch Tell LLC.
+ * Copyright © 2020-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely_test
import (
"testing"
"github.com/guregu/null/zero"
"github.com/stretchr/testify/assert"
"github.com/writefreely/writefreely"
)
func TestPostSummary(t *testing.T) {
testCases := map[string]struct {
given writefreely.Post
expected string
}{
"no special chars": {givenPost("Content."), "Content."},
"HTML content": {givenPost("Content with a
paragraph."), "Content with a paragraph."},
"content with escaped char": {givenPost("Content's all OK."), "Content's all OK."},
"multiline content": {givenPost(`Content
in
multiple
lines.`), "Content in multiple lines."},
}
for name, test := range testCases {
t.Run(name, func(t *testing.T) {
actual := test.given.Summary()
assert.Equal(t, test.expected, actual)
})
}
}
func givenPost(content string) writefreely.Post {
return writefreely.Post{Title: zero.StringFrom("Title"), Content: content}
}
diff --git a/read.go b/read.go
index f2706a9..a8c2352 100644
--- a/read.go
+++ b/read.go
@@ -1,342 +1,342 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"fmt"
"html/template"
"math"
"net/http"
"strconv"
"time"
. "github.com/gorilla/feeds"
"github.com/gorilla/mux"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/memo"
"github.com/writefreely/writefreely/page"
)
const (
tlFeedLimit = 100
tlAPIPageLimit = 10
tlMaxAuthorPosts = 5
tlPostsPerPage = 16
tlMaxPostCache = 250
tlCacheDur = 10 * time.Minute
)
type localTimeline struct {
m *memo.Memo
posts *[]PublicPost
// Configuration values
postsPerPage int
}
type readPublication struct {
page.StaticPage
Posts *[]PublicPost
CurrentPage int
TotalPages int
SelTopic string
IsAdmin bool
CanInvite bool
// Customizable page content
ContentTitle string
Content template.HTML
}
func initLocalTimeline(app *App) {
app.timeline = &localTimeline{
postsPerPage: tlPostsPerPage,
m: memo.New(app.FetchPublicPosts, tlCacheDur),
}
}
// satisfies memo.Func
func (app *App) FetchPublicPosts() (interface{}, error) {
// Conditions
limit := fmt.Sprintf("LIMIT %d", tlMaxPostCache)
// This is better than the hard limit when limiting posts from individual authors
// ageCond := `p.created >= ` + app.db.dateSub(3, "month") + ` AND `
// Finds all public posts and posts in a public collection published during the owner's active subscription period and within the last 3 months
rows, err := app.db.Query(`SELECT p.id, c.id, alias, c.title, p.slug, p.title, p.content, p.text_appearance, p.language, p.rtl, p.created, p.updated
FROM collections c
LEFT JOIN posts p ON p.collection_id = c.id
LEFT JOIN users u ON u.id = p.owner_id
WHERE c.privacy = 1 AND (p.created <= ` + app.db.now() + ` AND pinned_position IS NULL) AND u.status = 0
ORDER BY p.created DESC
` + limit)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts." + err.Error()}
}
defer rows.Close()
ap := map[string]uint{}
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
c := &Collection{}
var alias, title sql.NullString
err = rows.Scan(&p.ID, &c.ID, &alias, &title, &p.Slug, &p.Title, &p.Content, &p.Font, &p.Language, &p.RTL, &p.Created, &p.Updated)
if err != nil {
log.Error("[READ] Unable to scan row, skipping: %v", err)
continue
}
c.hostName = app.cfg.App.Host
isCollectionPost := alias.Valid
if isCollectionPost {
c.Alias = alias.String
if c.Alias != "" && ap[c.Alias] == tlMaxAuthorPosts {
// Don't add post if we've hit the post-per-author limit
continue
}
c.Public = true
c.Title = title.String
c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer")
}
p.extractData()
p.handlePremiumContent(c, false, false, app.cfg)
p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), "", app.cfg))
fp := p.processPost()
if isCollectionPost {
fp.Collection = &CollectionObj{Collection: *c}
}
posts = append(posts, fp)
ap[c.Alias]++
}
return posts, nil
}
func viewLocalTimelineAPI(app *App, w http.ResponseWriter, r *http.Request) error {
updateTimelineCache(app.timeline, false)
skip, _ := strconv.Atoi(r.FormValue("skip"))
posts := []PublicPost{}
for i := skip; i < skip+tlAPIPageLimit && i < len(*app.timeline.posts); i++ {
posts = append(posts, (*app.timeline.posts)[i])
}
return impart.WriteSuccess(w, posts, http.StatusOK)
}
func viewLocalTimeline(app *App, w http.ResponseWriter, r *http.Request) error {
if !app.cfg.App.LocalTimeline {
return impart.HTTPError{http.StatusNotFound, "Page doesn't exist."}
}
vars := mux.Vars(r)
var p int
page := 1
p, _ = strconv.Atoi(vars["page"])
if p > 0 {
page = p
}
return showLocalTimeline(app, w, r, page, vars["author"], vars["tag"])
}
// updateTimelineCache will reset and update the cache if it is stale or
// the boolean passed in is true.
func updateTimelineCache(tl *localTimeline, reset bool) {
if reset {
tl.m.Reset()
}
// Fetch posts if the cache is empty, has been reset or enough time has
// passed since last cache.
if tl.posts == nil || reset || tl.m.Invalidate() {
log.Info("[READ] Updating post cache")
postsInterfaces, err := tl.m.Get()
if err != nil {
log.Error("[READ] Unable to cache posts: %v", err)
} else {
castPosts := postsInterfaces.([]PublicPost)
tl.posts = &castPosts
}
}
}
func showLocalTimeline(app *App, w http.ResponseWriter, r *http.Request, page int, author, tag string) error {
updateTimelineCache(app.timeline, false)
pl := len(*(app.timeline.posts))
ttlPages := int(math.Ceil(float64(pl) / float64(app.timeline.postsPerPage)))
start := 0
if page > 1 {
start = app.timeline.postsPerPage * (page - 1)
if start > pl {
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/read/p/%d", ttlPages)}
}
}
end := app.timeline.postsPerPage * page
if end > pl {
end = pl
}
var posts []PublicPost
if author != "" {
posts = []PublicPost{}
for _, p := range *app.timeline.posts {
if author == "anonymous" {
if p.Collection == nil {
posts = append(posts, p)
}
} else if p.Collection != nil && p.Collection.Alias == author {
posts = append(posts, p)
}
}
} else if tag != "" {
posts = []PublicPost{}
for _, p := range *app.timeline.posts {
if p.HasTag(tag) {
posts = append(posts, p)
}
}
} else {
posts = *app.timeline.posts
posts = posts[start:end]
}
d := &readPublication{
StaticPage: pageForReq(app, r),
Posts: &posts,
CurrentPage: page,
TotalPages: ttlPages,
SelTopic: tag,
}
if app.cfg.App.Chorus {
u := getUserSession(app, r)
d.IsAdmin = u != nil && u.IsAdmin()
d.CanInvite = canUserInvite(app.cfg, d.IsAdmin)
}
c, err := getReaderSection(app)
if err != nil {
return err
}
d.ContentTitle = c.Title.String
d.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg))
err = templates["read"].ExecuteTemplate(w, "base", d)
if err != nil {
log.Error("Unable to render reader: %v", err)
fmt.Fprintf(w, ":(")
}
return nil
}
// NextPageURL provides a full URL for the next page of collection posts
func (c *readPublication) NextPageURL(n int) string {
return fmt.Sprintf("/read/p/%d", n+1)
}
// PrevPageURL provides a full URL for the previous page of collection posts,
// returning a /page/N result for pages >1
func (c *readPublication) PrevPageURL(n int) string {
if n == 2 {
// Previous page is 1; no need for /p/ prefix
return "/read"
}
return fmt.Sprintf("/read/p/%d", n-1)
}
// handlePostIDRedirect handles a route where a post ID is given and redirects
// the user to the canonical post URL.
