diff --git a/.editorconfig b/.editorconfig new file mode 100644 index 0000000..7ab0722 --- /dev/null +++ b/.editorconfig @@ -0,0 +1,10 @@ +root = true + +[*] +end_of_line = lf +insert_final_newline = true +trim_trailing_whitespace = true +charset = utf-8 + +[*.go] +indent_style = tab diff --git a/.github/dependabot.yml b/.github/dependabot.yml index d1a7fc2..c4deaa9 100644 --- a/.github/dependabot.yml +++ b/.github/dependabot.yml @@ -1,7 +1,15 @@ version: 2 updates: - package-ecosystem: "gomod" # See documentation for possible values directory: "/" # Location of package manifests open-pull-requests-limit: 50 schedule: interval: "monthly" + - package-ecosystem: "github-actions" + directory: "/" + schedule: + interval: "daily" + - package-ecosystem: "docker" + directory: "/Dockerfile" + schedule: + interval: "daily" diff --git a/.github/workflows/docker-publish.yml b/.github/workflows/docker-publish.yml new file mode 100644 index 0000000..683d5c4 --- /dev/null +++ b/.github/workflows/docker-publish.yml @@ -0,0 +1,61 @@ +name: Build container image, publish as GitHub-package + +# This workflow uses actions that are not certified by GitHub. +# They are provided by a third-party and are governed by +# separate terms of service, privacy policy, and support +# documentation. + +on: + push: + branches: [ main, develop ] + # Publish semver tags as releases. + tags: + - 'v*.*.*' + +env: + # Use docker.io for Docker Hub if empty + REGISTRY: ghcr.io + # github.repository as / + IMAGE_NAME: ${{ github.repository }} + +jobs: + build: + + runs-on: ubuntu-latest + permissions: + contents: read + packages: write + + steps: + - name: Checkout repository + uses: actions/checkout@v4 + + # Login against a Docker registry except on PR + # https://github.com/docker/login-action + - name: Log into registry ${{ env.REGISTRY }} + if: github.event_name != 'pull_request' + uses: docker/login-action@v3.0.0 + with: + registry: ${{ env.REGISTRY }} + username: ${{ github.actor }} + password: ${{ secrets.GITHUB_TOKEN }} + + # Extract metadata (tags, labels) for Docker + # https://github.com/docker/metadata-action + - name: Extract Docker metadata + id: meta + uses: docker/metadata-action@v4.6.0 + with: + images: | + ghcr.io/${{ github.repository }} + flavor: latest=true + + # Build and push Docker image with Buildx (don't push on PR) + # https://github.com/docker/build-push-action + - name: Build and push Docker images + uses: docker/build-push-action@v5.0.0 + with: + context: . + push: ${{ github.event_name != 'pull_request' }} + tags: ${{ steps.meta.outputs.tags }} + labels: ${{ steps.meta.outputs.labels }} diff --git a/.gitignore b/.gitignore index f33ebb0..45bf28e 100644 --- a/.gitignore +++ b/.gitignore @@ -1,11 +1,12 @@ node_modules *~ *.swp *.swo +static/local/custom.css build tmp *.ini *.db bindata.go diff --git a/Dockerfile b/Dockerfile index 53e7ba5..44bf954 100644 --- a/Dockerfile +++ b/Dockerfile @@ -1,37 +1,42 @@ # Build image -FROM golang:1.15-alpine as build +FROM golang:1.19-alpine as build + +LABEL org.opencontainers.image.source=https://github.com/writefreely/writefreely +LABEL org.opencontainers.image.description="WriteFreely is a clean, minimalist publishing platform made for writers. Start a blog, share knowledge within your organization, or build a community around the shared act of writing." RUN apk add --update nodejs npm make g++ git RUN npm install -g less less-plugin-clean-css -RUN go get -u github.com/go-bindata/go-bindata/... RUN mkdir -p /go/src/github.com/writefreely/writefreely WORKDIR /go/src/github.com/writefreely/writefreely COPY . . +RUN cat ossl_legacy.cnf > /etc/ssl/openssl.cnf + ENV GO111MODULE=on +ENV NODE_OPTIONS=--openssl-legacy-provider RUN make build \ && make ui RUN mkdir /stage && \ cp -R /go/bin \ /go/src/github.com/writefreely/writefreely/templates \ /go/src/github.com/writefreely/writefreely/static \ /go/src/github.com/writefreely/writefreely/pages \ /go/src/github.com/writefreely/writefreely/keys \ /go/src/github.com/writefreely/writefreely/cmd \ /stage # Final image -FROM alpine:3.12 +FROM alpine:3 RUN apk add --no-cache openssl ca-certificates COPY --from=build --chown=daemon:daemon /stage /go WORKDIR /go VOLUME /go/keys EXPOSE 8080 USER daemon ENTRYPOINT ["cmd/writefreely/writefreely"] diff --git a/Makefile b/Makefile index 10d04b2..b230cb7 100644 --- a/Makefile +++ b/Makefile @@ -1,171 +1,149 @@ GITREV=`git describe | cut -c 2-` -LDFLAGS=-ldflags="-X 'github.com/writefreely/writefreely.softwareVer=$(GITREV)'" +LDFLAGS=-ldflags="-s -w -X 'github.com/writefreely/writefreely.softwareVer=$(GITREV)'" GOCMD=go GOINSTALL=$(GOCMD) install $(LDFLAGS) GOBUILD=$(GOCMD) build $(LDFLAGS) GOTEST=$(GOCMD) test $(LDFLAGS) GOGET=$(GOCMD) get BINARY_NAME=writefreely BUILDPATH=build/$(BINARY_NAME) DOCKERCMD=docker IMAGE_NAME=writeas/writefreely TMPBIN=./tmp all : build -ci: ci-assets deps +ci: deps cd cmd/writefreely; $(GOBUILD) -v -build: assets deps - cd cmd/writefreely; $(GOBUILD) -v -tags='sqlite' +build: deps + cd cmd/writefreely; $(GOBUILD) -v -tags='netgo sqlite' -build-no-sqlite: assets-no-sqlite deps-no-sqlite - cd cmd/writefreely; $(GOBUILD) -v -o $(BINARY_NAME) +build-no-sqlite: deps-no-sqlite + cd cmd/writefreely; $(GOBUILD) -v -tags='netgo' -o $(BINARY_NAME) build-linux: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ - $(GOGET) -u src.techknowlogick.com/xgo; \ + $(GOCMD) install src.techknowlogick.com/xgo@latest; \ fi - xgo --targets=linux/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely + xgo --targets=linux/amd64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.19.x -out writefreely -pkg ./cmd/writefreely . build-windows: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ - $(GOGET) -u src.techknowlogick.com/xgo; \ + $(GOCMD) install src.techknowlogick.com/xgo@latest; \ fi - xgo --targets=windows/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely + xgo --targets=windows/amd64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.19.x -out writefreely -pkg ./cmd/writefreely . build-darwin: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ - $(GOGET) -u src.techknowlogick.com/xgo; \ + $(GOCMD) install src.techknowlogick.com/xgo@latest; \ fi - xgo --targets=darwin/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely + xgo --targets=darwin/amd64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.19.x -out writefreely -pkg ./cmd/writefreely . build-arm6: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ - $(GOGET) -u src.techknowlogick.com/xgo; \ + $(GOCMD) install src.techknowlogick.com/xgo@latest; \ fi - xgo --targets=linux/arm-6, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely + xgo --targets=linux/arm-6, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.19.x -out writefreely -pkg ./cmd/writefreely . build-arm7: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ - $(GOGET) -u src.techknowlogick.com/xgo; \ + $(GOCMD) install src.techknowlogick.com/xgo@latest; \ fi - xgo --targets=linux/arm-7, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely + xgo --targets=linux/arm-7, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.19.x -out writefreely -pkg ./cmd/writefreely . build-arm64: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ - $(GOGET) -u src.techknowlogick.com/xgo; \ + $(GOCMD) install src.techknowlogick.com/xgo@latest; \ fi - xgo --targets=linux/arm64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely + xgo --targets=linux/arm64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.19.x -out writefreely -pkg ./cmd/writefreely . build-docker : $(DOCKERCMD) build -t $(IMAGE_NAME):latest -t $(IMAGE_NAME):$(GITREV) . test: $(GOTEST) -v ./... -run: dev-assets - $(GOINSTALL) -tags='sqlite' ./... +run: + $(GOINSTALL) -tags='netgo sqlite' ./... $(BINARY_NAME) --debug deps : $(GOGET) -tags='sqlite' -d -v ./... deps-no-sqlite: $(GOGET) -d -v ./... install : build cmd/writefreely/$(BINARY_NAME) --config cmd/writefreely/$(BINARY_NAME) --gen-keys cmd/writefreely/$(BINARY_NAME) --init-db cd less/; $(MAKE) install $(MFLAGS) -release : clean ui assets +release : clean ui mkdir -p $(BUILDPATH) cp -r templates $(BUILDPATH) cp -r pages $(BUILDPATH) cp -r static $(BUILDPATH) + rm -r $(BUILDPATH)/static/local scripts/invalidate-css.sh $(BUILDPATH) mkdir $(BUILDPATH)/keys $(MAKE) build-linux mv build/$(BINARY_NAME)-linux-amd64 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-arm6 mv build/$(BINARY_NAME)-linux-arm-6 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm6.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-arm7 mv build/$(BINARY_NAME)-linux-arm-7 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm7.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-arm64 mv build/$(BINARY_NAME)-linux-arm64 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm64.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-darwin mv build/$(BINARY_NAME)-darwin-10.12-amd64 $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_macos_amd64.tar.gz -C build $(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-windows mv build/$(BINARY_NAME)-windows-4.0-amd64.exe $(BUILDPATH)/$(BINARY_NAME).exe cd build; zip -r ../$(BINARY_NAME)_$(GITREV)_windows_amd64.zip ./$(BINARY_NAME) rm $(BUILDPATH)/$(BINARY_NAME).exe $(MAKE) build-docker $(MAKE) release-docker # This assumes you're on linux/amd64 release-linux : clean ui mkdir -p $(BUILDPATH) cp -r templates $(BUILDPATH) cp -r pages $(BUILDPATH) cp -r static $(BUILDPATH) mkdir $(BUILDPATH)/keys $(MAKE) build-no-sqlite mv cmd/writefreely/$(BINARY_NAME) $(BUILDPATH)/$(BINARY_NAME) tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME) release-docker : $(DOCKERCMD) push $(IMAGE_NAME) ui : force_look cd less/; $(MAKE) $(MFLAGS) cd prose/; $(MAKE) $(MFLAGS) -assets : generate - go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql - -assets-no-sqlite: generate - go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql - -dev-assets : generate - go-bindata -pkg writefreely -ignore=\\.gitignore -debug -tags="!wflib" schema.sql sqlite.sql - -lib-assets : generate - go-bindata -pkg writefreely -ignore=\\.gitignore -o bindata-lib.go -tags="wflib" schema.sql - -generate : - @hash go-bindata > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ - $(GOGET) -u github.com/jteeuwen/go-bindata/go-bindata; \ - fi - $(TMPBIN): mkdir -p $(TMPBIN) -$(TMPBIN)/go-bindata: deps $(TMPBIN) - $(GOBUILD) -o $(TMPBIN)/go-bindata github.com/jteeuwen/go-bindata/go-bindata - $(TMPBIN)/xgo: deps $(TMPBIN) $(GOBUILD) -o $(TMPBIN)/xgo src.techknowlogick.com/xgo -ci-assets : $(TMPBIN)/go-bindata - $(TMPBIN)/go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql - clean : -rm -rf build -rm -rf tmp cd less/; $(MAKE) clean $(MFLAGS) force_look : true diff --git a/README.md b/README.md index c165820..7831e57 100644 --- a/README.md +++ b/README.md @@ -1,89 +1,89 @@  

WriteFreely


Latest release Build status Go Report Card

  WriteFreely is a clean, minimalist publishing platform made for writers. Start a blog, share knowledge within your organization, or build a community around the shared act of writing. ![](https://writefreely.org/img/screens/pencil-reader.png) [Try the writing experience](https://write.as/new) [Find an instance](https://writefreely.org/instances) ## Features ### Made for writing Built on a plain, auto-saving editor, WriteFreely gives you a distraction-free writing environment. Once published, your words are front and center, and easy to read. ### A connected community Start writing together, publicly or privately. Connect with other communities, whether running WriteFreely, [Plume](https://joinplu.me/), or other ActivityPub-powered software. And bring members on board from your existing platforms, thanks to our OAuth 2.0 support. ### Intuitive organization Categorize articles [with hashtags](https://writefreely.org/docs/latest/writer/hashtags), and create static pages from normal posts by [_pinning_ them](https://writefreely.org/docs/latest/writer/static) to your blog. Create draft posts and publish to multiple blogs from one account. ### International Blog elements are localized in 20+ languages, and WriteFreely includes first-class support for non-Latin and right-to-left (RTL) script languages. ### Private by default WriteFreely collects minimal data, and never publicizes more than a writer consents to. Writers can seamlessly create multiple blogs from a single account for different pen names or purposes without publicly revealing their association.

Write.as

The quickest way to deploy WriteFreely is with [Write.as](https://write.as/writefreely), a hosted service from the team behind WriteFreely. You'll get fully-managed installation, backup, upgrades, and maintenance — and directly fund our free software work ❤️ [**Learn more on Write.as**](https://write.as/writefreely). ## Quick start WriteFreely deploys as a static binary on any platform and architecture that Go supports. Just use our built-in SQLite support, or add a MySQL database, and you'll be up and running! For common platforms, start with our [pre-built binaries](https://github.com/writefreely/writefreely/releases/) and head over to our [installation guide](https://writefreely.org/start) to get started. ### Packages You can also find WriteFreely in these package repositories, thanks to our wonderful community! * [Arch User Repository](https://aur.archlinux.org/packages/writefreely/) ## Documentation Read our full [documentation on WriteFreely.org](https://writefreely.org/docs) —️ and help us improve by contributing to the [writefreely/documentation](https://github.com/writefreely/documentation) repo. ## Development Start hacking on WriteFreely with our [developer setup guide](https://writefreely.org/docs/latest/developer/setup). For Docker support, see our [Docker guide](https://writefreely.org/docs/latest/admin/docker). ## Contributing We gladly welcome contributions to WriteFreely, whether in the form of [code](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely), [bug reports](https://github.com/writefreely/writefreely/issues/new?template=bug_report.md), [feature requests](https://discuss.write.as/c/feedback/feature-requests), [translations](https://poeditor.com/join/project/TIZ6HFRFdE), or [documentation](https://github.com/writefreely/documentation) improvements. Before contributing anything, please read our [Contributing Guide](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely). It describes the correct channels for submitting contributions and any potential requirements. ## License -Copyright © 2018-2021 [A Bunch Tell LLC](https://abunchtell.com) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE). +Copyright © 2018-2022 [Musing Studio LLC](https://musing.studio) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE). diff --git a/SECURITY.md b/SECURITY.md new file mode 100644 index 0000000..4bf2cfd --- /dev/null +++ b/SECURITY.md @@ -0,0 +1,5 @@ +# Security Policy + +## Reporting a Vulnerability + +To report a vulnerability, send an email to security@writefreely.org. diff --git a/account.go b/account.go index 6ab73bd..4af1ba3 100644 --- a/account.go +++ b/account.go @@ -1,1245 +1,1378 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "encoding/json" "fmt" + "github.com/mailgun/mailgun-go" "html/template" "net/http" "regexp" "strconv" "strings" "sync" "time" "github.com/gorilla/csrf" "github.com/gorilla/mux" "github.com/gorilla/sessions" "github.com/guregu/null/zero" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/data" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/author" "github.com/writefreely/writefreely/config" "github.com/writefreely/writefreely/page" ) type ( userSettings struct { Username string `schema:"username" json:"username"` Email string `schema:"email" json:"email"` NewPass string `schema:"new-pass" json:"new_pass"` OldPass string `schema:"current-pass" json:"current_pass"` IsLogOut bool `schema:"logout" json:"logout"` } UserPage struct { page.StaticPage PageTitle string Separator template.HTML IsAdmin bool CanInvite bool CollAlias string } ) func NewUserPage(app *App, r *http.Request, u *User, title string, flashes []string) *UserPage { up := &UserPage{ StaticPage: pageForReq(app, r), PageTitle: title, } up.Username = u.Username up.Flashes = flashes up.Path = r.URL.Path up.IsAdmin = u.IsAdmin() up.CanInvite = canUserInvite(app.cfg, up.IsAdmin) return up } func canUserInvite(cfg *config.Config, isAdmin bool) bool { return cfg.App.UserInvites != "" && (isAdmin || cfg.App.UserInvites != "admin") } func (up *UserPage) SetMessaging(u *User) { // up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID) } const ( loginAttemptExpiration = 3 * time.Second ) var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead") func apiSignup(app *App, w http.ResponseWriter, r *http.Request) error { _, err := signup(app, w, r) return err } func signup(app *App, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { if app.cfg.App.DisablePasswordAuth { err := ErrDisabledPasswordAuth return nil, err } reqJSON := IsJSON(r) // Get params var ur userRegistration if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&ur) if err != nil { log.Error("Couldn't parse signup JSON request: %v\n", err) return nil, ErrBadJSON } } else { // Check if user is already logged in u := getUserSession(app, r) if u != nil { return &AuthUser{User: u}, nil } err := r.ParseForm() if err != nil { log.Error("Couldn't parse signup form request: %v\n", err) return nil, ErrBadFormData } err = app.formDecoder.Decode(&ur, r.PostForm) if err != nil { log.Error("Couldn't decode signup form request: %v\n", err) return nil, ErrBadFormData } } return signupWithRegistration(app, ur, w, r) } func signupWithRegistration(app *App, signup userRegistration, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { reqJSON := IsJSON(r) // Validate required params (alias) if signup.Alias == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."} } if signup.Pass == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."} } var desiredUsername string if signup.Normalize { // With this option we simply conform the username to what we expect // without complaining. Since they might've done something funny, like // enter: write.as/Way Out There, we'll use their raw input for the new // collection name and sanitize for the slug / username. desiredUsername = signup.Alias signup.Alias = getSlug(signup.Alias, "") } if !author.IsValidUsername(app.cfg, signup.Alias) { // Ensure the username is syntactically correct. return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."} } // Handle empty optional params hashedPass, err := auth.HashPass([]byte(signup.Pass)) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Create struct to insert u := &User{ Username: signup.Alias, HashedPass: hashedPass, HasPass: true, Email: prepareUserEmail(signup.Email, app.keys.EmailKey), Created: time.Now().Truncate(time.Second).UTC(), } // Create actual user if err := app.db.CreateUser(app.cfg, u, desiredUsername, signup.Description); err != nil { return nil, err } // Log invite if needed if signup.InviteCode != "" { err = app.db.CreateInvitedUser(signup.InviteCode, u.ID) if err != nil { return nil, err } } // Add back unencrypted data for response if signup.Email != "" { u.Email.String = signup.Email } resUser := &AuthUser{ User: u, } title := signup.Alias if signup.Normalize { title = desiredUsername } resUser.Collections = &[]Collection{ { Alias: signup.Alias, Title: title, Description: signup.Description, }, } var coll *Collection if signup.Monetization != "" { if coll == nil { coll, err = app.db.GetCollection(signup.Alias) if err != nil { log.Error("Unable to get new collection '%s' for monetization on signup: %v", signup.Alias, err) return nil, err } } err = app.db.SetCollectionAttribute(coll.ID, "monetization_pointer", signup.Monetization) if err != nil { log.Error("Unable to add monetization on signup: %v", err) return nil, err } coll.Monetization = signup.Monetization } var token string if reqJSON && !signup.Web { token, err = app.db.GetAccessToken(u.ID) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser.AccessToken = token } else { session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. // Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144 log.Error("Session: %v; ignoring", err) } session.Values[cookieUserVal] = resUser.User.Cookie() err = session.Save(r, w) if err != nil { log.Error("Couldn't save session: %v", err) return nil, err } } if reqJSON { return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated) } return resUser, nil } func viewLogout(app *App, w http.ResponseWriter, r *http.Request) error { session, err := app.sessionStore.Get(r, cookieName) if err != nil { return ErrInternalCookieSession } // Ensure user has an email or password set before they go, so they don't // lose access to their account. val := session.Values[cookieUserVal] var u = &User{} var ok bool if u, ok = val.(*User); !ok { log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values) err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } u, err = app.db.GetUserByID(u.ID) if err != nil && err != ErrUserNotFound { return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."} } session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } func handleAPILogout(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } t := auth.GetToken(accessToken) if len(t) == 0 { return ErrNoAccessToken } err := app.db.DeleteToken(t) if err != nil { return err } return impart.HTTPError{Status: http.StatusNoContent} } func viewLogin(app *App, w http.ResponseWriter, r *http.Request) error { var earlyError string oneTimeToken := r.FormValue("with") if oneTimeToken != "" { log.Info("Calling login with one-time token.") err := login(app, w, r) if err != nil { log.Info("Received error: %v", err) earlyError = fmt.Sprintf("%s", err) } } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session; ignoring: %v", err) } p := &struct { page.StaticPage *OAuthButtons To string Message template.HTML Flashes []template.HTML LoginUsername string }{ StaticPage: pageForReq(app, r), OAuthButtons: NewOAuthButtons(app.Config()), To: r.FormValue("to"), Message: template.HTML(""), Flashes: []template.HTML{}, LoginUsername: getTempInfo(app, "login-user", r, w), } if earlyError != "" { p.Flashes = append(p.Flashes, template.HTML(earlyError)) } // Display any error messages flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = pages["login.tmpl"].ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render login: %v", err) return err } return nil } func webLogin(app *App, w http.ResponseWriter, r *http.Request) error { err := login(app, w, r) if err != nil { username := r.FormValue("alias") // Login request was unsuccessful; save the error in the session and redirect them if err, ok := err.(impart.HTTPError); ok { session, _ := app.sessionStore.Get(r, cookieName) if session != nil { session.AddFlash(err.Message) session.Save(r, w) } if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 { // Retain fixed username recommendation for the login form username = m[1] } } // Pass along certain information saveTempInfo(app, "login-user", username, r, w) // Retain post-login URL if one was given redirectTo := "/login" postLoginRedirect := r.FormValue("to") if postLoginRedirect != "" { redirectTo += "?to=" + postLoginRedirect } log.Error("Unable to login: %v", err) return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo} } return nil } var loginAttemptUsers = sync.Map{} func login(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) oneTimeToken := r.FormValue("with") verbose := r.FormValue("all") == "true" || r.FormValue("verbose") == "1" || r.FormValue("verbose") == "true" || (reqJSON && oneTimeToken != "") redirectTo := r.FormValue("to") if redirectTo == "" { if app.cfg.App.SingleUser { redirectTo = "/me/new" } else { redirectTo = "/" } } var u *User var err error var signin userCredentials if app.cfg.App.DisablePasswordAuth { err := ErrDisabledPasswordAuth return err } // Log in with one-time token if one is given if oneTimeToken != "" { log.Info("Login: Logging user in via token.") userID := app.db.GetUserID(oneTimeToken) if userID == -1 { log.Error("Login: Got user -1 from token") err := ErrBadAccessToken err.Message = "Expired or invalid login code." return err } log.Info("Login: Found user %d.", userID) u, err = app.db.GetUserByID(userID) if err != nil { log.Error("Unable to fetch user on one-time token login: %v", err) return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."} } log.Info("Login: Got user via token") } else { // Get params if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&signin) if err != nil { log.Error("Couldn't parse signin JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse signin form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&signin, r.PostForm) if err != nil { log.Error("Couldn't decode signin form request: %v\n", err) return ErrBadFormData } } log.Info("Login: Attempting login for '%s'", signin.Alias) // Validate required params (all) if signin.Alias == "" { msg := "Parameter `alias` required." if signin.Web { msg = "A username is required." } return impart.HTTPError{http.StatusBadRequest, msg} } if !signin.EmailLogin && signin.Pass == "" { msg := "Parameter `pass` required." if signin.Web { msg = "A password is required." } return impart.HTTPError{http.StatusBadRequest, msg} } // Prevent excessive login attempts on the same account // Skip this check in dev environment if !app.cfg.Server.Dev { now := time.Now() attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration)) if att { if attemptExpTime, ok := attemptExp.(time.Time); ok { if attemptExpTime.After(now) { // This user attempted previously, and the period hasn't expired yet return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."} } else { // This user attempted previously, but the time expired; free up space loginAttemptUsers.Delete(signin.Alias) } } else { log.Error("Unable to cast expiration to time") } } } // Retrieve password u, err = app.db.GetUserForAuth(signin.Alias) if err != nil { log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err) if strings.IndexAny(signin.Alias, "@") > 0 { log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message) return ErrUserNotFoundEmail } return err } // Authenticate if u.Email.String == "" { // User has no email set, so check if they haven't added a password, either, // so we can return a more helpful error message. if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass { - log.Info("Tried logging in to %s, but no password or email.", signin.Alias) + log.Info("Tried logging into %s, but no password or email.", signin.Alias) return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."} } } if len(u.HashedPass) == 0 { return impart.HTTPError{http.StatusUnauthorized, "This user never set a password. Perhaps try logging in via OAuth?"} } if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } } if reqJSON && !signin.Web { var token string if r.Header.Get("User-Agent") == "" { // Get last created token when User-Agent is empty token = app.db.FetchLastAccessToken(u.ID) if token == "" { token, err = app.db.GetAccessToken(u.ID) } } else { token, err = app.db.GetAccessToken(u.ID) } if err != nil { log.Error("Login: Unable to create access token: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser := getVerboseAuthUser(app, token, u, verbose) return impart.WriteSuccess(w, resUser, http.StatusOK) } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Login: Session: %v; ignoring", err) } // Remove unwanted data session.Values[cookieUserVal] = u.Cookie() err = session.Save(r, w) if err != nil { log.Error("Login: Couldn't save session: %v", err) // TODO: return error } // Send success if reqJSON { return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK) } log.Info("Login: Redirecting to %s", redirectTo) w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func getVerboseAuthUser(app *App, token string, u *User, verbose bool) *AuthUser { resUser := &AuthUser{ AccessToken: token, User: u, } // Fetch verbose user data if requested if verbose { posts, err := app.db.GetUserPosts(u) if err != nil { log.Error("Login: Unable to get user posts: %v", err) } colls, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("Login: Unable to get user collections: %v", err) } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { - // TODO: correct error meesage + // TODO: correct error message log.Error("Login: Unable to get user collections: %v", err) } resUser.Posts = posts resUser.Collections = colls resUser.User.HasPass = passIsSet } return resUser } func viewExportOptions(app *App, u *User, w http.ResponseWriter, r *http.Request) error { // Fetch extra user data p := NewUserPage(app, r, u, "Export", nil) showUserPage(w, "export", p) return nil } func viewExportPosts(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var filename string var u = &User{} reqJSON := IsJSON(r) if reqJSON { // Use given Authorization header accessToken := r.Header.Get("Authorization") if accessToken == "" { return nil, filename, ErrNoAccessToken } userID := app.db.GetUserID(accessToken) if userID == -1 { return nil, filename, ErrBadAccessToken } var err error u, err = app.db.GetUserByID(userID) if err != nil { return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."} } } else { // Use user cookie session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Session: %v; ignoring", err) } val := session.Values[cookieUserVal] var ok bool if u, ok = val.(*User); !ok { return nil, filename, ErrNotLoggedIn } } filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") // Fetch data we're exporting var err error var data []byte posts, err := app.db.GetUserPosts(u) if err != nil { return data, filename, err } // Export as CSV if strings.HasSuffix(r.URL.Path, ".csv") { data = exportPostsCSV(app.cfg.App.Host, u, posts) return data, filename, err } if strings.HasSuffix(r.URL.Path, ".zip") { data = exportPostsZip(u, posts) return data, filename, err } if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(posts, "", "\t") } else { data, err = json.Marshal(posts) } return data, filename, err } func viewExportFull(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var err error filename := "" u := getUserSession(app, r) if u == nil { return nil, filename, ErrNotLoggedIn } filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") exportUser := compileFullExport(app, u) var data []byte if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(exportUser, "", "\t") } else { data, err = json.Marshal(exportUser) } return data, filename, err } func viewMeAPI(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) uObj := struct { ID int64 `json:"id,omitempty"` Username string `json:"username,omitempty"` }{} var err error if reqJSON { _, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization")) if err != nil { return err } } else { u := getUserSession(app, r) if u == nil { return impart.WriteSuccess(w, uObj, http.StatusOK) } uObj.Username = u.Username } return impart.WriteSuccess(w, uObj, http.StatusOK) } func viewMyPostsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) if !reqJSON { return ErrBadRequestedType } isAnonPosts := r.FormValue("anonymous") == "1" if isAnonPosts { pageStr := r.FormValue("page") pg, err := strconv.Atoi(pageStr) if err != nil { log.Error("Error parsing page parameter '%s': %s", pageStr, err) pg = 1 } p, err := app.db.GetAnonymousPosts(u, pg) if err != nil { return err } return impart.WriteSuccess(w, p, http.StatusOK) } var err error p := GetPostsCache(u.ID) if p == nil { userPostsCache.Lock() if userPostsCache.users[u.ID].ready == nil { userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})} userPostsCache.Unlock() p, err = app.db.GetUserPosts(u) if err != nil { return err } CachePosts(u.ID, p) } else { userPostsCache.Unlock() <-userPostsCache.users[u.ID].ready p = GetPostsCache(u.ID) } } return impart.WriteSuccess(w, p, http.StatusOK) } func viewMyCollectionsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) if !reqJSON { return ErrBadRequestedType } p, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { return err } return impart.WriteSuccess(w, p, http.StatusOK) } func viewArticles(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p, err := app.db.GetAnonymousPosts(u, 1) if err != nil { log.Error("unable to fetch anon posts: %v", err) } // nil-out AnonymousPosts slice for easy detection in the template if p != nil && len(*p) == 0 { p = nil } f, err := getSessionFlashes(app, w, r, nil) if err != nil { log.Error("unable to fetch flashes: %v", err) } c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { + if err == ErrUserNotFound { + return err + } log.Error("view articles: %v", err) } d := struct { *UserPage AnonymousPosts *[]PublicPost Collections *[]Collection Silenced bool }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f), AnonymousPosts: p, Collections: c, Silenced: silenced, } d.UserPage.SetMessaging(u) w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT") showUserPage(w, "articles", d) return nil } func viewCollections(app *App, u *User, w http.ResponseWriter, r *http.Request) error { c, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) return fmt.Errorf("No collections") } f, _ := getSessionFlashes(app, w, r, nil) uc, _ := app.db.GetUserCollectionCount(u.ID) // TODO: handle any errors silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { - log.Error("view collections %v", err) + if err == ErrUserNotFound { + return err + } + log.Error("view collections: %v", err) return fmt.Errorf("view collections: %v", err) } d := struct { *UserPage Collections *[]Collection UsedCollections, TotalCollections int NewBlogsDisabled bool Silenced bool }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f), Collections: c, UsedCollections: int(uc), NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc), Silenced: silenced, } d.UserPage.SetMessaging(u) showUserPage(w, "collections", d) return nil } func viewEditCollection(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) c, err := app.db.GetCollection(vars["collection"]) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } - // Add collection properties - c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer") - silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { + if err == ErrUserNotFound { + return err + } log.Error("view edit collection %v", err) return fmt.Errorf("view edit collection: %v", err) } flashes, _ := getSessionFlashes(app, w, r, nil) obj := struct { *UserPage *Collection Silenced bool + + config.EmailCfg + LetterReplyTo string }{ UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes), Collection: c, Silenced: silenced, + EmailCfg: app.cfg.Email, } obj.UserPage.CollAlias = c.Alias + if obj.EmailCfg.Enabled() { + obj.LetterReplyTo = app.db.GetCollectionAttribute(c.ID, collAttrLetterReplyTo) + } showUserPage(w, "collection", obj) return nil } func updateSettings(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) var s userSettings var u *User var sess *sessions.Session var err error if reqJSON { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } u, err = app.db.GetAPIUser(accessToken) if err != nil { return ErrBadAccessToken } decoder := json.NewDecoder(r.Body) err := decoder.Decode(&s) if err != nil { log.Error("Couldn't parse settings JSON request: %v\n", err) return ErrBadJSON } // Prevent all username updates // TODO: support changing username via JSON API request s.Username = "" } else { u, sess = getUserAndSession(app, r) if u == nil { return ErrNotLoggedIn } err := r.ParseForm() if err != nil { log.Error("Couldn't parse settings form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&s, r.PostForm) if err != nil { log.Error("Couldn't decode settings form request: %v\n", err) return ErrBadFormData } } // Do update postUpdateReturn := r.FormValue("return") redirectTo := "/me/settings" if s.IsLogOut { redirectTo += "?logout=1" } else if postUpdateReturn != "" { redirectTo = postUpdateReturn } // Only do updates on values we need if s.Username != "" && s.Username == u.Username { // Username hasn't actually changed; blank it out s.Username = "" } err = app.db.ChangeSettings(app, u, &s) if err != nil { if reqJSON { return err } if err, ok := err.(impart.HTTPError); ok { addSessionFlash(app, w, r, err.Message, nil) } } else { // Successful update. if reqJSON { return impart.WriteSuccess(w, u, http.StatusOK) } if s.IsLogOut { redirectTo = "/me/logout" } else { sess.Values[cookieUserVal] = u.Cookie() addSessionFlash(app, w, r, "Account updated.", nil) } } w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func updatePassphrase(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } curPass := r.FormValue("current") newPass := r.FormValue("new") // Ensure a new password is given (always required) if newPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide a new password."} } userID, sudo := app.db.GetUserIDPrivilege(accessToken) if userID == -1 { return ErrBadAccessToken } // Ensure a current password is given if the access token doesn't have sudo // privileges. if !sudo && curPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide current password."} } // Hash the new password hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Do update err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass) if err != nil { return err } return impart.WriteSuccess(w, struct{}{}, http.StatusOK) } func viewStats(app *App, u *User, w http.ResponseWriter, r *http.Request) error { var c *Collection var err error vars := mux.Vars(r) alias := vars["collection"] if alias != "" { c, err = app.db.GetCollection(alias) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } c.hostName = app.cfg.App.Host } topPosts, err := app.db.GetTopPosts(u, alias, c.hostName) if err != nil { log.Error("Unable to get top posts: %v", err) return err } flashes, _ := getSessionFlashes(app, w, r, nil) titleStats := "" if c != nil { titleStats = c.DisplayTitle() + " " } silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { + if err == ErrUserNotFound { + return err + } log.Error("view stats: %v", err) return err } obj := struct { *UserPage - VisitsBlog string - Collection *Collection - TopPosts *[]PublicPost - APFollowers int - Silenced bool + VisitsBlog string + Collection *Collection + TopPosts *[]PublicPost + APFollowers int + EmailEnabled bool + EmailSubscribers int + Silenced bool }{ - UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes), - VisitsBlog: alias, - Collection: c, - TopPosts: topPosts, - Silenced: silenced, + UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes), + VisitsBlog: alias, + Collection: c, + TopPosts: topPosts, + EmailEnabled: app.cfg.Email.Enabled(), + Silenced: silenced, } obj.UserPage.CollAlias = c.Alias if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(c) if err != nil { return err } obj.APFollowers = len(*folls) } + if obj.EmailEnabled { + subs, err := app.db.GetEmailSubscribers(c.ID, true) + if err != nil { + return err + } + obj.EmailSubscribers = len(subs) + } showUserPage(w, "stats", obj) return nil } +func handleViewSubscribers(app *App, u *User, w http.ResponseWriter, r *http.Request) error { + vars := mux.Vars(r) + c, err := app.db.GetCollection(vars["collection"]) + if err != nil { + return err + } + + filter := r.FormValue("filter") + + flashes, _ := getSessionFlashes(app, w, r, nil) + obj := struct { + *UserPage + Collection CollectionNav + EmailSubs []*EmailSubscriber + Followers *[]RemoteUser + Silenced bool + + Filter string + FederationEnabled bool + CanEmailSub bool + CanAddSubs bool + EmailSubsEnabled bool + }{ + UserPage: NewUserPage(app, r, u, c.DisplayTitle()+" Subscribers", flashes), + Collection: CollectionNav{ + Collection: c, + Path: r.URL.Path, + SingleUser: app.cfg.App.SingleUser, + }, + Silenced: u.IsSilenced(), + Filter: filter, + FederationEnabled: app.cfg.App.Federation, + CanEmailSub: app.cfg.Email.Enabled(), + EmailSubsEnabled: c.EmailSubsEnabled(), + } + + obj.Followers, err = app.db.GetAPFollowers(c) + if err != nil { + return err + } + + obj.EmailSubs, err = app.db.GetEmailSubscribers(c.ID, true) + if err != nil { + return err + } + + if obj.Filter == "" { + // Set permission to add email subscribers + //obj.CanAddSubs = app.db.GetUserAttribute(c.OwnerID, userAttrCanAddEmailSubs) == "1" + } + + showUserPage(w, "subscribers", obj) + return nil +} + func viewSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error { fullUser, err := app.db.GetUserByID(u.ID) if err != nil { + if err == ErrUserNotFound { + return err + } log.Error("Unable to get user for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { log.Error("Unable to get isUserPassSet for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } flashes, _ := getSessionFlashes(app, w, r, nil) enableOauthSlack := app.Config().SlackOauth.ClientID != "" enableOauthWriteAs := app.Config().WriteAsOauth.ClientID != "" enableOauthGitLab := app.Config().GitlabOauth.ClientID != "" enableOauthGeneric := app.Config().GenericOauth.ClientID != "" enableOauthGitea := app.Config().GiteaOauth.ClientID != "" oauthAccounts, err := app.db.GetOauthAccounts(r.Context(), u.ID) if err != nil { log.Error("Unable to get oauth accounts for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } for idx, oauthAccount := range oauthAccounts { switch oauthAccount.Provider { case "slack": enableOauthSlack = false case "write.as": enableOauthWriteAs = false case "gitlab": enableOauthGitLab = false case "generic": oauthAccounts[idx].DisplayName = app.Config().GenericOauth.DisplayName oauthAccounts[idx].AllowDisconnect = app.Config().GenericOauth.AllowDisconnect enableOauthGeneric = false case "gitea": enableOauthGitea = false } } displayOauthSection := enableOauthSlack || enableOauthWriteAs || enableOauthGitLab || enableOauthGeneric || enableOauthGitea || len(oauthAccounts) > 0 obj := struct { *UserPage Email string HasPass bool IsLogOut bool Silenced bool CSRFField template.HTML OauthSection bool OauthAccounts []oauthAccountInfo OauthSlack bool OauthWriteAs bool OauthGitLab bool GitLabDisplayName string OauthGeneric bool OauthGenericDisplayName string OauthGitea bool GiteaDisplayName string }{ UserPage: NewUserPage(app, r, u, "Account Settings", flashes), Email: fullUser.EmailClear(app.keys), HasPass: passIsSet, IsLogOut: r.FormValue("logout") == "1", Silenced: fullUser.IsSilenced(), CSRFField: csrf.TemplateField(r), OauthSection: displayOauthSection, OauthAccounts: oauthAccounts, OauthSlack: enableOauthSlack, OauthWriteAs: enableOauthWriteAs, OauthGitLab: enableOauthGitLab, GitLabDisplayName: config.OrDefaultString(app.Config().GitlabOauth.DisplayName, gitlabDisplayName), OauthGeneric: enableOauthGeneric, OauthGenericDisplayName: config.OrDefaultString(app.Config().GenericOauth.DisplayName, genericOauthDisplayName), OauthGitea: enableOauthGitea, GiteaDisplayName: config.OrDefaultString(app.Config().GiteaOauth.DisplayName, giteaDisplayName), } showUserPage(w, "settings", obj) return nil } +func loginViaEmail(app *App, alias, redirectTo string) error { + if !app.cfg.Email.Enabled() { + return fmt.Errorf("EMAIL ISN'T CONFIGURED on this server") + } + + // Make sure user has added an email + // TODO: create a new func to just get user's email; "ForAuth" doesn't match here + u, _ := app.db.GetUserForAuth(alias) + if u == nil { + if strings.IndexAny(alias, "@") > 0 { + return ErrUserNotFoundEmail + } + return ErrUserNotFound + } + if u.Email.String == "" { + return impart.HTTPError{http.StatusPreconditionFailed, "User doesn't have an email address. Log in with password, instead."} + } + + // Generate one-time login token + t, err := app.db.GetTemporaryOneTimeAccessToken(u.ID, 60*15, true) + if err != nil { + log.Error("Unable to generate token for email login: %s", err) + return impart.HTTPError{http.StatusInternalServerError, "Unable to generate token."} + } + + // Send email + gun := mailgun.NewMailgun(app.cfg.Email.Domain, app.cfg.Email.MailgunPrivate) + toEmail := u.EmailClear(app.keys) + footerPara := "This link will only work once and expires in 15 minutes. Didn't ask us to log in? You can safely ignore this email." + + plainMsg := fmt.Sprintf("Log in to %s here: %s/login?to=%s&with=%s\n\n%s", app.cfg.App.SiteName, app.cfg.App.Host, redirectTo, t, footerPara) + m := mailgun.NewMessage(app.cfg.App.SiteName+" ", "Log in to "+app.cfg.App.SiteName, plainMsg, fmt.Sprintf("<%s>", toEmail)) + m.AddTag("Email Login") + + m.SetHtml(fmt.Sprintf(` + +
+

%s

+

Log in to %s here.

