diff --git a/Makefile b/Makefile index 757bcfd..782e680 100644 --- a/Makefile +++ b/Makefile @@ -1,149 +1,159 @@ GITREV=`git describe | cut -c 2-` LDFLAGS=-ldflags="-X 'github.com/writeas/writefreely.softwareVer=$(GITREV)'" GOCMD=go GOINSTALL=$(GOCMD) install $(LDFLAGS) GOBUILD=$(GOCMD) build $(LDFLAGS) GOTEST=$(GOCMD) test $(LDFLAGS) GOGET=$(GOCMD) get BINARY_NAME=writefreely BUILDPATH=build/$(BINARY_NAME) DOCKERCMD=docker IMAGE_NAME=writeas/writefreely TMPBIN=./tmp all : build ci: ci-assets deps cd cmd/writefreely; $(GOBUILD) -v build: assets deps cd cmd/writefreely; $(GOBUILD) -v -tags='sqlite' build-no-sqlite: assets-no-sqlite deps-no-sqlite cd cmd/writefreely; $(GOBUILD) -v -o $(BINARY_NAME) build-linux: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=linux/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely build-windows: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=windows/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely build-darwin: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=darwin/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely build-arm7: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=linux/arm-7, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely +build-arm64: deps + @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ + $(GOGET) -u github.com/karalabe/xgo; \ + fi + xgo --targets=linux/arm64, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely + build-docker : $(DOCKERCMD) build -t $(IMAGE_NAME):latest -t $(IMAGE_NAME):$(GITREV) . test: $(GOTEST) -v ./... run: dev-assets $(GOINSTALL) -tags='sqlite' ./... $(BINARY_NAME) --debug deps : $(GOGET) -tags='sqlite' -d -v ./... deps-no-sqlite: $(GOGET) -d -v ./... install : build cmd/writefreely/$(BINARY_NAME) --config cmd/writefreely/$(BINARY_NAME) --gen-keys cmd/writefreely/$(BINARY_NAME) --init-db cd less/; $(MAKE) install $(MFLAGS) release : clean ui assets mkdir -p $(BUILDPATH) cp -r templates $(BUILDPATH) cp -r pages $(BUILDPATH) cp -r static $(BUILDPATH) mkdir $(BUILDPATH)/keys $(MAKE) build-linux mv build/$(BINARY_NAME)-linux-amd64 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-arm7 mv build/$(BINARY_NAME)-linux-arm-7 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm7.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) + $(MAKE) build-arm64 + mv build/$(BINARY_NAME)-linux-arm64 $(BUILDPATH)/$(BINARY_NAME) + tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm64.tar.gz -C build $(BINARY_NAME) + rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-darwin mv build/$(BINARY_NAME)-darwin-10.6-amd64 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_macos_amd64.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-windows mv build/$(BINARY_NAME)-windows-4.0-amd64.exe $(BUILDPATH)/$(BINARY_NAME).exe cd build; zip -r ../$(BINARY_NAME)_$(GITREV)_windows_amd64.zip ./$(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-docker $(MAKE) release-docker # This assumes you're on linux/amd64 release-linux : clean ui mkdir -p $(BUILDPATH) cp -r templates $(BUILDPATH) cp -r pages $(BUILDPATH) cp -r static $(BUILDPATH) mkdir $(BUILDPATH)/keys $(MAKE) build-no-sqlite mv cmd/writefreely/$(BINARY_NAME) $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME) release-docker : $(DOCKERCMD) push $(IMAGE_NAME) ui : force_look cd less/; $(MAKE) $(MFLAGS) assets : generate go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql assets-no-sqlite: generate go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql dev-assets : generate go-bindata -pkg writefreely -ignore=\\.gitignore -debug -tags="!wflib" schema.sql sqlite.sql lib-assets : generate go-bindata -pkg writefreely -ignore=\\.gitignore -o bindata-lib.go -tags="wflib" schema.sql generate : @hash go-bindata > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/jteeuwen/go-bindata/go-bindata; \ fi $(TMPBIN): mkdir -p $(TMPBIN) $(TMPBIN)/go-bindata: deps $(TMPBIN) $(GOBUILD) -o $(TMPBIN)/go-bindata github.com/jteeuwen/go-bindata/go-bindata $(TMPBIN)/xgo: deps $(TMPBIN) $(GOBUILD) -o $(TMPBIN)/xgo github.com/karalabe/xgo ci-assets : $(TMPBIN)/go-bindata $(TMPBIN)/go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql clean : -rm -rf build -rm -rf tmp cd less/; $(MAKE) clean $(MFLAGS) force_look : true diff --git a/account.go b/account.go index c41f24d..6fb8053 100644 --- a/account.go +++ b/account.go @@ -1,1099 +1,1104 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "encoding/json" "fmt" "html/template" "net/http" "regexp" "strings" "sync" "time" "github.com/gorilla/mux" "github.com/gorilla/sessions" "github.com/guregu/null/zero" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/data" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" ) type ( userSettings struct { Username string `schema:"username" json:"username"` Email string `schema:"email" json:"email"` NewPass string `schema:"new-pass" json:"new_pass"` OldPass string `schema:"current-pass" json:"current_pass"` IsLogOut bool `schema:"logout" json:"logout"` } UserPage struct { page.StaticPage PageTitle string Separator template.HTML IsAdmin bool CanInvite bool } ) func NewUserPage(app *App, r *http.Request, u *User, title string, flashes []string) *UserPage { up := &UserPage{ StaticPage: pageForReq(app, r), PageTitle: title, } up.Username = u.Username up.Flashes = flashes up.Path = r.URL.Path up.IsAdmin = u.IsAdmin() up.CanInvite = canUserInvite(app.cfg, up.IsAdmin) return up } func canUserInvite(cfg *config.Config, isAdmin bool) bool { return cfg.App.UserInvites != "" && (isAdmin || cfg.App.UserInvites != "admin") } func (up *UserPage) SetMessaging(u *User) { //up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID) } const ( loginAttemptExpiration = 3 * time.Second ) var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead") func apiSignup(app *App, w http.ResponseWriter, r *http.Request) error { _, err := signup(app, w, r) return err } func signup(app *App, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { reqJSON := IsJSON(r) // Get params var ur userRegistration if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&ur) if err != nil { log.Error("Couldn't parse signup JSON request: %v\n", err) return nil, ErrBadJSON } } else { // Check if user is already logged in u := getUserSession(app, r) if u != nil { return &AuthUser{User: u}, nil } err := r.ParseForm() if err != nil { log.Error("Couldn't parse signup form request: %v\n", err) return nil, ErrBadFormData } err = app.formDecoder.Decode(&ur, r.PostForm) if err != nil { log.Error("Couldn't decode signup form request: %v\n", err) return nil, ErrBadFormData } } return signupWithRegistration(app, ur, w, r) } func signupWithRegistration(app *App, signup userRegistration, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { reqJSON := IsJSON(r) // Validate required params (alias) if signup.Alias == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."} } if signup.Pass == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."} } var desiredUsername string if signup.Normalize { // With this option we simply conform the username to what we expect // without complaining. Since they might've done something funny, like // enter: write.as/Way Out There, we'll use their raw input for the new // collection name and sanitize for the slug / username. desiredUsername = signup.Alias signup.Alias = getSlug(signup.Alias, "") } if !author.IsValidUsername(app.cfg, signup.Alias) { // Ensure the username is syntactically correct. return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."} } // Handle empty optional params // TODO: remove this var createdWithPass := true hashedPass, err := auth.HashPass([]byte(signup.Pass)) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Create struct to insert u := &User{ Username: signup.Alias, HashedPass: hashedPass, HasPass: createdWithPass, - Email: zero.NewString("", signup.Email != ""), + Email: prepareUserEmail(signup.Email, app.keys.EmailKey), Created: time.Now().Truncate(time.Second).UTC(), } - if signup.Email != "" { - encEmail, err := data.Encrypt(app.keys.EmailKey, signup.Email) - if err != nil { - log.Error("Unable to encrypt email: %s\n", err) - } else { - u.Email.String = string(encEmail) - } - } // Create actual user if err := app.db.CreateUser(app.cfg, u, desiredUsername); err != nil { return nil, err } // Log invite if needed if signup.InviteCode != "" { cu, err := app.db.GetUserForAuth(signup.Alias) if err != nil { return nil, err } err = app.db.CreateInvitedUser(signup.InviteCode, cu.ID) if err != nil { return nil, err } } // Add back unencrypted data for response if signup.Email != "" { u.Email.String = signup.Email } resUser := &AuthUser{ User: u, } if !createdWithPass { resUser.Password = signup.Pass } title := signup.Alias if signup.Normalize { title = desiredUsername } resUser.Collections = &[]Collection{ { Alias: signup.Alias, Title: title, }, } var token string if reqJSON && !signup.Web { token, err = app.db.GetAccessToken(u.ID) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser.AccessToken = token } else { session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. // Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144 log.Error("Session: %v; ignoring", err) } session.Values[cookieUserVal] = resUser.User.Cookie() err = session.Save(r, w) if err != nil { log.Error("Couldn't save session: %v", err) return nil, err } } if reqJSON { return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated) } return resUser, nil } func viewLogout(app *App, w http.ResponseWriter, r *http.Request) error { session, err := app.sessionStore.Get(r, cookieName) if err != nil { return ErrInternalCookieSession } // Ensure user has an email or password set before they go, so they don't // lose access to their account. val := session.Values[cookieUserVal] var u = &User{} var ok bool if u, ok = val.(*User); !ok { log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values) err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } u, err = app.db.GetUserByID(u.ID) if err != nil && err != ErrUserNotFound { return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."} } session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } func handleAPILogout(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } t := auth.GetToken(accessToken) if len(t) == 0 { return ErrNoAccessToken } err := app.db.DeleteToken(t) if err != nil { return err } return impart.HTTPError{Status: http.StatusNoContent} } func viewLogin(app *App, w http.ResponseWriter, r *http.Request) error { var earlyError string oneTimeToken := r.FormValue("with") if oneTimeToken != "" { log.Info("Calling login with one-time token.") err := login(app, w, r) if err != nil { log.Info("Received error: %v", err) earlyError = fmt.Sprintf("%s", err) } } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session; ignoring: %v", err) } p := &struct { page.StaticPage To string Message template.HTML Flashes []template.HTML LoginUsername string }{ pageForReq(app, r), r.FormValue("to"), template.HTML(""), []template.HTML{}, getTempInfo(app, "login-user", r, w), } if earlyError != "" { p.Flashes = append(p.Flashes, template.HTML(earlyError)) } // Display any error messages flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = pages["login.tmpl"].ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render login: %v", err) return err } return nil } func webLogin(app *App, w http.ResponseWriter, r *http.Request) error { err := login(app, w, r) if err != nil { username := r.FormValue("alias") // Login request was unsuccessful; save the error in the session and redirect them if err, ok := err.(impart.HTTPError); ok { session, _ := app.sessionStore.Get(r, cookieName) if session != nil { session.AddFlash(err.Message) session.Save(r, w) } if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 { // Retain fixed username recommendation for the login form username = m[1] } } // Pass along certain information saveTempInfo(app, "login-user", username, r, w) // Retain post-login URL if one was given redirectTo := "/login" postLoginRedirect := r.FormValue("to") if postLoginRedirect != "" { redirectTo += "?to=" + postLoginRedirect } log.Error("Unable to login: %v", err) return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo} } return nil } var loginAttemptUsers = sync.Map{} func login(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) oneTimeToken := r.FormValue("with") verbose := r.FormValue("all") == "true" || r.FormValue("verbose") == "1" || r.FormValue("verbose") == "true" || (reqJSON && oneTimeToken != "") redirectTo := r.FormValue("to") if redirectTo == "" { if app.cfg.App.SingleUser { redirectTo = "/me/new" } else { redirectTo = "/" } } var u *User var err error var signin userCredentials // Log in with one-time token if one is given if oneTimeToken != "" { log.Info("Login: Logging user in via token.") userID := app.db.GetUserID(oneTimeToken) if userID == -1 { log.Error("Login: Got user -1 from token") err := ErrBadAccessToken err.Message = "Expired or invalid login code." return err } log.Info("Login: Found user %d.", userID) u, err = app.db.GetUserByID(userID) if err != nil { log.Error("Unable to fetch user on one-time token login: %v", err) return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."} } log.Info("Login: Got user via token") } else { // Get params if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&signin) if err != nil { log.Error("Couldn't parse signin JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse signin form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&signin, r.PostForm) if err != nil { log.Error("Couldn't decode signin form request: %v\n", err) return ErrBadFormData } } log.Info("Login: Attempting login for '%s'", signin.Alias) // Validate required params (all) if signin.Alias == "" { msg := "Parameter `alias` required." if signin.Web { msg = "A username is required." } return impart.HTTPError{http.StatusBadRequest, msg} } if !signin.EmailLogin && signin.Pass == "" { msg := "Parameter `pass` required." if signin.Web { msg = "A password is required." } return impart.HTTPError{http.StatusBadRequest, msg} } // Prevent excessive login attempts on the same account // Skip this check in dev environment if !app.cfg.Server.Dev { now := time.Now() attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration)) if att { if attemptExpTime, ok := attemptExp.(time.Time); ok { if attemptExpTime.After(now) { // This user attempted previously, and the period hasn't expired yet return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."} } else { // This user attempted previously, but the time expired; free up space loginAttemptUsers.Delete(signin.Alias) } } else { log.Error("Unable to cast expiration to time") } } } // Retrieve password u, err = app.db.GetUserForAuth(signin.Alias) if err != nil { log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err) if strings.IndexAny(signin.Alias, "@") > 0 { log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message) return ErrUserNotFoundEmail } return err } // Authenticate if u.Email.String == "" { // User has no email set, so check if they haven't added a password, either, // so we can return a more helpful error message. if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass { log.Info("Tried logging in to %s, but no password or email.", signin.Alias) return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."} } } if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } } if reqJSON && !signin.Web { var token string if r.Header.Get("User-Agent") == "" { // Get last created token when User-Agent is empty token = app.db.FetchLastAccessToken(u.ID) if token == "" { token, err = app.db.GetAccessToken(u.ID) } } else { token, err = app.db.GetAccessToken(u.ID) } if err != nil { log.Error("Login: Unable to create access token: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser := getVerboseAuthUser(app, token, u, verbose) return impart.WriteSuccess(w, resUser, http.StatusOK) } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Login: Session: %v; ignoring", err) } // Remove unwanted data session.Values[cookieUserVal] = u.Cookie() err = session.Save(r, w) if err != nil { log.Error("Login: Couldn't save session: %v", err) // TODO: return error } // Send success if reqJSON { return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK) } log.Info("Login: Redirecting to %s", redirectTo) w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func getVerboseAuthUser(app *App, token string, u *User, verbose bool) *AuthUser { resUser := &AuthUser{ AccessToken: token, User: u, } // Fetch verbose user data if requested if verbose { posts, err := app.db.GetUserPosts(u) if err != nil { log.Error("Login: Unable to get user posts: %v", err) } colls, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("Login: Unable to get user collections: %v", err) } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { // TODO: correct error meesage log.Error("Login: Unable to get user collections: %v", err) } resUser.Posts = posts resUser.Collections = colls resUser.User.HasPass = passIsSet } return resUser } func viewExportOptions(app *App, u *User, w http.ResponseWriter, r *http.Request) error { // Fetch extra user data p := NewUserPage(app, r, u, "Export", nil) showUserPage(w, "export", p) return nil } func viewExportPosts(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var filename string var u = &User{} reqJSON := IsJSON(r) if reqJSON { // Use given Authorization header accessToken := r.Header.Get("Authorization") if accessToken == "" { return nil, filename, ErrNoAccessToken } userID := app.db.GetUserID(accessToken) if userID == -1 { return nil, filename, ErrBadAccessToken } var err error u, err = app.db.GetUserByID(userID) if err != nil { return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."} } } else { // Use user cookie session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Session: %v; ignoring", err) } val := session.Values[cookieUserVal] var ok bool if u, ok = val.(*User); !ok { return nil, filename, ErrNotLoggedIn } } filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") // Fetch data we're exporting var err error var data []byte posts, err := app.db.GetUserPosts(u) if err != nil { return data, filename, err } // Export as CSV if strings.HasSuffix(r.URL.Path, ".csv") { data = exportPostsCSV(app.cfg.App.Host, u, posts) return data, filename, err } if strings.HasSuffix(r.URL.Path, ".zip") { data = exportPostsZip(u, posts) return data, filename, err } if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(posts, "", "\t") } else { data, err = json.Marshal(posts) } return data, filename, err } func viewExportFull(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var err error filename := "" u := getUserSession(app, r) if u == nil { return nil, filename, ErrNotLoggedIn } filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") exportUser := compileFullExport(app, u) var data []byte if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(exportUser, "", "\t") } else { data, err = json.Marshal(exportUser) } return data, filename, err } func viewMeAPI(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) uObj := struct { ID int64 `json:"id,omitempty"` Username string `json:"username,omitempty"` }{} var err error if reqJSON { _, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization")) if err != nil { return err } } else { u := getUserSession(app, r) if u == nil { return impart.WriteSuccess(w, uObj, http.StatusOK) } uObj.Username = u.Username } return impart.WriteSuccess(w, uObj, http.StatusOK) } func viewMyPostsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) if !reqJSON { return ErrBadRequestedType } var err error p := GetPostsCache(u.ID) if p == nil { userPostsCache.Lock() if userPostsCache.users[u.ID].ready == nil { userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})} userPostsCache.Unlock() p, err = app.db.GetUserPosts(u) if err != nil { return err } CachePosts(u.ID, p) } else { userPostsCache.Unlock() <-userPostsCache.users[u.ID].ready p = GetPostsCache(u.ID) } } return impart.WriteSuccess(w, p, http.StatusOK) } func viewMyCollectionsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) if !reqJSON { return ErrBadRequestedType } p, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { return err } return impart.WriteSuccess(w, p, http.StatusOK) } func viewArticles(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p, err := app.db.GetAnonymousPosts(u) if err != nil { log.Error("unable to fetch anon posts: %v", err) } // nil-out AnonymousPosts slice for easy detection in the template if p != nil && len(*p) == 0 { p = nil } f, err := getSessionFlashes(app, w, r, nil) if err != nil { log.Error("unable to fetch flashes: %v", err) } c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } suspended, err := app.db.IsUserSuspended(u.ID) if err != nil { log.Error("view articles: %v", err) } d := struct { *UserPage AnonymousPosts *[]PublicPost Collections *[]Collection Suspended bool }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f), AnonymousPosts: p, Collections: c, Suspended: suspended, } d.UserPage.SetMessaging(u) w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT") showUserPage(w, "articles", d) return nil } func viewCollections(app *App, u *User, w http.ResponseWriter, r *http.Request) error { c, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) return fmt.Errorf("No collections") } f, _ := getSessionFlashes(app, w, r, nil) uc, _ := app.db.GetUserCollectionCount(u.ID) // TODO: handle any errors suspended, err := app.db.IsUserSuspended(u.ID) if err != nil { log.Error("view collections %v", err) return fmt.Errorf("view collections: %v", err) } d := struct { *UserPage Collections *[]Collection UsedCollections, TotalCollections int NewBlogsDisabled bool Suspended bool }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f), Collections: c, UsedCollections: int(uc), NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc), Suspended: suspended, } d.UserPage.SetMessaging(u) showUserPage(w, "collections", d) return nil } func viewEditCollection(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) c, err := app.db.GetCollection(vars["collection"]) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } suspended, err := app.db.IsUserSuspended(u.ID) if err != nil { log.Error("view edit collection %v", err) return fmt.Errorf("view edit collection: %v", err) } flashes, _ := getSessionFlashes(app, w, r, nil) obj := struct { *UserPage *Collection Suspended bool }{ UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes), Collection: c, Suspended: suspended, } showUserPage(w, "collection", obj) return nil } func updateSettings(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) var s userSettings var u *User var sess *sessions.Session var err error if reqJSON { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } u, err = app.db.GetAPIUser(accessToken) if err != nil { return ErrBadAccessToken } decoder := json.NewDecoder(r.Body) err := decoder.Decode(&s) if err != nil { log.Error("Couldn't parse settings JSON request: %v\n", err) return ErrBadJSON } // Prevent all username updates // TODO: support changing username via JSON API request s.Username = "" } else { u, sess = getUserAndSession(app, r) if u == nil { return ErrNotLoggedIn } err := r.ParseForm() if err != nil { log.Error("Couldn't parse settings form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&s, r.PostForm) if err != nil { log.Error("Couldn't decode settings form request: %v\n", err) return ErrBadFormData } } // Do update postUpdateReturn := r.FormValue("return") redirectTo := "/me/settings" if s.IsLogOut { redirectTo += "?logout=1" } else if postUpdateReturn != "" { redirectTo = postUpdateReturn } // Only do updates on values we need if s.Username != "" && s.Username == u.Username { // Username hasn't actually changed; blank it out s.Username = "" } err = app.db.ChangeSettings(app, u, &s) if err != nil { if reqJSON { return err } if err, ok := err.(impart.HTTPError); ok { addSessionFlash(app, w, r, err.Message, nil) } } else { // Successful update. if reqJSON { return impart.WriteSuccess(w, u, http.StatusOK) } if s.IsLogOut { redirectTo = "/me/logout" } else { sess.Values[cookieUserVal] = u.Cookie() addSessionFlash(app, w, r, "Account updated.", nil) } } w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func updatePassphrase(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } curPass := r.FormValue("current") newPass := r.FormValue("new") // Ensure a new password is given (always required) if newPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide a new password."} } userID, sudo := app.db.GetUserIDPrivilege(accessToken) if userID == -1 { return ErrBadAccessToken } // Ensure a current password is given if the access token doesn't have sudo // privileges. if !sudo && curPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide current password."} } // Hash the new password hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Do update err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass) if err != nil { return err } return impart.WriteSuccess(w, struct{}{}, http.StatusOK) } func viewStats(app *App, u *User, w http.ResponseWriter, r *http.Request) error { var c *Collection var err error vars := mux.Vars(r) alias := vars["collection"] if alias != "" { c, err = app.db.GetCollection(alias) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } } topPosts, err := app.db.GetTopPosts(u, alias) if err != nil { log.Error("Unable to get top posts: %v", err) return err } flashes, _ := getSessionFlashes(app, w, r, nil) titleStats := "" if c != nil { titleStats = c.DisplayTitle() + " " } suspended, err := app.db.IsUserSuspended(u.ID) if err != nil { log.Error("view stats: %v", err) return err } obj := struct { *UserPage VisitsBlog string Collection *Collection TopPosts *[]PublicPost APFollowers int Suspended bool }{ UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes), VisitsBlog: alias, Collection: c, TopPosts: topPosts, Suspended: suspended, } if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(c) if err != nil { return err } obj.APFollowers = len(*folls) } showUserPage(w, "stats", obj) return nil } func viewSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error { fullUser, err := app.db.GetUserByID(u.ID) if err != nil { log.Error("Unable to get user for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { log.Error("Unable to get isUserPassSet for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } flashes, _ := getSessionFlashes(app, w, r, nil) obj := struct { *UserPage Email string HasPass bool IsLogOut bool Suspended bool }{ UserPage: NewUserPage(app, r, u, "Account Settings", flashes), Email: fullUser.EmailClear(app.keys), HasPass: passIsSet, IsLogOut: r.FormValue("logout") == "1", Suspended: fullUser.IsSilenced(), } showUserPage(w, "settings", obj) return nil } func saveTempInfo(app *App, key, val string, r *http.Request, w http.ResponseWriter) error { session, err := app.sessionStore.Get(r, "t") if err != nil { return ErrInternalCookieSession } session.Values[key] = val err = session.Save(r, w) if err != nil { log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err) } return err } func getTempInfo(app *App, key string, r *http.Request, w http.ResponseWriter) string { session, err := app.sessionStore.Get(r, "t") if err != nil { return "" } // Get the information var s = "" var ok bool if s, ok = session.Values[key].(string); !ok { return "" } // Delete cookie session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't erase temp data for key %s: %v", key, err) } // Return value return s } + +func prepareUserEmail(input string, emailKey []byte) zero.String { + email := zero.NewString("", input != "") + if len(input) > 0 { + encEmail, err := data.Encrypt(emailKey, input) + if err != nil { + log.Error("Unable to encrypt email: %s\n", err) + } else { + email.String = string(encEmail) + } + } + return email +} diff --git a/admin.go b/admin.go index ebb4225..0a73a11 100644 --- a/admin.go +++ b/admin.go @@ -1,526 +1,526 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "fmt" "net/http" "runtime" "strconv" "strings" "time" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/log" "github.com/writeas/web-core/passgen" "github.com/writeas/writefreely/appstats" "github.com/writeas/writefreely/config" ) var ( appStartTime = time.Now() sysStatus systemStatus ) const adminUsersPerPage = 30 type systemStatus struct { Uptime string NumGoroutine int // General statistics. MemAllocated string // bytes allocated and still in use MemTotal string // bytes allocated (even if freed) MemSys string // bytes obtained from system (sum of XxxSys below) Lookups uint64 // number of pointer lookups MemMallocs uint64 // number of mallocs MemFrees uint64 // number of frees // Main allocation heap statistics. HeapAlloc string // bytes allocated and still in use HeapSys string // bytes obtained from system HeapIdle string // bytes in idle spans HeapInuse string // bytes in non-idle span HeapReleased string // bytes released to the OS HeapObjects uint64 // total number of allocated objects // Low-level fixed-size structure allocator statistics. // Inuse is bytes used now. // Sys is bytes obtained from system. StackInuse string // bootstrap stacks StackSys string MSpanInuse string // mspan structures MSpanSys string MCacheInuse string // mcache structures MCacheSys string BuckHashSys string // profiling bucket hash table GCSys string // GC metadata OtherSys string // other system allocations // Garbage collector statistics. NextGC string // next run in HeapAlloc time (bytes) LastGC string // last run in absolute time (ns) PauseTotalNs string PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256] NumGC uint32 } type inspectedCollection struct { CollectionObj Followers int LastPost string } type instanceContent struct { ID string Type string Title sql.NullString Content string Updated time.Time } func (c instanceContent) UpdatedFriendly() string { /* // TODO: accept a locale in this method and use that for the format var loc monday.Locale = monday.LocaleEnUS return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc) */ return c.Updated.Format("January 2, 2006, 3:04 PM") } func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error { updateAppStats() p := struct { *UserPage SysStatus systemStatus Config config.AppCfg Message, ConfigMessage string }{ UserPage: NewUserPage(app, r, u, "Admin", nil), SysStatus: sysStatus, Config: app.cfg.App, Message: r.FormValue("m"), ConfigMessage: r.FormValue("cm"), } showUserPage(w, "admin", p) return nil } func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage Config config.AppCfg Message string Users *[]User CurPage int TotalUsers int64 TotalPages []int }{ UserPage: NewUserPage(app, r, u, "Users", nil), Config: app.cfg.App, Message: r.FormValue("m"), } p.TotalUsers = app.db.GetAllUsersCount() ttlPages := p.TotalUsers / adminUsersPerPage p.TotalPages = []int{} for i := 1; i <= int(ttlPages); i++ { p.TotalPages = append(p.TotalPages, i) } var err error p.CurPage, err = strconv.Atoi(r.FormValue("p")) if err != nil || p.CurPage < 1 { p.CurPage = 1 } else if p.CurPage > int(ttlPages) { p.CurPage = int(ttlPages) } p.Users, err = app.db.GetAllUsers(uint(p.CurPage)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)} } showUserPage(w, "users", p) return nil } func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } p := struct { *UserPage Config config.AppCfg Message string User *User Colls []inspectedCollection LastPost string NewPassword string TotalPosts int64 ClearEmail string }{ Config: app.cfg.App, Message: r.FormValue("m"), Colls: []inspectedCollection{}, } var err error p.User, err = app.db.GetUserForAuth(username) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user: %v", err)} } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { if strings.HasPrefix(flash, "SUCCESS: ") { p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ") p.ClearEmail = p.User.EmailClear(app.keys) } } p.UserPage = NewUserPage(app, r, u, p.User.Username, nil) p.TotalPosts = app.db.GetUserPostsCount(p.User.ID) lp, err := app.db.GetUserLastPostTime(p.User.ID) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)} } if lp != nil { p.LastPost = lp.Format("January 2, 2006, 3:04 PM") } colls, err := app.db.GetCollections(p.User, app.cfg.App.Host) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)} } for _, c := range *colls { ic := inspectedCollection{ CollectionObj: CollectionObj{Collection: c}, } if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(&c) if err == nil { // TODO: handle error here (at least log it) ic.Followers = len(*folls) } } app.db.GetPostsCount(&ic.CollectionObj, true) lp, err := app.db.GetCollectionLastPostTime(c.ID) if err != nil { log.Error("Didn't get last post time for collection %d: %v", c.ID, err) } if lp != nil { ic.LastPost = lp.Format("January 2, 2006, 3:04 PM") } p.Colls = append(p.Colls, ic) } showUserPage(w, "view-user", p) return nil } func handleAdminToggleUserStatus(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } user, err := app.db.GetUserForAuth(username) if err != nil { log.Error("failed to get user: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)} } if user.IsSilenced() { err = app.db.SetUserStatus(user.ID, UserActive) } else { err = app.db.SetUserStatus(user.ID, UserSilenced) } if err != nil { log.Error("toggle user suspended: %v", err) - return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v")} + return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)} } return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)} } func handleAdminResetUserPass(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } // Generate new random password since none supplied pass := passgen.NewWordish() hashedPass, err := auth.HashPass([]byte(pass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)} } userIDVal := r.FormValue("user") log.Info("ADMIN: Changing user %s password", userIDVal) id, err := strconv.Atoi(userIDVal) if err != nil { return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)} } err = app.db.ChangePassphrase(int64(id), true, "", hashedPass) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)} } log.Info("ADMIN: Successfully changed.") addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil) return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)} } func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage Config config.AppCfg Message string Pages []*instanceContent }{ UserPage: NewUserPage(app, r, u, "Pages", nil), Config: app.cfg.App, Message: r.FormValue("m"), } var err error p.Pages, err = app.db.GetInstancePages() if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)} } // Add in default pages var hasAbout, hasPrivacy bool for i, c := range p.Pages { if hasAbout && hasPrivacy { break } if c.ID == "about" { hasAbout = true if !c.Title.Valid { p.Pages[i].Title = defaultAboutTitle(app.cfg) } } else if c.ID == "privacy" { hasPrivacy = true if !c.Title.Valid { p.Pages[i].Title = defaultPrivacyTitle() } } } if !hasAbout { p.Pages = append(p.Pages, &instanceContent{ ID: "about", Title: defaultAboutTitle(app.cfg), Content: defaultAboutPage(app.cfg), Updated: defaultPageUpdatedTime, }) } if !hasPrivacy { p.Pages = append(p.Pages, &instanceContent{ ID: "privacy", Title: defaultPrivacyTitle(), Content: defaultPrivacyPolicy(app.cfg), Updated: defaultPageUpdatedTime, }) } showUserPage(w, "pages", p) return nil } func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] if slug == "" { return impart.HTTPError{http.StatusFound, "/admin/pages"} } p := struct { *UserPage Config config.AppCfg Message string Banner *instanceContent Content *instanceContent }{ Config: app.cfg.App, Message: r.FormValue("m"), } var err error // Get pre-defined pages, or select slug if slug == "about" { p.Content, err = getAboutPage(app) } else if slug == "privacy" { p.Content, err = getPrivacyPage(app) } else if slug == "landing" { p.Banner, err = getLandingBanner(app) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)} } p.Content, err = getLandingBody(app) p.Content.ID = "landing" } else if slug == "reader" { p.Content, err = getReaderSection(app) } else { p.Content, err = app.db.GetDynamicContent(slug) } if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)} } title := "New page" if p.Content != nil { title = "Edit " + p.Content.ID } else { p.Content = &instanceContent{} } p.UserPage = NewUserPage(app, r, u, title, nil) showUserPage(w, "view-page", p) return nil } func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) id := vars["page"] // Validate if id != "about" && id != "privacy" && id != "landing" && id != "reader" { return impart.HTTPError{http.StatusNotFound, "No such page."