func handlePostIDRedirect(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
postID := vars["post"]
p, err := app.db.GetPost(postID, 0)
if err != nil {
return err
}
if !p.CollectionID.Valid {
// No collection; send to normal URL
// NOTE: not handling single user blogs here since this handler is only used for the Reader
return impart.HTTPError{http.StatusFound, app.cfg.App.Host + "/" + postID + ".md"}
}
c, err := app.db.GetCollectionBy("id = ?", fmt.Sprintf("%d", p.CollectionID.Int64))
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Retrieve collection information and send user to canonical URL
return impart.HTTPError{http.StatusFound, c.CanonicalURL() + p.Slug.String}
}
func viewLocalTimelineFeed(app *App, w http.ResponseWriter, req *http.Request) error {
if !app.cfg.App.LocalTimeline {
return impart.HTTPError{http.StatusNotFound, "Page doesn't exist."}
}
updateTimelineCache(app.timeline, false)
feed := &Feed{
Title: app.cfg.App.SiteName + " Reader",
Link: &Link{Href: app.cfg.App.Host},
Description: "Read the latest posts from " + app.cfg.App.SiteName + ".",
Created: time.Now(),
}
c := 0
var title, permalink, author string
for _, p := range *app.timeline.posts {
if c == tlFeedLimit {
break
}
title = p.PlainDisplayTitle()
permalink = p.CanonicalURL(app.cfg.App.Host)
if p.Collection != nil {
author = p.Collection.Title
} else {
author = "Anonymous"
}
i := &Item{
Id: app.cfg.App.Host + "/read/a/" + p.ID,
Title: title,
Link: &Link{Href: permalink},
Description: "",
Content: applyMarkdown([]byte(p.Content), "", app.cfg),
Author: &Author{author, ""},
Created: p.Created,
Updated: p.Updated,
}
feed.Items = append(feed.Items, i)
c++
}
rss, err := feed.ToRss()
if err != nil {
return err
}
fmt.Fprint(w, rss)
return nil
}
diff --git a/request.go b/request.go
index 2eb29f5..0bb6e92 100644
--- a/request.go
+++ b/request.go
@@ -1,22 +1,22 @@
/*
- * Copyright © 2018 A Bunch Tell LLC.
+ * Copyright © 2018 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"mime"
"net/http"
)
func IsJSON(r *http.Request) bool {
ct, _, _ := mime.ParseMediaType(r.Header.Get("Content-Type"))
accept := r.Header.Get("Accept")
return ct == "application/json" || accept == "application/json"
}
diff --git a/routes.go b/routes.go
index 213958d..00b6bd0 100644
--- a/routes.go
+++ b/routes.go
@@ -1,237 +1,237 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"net/http"
"net/url"
"path/filepath"
"strings"
"github.com/gorilla/csrf"
"github.com/gorilla/mux"
"github.com/writeas/go-webfinger"
"github.com/writeas/web-core/log"
"github.com/writefreely/go-nodeinfo"
)
// InitStaticRoutes adds routes for serving static files.
// TODO: this should just be a func, not method
func (app *App) InitStaticRoutes(r *mux.Router) {
// Handle static files
fs := http.FileServer(http.Dir(filepath.Join(app.cfg.Server.StaticParentDir, staticDir)))
fs = cacheControl(fs)
app.shttp = http.NewServeMux()
app.shttp.Handle("/", fs)
r.PathPrefix("/").Handler(fs)
}
// InitRoutes adds dynamic routes for the given mux.Router.
func InitRoutes(apper Apper, r *mux.Router) *mux.Router {
// Create handler
handler := NewWFHandler(apper)
// Set up routes
hostSubroute := apper.App().cfg.App.Host[strings.Index(apper.App().cfg.App.Host, "://")+3:]
if apper.App().cfg.App.SingleUser {
hostSubroute = "{domain}"
} else {
if strings.HasPrefix(hostSubroute, "localhost") {
hostSubroute = "localhost"
}
}
if apper.App().cfg.App.SingleUser {
log.Info("Adding %s routes (single user)...", hostSubroute)
} else {
log.Info("Adding %s routes (multi-user)...", hostSubroute)
}
// Primary app routes
write := r.PathPrefix("/").Subrouter()
// Federation endpoint configurations
wf := webfinger.Default(wfResolver{apper.App().db, apper.App().cfg})
wf.NoTLSHandler = nil
// Federation endpoints
// host-meta
write.HandleFunc("/.well-known/host-meta", handler.Web(handleViewHostMeta, UserLevelReader))
// webfinger
write.HandleFunc(webfinger.WebFingerPath, handler.LogHandlerFunc(http.HandlerFunc(wf.Webfinger)))
// nodeinfo
niCfg := nodeInfoConfig(apper.App().db, apper.App().cfg)
ni := nodeinfo.NewService(*niCfg, nodeInfoResolver{apper.App().cfg, apper.App().db})
write.HandleFunc(nodeinfo.NodeInfoPath, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfoDiscover)))
write.HandleFunc(niCfg.InfoURL, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfo)))
// handle mentions
write.HandleFunc("/@/{handle}", handler.Web(handleViewMention, UserLevelReader))
configureSlackOauth(handler, write, apper.App())
configureWriteAsOauth(handler, write, apper.App())
configureGitlabOauth(handler, write, apper.App())
configureGenericOauth(handler, write, apper.App())
configureGiteaOauth(handler, write, apper.App())
// Set up dyamic page handlers
// Handle auth
auth := write.PathPrefix("/api/auth/").Subrouter()
if apper.App().cfg.App.OpenRegistration {
auth.HandleFunc("/signup", handler.All(apiSignup)).Methods("POST")
}
auth.HandleFunc("/login", handler.All(login)).Methods("POST")
auth.HandleFunc("/read", handler.WebErrors(handleWebCollectionUnlock, UserLevelNone)).Methods("POST")
auth.HandleFunc("/me", handler.All(handleAPILogout)).Methods("DELETE")
// Handle logged in user sections
me := write.PathPrefix("/me").Subrouter()
me.HandleFunc("/", handler.Redirect("/me", UserLevelUser))
me.HandleFunc("/c", handler.Redirect("/me/c/", UserLevelUser)).Methods("GET")
me.HandleFunc("/c/", handler.User(viewCollections)).Methods("GET")
me.HandleFunc("/c/{collection}", handler.User(viewEditCollection)).Methods("GET")
me.HandleFunc("/c/{collection}/stats", handler.User(viewStats)).Methods("GET")
me.Path("/delete").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(handleUserDelete))).Methods("POST")
me.HandleFunc("/posts", handler.Redirect("/me/posts/", UserLevelUser)).Methods("GET")
me.HandleFunc("/posts/", handler.User(viewArticles)).Methods("GET")
me.HandleFunc("/posts/export.csv", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
me.HandleFunc("/posts/export.zip", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
me.HandleFunc("/posts/export.json", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