+

%s

+
+ +`, app.cfg.App.Host, app.cfg.App.SiteName, app.cfg.App.Host, redirectTo, t, app.cfg.App.SiteName, footerPara)) + _, _, err = gun.Send(m) + + return err +} + func saveTempInfo(app *App, key, val string, r *http.Request, w http.ResponseWriter) error { session, err := app.sessionStore.Get(r, "t") if err != nil { return ErrInternalCookieSession } session.Values[key] = val err = session.Save(r, w) if err != nil { log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err) } return err } func getTempInfo(app *App, key string, r *http.Request, w http.ResponseWriter) string { session, err := app.sessionStore.Get(r, "t") if err != nil { return "" } // Get the information var s = "" var ok bool if s, ok = session.Values[key].(string); !ok { return "" } // Delete cookie session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't erase temp data for key %s: %v", key, err) } // Return value return s } func handleUserDelete(app *App, u *User, w http.ResponseWriter, r *http.Request) error { if !app.cfg.App.OpenDeletion { return impart.HTTPError{http.StatusForbidden, "Open account deletion is disabled on this instance."} } confirmUsername := r.PostFormValue("confirm-username") if u.Username != confirmUsername { return impart.HTTPError{http.StatusBadRequest, "Confirmation username must match your username exactly."} } // Check for account deletion safeguards in place if u.IsAdmin() { return impart.HTTPError{http.StatusForbidden, "Cannot delete admin."} } err := app.db.DeleteAccount(u.ID) if err != nil { log.Error("user delete account: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not delete account: %v", err)} } // FIXME: This doesn't ever appear to the user, as (I believe) the value is erased when the session cookie is reset _ = addSessionFlash(app, w, r, "Thanks for writing with us! You account was deleted successfully.", nil) return impart.HTTPError{http.StatusFound, "/me/logout"} } func removeOauth(app *App, u *User, w http.ResponseWriter, r *http.Request) error { provider := r.FormValue("provider") clientID := r.FormValue("client_id") remoteUserID := r.FormValue("remote_user_id") err := app.db.RemoveOauth(r.Context(), u.ID, provider, clientID, remoteUserID) if err != nil { return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()} } return impart.HTTPError{Status: http.StatusFound, Message: "/me/settings"} } func prepareUserEmail(input string, emailKey []byte) zero.String { email := zero.NewString("", input != "") if len(input) > 0 { encEmail, err := data.Encrypt(emailKey, input) if err != nil { log.Error("Unable to encrypt email: %s\n", err) } else { email.String = string(encEmail) } } return email } diff --git a/account_import.go b/account_import.go index b34f3a7..656852f 100644 --- a/account_import.go +++ b/account_import.go @@ -1,195 +1,194 @@ package writefreely import ( "encoding/json" "fmt" "html/template" "io" - "io/ioutil" "net/http" "os" "path/filepath" "strings" "time" "github.com/hashicorp/go-multierror" "github.com/writeas/impart" wfimport "github.com/writeas/import" "github.com/writeas/web-core/log" ) func viewImport(app *App, u *User, w http.ResponseWriter, r *http.Request) error { // Fetch extra user data p := NewUserPage(app, r, u, "Import Posts", nil) c, err := app.db.GetCollections(u, app.Config().App.Host) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("unable to fetch collections: %v", err)} } d := struct { *UserPage Collections *[]Collection Flashes []template.HTML Message string InfoMsg bool }{ UserPage: p, Collections: c, Flashes: []template.HTML{}, } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { if strings.HasPrefix(flash, "SUCCESS: ") { d.Message = strings.TrimPrefix(flash, "SUCCESS: ") } else if strings.HasPrefix(flash, "INFO: ") { d.Message = strings.TrimPrefix(flash, "INFO: ") d.InfoMsg = true } else { d.Flashes = append(d.Flashes, template.HTML(flash)) } } showUserPage(w, "import", d) return nil } func handleImport(app *App, u *User, w http.ResponseWriter, r *http.Request) error { // limit 10MB per submission r.ParseMultipartForm(10 << 20) collAlias := r.PostFormValue("collection") coll := &Collection{ ID: 0, } var err error if collAlias != "" { coll, err = app.db.GetCollection(collAlias) if err != nil { log.Error("Unable to get collection for import: %s", err) return err } // Only allow uploading to collection if current user is owner if coll.OwnerID != u.ID { err := ErrUnauthorizedGeneral _ = addSessionFlash(app, w, r, err.Message, nil) return err } coll.hostName = app.cfg.App.Host } fileDates := make(map[string]int64) err = json.Unmarshal([]byte(r.FormValue("fileDates")), &fileDates) if err != nil { log.Error("invalid form data for file dates: %v", err) return impart.HTTPError{http.StatusBadRequest, "form data for file dates was invalid"} } files := r.MultipartForm.File["files"] var fileErrs []error filesSubmitted := len(files) var filesImported int for _, formFile := range files { fname := "" ok := func() bool { file, err := formFile.Open() if err != nil { fileErrs = append(fileErrs, fmt.Errorf("Unable to read file %s", formFile.Filename)) log.Error("import file: open from form: %v", err) return false } defer file.Close() - tempFile, err := ioutil.TempFile("", "post-upload-*.txt") + tempFile, err := os.CreateTemp("", "post-upload-*.txt") if err != nil { fileErrs = append(fileErrs, fmt.Errorf("Internal error for %s", formFile.Filename)) log.Error("import file: create temp file %s: %v", formFile.Filename, err) return false } defer tempFile.Close() _, err = io.Copy(tempFile, file) if err != nil { fileErrs = append(fileErrs, fmt.Errorf("Internal error for %s", formFile.Filename)) log.Error("import file: copy to temp location %s: %v", formFile.Filename, err) return false } info, err := tempFile.Stat() if err != nil { fileErrs = append(fileErrs, fmt.Errorf("Internal error for %s", formFile.Filename)) log.Error("import file: stat temp file %s: %v", formFile.Filename, err) return false } fname = info.Name() return true }() if !ok { continue } post, err := wfimport.FromFile(filepath.Join(os.TempDir(), fname)) if err == wfimport.ErrEmptyFile { // not a real error so don't log _ = addSessionFlash(app, w, r, fmt.Sprintf("%s was empty, import skipped", formFile.Filename), nil) continue } else if err == wfimport.ErrInvalidContentType { // same as above _ = addSessionFlash(app, w, r, fmt.Sprintf("%s is not a supported post file", formFile.Filename), nil) continue } else if err != nil { fileErrs = append(fileErrs, fmt.Errorf("failed to read copy of %s", formFile.Filename)) log.Error("import textfile: file to post: %v", err) continue } if collAlias != "" { post.Collection = collAlias } dateTime := time.Unix(fileDates[formFile.Filename], 0) post.Created = &dateTime created := post.Created.Format("2006-01-02T15:04:05Z") submittedPost := SubmittedPost{ Title: &post.Title, Content: &post.Content, Font: "norm", Created: &created, } rp, err := app.db.CreatePost(u.ID, coll.ID, &submittedPost) if err != nil { fileErrs = append(fileErrs, fmt.Errorf("failed to create post from %s", formFile.Filename)) log.Error("import textfile: create db post: %v", err) continue } // Federate post, if necessary if app.cfg.App.Federation && coll.ID > 0 { go federatePost( app, &PublicPost{ Post: rp, Collection: &CollectionObj{ Collection: *coll, }, }, coll.ID, false, ) } filesImported++ } if len(fileErrs) != 0 { _ = addSessionFlash(app, w, r, multierror.ListFormatFunc(fileErrs), nil) } if filesImported == filesSubmitted { verb := "posts" if filesSubmitted == 1 { verb = "post" } _ = addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: Import complete, %d %s imported.", filesImported, verb), nil) } else if filesImported > 0 { _ = addSessionFlash(app, w, r, fmt.Sprintf("INFO: %d of %d posts imported, see details below.", filesImported, filesSubmitted), nil) } return impart.HTTPError{http.StatusFound, "/me/import"} } diff --git a/activitypub.go b/activitypub.go index 720d5c9..02fb9e7 100644 --- a/activitypub.go +++ b/activitypub.go @@ -1,874 +1,939 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "bytes" "crypto/sha256" "database/sql" "encoding/base64" "encoding/json" "fmt" - "io/ioutil" + "io" "net/http" "net/http/httputil" "net/url" "path/filepath" "strconv" + "strings" "time" "github.com/gorilla/mux" "github.com/writeas/activity/streams" + "github.com/writeas/activityserve" "github.com/writeas/httpsig" "github.com/writeas/impart" "github.com/writeas/web-core/activitypub" "github.com/writeas/web-core/activitystreams" "github.com/writeas/web-core/id" "github.com/writeas/web-core/log" + "github.com/writeas/web-core/silobridge" ) const ( // TODO: delete. don't use this! apCustomHandleDefault = "blog" apCacheTime = time.Minute ) var instanceColl *Collection func initActivityPub(app *App) { ur, _ := url.Parse(app.cfg.App.Host) instanceColl = &Collection{ ID: 0, Alias: ur.Host, Title: ur.Host, db: app.db, hostName: app.cfg.App.Host, } } type RemoteUser struct { ID int64 ActorID string Inbox string SharedInbox string + URL string Handle string } func (ru *RemoteUser) AsPerson() *activitystreams.Person { return &activitystreams.Person{ BaseObject: activitystreams.BaseObject{ Type: "Person", Context: []interface{}{ activitystreams.Namespace, }, ID: ru.ActorID, }, Inbox: ru.Inbox, Endpoints: activitystreams.Endpoints{ SharedInbox: ru.SharedInbox, }, } } func activityPubClient() *http.Client { return &http.Client{ Timeout: 15 * time.Second, } } func handleFetchCollectionActivities(app *App, w http.ResponseWriter, r *http.Request) error { w.Header().Set("Server", serverSoftware) vars := mux.Vars(r) alias := vars["alias"] if alias == "" { alias = filepath.Base(r.RequestURI) } // TODO: enforce visibility // Get base Collection data var c *Collection var err error if alias == r.Host { c = instanceColl } else if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { return err } c.hostName = app.cfg.App.Host if !c.IsInstanceColl() { silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("fetch collection activities: %v", err) return ErrInternalGeneral } if silenced { return ErrCollectionNotFound } } p := c.PersonObject() setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, p, http.StatusOK) } func handleFetchCollectionOutbox(app *App, w http.ResponseWriter, r *http.Request) error { w.Header().Set("Server", serverSoftware) vars := mux.Vars(r) alias := vars["alias"] // TODO: enforce visibility // Get base Collection data var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { return err } silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("fetch collection outbox: %v", err) return ErrInternalGeneral } if silenced { return ErrCollectionNotFound } c.hostName = app.cfg.App.Host if app.cfg.App.SingleUser { if alias != c.Alias { return ErrCollectionNotFound } } res := &CollectionObj{Collection: *c} app.db.GetPostsCount(res, false) accountRoot := c.FederatedAccount() page := r.FormValue("page") p, err := strconv.Atoi(page) if err != nil || p < 1 { // Return outbox oc := activitystreams.NewOrderedCollection(accountRoot, "outbox", res.TotalPosts) return impart.RenderActivityJSON(w, oc, http.StatusOK) } // Return outbox page ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "outbox", res.TotalPosts, p) ocp.OrderedItems = []interface{}{} posts, err := app.db.GetPosts(app.cfg, c, p, false, true, false) for _, pp := range *posts { pp.Collection = res o := pp.ActivityObject(app) a := activitystreams.NewCreateActivity(o) a.Context = nil ocp.OrderedItems = append(ocp.OrderedItems, *a) } setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, ocp, http.StatusOK) } func handleFetchCollectionFollowers(app *App, w http.ResponseWriter, r *http.Request) error { w.Header().Set("Server", serverSoftware) vars := mux.Vars(r) alias := vars["alias"] // TODO: enforce visibility // Get base Collection data var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { return err } silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("fetch collection followers: %v", err) return ErrInternalGeneral } if silenced { return ErrCollectionNotFound } c.hostName = app.cfg.App.Host accountRoot := c.FederatedAccount() folls, err := app.db.GetAPFollowers(c) if err != nil { return err } page := r.FormValue("page") p, err := strconv.Atoi(page) if err != nil || p < 1 { // Return outbox oc := activitystreams.NewOrderedCollection(accountRoot, "followers", len(*folls)) return impart.RenderActivityJSON(w, oc, http.StatusOK) } // Return outbox page ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "followers", len(*folls), p) ocp.OrderedItems = []interface{}{} /* for _, f := range *folls { ocp.OrderedItems = append(ocp.OrderedItems, f.ActorID) } */ setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, ocp, http.StatusOK) } func handleFetchCollectionFollowing(app *App, w http.ResponseWriter, r *http.Request) error { w.Header().Set("Server", serverSoftware) vars := mux.Vars(r) alias := vars["alias"] // TODO: enforce visibility // Get base Collection data var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { return err } silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("fetch collection following: %v", err) return ErrInternalGeneral } if silenced { return ErrCollectionNotFound } c.hostName = app.cfg.App.Host accountRoot := c.FederatedAccount() page := r.FormValue("page") p, err := strconv.Atoi(page) if err != nil || p < 1 { // Return outbox oc := activitystreams.NewOrderedCollection(accountRoot, "following", 0) return impart.RenderActivityJSON(w, oc, http.StatusOK) } // Return outbox page ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "following", 0, p) ocp.OrderedItems = []interface{}{} setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, ocp, http.StatusOK) } func handleFetchCollectionInbox(app *App, w http.ResponseWriter, r *http.Request) error { w.Header().Set("Server", serverSoftware) vars := mux.Vars(r) alias := vars["alias"] var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { // TODO: return Reject? return err } silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("fetch collection inbox: %v", err) return ErrInternalGeneral } if silenced { return ErrCollectionNotFound } c.hostName = app.cfg.App.Host if debugging { dump, err := httputil.DumpRequest(r, true) if err != nil { log.Error("Can't dump: %v", err) } else { log.Info("Rec'd! %q", dump) } } var m map[string]interface{} if err := json.NewDecoder(r.Body).Decode(&m); err != nil { return err } a := streams.NewAccept() p := c.PersonObject() var to *url.URL var isFollow, isUnfollow bool fullActor := &activitystreams.Person{} var remoteUser *RemoteUser res := &streams.Resolver{ FollowCallback: func(f *streams.Follow) error { isFollow = true // 1) Use the Follow concrete type here // 2) Errors are propagated to res.Deserialize call below m["@context"] = []string{activitystreams.Namespace} b, _ := json.Marshal(m) if debugging { log.Info("Follow: %s", b) } _, followID := f.GetId() if followID == nil { log.Error("Didn't resolve follow ID") } else { aID := c.FederatedAccount() + "#accept-" + id.GenerateFriendlyRandomString(20) acceptID, err := url.Parse(aID) if err != nil { log.Error("Couldn't parse generated Accept URL '%s': %v", aID, err) } a.SetId(acceptID) } a.AppendObject(f.Raw()) _, to = f.GetActor(0) obj := f.Raw().GetObjectIRI(0) a.AppendActor(obj) // First get actor information if to == nil { return fmt.Errorf("No valid `to` string") } fullActor, remoteUser, err = getActor(app, to.String()) if err != nil { return err } return impart.RenderActivityJSON(w, m, http.StatusOK) }, UndoCallback: func(u *streams.Undo) error { isUnfollow = true m["@context"] = []string{activitystreams.Namespace} b, _ := json.Marshal(m) if debugging { log.Info("Undo: %s", b) } a.AppendObject(u.Raw()) _, to = u.GetActor(0) // TODO: get actor from object.object, not object obj := u.Raw().GetObjectIRI(0) a.AppendActor(obj) if to != nil { // Populate fullActor from DB? remoteUser, err = getRemoteUser(app, to.String()) if err != nil { if iErr, ok := err.(*impart.HTTPError); ok { if iErr.Status == http.StatusNotFound { log.Error("No remoteuser info for Undo event!") } } return err } else { fullActor = remoteUser.AsPerson() } } else { log.Error("No to on Undo!") } return impart.RenderActivityJSON(w, m, http.StatusOK) }, } if err := res.Deserialize(m); err != nil { // 3) Any errors from #2 can be handled, or the payload is an unknown type. log.Error("Unable to resolve Follow: %v", err) if debugging { log.Error("Map: %s", m) } return err } go func() { if to == nil { if debugging { log.Error("No `to` value!") } return } time.Sleep(2 * time.Second) am, err := a.Serialize() if err != nil { log.Error("Unable to serialize Accept: %v", err) return } am["@context"] = []string{activitystreams.Namespace} err = makeActivityPost(app.cfg.App.Host, p, fullActor.Inbox, am) if err != nil { log.Error("Unable to make activity POST: %v", err) return } if isFollow { t, err := app.db.Begin() if err != nil { log.Error("Unable to start transaction: %v", err) return } var followerID int64 if remoteUser != nil { followerID = remoteUser.ID } else { // Add follower locally, since it wasn't found before - res, err := t.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox) VALUES (?, ?, ?)", fullActor.ID, fullActor.Inbox, fullActor.Endpoints.SharedInbox) + res, err := t.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, url) VALUES (?, ?, ?, ?)", fullActor.ID, fullActor.Inbox, fullActor.Endpoints.SharedInbox, fullActor.URL) if err != nil { // if duplicate key, res will be nil and panic on // res.LastInsertId below t.Rollback() log.Error("Couldn't add new remoteuser in DB: %v\n", err) return } followerID, err = res.LastInsertId() if err != nil { t.Rollback() log.Error("no lastinsertid for followers, rolling back: %v", err) return } // Add in key _, err = t.Exec("INSERT INTO remoteuserkeys (id, remote_user_id, public_key) VALUES (?, ?, ?)", fullActor.PublicKey.ID, followerID, fullActor.PublicKey.PublicKeyPEM) if err != nil { if !app.db.isDuplicateKeyErr(err) { t.Rollback() log.Error("Couldn't add follower keys in DB: %v\n", err) return } } } // Add follow _, err = t.Exec("INSERT INTO remotefollows (collection_id, remote_user_id, created) VALUES (?, ?, "+app.db.now()+")", c.ID, followerID) if err != nil { if !app.db.isDuplicateKeyErr(err) { t.Rollback() log.Error("Couldn't add follower in DB: %v\n", err) return } } err = t.Commit() if err != nil { t.Rollback() log.Error("Rolling back after Commit(): %v\n", err) return } } else if isUnfollow { // Remove follower locally _, err = app.db.Exec("DELETE FROM remotefollows WHERE collection_id = ? AND remote_user_id = (SELECT id FROM remoteusers WHERE actor_id = ?)", c.ID, to.String()) if err != nil { log.Error("Couldn't remove follower from DB: %v\n", err) } } }() return nil } func makeActivityPost(hostName string, p *activitystreams.Person, url string, m interface{}) error { log.Info("POST %s", url) b, err := json.Marshal(m) if err != nil { return err } r, _ := http.NewRequest("POST", url, bytes.NewBuffer(b)) r.Header.Add("Content-Type", "application/activity+json") r.Header.Set("User-Agent", ServerUserAgent(hostName)) h := sha256.New() h.Write(b) r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil))) // Sign using the 'Signature' header privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey()) if err != nil { return err } signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"}) err = signer.SignSigHeader(r) if err != nil { log.Error("Can't sign: %v", err) } if debugging { dump, err := httputil.DumpRequestOut(r, true) if err != nil { log.Error("Can't dump: %v", err) } else { log.Info("%s", dump) } } resp, err := activityPubClient().Do(r) if err != nil { return err } if resp != nil && resp.Body != nil { defer resp.Body.Close() } - body, err := ioutil.ReadAll(resp.Body) + body, err := io.ReadAll(resp.Body) if err != nil { return err } if debugging { log.Info("Status : %s", resp.Status) log.Info("Response: %s", body) } return nil } func resolveIRI(hostName, url string) ([]byte, error) { log.Info("GET %s", url) r, _ := http.NewRequest("GET", url, nil) r.Header.Add("Accept", "application/activity+json") r.Header.Set("User-Agent", ServerUserAgent(hostName)) p := instanceColl.PersonObject() h := sha256.New() h.Write([]byte{}) r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil))) // Sign using the 'Signature' header privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey()) if err != nil { return nil, err } signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"}) err = signer.SignSigHeader(r) if err != nil { log.Error("Can't sign: %v", err) } if debugging { dump, err := httputil.DumpRequestOut(r, true) if err != nil { log.Error("Can't dump: %v", err) } else { log.Info("%s", dump) } } resp, err := activityPubClient().Do(r) if err != nil { return nil, err } if resp != nil && resp.Body != nil { defer resp.Body.Close() } - body, err := ioutil.ReadAll(resp.Body) + body, err := io.ReadAll(resp.Body) if err != nil { return nil, err } if debugging { log.Info("Status : %s", resp.Status) log.Info("Response: %s", body) } return body, nil } func deleteFederatedPost(app *App, p *PublicPost, collID int64) error { if debugging { log.Info("Deleting federated post!") } p.Collection.hostName = app.cfg.App.Host actor := p.Collection.PersonObject(collID) na := p.ActivityObject(app) // Add followers p.Collection.ID = collID followers, err := app.db.GetAPFollowers(&p.Collection.Collection) if err != nil { log.Error("Couldn't delete post (get followers)! %v", err) return err } inboxes := map[string][]string{} for _, f := range *followers { inbox := f.SharedInbox if inbox == "" { inbox = f.Inbox } if _, ok := inboxes[inbox]; ok { inboxes[inbox] = append(inboxes[inbox], f.ActorID) } else { inboxes[inbox] = []string{f.ActorID} } } for si, instFolls := range inboxes { na.CC = []string{} - for _, f := range instFolls { - na.CC = append(na.CC, f) - } - + na.CC = append(na.CC, instFolls...) da := activitystreams.NewDeleteActivity(na) // Make the ID unique to ensure it works in Pleroma // See: https://git.pleroma.social/pleroma/pleroma/issues/1481 da.ID += "#Delete" err = makeActivityPost(app.cfg.App.Host, actor, si, da) if err != nil { log.Error("Couldn't delete post! %v", err) } } return nil } func federatePost(app *App, p *PublicPost, collID int64, isUpdate bool) error { // If app is private, do not federate if app.cfg.App.Private { return nil } // Do not federate posts from private or protected blogs if p.Collection.Visibility == CollPrivate || p.Collection.Visibility == CollProtected { return nil } if debugging { if isUpdate { log.Info("Federating updated post!") } else { log.Info("Federating new post!") } } actor := p.Collection.PersonObject(collID) na := p.ActivityObject(app) // Add followers p.Collection.ID = collID followers, err := app.db.GetAPFollowers(&p.Collection.Collection) if err != nil { log.Error("Couldn't post! %v", err) return err } log.Info("Followers for %d: %+v", collID, followers) inboxes := map[string][]string{} for _, f := range *followers { inbox := f.SharedInbox if inbox == "" { inbox = f.Inbox } if _, ok := inboxes[inbox]; ok { // check if we're already sending to this shared inbox inboxes[inbox] = append(inboxes[inbox], f.ActorID) } else { // add the new shared inbox to the list inboxes[inbox] = []string{f.ActorID} } } var activity *activitystreams.Activity // for each one of the shared inboxes for si, instFolls := range inboxes { // add all followers from that instance // to the CC field na.CC = []string{} - for _, f := range instFolls { - na.CC = append(na.CC, f) - } + na.CC = append(na.CC, instFolls...) // create a new "Create" activity // with our article as object if isUpdate { activity = activitystreams.NewUpdateActivity(na) } else { activity = activitystreams.NewCreateActivity(na) activity.To = na.To activity.CC = na.CC } // and post it to that sharedInbox err = makeActivityPost(app.cfg.App.Host, actor, si, activity) if err != nil { log.Error("Couldn't post! %v", err) } } // re-create the object so that the CC list gets reset and has // the mentioned users. This might seem wasteful but the code is // cleaner than adding the mentioned users to CC here instead of // in p.ActivityObject() na = p.ActivityObject(app) for _, tag := range na.Tag { if tag.Type == "Mention" { activity = activitystreams.NewCreateActivity(na) activity.To = na.To activity.CC = na.CC // This here might be redundant in some cases as we might have already // sent this to the sharedInbox of this instance above, but we need too // much logic to catch this at the expense of the odd extra request. // I don't believe we'd ever have too many mentions in a single post that this // could become a burden. remoteUser, err := getRemoteUser(app, tag.HRef) if err != nil { log.Error("Unable to find remote user %s. Skipping: %v", tag.HRef, err) continue } err = makeActivityPost(app.cfg.App.Host, actor, remoteUser.Inbox, activity) if err != nil { log.Error("Couldn't post! %v", err) } } } return nil } func getRemoteUser(app *App, actorID string) (*RemoteUser, error) { u := RemoteUser{ActorID: actorID} - var handle sql.NullString - err := app.db.QueryRow("SELECT id, inbox, shared_inbox, handle FROM remoteusers WHERE actor_id = ?", actorID).Scan(&u.ID, &u.Inbox, &u.SharedInbox, &handle) + var urlVal, handle sql.NullString + err := app.db.QueryRow("SELECT id, inbox, shared_inbox, url, handle FROM remoteusers WHERE actor_id = ?", actorID).Scan(&u.ID, &u.Inbox, &u.SharedInbox, &urlVal, &handle) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "No remote user with that ID."} case err != nil: log.Error("Couldn't get remote user %s: %v", actorID, err) return nil, err } + u.URL = urlVal.String u.Handle = handle.String return &u, nil } // getRemoteUserFromHandle retrieves the profile page of a remote user // from the @user@server.tld handle func getRemoteUserFromHandle(app *App, handle string) (*RemoteUser, error) { u := RemoteUser{Handle: handle} - err := app.db.QueryRow("SELECT id, actor_id, inbox, shared_inbox FROM remoteusers WHERE handle = ?", handle).Scan(&u.ID, &u.ActorID, &u.Inbox, &u.SharedInbox) + var urlVal sql.NullString + err := app.db.QueryRow("SELECT id, actor_id, inbox, shared_inbox, url FROM remoteusers WHERE handle = ?", handle).Scan(&u.ID, &u.ActorID, &u.Inbox, &u.SharedInbox, &urlVal) switch { case err == sql.ErrNoRows: return nil, ErrRemoteUserNotFound case err != nil: log.Error("Couldn't get remote user %s: %v", handle, err) return nil, err } + u.URL = urlVal.String return &u, nil } func getActor(app *App, actorIRI string) (*activitystreams.Person, *RemoteUser, error) { log.Info("Fetching actor %s locally", actorIRI) actor := &activitystreams.Person{} remoteUser, err := getRemoteUser(app, actorIRI) if err != nil { if iErr, ok := err.(impart.HTTPError); ok { if iErr.Status == http.StatusNotFound { // Fetch remote actor log.Info("Not found; fetching actor %s remotely", actorIRI) actorResp, err := resolveIRI(app.cfg.App.Host, actorIRI) if err != nil { log.Error("Unable to get actor! %v", err) return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't fetch actor."} } if err := unmarshalActor(actorResp, actor); err != nil { log.Error("Unable to unmarshal actor! %v", err) return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't parse actor."} } } else { return nil, nil, err } } else { return nil, nil, err } } else { actor = remoteUser.AsPerson() } return actor, remoteUser, nil } +func GetProfileURLFromHandle(app *App, handle string) (string, error) { + handle = strings.TrimLeft(handle, "@") + actorIRI := "" + parts := strings.Split(handle, "@") + if len(parts) != 2 { + return "", fmt.Errorf("invalid handle format") + } + domain := parts[1] + + // Check non-AP instances + if siloProfileURL := silobridge.Profile(parts[0], domain); siloProfileURL != "" { + return siloProfileURL, nil + } + + remoteUser, err := getRemoteUserFromHandle(app, handle) + if err != nil { + // can't find using handle in the table but the table may already have this user without + // handle from a previous version + // TODO: Make this determination. We should know whether a user exists without a handle, or doesn't exist at all + actorIRI = RemoteLookup(handle) + _, errRemoteUser := getRemoteUser(app, actorIRI) + // if it exists then we need to update the handle + if errRemoteUser == nil { + _, err := app.db.Exec("UPDATE remoteusers SET handle = ? WHERE actor_id = ?", handle, actorIRI) + if err != nil { + log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI) + } + } else { + // this probably means we don't have the user in the table so let's try to insert it + // here we need to ask the server for the inboxes + remoteActor, err := activityserve.NewRemoteActor(actorIRI) + if err != nil { + log.Error("Couldn't fetch remote actor: %v", err) + } + if debugging { + log.Info("Got remote actor: %s %s %s %s %s", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), remoteActor.URL(), handle) + } + _, err = app.db.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, url, handle) VALUES(?, ?, ?, ?, ?)", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), remoteActor.URL(), handle) + if err != nil { + log.Error("Couldn't insert remote user: %v", err) + return "", err + } + actorIRI = remoteActor.URL() + } + } else if remoteUser.URL == "" { + log.Info("Remote user %s URL empty, fetching", remoteUser.ActorID) + newRemoteActor, err := activityserve.NewRemoteActor(remoteUser.ActorID) + if err != nil { + log.Error("Couldn't fetch remote actor: %v", err) + } else { + _, err := app.db.Exec("UPDATE remoteusers SET url = ? WHERE actor_id = ?", newRemoteActor.URL(), remoteUser.ActorID) + if err != nil { + log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI) + } else { + actorIRI = newRemoteActor.URL() + } + } + } else { + actorIRI = remoteUser.URL + } + return actorIRI, nil +} + // unmarshal actor normalizes the actor response to conform to // the type Person from github.com/writeas/web-core/activitysteams // // some implementations return different context field types // this converts any non-slice contexts into a slice func unmarshalActor(actorResp []byte, actor *activitystreams.Person) error { // FIXME: Hubzilla has an object for the Actor's url: cannot unmarshal object into Go struct field Person.url of type string // flexActor overrides the Context field to allow // all valid representations during unmarshal flexActor := struct { activitystreams.Person Context json.RawMessage `json:"@context,omitempty"` }{} if err := json.Unmarshal(actorResp, &flexActor); err != nil { return err } actor.Endpoints = flexActor.Endpoints actor.Followers = flexActor.Followers actor.Following = flexActor.Following actor.ID = flexActor.ID actor.Icon = flexActor.Icon actor.Inbox = flexActor.Inbox actor.Name = flexActor.Name actor.Outbox = flexActor.Outbox actor.PreferredUsername = flexActor.PreferredUsername actor.PublicKey = flexActor.PublicKey actor.Summary = flexActor.Summary actor.Type = flexActor.Type actor.URL = flexActor.URL func(val interface{}) { switch val.(type) { case []interface{}: // already a slice, do nothing actor.Context = val.