} } var err error m := "" if id == "landing" { // Handle special landing page err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section") if err != nil { m = "?m=" + err.Error() return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section") } else if id == "reader" { // Update sections with titles err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section") } else { // Update page err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page") } if err != nil { m = "?m=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error { apper.App().cfg.App.SiteName = r.FormValue("site_name") apper.App().cfg.App.SiteDesc = r.FormValue("site_desc") apper.App().cfg.App.Landing = r.FormValue("landing") apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on" mul, err := strconv.Atoi(r.FormValue("min_username_len")) if err == nil { apper.App().cfg.App.MinUsernameLen = mul } mb, err := strconv.Atoi(r.FormValue("max_blogs")) if err == nil { apper.App().cfg.App.MaxBlogs = mb } apper.App().cfg.App.Federation = r.FormValue("federation") == "on" apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on" apper.App().cfg.App.Private = r.FormValue("private") == "on" apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on" if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil { log.Info("Initializing local timeline...") initLocalTimeline(apper.App()) } apper.App().cfg.App.UserInvites = r.FormValue("user_invites") if apper.App().cfg.App.UserInvites == "none" { apper.App().cfg.App.UserInvites = "" } apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility") m := "?cm=Configuration+saved." err = apper.SaveConfig(apper.App().cfg) if err != nil { m = "?cm=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin" + m + "#config"} } func updateAppStats() { sysStatus.Uptime = appstats.TimeSincePro(appStartTime) m := new(runtime.MemStats) runtime.ReadMemStats(m) sysStatus.NumGoroutine = runtime.NumGoroutine() sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc)) sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc)) sysStatus.MemSys = appstats.FileSize(int64(m.Sys)) sysStatus.Lookups = m.Lookups sysStatus.MemMallocs = m.Mallocs sysStatus.MemFrees = m.Frees sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc)) sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys)) sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle)) sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse)) sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased)) sysStatus.HeapObjects = m.HeapObjects sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse)) sysStatus.StackSys = appstats.FileSize(int64(m.StackSys)) sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse)) sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys)) sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse)) sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys)) sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys)) sysStatus.GCSys = appstats.FileSize(int64(m.GCSys)) sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys)) sysStatus.NextGC = appstats.FileSize(int64(m.NextGC)) sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000) sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000) sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000) sysStatus.NumGC = m.NumGC } func adminResetPassword(app *App, u *User, newPass string) error { hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)} } err = app.db.ChangePassphrase(u.ID, true, "", hashedPass) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)} } return nil } diff --git a/app.go b/app.go index 018ce37..d465a3e 100644 --- a/app.go +++ b/app.go @@ -1,826 +1,834 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "crypto/tls" "database/sql" "fmt" "html/template" "io/ioutil" "net/http" "net/url" "os" "os/signal" "path/filepath" "regexp" "strings" "syscall" "time" "github.com/gorilla/mux" "github.com/gorilla/schema" "github.com/gorilla/sessions" "github.com/manifoldco/promptui" "github.com/writeas/go-strip-markdown" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/converter" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/key" "github.com/writeas/writefreely/migrations" "github.com/writeas/writefreely/page" "golang.org/x/crypto/acme/autocert" ) const ( staticDir = "static" assumedTitleLen = 80 postsPerPage = 10 serverSoftware = "WriteFreely" softwareURL = "https://writefreely.org" ) var ( debugging bool // Software version can be set from git env using -ldflags - softwareVer = "0.11.1" + softwareVer = "0.11.2" // DEPRECATED VARS isSingleUser bool ) // App holds data and configuration for an individual WriteFreely instance. type App struct { router *mux.Router shttp *http.ServeMux db *datastore cfg *config.Config cfgFile string keys *key.Keychain - sessionStore *sessions.CookieStore + sessionStore sessions.Store formDecoder *schema.Decoder timeline *localTimeline } // DB returns the App's datastore func (app *App) DB() *datastore { return app.db } // Router returns the App's router func (app *App) Router() *mux.Router { return app.router } // Config returns the App's current configuration. func (app *App) Config() *config.Config { return app.cfg } // SetConfig updates the App's Config to the given value. func (app *App) SetConfig(cfg *config.Config) { app.cfg = cfg } // SetKeys updates the App's Keychain to the given value. func (app *App) SetKeys(k *key.Keychain) { app.keys = k } +func (app *App) SessionStore() sessions.Store { + return app.sessionStore +} + +func (app *App) SetSessionStore(s sessions.Store) { + app.sessionStore = s +} + // Apper is the interface for getting data into and out of a WriteFreely // instance (or "App"). // // App returns the App for the current instance. // // LoadConfig reads an app configuration into the App, returning any error // encountered. // // SaveConfig persists the current App configuration. // // LoadKeys reads the App's encryption keys and loads them into its // key.Keychain. type Apper interface { App() *App LoadConfig() error SaveConfig(*config.Config) error LoadKeys() error ReqLog(r *http.Request, status int, timeSince time.Duration) string } // App returns the App func (app *App) App() *App { return app } // LoadConfig loads and parses a config file. func (app *App) LoadConfig() error { log.Info("Loading %s configuration...", app.cfgFile) cfg, err := config.Load(app.cfgFile) if err != nil { log.Error("Unable to load configuration: %v", err) os.Exit(1) return err } app.cfg = cfg return nil } // SaveConfig saves the given Config to disk -- namely, to the App's cfgFile. func (app *App) SaveConfig(c *config.Config) error { return config.Save(c, app.cfgFile) } // LoadKeys reads all needed keys from disk into the App. In order to use the // configured `Server.KeysParentDir`, you must call initKeyPaths(App) before // this. func (app *App) LoadKeys() error { var err error app.keys = &key.Keychain{} if debugging { log.Info(" %s", emailKeyPath) } app.keys.EmailKey, err = ioutil.ReadFile(emailKeyPath) if err != nil { return err } if debugging { log.Info(" %s", cookieAuthKeyPath) } app.keys.CookieAuthKey, err = ioutil.ReadFile(cookieAuthKeyPath) if err != nil { return err } if debugging { log.Info(" %s", cookieKeyPath) } app.keys.CookieKey, err = ioutil.ReadFile(cookieKeyPath) if err != nil { return err } return nil } func (app *App) ReqLog(r *http.Request, status int, timeSince time.Duration) string { return fmt.Sprintf("\"%s %s\" %d %s \"%s\"", r.Method, r.RequestURI, status, timeSince, r.UserAgent()) } // handleViewHome shows page at root path. It checks the configuration and // authentication state to show the correct page. func handleViewHome(app *App, w http.ResponseWriter, r *http.Request) error { if app.cfg.App.SingleUser { // Render blog index return handleViewCollection(app, w, r) } // Multi-user instance forceLanding := r.FormValue("landing") == "1" if !forceLanding { // Show correct page based on user auth status and configured landing path u := getUserSession(app, r) if app.cfg.App.Chorus { // This instance is focused on reading, so show Reader on home route if not // private or a private-instance user is logged in. if !app.cfg.App.Private || u != nil { return viewLocalTimeline(app, w, r) } } if u != nil { // User is logged in, so show the Pad return handleViewPad(app, w, r) } if land := app.cfg.App.LandingPath(); land != "/" { return impart.HTTPError{http.StatusFound, land} } } return handleViewLanding(app, w, r) } func handleViewLanding(app *App, w http.ResponseWriter, r *http.Request) error { forceLanding := r.FormValue("landing") == "1" p := struct { page.StaticPage Flashes []template.HTML Banner template.HTML Content template.HTML ForcedLanding bool }{ StaticPage: pageForReq(app, r), ForcedLanding: forceLanding, } banner, err := getLandingBanner(app) if err != nil { log.Error("unable to get landing banner: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)} } p.Banner = template.HTML(applyMarkdown([]byte(banner.Content), "", app.cfg)) content, err := getLandingBody(app) if err != nil { log.Error("unable to get landing content: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get content: %v", err)} } p.Content = template.HTML(applyMarkdown([]byte(content.Content), "", app.cfg)) // Get error messages session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session in handleViewHome; ignoring: %v", err) } flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } // Show landing page return renderPage(w, "landing.tmpl", p) } func handleTemplatedPage(app *App, w http.ResponseWriter, r *http.Request, t *template.Template) error { p := struct { page.StaticPage ContentTitle string Content template.HTML PlainContent string Updated string AboutStats *InstanceStats }{ StaticPage: pageForReq(app, r), } if r.URL.Path == "/about" || r.URL.Path == "/privacy" { var c *instanceContent var err error if r.URL.Path == "/about" { c, err = getAboutPage(app) // Fetch stats p.AboutStats = &InstanceStats{} p.AboutStats.NumPosts, _ = app.db.GetTotalPosts() p.AboutStats.NumBlogs, _ = app.db.GetTotalCollections() } else { c, err = getPrivacyPage(app) } if err != nil { return err } p.ContentTitle = c.Title.String p.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg)) p.PlainContent = shortPostDescription(stripmd.Strip(c.Content)) if !c.Updated.IsZero() { p.Updated = c.Updated.Format("January 2, 2006") } } // Serve templated page err := t.ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render page: %v", err) } return nil } func pageForReq(app *App, r *http.Request) page.StaticPage { p := page.StaticPage{ AppCfg: app.cfg.App, Path: r.URL.Path, Version: "v" + softwareVer, } // Add user information, if given var u *User accessToken := r.FormValue("t") if accessToken != "" { userID := app.db.GetUserID(accessToken) if userID != -1 { var err error u, err = app.db.GetUserByID(userID) if err == nil { p.Username = u.Username } } } else { u = getUserSession(app, r) if u != nil { p.Username = u.Username p.IsAdmin = u != nil && u.IsAdmin() p.CanInvite = canUserInvite(app.cfg, p.IsAdmin) } } p.CanViewReader = !app.cfg.App.Private || u != nil return p } var fileRegex = regexp.MustCompile("/([^/]*\\.[^/]*)$") // Initialize loads the app configuration and initializes templates, keys, // session, route handlers, and the database connection. func Initialize(apper Apper, debug bool) (*App, error) { debugging = debug apper.LoadConfig() // Load templates err := InitTemplates(apper.App().Config()) if err != nil { return nil, fmt.Errorf("load templates: %s", err) } // Load keys and set up session initKeyPaths(apper.App()) // TODO: find a better way to do this, since it's unneeded in all Apper implementations err = InitKeys(apper) if err != nil { return nil, fmt.Errorf("init keys: %s", err) } apper.App().InitSession() apper.App().InitDecoder() err = ConnectToDatabase(apper.App()) if err != nil { return nil, fmt.Errorf("connect to DB: %s", err) } // Handle local timeline, if enabled if apper.App().cfg.App.LocalTimeline { log.Info("Initializing local timeline...") initLocalTimeline(apper.App()) } return apper.App(), nil } func Serve(app *App, r *mux.Router) { log.Info("Going to serve...") isSingleUser = app.cfg.App.SingleUser app.cfg.Server.Dev = debugging // Handle shutdown c := make(chan os.Signal, 2) signal.Notify(c, os.Interrupt, syscall.SIGTERM) go func() { <-c log.Info("Shutting down...") shutdown(app) log.Info("Done.") os.Exit(0) }() // Start web application server var bindAddress = app.cfg.Server.Bind if bindAddress == "" { bindAddress = "localhost" } var err error if app.cfg.IsSecureStandalone() { if app.cfg.Server.Autocert { m := &autocert.Manager{ Prompt: autocert.AcceptTOS, Cache: autocert.DirCache(app.cfg.Server.TLSCertPath), } host, err := url.Parse(app.cfg.App.Host) if err != nil { log.Error("[WARNING] Unable to parse configured host! %s", err) log.Error(`[WARNING] ALL hosts are allowed, which can open you to an attack where clients connect to a server by IP address and pretend to be asking for an incorrect host name, and cause you to reach the CA's rate limit for certificate requests. We recommend supplying a valid host name.`) log.Info("Using autocert on ANY host") } else { log.Info("Using autocert on host %s", host.Host) m.HostPolicy = autocert.HostWhitelist(host.Host) } s := &http.Server{ Addr: ":https", Handler: r, TLSConfig: &tls.Config{ GetCertificate: m.GetCertificate, }, } s.SetKeepAlivesEnabled(false) go func() { log.Info("Serving redirects on http://%s:80", bindAddress) err = http.ListenAndServe(":80", m.HTTPHandler(nil)) log.Error("Unable to start redirect server: %v", err) }() log.Info("Serving on https://%s:443", bindAddress) log.Info("---") err = s.ListenAndServeTLS("", "") } else { go func() { log.Info("Serving redirects on http://%s:80", bindAddress) err = http.ListenAndServe(fmt.Sprintf("%s:80", bindAddress), http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) { http.Redirect(w, r, app.cfg.App.Host, http.StatusMovedPermanently) })) log.Error("Unable to start redirect server: %v", err) }() log.Info("Serving on https://%s:443", bindAddress) log.Info("Using manual certificates") log.Info("---") err = http.ListenAndServeTLS(fmt.Sprintf("%s:443", bindAddress), app.cfg.Server.TLSCertPath, app.cfg.Server.TLSKeyPath, r) } } else { log.Info("Serving on http://%s:%d\n", bindAddress, app.cfg.Server.Port) log.Info("---") err = http.ListenAndServe(fmt.Sprintf("%s:%d", bindAddress, app.cfg.Server.Port), r) } if err != nil { log.Error("Unable to start: %v", err) os.Exit(1) } } func (app *App) InitDecoder() { // TODO: do this at the package level, instead of the App level // Initialize modules app.formDecoder = schema.NewDecoder() app.formDecoder.RegisterConverter(converter.NullJSONString{}, converter.ConvertJSONNullString) app.formDecoder.RegisterConverter(converter.NullJSONBool{}, converter.ConvertJSONNullBool) app.formDecoder.RegisterConverter(sql.NullString{}, converter.ConvertSQLNullString) app.formDecoder.RegisterConverter(sql.NullBool{}, converter.ConvertSQLNullBool) app.formDecoder.RegisterConverter(sql.NullInt64{}, converter.ConvertSQLNullInt64) app.formDecoder.RegisterConverter(sql.NullFloat64{}, converter.ConvertSQLNullFloat64) } // ConnectToDatabase validates and connects to the configured database, then // tests the connection. func ConnectToDatabase(app *App) error { // Check database configuration if app.cfg.Database.Type == driverMySQL && (app.cfg.Database.User == "" || app.cfg.Database.Password == "") { return fmt.Errorf("Database user or password not set.") } if app.cfg.Database.Host == "" { app.cfg.Database.Host = "localhost" } if app.cfg.Database.Database == "" { app.cfg.Database.Database = "writefreely" } // TODO: check err connectToDatabase(app) // Test database connection err := app.db.Ping() if err != nil { return fmt.Errorf("Database ping failed: %s", err) } return nil } // FormatVersion constructs the version string for the application func FormatVersion() string { return serverSoftware + " " + softwareVer } // OutputVersion prints out the version of the application. func OutputVersion() { fmt.Println(FormatVersion()) } // NewApp creates a new app instance. func NewApp(cfgFile string) *App { return &App{ cfgFile: cfgFile, } } // CreateConfig creates a default configuration and saves it to the app's cfgFile. func CreateConfig(app *App) error { log.Info("Creating configuration...") c := config.New() log.Info("Saving configuration %s...", app.cfgFile) err := config.Save(c, app.cfgFile) if err != nil { return fmt.Errorf("Unable to save configuration: %v", err) } return nil } // DoConfig runs the interactive configuration process. func DoConfig(app *App, configSections string) { if configSections == "" { configSections = "server db app" } // let's check there aren't any garbage in the list configSectionsArray := strings.Split(configSections, " ") for _, element := range configSectionsArray { if element != "server" && element != "db" && element != "app" { log.Error("Invalid argument to --sections. Valid arguments are only \"server\", \"db\" and \"app\"") os.Exit(1) } } d, err := config.Configure(app.cfgFile, configSections) if err != nil { log.Error("Unable to configure: %v", err) os.Exit(1) } app.cfg = d.Config connectToDatabase(app) defer shutdown(app) if !app.db.DatabaseInitialized() { err = adminInitDatabase(app) if err != nil { log.Error(err.Error()) os.Exit(1) } } else { log.Info("Database already initialized.") } if d.User != nil { u := &User{ Username: d.User.Username, HashedPass: d.User.HashedPass, Created: time.Now().Truncate(time.Second).UTC(), } // Create blog log.Info("Creating user %s...\n", u.Username) err = app.db.CreateUser(app.cfg, u, app.cfg.App.SiteName) if err != nil { log.Error("Unable to create user: %s", err) os.Exit(1) } log.Info("Done!") } os.Exit(0) } // GenerateKeyFiles creates app encryption keys and saves them into the configured KeysParentDir. func GenerateKeyFiles(app *App) error { // Read keys path from config app.LoadConfig() // Create keys dir if it doesn't exist yet fullKeysDir := filepath.Join(app.cfg.Server.KeysParentDir, keysDir) if _, err := os.Stat(fullKeysDir); os.IsNotExist(err) { err = os.Mkdir(fullKeysDir, 0700) if err != nil { return err } } // Generate keys initKeyPaths(app) // TODO: use something like https://github.com/hashicorp/go-multierror to return errors var keyErrs error err := generateKey(emailKeyPath) if err != nil { keyErrs = err } err = generateKey(cookieAuthKeyPath) if err != nil { keyErrs = err } err = generateKey(cookieKeyPath) if err != nil { keyErrs = err } return keyErrs } // CreateSchema creates all database tables needed for the application. func CreateSchema(apper Apper) error { apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) err := adminInitDatabase(apper.App()) if err != nil { return err } return nil } // Migrate runs all necessary database migrations. func Migrate(apper Apper) error { apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) err := migrations.Migrate(migrations.NewDatastore(apper.App().db.DB, apper.App().db.driverName)) if err != nil { return fmt.Errorf("migrate: %s", err) } return nil } // ResetPassword runs the interactive password reset process. func ResetPassword(apper Apper, username string) error { // Connect to the database apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) // Fetch user u, err := apper.App().db.GetUserForAuth(username) if err != nil { log.Error("Get user: %s", err) os.Exit(1) } // Prompt for new password prompt := promptui.Prompt{ Templates: &promptui.PromptTemplates{ Success: "{{ . | bold | faint }}: ", }, Label: "New password", Mask: '*', } newPass, err := prompt.Run() if err != nil { log.Error("%s", err) os.Exit(1) } // Do the update log.Info("Updating...") err = adminResetPassword(apper.App(), u, newPass) if err != nil { log.Error("%s", err) os.Exit(1) } log.Info("Success.") return nil } func connectToDatabase(app *App) { log.Info("Connecting to %s database...", app.cfg.Database.Type) var db *sql.DB var err error if app.cfg.Database.Type == driverMySQL { db, err = sql.Open(app.cfg.Database.Type, fmt.Sprintf("%s:%s@tcp(%s:%d)/%s?charset=utf8mb4&parseTime=true&loc=%s", app.cfg.Database.User, app.cfg.Database.Password, app.cfg.Database.Host, app.cfg.Database.Port, app.cfg.Database.Database, url.QueryEscape(time.Local.String()))) db.SetMaxOpenConns(50) } else if app.cfg.Database.Type == driverSQLite { if !SQLiteEnabled { log.Error("Invalid database type '%s'. Binary wasn't compiled with SQLite3 support.", app.cfg.Database.Type) os.Exit(1) } if app.cfg.Database.FileName == "" { log.Error("SQLite database filename value in config.ini is empty.") os.Exit(1) } db, err = sql.Open("sqlite3_with_regex", app.cfg.Database.FileName+"?parseTime=true&cached=shared") db.SetMaxOpenConns(1) } else { log.Error("Invalid database type '%s'. Only 'mysql' and 'sqlite3' are supported right now.", app.cfg.Database.Type) os.Exit(1) } if err != nil { log.Error("%s", err) os.Exit(1) } app.db = &datastore{db, app.cfg.Database.Type} } func shutdown(app *App) { log.Info("Closing database connection...") app.db.Close() } // CreateUser creates a new admin or normal user from the given credentials. func CreateUser(apper Apper, username, password string, isAdmin bool) error { // Create an admin user with --create-admin apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) // Ensure an admin / first user doesn't already exist firstUser, _ := apper.App().db.GetUserByID(1) if isAdmin { // Abort if trying to create admin user, but one already exists if firstUser != nil { return fmt.Errorf("Admin user already exists (%s). Create a regular user with: writefreely --create-user", firstUser.Username) } } else { // Abort if trying to create regular user, but no admin exists yet if firstUser == nil { return fmt.Errorf("No admin user exists yet. Create an admin first with: writefreely --create-admin") } } // Create the user // Normalize and validate username desiredUsername := username username = getSlug(username, "") usernameDesc := username if username != desiredUsername { usernameDesc += " (originally: " + desiredUsername + ")" } if !author.IsValidUsername(apper.App().cfg, username) { return fmt.Errorf("Username %s is invalid, reserved, or shorter than configured minimum length (%d characters).", usernameDesc, apper.App().cfg.App.MinUsernameLen) } // Hash the password hashedPass, err := auth.HashPass([]byte(password)) if err != nil { return fmt.Errorf("Unable to hash password: %v", err) } u := &User{ Username: username, HashedPass: hashedPass, Created: time.Now().Truncate(time.Second).UTC(), } userType := "user" if isAdmin { userType = "admin" } log.Info("Creating %s %s...", userType, usernameDesc) err = apper.App().db.CreateUser(apper.App().Config(), u, desiredUsername) if err != nil { return fmt.Errorf("Unable to create user: %s", err) } log.Info("Done!") return nil } func adminInitDatabase(app *App) error { schemaFileName := "schema.sql" if app.cfg.Database.Type == driverSQLite { schemaFileName = "sqlite.sql" } schema, err := Asset(schemaFileName) if err != nil { return fmt.Errorf("Unable to load schema file: %v", err) } tblReg := regexp.MustCompile("CREATE TABLE (IF NOT EXISTS )?`([a-z_]+)`") queries := strings.Split(string(schema), ";\n") for _, q := range queries { if strings.TrimSpace(q) == "" { continue } parts := tblReg.FindStringSubmatch(q) if len(parts) >= 3 { log.Info("Creating table %s...", parts[2]) } else { log.Info("Creating table ??? (Weird query) No match in: %v", parts) } _, err = app.db.Exec(q) if err != nil { log.Error("%s", err) } else { log.Info("Created.") } } // Set up migrations table log.Info("Initializing appmigrations table...") err = migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName)) if err != nil { return fmt.Errorf("Unable to set initial migrations: %v", err) } log.Info("Running migrations...") err = migrations.Migrate(migrations.NewDatastore(app.db.DB, app.db.driverName)) if err != nil { return fmt.Errorf("migrate: %s", err) } log.Info("Done.") return nil } diff --git a/collections.go b/collections.go index b85f0a4..66ad7a0 100644 --- a/collections.go +++ b/collections.go @@ -1,1122 +1,1132 @@ /* * Copyright © 2018 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "encoding/json" "fmt" "html/template" "math" "net/http" "net/url" "regexp" "strconv" "strings" "unicode" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/activitystreams" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/bots" "github.com/writeas/web-core/log" waposts "github.com/writeas/web-core/posts" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" ) type ( // TODO: add Direction to db // TODO: add Language to db Collection struct { ID int64 `datastore:"id" json:"-"` Alias string `datastore:"alias" schema:"alias" json:"alias"` Title string `datastore:"title" schema:"title" json:"title"` Description string `datastore:"description" schema:"description" json:"description"` Direction string `schema:"dir" json:"dir,omitempty"` Language string `schema:"lang" json:"lang,omitempty"` StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"` Script string `datastore:"script" schema:"script" json:"script,omitempty"` Public bool `datastore:"public" json:"public"` Visibility collVisibility `datastore:"private" json:"-"` Format string `datastore:"format" json:"format,omitempty"` Views int64 `json:"views"` OwnerID int64 `datastore:"owner_id" json:"-"` PublicOwner bool `datastore:"public_owner" json:"-"` URL string `json:"url,omitempty"` db *datastore hostName string } CollectionObj struct { Collection TotalPosts int `json:"total_posts"` Owner *User `json:"owner,omitempty"` Posts *[]PublicPost `json:"posts,omitempty"` } DisplayCollection struct { *CollectionObj Prefix string IsTopLevel bool CurrentPage int TotalPages int Format *CollectionFormat Suspended bool } SubmittedCollection struct { // Data used for updating a given collection ID int64 OwnerID uint64 // Form helpers PreferURL string `schema:"prefer_url" json:"prefer_url"` Privacy int `schema:"privacy" json:"privacy"` Pass string `schema:"password" json:"password"` MathJax bool `schema:"mathjax" json:"mathjax"` Handle string `schema:"handle" json:"handle"` // Actual collection values updated in the DB Alias *string `schema:"alias" json:"alias"` Title *string `schema:"title" json:"title"` Description *string `schema:"description" json:"description"` StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"` Script *sql.NullString `schema:"script" json:"script"` Visibility *int `schema:"visibility" json:"public"` Format *sql.NullString `schema:"format" json:"format"` } CollectionFormat struct { Format string } collectionReq struct { // Information about the collection request itself prefix, alias, domain string isCustomDomain bool // User-related fields isCollOwner bool } ) func (sc *SubmittedCollection) FediverseHandle() string { if sc.Handle == "" { return apCustomHandleDefault } return getSlug(sc.Handle, "") } // collVisibility represents the visibility level for the collection. type collVisibility int // Visibility levels. Values are bitmasks, stored in the database as // decimal numbers. If adding types, append them to this list. If removing, // replace the desired visibility with a new value. const CollUnlisted collVisibility = 0 const ( CollPublic collVisibility = 1 << iota CollPrivate CollProtected ) var collVisibilityStrings = map[string]collVisibility{ "unlisted": CollUnlisted, "public": CollPublic, "private": CollPrivate, "protected": CollProtected, } func defaultVisibility(cfg *config.Config) collVisibility { vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility] if !ok { vis = CollUnlisted } return vis } func (cf *CollectionFormat) Ascending() bool { return cf.Format == "novel" } func (cf *CollectionFormat) ShowDates() bool { return cf.Format == "blog" } func (cf *CollectionFormat) PostsPerPage() int { if cf.Format == "novel" { return postsPerPage } return postsPerPage } // Valid returns whether or not a format value is valid. func (cf *CollectionFormat) Valid() bool { return cf.Format == "blog" || cf.Format == "novel" || cf.Format == "notebook" } // NewFormat creates a new CollectionFormat object from the Collection. func (c *Collection) NewFormat() *CollectionFormat { cf := &CollectionFormat{Format: c.Format} // Fill in default format if cf.Format == "" { cf.Format = "blog" } return cf } func (c *Collection) IsUnlisted() bool { return c.Visibility == 0 } func (c *Collection) IsPrivate() bool { return c.Visibility&CollPrivate != 0 } func (c *Collection) IsProtected() bool { return c.Visibility&CollProtected != 0 } func (c *Collection) IsPublic() bool { return c.Visibility&CollPublic != 0 } func (c *Collection) FriendlyVisibility() string { if c.IsPrivate() { return "Private" } if c.IsPublic() { return "Public" } if c.IsProtected() { return "Password-protected" } return "Unlisted" } func (c *Collection) ShowFooterBranding() bool { // TODO: implement this setting return true } // CanonicalURL returns a fully-qualified URL to the collection. func (c *Collection) CanonicalURL() string { return c.RedirectingCanonicalURL(false) } func (c *Collection) DisplayCanonicalURL() string { us := c.CanonicalURL() u, err := url.Parse(us) if err != nil { return us } p := u.Path if p == "/" { p = "" } return u.Hostname() + p } func (c *Collection) RedirectingCanonicalURL(isRedir bool) string { if c.hostName == "" { // If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writeas/writefreely/issues/new?template=bug_report.md") } if isSingleUser { return c.hostName + "/" } return fmt.Sprintf("%s/%s/", c.hostName, c.Alias) } // PrevPageURL provides a full URL for the previous page of collection posts, // returning a /page/N result for pages >1 func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string { u := "" if n == 2 { // Previous page is 1; no need for /page/ prefix if prefix == "" { u = "/" } // Else leave off trailing slash } else { u = fmt.Sprintf("/page/%d", n-1) } if tl { return u } return "/" + prefix + c.Alias + u } // NextPageURL provides a full URL for the next page of collection posts func (c *Collection) NextPageURL(prefix string, n int, tl bool) string { if tl { return fmt.Sprintf("/page/%d", n+1) } return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1) } func (c *Collection) DisplayTitle() string { if c.Title != "" { return c.Title } return c.Alias } func (c *Collection) StyleSheetDisplay() template.CSS { return template.CSS(c.StyleSheet) } // ForPublic modifies the Collection for public consumption, such as via // the API. func (c *Collection) ForPublic() { c.URL = c.CanonicalURL() } var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person { accountRoot := c.FederatedAccount() p := activitystreams.NewPerson(accountRoot) p.URL = c.CanonicalURL() uname := c.Alias p.PreferredUsername = uname p.Name = c.DisplayTitle() p.Summary = c.Description if p.Name != "" { if av := c.AvatarURL(); av != "" { p.Icon = activitystreams.Image{ Type: "Image", MediaType: "image/png", URL: av, } } } collID := c.ID if len(ids) > 0 { collID = ids[0] } pub, priv := c.db.GetAPActorKeys(collID) if pub != nil { p.AddPubKey(pub) p.SetPrivKey(priv) } return p } func (c *Collection) AvatarURL() string { fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0])) if !isAvatarChar(fl) { return "" } return c.hostName + "/img/avatars/" + fl + ".png" } func (c *Collection) FederatedAPIBase() string { return c.hostName + "/" } func (c *Collection) FederatedAccount() string { accountUser := c.Alias return c.FederatedAPIBase() + "api/collections/" + accountUser } func (c *Collection) RenderMathJax() bool { return c.db.CollectionHasAttribute(c.ID, "render_mathjax") } func newCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) alias := r.FormValue("alias") title := r.FormValue("title") var missingParams, accessToken string var u *User c := struct { Alias string `json:"alias" schema:"alias"` Title string `json:"title" schema:"title"` Web bool `json:"web" schema:"web"` }{} if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err := decoder.Decode(&c) if err != nil { log.Error("Couldn't parse post update JSON request: %v\n", err) return ErrBadJSON } } else { // TODO: move form parsing to formDecoder c.Alias = alias c.Title = title } if c.Alias == "" { if c.Title != "" { // If only a title was given, just use it to generate the alias. c.Alias = getSlug(c.Title, "") } else { missingParams += "`alias` " } } if c.Title == "" { missingParams += "`title` " } if missingParams != "" { return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)} } var userID int64 var err error if reqJSON && !c.Web { accessToken = r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } userID = app.db.GetUserID(accessToken) if userID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } userID = u.ID } suspended, err := app.db.IsUserSuspended(userID) if err != nil { log.Error("new collection: %v", err) return ErrInternalGeneral } if suspended { return ErrUserSuspended } if !author.IsValidUsername(app.cfg, c.Alias) { return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."} } coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID) if err != nil { // TODO: handle this return err } res := &CollectionObj{Collection: *coll} if reqJSON { return impart.WriteSuccess(w, res, http.StatusCreated) } redirectTo := "/me/c/" // TODO: redirect to pad when necessary return impart.HTTPError{http.StatusFound, redirectTo} } func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) { accessToken := r.Header.Get("Authorization") var userID int64 = -1 if accessToken != "" { userID = app.db.GetUserID(accessToken) } isCollOwner := userID == c.OwnerID if c.IsPrivate() && !isCollOwner { // Collection is private, but user isn't authenticated return -1, ErrCollectionNotFound } if c.IsProtected() { // TODO: check access token return -1, ErrCollectionUnauthorizedRead } return userID, nil } // fetchCollection handles the API endpoint for retrieving collection data. func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error { accept := r.Header.Get("Accept") if strings.Contains(accept, "application/activity+json") { return handleFetchCollectionActivities(app, w, r) } vars := mux.Vars(r) alias := vars["alias"] // TODO: move this logic into a common getCollection function // Get base Collection data c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Redirect users who aren't requesting JSON reqJSON := IsJSON(r) if !reqJSON { return impart.HTTPError{http.StatusFound, c.CanonicalURL()} } // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Fetch extra data about the Collection res := &CollectionObj{Collection: *c} if c.PublicOwner { u, err := app.db.GetUserByID(res.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } else { res.Owner = u } } // TODO: check suspended app.db.GetPostsCount(res, isCollOwner) // Strip non-public information res.Collection.ForPublic() return impart.WriteSuccess(w, res, http.StatusOK) } // fetchCollectionPosts handles an API endpoint for retrieving a collection's // posts. func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) alias := vars["alias"] c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Get page page := 1 if p := r.FormValue("page"); p != "" { pInt, _ := strconv.Atoi(p) if pInt > 0 { page = pInt } } posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false) if err != nil { return err } coll := &CollectionObj{Collection: *c, Posts: posts} app.db.GetPostsCount(coll, isCollOwner) // Strip non-public information coll.Collection.ForPublic() // Transform post bodies if needed if r.FormValue("body") == "html" { for _, p := range *coll.Posts { p.Content = waposts.ApplyMarkdown([]byte(p.Content)) } } return impart.WriteSuccess(w, coll, http.StatusOK) } type CollectionPage struct { page.StaticPage *DisplayCollection IsCustomDomain bool IsWelcome bool IsOwner bool CanPin bool Username string Collections *[]Collection PinnedPosts *[]PublicPost IsAdmin bool CanInvite bool } func (c *CollectionObj) ScriptDisplay() template.JS { return template.JS(c.Script) } var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$") func (c *CollectionObj) ExternalScripts() []template.URL { scripts := []template.URL{} if c.Script == "" { return scripts } matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1) for _, m := range matches { scripts = append(scripts, template.URL(strings.TrimSpace(m[1]))) } return scripts } func (c *CollectionObj) CanShowScript() bool { return false } func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error { cr.prefix = vars["prefix"] cr.alias = vars["collection"] // Normalize the URL, redirecting user to consistent post URL if cr.alias != strings.ToLower(cr.alias) { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))} } return nil } // processCollectionPermissions checks the permissions for the given // collectionReq, returning a Collection if access is granted; otherwise this // renders any necessary collection pages, for example, if requesting a custom // domain that doesn't yet have a collection associated, or if a collection // requires a password. In either case, this will return nil, nil -- thus both // values should ALWAYS be checked to determine whether or not to continue. func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) { // Display collection if this is a collection var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(cr.alias) } // TODO: verify we don't reveal the existence of a private collection with redirection if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { if cr.isCustomDomain { // User is on the site from a custom domain //tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r)) //if tErr != nil { //log.Error("Unable to render 404-domain page: %v", err) //} return nil, nil } if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen { // Alias is within post ID range, so just be sure this isn't a post if app.db.PostIDExists(cr.alias) { // TODO: use StatusFound for vanity post URLs when we implement them return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias} } } // Redirect if necessary newAlias := app.db.GetCollectionRedirect(cr.alias) if newAlias != "" { return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"} } } } return nil, err } c.hostName = app.cfg.App.Host // Update CollectionRequest to reflect owner status cr.isCollOwner = u != nil && u.ID == c.OwnerID // Check permissions if !cr.isCollOwner { if c.IsPrivate() { return nil, ErrCollectionNotFound } else if c.IsProtected() { uname := "" if u != nil { uname = u.Username } + // TODO: move this to all permission checks? + suspended, err := app.db.IsUserSuspended(c.OwnerID) + if err != nil { + log.Error("process protected collection permissions: %v", err) + return nil, err + } + if suspended { + return nil, ErrCollectionNotFound + } + // See if we've authorized this collection authd := isAuthorizedForCollection(app, c.Alias, r) if !authd { p := struct { page.StaticPage *CollectionObj Username string Next string Flashes []template.HTML }{ StaticPage: pageForReq(app, r), CollectionObj: &CollectionObj{Collection: *c}, Username: uname, Next: r.FormValue("g"), Flashes: []template.HTML{}, } // Get owner information p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p) if err != nil { log.Error("Unable to render password-collection: %v", err) return nil, err } return nil, nil } } } return c, nil } func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) { u := getUserSession(app, r) return u, nil } func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection { coll := &DisplayCollection{ CollectionObj: &CollectionObj{Collection: *c}, CurrentPage: page, Prefix: cr.prefix, IsTopLevel: isSingleUser, Format: c.NewFormat(), } c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner) return coll } func getCollectionPage(vars map[string]string) int { page := 1 var p int p, _ = strconv.Atoi(vars["page"]) if p > 0 { page = p } return page } // handleViewCollection displays the requested Collection func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } c.hostName = app.cfg.App.Host suspended, err := app.db.IsUserSuspended(c.OwnerID) if err != nil { log.Error("view collection: %v", err) return ErrInternalGeneral } // Serve ActivityStreams data now, if requested if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { ac := c.PersonObject() ac.Context = []interface{}{activitystreams.Namespace} return impart.RenderActivityJSON(w, ac, http.StatusOK) } // Fetch extra data about the Collection // TODO: refactor out this logic, shared in collection.go:fetchCollection() coll := newDisplayCollection(c, cr, page) coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage()))) if coll.TotalPages > 0 && page > coll.TotalPages { redirURL := fmt.Sprintf("/page/%d", coll.TotalPages) if !app.cfg.App.SingleUser { redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL) } return impart.HTTPError{http.StatusFound, redirURL} } coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false) // Serve collection displayPage := CollectionPage{ DisplayCollection: coll, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, IsWelcome: r.FormValue("greeting") != "", } displayPage.IsAdmin = u != nil && u.IsAdmin() displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin) var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } isOwner := owner != nil if !isOwner { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } } if !isOwner && suspended { return ErrCollectionNotFound } displayPage.Suspended = isOwner && suspended displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner) collTmpl := "collection" if app.cfg.App.Chorus { collTmpl = "chorus-collection" } err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage) if err != nil { log.Error("Unable to render collection index: %v", err) } // Update collection view count go func() { // Don't update if owner is viewing the collection. if u != nil && u.ID == coll.OwnerID { return } // Only update for human views if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) { return } _, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID) if err != nil { log.Error("Unable to update collections count: %v", err) } }() return err } func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) tag := vars["tag"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } coll := newDisplayCollection(c, cr, page) coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner) if coll.Posts != nil && len(*coll.Posts) == 0 { return ErrCollectionPageNotFound } // Serve collection displayPage := struct { CollectionPage Tag string }{ CollectionPage: CollectionPage{ DisplayCollection: coll, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, }, Tag: tag, } var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } isOwner := owner != nil if !isOwner { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } if owner.IsSilenced() { return ErrCollectionNotFound } } displayPage.Suspended = owner != nil && owner.IsSilenced() displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner) err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage) if err != nil { log.Error("Unable to render collection tag page: %v", err) } return nil } func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } // Normalize the URL, redirecting user to consistent post URL loc := fmt.Sprintf("/%s", slug) if !app.cfg.App.SingleUser { loc = fmt.Sprintf("/%s/%s", cr.alias, slug) } return impart.HTTPError{http.StatusFound, loc} } func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) vars := mux.Vars(r) collAlias := vars["alias"] isWeb := r.FormValue("web") == "1" u := &User{} if reqJSON && !isWeb { // Ensure an access token was given accessToken := r.Header.Get("Authorization") u.ID = app.db.GetUserID(accessToken) if u.ID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } } suspended, err := app.db.IsUserSuspended(u.ID) if err != nil { log.Error("existing collection: %v", err) return ErrInternalGeneral } if suspended { return ErrUserSuspended } if r.Method == "DELETE" { err := app.db.DeleteCollection(collAlias, u.ID) if err != nil { // TODO: if not HTTPError, report error to admin log.Error("Unable to delete collection: %s", err) return err } addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil) return impart.HTTPError{Status: http.StatusNoContent} } c := SubmittedCollection{OwnerID: uint64(u.ID)} if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err = decoder.Decode(&c) if err != nil { log.Error("Couldn't parse collection update JSON request: %v\n", err) return ErrBadJSON } } else { err = r.ParseForm() if err != nil { log.Error("Couldn't parse collection update form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&c, r.PostForm) if err != nil { log.Error("Couldn't decode collection update form request: %v\n", err) return ErrBadFormData } } err = app.db.UpdateCollection(&c, collAlias) if err != nil { if err, ok := err.