me.HandleFunc("/export", handler.User(viewExportOptions)).Methods("GET")
me.HandleFunc("/export.json", handler.Download(viewExportFull, UserLevelUser)).Methods("GET")
me.HandleFunc("/import", handler.User(viewImport)).Methods("GET")
me.Path("/settings").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(viewSettings))).Methods("GET")
me.HandleFunc("/invites", handler.User(handleViewUserInvites)).Methods("GET")
me.HandleFunc("/logout", handler.Web(viewLogout, UserLevelNone)).Methods("GET")
write.HandleFunc("/api/me", handler.All(viewMeAPI)).Methods("GET")
apiMe := write.PathPrefix("/api/me/").Subrouter()
apiMe.HandleFunc("/", handler.All(viewMeAPI)).Methods("GET")
apiMe.HandleFunc("/posts", handler.UserWebAPI(viewMyPostsAPI)).Methods("GET")
apiMe.HandleFunc("/collections", handler.UserAPI(viewMyCollectionsAPI)).Methods("GET")
apiMe.HandleFunc("/password", handler.All(updatePassphrase)).Methods("POST")
apiMe.HandleFunc("/self", handler.All(updateSettings)).Methods("POST")
apiMe.HandleFunc("/invites", handler.User(handleCreateUserInvite)).Methods("POST")
apiMe.HandleFunc("/import", handler.User(handleImport)).Methods("POST")
apiMe.HandleFunc("/oauth/remove", handler.User(removeOauth)).Methods("POST")
// Sign up validation
write.HandleFunc("/api/alias", handler.All(handleUsernameCheck)).Methods("POST")
write.HandleFunc("/api/markdown", handler.All(handleRenderMarkdown)).Methods("POST")
instanceURL, _ := url.Parse(apper.App().Config().App.Host)
host := instanceURL.Host
// Handle collections
write.HandleFunc("/api/collections", handler.All(newCollection)).Methods("POST")
apiColls := write.PathPrefix("/api/collections/").Subrouter()
apiColls.HandleFunc("/monetization-pointer", handler.PlainTextAPI(handleSPSPEndpoint)).Methods("GET")
apiColls.HandleFunc("/"+host, handler.AllReader(fetchCollection)).Methods("GET")
apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.AllReader(fetchCollection)).Methods("GET")
apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.All(existingCollection)).Methods("POST", "DELETE")
apiColls.HandleFunc("/{alias}/posts", handler.AllReader(fetchCollectionPosts)).Methods("GET")
apiColls.HandleFunc("/{alias}/posts", handler.All(newPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/posts/{post}", handler.AllReader(fetchPost)).Methods("GET")
apiColls.HandleFunc("/{alias}/posts/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/posts/{post}/splitcontent", handler.AllReader(handleGetSplitContent)).Methods("GET", "POST")
apiColls.HandleFunc("/{alias}/posts/{post}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET")
apiColls.HandleFunc("/{alias}/collect", handler.All(addPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/pin", handler.All(pinPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/unpin", handler.All(pinPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/inbox", handler.All(handleFetchCollectionInbox)).Methods("POST")
apiColls.HandleFunc("/{alias}/outbox", handler.AllReader(handleFetchCollectionOutbox)).Methods("GET")
apiColls.HandleFunc("/{alias}/following", handler.AllReader(handleFetchCollectionFollowing)).Methods("GET")
apiColls.HandleFunc("/{alias}/followers", handler.AllReader(handleFetchCollectionFollowers)).Methods("GET")
// Handle posts
write.HandleFunc("/api/posts", handler.All(newPost)).Methods("POST")
posts := write.PathPrefix("/api/posts/").Subrouter()
posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.AllReader(fetchPost)).Methods("GET")
posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST", "PUT")
posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(deletePost)).Methods("DELETE")
posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET")
posts.HandleFunc("/claim", handler.All(addPost)).Methods("POST")
posts.HandleFunc("/disperse", handler.All(dispersePost)).Methods("POST")
write.HandleFunc("/auth/signup", handler.Web(handleWebSignup, UserLevelNoneRequired)).Methods("POST")
write.HandleFunc("/auth/login", handler.Web(webLogin, UserLevelNoneRequired)).Methods("POST")
write.HandleFunc("/admin", handler.Admin(handleViewAdminDash)).Methods("GET")
write.HandleFunc("/admin/monitor", handler.Admin(handleViewAdminMonitor)).Methods("GET")
write.HandleFunc("/admin/settings", handler.Admin(handleViewAdminSettings)).Methods("GET")
write.HandleFunc("/admin/users", handler.Admin(handleViewAdminUsers)).Methods("GET")
write.HandleFunc("/admin/user/{username}", handler.Admin(handleViewAdminUser)).Methods("GET")
write.HandleFunc("/admin/user/{username}/delete", handler.Admin(handleAdminDeleteUser)).Methods("POST")
write.HandleFunc("/admin/user/{username}/status", handler.Admin(handleAdminToggleUserStatus)).Methods("POST")
write.HandleFunc("/admin/user/{username}/passphrase", handler.Admin(handleAdminResetUserPass)).Methods("POST")
write.HandleFunc("/admin/pages", handler.Admin(handleViewAdminPages)).Methods("GET")
write.HandleFunc("/admin/page/{slug}", handler.Admin(handleViewAdminPage)).Methods("GET")
write.HandleFunc("/admin/update/config", handler.AdminApper(handleAdminUpdateConfig)).Methods("POST")
write.HandleFunc("/admin/update/{page}", handler.Admin(handleAdminUpdateSite)).Methods("POST")
write.HandleFunc("/admin/updates", handler.Admin(handleViewAdminUpdates)).Methods("GET")
// Handle special pages first
write.HandleFunc("/login", handler.Web(viewLogin, UserLevelNoneRequired))
write.HandleFunc("/signup", handler.Web(handleViewLanding, UserLevelNoneRequired))
write.HandleFunc("/invite/{code:[a-zA-Z0-9]+}", handler.Web(handleViewInvite, UserLevelOptional)).Methods("GET")
// TODO: show a reader-specific 404 page if the function is disabled
write.HandleFunc("/read", handler.Web(viewLocalTimeline, UserLevelReader))
RouteRead(handler, UserLevelReader, write.PathPrefix("/read").Subrouter())
draftEditPrefix := ""
if apper.App().cfg.App.SingleUser {
draftEditPrefix = "/d"
write.HandleFunc("/me/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
} else {
write.HandleFunc("/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
}
// All the existing stuff