([]interface{}) default: actor.Context = []interface{}{val} } }(flexActor.Context) return nil } func setCacheControl(w http.ResponseWriter, ttl time.Duration) { w.Header().Set("Cache-Control", fmt.Sprintf("public, max-age=%.0f", ttl.Seconds())) } diff --git a/admin.go b/admin.go index 2b757ca..258d0b8 100644 --- a/admin.go +++ b/admin.go @@ -1,675 +1,693 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "fmt" + "html/template" "net/http" "runtime" "strconv" "strings" "time" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/log" "github.com/writeas/web-core/passgen" "github.com/writefreely/writefreely/appstats" "github.com/writefreely/writefreely/config" ) var ( appStartTime = time.Now() sysStatus systemStatus ) const adminUsersPerPage = 30 type systemStatus struct { Uptime string NumGoroutine int // General statistics. MemAllocated string // bytes allocated and still in use MemTotal string // bytes allocated (even if freed) MemSys string // bytes obtained from system (sum of XxxSys below) Lookups uint64 // number of pointer lookups MemMallocs uint64 // number of mallocs MemFrees uint64 // number of frees // Main allocation heap statistics. HeapAlloc string // bytes allocated and still in use HeapSys string // bytes obtained from system HeapIdle string // bytes in idle spans HeapInuse string // bytes in non-idle span HeapReleased string // bytes released to the OS HeapObjects uint64 // total number of allocated objects // Low-level fixed-size structure allocator statistics. // Inuse is bytes used now. // Sys is bytes obtained from system. StackInuse string // bootstrap stacks StackSys string MSpanInuse string // mspan structures MSpanSys string MCacheInuse string // mcache structures MCacheSys string BuckHashSys string // profiling bucket hash table GCSys string // GC metadata OtherSys string // other system allocations // Garbage collector statistics. NextGC string // next run in HeapAlloc time (bytes) LastGC string // last run in absolute time (ns) PauseTotalNs string PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256] NumGC uint32 } type inspectedCollection struct { CollectionObj Followers int LastPost string } type instanceContent struct { ID string Type string Title sql.NullString Content string Updated time.Time } type AdminPage struct { UpdateAvailable bool } func NewAdminPage(app *App) *AdminPage { ap := &AdminPage{} if app.updates != nil { ap.UpdateAvailable = app.updates.AreAvailableNoCheck() } return ap } -func (c instanceContent) UpdatedFriendly() string { +func (c instanceContent) UpdatedFriendly() template.HTML { /* // TODO: accept a locale in this method and use that for the format var loc monday.Locale = monday.LocaleEnUS return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc) */ - return c.Updated.Format("January 2, 2006, 3:04 PM") + if c.Updated.IsZero() { + return "Never" + } + return template.HTML(c.Updated.Format("January 2, 2006, 3:04 PM")) } func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Message string UsersCount, CollectionsCount, PostsCount int64 }{ UserPage: NewUserPage(app, r, u, "Admin", nil), AdminPage: NewAdminPage(app), Message: r.FormValue("m"), } // Get user stats p.UsersCount = app.db.GetAllUsersCount() var err error p.CollectionsCount, err = app.db.GetTotalCollections() if err != nil { return err } p.PostsCount, err = app.db.GetTotalPosts() if err != nil { return err } showUserPage(w, "admin", p) return nil } func handleViewAdminMonitor(app *App, u *User, w http.ResponseWriter, r *http.Request) error { updateAppStats() p := struct { *UserPage *AdminPage SysStatus systemStatus Config config.AppCfg Message, ConfigMessage string }{ UserPage: NewUserPage(app, r, u, "Admin", nil), AdminPage: NewAdminPage(app), SysStatus: sysStatus, Config: app.cfg.App, Message: r.FormValue("m"), ConfigMessage: r.FormValue("cm"), } showUserPage(w, "monitor", p) return nil } func handleViewAdminSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Config config.AppCfg Message, ConfigMessage string }{ UserPage: NewUserPage(app, r, u, "Admin", nil), AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), ConfigMessage: r.FormValue("cm"), } showUserPage(w, "app-settings", p) return nil } func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Config config.AppCfg Message string Flashes []string Users *[]User CurPage int TotalUsers int64 TotalPages []int }{ UserPage: NewUserPage(app, r, u, "Users", nil), AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), } p.Flashes, _ = getSessionFlashes(app, w, r, nil) p.TotalUsers = app.db.GetAllUsersCount() ttlPages := p.TotalUsers / adminUsersPerPage p.TotalPages = []int{} for i := 1; i <= int(ttlPages); i++ { p.TotalPages = append(p.TotalPages, i) } var err error p.CurPage, err = strconv.Atoi(r.FormValue("p")) if err != nil || p.CurPage < 1 { p.CurPage = 1 } else if p.CurPage > int(ttlPages) { p.CurPage = int(ttlPages) } p.Users, err = app.db.GetAllUsers(uint(p.CurPage)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)} } showUserPage(w, "users", p) return nil } func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } p := struct { *UserPage *AdminPage Config config.AppCfg Message string User *User Colls []inspectedCollection LastPost string NewPassword string TotalPosts int64 ClearEmail string }{ AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), Colls: []inspectedCollection{}, } var err error p.User, err = app.db.GetUserForAuth(username) if err != nil { if err == ErrUserNotFound { return err } log.Error("Could not get user: %v", err) return impart.HTTPError{http.StatusInternalServerError, err.Error()} } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { if strings.HasPrefix(flash, "SUCCESS: ") { p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ") p.ClearEmail = p.User.EmailClear(app.keys) } } p.UserPage = NewUserPage(app, r, u, p.User.Username, nil) p.TotalPosts = app.db.GetUserPostsCount(p.User.ID) lp, err := app.db.GetUserLastPostTime(p.User.ID) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)} } if lp != nil { p.LastPost = lp.Format("January 2, 2006, 3:04 PM") } colls, err := app.db.GetCollections(p.User, app.cfg.App.Host) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)} } for _, c := range *colls { ic := inspectedCollection{ CollectionObj: CollectionObj{Collection: c}, } if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(&c) if err == nil { // TODO: handle error here (at least log it) ic.Followers = len(*folls) } } app.db.GetPostsCount(&ic.CollectionObj, true) lp, err := app.db.GetCollectionLastPostTime(c.ID) if err != nil { log.Error("Didn't get last post time for collection %d: %v", c.ID, err) } if lp != nil { ic.LastPost = lp.Format("January 2, 2006, 3:04 PM") } p.Colls = append(p.Colls, ic) } showUserPage(w, "view-user", p) return nil } func handleAdminDeleteUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error { if !u.IsAdmin() { return impart.HTTPError{http.StatusForbidden, "Administrator privileges required for this action"} } vars := mux.Vars(r) username := vars["username"] confirmUsername := r.PostFormValue("confirm-username") if confirmUsername != username { return impart.HTTPError{http.StatusBadRequest, "Username was not confirmed"} } user, err := app.db.GetUserForAuth(username) if err == ErrUserNotFound { return impart.HTTPError{http.StatusNotFound, fmt.Sprintf("User '%s' was not found", username)} } else if err != nil { log.Error("get user for deletion: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user with username '%s': %v", username, err)} } err = app.db.DeleteAccount(user.ID) if err != nil { log.Error("delete user %s: %v", user.Username, err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not delete user account for '%s': %v", username, err)} } _ = addSessionFlash(app, w, r, fmt.Sprintf("User \"%s\" was deleted successfully.", username), nil) return impart.HTTPError{http.StatusFound, "/admin/users"} } func handleAdminToggleUserStatus(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } user, err := app.db.GetUserForAuth(username) if err != nil { log.Error("failed to get user: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)} } if user.IsSilenced() { err = app.db.SetUserStatus(user.ID, UserActive) } else { err = app.db.SetUserStatus(user.ID, UserSilenced) // reset the cache to removed silence user posts updateTimelineCache(app.timeline, true) } if err != nil { log.Error("toggle user silenced: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)} } return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)} } func handleAdminResetUserPass(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } // Generate new random password since none supplied pass := passgen.NewWordish() hashedPass, err := auth.HashPass([]byte(pass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)} } userIDVal := r.FormValue("user") log.Info("ADMIN: Changing user %s password", userIDVal) id, err := strconv.Atoi(userIDVal) if err != nil { return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)} } err = app.db.ChangePassphrase(int64(id), true, "", hashedPass) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)} } log.Info("ADMIN: Successfully changed.") addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil) return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)} } func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Config config.AppCfg Message string Pages []*instanceContent }{ UserPage: NewUserPage(app, r, u, "Pages", nil), AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), } var err error p.Pages, err = app.db.GetInstancePages() if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)} } // Add in default pages - var hasAbout, hasPrivacy bool + var hasAbout, hasContact, hasPrivacy bool for i, c := range p.Pages { - if hasAbout && hasPrivacy { + if hasAbout && hasContact && hasPrivacy { break } if c.ID == "about" { hasAbout = true if !c.Title.Valid { p.Pages[i].Title = defaultAboutTitle(app.cfg) } + } else if c.ID == "contact" { + hasContact = true + if !c.Title.Valid { + p.Pages[i].Title = defaultContactTitle() + } } else if c.ID == "privacy" { hasPrivacy = true if !c.Title.Valid { p.Pages[i].Title = defaultPrivacyTitle() } } } if !hasAbout { p.Pages = append(p.Pages, &instanceContent{ ID: "about", Title: defaultAboutTitle(app.cfg), Content: defaultAboutPage(app.cfg), Updated: defaultPageUpdatedTime, }) } + if !hasContact { + p.Pages = append(p.Pages, &instanceContent{ + ID: "contact", + Title: defaultContactTitle(), + Content: defaultContactPage(app), + }) + } if !hasPrivacy { p.Pages = append(p.Pages, &instanceContent{ ID: "privacy", Title: defaultPrivacyTitle(), Content: defaultPrivacyPolicy(app.cfg), Updated: defaultPageUpdatedTime, }) } showUserPage(w, "pages", p) return nil } func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] if slug == "" { return impart.HTTPError{http.StatusFound, "/admin/pages"} } p := struct { *UserPage *AdminPage Config config.AppCfg Message string Banner *instanceContent Content *instanceContent }{ AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), } var err error // Get pre-defined pages, or select slug if slug == "about" { p.Content, err = getAboutPage(app) + } else if slug == "contact" { + p.Content, err = getContactPage(app) } else if slug == "privacy" { p.Content, err = getPrivacyPage(app) } else if slug == "landing" { p.Banner, err = getLandingBanner(app) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)} } p.Content, err = getLandingBody(app) p.Content.ID = "landing" } else if slug == "reader" { p.Content, err = getReaderSection(app) } else { p.Content, err = app.db.GetDynamicContent(slug) } if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)} } title := "New page" if p.Content != nil { title = "Edit " + p.Content.ID } else { p.Content = &instanceContent{} } p.UserPage = NewUserPage(app, r, u, title, nil) showUserPage(w, "view-page", p) return nil } func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) id := vars["page"] // Validate - if id != "about" && id != "privacy" && id != "landing" && id != "reader" { + if id != "about" && id != "contact" && id != "privacy" && id != "landing" && id != "reader" { return impart.HTTPError{http.StatusNotFound, "No such page."} } var err error m := "" if id == "landing" { // Handle special landing page err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section") if err != nil { m = "?m=" + err.Error() return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section") } else if id == "reader" { // Update sections with titles err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section") } else { // Update page err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page") } if err != nil { m = "?m=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error { apper.App().cfg.App.SiteName = r.FormValue("site_name") apper.App().cfg.App.SiteDesc = r.FormValue("site_desc") apper.App().cfg.App.Landing = r.FormValue("landing") apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on" apper.App().cfg.App.OpenDeletion = r.FormValue("open_deletion") == "on" mul, err := strconv.Atoi(r.FormValue("min_username_len")) if err == nil { apper.App().cfg.App.MinUsernameLen = mul } mb, err := strconv.Atoi(r.FormValue("max_blogs")) if err == nil { apper.App().cfg.App.MaxBlogs = mb } apper.App().cfg.App.Federation = r.FormValue("federation") == "on" apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on" apper.App().cfg.App.Monetization = r.FormValue("monetization") == "on" apper.App().cfg.App.Private = r.FormValue("private") == "on" apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on" if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil { log.Info("Initializing local timeline...") initLocalTimeline(apper.App()) } apper.App().cfg.App.UserInvites = r.FormValue("user_invites") if apper.App().cfg.App.UserInvites == "none" { apper.App().cfg.App.UserInvites = "" } apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility") m := "?cm=Configuration+saved." err = apper.SaveConfig(apper.App().cfg) if err != nil { m = "?cm=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin/settings" + m + "#config"} } func updateAppStats() { sysStatus.Uptime = appstats.TimeSincePro(appStartTime) m := new(runtime.MemStats) runtime.ReadMemStats(m) sysStatus.NumGoroutine = runtime.NumGoroutine() sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc)) sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc)) sysStatus.MemSys = appstats.FileSize(int64(m.Sys)) sysStatus.Lookups = m.Lookups sysStatus.MemMallocs = m.Mallocs sysStatus.MemFrees = m.Frees sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc)) sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys)) sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle)) sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse)) sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased)) sysStatus.HeapObjects = m.HeapObjects sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse)) sysStatus.StackSys = appstats.FileSize(int64(m.StackSys)) sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse)) sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys)) sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse)) sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys)) sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys)) sysStatus.GCSys = appstats.FileSize(int64(m.GCSys)) sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys)) sysStatus.NextGC = appstats.FileSize(int64(m.NextGC)) sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000) sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000) sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000) sysStatus.NumGC = m.NumGC } func adminResetPassword(app *App, u *User, newPass string) error { hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)} } err = app.db.ChangePassphrase(u.ID, true, "", hashedPass) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)} } return nil } func handleViewAdminUpdates(app *App, u *User, w http.ResponseWriter, r *http.Request) error { check := r.URL.Query().Get("check") if check == "now" && app.cfg.App.UpdateChecks { app.updates.CheckNow() } p := struct { *UserPage *AdminPage CurReleaseNotesURL string LastChecked string LastChecked8601 string LatestVersion string LatestReleaseURL string LatestReleaseNotesURL string CheckFailed bool }{ UserPage: NewUserPage(app, r, u, "Updates", nil), AdminPage: NewAdminPage(app), } p.CurReleaseNotesURL = wfReleaseNotesURL(p.Version) if app.cfg.App.UpdateChecks { p.LastChecked = app.updates.lastCheck.Format("January 2, 2006, 3:04 PM") p.LastChecked8601 = app.updates.lastCheck.Format("2006-01-02T15:04:05Z") p.LatestVersion = app.updates.LatestVersion() p.LatestReleaseURL = app.updates.ReleaseURL() p.LatestReleaseNotesURL = app.updates.ReleaseNotesURL() p.UpdateAvailable = app.updates.AreAvailable() p.CheckFailed = app.updates.checkError != nil } showUserPage(w, "app-updates", p) return nil } diff --git a/app.go b/app.go index 4c4aeb9..42d9891 100644 --- a/app.go +++ b/app.go @@ -1,934 +1,1003 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "crypto/tls" "database/sql" + _ "embed" "fmt" "html/template" - "io/ioutil" + "net" "net/http" "net/url" "os" "os/signal" "path/filepath" "regexp" "strings" "syscall" "time" "github.com/gorilla/mux" "github.com/gorilla/schema" "github.com/gorilla/sessions" "github.com/manifoldco/promptui" stripmd "github.com/writeas/go-strip-markdown/v2" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/converter" "github.com/writeas/web-core/log" + "golang.org/x/crypto/acme/autocert" + "github.com/writefreely/writefreely/author" "github.com/writefreely/writefreely/config" "github.com/writefreely/writefreely/key" "github.com/writefreely/writefreely/migrations" "github.com/writefreely/writefreely/page" - "golang.org/x/crypto/acme/autocert" ) const ( staticDir = "static" assumedTitleLen = 80 postsPerPage = 10 serverSoftware = "WriteFreely" softwareURL = "https://writefreely.org" ) var ( debugging bool // Software version can be set from git env using -ldflags - softwareVer = "0.13.1" + softwareVer = "0.14.0" // DEPRECATED VARS isSingleUser bool ) // App holds data and configuration for an individual WriteFreely instance. type App struct { router *mux.Router shttp *http.ServeMux db *datastore cfg *config.Config cfgFile string keys *key.Keychain sessionStore sessions.Store formDecoder *schema.Decoder updates *updatesCache timeline *localTimeline } // DB returns the App's datastore func (app *App) DB() *datastore { return app.db } // Router returns the App's router func (app *App) Router() *mux.Router { return app.router } // Config returns the App's current configuration. func (app *App) Config() *config.Config { return app.cfg } // SetConfig updates the App's Config to the given value. func (app *App) SetConfig(cfg *config.Config) { app.cfg = cfg } // SetKeys updates the App's Keychain to the given value. func (app *App) SetKeys(k *key.Keychain) { app.keys = k } func (app *App) SessionStore() sessions.Store { return app.sessionStore } func (app *App) SetSessionStore(s sessions.Store) { app.sessionStore = s } // Apper is the interface for getting data into and out of a WriteFreely // instance (or "App"). // // App returns the App for the current instance. // // LoadConfig reads an app configuration into the App, returning any error // encountered. // // SaveConfig persists the current App configuration. // // LoadKeys reads the App's encryption keys and loads them into its // key.Keychain. type Apper interface { App() *App LoadConfig() error SaveConfig(*config.Config) error LoadKeys() error ReqLog(r *http.Request, status int, timeSince time.Duration) string } // App returns the App func (app *App) App() *App { return app } // LoadConfig loads and parses a config file. func (app *App) LoadConfig() error { log.Info("Loading %s configuration...", app.cfgFile) cfg, err := config.Load(app.cfgFile) if err != nil { log.Error("Unable to load configuration: %v", err) os.Exit(1) return err } app.cfg = cfg return nil } // SaveConfig saves the given Config to disk -- namely, to the App's cfgFile. func (app *App) SaveConfig(c *config.Config) error { return config.Save(c, app.cfgFile) } // LoadKeys reads all needed keys from disk into the App. In order to use the // configured `Server.KeysParentDir`, you must call initKeyPaths(App) before // this. func (app *App) LoadKeys() error { var err error app.keys = &key.Keychain{} if debugging { log.Info(" %s", emailKeyPath) } executable, err := os.Executable() if err != nil { executable = "writefreely" } else { executable = filepath.Base(executable) } - app.keys.EmailKey, err = ioutil.ReadFile(emailKeyPath) + app.keys.EmailKey, err = os.ReadFile(emailKeyPath) if err != nil { return err } if debugging { log.Info(" %s", cookieAuthKeyPath) } - app.keys.CookieAuthKey, err = ioutil.ReadFile(cookieAuthKeyPath) + app.keys.CookieAuthKey, err = os.ReadFile(cookieAuthKeyPath) if err != nil { return err } if debugging { log.Info(" %s", cookieKeyPath) } - app.keys.CookieKey, err = ioutil.ReadFile(cookieKeyPath) + app.keys.CookieKey, err = os.ReadFile(cookieKeyPath) if err != nil { return err } if debugging { log.Info(" %s", csrfKeyPath) } - app.keys.CSRFKey, err = ioutil.ReadFile(csrfKeyPath) + app.keys.CSRFKey, err = os.ReadFile(csrfKeyPath) if err != nil { if os.IsNotExist(err) { log.Error(`Missing key: %s. Run this command to generate missing keys: %s keys generate `, csrfKeyPath, executable) } return err } return nil } func (app *App) ReqLog(r *http.Request, status int, timeSince time.Duration) string { return fmt.Sprintf("\"%s %s\" %d %s \"%s\"", r.Method, r.RequestURI, status, timeSince, r.UserAgent()) } // handleViewHome shows page at root path. It checks the configuration and // authentication state to show the correct page. func handleViewHome(app *App, w http.ResponseWriter, r *http.Request) error { if app.cfg.App.SingleUser { // Render blog index return handleViewCollection(app, w, r) } // Multi-user instance forceLanding := r.FormValue("landing") == "1" if !forceLanding { // Show correct page based on user auth status and configured landing path u := getUserSession(app, r) if app.cfg.App.Chorus { // This instance is focused on reading, so show Reader on home route if not // private or a private-instance user is logged in. if !app.cfg.App.Private || u != nil { return viewLocalTimeline(app, w, r) } } if u != nil { // User is logged in, so show the Pad return handleViewPad(app, w, r) } if app.cfg.App.Private { return viewLogin(app, w, r) } if land := app.cfg.App.LandingPath(); land != "/" { return impart.HTTPError{http.StatusFound, land} } } return handleViewLanding(app, w, r) } func handleViewLanding(app *App, w http.ResponseWriter, r *http.Request) error { forceLanding := r.FormValue("landing") == "1" p := struct { page.StaticPage *OAuthButtons Flashes []template.HTML Banner template.HTML Content template.HTML ForcedLanding bool }{ StaticPage: pageForReq(app, r), OAuthButtons: NewOAuthButtons(app.Config()), ForcedLanding: forceLanding, } banner, err := getLandingBanner(app) if err != nil { log.Error("unable to get landing banner: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)} } p.Banner = template.HTML(applyMarkdown([]byte(banner.Content), "", app.cfg)) content, err := getLandingBody(app) if err != nil { log.Error("unable to get landing content: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get content: %v", err)} } p.Content = template.HTML(applyMarkdown([]byte(content.Content), "", app.cfg)) // Get error messages session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session in handleViewHome; ignoring: %v", err) } flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } // Show landing page return renderPage(w, "landing.tmpl", p) } func handleTemplatedPage(app *App, w http.ResponseWriter, r *http.Request, t *template.Template) error { p := struct { page.StaticPage ContentTitle string Content template.HTML PlainContent string Updated string AboutStats *InstanceStats }{ StaticPage: pageForReq(app, r), } - if r.URL.Path == "/about" || r.URL.Path == "/privacy" { + if r.URL.Path == "/about" || r.URL.Path == "/contact" || r.URL.Path == "/privacy" { var c *instanceContent var err error if r.URL.Path == "/about" { c, err = getAboutPage(app) // Fetch stats p.AboutStats = &InstanceStats{} p.AboutStats.NumPosts, _ = app.db.GetTotalPosts() p.AboutStats.NumBlogs, _ = app.db.GetTotalCollections() + } else if r.URL.Path == "/contact" { + c, err = getContactPage(app) + if c.Updated.IsZero() { + // Page was never set up, so return 404 + return ErrPostNotFound + } } else { c, err = getPrivacyPage(app) } if err != nil { return err } p.ContentTitle = c.Title.String p.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg)) p.PlainContent = shortPostDescription(stripmd.Strip(c.Content)) if !c.Updated.IsZero() { p.Updated = c.Updated.Format("January 2, 2006") } } // Serve templated page err := t.ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render page: %v", err) } return nil } func pageForReq(app *App, r *http.Request) page.StaticPage { p := page.StaticPage{ AppCfg: app.cfg.App, Path: r.URL.Path, Version: "v" + softwareVer, } + // Use custom style, if file exists + if _, err := os.Stat(filepath.Join(staticDir, "local", "custom.css")); err == nil { + p.CustomCSS = true + } + // Add user information, if given var u *User accessToken := r.FormValue("t") if accessToken != "" { userID := app.db.GetUserID(accessToken) if userID != -1 { var err error u, err = app.db.GetUserByID(userID) if err == nil { p.Username = u.Username } } } else { u = getUserSession(app, r) if u != nil { p.Username = u.Username p.IsAdmin = u != nil && u.IsAdmin() p.CanInvite = canUserInvite(app.cfg, p.IsAdmin) } } p.CanViewReader = !app.cfg.App.Private || u != nil return p } var fileRegex = regexp.MustCompile("/([^/]*\\.[^/]*)$") // Initialize loads the app configuration and initializes templates, keys, // session, route handlers, and the database connection. func Initialize(apper Apper, debug bool) (*App, error) { debugging = debug apper.LoadConfig() // Load templates err := InitTemplates(apper.App().Config()) if err != nil { return nil, fmt.Errorf("load templates: %s", err) } // Load keys and set up session initKeyPaths(apper.App()) // TODO: find a better way to do this, since it's unneeded in all Apper implementations err = InitKeys(apper) if err != nil { return nil, fmt.Errorf("init keys: %s", err) } apper.App().InitUpdates() apper.App().InitSession() apper.App().InitDecoder() err = ConnectToDatabase(apper.App()) if err != nil { return nil, fmt.Errorf("connect to DB: %s", err) } initActivityPub(apper.App()) + if apper.App().cfg.Email.Domain != "" || apper.App().cfg.Email.MailgunPrivate != "" { + if apper.App().cfg.Email.Domain == "" { + log.Error("[FAILED] Starting publish jobs queue: no [letters]domain config value set.") + } else if apper.App().cfg.Email.MailgunPrivate == "" { + log.Error("[FAILED] Starting publish jobs queue: no [letters]mailgun_private config value set.") + } else { + log.Info("Starting publish jobs queue...") + go startPublishJobsQueue(apper.App()) + } + } + // Handle local timeline, if enabled if apper.App().cfg.App.LocalTimeline { log.Info("Initializing local timeline...") initLocalTimeline(apper.App()) } return apper.App(), nil } func Serve(app *App, r *mux.Router) { log.Info("Going to serve...") isSingleUser = app.cfg.App.SingleUser app.cfg.Server.Dev = debugging // Handle shutdown c := make(chan os.Signal, 2) signal.Notify(c, os.Interrupt, syscall.SIGTERM) go func() { <-c log.Info("Shutting down...") shutdown(app) log.Info("Done.") os.Exit(0) }() // Start gopher server if app.cfg.Server.GopherPort > 0 && !app.cfg.App.Private { go initGopher(app) } // Start web application server var bindAddress = app.cfg.Server.Bind if bindAddress == "" { bindAddress = "localhost" } var err error if app.cfg.IsSecureStandalone() { if app.cfg.Server.Autocert { m := &autocert.Manager{ Prompt: autocert.AcceptTOS, Cache: autocert.DirCache(app.cfg.Server.TLSCertPath), } host, err := url.Parse(app.cfg.App.Host) if err != nil { log.Error("[WARNING] Unable to parse configured host! %s", err) log.Error(`[WARNING] ALL hosts are allowed, which can open you to an attack where clients connect to a server by IP address and pretend to be asking for an incorrect host name, and cause you to reach the CA's rate limit for certificate requests. We recommend supplying a valid host name.`) log.Info("Using autocert on ANY host") } else { log.Info("Using autocert on host %s", host.Host) m.HostPolicy = autocert.HostWhitelist(host.Host) } s := &http.Server{ Addr: ":https", Handler: r, TLSConfig: &tls.Config{ GetCertificate: m.GetCertificate, }, } s.SetKeepAlivesEnabled(false) go func() { log.Info("Serving redirects on http://%s:80", bindAddress) err = http.ListenAndServe(":80", m.HTTPHandler(nil)) log.Error("Unable to start redirect server: %v", err) }() log.Info("Serving on https://%s:443", bindAddress) log.Info("---") err = s.ListenAndServeTLS("", "") } else { go func() { log.Info("Serving redirects on http://%s:80", bindAddress) err = http.ListenAndServe(fmt.Sprintf("%s:80", bindAddress), http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) { http.Redirect(w, r, app.cfg.App.Host, http.StatusMovedPermanently) })) log.Error("Unable to start redirect server: %v", err) }() log.Info("Serving on https://%s:443", bindAddress) log.Info("Using manual certificates") log.Info("---") err = http.ListenAndServeTLS(fmt.Sprintf("%s:443", bindAddress), app.cfg.Server.TLSCertPath, app.cfg.Server.TLSKeyPath, r) } } else { - log.Info("Serving on http://%s:%d\n", bindAddress, app.cfg.Server.Port) + network := "tcp" + protocol := "http" + if strings.HasPrefix(bindAddress, "/") { + network = "unix" + protocol = "http+unix" + + // old sockets will remain after server closes; + // we need to delete them in order to open new ones + err = os.Remove(bindAddress) + if err != nil && !os.IsNotExist(err) { + log.Error("%s already exists but could not be removed: %v", bindAddress, err) + os.Exit(1) + } + } else { + bindAddress = fmt.Sprintf("%s:%d", bindAddress, app.cfg.Server.Port) + } + + log.Info("Serving on %s://%s", protocol, bindAddress) log.Info("---") - err = http.ListenAndServe(fmt.Sprintf("%s:%d", bindAddress, app.cfg.Server.Port), r) + listener, err := net.Listen(network, bindAddress) + if err != nil { + log.Error("Could not bind to address: %v", err) + os.Exit(1) + } + + if network == "unix" { + err = os.Chmod(bindAddress, 0o666) + if err != nil { + log.Error("Could not update socket permissions: %v", err) + os.Exit(1) + } + } + + defer listener.Close() + err = http.Serve(listener, r) } if err != nil { log.Error("Unable to start: %v", err) os.Exit(1) } } func (app *App) InitDecoder() { // TODO: do this at the package level, instead of the App level // Initialize modules app.formDecoder = schema.NewDecoder() app.formDecoder.RegisterConverter(converter.NullJSONString{}, converter.ConvertJSONNullString) app.formDecoder.RegisterConverter(converter.NullJSONBool{}, converter.ConvertJSONNullBool) app.formDecoder.RegisterConverter(sql.NullString{}, converter.ConvertSQLNullString) app.formDecoder.RegisterConverter(sql.NullBool{}, converter.ConvertSQLNullBool) app.formDecoder.RegisterConverter(sql.NullInt64{}, converter.ConvertSQLNullInt64) app.formDecoder.RegisterConverter(sql.NullFloat64{}, converter.ConvertSQLNullFloat64) } // ConnectToDatabase validates and connects to the configured database, then // tests the connection. func ConnectToDatabase(app *App) error { // Check database configuration - if app.cfg.Database.Type == driverMySQL && (app.cfg.Database.User == "" || app.cfg.Database.Password == "") { - return fmt.Errorf("Database user or password not set.") + if app.cfg.Database.Type == driverMySQL && app.cfg.Database.User == "" { + return fmt.Errorf("Database user not set.") } if app.cfg.Database.Host == "" { app.cfg.Database.Host = "localhost" } if app.cfg.Database.Database == "" { app.cfg.Database.Database = "writefreely" } // TODO: check err connectToDatabase(app) // Test database connection err := app.db.Ping() if err != nil { return fmt.Errorf("Database ping failed: %s", err) } return nil } // FormatVersion constructs the version string for the application func FormatVersion() string { return serverSoftware + " " + softwareVer } // OutputVersion prints out the version of the application. func OutputVersion() { fmt.Println(FormatVersion()) } // NewApp creates a new app instance. func NewApp(cfgFile string) *App { return &App{ cfgFile: cfgFile, } } // CreateConfig creates a default configuration and saves it to the app's cfgFile. func CreateConfig(app *App) error { log.Info("Creating configuration...") c := config.New() log.Info("Saving configuration %s...", app.cfgFile) err := config.Save(c, app.cfgFile) if err != nil { return fmt.Errorf("Unable to save configuration: %v", err) } return nil } // DoConfig runs the interactive configuration process. func DoConfig(app *App, configSections string) { if configSections == "" { configSections = "server db app" } // let's check there aren't any garbage in the list configSectionsArray := strings.Split(configSections, " ") for _, element := range configSectionsArray { if element != "server" && element != "db" && element != "app" { log.Error("Invalid argument to --sections. Valid arguments are only \"server\", \"db\" and \"app\"") os.Exit(1) } } d, err := config.Configure(app.cfgFile, configSections) if err != nil { log.Error("Unable to configure: %v", err) os.Exit(1) } app.cfg = d.Config connectToDatabase(app) defer shutdown(app) if !app.db.DatabaseInitialized() { err = adminInitDatabase(app) if err != nil { log.Error(err.Error()) os.Exit(1) } } else { log.Info("Database already initialized.") } if d.User != nil { u := &User{ Username: d.User.Username, HashedPass: d.User.HashedPass, Created: time.Now().Truncate(time.Second).UTC(), } // Create blog log.Info("Creating user %s...\n", u.Username) err = app.db.CreateUser(app.cfg, u, app.cfg.App.SiteName, "") if err != nil { log.Error("Unable to create user: %s", err) os.Exit(1) } log.Info("Done!") } os.Exit(0) } // GenerateKeyFiles creates app encryption keys and saves them into the configured KeysParentDir. func GenerateKeyFiles(app *App) error { // Read keys path from config app.LoadConfig() // Create keys dir if it doesn't exist yet fullKeysDir := filepath.Join(app.cfg.Server.KeysParentDir, keysDir) if _, err := os.Stat(fullKeysDir); os.IsNotExist(err) { err = os.Mkdir(fullKeysDir, 0700) if err != nil { return err } } // Generate keys initKeyPaths(app) // TODO: use something like https://github.com/hashicorp/go-multierror to return errors var keyErrs error err := generateKey(emailKeyPath) if err != nil { keyErrs = err } err = generateKey(cookieAuthKeyPath) if err != nil { keyErrs = err } err = generateKey(cookieKeyPath) if err != nil { keyErrs = err } err = generateKey(csrfKeyPath) if err != nil { keyErrs = err } return keyErrs } // CreateSchema creates all database tables needed for the application. func CreateSchema(apper Apper) error { apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) err := adminInitDatabase(apper.App()) if err != nil { return err } return nil } // Migrate runs all necessary database migrations. func Migrate(apper Apper) error { apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) err := migrations.Migrate(migrations.NewDatastore(apper.App().db.DB, apper.App().db.driverName)) if err != nil { return fmt.Errorf("migrate: %s", err) } return nil } // ResetPassword runs the interactive password reset process. func ResetPassword(apper Apper, username string) error { // Connect to the database apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) // Fetch user u, err := apper.App().db.GetUserForAuth(username) if err != nil { log.Error("Get user: %s", err) os.Exit(1) } // Prompt for new password prompt := promptui.Prompt{ Templates: &promptui.PromptTemplates{ Success: "{{ . | bold | faint }}: ", }, Label: "New password", Mask: '*', } newPass, err := prompt.Run() if err != nil { log.Error("%s", err) os.Exit(1) } // Do the update log.Info("Updating...") err = adminResetPassword(apper.App(), u, newPass) if err != nil { log.Error("%s", err) os.Exit(1) } log.Info("Success.") return nil } // DoDeleteAccount runs the confirmation and account delete process. func DoDeleteAccount(apper Apper, username string) error { // Connect to the database apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) // check user exists u, err := apper.App().db.GetUserForAuth(username) if err != nil { log.Error("%s", err) os.Exit(1) } userID := u.ID // do not delete the admin account // TODO: check for other admins and skip? if u.IsAdmin() { log.Error("Can not delete admin account") os.Exit(1) } // confirm deletion, w/ w/out posts prompt := promptui.Prompt{ Templates: &promptui.PromptTemplates{ Success: "{{ . | bold | faint }}: ", }, Label: fmt.Sprintf("Really delete user : %s", username), IsConfirm: true, } _, err = prompt.Run() if err != nil { log.Info("Aborted...") os.Exit(0) } log.Info("Deleting...") err = apper.App().db.DeleteAccount(userID) if err != nil { log.Error("%s", err) os.Exit(1) } log.Info("Success.") return nil } func connectToDatabase(app *App) { log.Info("Connecting to %s database...", app.cfg.Database.Type) var db *sql.DB var err error if app.cfg.Database.Type == driverMySQL { db, err = sql.Open(app.cfg.Database.Type, fmt.Sprintf("%s:%s@tcp(%s:%d)/%s?charset=utf8mb4&parseTime=true&loc=%s&tls=%t", app.cfg.Database.User, app.cfg.Database.Password, app.cfg.Database.Host, app.cfg.Database.Port, app.cfg.Database.Database, url.QueryEscape(time.Local.String()), app.cfg.Database.TLS)) db.SetMaxOpenConns(50) } else if app.cfg.Database.Type == driverSQLite { if !SQLiteEnabled { log.Error("Invalid database type '%s'. Binary wasn't compiled with SQLite3 support.", app.cfg.Database.Type) os.Exit(1) } if app.cfg.Database.FileName == "" { log.Error("SQLite database filename value in config.ini is empty.") os.Exit(1) } db, err = sql.Open("sqlite3_with_regex", app.cfg.Database.FileName+"?parseTime=true&cached=shared") db.SetMaxOpenConns(2) } else { log.Error("Invalid database type '%s'. Only 'mysql' and 'sqlite3' are supported right now.", app.cfg.Database.Type) os.Exit(1) } if err != nil { log.Error("%s", err) os.Exit(1) } app.db = &datastore{db, app.cfg.Database.Type} } func shutdown(app *App) { log.Info("Closing database connection...") app.db.Close() + if strings.HasPrefix(app.cfg.Server.Bind, "/") { + // Clean up socket + log.Info("Removing socket file...") + err := os.Remove(app.cfg.Server.Bind) + if err != nil { + log.Error("Unable to remove socket: %s", err) + os.Exit(1) + } + log.Info("Success.") + } } // CreateUser creates a new admin or normal user from the given credentials. func CreateUser(apper Apper, username, password string, isAdmin bool) error { // Create an admin user with --create-admin apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) // Ensure an admin / first user doesn't already exist firstUser, _ := apper.App().db.GetUserByID(1) if isAdmin { // Abort if trying to create admin user, but one already exists if firstUser != nil { return fmt.Errorf("Admin user already exists (%s). Create a regular user with: writefreely --create-user", firstUser.Username) } } else { // Abort if trying to create regular user, but no admin exists yet if firstUser == nil { return fmt.Errorf("No admin user exists yet. Create an admin first with: writefreely --create-admin") } } // Create the user // Normalize and validate username desiredUsername := username username = getSlug(username, "") usernameDesc := username if username != desiredUsername { usernameDesc += " (originally: " + desiredUsername + ")" } if !author.IsValidUsername(apper.App().cfg, username) { return fmt.Errorf("Username %s is invalid, reserved, or shorter than configured minimum length (%d characters).", usernameDesc, apper.App().cfg.App.MinUsernameLen) } // Hash the password hashedPass, err := auth.HashPass([]byte(password)) if err != nil { return fmt.Errorf("Unable to hash password: %v", err) } u := &User{ Username: username, HashedPass: hashedPass, Created: time.Now().Truncate(time.Second).UTC(), } userType := "user" if isAdmin { userType = "admin" } log.Info("Creating %s %s...", userType, usernameDesc) err = apper.App().db.CreateUser(apper.App().Config(), u, desiredUsername, "") if err != nil { return fmt.Errorf("Unable to create user: %s", err) } log.Info("Done!") return nil } +//go:embed schema.sql +var schemaSql string + +//go:embed sqlite.sql +var sqliteSql string + func adminInitDatabase(app *App) error { - schemaFileName := "schema.sql" + var schema string if app.cfg.Database.Type == driverSQLite { - schemaFileName = "sqlite.sql" - } - - schema, err := Asset(schemaFileName) - if err != nil { - return fmt.Errorf("Unable to load schema file: %v", err) + schema = sqliteSql + } else { + schema = schemaSql } tblReg := regexp.MustCompile("CREATE TABLE (IF NOT EXISTS )?