(impart.HTTPError); ok { if reqJSON { return err } addSessionFlash(app, w, r, err.Message, nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } else { log.Error("Couldn't update collection: %v\n", err) return err } } if reqJSON { return impart.WriteSuccess(w, struct { }{}, http.StatusOK) } addSessionFlash(app, w, r, "Blog updated!", nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } // collectionAliasFromReq takes a request and returns the collection alias // if it can be ascertained, as well as whether or not the collection uses a // custom domain. func collectionAliasFromReq(r *http.Request) string { vars := mux.Vars(r) alias := vars["subdomain"] isSubdomain := alias != "" if !isSubdomain { // Fall back to write.as/{collection} since this isn't a custom domain alias = vars["collection"] } return alias } func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error { var readReq struct { Alias string `schema:"alias" json:"alias"` Pass string `schema:"password" json:"password"` Next string `schema:"to" json:"to"` } // Get params if impart.ReqJSON(r) { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&readReq) if err != nil { log.Error("Couldn't parse readReq JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse readReq form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&readReq, r.PostForm) if err != nil { log.Error("Couldn't decode readReq form request: %v\n", err) return ErrBadFormData } } if readReq.Alias == "" { return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."} } if readReq.Pass == "" { return impart.HTTPError{http.StatusBadRequest, "Please supply a password."} } var collHashedPass []byte err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass) if err != nil { if err == sql.ErrNoRows { log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias) return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."} } return err } if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } // Success; set cookie session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { session.Values[readReq.Alias] = true err = session.Save(r, w) if err != nil { log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err) } } next := "/" + readReq.Next if !app.cfg.App.SingleUser { next = "/" + readReq.Alias + next } return impart.HTTPError{http.StatusFound, next} } func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool { authd := false session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { _, authd = session.Values[alias] } return authd } diff --git a/config/config.go b/config/config.go index 84bae86..996c1df 100644 --- a/config/config.go +++ b/config/config.go @@ -1,190 +1,206 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // Package config holds and assists in the configuration of a writefreely instance. package config import ( "gopkg.in/ini.v1" "strings" ) const ( // FileName is the default configuration file name FileName = "config.ini" UserNormal UserType = "user" UserAdmin = "admin" ) type ( UserType string // ServerCfg holds values that affect how the HTTP server runs ServerCfg struct { HiddenHost string `ini:"hidden_host"` Port int `ini:"port"` Bind string `ini:"bind"` TLSCertPath string `ini:"tls_cert_path"` TLSKeyPath string `ini:"tls_key_path"` Autocert bool `ini:"autocert"` TemplatesParentDir string `ini:"templates_parent_dir"` StaticParentDir string `ini:"static_parent_dir"` PagesParentDir string `ini:"pages_parent_dir"` KeysParentDir string `ini:"keys_parent_dir"` Dev bool `ini:"-"` } // DatabaseCfg holds values that determine how the application connects to a datastore DatabaseCfg struct { Type string `ini:"type"` FileName string `ini:"filename"` User string `ini:"username"` Password string `ini:"password"` Database string `ini:"database"` Host string `ini:"host"` Port int `ini:"port"` } + WriteAsOauthCfg struct { + ClientID string `ini:"client_id"` + ClientSecret string `ini:"client_secret"` + AuthLocation string `ini:"auth_location"` + TokenLocation string `ini:"token_location"` + InspectLocation string `ini:"inspect_location"` + } + + SlackOauthCfg struct { + ClientID string `ini:"client_id"` + ClientSecret string `ini:"client_secret"` + TeamID string `ini:"team_id"` + } + // AppCfg holds values that affect how the application functions AppCfg struct { SiteName string `ini:"site_name"` SiteDesc string `ini:"site_description"` Host string `ini:"host"` // Site appearance Theme string `ini:"theme"` Editor string `ini:"editor"` JSDisabled bool `ini:"disable_js"` WebFonts bool `ini:"webfonts"` Landing string `ini:"landing"` SimpleNav bool `ini:"simple_nav"` WFModesty bool `ini:"wf_modesty"` // Site functionality Chorus bool `ini:"chorus"` DisableDrafts bool `ini:"disable_drafts"` // Users SingleUser bool `ini:"single_user"` OpenRegistration bool `ini:"open_registration"` MinUsernameLen int `ini:"min_username_len"` MaxBlogs int `ini:"max_blogs"` // Federation Federation bool `ini:"federation"` PublicStats bool `ini:"public_stats"` // Access Private bool `ini:"private"` // Additional functions LocalTimeline bool `ini:"local_timeline"` UserInvites string `ini:"user_invites"` // Defaults DefaultVisibility string `ini:"default_visibility"` } // Config holds the complete configuration for running a writefreely instance Config struct { - Server ServerCfg `ini:"server"` - Database DatabaseCfg `ini:"database"` - App AppCfg `ini:"app"` + Server ServerCfg `ini:"server"` + Database DatabaseCfg `ini:"database"` + App AppCfg `ini:"app"` + SlackOauth SlackOauthCfg `ini:"oauth.slack"` + WriteAsOauth WriteAsOauthCfg `ini:"oauth.writeas"` } ) // New creates a new Config with sane defaults func New() *Config { c := &Config{ Server: ServerCfg{ Port: 8080, Bind: "localhost", /* IPV6 support when not using localhost? */ }, App: AppCfg{ Host: "http://localhost:8080", Theme: "write", WebFonts: true, SingleUser: true, MinUsernameLen: 3, MaxBlogs: 1, Federation: true, PublicStats: true, }, } c.UseMySQL(true) return c } // UseMySQL resets the Config's Database to use default values for a MySQL setup. func (cfg *Config) UseMySQL(fresh bool) { cfg.Database.Type = "mysql" if fresh { cfg.Database.Host = "localhost" cfg.Database.Port = 3306 } } // UseSQLite resets the Config's Database to use default values for a SQLite setup. func (cfg *Config) UseSQLite(fresh bool) { cfg.Database.Type = "sqlite3" if fresh { cfg.Database.FileName = "writefreely.db" } } // IsSecureStandalone returns whether or not the application is running as a // standalone server with TLS enabled. func (cfg *Config) IsSecureStandalone() bool { return cfg.Server.Port == 443 && cfg.Server.TLSCertPath != "" && cfg.Server.TLSKeyPath != "" } func (ac *AppCfg) LandingPath() string { if !strings.HasPrefix(ac.Landing, "/") { return "/" + ac.Landing } return ac.Landing } // Load reads the given configuration file, then parses and returns it as a Config. func Load(fname string) (*Config, error) { if fname == "" { fname = FileName } cfg, err := ini.Load(fname) if err != nil { return nil, err } // Parse INI file uc := &Config{} err = cfg.MapTo(uc) if err != nil { return nil, err } return uc, nil } // Save writes the given Config to the given file. func Save(uc *Config, fname string) error { cfg := ini.Empty() err := ini.ReflectFrom(cfg, uc) if err != nil { return err } if fname == "" { fname = FileName } return cfg.SaveTo(fname) } diff --git a/config/funcs.go b/config/funcs.go index a9c82ce..9678df0 100644 --- a/config/funcs.go +++ b/config/funcs.go @@ -1,27 +1,42 @@ /* * Copyright © 2018 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package config import ( + "net/http" "strings" + "time" ) // FriendlyHost returns the app's Host sans any schema func (ac AppCfg) FriendlyHost() string { return ac.Host[strings.Index(ac.Host, "://")+len("://"):] } func (ac AppCfg) CanCreateBlogs(currentlyUsed uint64) bool { if ac.MaxBlogs <= 0 { return true } return int(currentlyUsed) < ac.MaxBlogs } + +// OrDefaultString returns input or a default value if input is empty. +func OrDefaultString(input, defaultValue string) string { + if len(input) == 0 { + return defaultValue + } + return input +} + +// DefaultHTTPClient returns a sane default HTTP client. +func DefaultHTTPClient() *http.Client { + return &http.Client{Timeout: 10 * time.Second} +} diff --git a/database.go b/database.go index d78d888..ef52d84 100644 --- a/database.go +++ b/database.go @@ -1,2485 +1,2557 @@ /* * Copyright © 2018 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( + "context" "database/sql" "fmt" + wf_db "github.com/writeas/writefreely/db" "net/http" "strings" "time" "github.com/guregu/null" "github.com/guregu/null/zero" uuid "github.com/nu7hatch/gouuid" "github.com/writeas/impart" "github.com/writeas/nerds/store" "github.com/writeas/web-core/activitypub" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/data" "github.com/writeas/web-core/id" "github.com/writeas/web-core/log" "github.com/writeas/web-core/query" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/key" ) const ( mySQLErrDuplicateKey = 1062 driverMySQL = "mysql" driverSQLite = "sqlite3" ) var ( SQLiteEnabled bool ) type writestore interface { CreateUser(*config.Config, *User, string) error UpdateUserEmail(keys *key.Keychain, userID int64, email string) error UpdateEncryptedUserEmail(int64, []byte) error GetUserByID(int64) (*User, error) GetUserForAuth(string) (*User, error) GetUserForAuthByID(int64) (*User, error) GetUserNameFromToken(string) (string, error) GetUserDataFromToken(string) (int64, string, error) GetAPIUser(header string) (*User, error) GetUserID(accessToken string) int64 GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) DeleteToken(accessToken []byte) error FetchLastAccessToken(userID int64) string GetAccessToken(userID int64) (string, error) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) DeleteAccount(userID int64) (l *string, err error) ChangeSettings(app *App, u *User, s *userSettings) error ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error GetCollections(u *User, hostName string) (*[]Collection, error) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) GetMeStats(u *User) userMeStats GetTotalCollections() (int64, error) GetTotalPosts() (int64, error) GetTopPosts(u *User, alias string) (*[]PublicPost, error) GetAnonymousPosts(u *User) (*[]PublicPost, error) GetUserPosts(u *User) (*[]PublicPost, error) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error GetEditablePost(id, editToken string) (*PublicPost, error) PostIDExists(id string) bool GetPost(id string, collectionID int64) (*PublicPost, error) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) CreateCollectionFromToken(*config.Config, string, string, string) (*Collection, error) CreateCollection(*config.Config, string, string, int64) (*Collection, error) GetCollectionBy(condition string, value interface{}) (*Collection, error) GetCollection(alias string) (*Collection, error) GetCollectionForPad(alias string) (*Collection, error) GetCollectionByID(id int64) (*Collection, error) UpdateCollection(c *SubmittedCollection, alias string) error DeleteCollection(alias string, userID int64) error UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error GetLastPinnedPostPos(collID int64) int64 GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error) RemoveCollectionRedirect(t *sql.Tx, alias string) error GetCollectionRedirect(alias string) (new string) IsCollectionAttributeOn(id int64, attr string) bool CollectionHasAttribute(id int64, attr string) bool CanCollect(cpr *ClaimPostRequest, userID int64) bool AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) GetPostsCount(c *CollectionObj, includeFuture bool) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) GetAPFollowers(c *Collection) (*[]RemoteUser, error) GetAPActorKeys(collectionID int64) ([]byte, []byte) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error GetUserInvites(userID int64) (*[]Invite, error) GetUserInvite(id string) (*Invite, error) GetUsersInvitedCount(id string) int64 CreateInvitedUser(inviteID string, userID int64) error GetDynamicContent(id string) (*instanceContent, error) UpdateDynamicContent(id, title, content, contentType string) error GetAllUsers(page uint) (*[]User, error) GetAllUsersCount() int64 GetUserLastPostTime(id int64) (*time.Time, error) GetCollectionLastPostTime(id int64) (*time.Time, error) + GetIDForRemoteUser(context.Context, string, string, string) (int64, error) + RecordRemoteUserID(context.Context, int64, string, string, string, string) error + ValidateOAuthState(context.Context, string) (string, string, error) + GenerateOAuthState(context.Context, string, string) (string, error) + DatabaseInitialized() bool } type datastore struct { *sql.DB driverName string } +var _ writestore = &datastore{} + func (db *datastore) now() string { if db.driverName == driverSQLite { return "strftime('%Y-%m-%d %H:%M:%S','now')" } return "NOW()" } func (db *datastore) clip(field string, l int) string { if db.driverName == driverSQLite { return fmt.Sprintf("SUBSTR(%s, 0, %d)", field, l) } return fmt.Sprintf("LEFT(%s, %d)", field, l) } func (db *datastore) upsert(indexedCols ...string) string { if db.driverName == driverSQLite { // NOTE: SQLite UPSERT syntax only works in v3.24.0 (2018-06-04) or later // Leaving this for whenever we can upgrade and include it in our binary cc := strings.Join(indexedCols, ", ") return "ON CONFLICT(" + cc + ") DO UPDATE SET" } return "ON DUPLICATE KEY UPDATE" } func (db *datastore) dateSub(l int, unit string) string { if db.driverName == driverSQLite { return fmt.Sprintf("DATETIME('now', '-%d %s')", l, unit) } return fmt.Sprintf("DATE_SUB(NOW(), INTERVAL %d %s)", l, unit) } func (db *datastore) CreateUser(cfg *config.Config, u *User, collectionTitle string) error { if db.PostIDExists(u.Username) { return impart.HTTPError{http.StatusConflict, "Invalid collection name."} } // New users get a `users` and `collections` row. t, err := db.Begin() if err != nil { return err } // 1. Add to `users` table // NOTE: Assumes User's Password is already hashed! res, err := t.Exec("INSERT INTO users (username, password, email) VALUES (?, ?, ?)", u.Username, u.HashedPass, u.Email) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Rolling back users INSERT: %v\n", err) return err } u.ID, err = res.LastInsertId() if err != nil { t.Rollback() log.Error("Rolling back after LastInsertId: %v\n", err) return err } // 2. Create user's Collection if collectionTitle == "" { collectionTitle = u.Username } res, err = t.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", u.Username, collectionTitle, "", defaultVisibility(cfg), u.ID, 0) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Rolling back collections INSERT: %v\n", err) return err } db.RemoveCollectionRedirect(t, u.Username) err = t.Commit() if err != nil { t.Rollback() log.Error("Rolling back after Commit(): %v\n", err) return err } return nil } // FIXME: We're returning errors inconsistently in this file. Do we use Errorf // for returned value, or impart? func (db *datastore) UpdateUserEmail(keys *key.Keychain, userID int64, email string) error { encEmail, err := data.Encrypt(keys.EmailKey, email) if err != nil { return fmt.Errorf("Couldn't encrypt email %s: %s\n", email, err) } return db.UpdateEncryptedUserEmail(userID, encEmail) } func (db *datastore) UpdateEncryptedUserEmail(userID int64, encEmail []byte) error { _, err := db.Exec("UPDATE users SET email = ? WHERE id = ?", encEmail, userID) if err != nil { return fmt.Errorf("Unable to update user email: %s", err) } return nil } func (db *datastore) CreateCollectionFromToken(cfg *config.Config, alias, title, accessToken string) (*Collection, error) { userID := db.GetUserID(accessToken) if userID == -1 { return nil, ErrBadAccessToken } return db.CreateCollection(cfg, alias, title, userID) } func (db *datastore) GetUserCollectionCount(userID int64) (uint64, error) { var collCount uint64 err := db.QueryRow("SELECT COUNT(*) FROM collections WHERE owner_id = ?", userID).Scan(&collCount) switch { case err == sql.ErrNoRows: return 0, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user from database."} case err != nil: log.Error("Couldn't get collections count for user %d: %v", userID, err) return 0, err } return collCount, nil } func (db *datastore) CreateCollection(cfg *config.Config, alias, title string, userID int64) (*Collection, error) { if db.PostIDExists(alias) { return nil, impart.HTTPError{http.StatusConflict, "Invalid collection name."} } // All good, so create new collection res, err := db.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", alias, title, "", defaultVisibility(cfg), userID, 0) if err != nil { if db.isDuplicateKeyErr(err) { return nil, impart.HTTPError{http.StatusConflict, "Collection already exists."} } log.Error("Couldn't add to collections: %v\n", err) return nil, err } c := &Collection{ Alias: alias, Title: title, OwnerID: userID, PublicOwner: false, Public: defaultVisibility(cfg) == CollPublic, } c.ID, err = res.LastInsertId() if err != nil { log.Error("Couldn't get collection LastInsertId: %v\n", err) } return c, nil } func (db *datastore) GetUserByID(id int64) (*User, error) { u := &User{ID: id} err := db.QueryRow("SELECT username, password, email, created, status FROM users WHERE id = ?", id).Scan(&u.Username, &u.HashedPass, &u.Email, &u.Created, &u.Status) switch { case err == sql.ErrNoRows: return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password: %v", err) return nil, err } return u, nil } // IsUserSuspended returns true if the user account associated with id is // currently suspended. func (db *datastore) IsUserSuspended(id int64) (bool, error) { u := &User{ID: id} err := db.QueryRow("SELECT status FROM users WHERE id = ?", id).Scan(&u.Status) switch { case err == sql.ErrNoRows: return false, fmt.Errorf("is user suspended: %v", ErrUserNotFound) case err != nil: log.Error("Couldn't SELECT user password: %v", err) return false, fmt.Errorf("is user suspended: %v", err) } return u.IsSilenced(), nil } // DoesUserNeedAuth returns true if the user hasn't provided any methods for // authenticating with the account, such a passphrase or email address. // Any errors are reported to admin and silently quashed, returning false as the // result. func (db *datastore) DoesUserNeedAuth(id int64) bool { var pass, email []byte // Find out if user has an email set first err := db.QueryRow("SELECT password, email FROM users WHERE id = ?", id).Scan(&pass, &email) switch { case err == sql.ErrNoRows: // ERROR. Don't give false positives on needing auth methods return false case err != nil: // ERROR. Don't give false positives on needing auth methods log.Error("Couldn't SELECT user %d from users: %v", id, err) return false } // User doesn't need auth if there's an email return len(email) == 0 && len(pass) == 0 } func (db *datastore) IsUserPassSet(id int64) (bool, error) { var pass []byte err := db.QueryRow("SELECT password FROM users WHERE id = ?", id).Scan(&pass) switch { case err == sql.ErrNoRows: return false, nil case err != nil: log.Error("Couldn't SELECT user %d from users: %v", id, err) return false, err } return len(pass) > 0, nil } func (db *datastore) GetUserForAuth(username string) (*User, error) { u := &User{Username: username} err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE username = ?", username).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status) switch { case err == sql.ErrNoRows: // Check if they've entered the wrong, unnormalized username username = getSlug(username, "") if username != u.Username { err = db.QueryRow("SELECT id FROM users WHERE username = ? LIMIT 1", username).Scan(&u.ID) if err == nil { return db.GetUserForAuth(username) } } return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password: %v", err) return nil, err } return u, nil } func (db *datastore) GetUserForAuthByID(userID int64) (*User, error) { u := &User{ID: userID} err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE id = ?", u.ID).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status) switch { case err == sql.ErrNoRows: return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT userForAuthByID: %v", err) return nil, err } return u, nil } func (db *datastore) GetUserNameFromToken(accessToken string) (string, error) { t := auth.GetToken(accessToken) if len(t) == 0 { return "", ErrNoAccessToken } var oneTime bool var username string err := db.QueryRow("SELECT username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&username, &oneTime) switch { case err == sql.ErrNoRows: return "", ErrBadAccessToken case err != nil: return "", ErrInternalGeneral } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return username, nil } func (db *datastore) GetUserDataFromToken(accessToken string) (int64, string, error) { t := auth.GetToken(accessToken) if len(t) == 0 { return 0, "", ErrNoAccessToken } var userID int64 var oneTime bool var username string err := db.QueryRow("SELECT user_id, username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &username, &oneTime) switch { case err == sql.ErrNoRows: return 0, "", ErrBadAccessToken case err != nil: return 0, "", ErrInternalGeneral } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return userID, username, nil } func (db *datastore) GetAPIUser(header string) (*User, error) { uID := db.GetUserID(header) if uID == -1 { return nil, fmt.Errorf(ErrUserNotFound.Error()) } return db.GetUserByID(uID) } // GetUserID takes a hexadecimal accessToken, parses it into its binary // representation, and gets any user ID associated with the token. If no user // is associated, -1 is returned. func (db *datastore) GetUserID(accessToken string) int64 { i, _ := db.GetUserIDPrivilege(accessToken) return i } func (db *datastore) GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) { t := auth.GetToken(accessToken) if len(t) == 0 { return -1, false } var oneTime bool err := db.QueryRow("SELECT user_id, sudo, one_time FROM accesstokens WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &sudo, &oneTime) switch { case err == sql.ErrNoRows: return -1, false case err != nil: return -1, false } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return } func (db *datastore) DeleteToken(accessToken []byte) error { res, err := db.Exec("DELETE FROM accesstokens WHERE token LIKE ?", accessToken) if err != nil { return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { return impart.HTTPError{http.StatusNotFound, "Token is invalid or doesn't exist"} } return nil } // FetchLastAccessToken creates a new non-expiring, valid access token for the given // userID. func (db *datastore) FetchLastAccessToken(userID int64) string { var t []byte err := db.QueryRow("SELECT token FROM accesstokens WHERE user_id = ? AND (expires IS NULL OR expires > "+db.now()+") ORDER BY created DESC LIMIT 1", userID).Scan(&t) switch { case err == sql.ErrNoRows: return "" case err != nil: log.Error("Failed selecting from accesstoken: %v", err) return "" } u, err := uuid.Parse(t) if err != nil { return "" } return u.String() } // GetAccessToken creates a new non-expiring, valid access token for the given // userID. func (db *datastore) GetAccessToken(userID int64) (string, error) { return db.GetTemporaryOneTimeAccessToken(userID, 0, false) } // GetTemporaryAccessToken creates a new valid access token for the given // userID that remains valid for the given time in seconds. If validSecs is 0, // the access token doesn't automatically expire. func (db *datastore) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) { return db.GetTemporaryOneTimeAccessToken(userID, validSecs, false) } // GetTemporaryOneTimeAccessToken creates a new valid access token for the given // userID that remains valid for the given time in seconds and can only be used // once if oneTime is true. If validSecs is 0, the access token doesn't // automatically expire. func (db *datastore) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) { u, err := uuid.NewV4() if err != nil { log.Error("Unable to generate token: %v", err) return "", err } // Insert UUID to `accesstokens` binTok := u[:] expirationVal := "NULL" if validSecs > 0 { expirationVal = fmt.Sprintf("DATE_ADD("+db.now()+", INTERVAL %d SECOND)", validSecs) } _, err = db.Exec("INSERT INTO accesstokens (token, user_id, one_time, expires) VALUES (?, ?, ?, "+expirationVal+")", string(binTok), userID, oneTime) if err != nil { log.Error("Couldn't INSERT accesstoken: %v", err) return "", err } return u.String(), nil } func (db *datastore) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) { var userID, collID int64 = -1, -1 var coll *Collection var err error if accessToken != "" { userID = db.GetUserID(accessToken) if userID == -1 { return nil, ErrBadAccessToken } if collAlias != "" { coll, err = db.GetCollection(collAlias) if err != nil { return nil, err } coll.hostName = hostName if coll.OwnerID != userID { return nil, ErrForbiddenCollection } collID = coll.ID } } rp := &PublicPost{} rp.Post, err = db.CreatePost(userID, collID, post) if err != nil { return rp, err } if coll != nil { coll.ForPublic() rp.Collection = &CollectionObj{Collection: *coll} } return rp, nil } func (db *datastore) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) { idLen := postIDLen friendlyID := store.GenerateFriendlyRandomString(idLen) // Handle appearance / font face appearance := post.Font if !post.isFontValid() { appearance = "norm" } var err error ownerID := sql.NullInt64{ Valid: false, } ownerCollID := sql.NullInt64{ Valid: false, } slug := sql.NullString{"", false} // If an alias was supplied, we'll add this to the collection as well. if userID > 0 { ownerID.Int64 = userID ownerID.Valid = true if collID > 0 { ownerCollID.Int64 = collID ownerCollID.Valid = true var slugVal string if post.Title != nil && *post.Title != "" { slugVal = getSlug(*post.Title, post.Language.String) if slugVal == "" { slugVal = getSlug(*post.Content, post.Language.String) } } else { slugVal = getSlug(*post.Content, post.Language.String) } if slugVal == "" { slugVal = friendlyID } slug = sql.NullString{slugVal, true} } } created := time.Now() if db.driverName == driverSQLite { // SQLite stores datetimes in UTC, so convert time.Now() to it here created = created.UTC() } if post.Created != nil { created, err = time.Parse("2006-01-02T15:04:05Z", *post.Created) if err != nil { log.Error("Unable to parse Created time '%s': %v", *post.Created, err) created = time.Now() if db.driverName == driverSQLite { // SQLite stores datetimes in UTC, so convert time.Now() to it here created = created.UTC() } } } stmt, err := db.Prepare("INSERT INTO posts (id, slug, title, content, text_appearance, language, rtl, privacy, owner_id, collection_id, created, updated, view_count) VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?, ?, " + db.now() + ", ?)") if err != nil { return nil, err } defer stmt.Close() _, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0) if err != nil { if db.isDuplicateKeyErr(err) { // Duplicate entry error; try a new slug // TODO: make this a little more robust slug = sql.NullString{id.GenSafeUniqueSlug(slug.String), true} _, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0) if err != nil { return nil, handleFailedPostInsert(fmt.Errorf("Retried slug generation, still failed: %v", err)) } } else { return nil, handleFailedPostInsert(err) } } // TODO: return Created field in proper format return &Post{ ID: friendlyID, Slug: null.NewString(slug.String, slug.Valid), Font: appearance, Language: zero.NewString(post.Language.String, post.Language.Valid), RTL: zero.NewBool(post.IsRTL.Bool, post.IsRTL.Valid), OwnerID: null.NewInt(userID, true), CollectionID: null.NewInt(userID, true), Created: created.Truncate(time.Second).UTC(), Updated: time.Now().Truncate(time.Second).UTC(), Title: zero.NewString(*(post.Title), true), Content: *(post.Content), }, nil } // UpdateOwnedPost updates an existing post with only the given fields in the // supplied AuthenticatedPost. func (db *datastore) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error { params := []interface{}{} var queryUpdates, sep, authCondition string if post.Slug != nil && *post.Slug != "" { queryUpdates += sep + "slug = ?" sep = ", " params = append(params, getSlug(*post.Slug, "")) } if post.Content != nil { queryUpdates += sep + "content = ?" sep = ", " params = append(params, post.Content) } if post.Title != nil { queryUpdates += sep + "title = ?" sep = ", " params = append(params, post.Title) } if post.Language.Valid { queryUpdates += sep + "language = ?" sep = ", " params = append(params, post.Language.String) } if post.IsRTL.Valid { queryUpdates += sep + "rtl = ?" sep = ", " params = append(params, post.IsRTL.Bool) } if post.Font != "" { queryUpdates += sep + "text_appearance = ?" sep = ", " params = append(params, post.Font) } if post.Created != nil { createTime, err := time.Parse(postMetaDateFormat, *post.Created) if err != nil { log.Error("Unable to parse Created date: %v", err) return fmt.Errorf("That's the incorrect format for Created date.") } queryUpdates += sep + "created = ?" sep = ", " params = append(params, createTime) } // WHERE parameters... // id = ? params = append(params, post.ID) // AND owner_id = ? authCondition = "(owner_id = ?)" params = append(params, userID) if queryUpdates == "" { return ErrPostNoUpdatableVals } queryUpdates += sep + "updated = " + db.now() res, err := db.Exec("UPDATE posts SET "+queryUpdates+" WHERE id = ? AND "+authCondition, params...) if err != nil { log.Error("Unable to update owned post: %v", err) return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND "+authCondition, post.ID, params[len(params)-1]).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedEditPost case err != nil: log.Error("Failed selecting from posts: %v", err) } return nil } return nil } func (db *datastore) GetCollectionBy(condition string, value interface{}) (*Collection, error) { c := &Collection{} // FIXME: change Collection to reflect database values. Add helper functions to get actual values var styleSheet, script, format zero.String row := db.QueryRow("SELECT id, alias, title, description, style_sheet, script, format, owner_id, privacy, view_count FROM collections WHERE "+condition, value) err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &styleSheet, &script, &format, &c.OwnerID, &c.Visibility, &c.Views) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."} case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } c.StyleSheet = styleSheet.String c.Script = script.String c.Format = format.String c.Public = c.IsPublic() c.db = db return c, nil } func (db *datastore) GetCollection(alias string) (*Collection, error) { return db.GetCollectionBy("alias = ?", alias) } func (db *datastore) GetCollectionForPad(alias string) (*Collection, error) { c := &Collection{Alias: alias} row := db.QueryRow("SELECT id, alias, title, description, privacy FROM collections WHERE alias = ?", alias) err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility) switch { case err == sql.ErrNoRows: return c, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."} case err != nil: log.Error("Failed selecting from collections: %v", err) return c, ErrInternalGeneral } c.Public = c.IsPublic() return c, nil } func (db *datastore) GetCollectionByID(id int64) (*Collection, error) { return db.GetCollectionBy("id = ?", id) } func (db *datastore) GetCollectionFromDomain(host string) (*Collection, error) { return db.GetCollectionBy("host = ?", host) } func (db *datastore) UpdateCollection(c *SubmittedCollection, alias string) error { q := query.NewUpdate(). SetStringPtr(c.Title, "title"). SetStringPtr(c.Description, "description"). SetNullString(c.StyleSheet, "style_sheet"). SetNullString(c.Script, "script") if c.Format != nil { cf := &CollectionFormat{Format: c.Format.String} if cf.Valid() { q.SetNullString(c.Format, "format") } } var updatePass bool if c.Visibility != nil && (collVisibility(*c.Visibility)&CollProtected == 0 || c.Pass != "") { q.SetIntPtr(c.Visibility, "privacy") if c.Pass != "" { updatePass = true } } // WHERE values q.Where("alias = ? AND owner_id = ?", alias, c.OwnerID) if q.Updates == "" { return ErrPostNoUpdatableVals } // Find any current domain var collID int64 var rowsAffected int64 var changed bool var res sql.Result err := db.QueryRow("SELECT id FROM collections WHERE alias = ?", alias).Scan(&collID) if err != nil { log.Error("Failed selecting from collections: %v. Some things won't work.", err) } // Update MathJax value if c.MathJax { if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", collID, "render_mathjax", "1") } else { _, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "render_mathjax", "1", "1") } if err != nil { log.Error("Unable to insert render_mathjax value: %v", err) return err } } else { _, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "render_mathjax") if err != nil { log.Error("Unable to delete render_mathjax value: %v", err) return err } } // Update rest of the collection data res, err = db.Exec("UPDATE collections SET "+q.Updates+" WHERE "+q.Conditions, q.Params...) if err != nil { log.Error("Unable to update collection: %v", err) return err } rowsAffected, _ = res.RowsAffected() if !changed || rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM collections WHERE alias = ? AND owner_id = ?", alias, c.OwnerID).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedEditPost case err != nil: log.Error("Failed selecting from collections: %v", err) } if !updatePass { return nil } } if updatePass { hashedPass, err := auth.HashPass([]byte(c.Pass)) if err != nil { log.Error("Unable to create hash: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?)", alias, hashedPass) } else { _, err = db.Exec("INSERT INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?) "+db.upsert("collection_id")+" password = ?", alias, hashedPass, hashedPass) } if err != nil { return err } } return nil } const postCols = "id, slug, text_appearance, language, rtl, privacy, owner_id, collection_id, pinned_position, created, updated, view_count, title, content" // getEditablePost returns a PublicPost with the given ID only if the given // edit token is valid for the post. func (db *datastore) GetEditablePost(id, editToken string) (*PublicPost, error) { // FIXME: code duplicated from getPost() // TODO: add slight logic difference to getPost / one func var ownerName sql.NullString p := &Post{} row := db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE id = ? LIMIT 1", id) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName) switch { case err == sql.ErrNoRows: return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() if ownerName.Valid { res.Owner = &PublicUser{Username: ownerName.String} } return &res, nil } func (db *datastore) PostIDExists(id string) bool { var dummy bool err := db.QueryRow("SELECT 1 FROM posts WHERE id = ?", id).Scan(&dummy) return err == nil && dummy } // GetPost gets a public-facing post object from the database. If collectionID // is > 0, the post will be retrieved by slug and collection ID, rather than // post ID. // TODO: break this into two functions: // - GetPost(id string) // - GetCollectionPost(slug string, collectionID int64) func (db *datastore) GetPost(id string, collectionID int64) (*PublicPost, error) { var ownerName sql.NullString p := &Post{} var row *sql.Row var where string params := []interface{}{id} if collectionID > 0 { where = "slug = ? AND collection_id = ?" params = append(params, collectionID) } else { where = "id = ?" } row = db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE "+where+" LIMIT 1", params...) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName) switch { case err == sql.ErrNoRows: if collectionID > 0 { return nil, ErrCollectionPageNotFound } return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() if ownerName.Valid { res.Owner = &PublicUser{Username: ownerName.String} } return &res, nil } // TODO: don't duplicate getPost() functionality func (db *datastore) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) { p := &Post{} var row *sql.Row where := "id = ? AND owner_id = ?" params := []interface{}{id, ownerID} row = db.QueryRow("SELECT "+postCols+" FROM posts WHERE "+where+" LIMIT 1", params...) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) switch { case err == sql.ErrNoRows: return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() return &res, nil } func (db *datastore) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) { propSelects := map[string]string{ "views": "view_count AS views", } selectQuery, ok := propSelects[property] if !ok { return nil, impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid property: %s.", property)} } var res interface{} var row *sql.Row if collectionID != 0 { row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE slug = ? AND collection_id = ? LIMIT 1", id, collectionID) } else { row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE id = ? LIMIT 1", id) } err := row.Scan(&res) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Post not found."} case err != nil: log.Error("Failed selecting post: %v", err) return nil, err } return res, nil } // GetPostsCount modifies the CollectionObj to include the correct number of // standard (non-pinned) posts. It will return future posts if `includeFuture` // is true. func (db *datastore) GetPostsCount(c *CollectionObj, includeFuture bool) { var count int64 timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND pinned_position IS NULL "+timeCondition, c.ID).Scan(&count) switch { case err == sql.ErrNoRows: c.TotalPosts = 0 case err != nil: log.Error("Failed selecting from collections: %v", err) c.TotalPosts = 0 } c.TotalPosts = int(count) } // GetPosts retrieves all posts for the given Collection. // It will return future posts if `includeFuture` is true. // It will include only standard (non-pinned) posts unless `includePinned` is true. // TODO: change includeFuture to isOwner, since that's how it's used func (db *datastore) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) { collID := c.ID cf := c.NewFormat() order := "DESC" if cf.Ascending() && !forceRecentFirst { order = "ASC" } pagePosts := cf.PostsPerPage() start := page*pagePosts - pagePosts if page == 0 { start = 0 pagePosts = 1000 } limitStr := "" if page > 0 { limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) } timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } pinnedCondition := "" if !includePinned { pinnedCondition = "AND pinned_position IS NULL" } rows, err := db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? "+pinnedCondition+" "+timeCondition+" ORDER BY created "+order+limitStr, collID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."