write.HandleFunc(draftEditPrefix+"/{action}/edit", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
write.HandleFunc(draftEditPrefix+"/{action}/meta", handler.Web(handleViewMeta, UserLevelUser)).Methods("GET")
// Collections
if apper.App().cfg.App.SingleUser {
RouteCollections(handler, write.PathPrefix("/").Subrouter())
} else {
write.HandleFunc("/{prefix:[@~$!\\-+]}{collection}", handler.Web(handleViewCollection, UserLevelReader))
write.HandleFunc("/{collection}/", handler.Web(handleViewCollection, UserLevelReader))
RouteCollections(handler, write.PathPrefix("/{prefix:[@~$!\\-+]?}{collection}").Subrouter())
// Posts
}
write.HandleFunc(draftEditPrefix+"/{post}", handler.Web(handleViewPost, UserLevelOptional))
write.HandleFunc("/", handler.Web(handleViewHome, UserLevelOptional))
return r
}
func RouteCollections(handler *Handler, r *mux.Router) {
r.HandleFunc("/logout", handler.Web(handleLogOutCollection, UserLevelOptional))
r.HandleFunc("/page/{page:[0-9]+}", handler.Web(handleViewCollection, UserLevelReader))
r.HandleFunc("/tag:{tag}", handler.Web(handleViewCollectionTag, UserLevelReader))
r.HandleFunc("/tag:{tag}/feed/", handler.Web(ViewFeed, UserLevelReader))
r.HandleFunc("/sitemap.xml", handler.AllReader(handleViewSitemap))
r.HandleFunc("/feed/", handler.AllReader(ViewFeed))
r.HandleFunc("/{slug}", handler.CollectionPostOrStatic)
r.HandleFunc("/{slug}/edit", handler.Web(handleViewPad, UserLevelUser))
r.HandleFunc("/{slug}/edit/meta", handler.Web(handleViewMeta, UserLevelUser))
r.HandleFunc("/{slug}/", handler.Web(handleCollectionPostRedirect, UserLevelReader)).Methods("GET")
}
func RouteRead(handler *Handler, readPerm UserLevelFunc, r *mux.Router) {
r.HandleFunc("/api/posts", handler.Web(viewLocalTimelineAPI, readPerm))
r.HandleFunc("/p/{page}", handler.Web(viewLocalTimeline, readPerm))
r.HandleFunc("/feed/", handler.Web(viewLocalTimelineFeed, readPerm))
r.HandleFunc("/t/{tag}", handler.Web(viewLocalTimeline, readPerm))
r.HandleFunc("/a/{post}", handler.Web(handlePostIDRedirect, readPerm))
r.HandleFunc("/{author}", handler.Web(viewLocalTimeline, readPerm))
r.HandleFunc("/", handler.Web(viewLocalTimeline, readPerm))
}
diff --git a/scripts/invalidate-css.sh b/scripts/invalidate-css.sh
index c411f70..295599e 100755
--- a/scripts/invalidate-css.sh
+++ b/scripts/invalidate-css.sh
@@ -1,37 +1,37 @@
#!/bin/bash
#
-# Copyright © 2020 A Bunch Tell LLC.
+# Copyright © 2020 Musing Studio LLC.
#
# This file is part of WriteFreely.
#
# WriteFreely is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License, included
# in the LICENSE file in this source code package.
#
###############################################################################
#
# WriteFreely CSS invalidation script
#
# usage: ./invalidate-css.sh
#
# This script provides an automated way to invalidate stylesheets cached in the
# browser. It uses the last git commit hashes of the most frequently modified
# LESS files in the project and appends them to the stylesheet `href` in all
# template files.
#
# This is designed to be used when building a WriteFreely release.
#
###############################################################################
# Get parent build directory from first argument
buildDir=$1
# Get short hash of each primary LESS file's last commit
cssHash=$(git log -n 1 --pretty=format:%h -- less/core.less)
cssNewHash=$(git log -n 1 --pretty=format:%h -- less/new-core.less)
cssPadHash=$(git log -n 1 --pretty=format:%h -- less/pad.less)
echo "Adding write.css version ($cssHash $cssNewHash $cssPadHash) to .tmpl files..."
cd "$buildDir/templates" || exit 1
find . -type f -name "*.tmpl" -print0 | xargs -0 sed -i "s/write.css/write.css?${cssHash}${cssNewHash}${cssPadHash}/g"
find . -type f -name "*.tmpl" -print0 | xargs -0 sed -i "s/{{.Theme}}.css/{{.Theme}}.css?${cssHash}${cssNewHash}${cssPadHash}/g"
\ No newline at end of file
diff --git a/scripts/upgrade-server.sh b/scripts/upgrade-server.sh
index 581085d..b129943 100755
--- a/scripts/upgrade-server.sh
+++ b/scripts/upgrade-server.sh
@@ -1,108 +1,108 @@
#! /bin/bash
###############################################################################
## writefreely update script ##
## ##
## WARNING: running this script will overwrite any modifed assets or ##
## template files. If you have any custom changes to these files you ##
## should back them up FIRST. ##
## ##
## This must be run from the web application root directory ##
## i.e. /var/www/writefreely, and operates under the assumption that you##
## have not installed the binary `writefreely` in another location. ##
###############################################################################
#
-# Copyright © 2019-2020 A Bunch Tell LLC.
+# Copyright © 2019-2020 Musing Studio LLC.
#
# This file is part of WriteFreely.
#
# WriteFreely is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License, included
# in the LICENSE file in this source code package.
#
# only execute as root, or use sudo
if [[ `id -u` -ne 0 ]]; then
echo "You must login as root, or execute this script with sudo"
exit 10
fi
# go ahead and check for the latest release on linux
echo "Checking for updates..."
url=`curl -s https://api.github.com/repos/writeas/writefreely/releases/latest | grep 'browser_' | grep 'linux' | grep 'amd64' | cut -d\" -f4`
# check current version
bin_output=`./writefreely -v`
if [ -z "$bin_output" ]; then
exit 1
fi
current=${bin_output:12:5}
echo "Current version is v$current"
# grab latest version number
IFS='/'
read -ra parts <<< "$url"
latest=${parts[-2]}
echo "Latest release is $latest"
IFS='.'
read -ra cv <<< "$current"
read -ra lv <<< "${latest#v}"
IFS=' '
tempdir=$(mktemp -d)
if [[ ${lv[0]} -gt ${cv[0]} ]]; then
echo "New major version available."
echo "Downloading..."
`wget -P $tempdir -q --show-progress $url`
elif [[ ${lv[0]} -eq ${cv[0]} ]] && [[ ${lv[1]} -gt ${cv[1]} ]]; then
echo "New minor version available."
echo "Downloading..."
`wget -P $tempdir -q --show-progress $url`
elif [[ ${lv[2]} -gt ${cv[2]} ]]; then
echo "New patch version available."
echo "Downloading..."