`([a-z_]+)`") queries := strings.Split(string(schema), ";\n") for _, q := range queries { if strings.TrimSpace(q) == "" { continue } parts := tblReg.FindStringSubmatch(q) if len(parts) >= 3 { log.Info("Creating table %s...", parts[2]) } else { log.Info("Creating table ??? (Weird query) No match in: %v", parts) } - _, err = app.db.Exec(q) + _, err := app.db.Exec(q) if err != nil { log.Error("%s", err) } else { log.Info("Created.") } } // Set up migrations table log.Info("Initializing appmigrations table...") - err = migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName)) + err := migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName)) if err != nil { return fmt.Errorf("Unable to set initial migrations: %v", err) } log.Info("Running migrations...") err = migrations.Migrate(migrations.NewDatastore(app.db.DB, app.db.driverName)) if err != nil { return fmt.Errorf("migrate: %s", err) } log.Info("Done.") return nil } // ServerUserAgent returns a User-Agent string to use in external requests. The // hostName parameter may be left empty. func ServerUserAgent(hostName string) string { hostUAStr := "" if hostName != "" { hostUAStr = "; +" + hostName } return "Go (" + serverSoftware + "/" + softwareVer + hostUAStr + ")" } diff --git a/auth.go b/auth.go index fbee601..e871bdd 100644 --- a/auth.go +++ b/auth.go @@ -1,28 +1,28 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely // AuthenticateUser ensures a user with the given accessToken is valid. Call // it before any operations that require authentication or optionally associate // data with a user account. // Returns an error if the given accessToken is invalid. Otherwise the // associated user ID is returned. func AuthenticateUser(db writestore, accessToken string) (int64, error) { if accessToken == "" { return 0, ErrNoAccessToken } userID := db.GetUserID(accessToken) if userID == -1 { return 0, ErrBadAccessToken } return userID, nil } diff --git a/author/author.go b/author/author.go index 7431ac5..a95eb61 100644 --- a/author/author.go +++ b/author/author.go @@ -1,128 +1,136 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package author import ( + "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/config" "os" "path/filepath" "regexp" ) // Regex pattern for valid usernames var validUsernameReg = regexp.MustCompile("^[a-zA-Z0-9][a-zA-Z0-9-]*$") // List of reserved usernames var reservedUsernames = map[string]bool{ "a": true, "about": true, "add": true, "admin": true, "administrator": true, "adminzone": true, "api": true, "article": true, "articles": true, "auth": true, "authenticate": true, "browse": true, "c": true, "categories": true, "category": true, "changes": true, "community": true, "create": true, "css": true, "data": true, "dev": true, "developers": true, "draft": true, "drafts": true, "edit": true, "edits": true, "faq": true, "feed": true, "feedback": true, "guide": true, "guides": true, "help": true, "index": true, "invite": true, "js": true, "login": true, "logout": true, "me": true, "media": true, "meta": true, "metadata": true, "new": true, "news": true, "oauth": true, "post": true, "posts": true, "privacy": true, "publication": true, "publications": true, "publish": true, "random": true, "read": true, "reader": true, "register": true, "remove": true, "signin": true, "signout": true, "signup": true, "start": true, "status": true, "summary": true, "support": true, "tag": true, "tags": true, "team": true, "template": true, "templates": true, "terms": true, "terms-of-service": true, "termsofservice": true, "theme": true, "themes": true, "tips": true, "tos": true, "update": true, "updates": true, "user": true, "users": true, "yourname": true, } // IsValidUsername returns true if a given username is neither reserved nor // of the correct format. func IsValidUsername(cfg *config.Config, username string) bool { // Username has to be above a character limit if len(username) < cfg.App.MinUsernameLen { return false } // Username is invalid if page with the same name exists. So traverse // available pages, adding them to reservedUsernames map that'll be checked // later. - filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, "pages"), func(path string, i os.FileInfo, err error) error { + err := filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, "pages"), func(path string, i os.FileInfo, err error) error { + if err != nil { + return err + } reservedUsernames[i.Name()] = true return nil }) + if err != nil { + log.Error("[IMPORTANT WARNING]: Could not determine IsValidUsername! %s", err) + return false + } // Username is invalid if it is reserved! if _, reserved := reservedUsernames[username]; reserved { return false } // TODO: use correct regexp function here return len(validUsernameReg.FindStringSubmatch(username)) > 0 } diff --git a/bindata-lib.go b/bindata-lib.go deleted file mode 100644 index 9f4a3fd..0000000 --- a/bindata-lib.go +++ /dev/null @@ -1,106 +0,0 @@ -// +build wflib - -package writefreely - -import ( - "bytes" - "compress/gzip" - "fmt" - "io" - "strings" -) - -func bindata_read(data []byte, name string) ([]byte, error) { - gz, err := gzip.NewReader(bytes.NewBuffer(data)) - if err != nil { - return nil, fmt.Errorf("Read %q: %v", name, err) - } - - var buf bytes.Buffer - _, err = io.Copy(&buf, gz) - gz.Close() - - if err != nil { - return nil, fmt.Errorf("Read %q: %v", name, err) - } - - return buf.Bytes(), nil -} - -var _schema_sql = []byte("\x1f\x8b\x08\x00\x00\x00\x00\x00\x00\xff\xd4\x59\x5f\x6f\xa3\x38\x10\x7f\xef\xa7\xf0\xdb\xa6\x52\x23\x6d\x7a\xdd\xaa\xba\xd3\x3e\x64\x53\x76\x2f\xba\x94\xee\x25\x44\xba\x7d\x02\x03\x93\xd4\xaa\xb1\x91\x6d\x92\xe6\xdb\x9f\x8c\x49\x08\x86\x24\xd0\xdb\x3b\x71\x7d\x2a\xcc\x6f\x8c\xfd\x9b\x3f\x9e\x99\x0c\x87\x57\xc3\x21\x7a\xc4\x0a\x87\x58\xc2\xaf\x28\xd8\x0a\xa2\x60\x25\x00\xe8\x2e\xb8\x1a\x0e\xaf\xb4\x78\xf8\xce\x3f\xad\xac\xf5\x3d\x1c\x52\x40\x52\x89\x2c\x52\x99\x00\xb4\xe2\x02\xa9\xfc\x5d\x80\xa3\x08\xa4\x54\xfc\x15\x98\x34\xdf\x9b\xcc\x9d\xb1\xe7\x20\x6f\xfc\x65\xe6\xa0\xe9\x57\xe4\x3e\x7b\xc8\xf9\x6b\xba\xf0\x16\x16\x1a\x0d\xae\x10\x0a\xf2\x87\x00\x85\x84\x61\xb1\x1b\x8c\xee\xaf\x73\x05\x77\x39\x9b\xdd\x68\x71\x26\x41\xf8\x24\x0e\x10\x61\x6a\x60\x0b\x65\x16\xf3\x00\x29\xc2\x76\x5a\x3a\x2a\xa5\xe8\xd1\xf9\x3a\x5e\xce\x3c\xf4\xe1\xe3\x87\x1c\xc9\x19\xf8\x8a\x24\xd0\x0e\x1d\x09\xc0\x0a\xe2\x00\xc5\x58\x81\x56\xab\x43\x27\xcb\xf9\xdc\x71\x3d\xdf\x9b\x3e\x39\x0b\x6f\xfc\xf4\x3d\x57\x84\xb7\x94\x08\x90\x47\x8a\x7b\x7c\xf5\x40\x78\x0d\x4c\x05\x68\x83\x45\xf4\x82\xc5\xe0\xf6\xd3\xa7\xeb\x1a\xf2\xfb\x7c\xfa\x34\x9e\xff\x40\x7f\x38\x3f\xd0\xa0\xa0\xe9\xfa\xea\x1a\x39\xee\xb7\xa9\xeb\x7c\x9e\x32\xc6\x1f\xbf\x94\xfb\xf9\x7d\x3c\x5f\x38\xde\x67\x8a\x15\x61\xa3\xdf\xfe\x75\xb3\xa7\x69\xc4\x99\xd2\xa7\xb8\x6c\xf4\x12\x6b\x4c\xae\xcd\xb9\x3f\xfa\x2f\xb6\x4d\x0f\xd0\x04\x62\x92\x25\x0a\xde\x54\x7e\xb8\xf1\xc4\x73\xe6\x68\xe1\x78\x28\x53\xab\x07\x34\x79\x9e\xcd\xf4\x17\xf5\x83\x1f\x12\x66\x79\x4d\x1a\xbf\xcb\x80\x55\xce\x49\xdc\x2b\xc2\x13\xb2\x16\x58\x11\xde\x18\x68\x16\xc0\x10\xbd\x01\x21\x09\x67\x26\x78\x46\x23\x8b\x69\x03\x6f\x64\x29\x97\x0b\x90\x19\x55\x01\xca\x4d\xb0\x97\xf4\x85\x8f\x88\x53\x0a\x91\x3e\x2c\x56\x4a\x90\x30\x53\xd0\x22\xff\x34\x6a\x19\xae\x4a\xd1\xc9\x74\x73\xd0\x29\xdd\x77\x74\xfb\x60\x81\x36\x98\x66\x60\x85\x76\xdd\x7f\x93\xf0\xae\xe2\xc2\x49\x78\x57\xf3\xe2\xaa\x33\x56\xf7\x77\x73\xb4\x99\xde\xf8\x68\xb9\xc5\x57\xd8\x75\xb2\x46\x8e\x6f\x6d\x87\x34\x0b\x29\x89\xfc\x57\xd8\x05\x28\xa4\x3c\xb4\xa4\x82\x6c\xb0\x82\x13\xe2\x73\xa4\xf6\x90\xc8\x14\x4b\xb9\xe5\x22\xee\xc4\x66\xa9\xd4\x9e\xd2\x42\x25\x40\xb9\xd7\xde\x7f\xbc\xfe\x3f\xb3\x26\x20\x26\x02\x22\xd5\x89\xb5\x52\xc9\xb0\x96\x0a\xd8\xf8\x98\x12\x2c\x8f\xc2\xfd\xa3\x45\x4c\xc0\x60\x7b\x11\x54\x65\xef\x68\xdd\x1e\x52\xd7\x89\x32\x79\x74\xa1\x5b\x5e\x85\xc6\x4b\xef\xd9\x9f\xba\x93\xb9\xf3\xe4\xb8\x9e\xc9\x9f\x0d\x3c\xb5\x4f\x8d\xb5\x4a\x4a\x11\x45\x7f\x4e\xa6\x0d\x62\x90\x91\x20\xa9\xca\x2f\xcb\xc3\xfe\xee\x3b\xed\xaf\x5a\x99\xaa\x1d\x05\x5f\xbe\x00\x14\x17\xa8\x79\x9b\x7f\xa4\xb8\x51\x5b\xaf\x9c\xab\xae\xb8\x48\xf0\x51\xc9\xf8\x50\x2f\x18\x4d\xe6\x8b\x76\x8d\x35\xae\xa9\x82\xb7\xec\x4c\x35\xbd\x21\xb0\xf5\x23\x9e\xe9\xe2\xab\x41\x5e\xaf\x8d\xf4\xdb\xa5\x3b\xfd\x73\xe9\xe4\x2f\xf7\xf6\x1d\x04\x3d\xf3\xee\x94\xcb\x36\xa9\xc0\xc0\x4a\x8f\x2e\x9c\xc0\xee\x39\x68\xb6\xb6\x7c\xb8\x66\x88\x84\xc7\x64\xb5\xf3\x8b\xd6\xc6\xd4\xb9\xb7\x0d\x38\xed\x07\x3e\x4e\x53\xc0\x02\xb3\x08\x0a\xe8\x5d\x53\x67\xc2\xb8\x48\x4c\x73\x42\x31\x5b\x67\x78\xbd\x47\x37\xad\x2b\x14\xad\x38\xc1\x4f\xf0\x94\xda\x12\xcd\x97\x4a\xfd\x4b\x84\x31\x88\xfd\x94\x4b\x62\xa2\xeb\xe8\x8b\x4b\x77\x31\xfd\xe6\x3a\x8f\x0d\x8b\xef\x1b\x30\x5d\x95\x4a\x85\x93\xb4\x6d\x07\x76\xa8\xfc\x3b\x6b\x5e\x70\x7f\x3b\xdd\xfc\x93\xec\x70\xe8\x71\xba\x25\x82\x8e\xe1\x48\x62\xdf\x38\x6b\xbd\x78\xcc\xdf\xd7\x14\x4a\xa3\x0f\xca\xff\x6f\x0e\x6b\xe7\x98\xc2\x73\x0a\xd4\xde\x8f\x6e\x7a\xd5\x2b\x09\x48\xb8\x82\x15\xa7\x94\x6f\x5b\xc4\x7d\x15\x7e\xb2\x64\xaa\xf5\x4f\x46\xcf\xaf\x4c\x28\x6a\xa0\xd3\xa3\x84\xcb\x25\xbe\xf5\x81\x9e\xf1\xab\xb7\xd5\xae\xce\xb7\xf0\xf5\x21\x40\x7e\x75\x77\xe7\xf6\x6c\x1f\x70\x39\x3e\x8c\xc5\x0f\x1e\xdf\x7f\xb6\x3b\x51\x6d\xd7\x66\xc7\xec\x35\x16\x67\x91\xe2\x86\x8a\xd3\x56\x21\x2c\xe4\x6f\xe7\x00\xf2\x05\x0b\x88\xfd\x4b\xb8\xcb\xb6\xb1\xe2\x6f\x50\x6e\xaf\x37\x76\xd1\x24\x77\x99\x3d\x58\x78\x63\x9d\xb3\xe3\xcd\x86\x79\xc3\xfd\xdd\x7f\x34\x6e\xd8\x6f\xac\x97\x83\x06\xbd\x39\xc2\x36\xa4\x99\xf7\x8a\xd8\x2a\xe7\x6c\x8a\xab\x75\x4e\x7d\x44\x86\xdf\x74\x42\x90\x01\x92\x09\xa6\xf4\x64\x2d\x74\x36\xc9\xb7\x99\x0a\x13\x86\x23\x45\x36\xcd\xf3\xe9\x3e\xd1\xde\xd2\xd1\x3b\x76\x86\x5a\x85\xe1\x04\xde\xdd\x1c\x5e\x1a\x66\x54\x57\x32\x7c\x1d\x16\x32\x8f\xf5\x75\x20\xc1\x84\xe6\x5b\x2a\x7e\x9d\x68\x9c\xd3\xbf\xfb\xd7\x82\xcb\x59\xb0\xa4\x65\x50\xfe\xdf\xab\x28\x94\x26\xce\xe2\x53\x61\x78\x90\x17\xee\x90\x3f\xf9\x27\xc3\xf1\xe4\x7d\xdf\xfa\xcc\x7f\x07\x00\x00\xff\xff\xbe\x79\x68\xa8\x10\x1b\x00\x00") - -func schema_sql() ([]byte, error) { - return bindata_read( - _schema_sql, - "schema.sql", - ) -} - -// Asset loads and returns the asset for the given name. -// It returns an error if the asset could not be found or -// could not be loaded. -func Asset(name string) ([]byte, error) { - cannonicalName := strings.Replace(name, "\\", "/", -1) - if f, ok := _bindata[cannonicalName]; ok { - return f() - } - return nil, fmt.Errorf("Asset %s not found", name) -} - -// AssetNames returns the names of the assets. -func AssetNames() []string { - names := make([]string, 0, len(_bindata)) - for name := range _bindata { - names = append(names, name) - } - return names -} - -// _bindata is a table, holding each asset generator, mapped to its name. -var _bindata = map[string]func() ([]byte, error){ - "schema.sql": schema_sql, -} - -// AssetDir returns the file names below a certain -// directory embedded in the file by go-bindata. -// For example if you run go-bindata on data/... and data contains the -// following hierarchy: -// data/ -// foo.txt -// img/ -// a.png -// b.png -// then AssetDir("data") would return []string{"foo.txt", "img"} -// AssetDir("data/img") would return []string{"a.png", "b.png"} -// AssetDir("foo.txt") and AssetDir("notexist") would return an error -// AssetDir("") will return []string{"data"}. -func AssetDir(name string) ([]string, error) { - node := _bintree - if len(name) != 0 { - cannonicalName := strings.Replace(name, "\\", "/", -1) - pathList := strings.Split(cannonicalName, "/") - for _, p := range pathList { - node = node.Children[p] - if node == nil { - return nil, fmt.Errorf("Asset %s not found", name) - } - } - } - if node.Func != nil { - return nil, fmt.Errorf("Asset %s not found", name) - } - rv := make([]string, 0, len(node.Children)) - for name := range node.Children { - rv = append(rv, name) - } - return rv, nil -} - -type _bintree_t struct { - Func func() ([]byte, error) - Children map[string]*_bintree_t -} - -var _bintree = &_bintree_t{nil, map[string]*_bintree_t{ - "schema.sql": &_bintree_t{schema_sql, map[string]*_bintree_t{}}, -}} diff --git a/cache.go b/cache.go index b1b1be9..47cff3a 100644 --- a/cache.go +++ b/cache.go @@ -1,69 +1,69 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "sync" "time" ) const ( postsCacheTime = 4 * time.Second ) type ( postsCacheItem struct { Expire time.Time Posts *[]PublicPost ready chan struct{} } AuthCache struct { Alias, Pass, Token string BadPasses map[string]bool expire time.Time } ) var ( userPostsCache = struct { sync.RWMutex users map[int64]postsCacheItem }{ users: map[int64]postsCacheItem{}, } ) func CachePosts(userID int64, p *[]PublicPost) { close(userPostsCache.users[userID].ready) userPostsCache.Lock() userPostsCache.users[userID] = postsCacheItem{ Expire: time.Now().Add(postsCacheTime), Posts: p, } userPostsCache.Unlock() } func GetPostsCache(userID int64) *[]PublicPost { userPostsCache.RLock() pci, ok := userPostsCache.users[userID] userPostsCache.RUnlock() if !ok { return nil } if pci.Expire.Before(time.Now()) { // Cache is expired return nil } return pci.Posts } diff --git a/cmd/writefreely/config.go b/cmd/writefreely/config.go index 32e3801..1c3e769 100644 --- a/cmd/writefreely/config.go +++ b/cmd/writefreely/config.go @@ -1,60 +1,60 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package main import ( "github.com/urfave/cli/v2" "github.com/writefreely/writefreely" ) var ( cmdConfig cli.Command = cli.Command{ Name: "config", Usage: "config management tools", Subcommands: []*cli.Command{ &cmdConfigGenerate, &cmdConfigInteractive, }, } cmdConfigGenerate cli.Command = cli.Command{ Name: "generate", Aliases: []string{"gen"}, Usage: "Generate a basic configuration", Action: genConfigAction, } cmdConfigInteractive cli.Command = cli.Command{ Name: "start", Usage: "Interactive configuration process", Action: interactiveConfigAction, Flags: []cli.Flag{ &cli.StringFlag{ Name: "sections", Value: "server db app", Usage: "Which sections of the configuration to go through\n" + "valid values of sections flag are any combination of 'server', 'db' and 'app' \n" + "example: writefreely config start --sections \"db app\"", }, }, } ) func genConfigAction(c *cli.Context) error { app := writefreely.NewApp(c.String("c")) return writefreely.CreateConfig(app) } func interactiveConfigAction(c *cli.Context) error { app := writefreely.NewApp(c.String("c")) writefreely.DoConfig(app, c.String("sections")) return nil } diff --git a/cmd/writefreely/db.go b/cmd/writefreely/db.go index ccae418..908e163 100644 --- a/cmd/writefreely/db.go +++ b/cmd/writefreely/db.go @@ -1,49 +1,49 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package main import ( "github.com/urfave/cli/v2" "github.com/writefreely/writefreely" ) var ( cmdDB cli.Command = cli.Command{ Name: "db", Usage: "db management tools", Subcommands: []*cli.Command{ &cmdDBInit, &cmdDBMigrate, }, } cmdDBInit cli.Command = cli.Command{ Name: "init", Usage: "Initialize Database", Action: initDBAction, } cmdDBMigrate cli.Command = cli.Command{ Name: "migrate", Usage: "Migrate Database", Action: migrateDBAction, } ) func initDBAction(c *cli.Context) error { app := writefreely.NewApp(c.String("c")) return writefreely.CreateSchema(app) } func migrateDBAction(c *cli.Context) error { app := writefreely.NewApp(c.String("c")) return writefreely.Migrate(app) } diff --git a/cmd/writefreely/keys.go b/cmd/writefreely/keys.go index 680cd4d..2e7cc8e 100644 --- a/cmd/writefreely/keys.go +++ b/cmd/writefreely/keys.go @@ -1,38 +1,38 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package main import ( "github.com/urfave/cli/v2" "github.com/writefreely/writefreely" ) var ( cmdKeys cli.Command = cli.Command{ Name: "keys", Usage: "key management tools", Subcommands: []*cli.Command{ &cmdGenerateKeys, }, } cmdGenerateKeys cli.Command = cli.Command{ Name: "generate", Aliases: []string{"gen"}, Usage: "Generate encryption and authentication keys", Action: genKeysAction, } ) func genKeysAction(c *cli.Context) error { app := writefreely.NewApp(c.String("c")) return writefreely.GenerateKeyFiles(app) } diff --git a/cmd/writefreely/main.go b/cmd/writefreely/main.go index 992d611..cd7ed69 100644 --- a/cmd/writefreely/main.go +++ b/cmd/writefreely/main.go @@ -1,183 +1,183 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package main import ( "fmt" "os" "strings" "github.com/gorilla/mux" "github.com/urfave/cli/v2" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely" ) func main() { cli.VersionPrinter = func(c *cli.Context) { fmt.Printf("%s\n", c.App.Version) } app := &cli.App{ Name: "WriteFreely", Usage: "A beautifully pared-down blogging platform", Version: writefreely.FormatVersion(), Action: legacyActions, // legacy due to use of flags for switching actions Flags: []cli.Flag{ &cli.BoolFlag{ Name: "create-config", Value: false, Usage: "Generate a basic configuration", Hidden: true, }, &cli.BoolFlag{ Name: "config", Value: false, Usage: "Interactive configuration process", Hidden: true, }, &cli.StringFlag{ Name: "sections", Value: "server db app", Usage: "Which sections of the configuration to go through (requires --config)\n" + "valid values are any combination of 'server', 'db' and 'app' \n" + "example: writefreely --config --sections \"db app\"", Hidden: true, }, &cli.BoolFlag{ Name: "gen-keys", Value: false, Usage: "Generate encryption and authentication keys", Hidden: true, }, &cli.BoolFlag{ Name: "init-db", Value: false, Usage: "Initialize app database", Hidden: true, }, &cli.BoolFlag{ Name: "migrate", Value: false, Usage: "Migrate the database", Hidden: true, }, &cli.StringFlag{ Name: "create-admin", Usage: "Create an admin with the given username:password", Hidden: true, }, &cli.StringFlag{ Name: "create-user", Usage: "Create a regular user with the given username:password", Hidden: true, }, &cli.StringFlag{ Name: "delete-user", Usage: "Delete a user with the given username", Hidden: true, }, &cli.StringFlag{ Name: "reset-pass", Usage: "Reset the given user's password", Hidden: true, }, }, // legacy flags (set to hidden to eventually switch to bash-complete compatible format) } defaultFlags := []cli.Flag{ &cli.StringFlag{ Name: "c", Value: "config.ini", Usage: "Load configuration from `FILE`", }, &cli.BoolFlag{ Name: "debug", Value: false, Usage: "Enables debug logging", }, } app.Flags = append(app.Flags, defaultFlags...) app.Commands = []*cli.Command{ &cmdUser, &cmdDB, &cmdConfig, &cmdKeys, &cmdServe, } err := app.Run(os.Args) if err != nil { log.Error(err.Error()) os.Exit(1) } } func legacyActions(c *cli.Context) error { app := writefreely.NewApp(c.String("c")) switch true { case c.IsSet("create-config"): return writefreely.CreateConfig(app) case c.IsSet("config"): writefreely.DoConfig(app, c.String("sections")) return nil case c.IsSet("gen-keys"): return writefreely.GenerateKeyFiles(app) case c.IsSet("init-db"): return writefreely.CreateSchema(app) case c.IsSet("migrate"): return writefreely.Migrate(app) case c.IsSet("create-admin"): username, password, err := parseCredentials(c.String("create-admin")) if err != nil { return err } return writefreely.CreateUser(app, username, password, true) case c.IsSet("create-user"): username, password, err := parseCredentials(c.String("create-user")) if err != nil { return err } return writefreely.CreateUser(app, username, password, false) case c.IsSet("delete-user"): return writefreely.DoDeleteAccount(app, c.String("delete-user")) case c.IsSet("reset-pass"): return writefreely.ResetPassword(app, c.String("reset-pass")) } // Initialize the application var err error log.Info("Starting %s...", writefreely.FormatVersion()) app, err = writefreely.Initialize(app, c.Bool("debug")) if err != nil { return err } // Set app routes r := mux.NewRouter() writefreely.InitRoutes(app, r) app.InitStaticRoutes(r) // Serve the application writefreely.Serve(app, r) return nil } func parseCredentials(credentialString string) (string, string, error) { creds := strings.Split(credentialString, ":") if len(creds) != 2 { return "", "", fmt.Errorf("invalid format for passed credentials, must be username:password") } return creds[0], creds[1], nil } diff --git a/cmd/writefreely/user.go b/cmd/writefreely/user.go index 8429513..2efb4b9 100644 --- a/cmd/writefreely/user.go +++ b/cmd/writefreely/user.go @@ -1,96 +1,96 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package main import ( "fmt" "github.com/urfave/cli/v2" "github.com/writefreely/writefreely" ) var ( cmdUser cli.Command = cli.Command{ Name: "user", Usage: "user management tools", Subcommands: []*cli.Command{ &cmdAddUser, &cmdDelUser, &cmdResetPass, // TODO: possibly add a user list command }, } cmdAddUser cli.Command = cli.Command{ Name: "create", Usage: "Add new user", Aliases: []string{"a", "add"}, Flags: []cli.Flag{ &cli.BoolFlag{ Name: "admin", Value: false, Usage: "Create admin user", }, }, Action: addUserAction, } cmdDelUser cli.Command = cli.Command{ Name: "delete", Usage: "Delete user", Aliases: []string{"del", "d"}, Action: delUserAction, } cmdResetPass cli.Command = cli.Command{ Name: "reset-pass", Usage: "Reset user's password", Aliases: []string{"resetpass", "reset"}, Action: resetPassAction, } ) func addUserAction(c *cli.Context) error { credentials := "" if c.NArg() > 0 { credentials = c.Args().Get(0) } else { return fmt.Errorf("No user passed. Example: writefreely user add [USER]:[PASSWORD]") } username, password, err := parseCredentials(credentials) if err != nil { return err } app := writefreely.NewApp(c.String("c")) return writefreely.CreateUser(app, username, password, c.Bool("admin")) } func delUserAction(c *cli.Context) error { username := "" if c.NArg() > 0 { username = c.Args().Get(0) } else { return fmt.Errorf("No user passed. Example: writefreely user delete [USER]") } app := writefreely.NewApp(c.String("c")) return writefreely.DoDeleteAccount(app, username) } func resetPassAction(c *cli.Context) error { username := "" if c.NArg() > 0 { username = c.Args().Get(0) } else { return fmt.Errorf("No user passed. Example: writefreely user reset-pass [USER]") } app := writefreely.NewApp(c.String("c")) return writefreely.ResetPassword(app, username) } diff --git a/cmd/writefreely/web.go b/cmd/writefreely/web.go index 02ae1c9..b91910c 100644 --- a/cmd/writefreely/web.go +++ b/cmd/writefreely/web.go @@ -1,48 +1,48 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package main import ( "github.com/gorilla/mux" "github.com/urfave/cli/v2" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely" ) var ( cmdServe cli.Command = cli.Command{ Name: "serve", Aliases: []string{"web"}, Usage: "Run web application", Action: serveAction, } ) func serveAction(c *cli.Context) error { // Initialize the application app := writefreely.NewApp(c.String("c")) var err error log.Info("Starting %s...", writefreely.FormatVersion()) app, err = writefreely.Initialize(app, c.Bool("debug")) if err != nil { return err } // Set app routes r := mux.NewRouter() writefreely.InitRoutes(app, r) app.InitStaticRoutes(r) // Serve the application writefreely.Serve(app, r) return nil } diff --git a/collections.go b/collections.go index beadf19..8368447 100644 --- a/collections.go +++ b/collections.go @@ -1,1229 +1,1433 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2022 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "encoding/json" "fmt" "html/template" "math" "net/http" "net/url" "regexp" "strconv" "strings" "unicode" "github.com/gorilla/mux" + stripmd "github.com/writeas/go-strip-markdown/v2" "github.com/writeas/impart" "github.com/writeas/web-core/activitystreams" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/bots" + "github.com/writeas/web-core/i18n" "github.com/writeas/web-core/log" - waposts "github.com/writeas/web-core/posts" + "github.com/writeas/web-core/posts" "github.com/writefreely/writefreely/author" "github.com/writefreely/writefreely/config" "github.com/writefreely/writefreely/page" + "github.com/writefreely/writefreely/spam" "golang.org/x/net/idna" ) +const collAttrLetterReplyTo = "letter_reply_to" + type ( // TODO: add Direction to db // TODO: add Language to db Collection struct { ID int64 `datastore:"id" json:"-"` Alias string `datastore:"alias" schema:"alias" json:"alias"` Title string `datastore:"title" schema:"title" json:"title"` Description string `datastore:"description" schema:"description" json:"description"` Direction string `schema:"dir" json:"dir,omitempty"` Language string `schema:"lang" json:"lang,omitempty"` StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"` Script string `datastore:"script" schema:"script" json:"script,omitempty"` Signature string `datastore:"post_signature" schema:"signature" json:"-"` Public bool `datastore:"public" json:"public"` Visibility collVisibility `datastore:"private" json:"-"` Format string `datastore:"format" json:"format,omitempty"` Views int64 `json:"views"` OwnerID int64 `datastore:"owner_id" json:"-"` PublicOwner bool `datastore:"public_owner" json:"-"` URL string `json:"url,omitempty"` Monetization string `json:"monetization_pointer,omitempty"` + Verification string `json:"verification_link"` db *datastore hostName string } CollectionObj struct { Collection TotalPosts int `json:"total_posts"` Owner *User `json:"owner,omitempty"` Posts *[]PublicPost `json:"posts,omitempty"` Format *CollectionFormat } DisplayCollection struct { *CollectionObj Prefix string + NavSuffix string IsTopLevel bool CurrentPage int TotalPages int Silenced bool } + + CollectionNav struct { + *Collection + Path string + SingleUser bool + CanPost bool + } + SubmittedCollection struct { // Data used for updating a given collection ID int64 OwnerID uint64 // Form helpers PreferURL string `schema:"prefer_url" json:"prefer_url"` Privacy int `schema:"privacy" json:"privacy"` Pass string `schema:"password" json:"password"` MathJax bool `schema:"mathjax" json:"mathjax"` + EmailSubs bool `schema:"email_subs" json:"email_subs"` Handle string `schema:"handle" json:"handle"` // Actual collection values updated in the DB Alias *string `schema:"alias" json:"alias"` Title *string `schema:"title" json:"title"` Description *string `schema:"description" json:"description"` StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"` Script *sql.NullString `schema:"script" json:"script"` Signature *sql.NullString `schema:"signature" json:"signature"` Monetization *string `schema:"monetization_pointer" json:"monetization_pointer"` + Verification *string `schema:"verification_link" json:"verification_link"` + LetterReply *string `schema:"letter_reply" json:"letter_reply"` Visibility *int `schema:"visibility" json:"public"` Format *sql.NullString `schema:"format" json:"format"` } CollectionFormat struct { Format string } collectionReq struct { // Information about the collection request itself prefix, alias, domain string isCustomDomain bool // User-related fields isCollOwner bool isAuthorized bool } ) func (sc *SubmittedCollection) FediverseHandle() string { if sc.Handle == "" { return apCustomHandleDefault } return getSlug(sc.Handle, "") } // collVisibility represents the visibility level for the collection. type collVisibility int // Visibility levels. Values are bitmasks, stored in the database as // decimal numbers. If adding types, append them to this list. If removing, // replace the desired visibility with a new value. const CollUnlisted collVisibility = 0 const ( CollPublic collVisibility = 1 << iota CollPrivate CollProtected ) var collVisibilityStrings = map[string]collVisibility{ "unlisted": CollUnlisted, "public": CollPublic, "private": CollPrivate, "protected": CollProtected, } func defaultVisibility(cfg *config.Config) collVisibility { vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility] if !ok { vis = CollUnlisted } return vis } func (cf *CollectionFormat) Ascending() bool { return cf.Format == "novel" } func (cf *CollectionFormat) ShowDates() bool { return cf.Format == "blog" } func (cf *CollectionFormat) PostsPerPage() int { if cf.Format == "novel" { return postsPerPage } return postsPerPage } // Valid returns whether or not a format value is valid. func (cf *CollectionFormat) Valid() bool { return cf.Format == "blog" || cf.Format == "novel" || cf.Format == "notebook" } // NewFormat creates a new CollectionFormat object from the Collection. func (c *Collection) NewFormat() *CollectionFormat { cf := &CollectionFormat{Format: c.Format} // Fill in default format if cf.Format == "" { cf.Format = "blog" } return cf } func (c *Collection) IsInstanceColl() bool { ur, _ := url.Parse(c.hostName) return c.Alias == ur.Host } func (c *Collection) IsUnlisted() bool { return c.Visibility == 0 } func (c *Collection) IsPrivate() bool { return c.Visibility&CollPrivate != 0 } func (c *Collection) IsProtected() bool { return c.Visibility&CollProtected != 0 } func (c *Collection) IsPublic() bool { return c.Visibility&CollPublic != 0 } func (c *Collection) FriendlyVisibility() string { if c.IsPrivate() { return "Private" } if c.IsPublic() { return "Public" } if c.IsProtected() { return "Password-protected" } return "Unlisted" } func (c *Collection) ShowFooterBranding() bool { // TODO: implement this setting return true } // CanonicalURL returns a fully-qualified URL to the collection. func (c *Collection) CanonicalURL() string { return c.RedirectingCanonicalURL(false) } func (c *Collection) DisplayCanonicalURL() string { us := c.CanonicalURL() u, err := url.Parse(us) if err != nil { return us } p := u.Path if p == "/" { p = "" } d := u.Hostname() d, _ = idna.ToUnicode(d) return d + p } // RedirectingCanonicalURL returns the fully-qualified canonical URL for the Collection, with a trailing slash. The // hostName field needs to be populated for this to work correctly. func (c *Collection) RedirectingCanonicalURL(isRedir bool) string { if c.hostName == "" { // If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writefreely/writefreely/issues/new?template=bug_report.md") } if isSingleUser { return c.hostName + "/" } return fmt.Sprintf("%s/%s/", c.hostName, c.Alias) } // PrevPageURL provides a full URL for the previous page of collection posts, // returning a /page/N result for pages >1 -func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string { +func (c *Collection) PrevPageURL(prefix, navSuffix string, n int, tl bool) string { u := "" if n == 2 { // Previous page is 1; no need for /page/ prefix if prefix == "" { - u = "/" + u = navSuffix + "/" } // Else leave off trailing slash } else { - u = fmt.Sprintf("/page/%d", n-1) + u = fmt.Sprintf("%s/page/%d", navSuffix, n-1) } if tl { return u } return "/" + prefix + c.Alias + u } // NextPageURL provides a full URL for the next page of collection posts -func (c *Collection) NextPageURL(prefix string, n int, tl bool) string { +func (c *Collection) NextPageURL(prefix, navSuffix string, n int, tl bool) string { + if tl { - return fmt.Sprintf("/page/%d", n+1) + return fmt.Sprintf("%s/page/%d", navSuffix, n+1) } - return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1) + return fmt.Sprintf("/%s%s%s/page/%d", prefix, c.Alias, navSuffix, n+1) } func (c *Collection) DisplayTitle() string { if c.Title != "" { return c.Title } return c.Alias } func (c *Collection) StyleSheetDisplay() template.CSS { return template.CSS(c.StyleSheet) } // ForPublic modifies the Collection for public consumption, such as via // the API. func (c *Collection) ForPublic() { c.URL = c.CanonicalURL() } var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person { accountRoot := c.FederatedAccount() p := activitystreams.NewPerson(accountRoot) p.URL = c.CanonicalURL() uname := c.Alias p.PreferredUsername = uname p.Name = c.DisplayTitle() p.Summary = c.Description if p.Name != "" { if av := c.AvatarURL(); av != "" { p.Icon = activitystreams.Image{ Type: "Image", MediaType: "image/png", URL: av, } } } collID := c.ID if len(ids) > 0 { collID = ids[0] } pub, priv := c.db.GetAPActorKeys(collID) if pub != nil { p.AddPubKey(pub) p.SetPrivKey(priv) } return p } func (c *Collection) AvatarURL() string { fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0])) if !isAvatarChar(fl) { return "" } return c.hostName + "/img/avatars/" + fl + ".png" } func (c *Collection) FederatedAPIBase() string { return c.hostName + "/" } func (c *Collection) FederatedAccount() string { accountUser := c.Alias return c.FederatedAPIBase() + "api/collections/" + accountUser } func (c *Collection) RenderMathJax() bool { return c.db.CollectionHasAttribute(c.ID, "render_mathjax") } +func (c *Collection) EmailSubsEnabled() bool { + return c.db.CollectionHasAttribute(c.ID, "email_subs") +} + func (c *Collection) MonetizationURL() string { if c.Monetization == "" { return "" } return strings.Replace(c.Monetization, "$", "https://", 1) } +// DisplayDescription returns the description with rendered Markdown and HTML. +func (c *Collection) DisplayDescription() *template.HTML { + if c.Description == "" { + s := template.HTML("") + return &s + } + t := template.HTML(posts.ApplyBasicAccessibleMarkdown([]byte(c.Description))) + return &t +} + +// PlainDescription returns the description with all Markdown and HTML removed. +func (c *Collection) PlainDescription() string { + if c.Description == "" { + return "" + } + desc := stripHTMLWithoutEscaping(c.Description) + desc = stripmd.Strip(desc) + return desc +} + func (c CollectionPage) DisplayMonetization() string { return displayMonetization(c.Monetization, c.Alias) } +func (c *DisplayCollection) Direction() string { + if c.Language == "" { + return "auto" + } + if i18n.LangIsRTL(c.Language) { + return "rtl" + } + return "ltr" +} + func newCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) alias := r.FormValue("alias") title := r.FormValue("title") var missingParams, accessToken string var u *User c := struct { Alias string `json:"alias" schema:"alias"` Title string `json:"title" schema:"title"` Web bool `json:"web" schema:"web"` }{} if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err := decoder.Decode(&c) if err != nil { log.Error("Couldn't parse post update JSON request: %v\n", err) return ErrBadJSON } } else { // TODO: move form parsing to formDecoder c.Alias = alias c.Title = title } if c.Alias == "" { if c.Title != "" { // If only a title was given, just use it to generate the alias. c.Alias = getSlug(c.Title, "") } else { missingParams += "`alias` " } } if c.Title == "" { missingParams += "`title` " } if missingParams != "" { return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)} } var userID int64 var err error if reqJSON && !c.Web { accessToken = r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } userID = app.db.GetUserID(accessToken) if userID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } userID = u.ID } silenced, err := app.db.IsUserSilenced(userID) if err != nil { log.Error("new collection: %v", err) return ErrInternalGeneral } if silenced { return ErrUserSilenced } if !author.IsValidUsername(app.cfg, c.Alias) { return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."} } coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID) if err != nil { // TODO: handle this return err } res := &CollectionObj{Collection: *coll} if reqJSON { return impart.WriteSuccess(w, res, http.StatusCreated) } redirectTo := "/me/c/" // TODO: redirect to pad when necessary return impart.HTTPError{http.StatusFound, redirectTo} } func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) { accessToken := r.Header.Get("Authorization") var userID int64 = -1 if accessToken != "" { userID = app.db.GetUserID(accessToken) } isCollOwner := userID == c.OwnerID if c.IsPrivate() && !isCollOwner { // Collection is private, but user isn't authenticated return -1, ErrCollectionNotFound } if c.IsProtected() { // TODO: check access token return -1, ErrCollectionUnauthorizedRead } return userID, nil } // fetchCollection handles the API endpoint for retrieving collection data. func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error { - accept := r.Header.Get("Accept") - if strings.Contains(accept, "application/activity+json") { + if IsActivityPubRequest(r) { return handleFetchCollectionActivities(app, w, r) } vars := mux.Vars(r) alias := vars["alias"] // TODO: move this logic into a common getCollection function // Get base Collection data c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Redirect users who aren't requesting JSON reqJSON := IsJSON(r) if !reqJSON { return impart.HTTPError{http.StatusFound, c.CanonicalURL()} } // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Fetch extra data about the Collection res := &CollectionObj{Collection: *c} if c.PublicOwner { u, err := app.db.GetUserByID(res.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } else { res.Owner = u } } // TODO: check status for silenced app.db.GetPostsCount(res, isCollOwner) // Strip non-public information res.Collection.ForPublic() return impart.WriteSuccess(w, res, http.StatusOK) } // fetchCollectionPosts handles an API endpoint for retrieving a collection's // posts. func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) alias := vars["alias"] c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Get page page := 1 if p := r.FormValue("page"); p != "" { pInt, _ := strconv.Atoi(p) if pInt > 0 { page = pInt } } - posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false) + ps, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false) if err != nil { return err } - coll := &CollectionObj{Collection: *c, Posts: posts} + coll := &CollectionObj{Collection: *c, Posts: ps} app.db.GetPostsCount(coll, isCollOwner) // Strip non-public information coll.Collection.ForPublic() // Transform post bodies if needed if r.FormValue("body") == "html" { for _, p := range *coll.Posts { - p.Content = waposts.ApplyMarkdown([]byte(p.Content)) + p.Content = posts.ApplyMarkdown([]byte(p.Content)) } } return impart.WriteSuccess(w, coll, http.StatusOK) } type CollectionPage struct { page.StaticPage *DisplayCollection IsCustomDomain bool IsWelcome bool IsOwner bool IsCollLoggedIn bool + Honeypot string + IsSubscriber bool CanPin bool Username string Monetization string + Flash template.HTML Collections *[]Collection PinnedPosts *[]PublicPost - IsAdmin bool - CanInvite bool + + IsAdmin bool + CanInvite bool // Helper field for Chorus mode CollAlias string } +type TagCollectionPage struct { + CollectionPage + Tag string +} + +func (tcp TagCollectionPage) PrevPageURL(prefix string, n int, tl bool) string { + u := fmt.Sprintf("/tag:%s", tcp.Tag) + if n > 2 { + u += fmt.Sprintf("/page/%d", n-1) + } + if tl { + return u + } + return "/" + prefix + tcp.Alias + u + +} + +func (tcp TagCollectionPage) NextPageURL(prefix string, n int, tl bool) string { + if tl { + return fmt.Sprintf("/tag:%s/page/%d", tcp.Tag, n+1) + } + return fmt.Sprintf("/%s%s/tag:%s/page/%d", prefix, tcp.Alias, tcp.Tag, n+1) +} + func NewCollectionObj(c *Collection) *CollectionObj { return &CollectionObj{ Collection: *c, Format: c.NewFormat(), } } func (c *CollectionObj) ScriptDisplay() template.JS { return template.JS(c.Script) } var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$") func (c *CollectionObj) ExternalScripts() []template.URL { scripts := []template.URL{} if c.Script == "" { return scripts } matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1) for _, m := range matches { scripts = append(scripts, template.URL(strings.TrimSpace(m[1]))) } return scripts } func (c *CollectionObj) CanShowScript() bool { return false } func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error { cr.prefix = vars["prefix"] cr.alias = vars["collection"] // Normalize the URL, redirecting user to consistent post URL if cr.alias != strings.ToLower(cr.alias) { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))} } return nil } // processCollectionPermissions checks the permissions for the given // collectionReq, returning a Collection if access is granted; otherwise this // renders any necessary collection pages, for example, if requesting a custom // domain that doesn't yet have a collection associated, or if a collection // requires a password. In either case, this will return nil, nil -- thus both // values should ALWAYS be checked to determine whether or not to continue. func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) { // Display collection if this is a collection var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(cr.alias) } // TODO: verify we don't reveal the existence of a private collection with redirection if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { if cr.isCustomDomain { // User is on the site from a custom domain //tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r)) //if tErr != nil { //log.Error("Unable to render 404-domain page: %v", err) //} return nil, nil } if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen { // Alias is within post ID range, so just be sure this isn't a post if app.db.PostIDExists(cr.alias) { // TODO: use StatusFound for vanity post URLs when we implement them return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias} } } // Redirect if necessary newAlias := app.db.GetCollectionRedirect(cr.alias) if newAlias != "" { return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"} } } } return nil, err } c.hostName = app.cfg.App.Host // Update CollectionRequest to reflect owner status cr.isCollOwner = u != nil && u.ID == c.OwnerID // Check permissions if !cr.isCollOwner { if c.IsPrivate() { return nil, ErrCollectionNotFound } else if c.IsProtected() { uname := "" if u != nil { uname = u.Username } // TODO: move this to all permission checks? suspended, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("process protected collection permissions: %v", err) return nil, err } if suspended { return nil, ErrCollectionNotFound } // See if we've authorized this collection cr.isAuthorized = isAuthorizedForCollection(app, c.Alias, r) if !cr.isAuthorized { p := struct { page.StaticPage *CollectionObj Username string Next string Flashes []template.HTML }{ StaticPage: pageForReq(app, r), CollectionObj: &CollectionObj{Collection: *c}, Username: uname, Next: r.FormValue("g"), Flashes: []template.HTML{}, } // Get owner information p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p) if err != nil { log.Error("Unable to render password-collection: %v", err) return nil, err } return nil, nil } } } return c, nil } func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) { u := getUserSession(app, r) return u, nil } func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection { coll := &DisplayCollection{ CollectionObj: NewCollectionObj(c), CurrentPage: page, Prefix: cr.prefix, IsTopLevel: isSingleUser, } c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner) return coll } // getCollectionPage returns the collection page as an int. If the parsed page value is not // greater than 0 then the default value of 1 is returned. func getCollectionPage(vars map[string]string) int { if p, _ := strconv.Atoi(vars["page"]); p > 0 { return p } return 1 } // handleViewCollection displays the requested Collection func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } c.hostName = app.cfg.App.Host silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("view collection: %v", err) return ErrInternalGeneral } // Serve ActivityStreams data now, if requested if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { ac := c.PersonObject() ac.Context = []interface{}{activitystreams.Namespace} setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, ac, http.StatusOK) } // Fetch extra data about the Collection // TODO: refactor out this logic, shared in collection.go:fetchCollection() coll := newDisplayCollection(c, cr, page) coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage()))) if coll.TotalPages > 0 && page > coll.TotalPages { redirURL := fmt.Sprintf("/page/%d", coll.TotalPages) if !app.cfg.App.SingleUser { redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL) } return impart.HTTPError{http.StatusFound, redirURL} } coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false) // Serve collection displayPage := CollectionPage{ DisplayCollection: coll, IsCollLoggedIn: cr.isAuthorized, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, IsWelcome: r.FormValue("greeting") != "", + Honeypot: spam.HoneypotFieldName(), CollAlias: c.Alias, } + flashes, _ := getSessionFlashes(app, w, r, nil) + for _, f := range flashes { + displayPage.Flash = template.HTML(f) + } displayPage.IsAdmin = u != nil && u.IsAdmin() displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin) var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID + displayPage.IsSubscriber = u.IsEmailSubscriber(app, coll.ID) if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } isOwner := owner != nil if !isOwner { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } } if !isOwner && silenced { return ErrCollectionNotFound } displayPage.Silenced = isOwner && silenced displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner) displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer") collTmpl := "collection" if app.cfg.App.Chorus { collTmpl = "chorus-collection" } err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage) if err != nil { log.Error("Unable to render collection index: %v", err) } // Update collection view count go func() { // Don't update if owner is viewing the collection. if u != nil && u.ID == coll.OwnerID { return } // Only update for human views if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) { return } _, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID) if err != nil { log.Error("Unable to update collections count: %v", err) } }() return err } func handleViewMention(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) handle := vars["handle"] remoteUser, err := app.db.GetProfilePageFromHandle(app, handle) if err != nil || remoteUser == "" { log.Error("Couldn't find user %s: %v", handle, err) return ErrRemoteUserNotFound } return impart.HTTPError{Status: http.StatusFound, Message: remoteUser} } func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) tag := vars["tag"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } coll := newDisplayCollection(c, cr, page) + taggedPostIDs, err := app.db.GetAllPostsTaggedIDs(c, tag, cr.isCollOwner) + if err != nil { + return err + } + + ttlPosts := len(taggedPostIDs) + pagePosts := coll.Format.PostsPerPage() + coll.TotalPages = int(math.Ceil(float64(ttlPosts) / float64(pagePosts))) + if coll.TotalPages > 0 && page > coll.TotalPages { + redirURL := fmt.Sprintf("/page/%d", coll.TotalPages) + if !app.cfg.App.SingleUser { + redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL) + } + return impart.HTTPError{http.StatusFound, redirURL} + } + coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner) if coll.Posts != nil && len(*coll.Posts) == 0 { return ErrCollectionPageNotFound } + // Serve collection + displayPage := TagCollectionPage{ + CollectionPage: CollectionPage{ + DisplayCollection: coll, + StaticPage: pageForReq(app, r), + IsCustomDomain: cr.isCustomDomain, + }, + Tag: tag, + } + var owner *User + if u != nil { + displayPage.Username = u.Username + displayPage.IsOwner = u.ID == coll.OwnerID + if displayPage.IsOwner { + // Add in needed information for users viewing their own collection + owner = u + displayPage.CanPin = true + + pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) + if err != nil { + log.Error("unable to fetch collections: %v", err) + } + displayPage.Collections = pubColls + } + } + isOwner := owner != nil + if !isOwner { + // Current user doesn't own collection; retrieve owner information + owner, err = app.db.GetUserByID(coll.OwnerID) + if err != nil { + // Log the error and just continue + log.Error("Error getting user for collection: %v", err) + } + if owner.IsSilenced() { + return ErrCollectionNotFound + } + } + displayPage.Silenced = owner != nil && owner.IsSilenced() + displayPage.Owner = owner + coll.Owner = displayPage.Owner + // Add more data + // TODO: fix this mess of collections inside collections + displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner) + displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer") + + err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage) + if err != nil { + log.Error("Unable to render collection tag page: %v", err) + } + + return nil +} + +func handleViewCollectionLang(app *App, w http.ResponseWriter, r *http.Request) error { + vars := mux.Vars(r) + lang := vars["lang"] + + cr := &collectionReq{} + err := processCollectionRequest(cr, vars, w, r) + if err != nil { + return err + } + + u, err := checkUserForCollection(app, cr, r, false) + if err != nil { + return err + } + + page := getCollectionPage(vars) + + c, err := processCollectionPermissions(app, cr, u, w, r) + if c == nil || err != nil { + return err + } + + coll := newDisplayCollection(c, cr, page) + coll.Language = lang + coll.NavSuffix = fmt.Sprintf("/lang:%s", lang) + + ttlPosts, err := app.db.GetCollLangTotalPosts(coll.ID, lang) + if err != nil { + log.Error("Unable to getCollLangTotalPosts: %s", err) + } + pagePosts := coll.Format.PostsPerPage() + coll.TotalPages = int(math.Ceil(float64(ttlPosts) / float64(pagePosts))) + if coll.TotalPages > 0 && page > coll.TotalPages { + redirURL := fmt.Sprintf("/lang:%s/page/%d", lang, coll.TotalPages) + if !app.cfg.App.SingleUser { + redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL) + } + return impart.HTTPError{http.StatusFound, redirURL} + } + + coll.Posts, _ = app.db.GetLangPosts(app.cfg, c, lang, page, cr.isCollOwner) + if err != nil { + return ErrCollectionPageNotFound + } + // Serve collection displayPage := struct { CollectionPage Tag string }{ CollectionPage: CollectionPage{ DisplayCollection: coll, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, }, - Tag: tag, + Tag: lang, } var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } isOwner := owner != nil if !isOwner { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } if owner.IsSilenced() { return ErrCollectionNotFound } } displayPage.Silenced = owner != nil && owner.IsSilenced() displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner) displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer") - err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage) + collTmpl := "collection" + if app.cfg.App.Chorus { + collTmpl = "chorus-collection" + } + err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage) if err != nil { - log.Error("Unable to render collection tag page: %v", err) + log.Error("Unable to render collection lang page: %v", err) } return nil } func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } // Normalize the URL, redirecting user to consistent post URL loc := fmt.Sprintf("/%s", slug) if !app.cfg.App.SingleUser { loc = fmt.Sprintf("/%s/%s", cr.alias, slug) } return impart.HTTPError{http.StatusFound, loc} } func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) vars := mux.Vars(r) collAlias := vars["alias"] isWeb := r.FormValue("web") == "1" u := &User{} if reqJSON && !isWeb { // Ensure an access token was given accessToken := r.Header.Get("Authorization") u.ID = app.db.GetUserID(accessToken) if u.ID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } } silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { log.Error("existing collection: %v", err) return ErrInternalGeneral } if silenced { return ErrUserSilenced } if r.Method == "DELETE" { err := app.db.DeleteCollection(collAlias, u.ID) if err != nil { // TODO: if not HTTPError, report error to admin log.Error("Unable to delete collection: %s", err) return err } addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil) return impart.HTTPError{Status: http.StatusNoContent} } c := SubmittedCollection{OwnerID: uint64(u.ID)} if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err = decoder.Decode(&c) if err != nil { log.Error("Couldn't parse collection update JSON request: %v\n", err) return ErrBadJSON } } else { err = r.ParseForm() if err != nil { log.Error("Couldn't parse collection update form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&c, r.PostForm) if err != nil { log.Error("Couldn't decode collection update form request: %v\n", err) return ErrBadFormData } } - err = app.db.UpdateCollection(&c, collAlias) + err = app.db.UpdateCollection(app, &c, collAlias) if err != nil { if err, ok := err.(impart.HTTPError); ok { if reqJSON { return err } addSessionFlash(app, w, r, err.Message, nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } else { log.Error("Couldn't update collection: %v\n", err) return err } } if reqJSON { return impart.WriteSuccess(w, struct { }{}, http.StatusOK) } addSessionFlash(app, w, r, "Blog updated!", nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } // collectionAliasFromReq takes a request and returns the collection alias // if it can be ascertained, as well as whether or not the collection uses a // custom domain. func collectionAliasFromReq(r *http.Request) string { vars := mux.Vars(r) alias := vars["subdomain"] isSubdomain := alias != "" if !isSubdomain { // Fall back to write.as/{collection} since this isn't a custom domain alias = vars["collection"] } return alias } func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error { var readReq struct { Alias string `schema:"alias" json:"alias"` Pass string `schema:"password" json:"password"` Next string `schema:"to" json:"to"` } // Get params if impart.ReqJSON(r) { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&readReq) if err != nil { log.Error("Couldn't parse readReq JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse readReq form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&readReq, r.PostForm) if err != nil { log.Error("Couldn't decode readReq form request: %v\n", err) return ErrBadFormData } } if readReq.Alias == "" { return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."} } if readReq.Pass == "" { return impart.HTTPError{http.StatusBadRequest, "Please supply a password."} } var collHashedPass []byte err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass) if err != nil { if err == sql.ErrNoRows { log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias) return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."} } return err } if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } // Success; set cookie session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { session.Values[readReq.Alias] = true err = session.Save(r, w) if err != nil { log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err) } } next := "/" + readReq.Next if !app.cfg.App.SingleUser { next = "/" + readReq.Alias + next } return impart.HTTPError{http.StatusFound, next} } func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool { authd := false session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { _, authd = session.Values[alias] } return authd } func logOutCollection(app *App, alias string, w http.ResponseWriter, r *http.Request) error { session, err := app.sessionStore.Get(r, blogPassCookieName) if err != nil { return err } // Remove this from map of blogs logged into delete(session.Values, alias) // If not auth'd with any blog, delete entire cookie if len(session.Values) == 0 { session.Options.MaxAge = -1 } return session.Save(r, w) } func handleLogOutCollection(app *App, w http.ResponseWriter, r *http.Request) error { alias := collectionAliasFromReq(r) var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { return err } if !c.IsProtected() { // Invalid to log out of this collection return ErrCollectionPageNotFound } err = logOutCollection(app, c.Alias, w, r) if err != nil { addSessionFlash(app, w, r, "Logging out failed. Try clearing cookies for this site, instead.", nil) } return impart.HTTPError{http.StatusFound, c.CanonicalURL()} } diff --git a/config/config.go b/config/config.go index 0f07329..1afd5f3 100644 --- a/config/config.go +++ b/config/config.go @@ -1,295 +1,305 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // Package config holds and assists in the configuration of a writefreely instance. package config import ( "net/url" "strings" + "github.com/go-ini/ini" "github.com/writeas/web-core/log" "golang.org/x/net/idna" - "gopkg.in/ini.v1" ) const ( // FileName is the default configuration file name FileName = "config.ini" UserNormal UserType = "user" UserAdmin = "admin" ) type ( UserType string // ServerCfg holds values that affect how the HTTP server runs ServerCfg struct { HiddenHost string `ini:"hidden_host"` Port int `ini:"port"` Bind string `ini:"bind"` TLSCertPath string `ini:"tls_cert_path"` TLSKeyPath string `ini:"tls_key_path"` Autocert bool `ini:"autocert"` TemplatesParentDir string `ini:"templates_parent_dir"` StaticParentDir string `ini:"static_parent_dir"` PagesParentDir string `ini:"pages_parent_dir"` KeysParentDir string `ini:"keys_parent_dir"` HashSeed string `ini:"hash_seed"` GopherPort int `ini:"gopher_port"` Dev bool `ini:"-"` } // DatabaseCfg holds values that determine how the application connects to a datastore DatabaseCfg struct { Type string `ini:"type"` FileName string `ini:"filename"` User string `ini:"username"` Password string `ini:"password"` Database string `ini:"database"` Host string `ini:"host"` Port int `ini:"port"` TLS bool `ini:"tls"` } WriteAsOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` AuthLocation string `ini:"auth_location"` TokenLocation string `ini:"token_location"` InspectLocation string `ini:"inspect_location"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } GitlabOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` Host string `ini:"host"` DisplayName string `ini:"display_name"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } GiteaOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` Host string `ini:"host"` DisplayName string `ini:"display_name"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } SlackOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` TeamID string `ini:"team_id"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } GenericOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` Host string `ini:"host"` DisplayName string `ini:"display_name"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` TokenEndpoint string `ini:"token_endpoint"` InspectEndpoint string `ini:"inspect_endpoint"` AuthEndpoint string `ini:"auth_endpoint"` Scope string `ini:"scope"` AllowDisconnect bool `ini:"allow_disconnect"` MapUserID string `ini:"map_user_id"` MapUsername string `ini:"map_username"` MapDisplayName string `ini:"map_display_name"` MapEmail string `ini:"map_email"` } // AppCfg holds values that affect how the application functions AppCfg struct { SiteName string `ini:"site_name"` SiteDesc string `ini:"site_description"` Host string `ini:"host"` // Site appearance Theme string `ini:"theme"` Editor string `ini:"editor"` JSDisabled bool `ini:"disable_js"` WebFonts bool `ini:"webfonts"` Landing string `ini:"landing"` SimpleNav bool `ini:"simple_nav"` WFModesty bool `ini:"wf_modesty"` // Site functionality Chorus bool `ini:"chorus"` Forest bool `ini:"forest"` // The admin cares about the forest, not the trees. Hide unnecessary technical info. DisableDrafts bool `ini:"disable_drafts"` // Users SingleUser bool `ini:"single_user"` OpenRegistration bool `ini:"open_registration"` OpenDeletion bool `ini:"open_deletion"` MinUsernameLen int `ini:"min_username_len"` MaxBlogs int `ini:"max_blogs"` // Options for public instances // Federation Federation bool `ini:"federation"` PublicStats bool `ini:"public_stats"` Monetization bool `ini:"monetization"` NotesOnly bool `ini:"notes_only"` // Access Private bool `ini:"private"` // Additional functions LocalTimeline bool `ini:"local_timeline"` UserInvites string `ini:"user_invites"` // Defaults DefaultVisibility string `ini:"default_visibility"` // Check for Updates UpdateChecks bool `ini:"update_checks"` // Disable password authentication if use only Oauth DisablePasswordAuth bool `ini:"disable_password_auth"` } + EmailCfg struct { + Domain string `ini:"domain"` + MailgunPrivate string `ini:"mailgun_private"` + } + // Config holds the complete configuration for running a writefreely instance Config struct { Server ServerCfg `ini:"server"` Database DatabaseCfg `ini:"database"` App AppCfg `ini:"app"` + Email EmailCfg `ini:"email"` SlackOauth SlackOauthCfg `ini:"oauth.slack"` WriteAsOauth WriteAsOauthCfg `ini:"oauth.writeas"` GitlabOauth GitlabOauthCfg `ini:"oauth.gitlab"` GiteaOauth GiteaOauthCfg `ini:"oauth.gitea"` GenericOauth GenericOauthCfg `ini:"oauth.generic"` } ) // New creates a new Config with sane defaults func New() *Config { c := &Config{ Server: ServerCfg{ Port: 8080, Bind: "localhost", /* IPV6 support when not using localhost? */ }, App: AppCfg{ Host: "http://localhost:8080", Theme: "write", WebFonts: true, SingleUser: true, MinUsernameLen: 3, MaxBlogs: 1, Federation: true, PublicStats: true, }, } c.UseMySQL(true) return c } // UseMySQL resets the Config's Database to use default values for a MySQL setup. func (cfg *Config) UseMySQL(fresh bool) { cfg.Database.Type = "mysql" if fresh { cfg.Database.Host = "localhost" cfg.Database.Port = 3306 } } // UseSQLite resets the Config's Database to use default values for a SQLite setup. func (cfg *Config) UseSQLite(fresh bool) { cfg.Database.Type = "sqlite3" if fresh { cfg.Database.FileName = "writefreely.db" } } // IsSecureStandalone returns whether or not the application is running as a // standalone server with TLS enabled. func (cfg *Config) IsSecureStandalone() bool { return cfg.Server.Port == 443 && cfg.Server.TLSCertPath != "" && cfg.Server.TLSKeyPath != "" } func (ac *AppCfg) LandingPath() string { if !strings.HasPrefix(ac.Landing, "/") { return "/" + ac.Landing } return ac.Landing } +func (lc EmailCfg) Enabled() bool { + return lc.Domain != "" && lc.MailgunPrivate != "" +} + func (ac AppCfg) SignupPath() string { if !ac.OpenRegistration { return "" } if ac.Chorus || ac.Private || (ac.Landing != "" && ac.Landing != "/") { return "/signup" } return "/" } // Load reads the given configuration file, then parses and returns it as a Config. func Load(fname string) (*Config, error) { if fname == "" { fname = FileName } cfg, err := ini.Load(fname) if err != nil { return nil, err } // Parse INI file uc := &Config{} err = cfg.MapTo(uc) if err != nil { return nil, err } // Do any transformations u, err := url.Parse(uc.App.Host) if err != nil { return nil, err } d, err := idna.ToASCII(u.Hostname()) if err != nil { log.Error("idna.ToASCII for %s: %s", u.Hostname(), err) return nil, err } uc.App.Host = u.Scheme + "://" + d if u.Port() != "" { uc.App.Host += ":" + u.Port() } return uc, nil } // Save writes the given Config to the given file. func Save(uc *Config, fname string) error { cfg := ini.Empty() err := ini.ReflectFrom(cfg, uc) if err != nil { return err } if fname == "" { fname = FileName } return cfg.SaveTo(fname) } diff --git a/config/data.go b/config/data.go index 1c12fdc..35b61cd 100644 --- a/config/data.go +++ b/config/data.go @@ -1,16 +1,16 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package config type UserCreation struct { Username string HashedPass []byte } diff --git a/config/funcs.go b/config/funcs.go index fc8c687..7c6fd4f 100644 --- a/config/funcs.go +++ b/config/funcs.go @@ -1,62 +1,62 @@ /* - * Copyright © 2018, 2020-2021 A Bunch Tell LLC. + * Copyright © 2018, 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package config import ( "github.com/writeas/web-core/log" "golang.org/x/net/idna" "net/http" "net/url" "strings" "time" ) // FriendlyHost returns the app's Host sans any schema func (ac AppCfg) FriendlyHost() string { rawHost := ac.Host[strings.Index(ac.Host, "://")+len("://"):] u, err := url.Parse(ac.Host) if err != nil { log.Error("url.Parse failed on %s: %s", ac.Host, err) return rawHost } d, err := idna.ToUnicode(u.Hostname()) if err != nil { log.Error("idna.ToUnicode failed on %s: %s", ac.Host, err) return rawHost } res := d if u.Port() != "" { res += ":" + u.Port() } return res } func (ac AppCfg) CanCreateBlogs(currentlyUsed uint64) bool { if ac.MaxBlogs <= 0 { return true } return int(currentlyUsed) < ac.MaxBlogs } // OrDefaultString returns input or a default value if input is empty. func OrDefaultString(input, defaultValue string) string { if len(input) == 0 { return defaultValue } return input } // DefaultHTTPClient returns a sane default HTTP client. func DefaultHTTPClient() *http.Client { return &http.Client{Timeout: 10 * time.Second} } diff --git a/config/setup.go b/config/setup.go index 08c479f..b00392d 100644 --- a/config/setup.go +++ b/config/setup.go @@ -1,382 +1,382 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package config import ( "fmt" "github.com/fatih/color" "github.com/manifoldco/promptui" "github.com/mitchellh/go-wordwrap" "github.com/writeas/web-core/auth" "strconv" "strings" ) type SetupData struct { User *UserCreation Config *Config } func Configure(fname string, configSections string) (*SetupData, error) { data := &SetupData{} var err error if fname == "" { fname = FileName } data.Config, err = Load(fname) var action string isNewCfg := false if err != nil { fmt.Printf("No %s configuration yet. Creating new.\n", fname) data.Config = New() action = "generate" isNewCfg = true } else { fmt.Printf("Loaded configuration %s.\n", fname) action = "update" } title := color.New(color.Bold, color.BgGreen).PrintFunc() intro := color.New(color.Bold, color.FgWhite).PrintlnFunc() fmt.Println() intro(" ✍ WriteFreely Configuration ✍") fmt.Println() fmt.Println(wordwrap.WrapString(" This quick configuration process will "+action+" the application's config file, "+fname+".