} } defer rows.Close() // TODO: extract this common row scanning logic for queries using `postCols` posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() p.formatContent(cfg, c, includeFuture) posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } // GetPostsTagged retrieves all posts on the given Collection that contain the // given tag. // It will return future posts if `includeFuture` is true. // TODO: change includeFuture to isOwner, since that's how it's used func (db *datastore) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) { collID := c.ID cf := c.NewFormat() order := "DESC" if cf.Ascending() { order = "ASC" } pagePosts := cf.PostsPerPage() start := page*pagePosts - pagePosts if page == 0 { start = 0 pagePosts = 1000 } limitStr := "" if page > 0 { limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) } timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } var rows *sql.Rows var err error if db.driverName == driverSQLite { rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, `.*#`+strings.ToLower(tag)+`\b.*`) } else { rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, "#"+strings.ToLower(tag)+"[[:>:]]") } if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."} } defer rows.Close() // TODO: extract this common row scanning logic for queries using `postCols` posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() p.formatContent(cfg, c, includeFuture) posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } func (db *datastore) GetAPFollowers(c *Collection) (*[]RemoteUser, error) { rows, err := db.Query("SELECT actor_id, inbox, shared_inbox FROM remotefollows f INNER JOIN remoteusers u ON f.remote_user_id = u.id WHERE collection_id = ?", c.ID) if err != nil { log.Error("Failed selecting from followers: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve followers."} } defer rows.Close() followers := []RemoteUser{} for rows.Next() { f := RemoteUser{} err = rows.Scan(&f.ActorID, &f.Inbox, &f.SharedInbox) followers = append(followers, f) } return &followers, nil } // CanCollect returns whether or not the given user can add the given post to a // collection. This is true when a post is already owned by the user. // NOTE: this is currently only used to potentially add owned posts to a // collection. This has the SIDE EFFECT of also generating a slug for the post. // FIXME: make this side effect more explicit (or extract it) func (db *datastore) CanCollect(cpr *ClaimPostRequest, userID int64) bool { var title, content string var lang sql.NullString err := db.QueryRow("SELECT title, content, language FROM posts WHERE id = ? AND owner_id = ?", cpr.ID, userID).Scan(&title, &content, &lang) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Failed on post CanCollect(%s, %d): %v", cpr.ID, userID, err) return false } // Since we have the post content and the post is collectable, generate the // post's slug now. cpr.Slug = getSlugFromPost(title, content, lang.String) return true } func (db *datastore) AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) { qRes, err := db.Exec(query, params...) if err != nil { if db.isDuplicateKeyErr(err) && slugIdx > -1 { s := id.GenSafeUniqueSlug(p.Slug) if s == p.Slug { // Sanity check to prevent infinite recursion return qRes, fmt.Errorf("GenSafeUniqueSlug generated nothing unique: %s", s) } p.Slug = s params[slugIdx] = p.Slug return db.AttemptClaim(p, query, params, slugIdx) } return qRes, fmt.Errorf("attemptClaim: %s", err) } return qRes, nil } func (db *datastore) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) { postClaimReqs := map[string]bool{} res := []ClaimPostResult{} for i := range postIDs { postID := postIDs[i] r := ClaimPostResult{Code: 0, ErrorMessage: ""} // Perform post validation if postID == "" { r.ErrorMessage = "Missing post ID. " } if _, ok := postClaimReqs[postID]; ok { r.Code = 429 r.ErrorMessage = "You've already tried anonymizing this post." r.ID = postID res = append(res, r) continue } postClaimReqs[postID] = true var err error // Get full post information to return var fullPost *PublicPost fullPost, err = db.GetPost(postID, 0) if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message r.ID = postID res = append(res, r) continue } else { log.Error("Error getting post in dispersePosts: %v", err) } } if fullPost.OwnerID.Int64 != userID { r.Code = http.StatusConflict r.ErrorMessage = "Post is already owned by someone else." r.ID = postID res = append(res, r) continue } var qRes sql.Result var query string var params []interface{} // Do AND owner_id = ? for sanity. // This should've been caught and returned with a good error message // just above. query = "UPDATE posts SET collection_id = NULL WHERE id = ? AND owner_id = ?" params = []interface{}{postID, userID} qRes, err = db.Exec(query, params...) if err != nil { r.Code = http.StatusInternalServerError r.ErrorMessage = "A glitch happened on our end." r.ID = postID res = append(res, r) log.Error("dispersePosts (post %s): %v", postID, err) continue } // Post was successfully dispersed r.Code = http.StatusOK r.Post = fullPost rowsAffected, _ := qRes.RowsAffected() if rowsAffected == 0 { // This was already claimed, but return 200 r.Code = http.StatusOK } res = append(res, r) } return &res, nil } func (db *datastore) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) { postClaimReqs := map[string]bool{} res := []ClaimPostResult{} postCollAlias := collAlias for i := range *posts { p := (*posts)[i] if &p == nil { continue } r := ClaimPostResult{Code: 0, ErrorMessage: ""} // Perform post validation if p.ID == "" { r.ErrorMessage = "Missing post ID `id`. " } if _, ok := postClaimReqs[p.ID]; ok { r.Code = 429 r.ErrorMessage = "You've already tried claiming this post." r.ID = p.ID res = append(res, r) continue } postClaimReqs[p.ID] = true canCollect := db.CanCollect(&p, userID) if !canCollect && p.Token == "" { // TODO: ensure post isn't owned by anyone else when a valid modify // token is given. r.ErrorMessage += "Missing post Edit Token `token`." } if r.ErrorMessage != "" { // Post validate failed r.Code = http.StatusBadRequest r.ID = p.ID res = append(res, r) continue } var err error var qRes sql.Result var query string var params []interface{} var slugIdx int = -1 var coll *Collection if collAlias == "" { // Posts are being claimed at /posts/claim, not // /collections/{alias}/collect, so use given individual collection // to associate post with. postCollAlias = p.CollectionAlias } if postCollAlias != "" { // Associate this post with a collection if p.CreateCollection { // This is a new collection // TODO: consider removing this. This seriously complicates this // method and adds another (unnecessary?) logic path. coll, err = db.CreateCollection(cfg, postCollAlias, "", userID) if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message } else { r.Code = http.StatusInternalServerError r.ErrorMessage = "Unknown error occurred creating collection" } r.ID = p.ID res = append(res, r) continue } } else { // Attempt to add to existing collection coll, err = db.GetCollection(postCollAlias) if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { // Show obfuscated "forbidden" response, as if attempting to add to an // unowned blog. r.Code = ErrForbiddenCollection.Status r.ErrorMessage = ErrForbiddenCollection.Message } else { r.Code = err.Status r.ErrorMessage = err.Message } } else { r.Code = http.StatusInternalServerError r.ErrorMessage = "Unknown error occurred claiming post with collection" } r.ID = p.ID res = append(res, r) continue } if coll.OwnerID != userID { r.Code = ErrForbiddenCollection.Status r.ErrorMessage = ErrForbiddenCollection.Message r.ID = p.ID res = append(res, r) continue } } if p.Slug == "" { p.Slug = p.ID } if canCollect { // User already owns this post, so just add it to the given // collection. query = "UPDATE posts SET collection_id = ?, slug = ? WHERE id = ? AND owner_id = ?" params = []interface{}{coll.ID, p.Slug, p.ID, userID} slugIdx = 1 } else { query = "UPDATE posts SET owner_id = ?, collection_id = ?, slug = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL" params = []interface{}{userID, coll.ID, p.Slug, p.ID, p.Token} slugIdx = 2 } } else { query = "UPDATE posts SET owner_id = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL" params = []interface{}{userID, p.ID, p.Token} } qRes, err = db.AttemptClaim(&p, query, params, slugIdx) if err != nil { r.Code = http.StatusInternalServerError r.ErrorMessage = "An unknown error occurred." r.ID = p.ID res = append(res, r) log.Error("claimPosts (post %s): %v", p.ID, err) continue } // Get full post information to return var fullPost *PublicPost if p.Token != "" { fullPost, err = db.GetEditablePost(p.ID, p.Token) } else { fullPost, err = db.GetPost(p.ID, 0) } if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message r.ID = p.ID res = append(res, r) continue } } if fullPost.OwnerID.Int64 != userID { r.Code = http.StatusConflict r.ErrorMessage = "Post is already owned by someone else." r.ID = p.ID res = append(res, r) continue } // Post was successfully claimed r.Code = http.StatusOK r.Post = fullPost if coll != nil { r.Post.Collection = &CollectionObj{Collection: *coll} } rowsAffected, _ := qRes.RowsAffected() if rowsAffected == 0 { // This was already claimed, but return 200 r.Code = http.StatusOK } res = append(res, r) } return &res, nil } func (db *datastore) UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error { if pos <= 0 || pos > 20 { pos = db.GetLastPinnedPostPos(collID) + 1 if pos == -1 { pos = 1 } } var err error if pinned { _, err = db.Exec("UPDATE posts SET pinned_position = ? WHERE id = ?", pos, postID) } else { _, err = db.Exec("UPDATE posts SET pinned_position = NULL WHERE id = ?", postID) } if err != nil { log.Error("Unable to update pinned post: %v", err) return err } return nil } func (db *datastore) GetLastPinnedPostPos(collID int64) int64 { var lastPos sql.NullInt64 err := db.QueryRow("SELECT MAX(pinned_position) FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL", collID).Scan(&lastPos) switch { case err == sql.ErrNoRows: return -1 case err != nil: log.Error("Failed selecting from posts: %v", err) return -1 } if !lastPos.Valid { return -1 } return lastPos.Int64 } func (db *datastore) GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error) { // FIXME: sqlite-backed instances don't include ellipsis on truncated titles timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } rows, err := db.Query("SELECT id, slug, title, "+db.clip("content", 80)+", pinned_position FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL "+timeCondition+" ORDER BY pinned_position ASC", coll.ID) if err != nil { log.Error("Failed selecting pinned posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve pinned posts."} } defer rows.Close() posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Title, &p.Content, &p.PinnedPosition) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() pp := p.processPost() pp.Collection = coll posts = append(posts, pp) } return &posts, nil } func (db *datastore) GetCollections(u *User, hostName string) (*[]Collection, error) { rows, err := db.Query("SELECT id, alias, title, description, privacy, view_count FROM collections WHERE owner_id = ? ORDER BY id ASC", u.ID) if err != nil { log.Error("Failed selecting from collections: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user collections."} } defer rows.Close() colls := []Collection{} for rows.Next() { c := Collection{} err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views) if err != nil { log.Error("Failed scanning row: %v", err) break } c.hostName = hostName c.URL = c.CanonicalURL() c.Public = c.IsPublic() colls = append(colls, c) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &colls, nil } func (db *datastore) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) { c, err := db.GetCollections(u, hostName) if err != nil { return nil, err } if len(*c) == 0 { return nil, impart.HTTPError{http.StatusInternalServerError, "You don't seem to have any blogs; they might've moved to another account. Try logging out and logging into your other account."} } return c, nil } func (db *datastore) GetMeStats(u *User) userMeStats { s := userMeStats{} // User counts colls, _ := db.GetUserCollectionCount(u.ID) s.TotalCollections = colls var articles, collPosts uint64 err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NULL", u.ID).Scan(&articles) if err != nil && err != sql.ErrNoRows { log.Error("Couldn't get articles count for user %d: %v", u.ID, err) } s.TotalArticles = articles err = db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NOT NULL", u.ID).Scan(&collPosts) if err != nil && err != sql.ErrNoRows { log.Error("Couldn't get coll posts count for user %d: %v", u.ID, err) } s.CollectionPosts = collPosts return s } func (db *datastore) GetTotalCollections() (collCount int64, err error) { err = db.QueryRow(` SELECT COUNT(*) FROM collections c LEFT JOIN users u ON u.id = c.owner_id WHERE u.status = 0`).Scan(&collCount) if err != nil { log.Error("Unable to fetch collections count: %v", err) } return } func (db *datastore) GetTotalPosts() (postCount int64, err error) { err = db.QueryRow(` SELECT COUNT(*) FROM posts p LEFT JOIN users u ON u.id = p.owner_id WHERE u.status = 0`).Scan(&postCount) if err != nil { log.Error("Unable to fetch posts count: %v", err) } return } func (db *datastore) GetTopPosts(u *User, alias string) (*[]PublicPost, error) { params := []interface{}{u.ID} where := "" if alias != "" { where = " AND alias = ?" params = append(params, alias) } rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user top posts."} } defer rows.Close() posts := []PublicPost{} var gotErr bool for rows.Next() { p := Post{} c := Collection{} var alias, title, description sql.NullString var views sql.NullInt64 err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &alias, &title, &description, &views) if err != nil { log.Error("Failed scanning User.getPosts() row: %v", err) gotErr = true break } p.extractData() pubPost := p.processPost() if alias.Valid && alias.String != "" { c.Alias = alias.String c.Title = title.String c.Description = description.String c.Views = views.Int64 pubPost.Collection = &CollectionObj{Collection: c} } posts = append(posts, pubPost) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } if gotErr && len(posts) == 0 { // There were a lot of errors return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."} } return &posts, nil } func (db *datastore) GetAnonymousPosts(u *User) (*[]PublicPost, error) { rows, err := db.Query("SELECT id, view_count, title, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC", u.ID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user anonymous posts."} } defer rows.Close() posts := []PublicPost{} for rows.Next() { p := Post{} err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } func (db *datastore) GetUserPosts(u *User) (*[]PublicPost, error) { rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.created, p.updated, p.content, p.text_appearance, p.language, p.rtl, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON collection_id = c.id WHERE p.owner_id = ? ORDER BY created ASC", u.ID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."} } defer rows.Close() posts := []PublicPost{} var gotErr bool for rows.Next() { p := Post{} c := Collection{} var alias, title, description sql.NullString var views sql.NullInt64 err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content, &p.Font, &p.Language, &p.RTL, &alias, &title, &description, &views) if err != nil { log.Error("Failed scanning User.getPosts() row: %v", err) gotErr = true break } p.extractData() pubPost := p.processPost() if alias.Valid && alias.String != "" { c.Alias = alias.String c.Title = title.String c.Description = description.String c.Views = views.Int64 pubPost.Collection = &CollectionObj{Collection: c} } posts = append(posts, pubPost) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } if gotErr && len(posts) == 0 { // There were a lot of errors return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."} } return &posts, nil } func (db *datastore) GetUserPostsCount(userID int64) int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ?", userID).Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting posts count for user %d: %v", userID, err) return 0 } return count } // ChangeSettings takes a User and applies the changes in the given // userSettings, MODIFYING THE USER with successful changes. func (db *datastore) ChangeSettings(app *App, u *User, s *userSettings) error { var errPass error q := query.NewUpdate() // Update email if given if s.Email != "" { encEmail, err := data.Encrypt(app.keys.EmailKey, s.Email) if err != nil { log.Error("Couldn't encrypt email %s: %s\n", s.Email, err) return impart.HTTPError{http.StatusInternalServerError, "Unable to encrypt email address."} } q.SetBytes(encEmail, "email") // Update the email if something goes awry updating the password defer func() { if errPass != nil { db.UpdateEncryptedUserEmail(u.ID, encEmail) } }() u.Email = zero.StringFrom(s.Email) } // Update username if given var newUsername string if s.Username != "" { var ie *impart.HTTPError newUsername, ie = getValidUsername(app, s.Username, u.Username) if ie != nil { // Username is invalid return *ie } if !author.IsValidUsername(app.cfg, newUsername) { // Ensure the username is syntactically correct. return impart.HTTPError{http.StatusPreconditionFailed, "Username isn't valid."} } t, err := db.Begin() if err != nil { log.Error("Couldn't start username change transaction: %v", err) return err } _, err = t.Exec("UPDATE users SET username = ? WHERE id = ?", newUsername, u.ID) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Unable to update users table: %v", err) return ErrInternalGeneral } _, err = t.Exec("UPDATE collections SET alias = ? WHERE alias = ? AND owner_id = ?", newUsername, u.Username, u.ID) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Unable to update collection: %v", err) return ErrInternalGeneral } // Keep track of name changes for redirection db.RemoveCollectionRedirect(t, newUsername) _, err = t.Exec("UPDATE collectionredirects SET new_alias = ? WHERE new_alias = ?", newUsername, u.Username) if err != nil { log.Error("Unable to update collectionredirects: %v", err) } _, err = t.Exec("INSERT INTO collectionredirects (prev_alias, new_alias) VALUES (?, ?)", u.Username, newUsername) if err != nil { log.Error("Unable to add new collectionredirect: %v", err) } err = t.Commit() if err != nil { t.Rollback() log.Error("Rolling back after Commit(): %v\n", err) return err } u.Username = newUsername } // Update passphrase if given if s.NewPass != "" { // Check if user has already set a password var err error u.HasPass, err = db.IsUserPassSet(u.ID) if err != nil { errPass = impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data."} return errPass } if u.HasPass { // Check if currently-set password is correct hashedPass := u.HashedPass if len(hashedPass) == 0 { authUser, err := db.GetUserForAuthByID(u.ID) if err != nil { errPass = err return errPass } hashedPass = authUser.HashedPass } if !auth.Authenticated(hashedPass, []byte(s.OldPass)) { errPass = impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} return errPass } } hashedPass, err := auth.HashPass([]byte(s.NewPass)) if err != nil { errPass = impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} return errPass } q.SetBytes(hashedPass, "password") } // WHERE values q.Append(u.ID) if q.Updates == "" { if s.Username == "" { return ErrPostNoUpdatableVals } // Nothing to update except username. That was successful, so return now. return nil } res, err := db.Exec("UPDATE users SET "+q.Updates+" WHERE id = ?", q.Params...) if err != nil { log.Error("Unable to update collection: %v", err) return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM users WHERE id = ?", u.ID).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedGeneral case err != nil: log.Error("Failed selecting from users: %v", err) } return nil } if s.NewPass != "" && !u.HasPass { u.HasPass = true } return nil } func (db *datastore) ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error { var dbPass []byte err := db.QueryRow("SELECT password FROM users WHERE id = ?", userID).Scan(&dbPass) switch { case err == sql.ErrNoRows: return ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password for change: %v", err) return err } if !sudo && !auth.Authenticated(dbPass, []byte(curPass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } _, err = db.Exec("UPDATE users SET password = ? WHERE id = ?", hashedPass, userID) if err != nil { log.Error("Could not update passphrase: %v", err) return err } return nil } func (db *datastore) RemoveCollectionRedirect(t *sql.Tx, alias string) error { _, err := t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ?", alias) if err != nil { log.Error("Unable to delete from collectionredirects: %v", err) return err } return nil } func (db *datastore) GetCollectionRedirect(alias string) (new string) { row := db.QueryRow("SELECT new_alias FROM collectionredirects WHERE prev_alias = ?", alias) err := row.Scan(&new) if err != nil && err != sql.ErrNoRows { log.Error("Failed selecting from collectionredirects: %v", err) } return } func (db *datastore) DeleteCollection(alias string, userID int64) error { c := &Collection{Alias: alias} var username string row := db.QueryRow("SELECT username FROM users WHERE id = ?", userID) err := row.Scan(&username) if err != nil { return err } // Ensure user isn't deleting their main blog if alias == username { return impart.HTTPError{http.StatusForbidden, "You cannot currently delete your primary blog."} } row = db.QueryRow("SELECT id FROM collections WHERE alias = ? AND owner_id = ?", alias, userID) err = row.Scan(&c.ID) switch { case err == sql.ErrNoRows: return impart.HTTPError{http.StatusNotFound, "Collection doesn't exist or you're not allowed to delete it."} case err != nil: log.Error("Failed selecting from collections: %v", err) return ErrInternalGeneral } t, err := db.Begin() if err != nil { return err } // Float all collection's posts _, err = t.Exec("UPDATE posts SET collection_id = NULL WHERE collection_id = ? AND owner_id = ?", c.ID, userID) if err != nil { t.Rollback() return err } // Remove redirects to or from this collection _, err = t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ? OR new_alias = ?", alias, alias) if err != nil { t.Rollback() return err } // Remove any optional collection password _, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() return err } // Finally, delete collection itself _, err = t.Exec("DELETE FROM collections WHERE id = ?", c.ID) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } func (db *datastore) IsCollectionAttributeOn(id int64, attr string) bool { var v string err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SELECT value in isCollectionAttributeOn for attribute '%s': %v", attr, err) return false } return v == "1" } func (db *datastore) CollectionHasAttribute(id int64, attr string) bool { var dummy string err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&dummy) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SELECT value in collectionHasAttribute for attribute '%s': %v", attr, err) return false } return true } func (db *datastore) DeleteAccount(userID int64) (l *string, err error) { debug := "" l = &debug t, err := db.Begin() if err != nil { stringLogln(l, "Unable to begin: %v", err) return } // Get all collections rows, err := db.Query("SELECT id, alias FROM collections WHERE owner_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to get collections: %v", err) return } defer rows.Close() colls := []Collection{} var c Collection for rows.Next() { err = rows.Scan(&c.ID, &c.Alias) if err != nil { t.Rollback() stringLogln(l, "Unable to scan collection cols: %v", err) return } colls = append(colls, c) } var res sql.Result for _, c := range colls { // TODO: user deleteCollection() func // Delete tokens res, err = t.Exec("DELETE FROM collectionattributes WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete attributes on %s: %v", c.Alias, err) return } rs, _ := res.RowsAffected() stringLogln(l, "Deleted %d for %s from collectionattributes", rs, c.Alias) // Remove any optional collection password res, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete passwords on %s: %v", c.Alias, err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d for %s from collectionpasswords", rs, c.Alias) // Remove redirects to this collection res, err = t.Exec("DELETE FROM collectionredirects WHERE new_alias = ?", c.Alias) if err != nil { t.Rollback() stringLogln(l, "Unable to delete redirects on %s: %v", c.Alias, err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d for %s from collectionredirects", rs, c.Alias) } // Delete collections res, err = t.Exec("DELETE FROM collections WHERE owner_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete collections: %v", err) return } rs, _ := res.RowsAffected() stringLogln(l, "Deleted %d from collections", rs) // Delete tokens res, err = t.Exec("DELETE FROM accesstokens WHERE user_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete access tokens: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from accesstokens", rs) // Delete posts res, err = t.Exec("DELETE FROM posts WHERE owner_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete posts: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from posts", rs) res, err = t.Exec("DELETE FROM userattributes WHERE user_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete attributes: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from userattributes", rs) res, err = t.Exec("DELETE FROM users WHERE id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete user: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from users", rs) err = t.Commit() if err != nil { t.Rollback() stringLogln(l, "Unable to commit: %v", err) return } return } func (db *datastore) GetAPActorKeys(collectionID int64) ([]byte, []byte) { var pub, priv []byte err := db.QueryRow("SELECT public_key, private_key FROM collectionkeys WHERE collection_id = ?", collectionID).Scan(&pub, &priv) switch { case err == sql.ErrNoRows: // Generate keys pub, priv = activitypub.GenerateKeys() _, err = db.Exec("INSERT INTO collectionkeys (collection_id, public_key, private_key) VALUES (?, ?, ?)", collectionID, pub, priv) if err != nil { log.Error("Unable to INSERT new activitypub keypair: %v", err) return nil, nil } case err != nil: log.Error("Couldn't SELECT collectionkeys: %v", err) return nil, nil } return pub, priv } func (db *datastore) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error { _, err := db.Exec("INSERT INTO userinvites (id, owner_id, max_uses, created, expires, inactive) VALUES (?, ?, ?, "+db.now()+", ?, 0)", id, userID, maxUses, expires) return err } func (db *datastore) GetUserInvites(userID int64) (*[]Invite, error) { rows, err := db.Query("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE owner_id = ? ORDER BY created DESC", userID) if err != nil { log.Error("Failed selecting from userinvites: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user invites."} } defer rows.Close() is := []Invite{} for rows.Next() { i := Invite{} err = rows.Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive) is = append(is, i) } return &is, nil } func (db *datastore) GetUserInvite(id string) (*Invite, error) { var i Invite err := db.QueryRow("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE id = ?", id).Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Invite doesn't exist."} case err != nil: log.Error("Failed selecting invite: %v", err) return nil, err } return &i, nil } // IsUsersInvite returns true if the user with ID created the invite with code // and an error other than sql no rows, if any. Will return false in the event // of an error. func (db *datastore) IsUsersInvite(code string, userID int64) (bool, error) { var id string err := db.QueryRow("SELECT id FROM userinvites WHERE id = ? AND owner_id = ?", code, userID).Scan(&id) if err != nil && err != sql.ErrNoRows { log.Error("Failed selecting invite: %v", err) return false, err } return id != "", nil } func (db *datastore) GetUsersInvitedCount(id string) int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM usersinvited WHERE invite_id = ?", id).Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting users invited count: %v", err) return 0 } return count } func (db *datastore) CreateInvitedUser(inviteID string, userID int64) error { _, err := db.Exec("INSERT INTO usersinvited (invite_id, user_id) VALUES (?, ?)", inviteID, userID) return err } func (db *datastore) GetInstancePages() ([]*instanceContent, error) { return db.GetAllDynamicContent("page") } func (db *datastore) GetAllDynamicContent(t string) ([]*instanceContent, error) { where := "" params := []interface{}{} if t != "" { where = " WHERE content_type = ?" params = append(params, t) } rows, err := db.Query("SELECT id, title, content, updated, content_type FROM appcontent"+where, params...) if err != nil { log.Error("Failed selecting from appcontent: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve instance pages."} } defer rows.Close() pages := []*instanceContent{} for rows.Next() { c := &instanceContent{} err = rows.Scan(&c.ID, &c.Title, &c.Content, &c.Updated, &c.Type) if err != nil { log.Error("Failed scanning row: %v", err) break } pages = append(pages, c) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return pages, nil } func (db *datastore) GetDynamicContent(id string) (*instanceContent, error) { c := &instanceContent{ ID: id, } err := db.QueryRow("SELECT title, content, updated, content_type FROM appcontent WHERE id = ?", id).Scan(&c.Title, &c.Content, &c.Updated, &c.Type) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Couldn't SELECT FROM appcontent for id '%s': %v", id, err) return nil, err } return c, nil } func (db *datastore) UpdateDynamicContent(id, title, content, contentType string) error { var err error if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?)", id, title, content, contentType) } else { _, err = db.Exec("INSERT INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?) "+db.upsert("id")+" title = ?, content = ?, updated = "+db.now(), id, title, content, contentType, title, content) } if err != nil { log.Error("Unable to INSERT appcontent for '%s': %v", id, err) } return err } func (db *datastore) GetAllUsers(page uint) (*[]User, error) { limitStr := fmt.Sprintf("0, %d", adminUsersPerPage) if page > 1 { limitStr = fmt.Sprintf("%d, %d", (page-1)*adminUsersPerPage, adminUsersPerPage) } rows, err := db.Query("SELECT id, username, created, status FROM users ORDER BY created DESC LIMIT " + limitStr) if err != nil { log.Error("Failed selecting from users: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve all users."} } defer rows.Close() users := []User{} for rows.Next() { u := User{} err = rows.Scan(&u.ID, &u.Username, &u.Created, &u.Status) if err != nil { log.Error("Failed scanning GetAllUsers() row: %v", err) break } users = append(users, u) } return &users, nil } func (db *datastore) GetAllUsersCount() int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM users").Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting all users count: %v", err) return 0 } return count } func (db *datastore) GetUserLastPostTime(id int64) (*time.Time, error) { var t time.Time err := db.QueryRow("SELECT created FROM posts WHERE owner_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Failed selecting last post time from posts: %v", err) return nil, err } return &t, nil } // SetUserStatus changes a user's status in the database. see Users.UserStatus func (db *datastore) SetUserStatus(id int64, status UserStatus) error { _, err := db.Exec("UPDATE users SET status = ? WHERE id = ?", status, id) if err != nil { return fmt.Errorf("failed to update user status: %v", err) } return nil } func (db *datastore) GetCollectionLastPostTime(id int64) (*time.Time, error) { var t time.Time err := db.QueryRow("SELECT created FROM posts WHERE collection_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Failed selecting last post time from posts: %v", err) return nil, err } return &t, nil } +func (db *datastore) GenerateOAuthState(ctx context.Context, provider, clientID string) (string, error) { + state := store.Generate62RandomString(24) + _, err := db.ExecContext(ctx, "INSERT INTO oauth_client_states (state, provider, client_id, used, created_at) VALUES (?, ?, ?, FALSE, NOW())", state, provider, clientID) + if err != nil { + return "", fmt.Errorf("unable to record oauth client state: %w", err) + } + return state, nil +} + +func (db *datastore) ValidateOAuthState(ctx context.Context, state string) (string, string, error) { + var provider string + var clientID string + err := wf_db.RunTransactionWithOptions(ctx, db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { + err := tx.QueryRow("SELECT provider, client_id FROM oauth_client_states WHERE state = ? AND used = FALSE", state).Scan(&provider, &clientID) + if err != nil { + return err + } + + res, err := tx.ExecContext(ctx, "UPDATE oauth_client_states SET used = TRUE WHERE state = ?", state) + if err != nil { + return err + } + rowsAffected, err := res.RowsAffected() + if err != nil { + return err + } + if rowsAffected != 1 { + return fmt.Errorf("state not found") + } + return nil + }) + if err != nil { + return "", "", nil + } + return provider, clientID, nil +} + +func (db *datastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error { + var err error + if db.driverName == driverSQLite { + _, err = db.ExecContext(ctx, "INSERT OR REPLACE INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?)", localUserID, remoteUserID, provider, clientID, accessToken) + } else { + _, err = db.ExecContext(ctx, "INSERT INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?) "+db.upsert("user")+" access_token = ?", localUserID, remoteUserID, provider, clientID, accessToken, accessToken) + } + if err != nil { + log.Error("Unable to INSERT oauth_users for '%d': %v", localUserID, err) + } + return err +} + +// GetIDForRemoteUser returns a user ID associated with a remote user ID. +func (db *datastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) { + var userID int64 = -1 + err := db. + QueryRowContext(ctx, "SELECT user_id FROM oauth_users WHERE remote_user_id = ? AND provider = ? AND client_id = ?", remoteUserID, provider, clientID). + Scan(&userID) + // Not finding a record is OK. + if err != nil && err != sql.ErrNoRows { + return -1, err + } + return userID, nil +} + // DatabaseInitialized returns whether or not the current datastore has been // initialized with the correct schema. // Currently, it checks to see if the `users` table exists. func (db *datastore) DatabaseInitialized() bool { var dummy string var err error if db.driverName == driverSQLite { err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = 'users'").Scan(&dummy) } else { err = db.QueryRow("SHOW TABLES LIKE 'users'").Scan(&dummy) } switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SHOW TABLES: %v", err) return false } return true } func stringLogln(log *string, s string, v ...interface{}) { *log += fmt.Sprintf(s+"\n", v...) } func handleFailedPostInsert(err error) error { log.Error("Couldn't insert into posts: %v", err) return err } diff --git a/database_test.go b/database_test.go new file mode 100644 index 0000000..c4c586a --- /dev/null +++ b/database_test.go @@ -0,0 +1,50 @@ +package writefreely + +import ( + "context" + "database/sql" + "github.com/stretchr/testify/assert" + "testing" +) + +func TestOAuthDatastore(t *testing.T) { + if !runMySQLTests() { + t.Skip("skipping mysql tests") + } + withTestDB(t, func(db *sql.DB) { + ctx := context.Background() + ds := &datastore{ + DB: db, + driverName: "", + } + + state, err := ds.GenerateOAuthState(ctx, "test", "development") + assert.NoError(t, err) + assert.Len(t, state, 24) + + countRows(t, ctx, db, 1, "SELECT COUNT(*) FROM `oauth_client_states` WHERE `state` = ? AND `used` = false", state) + + _, _, err = ds.ValidateOAuthState(ctx, state) + assert.NoError(t, err) + + countRows(t, ctx, db, 1, "SELECT COUNT(*) FROM `oauth_client_states` WHERE `state` = ? AND `used` = true", state) + + var localUserID int64 = 99 + var remoteUserID = "100" + err = ds.RecordRemoteUserID(ctx, localUserID, remoteUserID, "test", "test", "access_token_a") + assert.NoError(t, err) + + countRows(t, ctx, db, 1, "SELECT COUNT(*) FROM `oauth_users` WHERE `user_id` = ? AND `remote_user_id` = ? AND access_token = 'access_token_a'", localUserID, remoteUserID) + + err = ds.RecordRemoteUserID(ctx, localUserID, remoteUserID, "test", "test", "access_token_b") + assert.NoError(t, err) + + countRows(t, ctx, db, 1, "SELECT COUNT(*) FROM `oauth_users` WHERE `user_id` = ? AND `remote_user_id` = ? AND access_token = 'access_token_b'", localUserID, remoteUserID) + + countRows(t, ctx, db, 1, "SELECT COUNT(*) FROM `oauth_users`") + + foundUserID, err := ds.GetIDForRemoteUser(ctx, remoteUserID, "test", "test") + assert.NoError(t, err) + assert.Equal(t, localUserID, foundUserID) + }) +} diff --git a/db/alter.go b/db/alter.go new file mode 100644 index 0000000..0a4ffdd --- /dev/null +++ b/db/alter.go @@ -0,0 +1,52 @@ +package db + +import ( + "fmt" + "strings" +) + +type AlterTableSqlBuilder struct { + Dialect DialectType + Name string + Changes []string +} + +func (b *AlterTableSqlBuilder) AddColumn(col *Column) *AlterTableSqlBuilder { + if colVal, err := col.String(); err == nil { + b.Changes = append(b.Changes, fmt.Sprintf("ADD COLUMN %s", colVal)) + } + return b +} + +func (b *AlterTableSqlBuilder) ChangeColumn(name string, col *Column) *AlterTableSqlBuilder { + if colVal, err := col.String(); err == nil { + b.Changes = append(b.Changes, fmt.Sprintf("CHANGE COLUMN %s %s", name, colVal)) + } + return b +} + +func (b *AlterTableSqlBuilder) AddUniqueConstraint(name string, columns ...string) *AlterTableSqlBuilder { + b.Changes = append(b.Changes, fmt.Sprintf("ADD CONSTRAINT %s UNIQUE (%s)", name, strings.Join(columns, ", "))) + return b +} + +func (b *AlterTableSqlBuilder) ToSQL() (string, error) { + var str strings.Builder + + str.WriteString("ALTER TABLE ") + str.WriteString(b.Name) + str.WriteString(" ") + + if len(b.Changes) == 0 { + return "", fmt.Errorf("no changes provide for table: %s", b.Name) + } + changeCount := len(b.Changes) + for i, thing := range b.Changes { + str.WriteString(thing) + if i < changeCount-1 { + str.WriteString(", ") + } + } + + return str.String(), nil +} diff --git a/db/alter_test.go b/db/alter_test.go new file mode 100644 index 0000000..4bd58ac --- /dev/null +++ b/db/alter_test.go @@ -0,0 +1,56 @@ +package db + +import "testing" + +func TestAlterTableSqlBuilder_ToSQL(t *testing.T) { + type fields struct { + Dialect DialectType + Name string + Changes []string + } + tests := []struct { + name string + builder *AlterTableSqlBuilder + want string + wantErr bool + }{ + { + name: "MySQL add int", + builder: DialectMySQL. + AlterTable("the_table"). + AddColumn(DialectMySQL.Column("the_col", ColumnTypeInteger, UnsetSize)), + want: "ALTER TABLE the_table ADD COLUMN the_col INT NOT NULL", + wantErr: false, + }, + { + name: "MySQL add string", + builder: DialectMySQL. + AlterTable("the_table"). + AddColumn(DialectMySQL.Column("the_col", ColumnTypeVarChar, OptionalInt{true, 128})), + want: "ALTER TABLE the_table ADD COLUMN the_col VARCHAR(128) NOT NULL", + wantErr: false, + }, + + { + name: "MySQL add int and string", + builder: DialectMySQL. + AlterTable("the_table"). + AddColumn(DialectMySQL.Column("first_col", ColumnTypeInteger, UnsetSize)). + AddColumn(DialectMySQL.Column("second_col", ColumnTypeVarChar, OptionalInt{true, 128})), + want: "ALTER