`wget -P $tempdir -q --show-progress $url`
else
echo "Up to date."
exit 0
fi
filename=${parts[-1]}
# extract
echo "Extracting files..."
tar -zxf $tempdir/$filename -C $tempdir
# stop service
echo "Stopping writefreely systemd service..."
if `systemctl start writefreely`; then
echo "Success, service stopped."
else
echo "Upgrade failed to stop the systemd service, exiting early."
exit 1
fi
# copy files
echo "Copying files..."
cp -r $tempdir/writefreely/{pages,static,templates,writefreely} .
# migrate db
./writefreely -migrate
# restart service
echo "Starting writefreely systemd service..."
if `systemctl start writefreely`; then
echo "Success, version has been upgraded to $latest."
else
echo "Upgrade complete, but failed to restart service."
exit 1
fi
diff --git a/session.go b/session.go
index 81d628f..c8ca6fa 100644
--- a/session.go
+++ b/session.go
@@ -1,141 +1,141 @@
/*
- * Copyright © 2018-2019 A Bunch Tell LLC.
+ * Copyright © 2018-2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"encoding/gob"
"github.com/gorilla/sessions"
"github.com/writeas/web-core/log"
"net/http"
"strings"
)
const (
day = 86400
sessionLength = 180 * day
cookieName = "wfu"
cookieUserVal = "u"
blogPassCookieName = "ub"
)
// InitSession creates the cookie store. It depends on the keychain already
// being loaded.
func (app *App) InitSession() {
// Register complex data types we'll be storing in cookies
gob.Register(&User{})
// Create the cookie store
store := sessions.NewCookieStore(app.keys.CookieAuthKey, app.keys.CookieKey)
store.Options = &sessions.Options{
Path: "/",
MaxAge: sessionLength,
HttpOnly: true,
Secure: strings.HasPrefix(app.cfg.App.Host, "https://"),
}
if store.Options.Secure {
store.Options.SameSite = http.SameSiteNoneMode
}
app.sessionStore = store
}
func getSessionFlashes(app *App, w http.ResponseWriter, r *http.Request, session *sessions.Session) ([]string, error) {
var err error
if session == nil {
session, err = app.sessionStore.Get(r, cookieName)
if err != nil {
return nil, err
}
}
f := []string{}
if flashes := session.Flashes(); len(flashes) > 0 {
for _, flash := range flashes {
if str, ok := flash.(string); ok {
f = append(f, str)
}
}
}
saveUserSession(app, r, w)
return f, nil
}
func addSessionFlash(app *App, w http.ResponseWriter, r *http.Request, m string, session *sessions.Session) error {
var err error
if session == nil {
session, err = app.sessionStore.Get(r, cookieName)
}
if err != nil {
log.Error("Unable to add flash '%s': %v", m, err)
return err
}
session.AddFlash(m)
saveUserSession(app, r, w)
return nil
}
func getUserAndSession(app *App, r *http.Request) (*User, *sessions.Session) {
session, err := app.sessionStore.Get(r, cookieName)
if err == nil {
// Got the currently logged-in user
val := session.Values[cookieUserVal]
var u = &User{}
var ok bool
if u, ok = val.(*User); ok {
return u, session
}
}
return nil, nil
}
func getUserSession(app *App, r *http.Request) *User {
u, _ := getUserAndSession(app, r)
return u
}
func saveUserSession(app *App, r *http.Request, w http.ResponseWriter) error {
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
return ErrInternalCookieSession
}
// Extend the session
session.Options.MaxAge = int(sessionLength)
// Remove any information that accidentally got added
// FIXME: find where Plan information is getting saved to cookie.
val := session.Values[cookieUserVal]
var u = &User{}
var ok bool
if u, ok = val.(*User); ok {
session.Values[cookieUserVal] = u.Cookie()
}
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't saveUserSession: %v", err)
}
return err
}
func getFullUserSession(app *App, r *http.Request) *User {
u := getUserSession(app, r)
if u == nil {
return nil
}
u, _ = app.db.GetUserByID(u.ID)
return u
}
diff --git a/sitemap.go b/sitemap.go
index 00e148f..0bbcefb 100644
--- a/sitemap.go
+++ b/sitemap.go
@@ -1,109 +1,109 @@
/*
- * Copyright © 2018-2019 A Bunch Tell LLC.
+ * Copyright © 2018-2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"fmt"
"net/http"
"time"
"github.com/gorilla/mux"
"github.com/ikeikeikeike/go-sitemap-generator/v2/stm"
"github.com/writeas/web-core/log"
)
func buildSitemap(host, alias string) *stm.Sitemap {
sm := stm.NewSitemap(0)
sm.SetDefaultHost(host)
if alias != "/" {
sm.SetSitemapsPath(alias)
}
sm.Create()
// Note: Do not call `sm.Finalize()` because it flushes
// the underlying datastructure from memory to disk.
return sm
}
func handleViewSitemap(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
// Determine canonical blog URL
alias := vars["collection"]
subdomain := vars["subdomain"]
isSubdomain := subdomain != ""
if isSubdomain {
alias = subdomain
}
host := fmt.Sprintf("%s/%s/", app.cfg.App.Host, alias)
var c *Collection
var err error
pre := "/"
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
if !isSubdomain {
pre += alias + "/"
}
host = c.CanonicalURL()
sm := buildSitemap(host, pre)
posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false)
if err != nil {
log.Error("Error getting posts: %v", err)
return err
}
lastSiteMod := time.Now()
for i, p := range *posts {
if i == 0 {
lastSiteMod = p.Updated
}
u := stm.URL{
{"loc", p.Slug.String},
{"changefreq", "weekly"},
{"mobile", true},
{"lastmod", p.Updated},
}
if len(p.Images) > 0 {
imgs := []stm.URL{}
for _, i := range p.Images {
imgs = append(imgs, stm.URL{
{"loc", i},
{"title", ""},
})
}
u = append(u, []interface{}{"image", imgs})
}
sm.Add(u)
}
// Add top URL
sm.Add(stm.URL{
{"loc", pre},
{"changefreq", "daily"},
{"priority", "1.0"},
{"lastmod", lastSiteMod},
})
w.Write(sm.XMLContent())
return nil
}
diff --git a/static/js/modals.js b/static/js/modals.js
index 6705afa..0910d7e 100644
--- a/static/js/modals.js
+++ b/static/js/modals.js
@@ -1,24 +1,24 @@
/*
- * Copyright © 2016-2021 A Bunch Tell LLC.
+ * Copyright © 2016-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
function showModal(id) {
document.getElementById('overlay').style.display = 'block';
document.getElementById('modal-'+id).style.display = 'block';
}
var closeModals = function(e) {
e.preventDefault();
document.getElementById('overlay').style.display = 'none';
var modals = document.querySelectorAll('.modal');
for (var i=0; iFor $5 per month , you can read this and other great writing across our site and other websites that support Web Monetization.')