\n\n It validates your input along the way, so you can be sure any future errors aren't caused by a bad configuration. If you'd rather configure your server manually, instead run: writefreely --create-config and edit that file.", 75)) fmt.Println() tmpls := &promptui.PromptTemplates{ Success: "{{ . | bold | faint }}: ", } selTmpls := &promptui.SelectTemplates{ - Selected: fmt.Sprintf(`{{.Label}} {{ . | faint }}`), + Selected: `{{.Label}} {{ . | faint }}`, } var selPrompt promptui.Select var prompt promptui.Prompt if strings.Contains(configSections, "server") { title(" Server setup ") fmt.Println() // Environment selection selPrompt = promptui.Select{ Templates: selTmpls, Label: "Environment", Items: []string{"Development", "Production, standalone", "Production, behind reverse proxy"}, } _, envType, err := selPrompt.Run() if err != nil { return data, err } isDevEnv := envType == "Development" isStandalone := envType == "Production, standalone" data.Config.Server.Dev = isDevEnv if isDevEnv || !isStandalone { // Running in dev environment or behind reverse proxy; ask for port prompt = promptui.Prompt{ Templates: tmpls, Label: "Local port", Validate: validatePort, Default: fmt.Sprintf("%d", data.Config.Server.Port), } port, err := prompt.Run() if err != nil { return data, err } data.Config.Server.Port, _ = strconv.Atoi(port) // Ignore error, as we've already validated number } if isStandalone { selPrompt = promptui.Select{ Templates: selTmpls, Label: "Web server mode", Items: []string{"Insecure (port 80)", "Secure (port 443), manual certificate", "Secure (port 443), auto certificate"}, } sel, _, err := selPrompt.Run() if err != nil { return data, err } if sel == 0 { data.Config.Server.Autocert = false data.Config.Server.Port = 80 data.Config.Server.TLSCertPath = "" data.Config.Server.TLSKeyPath = "" } else if sel == 1 || sel == 2 { data.Config.Server.Port = 443 data.Config.Server.Autocert = sel == 2 if sel == 1 { // Manual certificate configuration prompt = promptui.Prompt{ Templates: tmpls, Label: "Certificate path", Validate: validateNonEmpty, Default: data.Config.Server.TLSCertPath, } data.Config.Server.TLSCertPath, err = prompt.Run() if err != nil { return data, err } prompt = promptui.Prompt{ Templates: tmpls, Label: "Key path", Validate: validateNonEmpty, Default: data.Config.Server.TLSKeyPath, } data.Config.Server.TLSKeyPath, err = prompt.Run() if err != nil { return data, err } } else { // Automatic certificate data.Config.Server.TLSCertPath = "certs" data.Config.Server.TLSKeyPath = "certs" } } } else { data.Config.Server.TLSCertPath = "" data.Config.Server.TLSKeyPath = "" } fmt.Println() } if strings.Contains(configSections, "db") { title(" Database setup ") fmt.Println() selPrompt = promptui.Select{ Templates: selTmpls, Label: "Database driver", Items: []string{"MySQL", "SQLite"}, } sel, _, err := selPrompt.Run() if err != nil { return data, err } if sel == 0 { // Configure for MySQL data.Config.UseMySQL(isNewCfg) prompt = promptui.Prompt{ Templates: tmpls, Label: "Username", Validate: validateNonEmpty, Default: data.Config.Database.User, } data.Config.Database.User, err = prompt.Run() if err != nil { return data, err } prompt = promptui.Prompt{ Templates: tmpls, Label: "Password", Validate: validateNonEmpty, Default: data.Config.Database.Password, Mask: '*', } data.Config.Database.Password, err = prompt.Run() if err != nil { return data, err } prompt = promptui.Prompt{ Templates: tmpls, Label: "Database name", Validate: validateNonEmpty, Default: data.Config.Database.Database, } data.Config.Database.Database, err = prompt.Run() if err != nil { return data, err } prompt = promptui.Prompt{ Templates: tmpls, Label: "Host", Validate: validateNonEmpty, Default: data.Config.Database.Host, } data.Config.Database.Host, err = prompt.Run() if err != nil { return data, err } prompt = promptui.Prompt{ Templates: tmpls, Label: "Port", Validate: validatePort, Default: fmt.Sprintf("%d", data.Config.Database.Port), } dbPort, err := prompt.Run() if err != nil { return data, err } data.Config.Database.Port, _ = strconv.Atoi(dbPort) // Ignore error, as we've already validated number } else if sel == 1 { // Configure for SQLite data.Config.UseSQLite(isNewCfg) prompt = promptui.Prompt{ Templates: tmpls, Label: "Filename", Validate: validateNonEmpty, Default: data.Config.Database.FileName, } data.Config.Database.FileName, err = prompt.Run() if err != nil { return data, err } } fmt.Println() } if strings.Contains(configSections, "app") { title(" App setup ") fmt.Println() selPrompt = promptui.Select{ Templates: selTmpls, Label: "Site type", Items: []string{"Single user blog", "Multi-user instance"}, } _, usersType, err := selPrompt.Run() if err != nil { return data, err } data.Config.App.SingleUser = usersType == "Single user blog" if data.Config.App.SingleUser { data.User = &UserCreation{} // prompt for username prompt = promptui.Prompt{ Templates: tmpls, Label: "Admin username", Validate: validateNonEmpty, } data.User.Username, err = prompt.Run() if err != nil { return data, err } // prompt for password prompt = promptui.Prompt{ Templates: tmpls, Label: "Admin password", Validate: validateNonEmpty, } newUserPass, err := prompt.Run() if err != nil { return data, err } data.User.HashedPass, err = auth.HashPass([]byte(newUserPass)) if err != nil { return data, err } } siteNameLabel := "Instance name" if data.Config.App.SingleUser { siteNameLabel = "Blog name" } prompt = promptui.Prompt{ Templates: tmpls, Label: siteNameLabel, Validate: validateNonEmpty, Default: data.Config.App.SiteName, } data.Config.App.SiteName, err = prompt.Run() if err != nil { return data, err } prompt = promptui.Prompt{ Templates: tmpls, Label: "Public URL", Validate: validateDomain, Default: data.Config.App.Host, } data.Config.App.Host, err = prompt.Run() if err != nil { return data, err } if !data.Config.App.SingleUser { selPrompt = promptui.Select{ Templates: selTmpls, Label: "Registration", Items: []string{"Open", "Closed"}, } _, regType, err := selPrompt.Run() if err != nil { return data, err } data.Config.App.OpenRegistration = regType == "Open" prompt = promptui.Prompt{ Templates: tmpls, Label: "Max blogs per user", Default: fmt.Sprintf("%d", data.Config.App.MaxBlogs), } maxBlogs, err := prompt.Run() if err != nil { return data, err } data.Config.App.MaxBlogs, _ = strconv.Atoi(maxBlogs) // Ignore error, as we've already validated number } selPrompt = promptui.Select{ Templates: selTmpls, Label: "Federation", Items: []string{"Enabled", "Disabled"}, } _, fedType, err := selPrompt.Run() if err != nil { return data, err } data.Config.App.Federation = fedType == "Enabled" if data.Config.App.Federation { selPrompt = promptui.Select{ Templates: selTmpls, Label: "Usage stats (active users, posts)", Items: []string{"Public", "Private"}, } _, fedStatsType, err := selPrompt.Run() if err != nil { return data, err } data.Config.App.PublicStats = fedStatsType == "Public" selPrompt = promptui.Select{ Templates: selTmpls, Label: "Instance metadata privacy", Items: []string{"Public", "Private"}, } _, fedStatsType, err = selPrompt.Run() if err != nil { return data, err } data.Config.App.Private = fedStatsType == "Private" } } return data, Save(data.Config, fname) } diff --git a/config/validation.go b/config/validation.go index 598c9fe..f6b8a14 100644 --- a/config/validation.go +++ b/config/validation.go @@ -1,51 +1,51 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package config import ( "fmt" "regexp" "strconv" ) var ( domainReg = regexp.MustCompile("^https?://") ) const ( minPort = 80 maxPort = 1<<16 - 1 ) func validateDomain(i string) error { if !domainReg.MatchString(i) { return fmt.Errorf("Domain must start with http:// or https://") } return nil } func validatePort(i string) error { p, err := strconv.Atoi(i) if err != nil { return err } if p < minPort || p > maxPort { return fmt.Errorf("Port must be a number %d - %d", minPort, maxPort) } return nil } func validateNonEmpty(i string) error { if i == "" { return fmt.Errorf("Must not be empty") } return nil } diff --git a/database-lib.go b/database-lib.go index 8b28577..87a9dee 100644 --- a/database-lib.go +++ b/database-lib.go @@ -1,28 +1,29 @@ +//go:build wflib // +build wflib /* - * Copyright © 2019-2020 A Bunch Tell LLC. + * Copyright © 2019-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // This file contains dummy database funcs for when writefreely is used as a // library. package writefreely func (db *datastore) isDuplicateKeyErr(err error) bool { return false } func (db *datastore) isIgnorableError(err error) bool { return false } func (db *datastore) isHighLoadError(err error) bool { return false } diff --git a/database-no-sqlite.go b/database-no-sqlite.go index f2c7ffc..ef5104e 100644 --- a/database-no-sqlite.go +++ b/database-no-sqlite.go @@ -1,52 +1,53 @@ +//go:build !sqlite && !wflib // +build !sqlite,!wflib /* - * Copyright © 2019-2020 A Bunch Tell LLC. + * Copyright © 2019-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "github.com/go-sql-driver/mysql" "github.com/writeas/web-core/log" ) func (db *datastore) isDuplicateKeyErr(err error) bool { if db.driverName == driverMySQL { if mysqlErr, ok := err.(*mysql.MySQLError); ok { return mysqlErr.Number == mySQLErrDuplicateKey } } else { log.Error("isDuplicateKeyErr: failed check for unrecognized driver '%s'", db.driverName) } return false } func (db *datastore) isIgnorableError(err error) bool { if db.driverName == driverMySQL { if mysqlErr, ok := err.(*mysql.MySQLError); ok { return mysqlErr.Number == mySQLErrCollationMix } } else { log.Error("isIgnorableError: failed check for unrecognized driver '%s'", db.driverName) } return false } func (db *datastore) isHighLoadError(err error) bool { if db.driverName == driverMySQL { if mysqlErr, ok := err.(*mysql.MySQLError); ok { return mysqlErr.Number == mySQLErrMaxUserConns || mysqlErr.Number == mySQLErrTooManyConns } } return false } diff --git a/database-sqlite.go b/database-sqlite.go index 10e701e..7d33315 100644 --- a/database-sqlite.go +++ b/database-sqlite.go @@ -1,72 +1,73 @@ +//go:build sqlite && !wflib // +build sqlite,!wflib /* - * Copyright © 2019-2020 A Bunch Tell LLC. + * Copyright © 2019-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "github.com/go-sql-driver/mysql" "github.com/mattn/go-sqlite3" "github.com/writeas/web-core/log" "regexp" ) func init() { SQLiteEnabled = true regex := func(re, s string) (bool, error) { return regexp.MatchString(re, s) } sql.Register("sqlite3_with_regex", &sqlite3.SQLiteDriver{ ConnectHook: func(conn *sqlite3.SQLiteConn) error { return conn.RegisterFunc("regexp", regex, true) }, }) } func (db *datastore) isDuplicateKeyErr(err error) bool { if db.driverName == driverSQLite { if err, ok := err.(sqlite3.Error); ok { return err.Code == sqlite3.ErrConstraint } } else if db.driverName == driverMySQL { if mysqlErr, ok := err.(*mysql.MySQLError); ok { return mysqlErr.Number == mySQLErrDuplicateKey } } else { log.Error("isDuplicateKeyErr: failed check for unrecognized driver '%s'", db.driverName) } return false } func (db *datastore) isIgnorableError(err error) bool { if db.driverName == driverMySQL { if mysqlErr, ok := err.(*mysql.MySQLError); ok { return mysqlErr.Number == mySQLErrCollationMix } } else { log.Error("isIgnorableError: failed check for unrecognized driver '%s'", db.driverName) } return false } func (db *datastore) isHighLoadError(err error) bool { if db.driverName == driverMySQL { if mysqlErr, ok := err.(*mysql.MySQLError); ok { return mysqlErr.Number == mySQLErrMaxUserConns || mysqlErr.Number == mySQLErrTooManyConns } } return false } diff --git a/database.go b/database.go index f474ae9..85cce90 100644 --- a/database.go +++ b/database.go @@ -1,2815 +1,3256 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "context" "database/sql" "fmt" + "github.com/go-sql-driver/mysql" "github.com/writeas/web-core/silobridge" wf_db "github.com/writefreely/writefreely/db" "net/http" + "net/url" "strings" "time" "github.com/guregu/null" "github.com/guregu/null/zero" uuid "github.com/nu7hatch/gouuid" "github.com/writeas/activityserve" "github.com/writeas/impart" "github.com/writeas/web-core/activitypub" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/data" "github.com/writeas/web-core/id" "github.com/writeas/web-core/log" "github.com/writeas/web-core/query" "github.com/writefreely/writefreely/author" "github.com/writefreely/writefreely/config" "github.com/writefreely/writefreely/key" ) const ( mySQLErrDuplicateKey = 1062 mySQLErrCollationMix = 1267 mySQLErrTooManyConns = 1040 mySQLErrMaxUserConns = 1203 driverMySQL = "mysql" driverSQLite = "sqlite3" ) var ( SQLiteEnabled bool ) type writestore interface { CreateUser(*config.Config, *User, string, string) error UpdateUserEmail(keys *key.Keychain, userID int64, email string) error UpdateEncryptedUserEmail(int64, []byte) error GetUserByID(int64) (*User, error) GetUserForAuth(string) (*User, error) GetUserForAuthByID(int64) (*User, error) GetUserNameFromToken(string) (string, error) GetUserDataFromToken(string) (int64, string, error) GetAPIUser(header string) (*User, error) GetUserID(accessToken string) int64 GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) DeleteToken(accessToken []byte) error FetchLastAccessToken(userID int64) string GetAccessToken(userID int64) (string, error) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) DeleteAccount(userID int64) error ChangeSettings(app *App, u *User, s *userSettings) error ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error GetCollections(u *User, hostName string) (*[]Collection, error) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) GetMeStats(u *User) userMeStats GetTotalCollections() (int64, error) GetTotalPosts() (int64, error) GetTopPosts(u *User, alias string, hostName string) (*[]PublicPost, error) GetAnonymousPosts(u *User, page int) (*[]PublicPost, error) GetUserPosts(u *User) (*[]PublicPost, error) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error GetEditablePost(id, editToken string) (*PublicPost, error) PostIDExists(id string) bool GetPost(id string, collectionID int64) (*PublicPost, error) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) CreateCollectionFromToken(*config.Config, string, string, string) (*Collection, error) CreateCollection(*config.Config, string, string, int64) (*Collection, error) GetCollectionBy(condition string, value interface{}) (*Collection, error) GetCollection(alias string) (*Collection, error) GetCollectionForPad(alias string) (*Collection, error) GetCollectionByID(id int64) (*Collection, error) - UpdateCollection(c *SubmittedCollection, alias string) error + UpdateCollection(app *App, c *SubmittedCollection, alias string) error DeleteCollection(alias string, userID int64) error UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error GetLastPinnedPostPos(collID int64) int64 GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error) RemoveCollectionRedirect(t *sql.Tx, alias string) error GetCollectionRedirect(alias string) (new string) IsCollectionAttributeOn(id int64, attr string) bool CollectionHasAttribute(id int64, attr string) bool CanCollect(cpr *ClaimPostRequest, userID int64) bool AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) GetPostsCount(c *CollectionObj, includeFuture bool) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) + GetAllPostsTaggedIDs(c *Collection, tag string, includeFuture bool) ([]string, error) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) GetAPFollowers(c *Collection) (*[]RemoteUser, error) GetAPActorKeys(collectionID int64) ([]byte, []byte) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error GetUserInvites(userID int64) (*[]Invite, error) GetUserInvite(id string) (*Invite, error) GetUsersInvitedCount(id string) int64 CreateInvitedUser(inviteID string, userID int64) error GetDynamicContent(id string) (*instanceContent, error) UpdateDynamicContent(id, title, content, contentType string) error GetAllUsers(page uint) (*[]User, error) GetAllUsersCount() int64 GetUserLastPostTime(id int64) (*time.Time, error) GetCollectionLastPostTime(id int64) (*time.Time, error) GetIDForRemoteUser(context.Context, string, string, string) (int64, error) RecordRemoteUserID(context.Context, int64, string, string, string, string) error ValidateOAuthState(context.Context, string) (string, string, int64, string, error) GenerateOAuthState(context.Context, string, string, int64, string) (string, error) GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error) RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error DatabaseInitialized() bool } type datastore struct { *sql.DB driverName string } var _ writestore = &datastore{} func (db *datastore) now() string { if db.driverName == driverSQLite { return "strftime('%Y-%m-%d %H:%M:%S','now')" } return "NOW()" } func (db *datastore) clip(field string, l int) string { if db.driverName == driverSQLite { return fmt.Sprintf("SUBSTR(%s, 0, %d)", field, l) } return fmt.Sprintf("LEFT(%s, %d)", field, l) } func (db *datastore) upsert(indexedCols ...string) string { if db.driverName == driverSQLite { // NOTE: SQLite UPSERT syntax only works in v3.24.0 (2018-06-04) or later // Leaving this for whenever we can upgrade and include it in our binary cc := strings.Join(indexedCols, ", ") return "ON CONFLICT(" + cc + ") DO UPDATE SET" } return "ON DUPLICATE KEY UPDATE" } +func (db *datastore) dateAdd(l int, unit string) string { + if db.driverName == driverSQLite { + return fmt.Sprintf("DATETIME('now', '%d %s')", l, unit) + } + return fmt.Sprintf("DATE_ADD(NOW(), INTERVAL %d %s)", l, unit) +} + func (db *datastore) dateSub(l int, unit string) string { if db.driverName == driverSQLite { return fmt.Sprintf("DATETIME('now', '-%d %s')", l, unit) } return fmt.Sprintf("DATE_SUB(NOW(), INTERVAL %d %s)", l, unit) } // CreateUser creates a new user in the database from the given User, UPDATING it in the process with the user's ID. func (db *datastore) CreateUser(cfg *config.Config, u *User, collectionTitle string, collectionDesc string) error { if db.PostIDExists(u.Username) { return impart.HTTPError{http.StatusConflict, "Invalid collection name."} } // New users get a `users` and `collections` row. t, err := db.Begin() if err != nil { return err } // 1. Add to `users` table // NOTE: Assumes User's Password is already hashed! res, err := t.Exec("INSERT INTO users (username, password, email) VALUES (?, ?, ?)", u.Username, u.HashedPass, u.Email) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Rolling back users INSERT: %v\n", err) return err } u.ID, err = res.LastInsertId() if err != nil { t.Rollback() log.Error("Rolling back after LastInsertId: %v\n", err) return err } // 2. Create user's Collection if collectionTitle == "" { collectionTitle = u.Username } res, err = t.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", u.Username, collectionTitle, collectionDesc, defaultVisibility(cfg), u.ID, 0) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Rolling back collections INSERT: %v\n", err) return err } db.RemoveCollectionRedirect(t, u.Username) err = t.Commit() if err != nil { t.Rollback() log.Error("Rolling back after Commit(): %v\n", err) return err } return nil } // FIXME: We're returning errors inconsistently in this file. Do we use Errorf // for returned value, or impart? func (db *datastore) UpdateUserEmail(keys *key.Keychain, userID int64, email string) error { encEmail, err := data.Encrypt(keys.EmailKey, email) if err != nil { return fmt.Errorf("Couldn't encrypt email %s: %s\n", email, err) } return db.UpdateEncryptedUserEmail(userID, encEmail) } func (db *datastore) UpdateEncryptedUserEmail(userID int64, encEmail []byte) error { _, err := db.Exec("UPDATE users SET email = ? WHERE id = ?", encEmail, userID) if err != nil { return fmt.Errorf("Unable to update user email: %s", err) } return nil } func (db *datastore) CreateCollectionFromToken(cfg *config.Config, alias, title, accessToken string) (*Collection, error) { userID := db.GetUserID(accessToken) if userID == -1 { return nil, ErrBadAccessToken } return db.CreateCollection(cfg, alias, title, userID) } func (db *datastore) GetUserCollectionCount(userID int64) (uint64, error) { var collCount uint64 err := db.QueryRow("SELECT COUNT(*) FROM collections WHERE owner_id = ?", userID).Scan(&collCount) switch { case err == sql.ErrNoRows: return 0, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user from database."} case err != nil: log.Error("Couldn't get collections count for user %d: %v", userID, err) return 0, err } return collCount, nil } func (db *datastore) CreateCollection(cfg *config.Config, alias, title string, userID int64) (*Collection, error) { if db.PostIDExists(alias) { return nil, impart.HTTPError{http.StatusConflict, "Invalid collection name."} } // All good, so create new collection res, err := db.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", alias, title, "", defaultVisibility(cfg), userID, 0) if err != nil { if db.isDuplicateKeyErr(err) { return nil, impart.HTTPError{http.StatusConflict, "Collection already exists."} } log.Error("Couldn't add to collections: %v\n", err) return nil, err } c := &Collection{ Alias: alias, Title: title, OwnerID: userID, PublicOwner: false, Public: defaultVisibility(cfg) == CollPublic, } c.ID, err = res.LastInsertId() if err != nil { log.Error("Couldn't get collection LastInsertId: %v\n", err) } return c, nil } func (db *datastore) GetUserByID(id int64) (*User, error) { u := &User{ID: id} err := db.QueryRow("SELECT username, password, email, created, status FROM users WHERE id = ?", id).Scan(&u.Username, &u.HashedPass, &u.Email, &u.Created, &u.Status) switch { case err == sql.ErrNoRows: return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password: %v", err) return nil, err } return u, nil } // IsUserSilenced returns true if the user account associated with id is // currently silenced. func (db *datastore) IsUserSilenced(id int64) (bool, error) { u := &User{ID: id} err := db.QueryRow("SELECT status FROM users WHERE id = ?", id).Scan(&u.Status) switch { case err == sql.ErrNoRows: - return false, fmt.Errorf("is user silenced: %v", ErrUserNotFound) + return false, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user status: %v", err) return false, fmt.Errorf("is user silenced: %v", err) } return u.IsSilenced(), nil } // DoesUserNeedAuth returns true if the user hasn't provided any methods for // authenticating with the account, such a passphrase or email address. // Any errors are reported to admin and silently quashed, returning false as the // result. func (db *datastore) DoesUserNeedAuth(id int64) bool { var pass, email []byte // Find out if user has an email set first err := db.QueryRow("SELECT password, email FROM users WHERE id = ?", id).Scan(&pass, &email) switch { case err == sql.ErrNoRows: // ERROR. Don't give false positives on needing auth methods return false case err != nil: // ERROR. Don't give false positives on needing auth methods log.Error("Couldn't SELECT user %d from users: %v", id, err) return false } // User doesn't need auth if there's an email return len(email) == 0 && len(pass) == 0 } func (db *datastore) IsUserPassSet(id int64) (bool, error) { var pass []byte err := db.QueryRow("SELECT password FROM users WHERE id = ?", id).Scan(&pass) switch { case err == sql.ErrNoRows: return false, nil case err != nil: log.Error("Couldn't SELECT user %d from users: %v", id, err) return false, err } return len(pass) > 0, nil } func (db *datastore) GetUserForAuth(username string) (*User, error) { u := &User{Username: username} err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE username = ?", username).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status) switch { case err == sql.ErrNoRows: // Check if they've entered the wrong, unnormalized username username = getSlug(username, "") if username != u.Username { err = db.QueryRow("SELECT id FROM users WHERE username = ? LIMIT 1", username).Scan(&u.ID) if err == nil { return db.GetUserForAuth(username) } } return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password: %v", err) return nil, err } return u, nil } func (db *datastore) GetUserForAuthByID(userID int64) (*User, error) { u := &User{ID: userID} err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE id = ?", u.ID).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status) switch { case err == sql.ErrNoRows: return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT userForAuthByID: %v", err) return nil, err } return u, nil } func (db *datastore) GetUserNameFromToken(accessToken string) (string, error) { t := auth.GetToken(accessToken) if len(t) == 0 { return "", ErrNoAccessToken } var oneTime bool var username string err := db.QueryRow("SELECT username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&username, &oneTime) switch { case err == sql.ErrNoRows: return "", ErrBadAccessToken case err != nil: return "", ErrInternalGeneral } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return username, nil } func (db *datastore) GetUserDataFromToken(accessToken string) (int64, string, error) { t := auth.GetToken(accessToken) if len(t) == 0 { return 0, "", ErrNoAccessToken } var userID int64 var oneTime bool var username string err := db.QueryRow("SELECT user_id, username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &username, &oneTime) switch { case err == sql.ErrNoRows: return 0, "", ErrBadAccessToken case err != nil: return 0, "", ErrInternalGeneral } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return userID, username, nil } func (db *datastore) GetAPIUser(header string) (*User, error) { uID := db.GetUserID(header) if uID == -1 { return nil, fmt.Errorf(ErrUserNotFound.Error()) } return db.GetUserByID(uID) } // GetUserID takes a hexadecimal accessToken, parses it into its binary // representation, and gets any user ID associated with the token. If no user // is associated, -1 is returned. func (db *datastore) GetUserID(accessToken string) int64 { i, _ := db.GetUserIDPrivilege(accessToken) return i } func (db *datastore) GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) { t := auth.GetToken(accessToken) if len(t) == 0 { return -1, false } var oneTime bool err := db.QueryRow("SELECT user_id, sudo, one_time FROM accesstokens WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &sudo, &oneTime) switch { case err == sql.ErrNoRows: return -1, false case err != nil: return -1, false } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return } func (db *datastore) DeleteToken(accessToken []byte) error { res, err := db.Exec("DELETE FROM accesstokens WHERE token LIKE ?", accessToken) if err != nil { return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { return impart.HTTPError{http.StatusNotFound, "Token is invalid or doesn't exist"} } return nil } // FetchLastAccessToken creates a new non-expiring, valid access token for the given // userID. func (db *datastore) FetchLastAccessToken(userID int64) string { var t []byte err := db.QueryRow("SELECT token FROM accesstokens WHERE user_id = ? AND (expires IS NULL OR expires > "+db.now()+") ORDER BY created DESC LIMIT 1", userID).Scan(&t) switch { case err == sql.ErrNoRows: return "" case err != nil: log.Error("Failed selecting from accesstoken: %v", err) return "" } u, err := uuid.Parse(t) if err != nil { return "" } return u.String() } // GetAccessToken creates a new non-expiring, valid access token for the given // userID. func (db *datastore) GetAccessToken(userID int64) (string, error) { return db.GetTemporaryOneTimeAccessToken(userID, 0, false) } // GetTemporaryAccessToken creates a new valid access token for the given // userID that remains valid for the given time in seconds. If validSecs is 0, // the access token doesn't automatically expire. func (db *datastore) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) { return db.GetTemporaryOneTimeAccessToken(userID, validSecs, false) } // GetTemporaryOneTimeAccessToken creates a new valid access token for the given // userID that remains valid for the given time in seconds and can only be used // once if oneTime is true. If validSecs is 0, the access token doesn't // automatically expire. func (db *datastore) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) { u, err := uuid.NewV4() if err != nil { log.Error("Unable to generate token: %v", err) return "", err } // Insert UUID to `accesstokens` binTok := u[:] expirationVal := "NULL" if validSecs > 0 { - expirationVal = fmt.Sprintf("DATE_ADD("+db.now()+", INTERVAL %d SECOND)", validSecs) + expirationVal = db.dateAdd(validSecs, "SECOND") } _, err = db.Exec("INSERT INTO accesstokens (token, user_id, one_time, expires) VALUES (?, ?, ?, "+expirationVal+")", string(binTok), userID, oneTime) if err != nil { log.Error("Couldn't INSERT accesstoken: %v", err) return "", err } return u.String(), nil } func (db *datastore) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) { var userID, collID int64 = -1, -1 var coll *Collection var err error if accessToken != "" { userID = db.GetUserID(accessToken) if userID == -1 { return nil, ErrBadAccessToken } if collAlias != "" { coll, err = db.GetCollection(collAlias) if err != nil { return nil, err } coll.hostName = hostName if coll.OwnerID != userID { return nil, ErrForbiddenCollection } collID = coll.ID } } rp := &PublicPost{} rp.Post, err = db.CreatePost(userID, collID, post) if err != nil { return rp, err } if coll != nil { coll.ForPublic() rp.Collection = &CollectionObj{Collection: *coll} } return rp, nil } func (db *datastore) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) { idLen := postIDLen friendlyID := id.GenerateFriendlyRandomString(idLen) // Handle appearance / font face appearance := post.Font if !post.isFontValid() { appearance = "norm" } var err error ownerID := sql.NullInt64{ Valid: false, } ownerCollID := sql.NullInt64{ Valid: false, } slug := sql.NullString{"", false} // If an alias was supplied, we'll add this to the collection as well. if userID > 0 { ownerID.Int64 = userID ownerID.Valid = true if collID > 0 { ownerCollID.Int64 = collID ownerCollID.Valid = true var slugVal string if post.Slug != nil && *post.Slug != "" { slugVal = *post.Slug } else { if post.Title != nil && *post.Title != "" { slugVal = getSlug(*post.Title, post.Language.String) if slugVal == "" { slugVal = getSlug(*post.Content, post.Language.String) } } else { slugVal = getSlug(*post.Content, post.Language.String) } } if slugVal == "" { slugVal = friendlyID } slug = sql.NullString{slugVal, true} } } created := time.Now() if db.driverName == driverSQLite { // SQLite stores datetimes in UTC, so convert time.Now() to it here created = created.UTC() } - if post.Created != nil { + if post.Created != nil && *post.Created != "" { created, err = time.Parse("2006-01-02T15:04:05Z", *post.Created) if err != nil { log.Error("Unable to parse Created time '%s': %v", *post.Created, err) created = time.Now() if db.driverName == driverSQLite { // SQLite stores datetimes in UTC, so convert time.Now() to it here created = created.UTC() } } } stmt, err := db.Prepare("INSERT INTO posts (id, slug, title, content, text_appearance, language, rtl, privacy, owner_id, collection_id, created, updated, view_count) VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?, ?, " + db.now() + ", ?)") if err != nil { return nil, err } defer stmt.Close() _, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0) if err != nil { if db.isDuplicateKeyErr(err) { // Duplicate entry error; try a new slug // TODO: make this a little more robust slug = sql.NullString{id.GenSafeUniqueSlug(slug.String), true} _, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0) if err != nil { return nil, handleFailedPostInsert(fmt.Errorf("Retried slug generation, still failed: %v", err)) } } else { return nil, handleFailedPostInsert(err) } } // TODO: return Created field in proper format return &Post{ ID: friendlyID, Slug: null.NewString(slug.String, slug.Valid), Font: appearance, Language: zero.NewString(post.Language.String, post.Language.Valid), RTL: zero.NewBool(post.IsRTL.Bool, post.IsRTL.Valid), OwnerID: null.NewInt(userID, true), CollectionID: null.NewInt(userID, true), Created: created.Truncate(time.Second).UTC(), Updated: time.Now().Truncate(time.Second).UTC(), Title: zero.NewString(*(post.Title), true), Content: *(post.Content), }, nil } // UpdateOwnedPost updates an existing post with only the given fields in the // supplied AuthenticatedPost. func (db *datastore) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error { params := []interface{}{} var queryUpdates, sep, authCondition string if post.Slug != nil && *post.Slug != "" { queryUpdates += sep + "slug = ?" sep = ", " params = append(params, getSlug(*post.Slug, "")) } if post.Content != nil { queryUpdates += sep + "content = ?" sep = ", " params = append(params, post.Content) } if post.Title != nil { queryUpdates += sep + "title = ?" sep = ", " params = append(params, post.Title) } if post.Language.Valid { queryUpdates += sep + "language = ?" sep = ", " params = append(params, post.Language.String) } if post.IsRTL.Valid { queryUpdates += sep + "rtl = ?" sep = ", " params = append(params, post.IsRTL.Bool) } if post.Font != "" { queryUpdates += sep + "text_appearance = ?" sep = ", " params = append(params, post.Font) } if post.Created != nil { createTime, err := time.Parse(postMetaDateFormat, *post.Created) if err != nil { log.Error("Unable to parse Created date: %v", err) return fmt.Errorf("That's the incorrect format for Created date.") } queryUpdates += sep + "created = ?" sep = ", " params = append(params, createTime) } // WHERE parameters... // id = ? params = append(params, post.ID) // AND owner_id = ? authCondition = "(owner_id = ?)" params = append(params, userID) if queryUpdates == "" { return ErrPostNoUpdatableVals } queryUpdates += sep + "updated = " + db.now() res, err := db.Exec("UPDATE posts SET "+queryUpdates+" WHERE id = ? AND "+authCondition, params...) if err != nil { log.Error("Unable to update owned post: %v", err) return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND "+authCondition, post.ID, params[len(params)-1]).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedEditPost case err != nil: log.Error("Failed selecting from posts: %v", err) } return nil } return nil } func (db *datastore) GetCollectionBy(condition string, value interface{}) (*Collection, error) { c := &Collection{} // FIXME: change Collection to reflect database values. Add helper functions to get actual values var styleSheet, script, signature, format zero.String row := db.QueryRow("SELECT id, alias, title, description, style_sheet, script, post_signature, format, owner_id, privacy, view_count FROM collections WHERE "+condition, value) err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &styleSheet, &script, &signature, &format, &c.OwnerID, &c.Visibility, &c.Views) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."} case db.isHighLoadError(err): return nil, ErrUnavailable case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } c.StyleSheet = styleSheet.String c.Script = script.String c.Signature = signature.String c.Format = format.String c.Public = c.IsPublic() c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer") + c.Verification = db.GetCollectionAttribute(c.ID, "verification_link") c.db = db return c, nil } func (db *datastore) GetCollection(alias string) (*Collection, error) { return db.GetCollectionBy("alias = ?", alias) } func (db *datastore) GetCollectionForPad(alias string) (*Collection, error) { c := &Collection{Alias: alias} row := db.QueryRow("SELECT id, alias, title, description, privacy FROM collections WHERE alias = ?", alias) err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility) switch { case err == sql.ErrNoRows: return c, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."