TABLE the_table ADD COLUMN first_col INT NOT NULL, ADD COLUMN second_col VARCHAR(128) NOT NULL", + wantErr: false, + }, + } + for _, tt := range tests { + t.Run(tt.name, func(t *testing.T) { + got, err := tt.builder.ToSQL() + if (err != nil) != tt.wantErr { + t.Errorf("ToSQL() error = %v, wantErr %v", err, tt.wantErr) + return + } + if got != tt.want { + t.Errorf("ToSQL() got = %v, want %v", got, tt.want) + } + }) + } +} diff --git a/db/create.go b/db/create.go new file mode 100644 index 0000000..c384778 --- /dev/null +++ b/db/create.go @@ -0,0 +1,244 @@ +package db + +import ( + "fmt" + "strings" +) + +type ColumnType int + +type OptionalInt struct { + Set bool + Value int +} + +type OptionalString struct { + Set bool + Value string +} + +type SQLBuilder interface { + ToSQL() (string, error) +} + +type Column struct { + Dialect DialectType + Name string + Nullable bool + Default OptionalString + Type ColumnType + Size OptionalInt + PrimaryKey bool +} + +type CreateTableSqlBuilder struct { + Dialect DialectType + Name string + IfNotExists bool + ColumnOrder []string + Columns map[string]*Column + Constraints []string +} + +const ( + ColumnTypeBool ColumnType = iota + ColumnTypeSmallInt ColumnType = iota + ColumnTypeInteger ColumnType = iota + ColumnTypeChar ColumnType = iota + ColumnTypeVarChar ColumnType = iota + ColumnTypeText ColumnType = iota + ColumnTypeDateTime ColumnType = iota +) + +var _ SQLBuilder = &CreateTableSqlBuilder{} + +var UnsetSize OptionalInt = OptionalInt{Set: false, Value: 0} +var UnsetDefault OptionalString = OptionalString{Set: false, Value: ""} + +func (d ColumnType) Format(dialect DialectType, size OptionalInt) (string, error) { + if dialect != DialectMySQL && dialect != DialectSQLite { + return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size) + } + switch d { + case ColumnTypeSmallInt: + { + if dialect == DialectSQLite { + return "INTEGER", nil + } + mod := "" + if size.Set { + mod = fmt.Sprintf("(%d)", size.Value) + } + return "SMALLINT" + mod, nil + } + case ColumnTypeInteger: + { + if dialect == DialectSQLite { + return "INTEGER", nil + } + mod := "" + if size.Set { + mod = fmt.Sprintf("(%d)", size.Value) + } + return "INT" + mod, nil + } + case ColumnTypeChar: + { + if dialect == DialectSQLite { + return "TEXT", nil + } + mod := "" + if size.Set { + mod = fmt.Sprintf("(%d)", size.Value) + } + return "CHAR" + mod, nil + } + case ColumnTypeVarChar: + { + if dialect == DialectSQLite { + return "TEXT", nil + } + mod := "" + if size.Set { + mod = fmt.Sprintf("(%d)", size.Value) + } + return "VARCHAR" + mod, nil + } + case ColumnTypeBool: + { + if dialect == DialectSQLite { + return "INTEGER", nil + } + return "TINYINT(1)", nil + } + case ColumnTypeDateTime: + return "DATETIME", nil + case ColumnTypeText: + return "TEXT", nil + } + return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size) +} + +func (c *Column) SetName(name string) *Column { + c.Name = name + return c +} + +func (c *Column) SetNullable(nullable bool) *Column { + c.Nullable = nullable + return c +} + +func (c *Column) SetPrimaryKey(pk bool) *Column { + c.PrimaryKey = pk + return c +} + +func (c *Column) SetDefault(value string) *Column { + c.Default = OptionalString{Set: true, Value: value} + return c +} + +func (c *Column) SetType(t ColumnType) *Column { + c.Type = t + return c +} + +func (c *Column) SetSize(size int) *Column { + c.Size = OptionalInt{Set: true, Value: size} + return c +} + +func (c *Column) String() (string, error) { + var str strings.Builder + + str.WriteString(c.Name) + + str.WriteString(" ") + typeStr, err := c.Type.Format(c.Dialect, c.Size) + if err != nil { + return "", err + } + + str.WriteString(typeStr) + + if !c.Nullable { + str.WriteString(" NOT NULL") + } + + if c.Default.Set { + str.WriteString(" DEFAULT ") + str.WriteString(c.Default.Value) + } + + if c.PrimaryKey { + str.WriteString(" PRIMARY KEY") + } + + return str.String(), nil +} + +func (b *CreateTableSqlBuilder) Column(column *Column) *CreateTableSqlBuilder { + if b.Columns == nil { + b.Columns = make(map[string]*Column) + } + b.Columns[column.Name] = column + b.ColumnOrder = append(b.ColumnOrder, column.Name) + return b +} + +func (b *CreateTableSqlBuilder) UniqueConstraint(columns ...string) *CreateTableSqlBuilder { + for _, column := range columns { + if _, ok := b.Columns[column]; !ok { + // This fails silently. + return b + } + } + b.Constraints = append(b.Constraints, fmt.Sprintf("UNIQUE(%s)", strings.Join(columns, ","))) + return b +} + +func (b *CreateTableSqlBuilder) SetIfNotExists(ine bool) *CreateTableSqlBuilder { + b.IfNotExists = ine + return b +} + +func (b *CreateTableSqlBuilder) ToSQL() (string, error) { + var str strings.Builder + + str.WriteString("CREATE TABLE ") + if b.IfNotExists { + str.WriteString("IF NOT EXISTS ") + } + str.WriteString(b.Name) + + var things []string + for _, columnName := range b.ColumnOrder { + column, ok := b.Columns[columnName] + if !ok { + return "", fmt.Errorf("column not found: %s", columnName) + } + columnStr, err := column.String() + if err != nil { + return "", err + } + things = append(things, columnStr) + } + for _, constraint := range b.Constraints { + things = append(things, constraint) + } + + if thingLen := len(things); thingLen > 0 { + str.WriteString(" ( ") + for i, thing := range things { + str.WriteString(thing) + if i < thingLen-1 { + str.WriteString(", ") + } + } + str.WriteString(" )") + } + + return str.String(), nil +} + diff --git a/db/create_test.go b/db/create_test.go new file mode 100644 index 0000000..369d5c1 --- /dev/null +++ b/db/create_test.go @@ -0,0 +1,146 @@ +package db + +import ( + "github.com/stretchr/testify/assert" + "testing" +) + +func TestDialect_Column(t *testing.T) { + c1 := DialectSQLite.Column("foo", ColumnTypeBool, UnsetSize) + assert.Equal(t, DialectSQLite, c1.Dialect) + c2 := DialectMySQL.Column("foo", ColumnTypeBool, UnsetSize) + assert.Equal(t, DialectMySQL, c2.Dialect) +} + +func TestColumnType_Format(t *testing.T) { + type args struct { + dialect DialectType + size OptionalInt + } + tests := []struct { + name string + d ColumnType + args args + want string + wantErr bool + }{ + {"Sqlite bool", ColumnTypeBool, args{dialect: DialectSQLite}, "INTEGER", false}, + {"Sqlite small int", ColumnTypeSmallInt, args{dialect: DialectSQLite}, "INTEGER", false}, + {"Sqlite int", ColumnTypeInteger, args{dialect: DialectSQLite}, "INTEGER", false}, + {"Sqlite char", ColumnTypeChar, args{dialect: DialectSQLite}, "TEXT", false}, + {"Sqlite varchar", ColumnTypeVarChar, args{dialect: DialectSQLite}, "TEXT", false}, + {"Sqlite text", ColumnTypeText, args{dialect: DialectSQLite}, "TEXT", false}, + {"Sqlite datetime", ColumnTypeDateTime, args{dialect: DialectSQLite}, "DATETIME", false}, + + {"MySQL bool", ColumnTypeBool, args{dialect: DialectMySQL}, "TINYINT(1)", false}, + {"MySQL small int", ColumnTypeSmallInt, args{dialect: DialectMySQL}, "SMALLINT", false}, + {"MySQL small int with param", ColumnTypeSmallInt, args{dialect: DialectMySQL, size: OptionalInt{true, 3}}, "SMALLINT(3)", false}, + {"MySQL int", ColumnTypeInteger, args{dialect: DialectMySQL}, "INT", false}, + {"MySQL int with param", ColumnTypeInteger, args{dialect: DialectMySQL, size: OptionalInt{true, 11}}, "INT(11)", false}, + {"MySQL char", ColumnTypeChar, args{dialect: DialectMySQL}, "CHAR", false}, + {"MySQL char with param", ColumnTypeChar, args{dialect: DialectMySQL, size: OptionalInt{true, 4}}, "CHAR(4)", false}, + {"MySQL varchar", ColumnTypeVarChar, args{dialect: DialectMySQL}, "VARCHAR", false}, + {"MySQL varchar with param", ColumnTypeVarChar, args{dialect: DialectMySQL, size: OptionalInt{true, 25}}, "VARCHAR(25)", false}, + {"MySQL text", ColumnTypeText, args{dialect: DialectMySQL}, "TEXT", false}, + {"MySQL datetime", ColumnTypeDateTime, args{dialect: DialectMySQL}, "DATETIME", false}, + + {"invalid column type", 10000, args{dialect: DialectMySQL}, "", true}, + {"invalid dialect", ColumnTypeBool, args{dialect: 10000}, "", true}, + } + for _, tt := range tests { + t.Run(tt.name, func(t *testing.T) { + got, err := tt.d.Format(tt.args.dialect, tt.args.size) + if (err != nil) != tt.wantErr { + t.Errorf("Format() error = %v, wantErr %v", err, tt.wantErr) + return + } + if got != tt.want { + t.Errorf("Format() got = %v, want %v", got, tt.want) + } + }) + } +} + +func TestColumn_Build(t *testing.T) { + type fields struct { + Dialect DialectType + Name string + Nullable bool + Default OptionalString + Type ColumnType + Size OptionalInt + PrimaryKey bool + } + tests := []struct { + name string + fields fields + want string + wantErr bool + }{ + {"Sqlite bool", fields{DialectSQLite, "foo", false, UnsetDefault, ColumnTypeBool, UnsetSize, false}, "foo INTEGER NOT NULL", false}, + {"Sqlite bool nullable", fields{DialectSQLite, "foo", true, UnsetDefault, ColumnTypeBool, UnsetSize, false}, "foo INTEGER", false}, + {"Sqlite small int", fields{DialectSQLite, "foo", false, UnsetDefault, ColumnTypeSmallInt, UnsetSize, true}, "foo INTEGER NOT NULL PRIMARY KEY", false}, + {"Sqlite small int nullable", fields{DialectSQLite, "foo", true, UnsetDefault, ColumnTypeSmallInt, UnsetSize, false}, "foo INTEGER", false}, + {"Sqlite int", fields{DialectSQLite, "foo", false, UnsetDefault, ColumnTypeInteger, UnsetSize, false}, "foo INTEGER NOT NULL", false}, + {"Sqlite int nullable", fields{DialectSQLite, "foo", true, UnsetDefault, ColumnTypeInteger, UnsetSize, false}, "foo INTEGER", false}, + {"Sqlite char", fields{DialectSQLite, "foo", false, UnsetDefault, ColumnTypeChar, UnsetSize, false}, "foo TEXT NOT NULL", false}, + {"Sqlite char nullable", fields{DialectSQLite, "foo", true, UnsetDefault, ColumnTypeChar, UnsetSize, false}, "foo TEXT", false}, + {"Sqlite varchar", fields{DialectSQLite, "foo", false, UnsetDefault, ColumnTypeVarChar, UnsetSize, false}, "foo TEXT NOT NULL", false}, + {"Sqlite varchar nullable", fields{DialectSQLite, "foo", true, UnsetDefault, ColumnTypeVarChar, UnsetSize, false}, "foo TEXT", false}, + {"Sqlite text", fields{DialectSQLite, "foo", false, UnsetDefault, ColumnTypeText, UnsetSize, false}, "foo TEXT NOT NULL", false}, + {"Sqlite text nullable", fields{DialectSQLite, "foo", true, UnsetDefault, ColumnTypeText, UnsetSize, false}, "foo TEXT", false}, + {"Sqlite datetime", fields{DialectSQLite, "foo", false, UnsetDefault, ColumnTypeDateTime, UnsetSize, false}, "foo DATETIME NOT NULL", false}, + {"Sqlite datetime nullable", fields{DialectSQLite, "foo", true, UnsetDefault, ColumnTypeDateTime, UnsetSize, false}, "foo DATETIME", false}, + + {"MySQL bool", fields{DialectMySQL, "foo", false, UnsetDefault, ColumnTypeBool, UnsetSize, false}, "foo TINYINT(1) NOT NULL", false}, + {"MySQL bool nullable", fields{DialectMySQL, "foo", true, UnsetDefault, ColumnTypeBool, UnsetSize, false}, "foo TINYINT(1)", false}, + {"MySQL small int", fields{DialectMySQL, "foo", false, UnsetDefault, ColumnTypeSmallInt, UnsetSize, true}, "foo SMALLINT NOT NULL PRIMARY KEY", false}, + {"MySQL small int nullable", fields{DialectMySQL, "foo", true, UnsetDefault, ColumnTypeSmallInt, UnsetSize, false}, "foo SMALLINT", false}, + {"MySQL int", fields{DialectMySQL, "foo", false, UnsetDefault, ColumnTypeInteger, UnsetSize, false}, "foo INT NOT NULL", false}, + {"MySQL int nullable", fields{DialectMySQL, "foo", true, UnsetDefault, ColumnTypeInteger, UnsetSize, false}, "foo INT", false}, + {"MySQL char", fields{DialectMySQL, "foo", false, UnsetDefault, ColumnTypeChar, UnsetSize, false}, "foo CHAR NOT NULL", false}, + {"MySQL char nullable", fields{DialectMySQL, "foo", true, UnsetDefault, ColumnTypeChar, UnsetSize, false}, "foo CHAR", false}, + {"MySQL varchar", fields{DialectMySQL, "foo", false, UnsetDefault, ColumnTypeVarChar, UnsetSize, false}, "foo VARCHAR NOT NULL", false}, + {"MySQL varchar nullable", fields{DialectMySQL, "foo", true, UnsetDefault, ColumnTypeVarChar, UnsetSize, false}, "foo VARCHAR", false}, + {"MySQL text", fields{DialectMySQL, "foo", false, UnsetDefault, ColumnTypeText, UnsetSize, false}, "foo TEXT NOT NULL", false}, + {"MySQL text nullable", fields{DialectMySQL, "foo", true, UnsetDefault, ColumnTypeText, UnsetSize, false}, "foo TEXT", false}, + {"MySQL datetime", fields{DialectMySQL, "foo", false, UnsetDefault, ColumnTypeDateTime, UnsetSize, false}, "foo DATETIME NOT NULL", false}, + {"MySQL datetime nullable", fields{DialectMySQL, "foo", true, UnsetDefault, ColumnTypeDateTime, UnsetSize, false}, "foo DATETIME", false}, + } + for _, tt := range tests { + t.Run(tt.name, func(t *testing.T) { + c := &Column{ + Dialect: tt.fields.Dialect, + Name: tt.fields.Name, + Nullable: tt.fields.Nullable, + Default: tt.fields.Default, + Type: tt.fields.Type, + Size: tt.fields.Size, + PrimaryKey: tt.fields.PrimaryKey, + } + if got, err := c.String(); got != tt.want { + if (err != nil) != tt.wantErr { + t.Errorf("String() error = %v, wantErr %v", err, tt.wantErr) + return + } + if got != tt.want { + t.Errorf("String() got = %v, want %v", got, tt.want) + } + } + }) + } +} + +func TestCreateTableSqlBuilder_ToSQL(t *testing.T) { + sql, err := DialectMySQL. + Table("foo"). + SetIfNotExists(true). + Column(DialectMySQL.Column("bar", ColumnTypeInteger, UnsetSize).SetPrimaryKey(true)). + Column(DialectMySQL.Column("baz", ColumnTypeText, UnsetSize)). + Column(DialectMySQL.Column("qux", ColumnTypeDateTime, UnsetSize).SetDefault("NOW()")). + UniqueConstraint("bar"). + UniqueConstraint("bar", "baz"). + ToSQL() + assert.NoError(t, err) + assert.Equal(t, "CREATE TABLE IF NOT EXISTS foo ( bar INT NOT NULL PRIMARY KEY, baz TEXT NOT NULL, qux DATETIME NOT NULL DEFAULT NOW(), UNIQUE(bar), UNIQUE(bar,baz) )", sql) +} diff --git a/db/dialect.go b/db/dialect.go new file mode 100644 index 0000000..4251465 --- /dev/null +++ b/db/dialect.go @@ -0,0 +1,76 @@ +package db + +import "fmt" + +type DialectType int + +const ( + DialectSQLite DialectType = iota + DialectMySQL DialectType = iota +) + +func (d DialectType) Column(name string, t ColumnType, size OptionalInt) *Column { + switch d { + case DialectSQLite: + return &Column{Dialect: DialectSQLite, Name: name, Type: t, Size: size} + case DialectMySQL: + return &Column{Dialect: DialectMySQL, Name: name, Type: t, Size: size} + default: + panic(fmt.Sprintf("unexpected dialect: %d", d)) + } +} + +func (d DialectType) Table(name string) *CreateTableSqlBuilder { + switch d { + case DialectSQLite: + return &CreateTableSqlBuilder{Dialect: DialectSQLite, Name: name} + case DialectMySQL: + return &CreateTableSqlBuilder{Dialect: DialectMySQL, Name: name} + default: + panic(fmt.Sprintf("unexpected dialect: %d", d)) + } +} + +func (d DialectType) AlterTable(name string) *AlterTableSqlBuilder { + switch d { + case DialectSQLite: + return &AlterTableSqlBuilder{Dialect: DialectSQLite, Name: name} + case DialectMySQL: + return &AlterTableSqlBuilder{Dialect: DialectMySQL, Name: name} + default: + panic(fmt.Sprintf("unexpected dialect: %d", d)) + } +} + +func (d DialectType) CreateUniqueIndex(name, table string, columns ...string) *CreateIndexSqlBuilder { + switch d { + case DialectSQLite: + return &CreateIndexSqlBuilder{Dialect: DialectSQLite, Name: name, Table: table, Unique: true, Columns: columns} + case DialectMySQL: + return &CreateIndexSqlBuilder{Dialect: DialectMySQL, Name: name, Table: table, Unique: true, Columns: columns} + default: + panic(fmt.Sprintf("unexpected dialect: %d", d)) + } +} + +func (d DialectType) CreateIndex(name, table string, columns ...string) *CreateIndexSqlBuilder { + switch d { + case DialectSQLite: + return &CreateIndexSqlBuilder{Dialect: DialectSQLite, Name: name, Table: table, Unique: false, Columns: columns} + case DialectMySQL: + return &CreateIndexSqlBuilder{Dialect: DialectMySQL, Name: name, Table: table, Unique: false, Columns: columns} + default: + panic(fmt.Sprintf("unexpected dialect: %d", d)) + } +} + +func (d DialectType) DropIndex(name, table string) *DropIndexSqlBuilder { + switch d { + case DialectSQLite: + return &DropIndexSqlBuilder{Dialect: DialectSQLite, Name: name, Table: table} + case DialectMySQL: + return &DropIndexSqlBuilder{Dialect: DialectMySQL, Name: name, Table: table} + default: + panic(fmt.Sprintf("unexpected dialect: %d", d)) + } +} diff --git a/db/index.go b/db/index.go new file mode 100644 index 0000000..8180224 --- /dev/null +++ b/db/index.go @@ -0,0 +1,53 @@ +package db + +import ( + "fmt" + "strings" +) + +type CreateIndexSqlBuilder struct { + Dialect DialectType + Name string + Table string + Unique bool + Columns []string +} + +type DropIndexSqlBuilder struct { + Dialect DialectType + Name string + Table string +} + +func (b *CreateIndexSqlBuilder) ToSQL() (string, error) { + var str strings.Builder + + str.WriteString("CREATE ") + if b.Unique { + str.WriteString("UNIQUE ") + } + str.WriteString("INDEX ") + str.WriteString(b.Name) + str.WriteString(" on ") + str.WriteString(b.Table) + + if len(b.Columns) == 0 { + return "", fmt.Errorf("columns provided for this index: %s", b.Name) + } + + str.WriteString(" (") + columnCount := len(b.Columns) + for i, thing := range b.Columns { + str.WriteString(thing) + if i < columnCount-1 { + str.WriteString(", ") + } + } + str.WriteString(")") + + return str.String(), nil +} + +func (b *DropIndexSqlBuilder) ToSQL() (string, error) { + return fmt.Sprintf("DROP INDEX %s on %s", b.Name, b.Table), nil +} diff --git a/db/raw.go b/db/raw.go new file mode 100644 index 0000000..d0301c8 --- /dev/null +++ b/db/raw.go @@ -0,0 +1,9 @@ +package db + +type RawSqlBuilder struct { + Query string +} + +func (b *RawSqlBuilder) ToSQL() (string, error) { + return b.Query, nil +} diff --git a/db/tx.go b/db/tx.go new file mode 100644 index 0000000..5c321af --- /dev/null +++ b/db/tx.go @@ -0,0 +1,26 @@ +package db + +import ( + "context" + "database/sql" +) + +// TransactionScopedWork describes code executed within a database transaction. +type TransactionScopedWork func(ctx context.Context, db *sql.Tx) error + +// RunTransactionWithOptions executes a block of code within a database transaction. +func RunTransactionWithOptions(ctx context.Context, db *sql.DB, txOpts *sql.TxOptions, txWork TransactionScopedWork) error { + tx, err := db.BeginTx(ctx, txOpts) + if err != nil { + return err + } + + if err = txWork(ctx, tx); err != nil { + if txErr := tx.Rollback(); txErr != nil { + return txErr + } + return err + } + return tx.Commit() +} + diff --git a/go.mod b/go.mod index 339af45..f6aa8b7 100644 --- a/go.mod +++ b/go.mod @@ -1,63 +1,63 @@ module github.com/writeas/writefreely require ( github.com/BurntSushi/toml v0.3.1 // indirect github.com/alecthomas/gometalinter v3.0.0+incompatible // indirect github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf // indirect github.com/captncraig/cors v0.0.0-20180620154129-376d45073b49 // indirect github.com/clbanning/mxj v1.8.4 // indirect github.com/dustin/go-humanize v1.0.0 github.com/fatih/color v1.7.0 github.com/go-sql-driver/mysql v1.4.1 github.com/go-test/deep v1.0.1 // indirect github.com/golang/lint v0.0.0-20181217174547-8f45f776aaf1 // indirect github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e // indirect github.com/gorilla/feeds v1.1.0 github.com/gorilla/mux v1.7.0 github.com/gorilla/schema v1.0.2 github.com/gorilla/sessions v1.1.3 github.com/guregu/null v3.4.0+incompatible github.com/hashicorp/go-multierror v1.0.0 github.com/ikeikeikeike/go-sitemap-generator v1.0.1 github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2 github.com/jtolds/gls v4.2.1+incompatible // indirect + github.com/kr/pretty v0.1.0 github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec github.com/lunixbochs/vtclean v1.0.0 // indirect github.com/manifoldco/promptui v0.3.2 github.com/mattn/go-colorable v0.1.0 // indirect github.com/mattn/go-sqlite3 v1.10.0 github.com/microcosm-cc/bluemonday v1.0.2 github.com/mitchellh/go-wordwrap v1.0.0 github.com/nicksnyder/go-i18n v1.10.0 // indirect github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d github.com/pelletier/go-toml v1.2.0 // indirect - github.com/pkg/errors v0.8.1 // indirect + github.com/pkg/errors v0.8.1 github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be // indirect - github.com/shurcooL/sanitized_anchor_name v1.0.0 // indirect github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304 // indirect github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c // indirect - github.com/stretchr/testify v1.3.0 // indirect + github.com/stretchr/testify v1.3.0 github.com/writeas/activity v0.1.2 github.com/writeas/go-strip-markdown v2.0.1+incompatible github.com/writeas/go-webfinger v0.0.0-20190106002315-85cf805c86d2 github.com/writeas/httpsig v1.0.0 - github.com/writeas/impart v1.1.0 + github.com/writeas/impart v1.1.1-0.20191230230525-d3c45ced010d github.com/writeas/import v0.2.0 github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219 github.com/writeas/nerds v1.0.0 - github.com/writeas/openssl-go v1.0.0 // indirect github.com/writeas/saturday v1.7.1 github.com/writeas/slug v1.2.0 github.com/writeas/web-core v1.2.0 github.com/writefreely/go-nodeinfo v1.2.0 golang.org/x/crypto v0.0.0-20190208162236-193df9c0f06f golang.org/x/lint v0.0.0-20181217174547-8f45f776aaf1 // indirect golang.org/x/net v0.0.0-20190206173232-65e2d4e15006 // indirect golang.org/x/sys v0.0.0-20190209173611-3b5209105503 // indirect - golang.org/x/tools v0.0.0-20190208222737-3744606dbb67 // indirect + golang.org/x/tools v0.0.0-20190208222737-3744606dbb67 google.golang.org/appengine v1.4.0 // indirect gopkg.in/alecthomas/kingpin.v3-unstable v3.0.0-20180810215634-df19058c872c // indirect gopkg.in/ini.v1 v1.41.0 - gopkg.in/yaml.v1 v1.0.0-20140924161607-9f9df34309c0 // indirect gopkg.in/yaml.v2 v2.2.2 // indirect ) + +go 1.13 diff --git a/go.sum b/go.sum index b0a56ab..5b8b88a 100644 --- a/go.sum +++ b/go.sum @@ -1,194 +1,198 @@ code.as/core/socks v1.0.0 h1:SPQXNp4SbEwjOAP9VzUahLHak8SDqy5n+9cm9tpjZOs= code.as/core/socks v1.0.0/go.mod h1:BAXBy5O9s2gmw6UxLqNJcVbWY7C/UPs+801CcSsfWOY= github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= github.com/alecthomas/gometalinter v2.0.11+incompatible/go.mod h1:qfIpQGGz3d+NmgyPBqv+LSh50emm1pt72EtcX2vKYQk= github.com/alecthomas/gometalinter v3.0.0+incompatible h1:e9Zfvfytsw/e6Kd/PYd75wggK+/kX5Xn8IYDUKyc5fU= github.com/alecthomas/gometalinter v3.0.0+incompatible/go.mod h1:qfIpQGGz3d+NmgyPBqv+LSh50emm1pt72EtcX2vKYQk= github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf h1:qet1QNfXsQxTZqLG4oE62mJzwPIB8+Tee4RNCL9ulrY= github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= github.com/beevik/etree v1.1.0 h1:T0xke/WvNtMoCqgzPhkX2r4rjY3GDZFi+FjpRZY2Jbs= github.com/beevik/etree v1.1.0/go.mod h1:r8Aw8JqVegEf0w2fDnATrX9VpkMcyFeM0FhwO62wh+A= github.com/captncraig/cors v0.0.0-20180620154129-376d45073b49 h1:jWNY1NDg6a/c8RSXkai7IX6UOhir0LD39I4Dukg+4Ks= github.com/captncraig/cors v0.0.0-20180620154129-376d45073b49/go.mod h1:EIlIeMufZ8nqdUhnesledB15xLRl4wIJUppwDLPrdrQ= github.com/chzyer/logex v1.1.10 h1:Swpa1K6QvQznwJRcfTfQJmTE72DqScAa40E+fbHEXEE= github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI= github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e h1:fY5BOSpyZCqRo5OhCuC+XN+r/bBCmeuuJtjz+bCNIf8= github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI= github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1 h1:q763qf9huN11kDQavWsoZXJNW3xEE4JJyHa5Q25/sd8= github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU= github.com/clbanning/mxj v1.8.3/go.mod h1:BVjHeAH+rl9rs6f+QIpeRl0tfu10SXn1pUSa5PVGJng= github.com/clbanning/mxj v1.8.4 h1:HuhwZtbyvyOw+3Z1AowPkU87JkJUSv751ELWaiTpj8I= github.com/clbanning/mxj v1.8.4/go.mod h1:BVjHeAH+rl9rs6f+QIpeRl0tfu10SXn1pUSa5PVGJng= github.com/client9/misspell v0.3.4 h1:ta993UF76GwbvJcIo3Y68y/M3WxlpEHPWIGDkJYwzJI= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/dustin/go-humanize v1.0.0 h1:VSnTsYCnlFHaM2/igO1h6X3HA71jcobQuxemgkq4zYo= github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= github.com/fatih/color v1.7.0 h1:DkWD4oS2D8LGGgTQ6IvwJJXSL5Vp2ffcQg58nFV38Ys= github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4= github.com/fatih/structs v1.1.0 h1:Q7juDM0QtcnhCpeyLGQKyg4TOIghuNXrkL32pHAUMxo= github.com/fatih/structs v1.1.0/go.mod h1:9NiDSp5zOcgEDl+j00MP/WkGVPOlPRLejGD8Ga6PJ7M= github.com/go-fed/httpsig v0.1.0/go.mod h1:T56HUNYZUQ1AGUzhAYPugZfp36sKApVnGBgKlIY+aIE= github.com/go-sql-driver/mysql v1.4.1 h1:g24URVg0OFbNUTx9qqY1IRZ9D9z3iPyi5zKhQZpNwpA= github.com/go-sql-driver/mysql v1.4.1/go.mod h1:zAC/RDZ24gD3HViQzih4MyKcchzm+sOG5ZlKdlhCg5w= github.com/go-test/deep v1.0.1 h1:UQhStjbkDClarlmv0am7OXXO4/GaPdCGiUiMTvi28sg= github.com/go-test/deep v1.0.1/go.mod h1:wGDj63lr65AM2AQyKZd/NYHGb0R+1RLqB8NKt3aSFNA= github.com/golang/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:tluoj9z5200jBnyusfRPU2LqT6J+DAorxEvtC7LHB+E= github.com/golang/lint v0.0.0-20181217174547-8f45f776aaf1 h1:6DVPu65tee05kY0/rciBQ47ue+AnuY8KTayV6VHikIo= github.com/golang/lint v0.0.0-20181217174547-8f45f776aaf1/go.mod h1:tluoj9z5200jBnyusfRPU2LqT6J+DAorxEvtC7LHB+E= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/google/shlex v0.0.0-20181106134648-c34317bd91bf h1:7+FW5aGwISbqUtkfmIpZJGRgNFg2ioYPvFaUxdqpDsg= github.com/google/shlex v0.0.0-20181106134648-c34317bd91bf/go.mod h1:RpwtwJQFrIEPstU94h88MWPXP2ektJZ8cZ0YntAmXiE= github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e h1:JKmoR8x90Iww1ks85zJ1lfDGgIiMDuIptTOhJq+zKyg= github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= github.com/gordonklaus/ineffassign v0.0.0-20180909121442-1003c8bd00dc h1:cJlkeAx1QYgO5N80aF5xRGstVsRQwgLR7uA2FnP1ZjY= github.com/gordonklaus/ineffassign v0.0.0-20180909121442-1003c8bd00dc/go.mod h1:cuNKsD1zp2v6XfE/orVX2QE1LC+i254ceGcVeDT3pTU= github.com/gorilla/context v1.1.1 h1:AWwleXJkX/nhcU9bZSnZoi3h/qGYqQAGhq6zZe/aQW8= github.com/gorilla/context v1.1.1/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg= github.com/gorilla/feeds v1.1.0 h1:pcgLJhbdYgaUESnj3AmXPcB7cS3vy63+jC/TI14AGXk= github.com/gorilla/feeds v1.1.0/go.mod h1:Nk0jZrvPFZX1OBe5NPiddPw7CfwF6Q9eqzaBbaightA= github.com/gorilla/mux v1.7.0 h1:tOSd0UKHQd6urX6ApfOn4XdBMY6Sh1MfxV3kmaazO+U= github.com/gorilla/mux v1.7.0/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gorilla/schema v1.0.2 h1:sAgNfOcNYvdDSrzGHVy9nzCQahG+qmsg+nE8dK85QRA= github.com/gorilla/schema v1.0.2/go.mod h1:kgLaKoK1FELgZqMAVxx/5cbj0kT+57qxUrAlIO2eleU= github.com/gorilla/securecookie v1.1.1 h1:miw7JPhV+b/lAHSXz4qd/nN9jRiAFV5FwjeKyCS8BvQ= github.com/gorilla/securecookie v1.1.1/go.mod h1:ra0sb63/xPlUeL+yeDciTfxMRAA+MP+HVt/4epWDjd4= github.com/gorilla/sessions v1.1.3 h1:uXoZdcdA5XdXF3QzuSlheVRUvjl+1rKY7zBXL68L9RU= github.com/gorilla/sessions v1.1.3/go.mod h1:8KCfur6+4Mqcc6S0FEfKuN15Vl5MgXW92AE8ovaJD0w= github.com/guregu/null v3.4.0+incompatible h1:a4mw37gBO7ypcBlTJeZGuMpSxxFTV9qFfFKgWxQSGaM= github.com/guregu/null v3.4.0+incompatible/go.mod h1:ePGpQaN9cw0tj45IR5E5ehMvsFlLlQZAkkOXZurJ3NM= github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o= github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= github.com/ikeikeikeike/go-sitemap-generator v1.0.1 h1:49Fn8gro/B12vCY8pf5/+/Jpr3kwB9TvP0MSymo69SY= github.com/ikeikeikeike/go-sitemap-generator v1.0.1/go.mod h1:QI+zWsz6yQyxkG9LWNcnu0f7aiAE5tPdsZOsICgmd1c= github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2 h1:wIdDEle9HEy7vBPjC6oKz6ejs3Ut+jmsYvuOoAW2pSM= github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2/go.mod h1:WtaVKD9TeruTED9ydiaOJU08qGoEPP/LyzTKiD3jEsw= github.com/jtolds/gls v4.2.1+incompatible h1:fSuqC+Gmlu6l/ZYAoZzx2pyucC8Xza35fpRVWLVmUEE= github.com/jtolds/gls v4.2.1+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU= github.com/juju/ansiterm v0.0.0-20180109212912-720a0952cc2a h1:FaWFmfWdAUKbSCtOU2QjDaorUexogfaMgbipgYATUMU= github.com/juju/ansiterm v0.0.0-20180109212912-720a0952cc2a/go.mod h1:UJSiEoRfvx3hP73CvoARgeLjaIOjybY9vj8PUPPFGeU= github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI= github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE= github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec h1:ZXWuspqypleMuJy4bzYEqlMhJnGAYpLrWe5p7W3CdvI= github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec/go.mod h1:voECJzdraJmolzPBgL9Z7ANwXf4oMXaTCsIkdiPpR/g= github.com/lunixbochs/vtclean v0.0.0-20180621232353-2d01aacdc34a h1:weJVJJRzAJBFRlAiJQROKQs8oC9vOxvm4rZmBBk0ONw= github.com/lunixbochs/vtclean v0.0.0-20180621232353-2d01aacdc34a/go.mod h1:pHhQNgMf3btfWnGBVipUOjRYhoOsdGqdm/+2c2E2WMI= github.com/lunixbochs/vtclean v1.0.0 h1:xu2sLAri4lGiovBDQKxl5mrXyESr3gUr5m5SM5+LVb8= github.com/lunixbochs/vtclean v1.0.0/go.mod h1:pHhQNgMf3btfWnGBVipUOjRYhoOsdGqdm/+2c2E2WMI= github.com/manifoldco/promptui v0.3.2 h1:rir7oByTERac6jhpHUPErHuopoRDvO3jxS+FdadEns8= github.com/manifoldco/promptui v0.3.2/go.mod h1:8JU+igZ+eeiiRku4T5BjtKh2ms8sziGpSYl1gN8Bazw= github.com/mattn/go-colorable v0.0.9 h1:UVL0vNpWh04HeJXV0KLcaT7r06gOH2l4OW6ddYRUIY4= github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= github.com/mattn/go-colorable v0.1.0 h1:v2XXALHHh6zHfYTJ+cSkwtyffnaOyR1MXaA91mTrb8o= github.com/mattn/go-colorable v0.1.0/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= github.com/mattn/go-isatty v0.0.4 h1:bnP0vzxcAdeI1zdubAl5PjU6zsERjGZb7raWodagDYs= github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= github.com/mattn/go-sqlite3 v1.10.0 h1:jbhqpg7tQe4SupckyijYiy0mJJ/pRyHvXf7JdWK860o= github.com/mattn/go-sqlite3 v1.10.0/go.mod h1:FPy6KqzDD04eiIsT53CuJW3U88zkxoIYsOqkbpncsNc= github.com/microcosm-cc/bluemonday v1.0.2 h1:5lPfLTTAvAbtS0VqT+94yOtFnGfUWYyx0+iToC3Os3s= github.com/microcosm-cc/bluemonday v1.0.2/go.mod h1:iVP4YcDBq+n/5fb23BhYFvIMq/leAFZyRl6bYmGDlGc= github.com/mitchellh/go-wordwrap v1.0.0 h1:6GlHJ/LTGMrIJbwgdqdl2eEH8o+Exx/0m8ir9Gns0u4= github.com/mitchellh/go-wordwrap v1.0.0/go.mod h1:ZXFpozHsX6DPmq2I0TCekCxypsnAUbP2oI0UX1GXzOo= github.com/nicksnyder/go-i18n v1.10.0 h1:5AzlPKvXBH4qBzmZ09Ua9Gipyruv6uApMcrNZdo96+Q= github.com/nicksnyder/go-i18n v1.10.0/go.mod h1:HrK7VCrbOvQoUAQ7Vpy7i87N7JZZZ7R2xBGjv0j365Q= github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ= github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U= github.com/pelletier/go-toml v1.2.0 h1:T5zMGML61Wp+FlcbWjRDT7yAxhJNAiPPLOFECq181zc= github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/94hg7ilaic= github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be h1:ta7tUOvsPHVHGom5hKW5VXNc2xZIkfCKP8iaqOyYtUQ= github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be/go.mod h1:MIDFMn7db1kT65GmV94GzpX9Qdi7N/pQlwb+AN8wh+Q= github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo= github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304 h1:Jpy1PXuP99tXNrhbq2BaPz9B+jNAvH1JPQQpG/9GCXY= github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc= github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c h1:Ho+uVpkel/udgjbwB5Lktg9BtvJSh2DT0Hi6LPSyI2w= github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c/go.mod h1:XDJAKZRPZ1CvBcN2aX5YOUTYGHki24fSF0Iv48Ibg0s= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q= github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= github.com/tsenart/deadcode v0.0.0-20160724212837-210d2dc333e9 h1:vY5WqiEon0ZSTGM3ayVVi+twaHKHDFUVloaQ/wug9/c= github.com/tsenart/deadcode v0.0.0-20160724212837-210d2dc333e9/go.mod h1:q+QjxYvZ+fpjMXqs+XEriussHjSYqeXVnAdSV1tkMYk= github.com/writeas/activity v0.1.2 h1:Y12B5lIrabfqKE7e7HFCWiXrlfXljr9tlkFm2mp7DgY= github.com/writeas/activity v0.1.2/go.mod h1:mYYgiewmEM+8tlifirK/vl6tmB2EbjYaxwb+ndUw5T0= github.com/writeas/go-strip-markdown v2.0.1+incompatible h1:IIqxTM5Jr7RzhigcL6FkrCNfXkvbR+Nbu1ls48pXYcw= github.com/writeas/go-strip-markdown v2.0.1+incompatible/go.mod h1:Rsyu10ZhbEK9pXdk8V6MVnZmTzRG0alMNLMwa0J01fE= github.com/writeas/go-webfinger v0.0.0-20190106002315-85cf805c86d2 h1:DUsp4OhdfI+e6iUqcPQlwx8QYXuUDsToTz/x82D3Zuo= github.com/writeas/go-webfinger v0.0.0-20190106002315-85cf805c86d2/go.mod h1:w2VxyRO/J5vfNjJHYVubsjUGHd3RLDoVciz0DE3ApOc= github.com/writeas/go-writeas v1.1.0 h1:WHGm6wriBkxYAOGbvriXH8DlMUGOi6jhSZLUZKQ+4mQ= github.com/writeas/go-writeas v1.1.0/go.mod h1:oh9U1rWaiE0p3kzdKwwvOpNXgp0P0IELI7OLOwV4fkA= github.com/writeas/go-writeas/v2 v2.0.2 h1:akvdMg89U5oBJiCkBwOXljVLTqP354uN6qnG2oOMrbk= github.com/writeas/go-writeas/v2 v2.0.2/go.mod h1:9sjczQJKmru925fLzg0usrU1R1tE4vBmQtGnItUMR0M= github.com/writeas/httpsig v1.0.0 h1:peIAoIA3DmlP8IG8tMNZqI4YD1uEnWBmkcC9OFPjt3A= github.com/writeas/httpsig v1.0.0/go.mod h1:7ClMGSrSVXJbmiLa17bZ1LrG1oibGZmUMlh3402flPY= github.com/writeas/impart v1.1.0 h1:nPnoO211VscNkp/gnzir5UwCDEvdHThL5uELU60NFSE= github.com/writeas/impart v1.1.0/go.mod h1:g0MpxdnTOHHrl+Ca/2oMXUHJ0PcRAEWtkCzYCJUXC9Y= +github.com/writeas/impart v1.1.1-0.20191230230525-d3c45ced010d h1:PK7DOj3JE6MGf647esPrKzXEHFjGWX2hl22uX79ixaE= +github.com/writeas/impart v1.1.1-0.20191230230525-d3c45ced010d/go.mod h1:g0MpxdnTOHHrl+Ca/2oMXUHJ0PcRAEWtkCzYCJUXC9Y= github.com/writeas/import v0.0.0-20190815214647-baae8acd8d06 h1:S6oKKP8GhSoyZUvVuhO9UiQ9f+U1aR/x5B4MP7YQHaU= github.com/writeas/import v0.0.0-20190815214647-baae8acd8d06/go.mod h1:f3K8z7YnJwKnPIT4h7980n9C6cQb4DIB2QcxVCTB7lE= github.com/writeas/import v0.0.0-20190815235139-628d10daaa9e h1:31PkvDTWkjzC1nGzWw9uAE92ZfcVyFX/K9L9ejQjnEs= github.com/writeas/import v0.0.0-20190815235139-628d10daaa9e/go.mod h1:f3K8z7YnJwKnPIT4h7980n9C6cQb4DIB2QcxVCTB7lE= github.com/writeas/import v0.1.1 h1:SbYltT+nxrJBUe0xQWJqeKMHaupbxV0a6K3RtwcE4yY= github.com/writeas/import v0.1.1/go.mod h1:gFe0Pl7ZWYiXbI0TJxeMMyylPGZmhVvCfQxhMEc8CxM= github.com/writeas/import v0.2.0 h1:Ov23JW9Rnjxk06rki1Spar45bNX647HhwhAZj3flJiY= github.com/writeas/import v0.2.0/go.mod h1:gFe0Pl7ZWYiXbI0TJxeMMyylPGZmhVvCfQxhMEc8CxM= github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219 h1:baEp0631C8sT2r/hqwypIw2snCFZa6h7U6TojoLHu/c= github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219/go.mod h1:NyM35ayknT7lzO6O/1JpfgGyv+0W9Z9q7aE0J8bXxfQ= github.com/writeas/nerds v1.0.0 h1:ZzRcCN+Sr3MWID7o/x1cr1ZbLvdpej9Y1/Ho+JKlqxo= github.com/writeas/nerds v1.0.0/go.mod h1:Gn2bHy1EwRcpXeB7ZhVmuUwiweK0e+JllNf66gvNLdU= github.com/writeas/openssl-go v1.0.0 h1:YXM1tDXeYOlTyJjoMlYLQH1xOloUimSR1WMF8kjFc5o= github.com/writeas/openssl-go v1.0.0/go.mod h1:WsKeK5jYl0B5y8ggOmtVjbmb+3rEGqSD25TppjJnETA= +github.com/writeas/saturday v1.6.0/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ= github.com/writeas/saturday v1.7.1 h1:lYo1EH6CYyrFObQoA9RNWHVlpZA5iYL5Opxo7PYAnZE= github.com/writeas/saturday v1.7.1/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ= github.com/writeas/slug v1.2.0 h1:EMQ+cwLiOcA6EtFwUgyw3Ge18x9uflUnOnR6bp/J+/g= github.com/writeas/slug v1.2.0/go.mod h1:RE8shOqQP3YhsfsQe0L3RnuejfQ4Mk+JjY5YJQFubfQ= github.com/writeas/web-core v1.0.0 h1:5VKkCakQgdKZcbfVKJXtRpc5VHrkflusCl/KRCPzpQ0= github.com/writeas/web-core v1.0.0/go.mod h1:Si3chV7VWgY8CsV+3gRolMXSO2Vx1ZFAQ/mkrpvmyEE= github.com/writeas/web-core v1.2.0 h1:CYqvBd+byi1cK4mCr1NZ6CjILuMOFmiFecv+OACcmG0= github.com/writeas/web-core v1.2.0/go.mod h1:vTYajviuNBAxjctPp2NUYdgjofywVkxUGpeaERF3SfI= github.com/writefreely/go-nodeinfo v1.2.0 h1:La+YbTCvmpTwFhBSlebWDDL81N88Qf/SCAvRLR7F8ss= github.com/writefreely/go-nodeinfo v1.2.0/go.mod h1:UTvE78KpcjYOlRHupZIiSEFcXHioTXuacCbHU+CAcPg= golang.org/x/crypto v0.0.0-20180527072434-ab813273cd59 h1:hk3yo72LXLapY9EXVttc3Z1rLOxT9IuAPPX3GpY2+jo= golang.org/x/crypto v0.0.0-20180527072434-ab813273cd59/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20190131182504-b8fe1690c613/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190208162236-193df9c0f06f h1:ETU2VEl7TnT5bl7IvuKEzTDpplg5wzGYsOCAPhdoEIg= golang.org/x/crypto v0.0.0-20190208162236-193df9c0f06f/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= golang.org/x/lint v0.0.0-20181217174547-8f45f776aaf1 h1:rJm0LuqUjoDhSk2zO9ISMSToQxGz7Os2jRiOL8AWu4c= golang.org/x/lint v0.0.0-20181217174547-8f45f776aaf1/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20181220203305-927f97764cc3 h1:eH6Eip3UpmR+yM/qI9Ijluzb1bNv/cAU/n+6l8tRSis= golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190206173232-65e2d4e15006 h1:bfLnR+k0tq5Lqt6dflRLcZiz6UaXCMt3vhYJ1l4FQ80= golang.org/x/net v0.0.0-20190206173232-65e2d4e15006/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/sys v0.0.0-20180525142821-c11f84a56e43/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181122145206-62eef0e2fa9b/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190209173611-3b5209105503 h1:5SvYFrOM3W8Mexn9/oA44Ji7vhXAZQ9hiP+1Q/DMrWg= golang.org/x/sys v0.0.0-20190209173611-3b5209105503/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/tools v0.0.0-20181122213734-04b5d21e00f1/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190208222737-3744606dbb67 h1:bPP/rGuN1LUM0eaEwo6vnP6OfIWJzJBulzGUiKLjjSY= golang.org/x/tools v0.0.0-20190208222737-3744606dbb67/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= google.golang.org/appengine v1.4.0 h1:/wp5JvzpHIxhs/dumFmF7BXTf3Z+dd4uXta4kVyO508= google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= gopkg.in/alecthomas/kingpin.v3-unstable v3.0.0-20180810215634-df19058c872c h1:vTxShRUnK60yd8DZU+f95p1zSLj814+5CuEh7NjF2/Y= gopkg.in/alecthomas/kingpin.v3-unstable v3.0.0-20180810215634-df19058c872c/go.mod h1:3HH7i1SgMqlzxCcBmUHW657sD4Kvv9sC3HpL3YukzwA= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/ini.v1 v1.41.0 h1:Ka3ViY6gNYSKiVy71zXBEqKplnV35ImDLVG+8uoIklE= gopkg.in/ini.v1 v1.41.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= gopkg.in/yaml.v1 v1.0.0-20140924161607-9f9df34309c0 h1:POO/ycCATvegFmVuPpQzZFJ+pGZeX22Ufu6fibxDVjU= gopkg.in/yaml.v1 v1.0.0-20140924161607-9f9df34309c0/go.mod h1:WDnlLJ4WF5VGsH/HVa3CI79GS0ol3YnhVnKP89i0kNg= gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw= gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= diff --git a/handle.go b/handle.go index 7e410f5..0fcc483 100644 --- a/handle.go +++ b/handle.go @@ -1,848 +1,898 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "fmt" "html/template" "net/http" "net/url" "runtime/debug" "strconv" "strings" "time" "github.com/gorilla/sessions" "github.com/writeas/impart" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" ) // UserLevel represents the required user level for accessing an endpoint type UserLevel int const ( UserLevelNoneType UserLevel = iota // user or not -- ignored UserLevelOptionalType // user or not -- object fetched if user UserLevelNoneRequiredType // non-user (required) UserLevelUserType // user (required) ) func UserLevelNone(cfg *config.Config) UserLevel { return UserLevelNoneType } func UserLevelOptional(cfg *config.Config) UserLevel { return UserLevelOptionalType } func UserLevelNoneRequired(cfg *config.Config) UserLevel { return UserLevelNoneRequiredType } func UserLevelUser(cfg *config.Config) UserLevel { return UserLevelUserType } // UserLevelReader returns the permission level required for any route where // users can read published content. func UserLevelReader(cfg *config.Config) UserLevel { if cfg.App.Private { return UserLevelUserType } return UserLevelOptionalType } type ( handlerFunc func(app *App, w http.ResponseWriter, r *http.Request) error userHandlerFunc func(app *App, u *User, w http.ResponseWriter, r *http.Request) error userApperHandlerFunc func(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error dataHandlerFunc func(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) authFunc func(app *App, r *http.Request) (*User, error) UserLevelFunc func(cfg *config.Config) UserLevel ) type Handler struct { errors *ErrorPages - sessionStore *sessions.CookieStore + sessionStore sessions.Store app Apper } // ErrorPages hold template HTML error pages for displaying errors to the user. // In each, there should be a defined template named "base". type ErrorPages struct { NotFound *template.Template Gone *template.Template InternalServerError *template.Template Blank *template.Template } // NewHandler returns a new Handler instance, using the given StaticPage data, // and saving alias to the application's CookieStore. func NewHandler(apper Apper) *Handler { h := &Handler{ errors: &ErrorPages{ NotFound: template.Must(template.New("").Parse("{{define \"base\"}}
Not found.