$readmoreSell.insertAdjacentHTML("beforeend", '\n\nGet started Learn more
')
}
function initMonetization() {
let $content = document.querySelector('.e-content')
let $post = document.getElementById('post-body')
let $split = $post.querySelector('.split')
if (document.monetization === undefined || $split == null) {
if ($split) {
showWMPaywall($content, $split)
}
return
}
document.monetization.addEventListener('monetizationstop', function(event) {
if (pendingSplitContent) {
// We've seen the 'pending' activity, so we can assume things will work
document.monetization.removeEventListener('monetizationstop', progressHandler)
return
}
// We're getting 'stop' without ever starting, so display the paywall.
showWMPaywall($content, $split)
});
document.monetization.addEventListener('monetizationpending', function (event) {
pendingSplitContent = true
})
let progressHandler = function(event) {
if (unlockedSplitContent) {
document.monetization.removeEventListener('monetizationprogress', progressHandler)
return
}
if (!unlockingSplitContent && !unlockedSplitContent) {
unlockingSplitContent = true
getSplitContent(event.detail.receipt, function (status, data) {
unlockingSplitContent = false
if (status == 200) {
$split.textContent = "Your subscriber perks start here."
$split.insertAdjacentHTML("afterend", "\n\n"+data.data.html_body)
} else {
$split.textContent = "Something went wrong while unlocking subscriber content."
}
unlockedSplitContent = true
})
}
}
function getSplitContent(receipt, callback) {
let params = "receipt="+encodeURIComponent(receipt)
let http = new XMLHttpRequest();
http.open("POST", "/api/collections/" + window.collAlias + "/posts/" + window.postSlug + "/splitcontent", true);
// Send the proper header information along with the request
http.setRequestHeader("Content-type", "application/x-www-form-urlencoded");
http.onreadystatechange = function () {
if (http.readyState == 4) {
callback(http.status, JSON.parse(http.responseText));
}
}
http.send(params);
}
document.monetization.addEventListener('monetizationstart', function() {
if (!unlockedSplitContent) {
$split.textContent = "Unlocking subscriber content..."
}
document.monetization.removeEventListener('monetizationstart', progressHandler)
});
document.monetization.addEventListener('monetizationprogress', progressHandler);
}
\ No newline at end of file
diff --git a/templates.go b/templates.go
index e0c728e..ecd8750 100644
--- a/templates.go
+++ b/templates.go
@@ -1,229 +1,229 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"errors"
"html/template"
"io"
"io/ioutil"
"net/http"
"os"
"path/filepath"
"strings"
"github.com/dustin/go-humanize"
"github.com/writeas/web-core/l10n"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/config"
)
var (
templates = map[string]*template.Template{}
pages = map[string]*template.Template{}
userPages = map[string]*template.Template{}
funcMap = template.FuncMap{
"largeNumFmt": largeNumFmt,
"pluralize": pluralize,
"isRTL": isRTL,
"isLTR": isLTR,
"localstr": localStr,
"localhtml": localHTML,
"tolower": strings.ToLower,
"title": strings.Title,
"hasPrefix": strings.HasPrefix,
"hasSuffix": strings.HasSuffix,
"dict": dict,
}
)
const (
templatesDir = "templates"
pagesDir = "pages"
)
func showUserPage(w http.ResponseWriter, name string, obj interface{}) {
if obj == nil {
log.Error("showUserPage: data is nil!")
return
}
if err := userPages[filepath.Join("user", name+".tmpl")].ExecuteTemplate(w, name, obj); err != nil {
log.Error("Error parsing %s: %v", name, err)
}
}
func initTemplate(parentDir, name string) {
if debugging {
log.Info(" " + filepath.Join(parentDir, templatesDir, name+".tmpl"))
}
files := []string{
filepath.Join(parentDir, templatesDir, name+".tmpl"),
filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "base.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
}
if name == "collection" || name == "collection-tags" || name == "chorus-collection" || name == "read" {
// These pages list out collection posts, so we also parse templatesDir + "include/posts.tmpl"
files = append(files, filepath.Join(parentDir, templatesDir, "include", "posts.tmpl"))
}
if name == "chorus-collection" || name == "chorus-collection-post" {
files = append(files, filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"))
}
if name == "collection" || name == "collection-tags" || name == "collection-post" || name == "post" || name == "chorus-collection" || name == "chorus-collection-post" {
files = append(files, filepath.Join(parentDir, templatesDir, "include", "post-render.tmpl"))
}
templates[name] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...))
}
func initPage(parentDir, path, key string) {
if debugging {
log.Info(" [%s] %s", key, path)
}
files := []string{
path,
filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "base.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
}
if key == "login.tmpl" || key == "landing.tmpl" || key == "signup.tmpl" {
files = append(files, filepath.Join(parentDir, templatesDir, "include", "oauth.tmpl"))
}
pages[key] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...))
}
func initUserPage(parentDir, path, key string) {
if debugging {
log.Info(" [%s] %s", key, path)
}
userPages[key] = template.Must(template.New(key).Funcs(funcMap).ParseFiles(
path,
filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "nav.tmpl"),
))
}
// InitTemplates loads all template files from the configured parent dir.
func InitTemplates(cfg *config.Config) error {
log.Info("Loading templates...")
tmplFiles, err := ioutil.ReadDir(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir))
if err != nil {
return err
}
for _, f := range tmplFiles {
if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
parts := strings.Split(f.Name(), ".")
key := parts[0]
initTemplate(cfg.Server.TemplatesParentDir, key)
}
}
log.Info("Loading pages...")
// Initialize all static pages that use the base template
filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, pagesDir), func(path string, i os.FileInfo, err error) error {
if !i.IsDir() && !strings.HasPrefix(i.Name(), ".") {
key := i.Name()
initPage(cfg.Server.PagesParentDir, path, key)
}
return nil
})
log.Info("Loading user pages...")
// Initialize all user pages that use base templates
filepath.Walk(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir, "user"), func(path string, f os.FileInfo, err error) error {
if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
corePath := path
if cfg.Server.TemplatesParentDir != "" {
corePath = corePath[len(cfg.Server.TemplatesParentDir)+1:]
}
parts := strings.Split(corePath, string(filepath.Separator))
key := f.Name()
if len(parts) > 2 {
key = filepath.Join(parts[1], f.Name())
}
initUserPage(cfg.Server.TemplatesParentDir, path, key)
}
return nil
})
return nil
}
// renderPage retrieves the given template and renders it to the given io.Writer.
// If something goes wrong, the error is logged and returned.
func renderPage(w io.Writer, tmpl string, data interface{}) error {
err := pages[tmpl].ExecuteTemplate(w, "base", data)
if err != nil {
log.Error("%v", err)
}
return err
}
func largeNumFmt(n int64) string {
return humanize.Comma(n)
}
func pluralize(singular, plural string, n int64) string {
if n == 1 {
return singular
}
return plural
}
func isRTL(d string) bool {
return d == "rtl"
}
func isLTR(d string) bool {
return d == "ltr" || d == "auto"
}
func localStr(term, lang string) string {
s := l10n.Strings(lang)[term]
if s == "" {
s = l10n.Strings("")[term]
}
return s
}
func localHTML(term, lang string) template.HTML {
s := l10n.Strings(lang)[term]
if s == "" {
s = l10n.Strings("")[term]
}
s = strings.Replace(s, "write.as", "writefreely ", 1)
return template.HTML(s)
}
// from: https://stackoverflow.com/a/18276968/1549194
func dict(values ...interface{}) (map[string]interface{}, error) {
if len(values)%2 != 0 {
return nil, errors.New("dict: invalid number of parameters")
}
dict := make(map[string]interface{}, len(values)/2)
for i := 0; i < len(values); i += 2 {
key, ok := values[i].(string)
if !ok {
return nil, errors.New("dict: keys must be strings")
}
dict[key] = values[i+1]
}
return dict, nil
}
diff --git a/unregisteredusers.go b/unregisteredusers.go
index b6f6ce6..9473c89 100644
--- a/unregisteredusers.go
+++ b/unregisteredusers.go
@@ -1,148 +1,148 @@
/*
- * Copyright © 2018-2019 A Bunch Tell LLC.