} case err != nil: log.Error("Failed selecting from collections: %v", err) return c, ErrInternalGeneral } c.Public = c.IsPublic() return c, nil } func (db *datastore) GetCollectionByID(id int64) (*Collection, error) { return db.GetCollectionBy("id = ?", id) } func (db *datastore) GetCollectionFromDomain(host string) (*Collection, error) { return db.GetCollectionBy("host = ?", host) } -func (db *datastore) UpdateCollection(c *SubmittedCollection, alias string) error { +func (db *datastore) UpdateCollection(app *App, c *SubmittedCollection, alias string) error { q := query.NewUpdate(). SetStringPtr(c.Title, "title"). SetStringPtr(c.Description, "description"). SetNullString(c.StyleSheet, "style_sheet"). SetNullString(c.Script, "script"). SetNullString(c.Signature, "post_signature") if c.Format != nil { cf := &CollectionFormat{Format: c.Format.String} if cf.Valid() { q.SetNullString(c.Format, "format") } } var updatePass bool if c.Visibility != nil && (collVisibility(*c.Visibility)&CollProtected == 0 || c.Pass != "") { q.SetIntPtr(c.Visibility, "privacy") if c.Pass != "" { updatePass = true } } // WHERE values q.Where("alias = ? AND owner_id = ?", alias, c.OwnerID) if q.Updates == "" && c.Monetization == nil { return ErrPostNoUpdatableVals } // Find any current domain var collID int64 var rowsAffected int64 var changed bool var res sql.Result err := db.QueryRow("SELECT id FROM collections WHERE alias = ?", alias).Scan(&collID) if err != nil { log.Error("Failed selecting from collections: %v. Some things won't work.", err) } // Update MathJax value if c.MathJax { if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", collID, "render_mathjax", "1") } else { _, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "render_mathjax", "1", "1") } if err != nil { log.Error("Unable to insert render_mathjax value: %v", err) return err } } else { _, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "render_mathjax") if err != nil { log.Error("Unable to delete render_mathjax value: %v", err) return err } } + // Update Verification link value + if c.Verification != nil { + skipUpdate := false + if *c.Verification != "" { + // Strip away any excess spaces + trimmed := strings.TrimSpace(*c.Verification) + if strings.HasPrefix(trimmed, "@") && strings.Count(trimmed, "@") == 2 { + // This looks like a fediverse handle, so resolve profile URL + profileURL, err := GetProfileURLFromHandle(app, trimmed) + if err != nil || profileURL == "" { + log.Error("Couldn't find user %s: %v", trimmed, err) + skipUpdate = true + } else { + c.Verification = &profileURL + } + } else { + if !strings.HasPrefix(trimmed, "http") { + trimmed = "https://" + trimmed + } + vu, err := url.Parse(trimmed) + if err != nil { + // Value appears invalid, so don't update + skipUpdate = true + } else { + s := vu.String() + c.Verification = &s + } + } + } + if !skipUpdate { + err = db.SetCollectionAttribute(collID, "verification_link", *c.Verification) + if err != nil { + log.Error("Unable to insert verification_link value: %v", err) + return err + } + } + } + // Update Monetization value if c.Monetization != nil { skipUpdate := false if *c.Monetization != "" { // Strip away any excess spaces trimmed := strings.TrimSpace(*c.Monetization) // Only update value when it starts with "$", per spec: https://paymentpointers.org if strings.HasPrefix(trimmed, "$") { c.Monetization = &trimmed } else { // Value appears invalid, so don't update skipUpdate = true } } if !skipUpdate { - _, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) ON DUPLICATE KEY UPDATE value = ?", collID, "monetization_pointer", *c.Monetization, *c.Monetization) + _, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "monetization_pointer", *c.Monetization, *c.Monetization) if err != nil { log.Error("Unable to insert monetization_pointer value: %v", err) return err } } } + // Update EmailSub value + if c.EmailSubs { + err = db.SetCollectionAttribute(collID, "email_subs", "1") + if err != nil { + log.Error("Unable to insert email_subs value: %v", err) + return err + } + skipUpdate := false + if c.LetterReply != nil { + // Strip away any excess spaces + trimmed := strings.TrimSpace(*c.LetterReply) + // Only update value when it contains "@" + if strings.IndexRune(trimmed, '@') > 0 { + c.LetterReply = &trimmed + } else { + // Value appears invalid, so don't update + skipUpdate = true + } + if !skipUpdate { + err = db.SetCollectionAttribute(collID, collAttrLetterReplyTo, *c.LetterReply) + if err != nil { + log.Error("Unable to insert %s value: %v", collAttrLetterReplyTo, err) + return err + } + } + } + } else { + _, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "email_subs") + if err != nil { + log.Error("Unable to delete email_subs value: %v", err) + return err + } + } + // Update rest of the collection data if q.Updates != "" { res, err = db.Exec("UPDATE collections SET "+q.Updates+" WHERE "+q.Conditions, q.Params...) if err != nil { log.Error("Unable to update collection: %v", err) return err } } rowsAffected, _ = res.RowsAffected() if !changed || rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM collections WHERE alias = ? AND owner_id = ?", alias, c.OwnerID).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedEditPost case err != nil: log.Error("Failed selecting from collections: %v", err) } if !updatePass { return nil } } if updatePass { hashedPass, err := auth.HashPass([]byte(c.Pass)) if err != nil { log.Error("Unable to create hash: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?)", alias, hashedPass) } else { _, err = db.Exec("INSERT INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?) "+db.upsert("collection_id")+" password = ?", alias, hashedPass, hashedPass) } if err != nil { return err } } return nil } const postCols = "id, slug, text_appearance, language, rtl, privacy, owner_id, collection_id, pinned_position, created, updated, view_count, title, content" // getEditablePost returns a PublicPost with the given ID only if the given // edit token is valid for the post. func (db *datastore) GetEditablePost(id, editToken string) (*PublicPost, error) { // FIXME: code duplicated from getPost() // TODO: add slight logic difference to getPost / one func var ownerName sql.NullString p := &Post{} row := db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE id = ? LIMIT 1", id) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName) switch { case err == sql.ErrNoRows: return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() if ownerName.Valid { res.Owner = &PublicUser{Username: ownerName.String} } return &res, nil } func (db *datastore) PostIDExists(id string) bool { var dummy bool err := db.QueryRow("SELECT 1 FROM posts WHERE id = ?", id).Scan(&dummy) return err == nil && dummy } // GetPost gets a public-facing post object from the database. If collectionID // is > 0, the post will be retrieved by slug and collection ID, rather than // post ID. // TODO: break this into two functions: // - GetPost(id string) // - GetCollectionPost(slug string, collectionID int64) func (db *datastore) GetPost(id string, collectionID int64) (*PublicPost, error) { var ownerName sql.NullString p := &Post{} var row *sql.Row var where string params := []interface{}{id} if collectionID > 0 { where = "slug = ? AND collection_id = ?" params = append(params, collectionID) } else { where = "id = ?" } row = db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE "+where+" LIMIT 1", params...) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName) switch { case err == sql.ErrNoRows: if collectionID > 0 { return nil, ErrCollectionPageNotFound } return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() if ownerName.Valid { res.Owner = &PublicUser{Username: ownerName.String} } return &res, nil } // TODO: don't duplicate getPost() functionality func (db *datastore) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) { p := &Post{} var row *sql.Row where := "id = ? AND owner_id = ?" params := []interface{}{id, ownerID} row = db.QueryRow("SELECT "+postCols+" FROM posts WHERE "+where+" LIMIT 1", params...) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) switch { case err == sql.ErrNoRows: return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() return &res, nil } func (db *datastore) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) { propSelects := map[string]string{ "views": "view_count AS views", } selectQuery, ok := propSelects[property] if !ok { return nil, impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid property: %s.", property)} } var res interface{} var row *sql.Row if collectionID != 0 { row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE slug = ? AND collection_id = ? LIMIT 1", id, collectionID) } else { row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE id = ? LIMIT 1", id) } err := row.Scan(&res) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Post not found."} case err != nil: log.Error("Failed selecting post: %v", err) return nil, err } return res, nil } // GetPostsCount modifies the CollectionObj to include the correct number of // standard (non-pinned) posts. It will return future posts if `includeFuture` // is true. func (db *datastore) GetPostsCount(c *CollectionObj, includeFuture bool) { var count int64 timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND pinned_position IS NULL "+timeCondition, c.ID).Scan(&count) switch { case err == sql.ErrNoRows: c.TotalPosts = 0 case err != nil: log.Error("Failed selecting from collections: %v", err) c.TotalPosts = 0 } c.TotalPosts = int(count) } // GetPosts retrieves all posts for the given Collection. // It will return future posts if `includeFuture` is true. // It will include only standard (non-pinned) posts unless `includePinned` is true. // TODO: change includeFuture to isOwner, since that's how it's used func (db *datastore) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) { collID := c.ID cf := c.NewFormat() order := "DESC" if cf.Ascending() && !forceRecentFirst { order = "ASC" } pagePosts := cf.PostsPerPage() start := page*pagePosts - pagePosts if page == 0 { start = 0 pagePosts = 1000 } limitStr := "" if page > 0 { limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) } timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } pinnedCondition := "" if !includePinned { pinnedCondition = "AND pinned_position IS NULL" } rows, err := db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? "+pinnedCondition+" "+timeCondition+" ORDER BY created "+order+limitStr, collID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."} } defer rows.Close() // TODO: extract this common row scanning logic for queries using `postCols` posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() p.augmentContent(c) p.formatContent(cfg, c, includeFuture, false) posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } +func (db *datastore) GetAllPostsTaggedIDs(c *Collection, tag string, includeFuture bool) ([]string, error) { + collID := c.ID + + cf := c.NewFormat() + order := "DESC" + if cf.Ascending() { + order = "ASC" + } + + timeCondition := "" + if !includeFuture { + timeCondition = "AND created <= NOW()" + } + var rows *sql.Rows + var err error + if db.driverName == driverSQLite { + rows, err = db.Query("SELECT id FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order, collID, `.*#`+strings.ToLower(tag)+`\b.*`) + } else { + rows, err = db.Query("SELECT id FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order, collID, "#"+strings.ToLower(tag)+"[[:>:]]") + } + if err != nil { + log.Error("Failed selecting tagged posts: %v", err) + return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve tagged collection posts."} + } + defer rows.Close() + + ids := []string{} + for rows.Next() { + var id string + err = rows.Scan(&id) + if err != nil { + log.Error("Failed scanning row: %v", err) + break + } + + ids = append(ids, id) + } + err = rows.Err() + if err != nil { + log.Error("Error after Next() on rows: %v", err) + } + + return ids, nil +} + // GetPostsTagged retrieves all posts on the given Collection that contain the // given tag. // It will return future posts if `includeFuture` is true. // TODO: change includeFuture to isOwner, since that's how it's used func (db *datastore) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) { collID := c.ID cf := c.NewFormat() order := "DESC" if cf.Ascending() { order = "ASC" } pagePosts := cf.PostsPerPage() start := page*pagePosts - pagePosts if page == 0 { start = 0 pagePosts = 1000 } limitStr := "" if page > 0 { limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) } timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } var rows *sql.Rows var err error if db.driverName == driverSQLite { rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, `.*#`+strings.ToLower(tag)+`\b.*`) } else { rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, "#"+strings.ToLower(tag)+"[[:>:]]") } if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."} } defer rows.Close() // TODO: extract this common row scanning logic for queries using `postCols` posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() p.augmentContent(c) p.formatContent(cfg, c, includeFuture, false) posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } +func (db *datastore) GetCollLangTotalPosts(collID int64, lang string) (uint64, error) { + var articles uint64 + err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND language = ? AND created <= "+db.now(), collID, lang).Scan(&articles) + if err != nil && err != sql.ErrNoRows { + log.Error("Couldn't get total lang posts count for collection %d: %v", collID, err) + return 0, err + } + return articles, nil +} + +func (db *datastore) GetLangPosts(cfg *config.Config, c *Collection, lang string, page int, includeFuture bool) (*[]PublicPost, error) { + collID := c.ID + + cf := c.NewFormat() + order := "DESC" + if cf.Ascending() { + order = "ASC" + } + + pagePosts := cf.PostsPerPage() + start := page*pagePosts - pagePosts + if page == 0 { + start = 0 + pagePosts = 1000 + } + + limitStr := "" + if page > 0 { + limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) + } + timeCondition := "" + if !includeFuture { + timeCondition = "AND created <= " + db.now() + } + + rows, err := db.Query(`SELECT `+postCols+` +FROM posts +WHERE collection_id = ? AND language = ? `+timeCondition+` +ORDER BY created `+order+limitStr, collID, lang) + if err != nil { + log.Error("Failed selecting from posts: %v", err) + return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."} + } + defer rows.Close() + + // TODO: extract this common row scanning logic for queries using `postCols` + posts := []PublicPost{} + for rows.Next() { + p := &Post{} + err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) + if err != nil { + log.Error("Failed scanning row: %v", err) + break + } + p.extractData() + p.augmentContent(c) + p.formatContent(cfg, c, includeFuture, false) + + posts = append(posts, p.processPost()) + } + err = rows.Err() + if err != nil { + log.Error("Error after Next() on rows: %v", err) + } + + return &posts, nil +} + func (db *datastore) GetAPFollowers(c *Collection) (*[]RemoteUser, error) { rows, err := db.Query("SELECT actor_id, inbox, shared_inbox FROM remotefollows f INNER JOIN remoteusers u ON f.remote_user_id = u.id WHERE collection_id = ?", c.ID) if err != nil { log.Error("Failed selecting from followers: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve followers."} } defer rows.Close() followers := []RemoteUser{} for rows.Next() { f := RemoteUser{} err = rows.Scan(&f.ActorID, &f.Inbox, &f.SharedInbox) followers = append(followers, f) } return &followers, nil } // CanCollect returns whether or not the given user can add the given post to a // collection. This is true when a post is already owned by the user. // NOTE: this is currently only used to potentially add owned posts to a // collection. This has the SIDE EFFECT of also generating a slug for the post. // FIXME: make this side effect more explicit (or extract it) func (db *datastore) CanCollect(cpr *ClaimPostRequest, userID int64) bool { var title, content string var lang sql.NullString err := db.QueryRow("SELECT title, content, language FROM posts WHERE id = ? AND owner_id = ?", cpr.ID, userID).Scan(&title, &content, &lang) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Failed on post CanCollect(%s, %d): %v", cpr.ID, userID, err) return false } // Since we have the post content and the post is collectable, generate the // post's slug now. cpr.Slug = getSlugFromPost(title, content, lang.String) return true } func (db *datastore) AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) { qRes, err := db.Exec(query, params...) if err != nil { if db.isDuplicateKeyErr(err) && slugIdx > -1 { s := id.GenSafeUniqueSlug(p.Slug) if s == p.Slug { // Sanity check to prevent infinite recursion return qRes, fmt.Errorf("GenSafeUniqueSlug generated nothing unique: %s", s) } p.Slug = s params[slugIdx] = p.Slug return db.AttemptClaim(p, query, params, slugIdx) } return qRes, fmt.Errorf("attemptClaim: %s", err) } return qRes, nil } func (db *datastore) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) { postClaimReqs := map[string]bool{} res := []ClaimPostResult{} for i := range postIDs { postID := postIDs[i] r := ClaimPostResult{Code: 0, ErrorMessage: ""} // Perform post validation if postID == "" { r.ErrorMessage = "Missing post ID. " } if _, ok := postClaimReqs[postID]; ok { r.Code = 429 r.ErrorMessage = "You've already tried anonymizing this post." r.ID = postID res = append(res, r) continue } postClaimReqs[postID] = true var err error // Get full post information to return var fullPost *PublicPost fullPost, err = db.GetPost(postID, 0) if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message r.ID = postID res = append(res, r) continue } else { log.Error("Error getting post in dispersePosts: %v", err) } } if fullPost.OwnerID.Int64 != userID { r.Code = http.StatusConflict r.ErrorMessage = "Post is already owned by someone else." r.ID = postID res = append(res, r) continue } var qRes sql.Result var query string var params []interface{} // Do AND owner_id = ? for sanity. // This should've been caught and returned with a good error message // just above. query = "UPDATE posts SET collection_id = NULL WHERE id = ? AND owner_id = ?" params = []interface{}{postID, userID} qRes, err = db.Exec(query, params...) if err != nil { r.Code = http.StatusInternalServerError r.ErrorMessage = "A glitch happened on our end." r.ID = postID res = append(res, r) log.Error("dispersePosts (post %s): %v", postID, err) continue } // Post was successfully dispersed r.Code = http.StatusOK r.Post = fullPost rowsAffected, _ := qRes.RowsAffected() if rowsAffected == 0 { // This was already claimed, but return 200 r.Code = http.StatusOK } res = append(res, r) } return &res, nil } func (db *datastore) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) { postClaimReqs := map[string]bool{} res := []ClaimPostResult{} postCollAlias := collAlias for i := range *posts { p := (*posts)[i] if &p == nil { continue } r := ClaimPostResult{Code: 0, ErrorMessage: ""} // Perform post validation if p.ID == "" { r.ErrorMessage = "Missing post ID `id`. " } if _, ok := postClaimReqs[p.ID]; ok { r.Code = 429 r.ErrorMessage = "You've already tried claiming this post." r.ID = p.ID res = append(res, r) continue } postClaimReqs[p.ID] = true canCollect := db.CanCollect(&p, userID) if !canCollect && p.Token == "" { // TODO: ensure post isn't owned by anyone else when a valid modify // token is given. r.ErrorMessage += "Missing post Edit Token `token`." } if r.ErrorMessage != "" { // Post validate failed r.Code = http.StatusBadRequest r.ID = p.ID res = append(res, r) continue } var err error var qRes sql.Result var query string var params []interface{} var slugIdx int = -1 var coll *Collection if collAlias == "" { // Posts are being claimed at /posts/claim, not // /collections/{alias}/collect, so use given individual collection // to associate post with. postCollAlias = p.CollectionAlias } if postCollAlias != "" { // Associate this post with a collection if p.CreateCollection { // This is a new collection // TODO: consider removing this. This seriously complicates this // method and adds another (unnecessary?) logic path. coll, err = db.CreateCollection(cfg, postCollAlias, "", userID) if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message } else { r.Code = http.StatusInternalServerError r.ErrorMessage = "Unknown error occurred creating collection" } r.ID = p.ID res = append(res, r) continue } } else { // Attempt to add to existing collection coll, err = db.GetCollection(postCollAlias) if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { // Show obfuscated "forbidden" response, as if attempting to add to an // unowned blog. r.Code = ErrForbiddenCollection.Status r.ErrorMessage = ErrForbiddenCollection.Message } else { r.Code = err.Status r.ErrorMessage = err.Message } } else { r.Code = http.StatusInternalServerError r.ErrorMessage = "Unknown error occurred claiming post with collection" } r.ID = p.ID res = append(res, r) continue } if coll.OwnerID != userID { r.Code = ErrForbiddenCollection.Status r.ErrorMessage = ErrForbiddenCollection.Message r.ID = p.ID res = append(res, r) continue } } if p.Slug == "" { p.Slug = p.ID } if canCollect { // User already owns this post, so just add it to the given // collection. query = "UPDATE posts SET collection_id = ?, slug = ? WHERE id = ? AND owner_id = ?" params = []interface{}{coll.ID, p.Slug, p.ID, userID} slugIdx = 1 } else { query = "UPDATE posts SET owner_id = ?, collection_id = ?, slug = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL" params = []interface{}{userID, coll.ID, p.Slug, p.ID, p.Token} slugIdx = 2 } } else { query = "UPDATE posts SET owner_id = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL" params = []interface{}{userID, p.ID, p.Token} } qRes, err = db.AttemptClaim(&p, query, params, slugIdx) if err != nil { r.Code = http.StatusInternalServerError r.ErrorMessage = "An unknown error occurred." r.ID = p.ID res = append(res, r) log.Error("claimPosts (post %s): %v", p.ID, err) continue } // Get full post information to return var fullPost *PublicPost if p.Token != "" { fullPost, err = db.GetEditablePost(p.ID, p.Token) } else { fullPost, err = db.GetPost(p.ID, 0) } if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message r.ID = p.ID res = append(res, r) continue } } if fullPost.OwnerID.Int64 != userID { r.Code = http.StatusConflict r.ErrorMessage = "Post is already owned by someone else." r.ID = p.ID res = append(res, r) continue } // Post was successfully claimed r.Code = http.StatusOK r.Post = fullPost if coll != nil { r.Post.Collection = &CollectionObj{Collection: *coll} } rowsAffected, _ := qRes.RowsAffected() if rowsAffected == 0 { // This was already claimed, but return 200 r.Code = http.StatusOK } res = append(res, r) } return &res, nil } func (db *datastore) UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error { if pos <= 0 || pos > 20 { pos = db.GetLastPinnedPostPos(collID) + 1 if pos == -1 { pos = 1 } } var err error if pinned { _, err = db.Exec("UPDATE posts SET pinned_position = ? WHERE id = ?", pos, postID) } else { _, err = db.Exec("UPDATE posts SET pinned_position = NULL WHERE id = ?", postID) } if err != nil { log.Error("Unable to update pinned post: %v", err) return err } return nil } func (db *datastore) GetLastPinnedPostPos(collID int64) int64 { var lastPos sql.NullInt64 err := db.QueryRow("SELECT MAX(pinned_position) FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL", collID).Scan(&lastPos) switch { case err == sql.ErrNoRows: return -1 case err != nil: log.Error("Failed selecting from posts: %v", err) return -1 } if !lastPos.Valid { return -1 } return lastPos.Int64 } func (db *datastore) GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error) { // FIXME: sqlite-backed instances don't include ellipsis on truncated titles timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } rows, err := db.Query("SELECT id, slug, title, "+db.clip("content", 80)+", pinned_position FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL "+timeCondition+" ORDER BY pinned_position ASC", coll.ID) if err != nil { log.Error("Failed selecting pinned posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve pinned posts."} } defer rows.Close() posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Title, &p.Content, &p.PinnedPosition) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() p.augmentContent(&coll.Collection) pp := p.processPost() pp.Collection = coll posts = append(posts, pp) } return &posts, nil } func (db *datastore) GetCollections(u *User, hostName string) (*[]Collection, error) { rows, err := db.Query("SELECT id, alias, title, description, privacy, view_count FROM collections WHERE owner_id = ? ORDER BY id ASC", u.ID) if err != nil { log.Error("Failed selecting from collections: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user collections."} } defer rows.Close() colls := []Collection{} for rows.Next() { c := Collection{} err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views) if err != nil { log.Error("Failed scanning row: %v", err) break } c.hostName = hostName c.URL = c.CanonicalURL() c.Public = c.IsPublic() /* // NOTE: future functionality if visibility != nil { // TODO: && visibility == CollPublic { // Add Monetization info when retrieving all public collections c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer") } */ colls = append(colls, c) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &colls, nil } func (db *datastore) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) { c, err := db.GetCollections(u, hostName) if err != nil { return nil, err } if len(*c) == 0 { return nil, impart.HTTPError{http.StatusInternalServerError, "You don't seem to have any blogs; they might've moved to another account. Try logging out and logging into your other account."} } return c, nil } func (db *datastore) GetPublicCollections(hostName string) (*[]Collection, error) { rows, err := db.Query(`SELECT c.id, alias, title, description, privacy, view_count FROM collections c LEFT JOIN users u ON u.id = c.owner_id WHERE c.privacy = 1 AND u.status = 0 - ORDER BY id ASC`) + ORDER BY title ASC`) if err != nil { log.Error("Failed selecting public collections: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve public collections."} } defer rows.Close() colls := []Collection{} for rows.Next() { c := Collection{} err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views) if err != nil { log.Error("Failed scanning row: %v", err) break } c.hostName = hostName c.URL = c.CanonicalURL() c.Public = c.IsPublic() // Add Monetization information c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer") colls = append(colls, c) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &colls, nil } func (db *datastore) GetMeStats(u *User) userMeStats { s := userMeStats{} // User counts colls, _ := db.GetUserCollectionCount(u.ID) s.TotalCollections = colls var articles, collPosts uint64 err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NULL", u.ID).Scan(&articles) if err != nil && err != sql.ErrNoRows { log.Error("Couldn't get articles count for user %d: %v", u.ID, err) } s.TotalArticles = articles err = db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NOT NULL", u.ID).Scan(&collPosts) if err != nil && err != sql.ErrNoRows { log.Error("Couldn't get coll posts count for user %d: %v", u.ID, err) } s.CollectionPosts = collPosts return s } func (db *datastore) GetTotalCollections() (collCount int64, err error) { err = db.QueryRow(` SELECT COUNT(*) FROM collections c LEFT JOIN users u ON u.id = c.owner_id WHERE u.status = 0`).Scan(&collCount) if err != nil { log.Error("Unable to fetch collections count: %v", err) } return } func (db *datastore) GetTotalPosts() (postCount int64, err error) { err = db.QueryRow(` SELECT COUNT(*) FROM posts p LEFT JOIN users u ON u.id = p.owner_id WHERE u.status = 0`).Scan(&postCount) if err != nil { log.Error("Unable to fetch posts count: %v", err) } return } func (db *datastore) GetTopPosts(u *User, alias string, hostName string) (*[]PublicPost, error) { params := []interface{}{u.ID} where := "" if alias != "" { where = " AND alias = ?" params = append(params, alias) } - rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...) + rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.content, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user top posts."} } defer rows.Close() posts := []PublicPost{} var gotErr bool for rows.Next() { p := Post{} c := Collection{} var alias, title, description sql.NullString var views sql.NullInt64 - err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &alias, &title, &description, &views) + err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Content, &alias, &title, &description, &views) if err != nil { log.Error("Failed scanning User.getPosts() row: %v", err) gotErr = true break } p.extractData() pubPost := p.processPost() if alias.Valid && alias.String != "" { c.Alias = alias.String c.Title = title.String c.Description = description.String c.Views = views.Int64 c.hostName = hostName pubPost.Collection = &CollectionObj{Collection: c} } posts = append(posts, pubPost) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } if gotErr && len(posts) == 0 { // There were a lot of errors return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."} } return &posts, nil } func (db *datastore) GetAnonymousPosts(u *User, page int) (*[]PublicPost, error) { pagePosts := 10 start := page*pagePosts - pagePosts if page == 0 { start = 0 pagePosts = 1000 } limitStr := "" if page > 0 { limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) } - rows, err := db.Query("SELECT id, view_count, title, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC"+limitStr, u.ID) + rows, err := db.Query("SELECT id, view_count, title, language, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC"+limitStr, u.ID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user anonymous posts."} } defer rows.Close() posts := []PublicPost{} for rows.Next() { p := Post{} - err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content) + err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Language, &p.Created, &p.Updated, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } func (db *datastore) GetUserPosts(u *User) (*[]PublicPost, error) { rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.created, p.updated, p.content, p.text_appearance, p.language, p.rtl, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON collection_id = c.id WHERE p.owner_id = ? ORDER BY created ASC", u.ID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."} } defer rows.Close() posts := []PublicPost{} var gotErr bool for rows.Next() { p := Post{} c := Collection{} var alias, title, description sql.NullString var views sql.NullInt64 err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content, &p.Font, &p.Language, &p.RTL, &alias, &title, &description, &views) if err != nil { log.Error("Failed scanning User.getPosts() row: %v", err) gotErr = true break } p.extractData() pubPost := p.processPost() if alias.Valid && alias.String != "" { c.Alias = alias.String c.Title = title.String c.Description = description.String c.Views = views.Int64 pubPost.Collection = &CollectionObj{Collection: c} } posts = append(posts, pubPost) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } if gotErr && len(posts) == 0 { // There were a lot of errors return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."} } return &posts, nil } func (db *datastore) GetUserPostsCount(userID int64) int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ?", userID).Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting posts count for user %d: %v", userID, err) return 0 } return count } // ChangeSettings takes a User and applies the changes in the given // userSettings, MODIFYING THE USER with successful changes. func (db *datastore) ChangeSettings(app *App, u *User, s *userSettings) error { var errPass error q := query.NewUpdate() // Update email if given if s.Email != "" { encEmail, err := data.Encrypt(app.keys.EmailKey, s.Email) if err != nil { log.Error("Couldn't encrypt email %s: %s\n", s.Email, err) return impart.HTTPError{http.StatusInternalServerError, "Unable to encrypt email address."} } q.SetBytes(encEmail, "email") // Update the email if something goes awry updating the password defer func() { if errPass != nil { db.UpdateEncryptedUserEmail(u.ID, encEmail) } }() u.Email = zero.StringFrom(s.Email) } // Update username if given var newUsername string if s.Username != "" { var ie *impart.HTTPError newUsername, ie = getValidUsername(app, s.Username, u.Username) if ie != nil { // Username is invalid return *ie } if !author.IsValidUsername(app.cfg, newUsername) { // Ensure the username is syntactically correct. return impart.HTTPError{http.StatusPreconditionFailed, "Username isn't valid."} } t, err := db.Begin() if err != nil { log.Error("Couldn't start username change transaction: %v", err) return err } _, err = t.Exec("UPDATE users SET username = ? WHERE id = ?", newUsername, u.ID) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Unable to update users table: %v", err) return ErrInternalGeneral } _, err = t.Exec("UPDATE collections SET alias = ? WHERE alias = ? AND owner_id = ?", newUsername, u.Username, u.ID) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Unable to update collection: %v", err) return ErrInternalGeneral } // Keep track of name changes for redirection db.RemoveCollectionRedirect(t, newUsername) _, err = t.Exec("UPDATE collectionredirects SET new_alias = ? WHERE new_alias = ?", newUsername, u.Username) if err != nil { log.Error("Unable to update collectionredirects: %v", err) } _, err = t.Exec("INSERT INTO collectionredirects (prev_alias, new_alias) VALUES (?, ?)", u.Username, newUsername) if err != nil { log.Error("Unable to add new collectionredirect: %v", err) } err = t.Commit() if err != nil { t.Rollback() log.Error("Rolling back after Commit(): %v\n", err) return err } u.Username = newUsername } // Update passphrase if given if s.NewPass != "" { // Check if user has already set a password var err error u.HasPass, err = db.IsUserPassSet(u.ID) if err != nil { errPass = impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data."