{{end}}")), Gone: template.Must(template.New("").Parse("{{define \"base\"}}Gone.
{{end}}")), InternalServerError: template.Must(template.New("").Parse("{{define \"base\"}}Internal server error.
{{end}}")), Blank: template.Must(template.New("").Parse("{{define \"base\"}}{{.Content}}
{{end}}")), }, - sessionStore: apper.App().sessionStore, + sessionStore: apper.App().SessionStore(), app: apper, } return h } // NewWFHandler returns a new Handler instance, using WriteFreely template files. // You MUST call writefreely.InitTemplates() before this. func NewWFHandler(apper Apper) *Handler { h := NewHandler(apper) h.SetErrorPages(&ErrorPages{ NotFound: pages["404-general.tmpl"], Gone: pages["410.tmpl"], InternalServerError: pages["500.tmpl"], Blank: pages["blank.tmpl"], }) return h } // SetErrorPages sets the given set of ErrorPages as templates for any errors // that come up. func (h *Handler) SetErrorPages(e *ErrorPages) { h.errors = e } // User handles requests made in the web application by the authenticated user. // This provides user-friendly HTML pages and actions that work in the browser. func (h *Handler) User(f userHandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = http.StatusInternalServerError } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u := getUserSession(h.app.App(), r) if u == nil { err := ErrNotLoggedIn status = err.Status return err } err := f(h.app.App(), u, w, r) if err == nil { status = http.StatusOK } else if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = http.StatusInternalServerError } return err }()) } } // Admin handles requests on /admin routes func (h *Handler) Admin(f userHandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = http.StatusInternalServerError } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u := getUserSession(h.app.App(), r) if u == nil || !u.IsAdmin() { err := impart.HTTPError{http.StatusNotFound, ""} status = err.Status return err } err := f(h.app.App(), u, w, r) if err == nil { status = http.StatusOK } else if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = http.StatusInternalServerError } return err }()) } } // AdminApper handles requests on /admin routes that require an Apper. func (h *Handler) AdminApper(f userApperHandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = http.StatusInternalServerError } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u := getUserSession(h.app.App(), r) if u == nil || !u.IsAdmin() { err := impart.HTTPError{http.StatusNotFound, ""} status = err.Status return err } err := f(h.app, u, w, r) if err == nil { status = http.StatusOK } else if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = http.StatusInternalServerError } return err }()) } } func apiAuth(app *App, r *http.Request) (*User, error) { // Authorize user from Authorization header t := r.Header.Get("Authorization") if t == "" { return nil, ErrNoAccessToken } u := &User{ID: app.db.GetUserID(t)} if u.ID == -1 { return nil, ErrBadAccessToken } return u, nil } // optionaAPIAuth is used for endpoints that accept authenticated requests via // Authorization header or cookie, unlike apiAuth. It returns a different err // in the case where no Authorization header is present. func optionalAPIAuth(app *App, r *http.Request) (*User, error) { // Authorize user from Authorization header t := r.Header.Get("Authorization") if t == "" { return nil, ErrNotLoggedIn } u := &User{ID: app.db.GetUserID(t)} if u.ID == -1 { return nil, ErrBadAccessToken } return u, nil } func webAuth(app *App, r *http.Request) (*User, error) { u := getUserSession(app, r) if u == nil { return nil, ErrNotLoggedIn } return u, nil } // UserAPI handles requests made in the API by the authenticated user. // This provides user-friendly HTML pages and actions that work in the browser. func (h *Handler) UserAPI(f userHandlerFunc) http.HandlerFunc { return h.UserAll(false, f, apiAuth) } func (h *Handler) UserAll(web bool, f userHandlerFunc, a authFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { handleFunc := func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u, err := a(h.app.App(), r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } err = f(h.app.App(), u, w, r) if err == nil { status = 200 } else if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } if web { h.handleHTTPError(w, r, handleFunc()) } else { h.handleError(w, r, handleFunc()) } } } func (h *Handler) RedirectOnErr(f handlerFunc, loc string) handlerFunc { return func(app *App, w http.ResponseWriter, r *http.Request) error { err := f(app, w, r) if err != nil { if ie, ok := err.(impart.HTTPError); ok { // Override default redirect with returned error's, if it's a // redirect error. if ie.Status == http.StatusFound { return ie } } return impart.HTTPError{http.StatusFound, loc} } return nil } } func (h *Handler) Page(n string) http.HandlerFunc { return h.Web(func(app *App, w http.ResponseWriter, r *http.Request) error { t, ok := pages[n] if !ok { return impart.HTTPError{http.StatusNotFound, "Page not found."} } sp := pageForReq(app, r) err := t.ExecuteTemplate(w, "base", sp) if err != nil { log.Error("Unable to render page: %v", err) } return err }, UserLevelOptional) } func (h *Handler) WebErrors(f handlerFunc, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { // TODO: factor out this logic shared with Web() h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { u := getUserSession(h.app.App(), r) username := "None" if u != nil { username = u.Username } log.Error("User: %s\n\n%s: %s", username, e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() var session *sessions.Session var err error if ul(h.app.App().cfg) != UserLevelNoneType { session, err = h.sessionStore.Get(r, cookieName) if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) { // Cookie is required, but we can ignore this error log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err) } _, gotUser := session.Values[cookieUserVal].(*User) if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser { to := correctPageFromLoginAttempt(r) log.Info("Handler: Required NO user, but got one. Redirecting to %s", to) err := impart.HTTPError{http.StatusFound, to} status = err.Status return err } else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser { log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.") err := ErrNotLoggedIn status = err.Status return err } } // TODO: pass User object to function err = f(h.app.App(), w, r) if err == nil { status = 200 } else if httpErr, ok := err.(impart.HTTPError); ok { status = httpErr.Status if status < 300 || status > 399 { addSessionFlash(h.app.App(), w, r, httpErr.Message, session) return impart.HTTPError{http.StatusFound, r.Referer()} } } else { e := fmt.Sprintf("[Web handler] 500: %v", err) if !strings.HasSuffix(e, "write: broken pipe") { log.Error(e) } else { log.Error(e) } log.Info("Web handler internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } return err }()) } } func (h *Handler) CollectionPostOrStatic(w http.ResponseWriter, r *http.Request) { if strings.Contains(r.URL.Path, ".") && !isRaw(r) { start := time.Now() status := 200 defer func() { log.Info(h.app.ReqLog(r, status, time.Since(start))) }() // Serve static file h.app.App().shttp.ServeHTTP(w, r) return } h.Web(viewCollectionPost, UserLevelReader)(w, r) } // Web handles requests made in the web application. This provides user- // friendly HTML pages and actions that work in the browser. func (h *Handler) Web(f handlerFunc, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { u := getUserSession(h.app.App(), r) username := "None" if u != nil { username = u.Username } log.Error("User: %s\n\n%s: %s", username, e, debug.Stack()) log.Info("Web deferred internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() if ul(h.app.App().cfg) != UserLevelNoneType { session, err := h.sessionStore.Get(r, cookieName) if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) { // Cookie is required, but we can ignore this error log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err) } _, gotUser := session.Values[cookieUserVal].(*User) if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser { to := correctPageFromLoginAttempt(r) log.Info("Handler: Required NO user, but got one. Redirecting to %s", to) err := impart.HTTPError{http.StatusFound, to} status = err.Status return err } else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser { log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.") err := ErrNotLoggedIn status = err.Status return err } } // TODO: pass User object to function err := f(h.app.App(), w, r) if err == nil { status = 200 } else if httpErr, ok := err.(impart.HTTPError); ok { status = httpErr.Status } else { e := fmt.Sprintf("[Web handler] 500: %v", err) log.Error(e) log.Info("Web internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } return err }()) } } func (h *Handler) All(f handlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleError(w, r, func() error { // TODO: return correct "success" status status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s:\n%s", e, debug.Stack()) impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() // TODO: do any needed authentication err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } } return err }()) } } +func (h *Handler) OAuth(f handlerFunc) http.HandlerFunc { + return func(w http.ResponseWriter, r *http.Request) { + h.handleOAuthError(w, r, func() error { + // TODO: return correct "success" status + status := 200 + start := time.Now() + + defer func() { + if e := recover(); e != nil { + log.Error("%s:\n%s", e, debug.Stack()) + impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) + status = 500 + } + + log.Info(h.app.ReqLog(r, status, time.Since(start))) + }() + + err := f(h.app.App(), w, r) + if err != nil { + if err, ok := err.(impart.HTTPError); ok { + status = err.Status + } else { + status = 500 + } + } + + return err + }()) + } +} + func (h *Handler) AllReader(f handlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleError(w, r, func() error { status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s:\n%s", e, debug.Stack()) impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() if h.app.App().cfg.App.Private { // This instance is private, so ensure it's being accessed by a valid user // Check if authenticated with an access token _, apiErr := optionalAPIAuth(h.app.App(), r) if apiErr != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } if apiErr == ErrNotLoggedIn { // Fall back to web auth since there was no access token given _, err := webAuth(h.app.App(), r) if err != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } } else { return apiErr } } } err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } } return err }()) } } func (h *Handler) Download(f dataHandlerFunc, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() data, filename, err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } ext := ".json" ct := "application/json" if strings.HasSuffix(r.URL.Path, ".csv") { ext = ".csv" ct = "text/csv" } else if strings.HasSuffix(r.URL.Path, ".zip") { ext = ".zip" ct = "application/zip" } w.Header().Set("Content-Disposition", fmt.Sprintf("attachment; filename=%s%s", filename, ext)) w.Header().Set("Content-Type", ct) w.Header().Set("Content-Length", strconv.Itoa(len(data))) fmt.Fprint(w, string(data)) status = 200 return nil }()) } } func (h *Handler) Redirect(url string, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { start := time.Now() var status int if ul(h.app.App().cfg) != UserLevelNoneType { session, err := h.sessionStore.Get(r, cookieName) if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) { // Cookie is required, but we can ignore this error log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err) } _, gotUser := session.Values[cookieUserVal].(*User) if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser { to := correctPageFromLoginAttempt(r) log.Info("Handler: Required NO user, but got one. Redirecting to %s", to) err := impart.HTTPError{http.StatusFound, to} status = err.Status return err } else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser { log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.") err := ErrNotLoggedIn status = err.Status return err } } status = sendRedirect(w, http.StatusFound, url) log.Info(h.app.ReqLog(r, status, time.Since(start))) return nil }()) } } func (h *Handler) handleHTTPError(w http.ResponseWriter, r *http.Request, err error) { if err == nil { return } if err, ok := err.(impart.HTTPError); ok { if err.Status >= 300 && err.Status < 400 { sendRedirect(w, err.Status, err.Message) return } else if err.Status == http.StatusUnauthorized { q := "" if r.URL.RawQuery != "" { q = url.QueryEscape("?" + r.URL.RawQuery) } sendRedirect(w, http.StatusFound, "/login?to="+r.URL.Path+q) return } else if err.Status == http.StatusGone { w.WriteHeader(err.Status) p := &struct { page.StaticPage Content *template.HTML }{ StaticPage: pageForReq(h.app.App(), r), } if err.Message != "" { co := template.HTML(err.Message) p.Content = &co } h.errors.Gone.ExecuteTemplate(w, "base", p) return } else if err.Status == http.StatusNotFound { w.WriteHeader(err.Status) if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { // This is a fediverse request; simply return the header return } h.errors.NotFound.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) return } else if err.Status == http.StatusInternalServerError { w.WriteHeader(err.Status) log.Info("handleHTTPErorr internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) return } else if err.Status == http.StatusAccepted { impart.WriteSuccess(w, "", err.Status) return } else { p := &struct { page.StaticPage Title string Content template.HTML }{ pageForReq(h.app.App(), r), fmt.Sprintf("Uh oh (%d)", err.Status), template.HTML(fmt.Sprintf("%s
", err.Message)), } h.errors.Blank.ExecuteTemplate(w, "base", p) return } impart.WriteError(w, err) return } impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."}) } func (h *Handler) handleError(w http.ResponseWriter, r *http.Request, err error) { if err == nil { return } if err, ok := err.(impart.HTTPError); ok { if err.Status >= 300 && err.Status < 400 { sendRedirect(w, err.Status, err.Message) return } // if strings.Contains(r.Header.Get("Accept"), "text/html") { impart.WriteError(w, err) // } return } if IsJSON(r) { impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."}) return } h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) } +func (h *Handler) handleOAuthError(w http.ResponseWriter, r *http.Request, err error) { + if err == nil { + return + } + + if err, ok := err.(impart.HTTPError); ok { + if err.Status >= 300 && err.Status < 400 { + sendRedirect(w, err.Status, err.Message) + return + } + + impart.WriteOAuthError(w, err) + return + } + + impart.WriteOAuthError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."}) + return +} + func correctPageFromLoginAttempt(r *http.Request) string { to := r.FormValue("to") if to == "" { to = "/" } else if !strings.HasPrefix(to, "/") { to = "/" + to } return to } func (h *Handler) LogHandlerFunc(f http.HandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("Handler.LogHandlerFunc\n\n%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } // TODO: log actual status code returned log.Info(h.app.ReqLog(r, status, time.Since(start))) }() if h.app.App().cfg.App.Private { // This instance is private, so ensure it's being accessed by a valid user // Check if authenticated with an access token _, apiErr := optionalAPIAuth(h.app.App(), r) if apiErr != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } if apiErr == ErrNotLoggedIn { // Fall back to web auth since there was no access token given _, err := webAuth(h.app.App(), r) if err != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } } else { return apiErr } } } f(w, r) return nil }()) } } func sendRedirect(w http.ResponseWriter, code int, location string) int { w.Header().Set("Location", location) w.WriteHeader(code) return code } diff --git a/main_test.go b/main_test.go new file mode 100644 index 0000000..d600d83 --- /dev/null +++ b/main_test.go @@ -0,0 +1,153 @@ +package writefreely + +import ( + "context" + "database/sql" + "encoding/gob" + "errors" + "fmt" + uuid "github.com/nu7hatch/gouuid" + "github.com/stretchr/testify/assert" + "math/rand" + "os" + "strings" + "testing" + "time" +) + +var testDB *sql.DB + +type ScopedTestBody func(*sql.DB) + +// TestMain provides testing infrastructure within this package. +func TestMain(m *testing.M) { + rand.Seed(time.Now().UTC().UnixNano()) + gob.Register(&User{}) + + if runMySQLTests() { + var err error + + testDB, err = initMySQL(os.Getenv("WF_USER"), os.Getenv("WF_PASSWORD"), os.Getenv("WF_DB"), os.Getenv("WF_HOST")) + if err != nil { + fmt.Println(err) + return + } + } + + code := m.Run() + if runMySQLTests() { + if closeErr := testDB.Close(); closeErr != nil { + fmt.Println(closeErr) + } + } + os.Exit(code) +} + +func runMySQLTests() bool { + return len(os.Getenv("TEST_MYSQL")) > 0 +} + +func initMySQL(dbUser, dbPassword, dbName, dbHost string) (*sql.DB, error) { + if dbUser == "" || dbPassword == "" { + return nil, errors.New("database user or password not set") + } + if dbHost == "" { + dbHost = "localhost" + } + if dbName == "" { + dbName = "writefreely" + } + + dsn := fmt.Sprintf("%s:%s@tcp(%s:3306)/%s?charset=utf8mb4&parseTime=true", dbUser, dbPassword, dbHost, dbName) + db, err := sql.Open("mysql", dsn) + if err != nil { + return nil, err + } + if err := ensureMySQL(db); err != nil { + return nil, err + } + return db, nil +} + +func ensureMySQL(db *sql.DB) error { + if err := db.Ping(); err != nil { + return err + } + db.SetMaxOpenConns(250) + return nil +} + +// withTestDB provides a scoped database connection. +func withTestDB(t *testing.T, testBody ScopedTestBody) { + db, cleanup, err := newTestDatabase(testDB, + os.Getenv("WF_USER"), + os.Getenv("WF_PASSWORD"), + os.Getenv("WF_DB"), + os.Getenv("WF_HOST"), + ) + assert.NoError(t, err) + defer func() { + assert.NoError(t, cleanup()) + }() + + testBody(db) +} + +// newTestDatabase creates a new temporary test database. When a test +// database connection is returned, it will have created a new database and +// initialized it with tables from a reference database. +func newTestDatabase(base *sql.DB, dbUser, dbPassword, dbName, dbHost string) (*sql.DB, func() error, error) { + var err error + var baseName = dbName + + if baseName == "" { + row := base.QueryRow("SELECT DATABASE()") + err := row.Scan(&baseName) + if err != nil { + return nil, nil, err + } + } + tUUID, _ := uuid.NewV4() + suffix := strings.Replace(tUUID.String(), "-", "_", -1) + newDBName := baseName + suffix + _, err = base.Exec("CREATE DATABASE " + newDBName) + if err != nil { + return nil, nil, err + } + newDB, err := initMySQL(dbUser, dbPassword, newDBName, dbHost) + if err != nil { + return nil, nil, err + } + + rows, err := base.Query("SHOW TABLES IN " + baseName) + if err != nil { + return nil, nil, err + } + for rows.Next() { + var tableName string + if err := rows.Scan(&tableName); err != nil { + return nil, nil, err + } + query := fmt.Sprintf("CREATE TABLE %s LIKE %s.%s", tableName, baseName, tableName) + if _, err := newDB.Exec(query); err != nil { + return nil, nil, err + } + } + + cleanup := func() error { + if closeErr := newDB.Close(); closeErr != nil { + fmt.Println(closeErr) + } + + _, err = base.Exec("DROP DATABASE " + newDBName) + return err + } + return newDB, cleanup, nil +} + +func countRows(t *testing.T, ctx context.Context, db *sql.DB, count int, query string, args ...interface{}) { + var returned int + err := db.QueryRowContext(ctx, query, args...).Scan(&returned) + assert.NoError(t, err, "error executing query %s and args %s", query, args) + assert.Equal(t, count, returned, "unexpected return count %d, expected %d from %s and args %s", returned, count, query, args) +} \ No newline at end of file diff --git a/migrations/migrations.go b/migrations/migrations.go index 0799f8e..917d912 100644 --- a/migrations/migrations.go +++ b/migrations/migrations.go @@ -1,135 +1,137 @@ /* * Copyright © 2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // Package migrations contains database migrations for WriteFreely package migrations import ( "database/sql" "github.com/writeas/web-core/log" ) // TODO: refactor to use the datastore struct from writefreely pkg type datastore struct { *sql.DB driverName string } func NewDatastore(db *sql.DB, dn string) *datastore { return &datastore{db, dn} } // TODO: use these consts from writefreely pkg const ( driverMySQL = "mysql" driverSQLite = "sqlite3" ) type Migration interface { Description() string Migrate(db *datastore) error } type migration struct { description string migrate func(db *datastore) error } func New(d string, fn func(db *datastore) error) Migration { return &migration{d, fn} } func (m *migration) Description() string { return m.description } func (m *migration) Migrate(db *datastore) error { return m.migrate(db) } var migrations = []Migration{ New("support user invites", supportUserInvites), // -> V1 (v0.8.0) New("support dynamic instance pages", supportInstancePages), // V1 -> V2 (v0.9.0) New("support users suspension", supportUserStatus), // V2 -> V3 (v0.11.0) + New("support oauth", oauth), // V3 -> V4 + New("support slack oauth", oauthSlack), // V4 -> v5 } // CurrentVer returns the current migration version the application is on func CurrentVer() int { return len(migrations) } func SetInitialMigrations(db *datastore) error { // Included schema files represent changes up to V1, so note that in the database _, err := db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", 1, "") if err != nil { return err } return nil } func Migrate(db *datastore) error { var version int var err error if db.tableExists("appmigrations") { err = db.QueryRow("SELECT MAX(version) FROM appmigrations").Scan(&version) } else { log.Info("Initializing appmigrations table...") version = 0 _, err = db.Exec(`CREATE TABLE appmigrations ( version ` + db.typeInt() + ` NOT NULL, migrated ` + db.typeDateTime() + ` NOT NULL, result ` + db.typeText() + ` NOT NULL ) ` + db.engine() + `;`) if err != nil { return err } } if len(migrations[version:]) > 0 { for i, m := range migrations[version:] { curVer := version + i + 1 log.Info("Migrating to V%d: %s", curVer, m.Description()) err = m.Migrate(db) if err != nil { return err } // Update migrations table _, err = db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", curVer, "") if err != nil { return err } } } else { log.Info("Database up-to-date. No migrations to run.") } return nil } func (db *datastore) tableExists(t string) bool { var dummy string var err error if db.driverName == driverSQLite { err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = ?", t).Scan(&dummy) } else { err = db.QueryRow("SHOW TABLES LIKE '" + t + "'").Scan(&dummy) } switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SHOW TABLES: %v", err) return false } return true } diff --git a/migrations/v4.go b/migrations/v4.go new file mode 100644 index 0000000..c075dd8 --- /dev/null +++ b/migrations/v4.go @@ -0,0 +1,46 @@ +package migrations + +import ( + "context" + "database/sql" + + wf_db "github.com/writeas/writefreely/db" +) + +func oauth(db *datastore) error { + dialect := wf_db.DialectMySQL + if db.driverName == driverSQLite { + dialect = wf_db.DialectSQLite + } + return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { + createTableUsersOauth, err := dialect. + Table("oauth_users"). + SetIfNotExists(true). + Column(dialect.Column("user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)). + Column(dialect.Column("remote_user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)). + UniqueConstraint("user_id"). + UniqueConstraint("remote_user_id"). + ToSQL() + if err != nil { + return err + } + createTableOauthClientState, err := dialect. + Table("oauth_client_states"). + SetIfNotExists(true). + Column(dialect.Column("state", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 255})). + Column(dialect.Column("used", wf_db.ColumnTypeBool, wf_db.UnsetSize)). + Column(dialect.Column("created_at", wf_db.ColumnTypeDateTime, wf_db.UnsetSize).SetDefault("NOW()")). + UniqueConstraint("state"). + ToSQL() + if err != nil { + return err + } + + for _, table := range []string{createTableUsersOauth, createTableOauthClientState} { + if _, err := tx.ExecContext(ctx, table); err != nil { + return err + } + } + return nil + }) +} diff --git a/migrations/v5.go b/migrations/v5.go new file mode 100644 index 0000000..94e3944 --- /dev/null +++ b/migrations/v5.go @@ -0,0 +1,67 @@ +package migrations + +import ( + "context" + "database/sql" + + wf_db "github.com/writeas/writefreely/db" +) + +func oauthSlack(db *datastore) error { + dialect := wf_db.DialectMySQL + if db.driverName == driverSQLite { + dialect = wf_db.DialectSQLite + } + return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { + builders := []wf_db.SQLBuilder{ + dialect. + AlterTable("oauth_client_states"). + AddColumn(dialect. + Column( + "provider", + wf_db.ColumnTypeVarChar, + wf_db.OptionalInt{Set: true, Value: 24,})). + AddColumn(dialect. + Column( + "client_id", + wf_db.ColumnTypeVarChar, + wf_db.OptionalInt{Set: true, Value: 128,})), + dialect. + AlterTable("oauth_users"). + ChangeColumn("remote_user_id", + dialect. + Column( + "remote_user_id", + wf_db.ColumnTypeVarChar, + wf_db.OptionalInt{Set: true, Value: 128,})). + AddColumn(dialect. + Column( + "provider", + wf_db.ColumnTypeVarChar, + wf_db.OptionalInt{Set: true, Value: 24,})). + AddColumn(dialect. + Column( + "client_id", + wf_db.ColumnTypeVarChar, + wf_db.OptionalInt{Set: true, Value: 128,})). + AddColumn(dialect. + Column( + "access_token", + wf_db.ColumnTypeVarChar, + wf_db.OptionalInt{Set: true, Value: 512,})), + dialect.DropIndex("remote_user_id", "oauth_users"), + dialect.DropIndex("user_id", "oauth_users"), + dialect.CreateUniqueIndex("oauth_users", "oauth_users", "user_id", "provider", "client_id"), + } + for _, builder := range builders { + query, err := builder.ToSQL() + if err != nil { + return err + } + if _, err := tx.ExecContext(ctx, query); err != nil { + return err + } + } + return nil + }) +} diff --git a/oauth.go b/oauth.go new file mode 100644 index 0000000..4758e0f --- /dev/null +++ b/oauth.go @@ -0,0 +1,244 @@ +package writefreely + +import ( + "context" + "encoding/json" + "fmt" + "github.com/gorilla/mux" + "github.com/gorilla/sessions" + "github.com/writeas/impart" + "github.com/writeas/nerds/store" + "github.com/writeas/web-core/auth" + "github.com/writeas/web-core/log" + "github.com/writeas/writefreely/config" + "io" + "io/ioutil" + "net/http" + "time" +) + +// TokenResponse contains data returned when a token is created either +// through a code exchange or using a refresh token. +type TokenResponse struct { + AccessToken string `json:"access_token"` + ExpiresIn int `json:"expires_in"` + RefreshToken string `json:"refresh_token"` + TokenType string `json:"token_type"` + Error string `json:"error"` +} + +// InspectResponse contains data returned when an access token is inspected. +type InspectResponse struct { + ClientID string `json:"client_id"` + UserID string `json:"user_id"` + ExpiresAt time.Time `json:"expires_at"` + Username string `json:"username"` + DisplayName string `json:"-"` + Email string `json:"email"` + Error string `json:"error"` +} + +// tokenRequestMaxLen is the most bytes that we'll read from the /oauth/token +// endpoint. One megabyte is plenty. +const tokenRequestMaxLen = 1000000 + +// infoRequestMaxLen is the most bytes that we'll read from the +// /oauth/inspect endpoint. +const infoRequestMaxLen = 1000000 + +// OAuthDatastoreProvider provides a minimal interface of data store, config, +// and session store for use with the oauth handlers. +type OAuthDatastoreProvider interface { + DB() OAuthDatastore + Config() *config.Config + SessionStore() sessions.Store +} + +// OAuthDatastore provides a minimal interface of data store methods used in +// oauth functionality. +type OAuthDatastore interface { + GetIDForRemoteUser(context.Context, string, string, string) (int64, error) + RecordRemoteUserID(context.Context, int64, string, string, string, string) error + ValidateOAuthState(context.Context, string) (string, string, error) + GenerateOAuthState(context.Context, string, string) (string, error) + + CreateUser(*config.Config, *User, string) error + GetUserByID(int64) (*User, error) +} + +type HttpClient interface { + Do(req *http.Request) (*http.Response, error) +} + +type oauthClient interface { + GetProvider() string + GetClientID() string + buildLoginURL(state string) (string, error) + exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) + inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) +} + +type oauthHandler struct { + Config *config.Config + DB OAuthDatastore + Store sessions.Store + EmailKey []byte + oauthClient oauthClient +} + +func (h oauthHandler) viewOauthInit(app *App, w http.ResponseWriter, r *http.Request) error { + ctx := r.Context() + state, err := h.DB.GenerateOAuthState(ctx, h.oauthClient.GetProvider(), h.oauthClient.GetClientID()) + if err != nil { + return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"} + } + location, err := h.oauthClient.buildLoginURL(state) + if err != nil { + return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"} + } + return impart.HTTPError{http.StatusTemporaryRedirect, location} +} + +func configureSlackOauth(parentHandler *Handler, r *mux.Router, app *App) { + if app.Config().SlackOauth.ClientID != "" { + oauthClient := slackOauthClient{ + ClientID: app.Config().SlackOauth.ClientID, + ClientSecret: app.Config().SlackOauth.ClientSecret, + TeamID: app.Config().SlackOauth.TeamID, + CallbackLocation: app.Config().App.Host + "/oauth/callback", + HttpClient: config.DefaultHTTPClient(), + } + configureOauthRoutes(parentHandler, r, app, oauthClient) + } +} + +func configureWriteAsOauth(parentHandler *Handler, r *mux.Router, app *App) { + if app.Config().WriteAsOauth.ClientID != "" { + oauthClient := writeAsOauthClient{ + ClientID: app.Config().WriteAsOauth.ClientID, + ClientSecret: app.Config().WriteAsOauth.ClientSecret, + ExchangeLocation: config.OrDefaultString(app.Config().WriteAsOauth.TokenLocation, writeAsExchangeLocation), + InspectLocation: config.OrDefaultString(app.Config().WriteAsOauth.InspectLocation, writeAsIdentityLocation), + AuthLocation: config.OrDefaultString(app.Config().WriteAsOauth.AuthLocation, writeAsAuthLocation), + HttpClient: config.DefaultHTTPClient(), + CallbackLocation: app.Config().App.Host + "/oauth/callback", + } + configureOauthRoutes(parentHandler, r, app, oauthClient) + } +} + +func configureOauthRoutes(parentHandler *Handler, r *mux.Router, app *App, oauthClient oauthClient) { + handler := &oauthHandler{ + Config: app.Config(), + DB: app.DB(), + Store: app.SessionStore(), + oauthClient: oauthClient, + EmailKey: app.keys.EmailKey, + } + r.HandleFunc("/oauth/"+oauthClient.GetProvider(), parentHandler.OAuth(handler.viewOauthInit)).Methods("GET") + r.HandleFunc("/oauth/callback", parentHandler.OAuth(handler.viewOauthCallback)).Methods("GET") +} + +func (h oauthHandler) viewOauthCallback(app *App, w http.ResponseWriter, r *http.Request) error { + ctx := r.Context() + + code := r.FormValue("code") + state := r.FormValue("state") + + provider, clientID, err := h.DB.ValidateOAuthState(ctx, state) + if err != nil { + log.Error("Unable to ValidateOAuthState: %s", err) + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + + tokenResponse, err := h.oauthClient.exchangeOauthCode(ctx, code) + if err != nil { + log.Error("Unable to exchangeOauthCode: %s", err) + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + + // Now that we have the access token, let's use it real quick to make sur + // it really really works. + tokenInfo, err := h.oauthClient.inspectOauthAccessToken(ctx, tokenResponse.AccessToken) + if err != nil { + log.Error("Unable to inspectOauthAccessToken: %s", err) + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + + localUserID, err := h.DB.GetIDForRemoteUser(ctx, tokenInfo.UserID, provider, clientID) + if err != nil { + log.Error("Unable to GetIDForRemoteUser: %s", err) + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + + if localUserID == -1 { + // We don't have, nor do we want, the password from the origin, so we + //create a random string. If the user needs to set a password, they + //can do so through the settings page or through the password reset + //flow. + randPass := store.Generate62RandomString(14) + hashedPass, err := auth.HashPass([]byte(randPass)) + if err != nil { + return impart.HTTPError{http.StatusInternalServerError, "unable to create password hash"} + } + newUser := &User{ + Username: tokenInfo.Username, + HashedPass: hashedPass, + HasPass: true, + Email: prepareUserEmail(tokenInfo.Email, h.EmailKey), + Created: time.Now().Truncate(time.Second).UTC(), + } + displayName := tokenInfo.DisplayName + if len(displayName) == 0 { + displayName = tokenInfo.Username + } + + err = h.DB.CreateUser(h.Config, newUser, displayName) + if err != nil { + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + + err = h.DB.RecordRemoteUserID(ctx, newUser.ID, tokenInfo.UserID, provider, clientID, tokenResponse.AccessToken) + if err != nil { + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + + if err := loginOrFail(h.Store, w, r, newUser); err != nil { + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + return nil + } + + user, err := h.DB.GetUserByID(localUserID) + if err != nil { + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + if err = loginOrFail(h.Store, w, r, user); err != nil { + return impart.HTTPError{http.StatusInternalServerError, err.Error()} + } + return nil +} + +func limitedJsonUnmarshal(body io.ReadCloser, n int, thing interface{}) error { + lr := io.LimitReader(body, int64(n+1)) + data, err := ioutil.ReadAll(lr) + if err != nil { + return err + } + if len(data) == n+1 { + return fmt.Errorf("content larger than max read allowance: %d", n) + } + return json.Unmarshal(data, thing) +} + +func loginOrFail(store sessions.Store, w http.ResponseWriter, r *http.Request, user *User) error { + // An error may be returned, but a valid session should always be returned. + session, _ := store.Get(r, cookieName) + session.Values[cookieUserVal] = user.Cookie() + if err := session.Save(r, w); err != nil { + fmt.Println("error saving session", err) + return err + } + http.Redirect(w, r, "/", http.StatusTemporaryRedirect) + return nil +} diff --git a/oauth/state.go b/oauth/state.go new file mode 100644 index 0000000..e8dd154 --- /dev/null +++ b/oauth/state.go @@ -0,0 +1,10 @@ +package oauth + +import "context" + +// ClientStateStore provides state management used by the OAuth client. +type ClientStateStore interface { + Generate(ctx context.Context) (string, error) + Validate(ctx context.Context, state string) error +} + diff --git a/oauth_slack.go b/oauth_slack.go new file mode 100644 index 0000000..066aa18 --- /dev/null +++ b/oauth_slack.go @@ -0,0 +1,164 @@ +package writefreely + +import ( + "context" + "errors" + "github.com/writeas/slug" + "net/http" + "net/url" + "strings" +) + +type slackOauthClient struct { + ClientID string + ClientSecret string + TeamID string + CallbackLocation string + HttpClient HttpClient +} + +type slackExchangeResponse struct { + OK bool `json:"ok"` + AccessToken string `json:"access_token"` + Scope string `json:"scope"` + TeamName string `json:"team_name"` + TeamID string `json:"team_id"` + Error string `json:"error"` +} + +type slackIdentity struct { + Name string `json:"name"` + ID string `json:"id"` + Email string `json:"email"` +} + +type slackTeam struct { + Name string `json:"name"` + ID string `json:"id"` +} + +type slackUserIdentityResponse struct { + OK bool `json:"ok"` + User slackIdentity `json:"user"` + Team slackTeam `json:"team"` + Error string `json:"error"` +} + +const ( + slackAuthLocation = "https://slack.com/oauth/authorize" + slackExchangeLocation = "https://slack.com/api/oauth.access" + slackIdentityLocation = "https://slack.com/api/users.identity" +) + +var _ oauthClient = slackOauthClient{} + +func (c slackOauthClient) GetProvider() string { + return "slack" +} + +func (c slackOauthClient) GetClientID() string { + return c.ClientID +} + +func (c slackOauthClient) buildLoginURL(state string) (string, error) { + u, err := url.Parse(slackAuthLocation) + if err != nil { + return "", err + } + q := u.Query() + q.Set("client_id", c.ClientID) + q.Set("scope", "identity.basic identity.email identity.team") + q.Set("redirect_uri", c.CallbackLocation) + q.Set("state", state) + + // If this param is not set, the user can select which team they + // authenticate through and then we'd have to match the configured team + // against the profile get. That is extra work in the post-auth phase + // that we don't want to do. + q.Set("team", c.TeamID) + + // The Slack OAuth docs don't explicitly list this one, but it is part of + // the spec, so we include it anyway. + q.Set("response_type", "code") + u.RawQuery = q.Encode() + return u.String(), nil +} + +func (c slackOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) { + form := url.Values{} + // The oauth.access documentation doesn't explicitly mention this + // parameter, but it is part of the spec, so we include it anyway. + // https://api.slack.com/methods/oauth.access + form.Add("grant_type", "authorization_code") + form.Add("redirect_uri", c.CallbackLocation) + form.Add("code", code) + req, err := http.NewRequest("POST", slackExchangeLocation, strings.NewReader(form.Encode())) + if err != nil { + return nil, err + } + req.WithContext(ctx) + req.Header.Set("User-Agent", "writefreely") + req.Header.Set("Accept", "application/json") + req.Header.Set("Content-Type", "application/x-www-form-urlencoded") + req.SetBasicAuth(c.ClientID, c.ClientSecret) + + resp, err := c.HttpClient.Do(req) + if err != nil { + return nil, err + } + if resp.StatusCode != http.StatusOK { + return nil, errors.New("unable to exchange code for access token") + } + + var tokenResponse slackExchangeResponse + if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil { + return nil, err + } + if !tokenResponse.OK { + return nil, errors.New(tokenResponse.Error) + } + return tokenResponse.TokenResponse(), nil +} + +func (c slackOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) { + req, err := http.NewRequest("GET", slackIdentityLocation, nil) + if err != nil { + return nil, err + } + req.WithContext(ctx) + req.Header.Set("User-Agent", "writefreely") + req.Header.Set("Accept", "application/json") + req.Header.Set("Authorization", "Bearer "+accessToken) + + resp, err := c.HttpClient.Do(req) + if err != nil { + return nil, err + } + if resp.StatusCode != http.StatusOK { + return nil, errors.New("unable to inspect access token") + } + + var inspectResponse slackUserIdentityResponse + if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &inspectResponse); err != nil { + return nil, err + } + if !inspectResponse.OK { + return nil, errors.New(inspectResponse.Error) + } + return inspectResponse.InspectResponse(), nil +} + +func (resp slackUserIdentityResponse) InspectResponse() *InspectResponse { + return &InspectResponse{ + UserID: resp.User.ID, + Username: slug.Make(resp.User.Name), + DisplayName: resp.User.Name, + Email: resp.User.Email, + } +} + +func (resp slackExchangeResponse) TokenResponse() *TokenResponse { + return &TokenResponse{ + AccessToken: resp.AccessToken, + } +} diff --git a/oauth_test.go b/oauth_test.go new file mode 100644 index 0000000..2e293e7 --- /dev/null +++ b/oauth_test.go @@ -0,0 +1,253 @@ +package writefreely + +import ( + "context" + "fmt" + "github.com/gorilla/sessions" + "github.com/stretchr/testify/assert" + "github.com/writeas/impart" + "github.com/writeas/nerds/store" + "github.com/writeas/writefreely/config" + "net/http" + "net/http/httptest" + "net/url" + "strings" + "testing" +) + +type MockOAuthDatastoreProvider struct { + DoDB func() OAuthDatastore + DoConfig func() *config.Config + DoSessionStore func() sessions.Store +} + +type MockOAuthDatastore struct { + DoGenerateOAuthState func(context.Context, string, string) (string, error) + DoValidateOAuthState func(context.Context, string) (string, string, error) + DoGetIDForRemoteUser func(context.Context, string, string, string) (int64, error) + DoCreateUser func(*config.Config, *User, string) error + DoRecordRemoteUserID func(context.Context, int64, string, string, string, string) error + DoGetUserByID func(int64) (*User, error) +} + +var _ OAuthDatastore = &MockOAuthDatastore{} + +type StringReadCloser struct { + *strings.Reader +} + +func (src *StringReadCloser) Close() error { + return nil +} + +type MockHTTPClient struct { + DoDo func(req *http.Request) (*http.Response, error) +} + +func (m *MockHTTPClient) Do(req *http.Request) (*http.Response, error) { + if m.DoDo != nil { + return m.DoDo(req) + } + return &http.Response{}, nil +} + +func (m *MockOAuthDatastoreProvider) SessionStore() sessions.Store { + if m.DoSessionStore != nil { + return m.DoSessionStore() + } + return sessions.NewCookieStore([]byte("secret-key")) +} + +func (m *MockOAuthDatastoreProvider) DB() OAuthDatastore { + if m.DoDB != nil { + return m.DoDB() + } + return &MockOAuthDatastore{} +} + +func (m *MockOAuthDatastoreProvider) Config() *config.Config { + if m.DoConfig != nil { + return m.DoConfig() + } + cfg := config.New() + cfg.UseSQLite(true) + cfg.WriteAsOauth = config.WriteAsOauthCfg{ + ClientID: "development", + ClientSecret: "development", + AuthLocation: "https://write.as/oauth/login", + TokenLocation: "https://write.as/oauth/token", + InspectLocation: "https://write.as/oauth/inspect", + } + cfg.SlackOauth = config.SlackOauthCfg{ + ClientID: "development", + ClientSecret: "development", + TeamID: "development", + } + return cfg +} + +func (m *MockOAuthDatastore) ValidateOAuthState(ctx context.Context, state string) (string, string, error) { + if m.DoValidateOAuthState != nil { + return m.DoValidateOAuthState(ctx, state) + } + return "", "", nil +} + +func (m *MockOAuthDatastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) { + if m.DoGetIDForRemoteUser != nil { + return m.DoGetIDForRemoteUser(ctx, remoteUserID, provider, clientID) + } + return -1, nil +} + +func (m *MockOAuthDatastore) CreateUser(cfg *config.Config, u *User, username string) error { + if m.DoCreateUser != nil { + return m.DoCreateUser(cfg, u, username) + } + u.ID = 1 + return nil +} + +func (m *MockOAuthDatastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error { + if m.DoRecordRemoteUserID != nil { + return m.DoRecordRemoteUserID(ctx, localUserID, remoteUserID, provider, clientID, accessToken) + } + return nil +} + +func (m *MockOAuthDatastore) GetUserByID(userID int64) (*User, error) { + if m.DoGetUserByID != nil { + return m.DoGetUserByID(userID) + } + user := &User{ + + } + return user, nil +} + +func (m *MockOAuthDatastore) GenerateOAuthState(ctx context.Context, provider string, clientID string) (string, error) { + if m.DoGenerateOAuthState != nil { + return m.DoGenerateOAuthState(ctx, provider, clientID) + } + return store.Generate62RandomString(14), nil +} + +func TestViewOauthInit(t *testing.T) { + + t.Run("success", func(t *testing.T) { + app := &MockOAuthDatastoreProvider{} + h := oauthHandler{ + Config: app.Config(), + DB: app.DB(), + Store: app.SessionStore(), + EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd}, + oauthClient: writeAsOauthClient{ + ClientID: app.Config().WriteAsOauth.ClientID, + ClientSecret: app.Config().WriteAsOauth.ClientSecret, + ExchangeLocation: app.Config().WriteAsOauth.TokenLocation, + InspectLocation: app.Config().WriteAsOauth.InspectLocation, + AuthLocation: app.Config().WriteAsOauth.AuthLocation, + CallbackLocation: "http://localhost/oauth/callback", + HttpClient: nil, + }, + } + req, err := http.NewRequest("GET", "/oauth/client", nil) + assert.NoError(t, err) + rr := httptest.NewRecorder() + err = h.viewOauthInit(nil, rr, req) + assert.NotNil(t, err) + httpErr, ok := err.(impart.HTTPError) + assert.True(t, ok) + assert.Equal(t, http.StatusTemporaryRedirect, httpErr.Status) + assert.NotEmpty(t, httpErr.Message) + locURI, err := url.Parse(httpErr.Message) + assert.NoError(t, err) + assert.Equal(t, "/oauth/login", locURI.Path) + assert.Equal(t, "development", locURI.Query().Get("client_id")) + assert.Equal(t, "http://localhost/oauth/callback", locURI.Query().Get("redirect_uri")) + assert.Equal(t, "code", locURI.Query().Get("response_type")) + assert.NotEmpty(t, locURI.Query().Get("state")) + }) + + t.Run("state failure", func(t *testing.T) { + app := &MockOAuthDatastoreProvider{ + DoDB: func() OAuthDatastore { + return &MockOAuthDatastore{ + DoGenerateOAuthState: func(ctx context.Context, provider, clientID string) (string, error) { + return "", fmt.Errorf("pretend unable to write state error") + }, + } + }, + } + h := oauthHandler{ + Config: app.Config(), + DB: app.DB(), + Store: app.SessionStore(), + EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd}, + oauthClient: writeAsOauthClient{ + ClientID: app.Config().WriteAsOauth.ClientID, + ClientSecret: app.Config().WriteAsOauth.ClientSecret, + ExchangeLocation: app.Config().WriteAsOauth.TokenLocation, + InspectLocation: app.Config().WriteAsOauth.InspectLocation, + AuthLocation: app.Config().WriteAsOauth.AuthLocation, + CallbackLocation: "http://localhost/oauth/callback", + HttpClient: nil, + }, + } + req, err := http.NewRequest("GET", "/oauth/client", nil) + assert.NoError(t, err) + rr := httptest.NewRecorder() + err = h.viewOauthInit(nil, rr, req) + httpErr, ok := err.(impart.HTTPError) + assert.True(t, ok) + assert.NotEmpty(t, httpErr.Message) + assert.Equal(t, http.StatusInternalServerError, httpErr.Status) + assert.Equal(t, "could not prepare oauth redirect url", httpErr.Message) + }) +} + +func TestViewOauthCallback(t *testing.T) { + t.Run("success", func(t *testing.T) { + app := &MockOAuthDatastoreProvider{} + h := oauthHandler{ + Config: app.Config(), + DB: app.DB(), + Store: app.SessionStore(), + EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd}, + oauthClient: writeAsOauthClient{ + ClientID: app.Config().WriteAsOauth.ClientID, + ClientSecret: app.Config().WriteAsOauth.ClientSecret, + ExchangeLocation: app.Config().WriteAsOauth.TokenLocation, + InspectLocation: app.Config().WriteAsOauth.InspectLocation, + AuthLocation: app.Config().WriteAsOauth.AuthLocation, + CallbackLocation: "http://localhost/oauth/callback", + HttpClient: &MockHTTPClient{ + DoDo: func(req *http.Request) (*http.Response, error) { + switch req.URL.String() { + case "https://write.as/oauth/token": + return &http.Response{ + StatusCode: 200, + Body: &StringReadCloser{strings.NewReader(`{"access_token": "access_token", "expires_in": 1000, "refresh_token": "refresh_token", "token_type": "access"}`)}, + }, nil + case "https://write.as/oauth/inspect": + return &http.Response{ + StatusCode: 200, + Body: &StringReadCloser{strings.NewReader(`{"client_id": "development", "user_id": "1", "expires_at": "2019-12-19T11:42:01Z", "username": "nick", "email": "nick@testing.write.as"}`)}, + }, nil + } + + return &http.Response{ + StatusCode: http.StatusNotFound, + }, nil + }, + }, + }, + } + req, err := http.NewRequest("GET", "/oauth/callback", nil) + assert.NoError(t, err) + rr := httptest.NewRecorder() + err = h.viewOauthCallback(nil, rr, req) + assert.NoError(t, err) + assert.Equal(t, http.StatusTemporaryRedirect, rr.Code) + }) +} diff --git a/oauth_writeas.go b/oauth_writeas.go new file mode 100644 index 0000000..eb12f64 --- /dev/null +++ b/oauth_writeas.go @@ -0,0 +1,110 @@ +package writefreely + +import ( + "context" + "errors" + "net/http" + "net/url" + "strings" +) + +type writeAsOauthClient struct { + ClientID string + ClientSecret string + AuthLocation string + ExchangeLocation string + InspectLocation string + CallbackLocation string + HttpClient HttpClient +} + +var _ oauthClient = writeAsOauthClient{} + +const ( + writeAsAuthLocation = "https://write.as/oauth/login" + writeAsExchangeLocation = "https://write.as/oauth/token" + writeAsIdentityLocation = "https://write.as/oauth/inspect" +) + +func (c writeAsOauthClient) GetProvider() string { + return "write.as" +} + +func (c writeAsOauthClient) GetClientID() string { + return c.ClientID +} + +func (c writeAsOauthClient) buildLoginURL(state string) (string, error) { + u, err := url.Parse(c.AuthLocation) + if err != nil { + return "", err + } + q := u.Query() + q.Set("client_id", c.ClientID) + q.Set("redirect_uri", c.CallbackLocation) + q.Set("response_type", "code") + q.Set("state", state) + u.RawQuery = q.Encode() + return u.String(), nil +} + +func (c writeAsOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) { + form := url.Values{} + form.Add("grant_type", "authorization_code") + form.Add("redirect_uri", c.CallbackLocation) + form.Add("code", code) + req, err := http.NewRequest("POST", c.ExchangeLocation, strings.NewReader(form.Encode())) + if err != nil { + return nil, err + } + req.WithContext(ctx) + req.Header.Set("User-Agent", "writefreely") + req.Header.Set("Accept", "application/json") + req.Header.Set("Content-Type", "application/x-www-form-urlencoded") + req.SetBasicAuth(c.ClientID, c.ClientSecret) + + resp, err := c.HttpClient.Do(req) + if err != nil { + return nil, err + } + if resp.StatusCode != http.StatusOK { + return nil, errors.New("unable to exchange code for access token") + } + + var tokenResponse TokenResponse + if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil { + return nil, err + } + if tokenResponse.Error != "" { + return nil, errors.New(tokenResponse.Error) + } + return &tokenResponse, nil +} + +func (c writeAsOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) { + req, err := http.NewRequest("GET", c.InspectLocation, nil) + if err != nil { + return nil, err + } + req.WithContext(ctx) + req.Header.Set("User-Agent", "writefreely") + req.Header.Set("Accept", "application/json") + req.Header.Set("Authorization", "Bearer "+accessToken) + + resp, err := c.HttpClient.Do(req) + if err != nil { + return nil, err + } + if resp.StatusCode != http.StatusOK { + return nil, errors.New("unable to inspect access token") + } + + var inspectResponse InspectResponse + if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &inspectResponse); err != nil { + return nil, err + } + if inspectResponse.Error != "" { + return nil, errors.New(inspectResponse.Error) + } + return &inspectResponse, nil +} diff --git a/pad.go b/pad.go index 37d1c9b..3b0f1c2 100644 --- a/pad.go +++ b/pad.go @@ -1,186 +1,188 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "net/http" "strings" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/page" ) func handleViewPad(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) action := vars["action"] slug := vars["slug"] collAlias := vars["collection"] if app.cfg.App.SingleUser { // TODO: refactor all of this, especially for single-user blogs c, err := app.db.GetCollectionByID(1) if err != nil { return err } collAlias = c.Alias } appData := &struct { page.StaticPage Post *RawPost User *User Blogs *[]Collection Suspended bool Editing bool // True if we're modifying an existing post EditCollection *Collection // Collection of the post we're editing, if any }{ StaticPage: pageForReq(app, r), Post: &RawPost{Font: "norm"}, User: getUserSession(app, r), } var err error if appData.User != nil { appData.Blogs, err = app.db.GetPublishableCollections(appData.User, app.cfg.App.Host) if err != nil { log.Error("Unable to get user's blogs for Pad: %v", err) } appData.Suspended, err = app.db.IsUserSuspended(appData.User.ID) if err != nil { log.Error("Unable to get users suspension status for Pad: %v", err) } } padTmpl := app.cfg.App.Editor if templates[padTmpl] == nil { if padTmpl != "" { log.Info("No template '%s' found. Falling back to default 'pad' template.", padTmpl) } padTmpl = "pad" } if action == "" && slug == "" { // Not editing any post; simply render the Pad if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } // Retrieve post information for editing appData.Editing = true // Make sure this isn't cached, so user doesn't accidentally lose data w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT") if slug != "" { // TODO: refactor all of this, especially for single-user blogs appData.Post = getRawCollectionPost(app, slug, collAlias) if appData.Post.OwnerID != appData.User.ID { // TODO: add ErrForbiddenEditPost message to flashes return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/edit")]} } appData.EditCollection, err = app.db.GetCollectionForPad(collAlias) if err != nil { return err } + appData.EditCollection.hostName = app.cfg.App.Host } else { // Editing a floating article appData.Post = getRawPost(app, action) appData.Post.Id = action } if appData.Post.Gone { return ErrPostUnpublished } else if appData.Post.Found && appData.Post.Content != "" { // Got the post } else if appData.Post.Found { return ErrPostFetchError } else { return ErrPostNotFound } if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } func handleViewMeta(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) action := vars["action"] slug := vars["slug"] collAlias := vars["collection"] appData := &struct { page.StaticPage Post *RawPost User *User EditCollection *Collection // Collection of the post we're editing, if any Flashes []string NeedsToken bool Suspended bool }{ StaticPage: pageForReq(app, r), Post: &RawPost{Font: "norm"}, User: getUserSession(app, r), } var err error appData.Suspended, err = app.db.IsUserSuspended(appData.User.ID) if err != nil { log.Error("view meta: get user suspended status: %v", err) return ErrInternalGeneral } if action == "" && slug == "" { return ErrPostNotFound } // Make sure this isn't cached, so user doesn't accidentally lose data w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 28 Jul 1989 12:00:00 GMT") if slug != "" { appData.Post = getRawCollectionPost(app, slug, collAlias) if appData.Post.OwnerID != appData.User.ID { // TODO: add ErrForbiddenEditPost message to flashes return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/meta")]} } if app.cfg.App.SingleUser { // TODO: optimize this query just like we do in GetCollectionForPad (?) appData.EditCollection, err = app.db.GetCollectionByID(1) } else { appData.EditCollection, err = app.db.GetCollectionForPad(collAlias) } if err != nil { return err } + appData.EditCollection.hostName = app.cfg.App.Host } else { // Editing a floating article appData.Post = getRawPost(app, action) appData.Post.Id = action } appData.NeedsToken = appData.User == nil || appData.User.ID != appData.Post.OwnerID if appData.Post.Gone { return ErrPostUnpublished } else if appData.Post.Found && appData.Post.Content != "" { // Got the post } else if appData.Post.Found { return ErrPostFetchError } else { return ErrPostNotFound } appData.Flashes, _ = getSessionFlashes(app, w, r, nil) if err = templates["edit-meta"].ExecuteTemplate(w, "edit-meta", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } diff --git a/postrender.go b/postrender.go index 83fb5ad..312de58 100644 --- a/postrender.go +++ b/postrender.go @@ -1,236 +1,266 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018-2020 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( + "encoding/json" "fmt" "html" "html/template" + "net/http" "regexp" "strings" "unicode" "unicode/utf8" "github.com/microcosm-cc/bluemonday" stripmd "github.com/writeas/go-strip-markdown" + "github.com/writeas/impart" blackfriday "github.com/writeas/saturday" + "github.com/writeas/web-core/log" "github.com/writeas/web-core/stringmanip" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/parse" ) var ( blockReg = regexp.MustCompile("<(ul|ol|blockquote)>\n") endBlockReg = regexp.MustCompile("([a-z]+)>\n(ul|ol|blockquote)>") youtubeReg = regexp.MustCompile("(https?://www.youtube.com/embed/[a-zA-Z0-9\\-_]+)(\\?[^\t\n\f\r \"']+)?") titleElementReg = regexp.MustCompile("?h[1-6]>") hashtagReg = regexp.MustCompile(`{{\[\[\|\|([^|]+)\|\|\]\]}}`) markeddownReg = regexp.MustCompile("(.+)
") ) func (p *Post) formatContent(cfg *config.Config, c *Collection, isOwner bool) { baseURL := c.CanonicalURL() // TODO: redundant if !isSingleUser { baseURL = "/" + c.Alias + "/" } p.HTMLTitle = template.HTML(applyBasicMarkdown([]byte(p.Title.String))) p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), baseURL, cfg)) if exc := strings.Index(string(p.Content), ""); exc > -1 { p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:exc]), baseURL, cfg)) } } func (p *PublicPost) formatContent(cfg *config.Config, isOwner bool) { p.Post.formatContent(cfg, &p.Collection.Collection, isOwner) } func applyMarkdown(data []byte, baseURL string, cfg *config.Config) string { return applyMarkdownSpecial(data, false, baseURL, cfg) } func applyMarkdownSpecial(data []byte, skipNoFollow bool, baseURL string, cfg *config.Config) string { mdExtensions := 0 | blackfriday.EXTENSION_TABLES | blackfriday.EXTENSION_FENCED_CODE | blackfriday.EXTENSION_AUTOLINK | blackfriday.EXTENSION_STRIKETHROUGH | blackfriday.EXTENSION_SPACE_HEADERS | blackfriday.EXTENSION_AUTO_HEADER_IDS htmlFlags := 0 | blackfriday.HTML_USE_SMARTYPANTS | blackfriday.HTML_SMARTYPANTS_DASHES if baseURL != "" { htmlFlags |= blackfriday.HTML_HASHTAGS } // Generate Markdown md := blackfriday.Markdown([]byte(data), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions) if baseURL != "" { // Replace special text generated by Markdown parser tagPrefix := baseURL + "tag:" if cfg.App.Chorus { tagPrefix = "/read/t/" } md = []byte(hashtagReg.ReplaceAll(md, []byte("#$1"))) } // Strip out bad HTML policy := getSanitizationPolicy() policy.RequireNoFollowOnLinks(!skipNoFollow) outHTML := string(policy.SanitizeBytes(md)) // Strip newlines on certain block elements that render with them outHTML = blockReg.ReplaceAllString(outHTML, "<$1>") outHTML = endBlockReg.ReplaceAllString(outHTML, "$1>$2>") // Remove all query parameters on YouTube embed links // TODO: make this more specific. Taking the nuclear approach here to strip ?autoplay=1 outHTML = youtubeReg.ReplaceAllString(outHTML, "$1") return outHTML } func applyBasicMarkdown(data []byte) string { mdExtensions := 0 | blackfriday.EXTENSION_STRIKETHROUGH | blackfriday.EXTENSION_SPACE_HEADERS | blackfriday.EXTENSION_HEADER_IDS htmlFlags := 0 | blackfriday.HTML_SKIP_HTML | blackfriday.HTML_USE_SMARTYPANTS | blackfriday.HTML_SMARTYPANTS_DASHES // Generate Markdown md := blackfriday.Markdown([]byte(data), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions) // Strip out bad HTML policy := bluemonday.UGCPolicy() policy.AllowAttrs("class", "id").Globally() outHTML := string(policy.SanitizeBytes(md)) outHTML = markeddownReg.ReplaceAllString(outHTML, "$1") outHTML = strings.TrimRightFunc(outHTML, unicode.IsSpace) return outHTML } func postTitle(content, friendlyId string) string { const maxTitleLen = 80 // Strip HTML tags with bluemonday's StrictPolicy, then unescape the HTML // entities added in by sanitizing the content. content = html.UnescapeString(bluemonday.StrictPolicy().Sanitize(content)) content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace) eol := strings.IndexRune(content, '\n') blankLine := strings.Index(content, "\n\n") if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen { return strings.TrimSpace(content[:blankLine]) } else if utf8.RuneCountInString(content) <= maxTitleLen { return content } return friendlyId } // TODO: fix duplicated code from postTitle. postTitle is a widely used func we // don't have time to investigate right now. func friendlyPostTitle(content, friendlyId string) string { const maxTitleLen = 80 // Strip HTML tags with bluemonday's StrictPolicy, then unescape the HTML // entities added in by sanitizing the content. content = html.UnescapeString(bluemonday.StrictPolicy().Sanitize(content)) content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace) eol := strings.IndexRune(content, '\n') blankLine := strings.Index(content, "\n\n") if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen { return strings.TrimSpace(content[:blankLine]) } else if eol == -1 && utf8.RuneCountInString(content) <= maxTitleLen { return content } title, truncd := parse.TruncToWord(parse.PostLede(content, true), maxTitleLen) if truncd { title += "..." } return title } func getSanitizationPolicy() *bluemonday.Policy { policy := bluemonday.UGCPolicy() policy.AllowAttrs("src", "style").OnElements("iframe", "video", "audio") policy.AllowAttrs("src", "type").OnElements("source") policy.AllowAttrs("frameborder", "width", "height").Matching(bluemonday.Integer).OnElements("iframe") policy.AllowAttrs("allowfullscreen").OnElements("iframe") policy.AllowAttrs("controls", "loop", "muted", "autoplay").OnElements("video") policy.AllowAttrs("controls", "loop", "muted", "autoplay", "preload").OnElements("audio") policy.AllowAttrs("target").OnElements("a") policy.AllowAttrs("title").OnElements("abbr") policy.AllowAttrs("style", "class", "id").Globally() policy.AllowURLSchemes("http", "https", "mailto", "xmpp") return policy } func sanitizePost(content string) string { return strings.Replace(content, "<", "<", -1) } // postDescription generates a description based on the given post content, // title, and post ID. This doesn't consider a V2 post field, `title` when // choosing what to generate. In case a post has a title, this function will // fail, and logic should instead be implemented to skip this when there's no // title, like so: // var desc string // if title == "" { // desc = postDescription(content, title, friendlyId) // } else { // desc = shortPostDescription(content) // } func postDescription(content, title, friendlyId string) string { maxLen := 140 if content == "" { content = "WriteFreely is a painless, simple, federated blogging platform." } else { fmtStr := "%s" truncation := 0 if utf8.RuneCountInString(content) > maxLen { // Post is longer than the max description, so let's show a better description fmtStr = "%s..." truncation = 3 } if title == friendlyId { // No specific title was found; simply truncate the post, starting at the beginning content = fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1)) } else { // There was a title, so return a real description blankLine := strings.Index(content, "\n\n") if blankLine < 0 { blankLine = 0 } truncd := stringmanip.Substring(content, blankLine, blankLine+maxLen-truncation) contentNoNL := strings.Replace(truncd, "\n", " ", -1) content = strings.TrimSpace(fmt.Sprintf(fmtStr, contentNoNL)) } } return content } func shortPostDescription(content string) string { maxLen := 140 fmtStr := "%s" truncation := 0 if utf8.RuneCountInString(content) > maxLen { // Post is longer than the max description, so let's show a better description fmtStr = "%s..." truncation = 3 } return strings.TrimSpace(fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1))) } + +func handleRenderMarkdown(app *App, w http.ResponseWriter, r *http.Request) error { + if !IsJSON(r) { + return impart.HTTPError{Status: http.StatusUnsupportedMediaType, Message: "Markdown API only supports JSON requests"} + } + + in := struct { + CollectionURL string `json:"collection_url"` + RawBody string `json:"raw_body"` + }{} + + decoder := json.NewDecoder(r.Body) + err := decoder.Decode(&in) + if err != nil { + log.Error("Couldn't parse markdown JSON request: %v", err) + return ErrBadJSON + } + + out := struct { + Body string `json:"body"` + }{ + Body: applyMarkdown([]byte(in.RawBody), in.CollectionURL, app.cfg), + } + + return impart.WriteSuccess(w, out, http.StatusOK) +} diff --git a/posts.go b/posts.go index 6410735..21ed1a1 100644 --- a/posts.go +++ b/posts.go @@ -1,1535 +1,1535 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "encoding/json" "fmt" "html/template" "net/http" "regexp" "strings" "time" "github.com/gorilla/mux" "github.com/guregu/null" "github.com/guregu/null/zero" "github.com/kylemcc/twitter-text-go/extract" "github.com/microcosm-cc/bluemonday" stripmd "github.com/writeas/go-strip-markdown" "github.com/writeas/impart" "github.com/writeas/monday" "github.com/writeas/slug" "github.com/writeas/web-core/activitystreams" "github.com/writeas/web-core/bots" "github.com/writeas/web-core/converter" "github.com/writeas/web-core/i18n" "github.com/writeas/web-core/log" "github.com/writeas/web-core/tags" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" "github.com/writeas/writefreely/parse" ) const ( // Post ID length bounds minIDLen = 10 maxIDLen = 10 userPostIDLen = 10 postIDLen = 10 postMetaDateFormat = "2006-01-02 15:04:05" ) type ( AnonymousPost struct { ID string Content string HTMLContent template.HTML Font string Language string Direction string Title string GenTitle string Description string Author string Views int64 IsPlainText bool IsCode bool IsLinkable bool } AuthenticatedPost struct { ID string `json:"id" schema:"id"` Web bool `json:"web" schema:"web"` *SubmittedPost } // SubmittedPost represents a post supplied by a client for publishing or // updating. Since Title and Content can be updated to "", they are // pointers that can be easily tested to detect changes. SubmittedPost struct { Slug *string `json:"slug" schema:"slug"` Title *string `json:"title" schema:"title"` Content *string `json:"body" schema:"body"` Font string `json:"font" schema:"font"` IsRTL converter.NullJSONBool `json:"rtl" schema:"rtl"` Language converter.NullJSONString `json:"lang" schema:"lang"` Created *string `json:"created" schema:"created"` } // Post represents a post as found in the database. Post struct { ID string `db:"id" json:"id"` Slug null.String `db:"slug" json:"slug,omitempty"` Font string `db:"text_appearance" json:"appearance"` Language zero.String `db:"language" json:"language"` RTL zero.Bool `db:"rtl" json:"rtl"` Privacy int64 `db:"privacy" json:"-"` OwnerID null.Int `db:"owner_id" json:"-"` CollectionID null.Int `db:"collection_id" json:"-"` PinnedPosition null.Int `db:"pinned_position" json:"-"` Created time.Time `db:"created" json:"created"` Updated time.Time `db:"updated" json:"updated"` ViewCount int64 `db:"view_count" json:"-"` Title zero.String `db:"title" json:"title"` HTMLTitle template.HTML `db:"title" json:"-"` Content string `db:"content" json:"body"` HTMLContent template.HTML `db:"content" json:"-"` HTMLExcerpt template.HTML `db:"content" json:"-"` Tags []string `json:"tags"` Images []string `json:"images,omitempty"` OwnerName string `json:"owner,omitempty"` } // PublicPost holds properties for a publicly returned post, i.e. a post in // a context where the viewer may not be the owner. As such, sensitive // metadata for the post is hidden and properties supporting the display of // the post are added. PublicPost struct { *Post IsSubdomain bool `json:"-"` IsTopLevel bool `json:"-"` DisplayDate string `json:"-"` Views int64 `json:"views"` Owner *PublicUser `json:"-"` IsOwner bool `json:"-"` Collection *CollectionObj `json:"collection,omitempty"` } RawPost struct { Id, Slug string Title string Content string Views int64 Font string Created time.Time IsRTL sql.NullBool Language sql.NullString OwnerID int64 CollectionID sql.NullInt64 Found bool Gone bool } AnonymousAuthPost struct { ID string `json:"id"` Token string `json:"token"` } ClaimPostRequest struct { *AnonymousAuthPost CollectionAlias string `json:"collection"` CreateCollection bool `json:"create_collection"` // Generated properties Slug string `json:"-"` } ClaimPostResult struct { ID string `json:"id,omitempty"` Code int `json:"code,omitempty"` ErrorMessage string `json:"error_msg,omitempty"` Post *PublicPost `json:"post,omitempty"` } ) func (p *Post) Direction() string { if p.RTL.Valid { if p.RTL.Bool { return "rtl" } return "ltr" } return "auto" } // DisplayTitle dynamically generates a title from the Post's contents if it // doesn't already have an explicit title. func (p *Post) DisplayTitle() string { if p.Title.String != "" { return p.Title.String } t := friendlyPostTitle(p.Content, p.ID) return t } // PlainDisplayTitle dynamically generates a title from the Post's contents if it // doesn't already have an explicit title. func (p *Post) PlainDisplayTitle() string { if t := stripmd.Strip(p.DisplayTitle()); t != "" { return t } return p.ID } // FormattedDisplayTitle dynamically generates a title from the Post's contents if it // doesn't already have an explicit title. func (p *Post) FormattedDisplayTitle() template.HTML { if p.HTMLTitle != "" { return p.HTMLTitle } return template.HTML(p.DisplayTitle()) } // Summary gives a shortened summary of the post based on the post's title, // especially for display in a longer list of posts. It extracts a summary for // posts in the Title\n\nBody format, returning nothing if the entire was short // enough that the extracted title == extracted summary. func (p Post) Summary() string { if p.Content == "" { return "" } // Strip out HTML p.Content = bluemonday.StrictPolicy().Sanitize(p.Content) // and Markdown p.Content = stripmd.Strip(p.Content) title := p.Title.String var desc string if title == "" { // No title, so generate one title = friendlyPostTitle(p.Content, p.ID) desc = postDescription(p.Content, title, p.ID) if desc == title { return "" } return desc } return shortPostDescription(p.Content) } // Excerpt shows any text that comes before a (more) tag. // TODO: use HTMLExcerpt in templates instead of this method func (p *Post) Excerpt() template.HTML { return p.HTMLExcerpt } func (p *Post) CreatedDate() string { return p.Created.Format("2006-01-02") } func (p *Post) Created8601() string { return p.Created.Format("2006-01-02T15:04:05Z") } func (p *Post) IsScheduled() bool { return p.Created.After(time.Now()) } func (p *Post) HasTag(tag string) bool { // Regexp looks for tag and has a non-capturing group at the end looking // for the end of the word. // Assisted by: https://stackoverflow.com/a/35192941/1549194 hasTag, _ := regexp.MatchString("#"+tag+`(?:[[:punct:]]|\s|\z)`, p.Content) return hasTag } func (p *Post) HasTitleLink() bool { if p.Title.String == "" { return false } hasLink, _ := regexp.MatchString(`([^!]+|^)\[.+\]\(.+\)`, p.Title.String) return hasLink } func handleViewPost(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) friendlyID := vars["post"] // NOTE: until this is done better, be sure to keep this in parity with // isRaw() and viewCollectionPost() isJSON := strings.HasSuffix(friendlyID, ".json") isXML := strings.HasSuffix(friendlyID, ".xml") isCSS := strings.HasSuffix(friendlyID, ".css") isMarkdown := strings.HasSuffix(friendlyID, ".md") isRaw := strings.HasSuffix(friendlyID, ".txt") || isJSON || isXML || isCSS || isMarkdown // Display reserved page if that is requested resource if t, ok := pages[r.URL.Path[1:]+".tmpl"]; ok { return handleTemplatedPage(app, w, r, t) } else if (strings.Contains(r.URL.Path, ".") && !isRaw && !isMarkdown) || r.URL.Path == "/robots.txt" || r.URL.Path == "/manifest.json" { // Serve static file app.shttp.ServeHTTP(w, r) return nil } // Display collection if this is a collection c, _ := app.db.GetCollection(friendlyID) if c != nil { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", friendlyID)} } // Normalize the URL, redirecting user to consistent post URL if friendlyID != strings.ToLower(friendlyID) { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s", strings.ToLower(friendlyID))} } ext := "" if isRaw { parts := strings.Split(friendlyID, ".") friendlyID = parts[0] if len(parts) > 1 { ext = "." + parts[1] } } var ownerID sql.NullInt64 var title string var content string var font string var language []byte var rtl []byte var views int64 var post *AnonymousPost var found bool var gone bool fixedID := slug.Make(friendlyID) if fixedID != friendlyID { return impart.HTTPError{http.StatusFound, fmt.Sprintf("/%s%s", fixedID, ext)} } err := app.db.QueryRow(fmt.Sprintf("SELECT owner_id, title, content, text_appearance, view_count, language, rtl FROM posts WHERE id = ?"), friendlyID).Scan(&ownerID, &title, &content, &font, &views, &language, &rtl) switch { case err == sql.ErrNoRows: found = false // Output the error in the correct format if isJSON { content = "{\"error\": \"Post not found.\"}" } else if isRaw { content = "Post not found." } else { return ErrPostNotFound } case err != nil: found = false log.Error("Post loading err: %s\n", err) return ErrInternalGeneral default: found = true var d string if len(rtl) == 0 { d = "auto" } else if rtl[0] == 49 { // TODO: find a cleaner way to get this (possibly NULL) value d = "rtl" } else { d = "ltr" } generatedTitle := friendlyPostTitle(content, friendlyID) sanitizedContent := content if font != "code" { sanitizedContent = template.HTMLEscapeString(content) } var desc string if title == "" { desc = postDescription(content, title, friendlyID) } else { desc = shortPostDescription(content) } post = &AnonymousPost{ ID: friendlyID, Content: sanitizedContent, Title: title, GenTitle: generatedTitle, Description: desc, Author: "", Font: font, IsPlainText: isRaw, IsCode: font == "code", IsLinkable: font != "code", Views: views, Language: string(language), Direction: d, } if !isRaw { post.HTMLContent = template.HTML(applyMarkdown([]byte(content), "", app.cfg)) } } - suspended, err := app.db.IsUserSuspended(ownerID.Int64) - if err != nil { - log.Error("view post: %v", err) - return ErrInternalGeneral + var suspended bool + if found { + suspended, err = app.db.IsUserSuspended(ownerID.Int64) + if err != nil { + log.Error("view post: %v", err) + } } // Check if post has been unpublished if content == "" { gone = true if isJSON { content = "{\"error\": \"Post was unpublished.