+ * Copyright © 2018-2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"net/http"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
)
func handleWebSignup(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
// Get params
var ur userRegistration
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&ur)
if err != nil {
log.Error("Couldn't parse signup JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse signup form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&ur, r.PostForm)
if err != nil {
log.Error("Couldn't decode signup form request: %v\n", err)
return ErrBadFormData
}
}
ur.Web = true
ur.Normalize = true
to := "/"
if app.cfg.App.SimpleNav {
to = "/new"
}
if ur.InviteCode != "" {
to = "/invite/" + ur.InviteCode
}
_, err := signupWithRegistration(app, ur, w, r)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
session, _ := app.sessionStore.Get(r, cookieName)
if session != nil {
session.AddFlash(err.Message)
session.Save(r, w)
return impart.HTTPError{http.StatusFound, to}
}
}
return err
}
return impart.HTTPError{http.StatusFound, to}
}
// { "username": "asdf" }
// result: { code: 204 }
func handleUsernameCheck(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
// Get params
var d struct {
Username string `json:"username"`
}
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&d)
if err != nil {
log.Error("Couldn't decode username check: %v\n", err)
return ErrBadFormData
}
} else {
return impart.HTTPError{http.StatusNotAcceptable, "Must be JSON request"}
}
// Check if username is okay
finalUsername := getSlug(d.Username, "")
if finalUsername == "" {
errMsg := "Invalid username"
if d.Username != "" {
// Username was provided, but didn't convert into valid latin characters
errMsg += " - must have at least 2 letters or numbers"
}
return impart.HTTPError{http.StatusBadRequest, errMsg + "."}
}
if app.db.PostIDExists(finalUsername) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
var un string
err := app.db.QueryRow("SELECT username FROM users WHERE username = ?", finalUsername).Scan(&un)
switch {
case err == sql.ErrNoRows:
return impart.WriteSuccess(w, finalUsername, http.StatusOK)
case err != nil:
log.Error("Couldn't SELECT username: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "We messed up."}
}
// Username was found, so it's taken
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
func getValidUsername(app *App, reqName, prevName string) (string, *impart.HTTPError) {
// Check if username is okay
finalUsername := getSlug(reqName, "")
if finalUsername == "" {
errMsg := "Invalid username"
if reqName != "" {
// Username was provided, but didn't convert into valid latin characters
errMsg += " - must have at least 2 letters or numbers"
}
return "", &impart.HTTPError{http.StatusBadRequest, errMsg + "."}
}
if finalUsername == prevName {
return "", &impart.HTTPError{http.StatusNotModified, "Username unchanged."}
}
if app.db.PostIDExists(finalUsername) {
return "", &impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
var un string
err := app.db.QueryRow("SELECT username FROM users WHERE username = ?", finalUsername).Scan(&un)
switch {
case err == sql.ErrNoRows:
return finalUsername, nil
case err != nil:
log.Error("Couldn't SELECT username: %v", err)
return "", &impart.HTTPError{http.StatusInternalServerError, "We messed up."}
}
// Username was found, so it's taken
return "", &impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
diff --git a/updates.go b/updates.go
index 8ecccf6..574a91c 100644
--- a/updates.go
+++ b/updates.go
@@ -1,131 +1,131 @@
/*
- * Copyright © 2019-2020 A Bunch Tell LLC.
+ * Copyright © 2019-2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"github.com/writeas/web-core/log"
"io/ioutil"
"net/http"
"strings"
"sync"
"time"
)
// updatesCacheTime is the default interval between cache updates for new
// software versions
const defaultUpdatesCacheTime = 12 * time.Hour
// updatesCache holds data about current and new releases of the writefreely
// software
type updatesCache struct {
mu sync.Mutex
frequency time.Duration
lastCheck time.Time
latestVersion string
currentVersion string
checkError error
}
// CheckNow asks for the latest released version of writefreely and updates
// the cache last checked time. If the version postdates the current 'latest'
// the version value is replaced.
func (uc *updatesCache) CheckNow() error {
if debugging {
log.Info("[update check] Checking for update now.")
}
uc.mu.Lock()
defer uc.mu.Unlock()
uc.lastCheck = time.Now()
latestRemote, err := newVersionCheck()
if err != nil {
log.Error("[update check] Failed: %v", err)
uc.checkError = err
return err
}
if CompareSemver(latestRemote, uc.latestVersion) == 1 {
uc.latestVersion = latestRemote
}
return nil
}
// AreAvailable updates the cache if the frequency duration has passed
// then returns if the latest release is newer than the current running version.
func (uc updatesCache) AreAvailable() bool {
if time.Since(uc.lastCheck) > uc.frequency {
uc.CheckNow()
}
return CompareSemver(uc.latestVersion, uc.currentVersion) == 1
}
// AreAvailableNoCheck returns if the latest release is newer than the current
// running version.
func (uc updatesCache) AreAvailableNoCheck() bool {
return CompareSemver(uc.latestVersion, uc.currentVersion) == 1
}
// LatestVersion returns the latest stored version available.
func (uc updatesCache) LatestVersion() string {
return uc.latestVersion
}
func (uc updatesCache) ReleaseURL() string {
return "https://writefreely.org/releases/" + uc.latestVersion
}
// ReleaseNotesURL returns the full URL to the blog.writefreely.org release notes
// for the latest version as stored in the cache.
func (uc updatesCache) ReleaseNotesURL() string {
return wfReleaseNotesURL(uc.latestVersion)
}
func wfReleaseNotesURL(v string) string {
ver := strings.TrimPrefix(v, "v")
ver = strings.TrimSuffix(ver, ".0")
// hack until go 1.12 in build/travis
seg := strings.Split(ver, ".")
return "https://blog.writefreely.org/version-" + strings.Join(seg, "-")
}
// newUpdatesCache returns an initialized updates cache
func newUpdatesCache(expiry time.Duration) *updatesCache {
cache := updatesCache{
frequency: expiry,
currentVersion: "v" + softwareVer,
}
go cache.CheckNow()
return &cache
}
// InitUpdates initializes the updates cache, if the config value is set
// It uses the defaultUpdatesCacheTime for the cache expiry
func (app *App) InitUpdates() {
if app.cfg.App.UpdateChecks {
app.updates = newUpdatesCache(defaultUpdatesCacheTime)
}
}
func newVersionCheck() (string, error) {
res, err := http.Get("https://version.writefreely.org")
if debugging {
log.Info("[update check] GET https://version.writefreely.org")
}
// TODO: return error if statusCode != OK
if err == nil && res.StatusCode == http.StatusOK {
defer res.Body.Close()
body, err := ioutil.ReadAll(res.Body)
if err != nil {
return "", err
}
return string(body), nil
}
return "", err
}
diff --git a/users.go b/users.go
index cc6764f..05c7f24 100644
--- a/users.go
+++ b/users.go
@@ -1,136 +1,136 @@
/*
- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"time"
"github.com/guregu/null/zero"
"github.com/writeas/web-core/data"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/key"
)
type UserStatus int
const (
UserActive = iota
UserSilenced
)
type (
userCredentials struct {
Alias string `json:"alias" schema:"alias"`
Pass string `json:"pass" schema:"pass"`
Email string `json:"email" schema:"email"`
Web bool `json:"web" schema:"-"`
To string `json:"-" schema:"to"`
EmailLogin bool `json:"via_email" schema:"via_email"`
}
userRegistration struct {
userCredentials
InviteCode string `json:"invite_code" schema:"invite_code"`
Honeypot string `json:"fullname" schema:"fullname"`
Normalize bool `json:"normalize" schema:"normalize"`
Signup bool `json:"signup" schema:"signup"`
// Feature fields
Description string `json:"description" schema:"description"`
Monetization string `json:"monetization" schema:"monetization"`
}
// AuthUser contains information for a newly authenticated user (either
// from signing up or logging in).
AuthUser struct {
AccessToken string `json:"access_token,omitempty"`
Password string `json:"password,omitempty"`
User *User `json:"user"`
// Verbose user data
Posts *[]PublicPost `json:"posts,omitempty"`
Collections *[]Collection `json:"collections,omitempty"`
}
// User is a consistent user object in the database and all contexts (auth
// and non-auth) in the API.
User struct {
ID int64 `json:"-"`
Username string `json:"username"`
HashedPass []byte `json:"-"`
HasPass bool `json:"has_pass"`
Email zero.String `json:"email"`
Created time.Time `json:"created"`
Status UserStatus `json:"status"`
clearEmail string `json:"email"`
}
userMeStats struct {
TotalCollections, TotalArticles, CollectionPosts uint64
}
ExportUser struct {
*User
Collections *[]CollectionObj `json:"collections"`
AnonymousPosts []PublicPost `json:"posts"`
}
PublicUser struct {
Username string `json:"username"`
}
)
// EmailClear decrypts and returns the user's email, caching it in the user
// object.
func (u *User) EmailClear(keys *key.Keychain) string {
if u.clearEmail != "" {
return u.clearEmail
}
if u.Email.Valid && u.Email.String != "" {
email, err := data.Decrypt(keys.EmailKey, []byte(u.Email.String))
if err != nil {
log.Error("Error decrypting user email: %v", err)
} else {
u.clearEmail = string(email)
return u.clearEmail
}
}
return ""
}
func (u User) CreatedFriendly() string {
/*
// TODO: accept a locale in this method and use that for the format
var loc monday.Locale = monday.LocaleEnUS
return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc)
*/
return u.Created.Format("January 2, 2006, 3:04 PM")
}
// Cookie strips down an AuthUser to contain only information necessary for
// cookies.
func (u User) Cookie() *User {
u.HashedPass = []byte{}
return &u
}
func (u *User) IsAdmin() bool {
// TODO: get this from database
return u.ID == 1
}
func (u *User) IsSilenced() bool {
return u.Status&UserSilenced != 0
}
diff --git a/webfinger.go b/webfinger.go
index 6c1341f..023c8a5 100644
--- a/webfinger.go
+++ b/webfinger.go
@@ -1,145 +1,145 @@
/*
- * Copyright © 2018-2021 A Bunch Tell LLC.
+ * Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"encoding/json"
"io/ioutil"
"net/http"
"strings"
"github.com/writeas/go-webfinger"
"github.com/writeas/impart"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/config"
)
type wfResolver struct {
db *datastore
cfg *config.Config
}
var wfUserNotFoundErr = impart.HTTPError{http.StatusNotFound, "User not found."}
func (wfr wfResolver) FindUser(username string, host, requestHost string, r []webfinger.Rel) (*webfinger.Resource, error) {
var c *Collection
var err error
if username == host {
c = instanceColl
} else if wfr.cfg.App.SingleUser {
c, err = wfr.db.GetCollectionByID(1)
} else {
c, err = wfr.db.GetCollection(username)
}
if err != nil {
log.Error("Unable to get blog: %v", err)
return nil, err
}
c.hostName = wfr.cfg.App.Host
if !c.IsInstanceColl() {
silenced, err := wfr.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("webfinger find user: check is silenced: %v", err)
return nil, err
}
if silenced {
return nil, wfUserNotFoundErr
}
}
if wfr.cfg.App.SingleUser {
// Ensure handle matches user-chosen one on single-user blogs
if username != c.Alias {
log.Info("Username '%s' is not handle '%s'", username, c.Alias)
return nil, wfUserNotFoundErr
}
}
// Only return information if site has federation enabled.
// TODO: enable two levels of federation? Unlisted or Public on timelines?
if !wfr.cfg.App.Federation {
return nil, wfUserNotFoundErr
}
res := webfinger.Resource{
Subject: "acct:" + username + "@" + host,
Aliases: []string{
c.CanonicalURL(),
c.FederatedAccount(),
},
Links: []webfinger.Link{
{
HRef: c.CanonicalURL(),
Type: "text/html",
Rel: "https://webfinger.net/rel/profile-page",
},
{
HRef: c.FederatedAccount(),
Type: "application/activity+json",
Rel: "self",
},
},
}
return &res, nil
}
func (wfr wfResolver) DummyUser(username string, hostname string, r []webfinger.Rel) (*webfinger.Resource, error) {
return nil, wfUserNotFoundErr
}
func (wfr wfResolver) IsNotFoundError(err error) bool {
return err == wfUserNotFoundErr
}
// RemoteLookup looks up a user by handle at a remote server
// and returns the actor URL
func RemoteLookup(handle string) string {
handle = strings.TrimLeft(handle, "@")
// let's take the server part of the handle
parts := strings.Split(handle, "@")
resp, err := http.Get("https://" + parts[1] + "/.well-known/webfinger?resource=acct:" + handle)
if err != nil {
log.Error("Error on webfinger request: %v", err)
return ""
}
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
log.Error("Error on webfinger response: %v", err)
return ""
}
var result webfinger.Resource
err = json.Unmarshal(body, &result)
if err != nil {
log.Error("Unable to parse webfinger response: %v", err)
return ""
}
var href string
// iterate over webfinger links and find the one with
// a self "rel"
for _, link := range result.Links {
if link.Rel == "self" {
href = link.HRef
}
}
// if we didn't find it with the above then
// try using aliases
if href == "" {
// take the last alias because mastodon has the
// https://instance.tld/@user first which
// doesn't work as an href
href = result.Aliases[len(result.Aliases)-1]
}
return href
}