\"}" } else if isCSS { content = "" } else if isRaw { content = "Post was unpublished." } else { return ErrPostUnpublished } } var u = &User{} if isRaw { contentType := "text/plain" if isJSON { contentType = "application/json" } else if isCSS { contentType = "text/css" } else if isXML { contentType = "application/xml" } else if isMarkdown { contentType = "text/markdown" } w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType)) if isMarkdown && post.Title != "" { fmt.Fprintf(w, "%s\n", post.Title) for i := 1; i <= len(post.Title); i++ { fmt.Fprintf(w, "=") } fmt.Fprintf(w, "\n\n") } fmt.Fprint(w, content) if !found { return ErrPostNotFound } else if gone { return ErrPostUnpublished } } else { var err error page := struct { *AnonymousPost page.StaticPage Username string IsOwner bool SiteURL string Suspended bool }{ AnonymousPost: post, StaticPage: pageForReq(app, r), SiteURL: app.cfg.App.Host, } if u = getUserSession(app, r); u != nil { page.Username = u.Username page.IsOwner = ownerID.Valid && ownerID.Int64 == u.ID } if !page.IsOwner && suspended { return ErrPostNotFound } page.Suspended = suspended err = templates["post"].ExecuteTemplate(w, "post", page) if err != nil { log.Error("Post template execute error: %v", err) } } go func() { if u != nil && ownerID.Valid && ownerID.Int64 == u.ID { // Post is owned by someone; skip view increment since that person is viewing this post. return } // Update stats for non-raw post views if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) { _, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE id = ?", friendlyID) if err != nil { log.Error("Unable to update posts count: %v", err) } } }() return nil } // API v2 funcs // newPost creates a new post with or without an owning Collection. // // Endpoints: // /posts // /posts?collection={alias} // ? /collections/{alias}/posts func newPost(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) vars := mux.Vars(r) collAlias := vars["alias"] if collAlias == "" { collAlias = r.FormValue("collection") } accessToken := r.Header.Get("Authorization") if accessToken == "" { // TODO: remove this accessToken = r.FormValue("access_token") } // FIXME: determine web submission with Content-Type header var u *User var userID int64 = -1 var username string if accessToken == "" { u = getUserSession(app, r) if u != nil { userID = u.ID username = u.Username } } else { userID = app.db.GetUserID(accessToken) } suspended, err := app.db.IsUserSuspended(userID) if err != nil { log.Error("new post: %v", err) - return ErrInternalGeneral } if suspended { return ErrUserSuspended } if userID == -1 { return ErrNotLoggedIn } if accessToken == "" && u == nil && collAlias != "" { return impart.HTTPError{http.StatusBadRequest, "Parameter `access_token` required."} } // Get post data var p *SubmittedPost if reqJSON { decoder := json.NewDecoder(r.Body) err = decoder.Decode(&p) if err != nil { log.Error("Couldn't parse new post JSON request: %v\n", err) return ErrBadJSON } if p.Title == nil { t := "" p.Title = &t } if strings.TrimSpace(*(p.Content)) == "" { return ErrNoPublishableContent } } else { post := r.FormValue("body") appearance := r.FormValue("font") title := r.FormValue("title") rtlValue := r.FormValue("rtl") langValue := r.FormValue("lang") if strings.TrimSpace(post) == "" { return ErrNoPublishableContent } var isRTL, rtlValid bool if rtlValue == "auto" && langValue != "" { isRTL = i18n.LangIsRTL(langValue) rtlValid = true } else { isRTL = rtlValue == "true" rtlValid = rtlValue != "" && langValue != "" } // Create a new post p = &SubmittedPost{ Title: &title, Content: &post, Font: appearance, IsRTL: converter.NullJSONBool{sql.NullBool{Bool: isRTL, Valid: rtlValid}}, Language: converter.NullJSONString{sql.NullString{String: langValue, Valid: langValue != ""}}, } } if !p.isFontValid() { p.Font = "norm" } var newPost *PublicPost = &PublicPost{} var coll *Collection if accessToken != "" { newPost, err = app.db.CreateOwnedPost(p, accessToken, collAlias, app.cfg.App.Host) } else { //return ErrNotLoggedIn // TODO: verify user is logged in var collID int64 if collAlias != "" { coll, err = app.db.GetCollection(collAlias) if err != nil { return err } coll.hostName = app.cfg.App.Host if coll.OwnerID != u.ID { return ErrForbiddenCollection } collID = coll.ID } // TODO: return PublicPost from createPost newPost.Post, err = app.db.CreatePost(userID, collID, p) } if err != nil { return err } if coll != nil { coll.ForPublic() newPost.Collection = &CollectionObj{Collection: *coll} } newPost.extractData() newPost.OwnerName = username // Write success now response := impart.WriteSuccess(w, newPost, http.StatusCreated) if newPost.Collection != nil && !app.cfg.App.Private && app.cfg.App.Federation && !newPost.Created.After(time.Now()) { go federatePost(app, newPost, newPost.Collection.ID, false) } return response } func existingPost(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) vars := mux.Vars(r) postID := vars["post"] p := AuthenticatedPost{ID: postID} var err error if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err = decoder.Decode(&p) if err != nil { log.Error("Couldn't parse post update JSON request: %v\n", err) return ErrBadJSON } } else { err = r.ParseForm() if err != nil { log.Error("Couldn't parse post update form request: %v\n", err) return ErrBadFormData } // Can't decode to a nil SubmittedPost property, so create instance now p.SubmittedPost = &SubmittedPost{} err = app.formDecoder.Decode(&p, r.PostForm) if err != nil { log.Error("Couldn't decode post update form request: %v\n", err) return ErrBadFormData } } if p.Web { p.IsRTL.Valid = true } if p.SubmittedPost == nil { return ErrPostNoUpdatableVals } // Ensure an access token was given accessToken := r.Header.Get("Authorization") // Get user's cookie session if there's no token var u *User //var username string if accessToken == "" { u = getUserSession(app, r) if u != nil { //username = u.Username } } if u == nil && accessToken == "" { return ErrNoAccessToken } // Get user ID from current session or given access token, if one was given. var userID int64 if u != nil { userID = u.ID } else if accessToken != "" { userID, err = AuthenticateUser(app.db, accessToken) if err != nil { return err } } suspended, err := app.db.IsUserSuspended(userID) if err != nil { log.Error("existing post: %v", err) - return ErrInternalGeneral } if suspended { return ErrUserSuspended } // Modify post struct p.ID = postID err = app.db.UpdateOwnedPost(&p, userID) if err != nil { if reqJSON { return err } if err, ok := err.(impart.HTTPError); ok { addSessionFlash(app, w, r, err.Message, nil) } else { addSessionFlash(app, w, r, err.Error(), nil) } } var pRes *PublicPost pRes, err = app.db.GetPost(p.ID, 0) if reqJSON { if err != nil { return err } pRes.extractData() } if pRes.CollectionID.Valid { coll, err := app.db.GetCollectionBy("id = ?", pRes.CollectionID.Int64) if err == nil && !app.cfg.App.Private && app.cfg.App.Federation { coll.hostName = app.cfg.App.Host pRes.Collection = &CollectionObj{Collection: *coll} go federatePost(app, pRes, pRes.Collection.ID, true) } } // Write success now if reqJSON { return impart.WriteSuccess(w, pRes, http.StatusOK) } addSessionFlash(app, w, r, "Changes saved.", nil) collectionAlias := vars["alias"] redirect := "/" + postID + "/meta" if collectionAlias != "" { collPre := "/" + collectionAlias if app.cfg.App.SingleUser { collPre = "" } redirect = collPre + "/" + pRes.Slug.String + "/edit/meta" } else { if app.cfg.App.SingleUser { redirect = "/d" + redirect } } w.Header().Set("Location", redirect) w.WriteHeader(http.StatusFound) return nil } func deletePost(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) friendlyID := vars["post"] editToken := r.FormValue("token") var ownerID int64 var u *User accessToken := r.Header.Get("Authorization") if accessToken == "" && editToken == "" { u = getUserSession(app, r) if u == nil { return ErrNoAccessToken } } var res sql.Result var t *sql.Tx var err error var collID sql.NullInt64 var coll *Collection var pp *PublicPost if editToken != "" { // TODO: SELECT owner_id, as well, and return appropriate error if NULL instead of running two queries var dummy int64 err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ?", friendlyID).Scan(&dummy) switch { case err == sql.ErrNoRows: return impart.HTTPError{http.StatusNotFound, "Post not found."} } err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND owner_id IS NULL", friendlyID).Scan(&dummy) switch { case err == sql.ErrNoRows: // Post already has an owner. This could provide a bad experience // for the user, but it's more important to ensure data isn't lost // unexpectedly. So prevent deletion via token. return impart.HTTPError{http.StatusConflict, "This post belongs to some user (hopefully yours). Please log in and delete it from that user's account."} } res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND modify_token = ? AND owner_id IS NULL", friendlyID, editToken) } else if accessToken != "" || u != nil { // Caller provided some way to authenticate; assume caller expects the // post to be deleted based on a specific post owner, thus we should // return corresponding errors. if accessToken != "" { ownerID = app.db.GetUserID(accessToken) if ownerID == -1 { return ErrBadAccessToken } } else { ownerID = u.ID } // TODO: don't make two queries var realOwnerID sql.NullInt64 err = app.db.QueryRow("SELECT collection_id, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&collID, &realOwnerID) if err != nil { return err } if !collID.Valid { // There's no collection; simply delete the post res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID) } else { // Post belongs to a collection; do any additional clean up coll, err = app.db.GetCollectionBy("id = ?", collID.Int64) if err != nil { log.Error("Unable to get collection: %v", err) return err } if app.cfg.App.Federation { // First fetch full post for federation pp, err = app.db.GetOwnedPost(friendlyID, ownerID) if err != nil { log.Error("Unable to get owned post: %v", err) return err } collObj := &CollectionObj{Collection: *coll} pp.Collection = collObj } t, err = app.db.Begin() if err != nil { log.Error("No begin: %v", err) return err } res, err = t.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID) } } else { return impart.HTTPError{http.StatusBadRequest, "No authenticated user or post token given."} } if err != nil { return err } affected, err := res.RowsAffected() if err != nil { if t != nil { t.Rollback() log.Error("Rows affected err! Rolling back") } return err } else if affected == 0 { if t != nil { t.Rollback() log.Error("No rows affected! Rolling back") } return impart.HTTPError{http.StatusForbidden, "Post not found, or you're not the owner."} } if t != nil { t.Commit() } if coll != nil && !app.cfg.App.Private && app.cfg.App.Federation { go deleteFederatedPost(app, pp, collID.Int64) } return impart.HTTPError{Status: http.StatusNoContent} } // addPost associates a post with the authenticated user. func addPost(app *App, w http.ResponseWriter, r *http.Request) error { var ownerID int64 // Authenticate user at := r.Header.Get("Authorization") if at != "" { ownerID = app.db.GetUserID(at) if ownerID == -1 { return ErrBadAccessToken } } else { u := getUserSession(app, r) if u == nil { return ErrNotLoggedIn } ownerID = u.ID } suspended, err := app.db.IsUserSuspended(ownerID) if err != nil { log.Error("add post: %v", err) - return ErrInternalGeneral } if suspended { return ErrUserSuspended } // Parse claimed posts in format: // [{"id": "...", "token": "..."}] var claims *[]ClaimPostRequest decoder := json.NewDecoder(r.Body) err = decoder.Decode(&claims) if err != nil { return ErrBadJSONArray } vars := mux.Vars(r) collAlias := vars["alias"] // Update all given posts res, err := app.db.ClaimPosts(app.cfg, ownerID, collAlias, claims) if err != nil { return err } if !app.cfg.App.Private && app.cfg.App.Federation { for _, pRes := range *res { if pRes.Code != http.StatusOK { continue } if !pRes.Post.Created.After(time.Now()) { pRes.Post.Collection.hostName = app.cfg.App.Host go federatePost(app, pRes.Post, pRes.Post.Collection.ID, false) } } } return impart.WriteSuccess(w, res, http.StatusOK) } func dispersePost(app *App, w http.ResponseWriter, r *http.Request) error { var ownerID int64 // Authenticate user at := r.Header.Get("Authorization") if at != "" { ownerID = app.db.GetUserID(at) if ownerID == -1 { return ErrBadAccessToken } } else { u := getUserSession(app, r) if u == nil { return ErrNotLoggedIn } ownerID = u.ID } // Parse posts in format: // ["..."] var postIDs []string decoder := json.NewDecoder(r.Body) err := decoder.Decode(&postIDs) if err != nil { return ErrBadJSONArray } // Update all given posts res, err := app.db.DispersePosts(ownerID, postIDs) if err != nil { return err } return impart.WriteSuccess(w, res, http.StatusOK) } type ( PinPostResult struct { ID string `json:"id,omitempty"` Code int `json:"code,omitempty"` ErrorMessage string `json:"error_msg,omitempty"` } ) // pinPost pins a post to a blog func pinPost(app *App, w http.ResponseWriter, r *http.Request) error { var userID int64 // Authenticate user at := r.Header.Get("Authorization") if at != "" { userID = app.db.GetUserID(at) if userID == -1 { return ErrBadAccessToken } } else { u := getUserSession(app, r) if u == nil { return ErrNotLoggedIn } userID = u.ID } suspended, err := app.db.IsUserSuspended(userID) if err != nil { log.Error("pin post: %v", err) - return ErrInternalGeneral } if suspended { return ErrUserSuspended } // Parse request var posts []struct { ID string `json:"id"` Position int64 `json:"position"` } decoder := json.NewDecoder(r.Body) err = decoder.Decode(&posts) if err != nil { return ErrBadJSONArray } // Validate data vars := mux.Vars(r) collAlias := vars["alias"] coll, err := app.db.GetCollection(collAlias) if err != nil { return err } if coll.OwnerID != userID { return ErrForbiddenCollection } // Do (un)pinning isPinning := r.URL.Path[strings.LastIndex(r.URL.Path, "/"):] == "/pin" res := []PinPostResult{} for _, p := range posts { err = app.db.UpdatePostPinState(isPinning, p.ID, coll.ID, userID, p.Position) ppr := PinPostResult{ID: p.ID} if err != nil { ppr.Code = http.StatusInternalServerError // TODO: set error messsage } else { ppr.Code = http.StatusOK } res = append(res, ppr) } return impart.WriteSuccess(w, res, http.StatusOK) } func fetchPost(app *App, w http.ResponseWriter, r *http.Request) error { var collID int64 - var ownerID int64 var coll *Collection var err error vars := mux.Vars(r) if collAlias := vars["alias"]; collAlias != "" { // Fetch collection information, since an alias is provided coll, err = app.db.GetCollection(collAlias) if err != nil { return err } - coll.hostName = app.cfg.App.Host - _, err = apiCheckCollectionPermissions(app, r, coll) - if err != nil { - return err - } collID = coll.ID - ownerID = coll.OwnerID } p, err := app.db.GetPost(vars["post"], collID) if err != nil { return err } - suspended, err := app.db.IsUserSuspended(ownerID) + if coll == nil && p.CollectionID.Valid { + // Collection post is getting fetched by post ID, not coll alias + post slug, so get coll info now. + coll, err = app.db.GetCollectionByID(p.CollectionID.Int64) + if err != nil { + return err + } + } + if coll != nil { + coll.hostName = app.cfg.App.Host + _, err = apiCheckCollectionPermissions(app, r, coll) + if err != nil { + return err + } + } + + suspended, err := app.db.IsUserSuspended(p.OwnerID.Int64) if err != nil { log.Error("fetch post: %v", err) - return ErrInternalGeneral } - if suspended { return ErrPostNotFound } p.extractData() accept := r.Header.Get("Accept") if strings.Contains(accept, "application/activity+json") { - // Fetch information about the collection this belongs to - if coll == nil && p.CollectionID.Valid { - coll, err = app.db.GetCollectionByID(p.CollectionID.Int64) - if err != nil { - return err - } - } if coll == nil { // This is a draft post; 404 for now // TODO: return ActivityObject return impart.HTTPError{http.StatusNotFound, ""} } p.Collection = &CollectionObj{Collection: *coll} po := p.ActivityObject(app.cfg) po.Context = []interface{}{activitystreams.Namespace} return impart.RenderActivityJSON(w, po, http.StatusOK) } return impart.WriteSuccess(w, p, http.StatusOK) } func fetchPostProperty(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) p, err := app.db.GetPostProperty(vars["post"], 0, vars["property"]) if err != nil { return err } return impart.WriteSuccess(w, p, http.StatusOK) } func (p *Post) processPost() PublicPost { res := &PublicPost{Post: p, Views: 0} res.Views = p.ViewCount // TODO: move to own function loc := monday.FuzzyLocale(p.Language.String) res.DisplayDate = monday.Format(p.Created, monday.LongFormatsByLocale[loc], loc) return *res } func (p *PublicPost) CanonicalURL(hostName string) string { if p.Collection == nil || p.Collection.Alias == "" { return hostName + "/" + p.ID } return p.Collection.CanonicalURL() + p.Slug.String } func (p *PublicPost) ActivityObject(cfg *config.Config) *activitystreams.Object { o := activitystreams.NewArticleObject() o.ID = p.Collection.FederatedAPIBase() + "api/posts/" + p.ID o.Published = p.Created o.URL = p.CanonicalURL(cfg.App.Host) o.AttributedTo = p.Collection.FederatedAccount() o.CC = []string{ p.Collection.FederatedAccount() + "/followers", } o.Name = p.DisplayTitle() if p.HTMLContent == template.HTML("") { p.formatContent(cfg, false) } o.Content = string(p.HTMLContent) if p.Language.Valid { o.ContentMap = map[string]string{ p.Language.String: string(p.HTMLContent), } } if len(p.Tags) == 0 { o.Tag = []activitystreams.Tag{} } else { var tagBaseURL string if isSingleUser { tagBaseURL = p.Collection.CanonicalURL() + "tag:" } else { if cfg.App.Chorus { tagBaseURL = fmt.Sprintf("%s/read/t/", p.Collection.hostName) } else { tagBaseURL = fmt.Sprintf("%s/%s/tag:", p.Collection.hostName, p.Collection.Alias) } } for _, t := range p.Tags { o.Tag = append(o.Tag, activitystreams.Tag{ Type: activitystreams.TagHashtag, HRef: tagBaseURL + t, Name: "#" + t, }) } } return o } // TODO: merge this into getSlugFromPost or phase it out func getSlug(title, lang string) string { return getSlugFromPost("", title, lang) } func getSlugFromPost(title, body, lang string) string { if title == "" { title = postTitle(body, body) } title = parse.PostLede(title, false) // Truncate lede if needed title, _ = parse.TruncToWord(title, 80) var s string if lang != "" && len(lang) == 2 { s = slug.MakeLang(title, lang) } else { s = slug.Make(title) } // Transliteration may cause the slug to expand past the limit, so truncate again s, _ = parse.TruncToWord(s, 80) return strings.TrimFunc(s, func(r rune) bool { // TruncToWord doesn't respect words in a slug, since spaces are replaced // with hyphens. So remove any trailing hyphens. return r == '-' }) } // isFontValid returns whether or not the submitted post's appearance is valid. func (p *SubmittedPost) isFontValid() bool { validFonts := map[string]bool{ "norm": true, "sans": true, "mono": true, "wrap": true, "code": true, } _, valid := validFonts[p.Font] return valid } func getRawPost(app *App, friendlyID string) *RawPost { var content, font, title string var isRTL sql.NullBool var lang sql.NullString var ownerID sql.NullInt64 var created time.Time err := app.db.QueryRow("SELECT title, content, text_appearance, language, rtl, created, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&title, &content, &font, &lang, &isRTL, &created, &ownerID) switch { case err == sql.ErrNoRows: return &RawPost{Content: "", Found: false, Gone: false} case err != nil: return &RawPost{Content: "", Found: true, Gone: false} } return &RawPost{Title: title, Content: content, Font: font, Created: created, IsRTL: isRTL, Language: lang, OwnerID: ownerID.Int64, Found: true, Gone: content == ""} } // TODO; return a Post! func getRawCollectionPost(app *App, slug, collAlias string) *RawPost { var id, title, content, font string var isRTL sql.NullBool var lang sql.NullString var created time.Time var ownerID null.Int var views int64 var err error if app.cfg.App.SingleUser { err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, owner_id FROM posts WHERE slug = ? AND collection_id = 1", slug).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &ownerID) } else { err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, owner_id FROM posts WHERE slug = ? AND collection_id = (SELECT id FROM collections WHERE alias = ?)", slug, collAlias).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &ownerID) } switch { case err == sql.ErrNoRows: return &RawPost{Content: "", Found: false, Gone: false} case err != nil: return &RawPost{Content: "", Found: true, Gone: false} } return &RawPost{ Id: id, Slug: slug, Title: title, Content: content, Font: font, Created: created, IsRTL: isRTL, Language: lang, OwnerID: ownerID.Int64, Found: true, Gone: content == "", Views: views, } } func isRaw(r *http.Request) bool { vars := mux.Vars(r) slug := vars["slug"] // NOTE: until this is done better, be sure to keep this in parity with // isRaw in viewCollectionPost() and handleViewPost() isJSON := strings.HasSuffix(slug, ".json") isXML := strings.HasSuffix(slug, ".xml") isMarkdown := strings.HasSuffix(slug, ".md") return strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown } func viewCollectionPost(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] // NOTE: until this is done better, be sure to keep this in parity with // isRaw() and handleViewPost() isJSON := strings.HasSuffix(slug, ".json") isXML := strings.HasSuffix(slug, ".xml") isMarkdown := strings.HasSuffix(slug, ".md") isRaw := strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } // Check for hellbanned users u, err := checkUserForCollection(app, cr, r, true) if err != nil { return err } // Normalize the URL, redirecting user to consistent post URL if slug != strings.ToLower(slug) { loc := fmt.Sprintf("/%s", strings.ToLower(slug)) if !app.cfg.App.SingleUser { loc = "/" + cr.alias + loc } return impart.HTTPError{http.StatusMovedPermanently, loc} } // Display collection if this is a collection var c *Collection if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(cr.alias) } if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { // Redirect if necessary newAlias := app.db.GetCollectionRedirect(cr.alias) if newAlias != "" { return impart.HTTPError{http.StatusFound, "/" + newAlias + "/" + slug} } } } return err } c.hostName = app.cfg.App.Host suspended, err := app.db.IsUserSuspended(c.OwnerID) if err != nil { log.Error("view collection post: %v", err) - return ErrInternalGeneral } // Check collection permissions if c.IsPrivate() && (u == nil || u.ID != c.OwnerID) { return ErrPostNotFound } - if c.IsProtected() && ((u == nil || u.ID != c.OwnerID) && !isAuthorizedForCollection(app, c.Alias, r)) { - return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/?g=" + slug} + if c.IsProtected() && (u == nil || u.ID != c.OwnerID) { + if suspended { + return ErrPostNotFound + } else if !isAuthorizedForCollection(app, c.Alias, r) { + return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/?g=" + slug} + } } cr.isCollOwner = u != nil && c.OwnerID == u.ID if isRaw { slug = strings.Split(slug, ".")[0] } // Fetch extra data about the Collection // TODO: refactor out this logic, shared in collection.go:fetchCollection() coll := &CollectionObj{Collection: *c} owner, err := app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } else { coll.Owner = owner } postFound := true p, err := app.db.GetPost(slug, coll.ID) if err != nil { if err == ErrCollectionPageNotFound { postFound = false if slug == "feed" { // User tried to access blog feed without a trailing slash, and // there's no post with a slug "feed" return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/feed/"} } po := &Post{ Slug: null.NewString(slug, true), Font: "norm", Language: zero.NewString("en", true), RTL: zero.NewBool(false, true), Content: `This page is missing.
Are you sure it was ever here?`, } pp := po.processPost() p = &pp } else { return err } } p.IsOwner = owner != nil && p.OwnerID.Valid && owner.ID == p.OwnerID.Int64 p.Collection = coll p.IsTopLevel = app.cfg.App.SingleUser if !p.IsOwner && suspended { return ErrPostNotFound } // Check if post has been unpublished if p.Content == "" && p.Title.String == "" { return impart.HTTPError{http.StatusGone, "Post was unpublished."} } // Serve collection post if isRaw { contentType := "text/plain" if isJSON { contentType = "application/json" } else if isXML { contentType = "application/xml" } else if isMarkdown { contentType = "text/markdown" } w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType)) if !postFound { w.WriteHeader(http.StatusNotFound) fmt.Fprintf(w, "Post not found.") // TODO: return error instead, so status is correctly reflected in logs return nil } if isMarkdown && p.Title.String != "" { fmt.Fprintf(w, "# %s\n\n", p.Title.String) } fmt.Fprint(w, p.Content) } else if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { if !postFound { return ErrCollectionPageNotFound } p.extractData() ap := p.ActivityObject(app.cfg) ap.Context = []interface{}{activitystreams.Namespace} return impart.RenderActivityJSON(w, ap, http.StatusOK) } else { p.extractData() p.Content = strings.Replace(p.Content, "", "", 1) // TODO: move this to function p.formatContent(app.cfg, cr.isCollOwner) tp := struct { *PublicPost page.StaticPage IsOwner bool IsPinned bool IsCustomDomain bool PinnedPosts *[]PublicPost IsFound bool IsAdmin bool CanInvite bool Suspended bool }{ PublicPost: p, StaticPage: pageForReq(app, r), IsOwner: cr.isCollOwner, IsCustomDomain: cr.isCustomDomain, IsFound: postFound, Suspended: suspended, } tp.IsAdmin = u != nil && u.IsAdmin() tp.CanInvite = canUserInvite(app.cfg, tp.IsAdmin) tp.PinnedPosts, _ = app.db.GetPinnedPosts(coll, p.IsOwner) tp.IsPinned = len(*tp.PinnedPosts) > 0 && PostsContains(tp.PinnedPosts, p) if !postFound { w.WriteHeader(http.StatusNotFound) } postTmpl := "collection-post" if app.cfg.App.Chorus { postTmpl = "chorus-collection-post" } if err := templates[postTmpl].ExecuteTemplate(w, "post", tp); err != nil { log.Error("Error in collection-post template: %v", err) } } go func() { if p.OwnerID.Valid { // Post is owned by someone. Don't update stats if owner is viewing the post. if u != nil && p.OwnerID.Int64 == u.ID { return } } // Update stats for non-raw post views if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) { _, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE slug = ? AND collection_id = ?", slug, coll.ID) if err != nil { log.Error("Unable to update posts count: %v", err) } } }() return nil } // TODO: move this to utils after making it more generic func PostsContains(sl *[]PublicPost, s *PublicPost) bool { for _, e := range *sl { if e.ID == s.ID { return true } } return false } func (p *Post) extractData() { p.Tags = tags.Extract(p.Content) p.extractImages() } func (rp *RawPost) UserFacingCreated() string { return rp.Created.Format(postMetaDateFormat) } func (rp *RawPost) Created8601() string { return rp.Created.Format("2006-01-02T15:04:05Z") } var imageURLRegex = regexp.MustCompile(`(?i)^https?:\/\/[^ ]*\.(gif|png|jpg|jpeg|image)$`) func (p *Post) extractImages() { matches := extract.ExtractUrls(p.Content) urls := map[string]bool{} for i := range matches { u := matches[i].Text if !imageURLRegex.MatchString(u) { continue } urls[u] = true } resURLs := make([]string, 0) for k := range urls { resURLs = append(resURLs, k) } p.Images = resURLs } diff --git a/routes.go b/routes.go index eb5422a..7784d71 100644 --- a/routes.go +++ b/routes.go @@ -1,210 +1,216 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "net/http" "path/filepath" "strings" "github.com/gorilla/mux" "github.com/writeas/go-webfinger" "github.com/writeas/web-core/log" "github.com/writefreely/go-nodeinfo" ) // InitStaticRoutes adds routes for serving static files. // TODO: this should just be a func, not method func (app *App) InitStaticRoutes(r *mux.Router) { // Handle static files fs := http.FileServer(http.Dir(filepath.Join(app.cfg.Server.StaticParentDir, staticDir))) app.shttp = http.NewServeMux() app.shttp.Handle("/", fs) r.PathPrefix("/").Handler(fs) } // InitRoutes adds dynamic routes for the given mux.Router. func InitRoutes(apper Apper, r *mux.Router) *mux.Router { // Create handler handler := NewWFHandler(apper) // Set up routes hostSubroute := apper.App().cfg.App.Host[strings.Index(apper.App().cfg.App.Host, "://")+3:] if apper.App().cfg.App.SingleUser { hostSubroute = "{domain}" } else { if strings.HasPrefix(hostSubroute, "localhost") { hostSubroute = "localhost" } } if apper.App().cfg.App.SingleUser { log.Info("Adding %s routes (single user)...", hostSubroute) } else { log.Info("Adding %s routes (multi-user)...", hostSubroute) } // Primary app routes write := r.PathPrefix("/").Subrouter() // Federation endpoint configurations wf := webfinger.Default(wfResolver{apper.App().db, apper.App().cfg}) wf.NoTLSHandler = nil // Federation endpoints // host-meta write.HandleFunc("/.well-known/host-meta", handler.Web(handleViewHostMeta, UserLevelReader)) // webfinger write.HandleFunc(webfinger.WebFingerPath, handler.LogHandlerFunc(http.HandlerFunc(wf.Webfinger))) // nodeinfo niCfg := nodeInfoConfig(apper.App().db, apper.App().cfg) ni := nodeinfo.NewService(*niCfg, nodeInfoResolver{apper.App().cfg, apper.App().db}) write.HandleFunc(nodeinfo.NodeInfoPath, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfoDiscover))) write.HandleFunc(niCfg.InfoURL, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfo))) + configureSlackOauth(handler, write, apper.App()) + configureWriteAsOauth(handler, write, apper.App()) + // Set up dyamic page handlers // Handle auth auth := write.PathPrefix("/api/auth/").Subrouter() if apper.App().cfg.App.OpenRegistration { auth.HandleFunc("/signup", handler.All(apiSignup)).Methods("POST") } auth.HandleFunc("/login", handler.All(login)).Methods("POST") auth.HandleFunc("/read", handler.WebErrors(handleWebCollectionUnlock, UserLevelNone)).Methods("POST") auth.HandleFunc("/me", handler.All(handleAPILogout)).Methods("DELETE") // Handle logged in user sections me := write.PathPrefix("/me").Subrouter() me.HandleFunc("/", handler.Redirect("/me", UserLevelUser)) me.HandleFunc("/c", handler.Redirect("/me/c/", UserLevelUser)).Methods("GET") me.HandleFunc("/c/", handler.User(viewCollections)).Methods("GET") me.HandleFunc("/c/{collection}", handler.User(viewEditCollection)).Methods("GET") me.HandleFunc("/c/{collection}/stats", handler.User(viewStats)).Methods("GET") me.HandleFunc("/posts", handler.Redirect("/me/posts/", UserLevelUser)).Methods("GET") me.HandleFunc("/posts/", handler.User(viewArticles)).Methods("GET") me.HandleFunc("/posts/export.csv", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET") me.HandleFunc("/posts/export.zip", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET") me.HandleFunc("/posts/export.json", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET") me.HandleFunc("/export", handler.User(viewExportOptions)).Methods("GET") me.HandleFunc("/export.json", handler.Download(viewExportFull, UserLevelUser)).Methods("GET") me.HandleFunc("/import", handler.User(viewImport)).Methods("GET") me.HandleFunc("/settings", handler.User(viewSettings)).Methods("GET") me.HandleFunc("/invites", handler.User(handleViewUserInvites)).Methods("GET") me.HandleFunc("/logout", handler.Web(viewLogout, UserLevelNone)).Methods("GET") write.HandleFunc("/api/me", handler.All(viewMeAPI)).Methods("GET") apiMe := write.PathPrefix("/api/me/").Subrouter() apiMe.HandleFunc("/", handler.All(viewMeAPI)).Methods("GET") apiMe.HandleFunc("/posts", handler.UserAPI(viewMyPostsAPI)).Methods("GET") apiMe.HandleFunc("/collections", handler.UserAPI(viewMyCollectionsAPI)).Methods("GET") apiMe.HandleFunc("/password", handler.All(updatePassphrase)).Methods("POST") apiMe.HandleFunc("/self", handler.All(updateSettings)).Methods("POST") apiMe.HandleFunc("/invites", handler.User(handleCreateUserInvite)).Methods("POST") apiMe.HandleFunc("/import", handler.User(handleImport)).Methods("POST") // Sign up validation write.HandleFunc("/api/alias", handler.All(handleUsernameCheck)).Methods("POST") + write.HandleFunc("/api/markdown", handler.All(handleRenderMarkdown)).Methods("POST") + // Handle collections write.HandleFunc("/api/collections", handler.All(newCollection)).Methods("POST") apiColls := write.PathPrefix("/api/collections/").Subrouter() apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.AllReader(fetchCollection)).Methods("GET") apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.All(existingCollection)).Methods("POST", "DELETE") apiColls.HandleFunc("/{alias}/posts", handler.AllReader(fetchCollectionPosts)).Methods("GET") apiColls.HandleFunc("/{alias}/posts", handler.All(newPost)).Methods("POST") apiColls.HandleFunc("/{alias}/posts/{post}", handler.AllReader(fetchPost)).Methods("GET") apiColls.HandleFunc("/{alias}/posts/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST") apiColls.HandleFunc("/{alias}/posts/{post}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET") apiColls.HandleFunc("/{alias}/collect", handler.All(addPost)).Methods("POST") apiColls.HandleFunc("/{alias}/pin", handler.All(pinPost)).Methods("POST") apiColls.HandleFunc("/{alias}/unpin", handler.All(pinPost)).Methods("POST") apiColls.HandleFunc("/{alias}/inbox", handler.All(handleFetchCollectionInbox)).Methods("POST") apiColls.HandleFunc("/{alias}/outbox", handler.AllReader(handleFetchCollectionOutbox)).Methods("GET") apiColls.HandleFunc("/{alias}/following", handler.AllReader(handleFetchCollectionFollowing)).Methods("GET") apiColls.HandleFunc("/{alias}/followers", handler.AllReader(handleFetchCollectionFollowers)).Methods("GET") // Handle posts write.HandleFunc("/api/posts", handler.All(newPost)).Methods("POST") posts := write.PathPrefix("/api/posts/").Subrouter() posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.AllReader(fetchPost)).Methods("GET") posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST", "PUT") posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(deletePost)).Methods("DELETE") posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET") posts.HandleFunc("/claim", handler.All(addPost)).Methods("POST") posts.HandleFunc("/disperse", handler.All(dispersePost)).Methods("POST") write.HandleFunc("/auth/signup", handler.Web(handleWebSignup, UserLevelNoneRequired)).Methods("POST") write.HandleFunc("/auth/login", handler.Web(webLogin, UserLevelNoneRequired)).Methods("POST") write.HandleFunc("/admin", handler.Admin(handleViewAdminDash)).Methods("GET") write.HandleFunc("/admin/users", handler.Admin(handleViewAdminUsers)).Methods("GET") write.HandleFunc("/admin/user/{username}", handler.Admin(handleViewAdminUser)).Methods("GET") write.HandleFunc("/admin/user/{username}/status", handler.Admin(handleAdminToggleUserStatus)).Methods("POST") write.HandleFunc("/admin/user/{username}/passphrase", handler.Admin(handleAdminResetUserPass)).Methods("POST") write.HandleFunc("/admin/pages", handler.Admin(handleViewAdminPages)).Methods("GET") write.HandleFunc("/admin/page/{slug}", handler.Admin(handleViewAdminPage)).Methods("GET") write.HandleFunc("/admin/update/config", handler.AdminApper(handleAdminUpdateConfig)).Methods("POST") write.HandleFunc("/admin/update/{page}", handler.Admin(handleAdminUpdateSite)).Methods("POST") // Handle special pages first write.HandleFunc("/login", handler.Web(viewLogin, UserLevelNoneRequired)) write.HandleFunc("/signup", handler.Web(handleViewLanding, UserLevelNoneRequired)) write.HandleFunc("/invite/{code}", handler.Web(handleViewInvite, UserLevelOptional)).Methods("GET") // TODO: show a reader-specific 404 page if the function is disabled write.HandleFunc("/read", handler.Web(viewLocalTimeline, UserLevelReader)) RouteRead(handler, UserLevelReader, write.PathPrefix("/read").Subrouter()) draftEditPrefix := "" if apper.App().cfg.App.SingleUser { draftEditPrefix = "/d" write.HandleFunc("/me/new", handler.Web(handleViewPad, UserLevelOptional)).Methods("GET") } else { write.HandleFunc("/new", handler.Web(handleViewPad, UserLevelOptional)).Methods("GET") } // All the existing stuff write.HandleFunc(draftEditPrefix+"/{action}/edit", handler.Web(handleViewPad, UserLevelOptional)).Methods("GET") write.HandleFunc(draftEditPrefix+"/{action}/meta", handler.Web(handleViewMeta, UserLevelOptional)).Methods("GET") // Collections if apper.App().cfg.App.SingleUser { RouteCollections(handler, write.PathPrefix("/").Subrouter()) } else { write.HandleFunc("/{prefix:[@~$!\\-+]}{collection}", handler.Web(handleViewCollection, UserLevelReader)) write.HandleFunc("/{collection}/", handler.Web(handleViewCollection, UserLevelReader)) RouteCollections(handler, write.PathPrefix("/{prefix:[@~$!\\-+]?}{collection}").Subrouter()) // Posts } write.HandleFunc(draftEditPrefix+"/{post}", handler.Web(handleViewPost, UserLevelOptional)) write.HandleFunc("/", handler.Web(handleViewHome, UserLevelOptional)) + return r } func RouteCollections(handler *Handler, r *mux.Router) { r.HandleFunc("/page/{page:[0-9]+}", handler.Web(handleViewCollection, UserLevelReader)) r.HandleFunc("/tag:{tag}", handler.Web(handleViewCollectionTag, UserLevelReader)) r.HandleFunc("/tag:{tag}/feed/", handler.Web(ViewFeed, UserLevelReader)) r.HandleFunc("/tags/{tag}", handler.Web(handleViewCollectionTag, UserLevelReader)) r.HandleFunc("/sitemap.xml", handler.AllReader(handleViewSitemap)) r.HandleFunc("/feed/", handler.AllReader(ViewFeed)) r.HandleFunc("/{slug}", handler.CollectionPostOrStatic) r.HandleFunc("/{slug}/edit", handler.Web(handleViewPad, UserLevelUser)) r.HandleFunc("/{slug}/edit/meta", handler.Web(handleViewMeta, UserLevelUser)) r.HandleFunc("/{slug}/", handler.Web(handleCollectionPostRedirect, UserLevelReader)).Methods("GET") } func RouteRead(handler *Handler, readPerm UserLevelFunc, r *mux.Router) { r.HandleFunc("/api/posts", handler.Web(viewLocalTimelineAPI, readPerm)) r.HandleFunc("/p/{page}", handler.Web(viewLocalTimeline, readPerm)) r.HandleFunc("/feed/", handler.Web(viewLocalTimelineFeed, readPerm)) r.HandleFunc("/t/{tag}", handler.Web(viewLocalTimeline, readPerm)) r.HandleFunc("/a/{post}", handler.Web(handlePostIDRedirect, readPerm)) r.HandleFunc("/{author}", handler.Web(viewLocalTimeline, readPerm)) r.HandleFunc("/", handler.Web(viewLocalTimeline, readPerm)) } diff --git a/templates/edit-meta.tmpl b/templates/edit-meta.tmpl index 6707e68..49c7781 100644 --- a/templates/edit-meta.tmpl +++ b/templates/edit-meta.tmpl @@ -1,374 +1,374 @@ {{define "edit-meta"}}