} return errPass } if u.HasPass { // Check if currently-set password is correct hashedPass := u.HashedPass if len(hashedPass) == 0 { authUser, err := db.GetUserForAuthByID(u.ID) if err != nil { errPass = err return errPass } hashedPass = authUser.HashedPass } if !auth.Authenticated(hashedPass, []byte(s.OldPass)) { errPass = impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} return errPass } } hashedPass, err := auth.HashPass([]byte(s.NewPass)) if err != nil { errPass = impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} return errPass } q.SetBytes(hashedPass, "password") } // WHERE values q.Append(u.ID) if q.Updates == "" { if s.Username == "" { return ErrPostNoUpdatableVals } // Nothing to update except username. That was successful, so return now. return nil } res, err := db.Exec("UPDATE users SET "+q.Updates+" WHERE id = ?", q.Params...) if err != nil { log.Error("Unable to update collection: %v", err) return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM users WHERE id = ?", u.ID).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedGeneral case err != nil: log.Error("Failed selecting from users: %v", err) } return nil } if s.NewPass != "" && !u.HasPass { u.HasPass = true } return nil } func (db *datastore) ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error { var dbPass []byte err := db.QueryRow("SELECT password FROM users WHERE id = ?", userID).Scan(&dbPass) switch { case err == sql.ErrNoRows: return ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password for change: %v", err) return err } if !sudo && !auth.Authenticated(dbPass, []byte(curPass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } _, err = db.Exec("UPDATE users SET password = ? WHERE id = ?", hashedPass, userID) if err != nil { log.Error("Could not update passphrase: %v", err) return err } return nil } func (db *datastore) RemoveCollectionRedirect(t *sql.Tx, alias string) error { _, err := t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ?", alias) if err != nil { log.Error("Unable to delete from collectionredirects: %v", err) return err } return nil } func (db *datastore) GetCollectionRedirect(alias string) (new string) { row := db.QueryRow("SELECT new_alias FROM collectionredirects WHERE prev_alias = ?", alias) err := row.Scan(&new) if err != nil && err != sql.ErrNoRows && !db.isIgnorableError(err) { log.Error("Failed selecting from collectionredirects: %v", err) } return } func (db *datastore) DeleteCollection(alias string, userID int64) error { c := &Collection{Alias: alias} var username string row := db.QueryRow("SELECT username FROM users WHERE id = ?", userID) err := row.Scan(&username) if err != nil { return err } // Ensure user isn't deleting their main blog if alias == username { return impart.HTTPError{http.StatusForbidden, "You cannot currently delete your primary blog."} } row = db.QueryRow("SELECT id FROM collections WHERE alias = ? AND owner_id = ?", alias, userID) err = row.Scan(&c.ID) switch { case err == sql.ErrNoRows: return impart.HTTPError{http.StatusNotFound, "Collection doesn't exist or you're not allowed to delete it."} case err != nil: log.Error("Failed selecting from collections: %v", err) return ErrInternalGeneral } t, err := db.Begin() if err != nil { return err } // Float all collection's posts _, err = t.Exec("UPDATE posts SET collection_id = NULL WHERE collection_id = ? AND owner_id = ?", c.ID, userID) if err != nil { t.Rollback() return err } // Remove redirects to or from this collection _, err = t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ? OR new_alias = ?", alias, alias) if err != nil { t.Rollback() return err } // Remove any optional collection password _, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() return err } // Finally, delete collection itself _, err = t.Exec("DELETE FROM collections WHERE id = ?", c.ID) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } func (db *datastore) IsCollectionAttributeOn(id int64, attr string) bool { var v string err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SELECT value in isCollectionAttributeOn for attribute '%s': %v", attr, err) return false } return v == "1" } func (db *datastore) CollectionHasAttribute(id int64, attr string) bool { var dummy string err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&dummy) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SELECT value in collectionHasAttribute for attribute '%s': %v", attr, err) return false } return true } func (db *datastore) GetCollectionAttribute(id int64, attr string) string { var v string err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v) switch { case err == sql.ErrNoRows: return "" case err != nil: log.Error("Couldn't SELECT value in getCollectionAttribute for attribute '%s': %v", attr, err) return "" } return v } func (db *datastore) SetCollectionAttribute(id int64, attr, v string) error { - _, err := db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", id, attr, v) + _, err := db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", id, attr, v, v) if err != nil { log.Error("Unable to INSERT into collectionattributes: %v", err) return err } return nil } // DeleteAccount will delete the entire account for userID func (db *datastore) DeleteAccount(userID int64) error { // Get all collections rows, err := db.Query("SELECT id, alias FROM collections WHERE owner_id = ?", userID) if err != nil { log.Error("Unable to get collections: %v", err) return err } defer rows.Close() colls := []Collection{} var c Collection for rows.Next() { err = rows.Scan(&c.ID, &c.Alias) if err != nil { log.Error("Unable to scan collection cols: %v", err) return err } colls = append(colls, c) } // Start transaction t, err := db.Begin() if err != nil { log.Error("Unable to begin: %v", err) return err } // Clean up all collection related information var res sql.Result for _, c := range colls { // Delete tokens res, err = t.Exec("DELETE FROM collectionattributes WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() log.Error("Unable to delete attributes on %s: %v", c.Alias, err) return err } rs, _ := res.RowsAffected() log.Info("Deleted %d for %s from collectionattributes", rs, c.Alias) // Remove any optional collection password res, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() log.Error("Unable to delete passwords on %s: %v", c.Alias, err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d for %s from collectionpasswords", rs, c.Alias) // Remove redirects to this collection res, err = t.Exec("DELETE FROM collectionredirects WHERE new_alias = ?", c.Alias) if err != nil { t.Rollback() log.Error("Unable to delete redirects on %s: %v", c.Alias, err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d for %s from collectionredirects", rs, c.Alias) // Remove any collection keys res, err = t.Exec("DELETE FROM collectionkeys WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() log.Error("Unable to delete keys on %s: %v", c.Alias, err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d for %s from collectionkeys", rs, c.Alias) // TODO: federate delete collection // Remove remote follows res, err = t.Exec("DELETE FROM remotefollows WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() log.Error("Unable to delete remote follows on %s: %v", c.Alias, err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d for %s from remotefollows", rs, c.Alias) } // Delete collections res, err = t.Exec("DELETE FROM collections WHERE owner_id = ?", userID) if err != nil { t.Rollback() log.Error("Unable to delete collections: %v", err) return err } rs, _ := res.RowsAffected() log.Info("Deleted %d from collections", rs) // Delete tokens res, err = t.Exec("DELETE FROM accesstokens WHERE user_id = ?", userID) if err != nil { t.Rollback() log.Error("Unable to delete access tokens: %v", err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d from accesstokens", rs) // Delete user attributes res, err = t.Exec("DELETE FROM oauth_users WHERE user_id = ?", userID) if err != nil { t.Rollback() log.Error("Unable to delete oauth_users: %v", err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d from oauth_users", rs) // Delete posts // TODO: should maybe get each row so we can federate a delete // if so needs to be outside of transaction like collections res, err = t.Exec("DELETE FROM posts WHERE owner_id = ?", userID) if err != nil { t.Rollback() log.Error("Unable to delete posts: %v", err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d from posts", rs) // Delete user attributes res, err = t.Exec("DELETE FROM userattributes WHERE user_id = ?", userID) if err != nil { t.Rollback() log.Error("Unable to delete attributes: %v", err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d from userattributes", rs) // Delete user invites res, err = t.Exec("DELETE FROM userinvites WHERE owner_id = ?", userID) if err != nil { t.Rollback() log.Error("Unable to delete invites: %v", err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d from userinvites", rs) // Delete the user res, err = t.Exec("DELETE FROM users WHERE id = ?", userID) if err != nil { t.Rollback() log.Error("Unable to delete user: %v", err) return err } rs, _ = res.RowsAffected() log.Info("Deleted %d from users", rs) // Commit all changes to the database err = t.Commit() if err != nil { t.Rollback() log.Error("Unable to commit: %v", err) return err } // TODO: federate delete actor return nil } func (db *datastore) GetAPActorKeys(collectionID int64) ([]byte, []byte) { var pub, priv []byte err := db.QueryRow("SELECT public_key, private_key FROM collectionkeys WHERE collection_id = ?", collectionID).Scan(&pub, &priv) switch { case err == sql.ErrNoRows: // Generate keys pub, priv = activitypub.GenerateKeys() _, err = db.Exec("INSERT INTO collectionkeys (collection_id, public_key, private_key) VALUES (?, ?, ?)", collectionID, pub, priv) if err != nil { log.Error("Unable to INSERT new activitypub keypair: %v", err) return nil, nil } case err != nil: log.Error("Couldn't SELECT collectionkeys: %v", err) return nil, nil } return pub, priv } func (db *datastore) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error { _, err := db.Exec("INSERT INTO userinvites (id, owner_id, max_uses, created, expires, inactive) VALUES (?, ?, ?, "+db.now()+", ?, 0)", id, userID, maxUses, expires) return err } func (db *datastore) GetUserInvites(userID int64) (*[]Invite, error) { rows, err := db.Query("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE owner_id = ? ORDER BY created DESC", userID) if err != nil { log.Error("Failed selecting from userinvites: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user invites."} } defer rows.Close() is := []Invite{} for rows.Next() { i := Invite{} err = rows.Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive) is = append(is, i) } return &is, nil } func (db *datastore) GetUserInvite(id string) (*Invite, error) { var i Invite err := db.QueryRow("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE id = ?", id).Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive) switch { case err == sql.ErrNoRows, db.isIgnorableError(err): return nil, impart.HTTPError{http.StatusNotFound, "Invite doesn't exist."} case err != nil: log.Error("Failed selecting invite: %v", err) return nil, err } return &i, nil } // IsUsersInvite returns true if the user with ID created the invite with code // and an error other than sql no rows, if any. Will return false in the event // of an error. func (db *datastore) IsUsersInvite(code string, userID int64) (bool, error) { var id string err := db.QueryRow("SELECT id FROM userinvites WHERE id = ? AND owner_id = ?", code, userID).Scan(&id) if err != nil && err != sql.ErrNoRows { log.Error("Failed selecting invite: %v", err) return false, err } return id != "", nil } func (db *datastore) GetUsersInvitedCount(id string) int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM usersinvited WHERE invite_id = ?", id).Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting users invited count: %v", err) return 0 } return count } func (db *datastore) CreateInvitedUser(inviteID string, userID int64) error { _, err := db.Exec("INSERT INTO usersinvited (invite_id, user_id) VALUES (?, ?)", inviteID, userID) return err } func (db *datastore) GetInstancePages() ([]*instanceContent, error) { return db.GetAllDynamicContent("page") } func (db *datastore) GetAllDynamicContent(t string) ([]*instanceContent, error) { where := "" params := []interface{}{} if t != "" { where = " WHERE content_type = ?" params = append(params, t) } rows, err := db.Query("SELECT id, title, content, updated, content_type FROM appcontent"+where, params...) if err != nil { log.Error("Failed selecting from appcontent: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve instance pages."} } defer rows.Close() pages := []*instanceContent{} for rows.Next() { c := &instanceContent{} err = rows.Scan(&c.ID, &c.Title, &c.Content, &c.Updated, &c.Type) if err != nil { log.Error("Failed scanning row: %v", err) break } pages = append(pages, c) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return pages, nil } func (db *datastore) GetDynamicContent(id string) (*instanceContent, error) { c := &instanceContent{ ID: id, } err := db.QueryRow("SELECT title, content, updated, content_type FROM appcontent WHERE id = ?", id).Scan(&c.Title, &c.Content, &c.Updated, &c.Type) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Couldn't SELECT FROM appcontent for id '%s': %v", id, err) return nil, err } return c, nil } func (db *datastore) UpdateDynamicContent(id, title, content, contentType string) error { var err error if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?)", id, title, content, contentType) } else { _, err = db.Exec("INSERT INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?) "+db.upsert("id")+" title = ?, content = ?, updated = "+db.now(), id, title, content, contentType, title, content) } if err != nil { log.Error("Unable to INSERT appcontent for '%s': %v", id, err) } return err } func (db *datastore) GetAllUsers(page uint) (*[]User, error) { limitStr := fmt.Sprintf("0, %d", adminUsersPerPage) if page > 1 { limitStr = fmt.Sprintf("%d, %d", (page-1)*adminUsersPerPage, adminUsersPerPage) } rows, err := db.Query("SELECT id, username, created, status FROM users ORDER BY created DESC LIMIT " + limitStr) if err != nil { log.Error("Failed selecting from users: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve all users."} } defer rows.Close() users := []User{} for rows.Next() { u := User{} err = rows.Scan(&u.ID, &u.Username, &u.Created, &u.Status) if err != nil { log.Error("Failed scanning GetAllUsers() row: %v", err) break } users = append(users, u) } return &users, nil } func (db *datastore) GetAllUsersCount() int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM users").Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting all users count: %v", err) return 0 } return count } func (db *datastore) GetUserLastPostTime(id int64) (*time.Time, error) { var t time.Time err := db.QueryRow("SELECT created FROM posts WHERE owner_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Failed selecting last post time from posts: %v", err) return nil, err } return &t, nil } // SetUserStatus changes a user's status in the database. see Users.UserStatus func (db *datastore) SetUserStatus(id int64, status UserStatus) error { _, err := db.Exec("UPDATE users SET status = ? WHERE id = ?", status, id) if err != nil { return fmt.Errorf("failed to update user status: %v", err) } return nil } func (db *datastore) GetCollectionLastPostTime(id int64) (*time.Time, error) { var t time.Time err := db.QueryRow("SELECT created FROM posts WHERE collection_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Failed selecting last post time from posts: %v", err) return nil, err } return &t, nil } func (db *datastore) GenerateOAuthState(ctx context.Context, provider string, clientID string, attachUser int64, inviteCode string) (string, error) { state := id.Generate62RandomString(24) attachUserVal := sql.NullInt64{Valid: attachUser > 0, Int64: attachUser} inviteCodeVal := sql.NullString{Valid: inviteCode != "", String: inviteCode} _, err := db.ExecContext(ctx, "INSERT INTO oauth_client_states (state, provider, client_id, used, created_at, attach_user_id, invite_code) VALUES (?, ?, ?, FALSE, "+db.now()+", ?, ?)", state, provider, clientID, attachUserVal, inviteCodeVal) if err != nil { return "", fmt.Errorf("unable to record oauth client state: %w", err) } return state, nil } func (db *datastore) ValidateOAuthState(ctx context.Context, state string) (string, string, int64, string, error) { var provider string var clientID string var attachUserID sql.NullInt64 var inviteCode sql.NullString err := wf_db.RunTransactionWithOptions(ctx, db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { err := tx. QueryRowContext(ctx, "SELECT provider, client_id, attach_user_id, invite_code FROM oauth_client_states WHERE state = ? AND used = FALSE", state). Scan(&provider, &clientID, &attachUserID, &inviteCode) if err != nil { return err } res, err := tx.ExecContext(ctx, "UPDATE oauth_client_states SET used = TRUE WHERE state = ?", state) if err != nil { return err } rowsAffected, err := res.RowsAffected() if err != nil { return err } if rowsAffected != 1 { return fmt.Errorf("state not found") } return nil }) if err != nil { return "", "", 0, "", nil } return provider, clientID, attachUserID.Int64, inviteCode.String, nil } func (db *datastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error { var err error if db.driverName == driverSQLite { _, err = db.ExecContext(ctx, "INSERT OR REPLACE INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?)", localUserID, remoteUserID, provider, clientID, accessToken) } else { _, err = db.ExecContext(ctx, "INSERT INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?) "+db.upsert("user")+" access_token = ?", localUserID, remoteUserID, provider, clientID, accessToken, accessToken) } if err != nil { log.Error("Unable to INSERT oauth_users for '%d': %v", localUserID, err) } return err } // GetIDForRemoteUser returns a user ID associated with a remote user ID. func (db *datastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) { var userID int64 = -1 err := db. QueryRowContext(ctx, "SELECT user_id FROM oauth_users WHERE remote_user_id = ? AND provider = ? AND client_id = ?", remoteUserID, provider, clientID). Scan(&userID) // Not finding a record is OK. if err != nil && err != sql.ErrNoRows { return -1, err } return userID, nil } type oauthAccountInfo struct { Provider string ClientID string RemoteUserID string DisplayName string AllowDisconnect bool } func (db *datastore) GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error) { rows, err := db.QueryContext(ctx, "SELECT provider, client_id, remote_user_id FROM oauth_users WHERE user_id = ? ", userID) if err != nil { log.Error("Failed selecting from oauth_users: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user oauth accounts."} } defer rows.Close() var records []oauthAccountInfo for rows.Next() { info := oauthAccountInfo{} err = rows.Scan(&info.Provider, &info.ClientID, &info.RemoteUserID) if err != nil { log.Error("Failed scanning GetAllUsers() row: %v", err) break } records = append(records, info) } return records, nil } // DatabaseInitialized returns whether or not the current datastore has been // initialized with the correct schema. // Currently, it checks to see if the `users` table exists. func (db *datastore) DatabaseInitialized() bool { var dummy string var err error if db.driverName == driverSQLite { err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = 'users'").Scan(&dummy) } else { err = db.QueryRow("SHOW TABLES LIKE 'users'").Scan(&dummy) } switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SHOW TABLES: %v", err) return false } return true } func (db *datastore) RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error { _, err := db.ExecContext(ctx, `DELETE FROM oauth_users WHERE user_id = ? AND provider = ? AND client_id = ? AND remote_user_id = ?`, userID, provider, clientID, remoteUserID) return err } func stringLogln(log *string, s string, v ...interface{}) { *log += fmt.Sprintf(s+"\n", v...) } func handleFailedPostInsert(err error) error { log.Error("Couldn't insert into posts: %v", err) return err } +// Deprecated: use GetProfileURLFromHandle() instead, which returns user-facing URL instead of actor_id func (db *datastore) GetProfilePageFromHandle(app *App, handle string) (string, error) { handle = strings.TrimLeft(handle, "@") actorIRI := "" parts := strings.Split(handle, "@") if len(parts) != 2 { return "", fmt.Errorf("invalid handle format") } domain := parts[1] // Check non-AP instances if siloProfileURL := silobridge.Profile(parts[0], domain); siloProfileURL != "" { return siloProfileURL, nil } remoteUser, err := getRemoteUserFromHandle(app, handle) if err != nil { // can't find using handle in the table but the table may already have this user without // handle from a previous version // TODO: Make this determination. We should know whether a user exists without a handle, or doesn't exist at all actorIRI = RemoteLookup(handle) _, errRemoteUser := getRemoteUser(app, actorIRI) // if it exists then we need to update the handle if errRemoteUser == nil { _, err := app.db.Exec("UPDATE remoteusers SET handle = ? WHERE actor_id = ?", handle, actorIRI) if err != nil { log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI) } } else { // this probably means we don't have the user in the table so let's try to insert it // here we need to ask the server for the inboxes remoteActor, err := activityserve.NewRemoteActor(actorIRI) if err != nil { log.Error("Couldn't fetch remote actor: %v", err) } if debugging { log.Info("%s %s %s %s", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle) } _, err = app.db.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, handle) VALUES(?, ?, ?, ?)", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle) if err != nil { log.Error("Couldn't insert remote user: %v", err) return "", err } } } else { actorIRI = remoteUser.ActorID } return actorIRI, nil } + +func (db *datastore) AddEmailSubscription(collID, userID int64, email string, confirmed bool) (*EmailSubscriber, error) { + friendlyChars := "0123456789BCDFGHJKLMNPQRSTVWXYZbcdfghjklmnpqrstvwxyz" + subID := id.GenerateRandomString(friendlyChars, 8) + token := id.GenerateRandomString(friendlyChars, 16) + emailVal := sql.NullString{ + String: email, + Valid: email != "", + } + userIDVal := sql.NullInt64{ + Int64: userID, + Valid: userID > 0, + } + + _, err := db.Exec("INSERT INTO emailsubscribers (id, collection_id, user_id, email, subscribed, token, confirmed) VALUES (?, ?, ?, ?, "+db.now()+", ?, ?)", subID, collID, userIDVal, emailVal, token, confirmed) + if err != nil { + if mysqlErr, ok := err.(*mysql.MySQLError); ok { + if mysqlErr.Number == mySQLErrDuplicateKey { + // Duplicate, so just return existing subscriber information + log.Info("Duplicate subscriber for email %s, user %d; returning existing subscriber", email, userID) + return db.FetchEmailSubscriber(email, userID, collID) + } + } + return nil, err + } + + return &EmailSubscriber{ + ID: subID, + CollID: collID, + UserID: userIDVal, + Email: emailVal, + Token: token, + }, nil +} + +func (db *datastore) IsEmailSubscriber(email string, userID, collID int64) bool { + var dummy int + var err error + if email != "" { + err = db.QueryRow("SELECT 1 FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID).Scan(&dummy) + } else { + err = db.QueryRow("SELECT 1 FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID).Scan(&dummy) + } + switch { + case err == sql.ErrNoRows: + return false + case err != nil: + return false + } + return true +} + +func (db *datastore) GetEmailSubscribers(collID int64, reqConfirmed bool) ([]*EmailSubscriber, error) { + cond := "" + if reqConfirmed { + cond = " AND confirmed = 1" + } + rows, err := db.Query(`SELECT s.id, collection_id, user_id, s.email, u.email, subscribed, token, confirmed, allow_export +FROM emailsubscribers s +LEFT JOIN users u + ON u.id = user_id +WHERE collection_id = ?`+cond+` +ORDER BY subscribed DESC`, collID) + if err != nil { + log.Error("Failed selecting email subscribers for collection %d: %v", collID, err) + return nil, err + } + defer rows.Close() + + var subs []*EmailSubscriber + for rows.Next() { + s := &EmailSubscriber{} + err = rows.Scan(&s.ID, &s.CollID, &s.UserID, &s.Email, &s.acctEmail, &s.Subscribed, &s.Token, &s.Confirmed, &s.AllowExport) + if err != nil { + log.Error("Failed scanning row from email subscribers: %v", err) + continue + } + subs = append(subs, s) + } + return subs, nil +} + +func (db *datastore) FetchEmailSubscriberEmail(subID, token string) (string, error) { + var email sql.NullString + // TODO: return user email if there's a user_id ? + err := db.QueryRow("SELECT email FROM emailsubscribers WHERE id = ? AND token = ?", subID, token).Scan(&email) + switch { + case err == sql.ErrNoRows: + return "", fmt.Errorf("Subscriber doesn't exist or token is invalid.") + case err != nil: + log.Error("Couldn't SELECT email from emailsubscribers: %v", err) + return "", fmt.Errorf("Something went very wrong.") + } + + return email.String, nil +} + +func (db *datastore) FetchEmailSubscriber(email string, userID, collID int64) (*EmailSubscriber, error) { + const emailSubCols = "id, collection_id, user_id, email, subscribed, token, confirmed, allow_export" + + s := &EmailSubscriber{} + var row *sql.Row + if email != "" { + row = db.QueryRow("SELECT "+emailSubCols+" FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID) + } else { + row = db.QueryRow("SELECT "+emailSubCols+" FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID) + } + err := row.Scan(&s.ID, &s.CollID, &s.UserID, &s.Email, &s.Subscribed, &s.Token, &s.Confirmed, &s.AllowExport) + switch { + case err == sql.ErrNoRows: + return nil, nil + case err != nil: + return nil, err + } + return s, nil +} + +func (db *datastore) DeleteEmailSubscriber(subID, token string) error { + res, err := db.Exec("DELETE FROM emailsubscribers WHERE id = ? AND token = ?", subID, token) + if err != nil { + return err + } + + rowsAffected, _ := res.RowsAffected() + if rowsAffected == 0 { + return impart.HTTPError{http.StatusNotFound, "Invalid token, or subscriber doesn't exist"} + } + return nil +} + +func (db *datastore) DeleteEmailSubscriberByUser(email string, userID, collID int64) error { + var res sql.Result + var err error + if email != "" { + res, err = db.Exec("DELETE FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID) + } else { + res, err = db.Exec("DELETE FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID) + } + if err != nil { + return err + } + + rowsAffected, _ := res.RowsAffected() + if rowsAffected == 0 { + return impart.HTTPError{http.StatusNotFound, "Subscriber doesn't exist"} + } + return nil +} + +func (db *datastore) UpdateSubscriberConfirmed(subID, token string) error { + email, err := db.FetchEmailSubscriberEmail(subID, token) + if err != nil { + log.Error("Didn't fetch email subscriber: %v", err) + return err + } + + // TODO: ensure all addresses with original name are also confirmed, e.g. matt+fake@write.as and matt@write.as are now confirmed + _, err = db.Exec("UPDATE emailsubscribers SET confirmed = 1 WHERE email = ?", email) + if err != nil { + log.Error("Could not update email subscriber confirmation status: %v", err) + return err + } + return nil +} + +func (db *datastore) IsSubscriberConfirmed(email string) bool { + var dummy int64 + err := db.QueryRow("SELECT 1 FROM emailsubscribers WHERE email = ? AND confirmed = 1", email).Scan(&dummy) + switch { + case err == sql.ErrNoRows: + return false + case err != nil: + log.Error("Couldn't SELECT in isSubscriberConfirmed: %v", err) + return false + } + + return true +} + +func (db *datastore) InsertJob(j *PostJob) error { + res, err := db.Exec("INSERT INTO publishjobs (post_id, action, delay) VALUES (?, ?, ?)", j.PostID, j.Action, j.Delay) + if err != nil { + return err + } + jobID, err := res.LastInsertId() + if err != nil { + log.Error("[jobs] Couldn't get last insert ID! %s", err) + } + log.Info("[jobs] Queued %s job #%d for post %s, delayed %d minutes", j.Action, jobID, j.PostID, j.Delay) + return nil +} + +func (db *datastore) UpdateJobForPost(postID string, delay int64) error { + _, err := db.Exec("UPDATE publishjobs SET delay = ? WHERE post_id = ?", delay, postID) + if err != nil { + return fmt.Errorf("Unable to update publish job: %s", err) + } + log.Info("Updated job for post %s: delay %d", postID, delay) + return nil +} + +func (db *datastore) DeleteJob(id int64) error { + _, err := db.Exec("DELETE FROM publishjobs WHERE id = ?", id) + if err != nil { + return err + } + log.Info("[job #%d] Deleted.", id) + return nil +} + +func (db *datastore) DeleteJobByPost(postID string) error { + _, err := db.Exec("DELETE FROM publishjobs WHERE post_id = ?", postID) + if err != nil { + return err + } + log.Info("[job] Deleted job for post %s", postID) + return nil +} + +func (db *datastore) GetJobsToRun(action string) ([]*PostJob, error) { + timeWhere := "created < DATE_SUB(NOW(), INTERVAL delay MINUTE) AND created > DATE_SUB(NOW(), INTERVAL delay + 5 MINUTE)" + if db.driverName == driverSQLite { + timeWhere = "created < DATETIME('now', '-' || delay || ' MINUTE') AND created > DATETIME('now', '-' || (delay+5) || ' MINUTE')" + } + rows, err := db.Query(`SELECT pj.id, post_id, action, delay + FROM publishjobs pj + INNER JOIN posts p + ON post_id = p.id + WHERE action = ? AND `+timeWhere+` + ORDER BY created ASC`, action) + if err != nil { + log.Error("Failed selecting from publishjobs: %v", err) + return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve publish jobs."} + } + defer rows.Close() + + jobs := []*PostJob{} + for rows.Next() { + j := &PostJob{} + err = rows.Scan(&j.ID, &j.PostID, &j.Action, &j.Delay) + jobs = append(jobs, j) + } + return jobs, nil +} diff --git a/db/create.go b/db/create.go index 648f93a..1e9e679 100644 --- a/db/create.go +++ b/db/create.go @@ -1,266 +1,263 @@ /* - * Copyright © 2019-2020 A Bunch Tell LLC. + * Copyright © 2019-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package db import ( "fmt" "strings" ) type ColumnType int type OptionalInt struct { Set bool Value int } type OptionalString struct { Set bool Value string } type SQLBuilder interface { ToSQL() (string, error) } type Column struct { Dialect DialectType Name string Nullable bool Default OptionalString Type ColumnType Size OptionalInt PrimaryKey bool } type CreateTableSqlBuilder struct { Dialect DialectType Name string IfNotExists bool ColumnOrder []string Columns map[string]*Column Constraints []string } const ( ColumnTypeBool ColumnType = iota ColumnTypeSmallInt ColumnType = iota ColumnTypeInteger ColumnType = iota ColumnTypeChar ColumnType = iota ColumnTypeVarChar ColumnType = iota ColumnTypeText ColumnType = iota ColumnTypeDateTime ColumnType = iota ) var _ SQLBuilder = &CreateTableSqlBuilder{} var UnsetSize OptionalInt = OptionalInt{Set: false, Value: 0} var UnsetDefault OptionalString = OptionalString{Set: false, Value: ""} func (d ColumnType) Format(dialect DialectType, size OptionalInt) (string, error) { if dialect != DialectMySQL && dialect != DialectSQLite { return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size) } switch d { case ColumnTypeSmallInt: { if dialect == DialectSQLite { return "INTEGER", nil } mod := "" if size.Set { mod = fmt.Sprintf("(%d)", size.Value) } return "SMALLINT" + mod, nil } case ColumnTypeInteger: { if dialect == DialectSQLite { return "INTEGER", nil } mod := "" if size.Set { mod = fmt.Sprintf("(%d)", size.Value) } return "INT" + mod, nil } case ColumnTypeChar: { if dialect == DialectSQLite { return "TEXT", nil } mod := "" if size.Set { mod = fmt.Sprintf("(%d)", size.Value) } return "CHAR" + mod, nil } case ColumnTypeVarChar: { if dialect == DialectSQLite { return "TEXT", nil } mod := "" if size.Set { mod = fmt.Sprintf("(%d)", size.Value) } return "VARCHAR" + mod, nil } case ColumnTypeBool: { if dialect == DialectSQLite { return "INTEGER", nil } return "TINYINT(1)", nil } case ColumnTypeDateTime: return "DATETIME", nil case ColumnTypeText: return "TEXT", nil } return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size) } func (c *Column) SetName(name string) *Column { c.Name = name return c } func (c *Column) SetNullable(nullable bool) *Column { c.Nullable = nullable return c } func (c *Column) SetPrimaryKey(pk bool) *Column { c.PrimaryKey = pk return c } func (c *Column) SetDefault(value string) *Column { c.Default = OptionalString{Set: true, Value: value} return c } func (c *Column) SetDefaultCurrentTimestamp() *Column { def := "NOW()" if c.Dialect == DialectSQLite { def = "CURRENT_TIMESTAMP" } c.Default = OptionalString{Set: true, Value: def} return c } func (c *Column) SetType(t ColumnType) *Column { c.Type = t return c } func (c *Column) SetSize(size int) *Column { c.Size = OptionalInt{Set: true, Value: size} return c } func (c *Column) String() (string, error) { var str strings.Builder str.WriteString(c.Name) str.WriteString(" ") typeStr, err := c.Type.Format(c.Dialect, c.Size) if err != nil { return "", err } str.WriteString(typeStr) if !c.Nullable { str.WriteString(" NOT NULL") } if c.Default.Set { str.WriteString(" DEFAULT ") val := c.Default.Value if val == "" { val = "''" } str.WriteString(val) } if c.PrimaryKey { str.WriteString(" PRIMARY KEY") } return str.String(), nil } func (b *CreateTableSqlBuilder) Column(column *Column) *CreateTableSqlBuilder { if b.Columns == nil { b.Columns = make(map[string]*Column) } b.Columns[column.Name] = column b.ColumnOrder = append(b.ColumnOrder, column.Name) return b } func (b *CreateTableSqlBuilder) UniqueConstraint(columns ...string) *CreateTableSqlBuilder { for _, column := range columns { if _, ok := b.Columns[column]; !ok { // This fails silently. return b } } b.Constraints = append(b.Constraints, fmt.Sprintf("UNIQUE(%s)", strings.Join(columns, ","))) return b } func (b *CreateTableSqlBuilder) SetIfNotExists(ine bool) *CreateTableSqlBuilder { b.IfNotExists = ine return b } func (b *CreateTableSqlBuilder) ToSQL() (string, error) { var str strings.Builder str.WriteString("CREATE TABLE ") if b.IfNotExists { str.WriteString("IF NOT EXISTS ") } str.WriteString(b.Name) var things []string for _, columnName := range b.ColumnOrder { column, ok := b.Columns[columnName] if !ok { return "", fmt.Errorf("column not found: %s", columnName) } columnStr, err := column.String() if err != nil { return "", err } things = append(things, columnStr) } - for _, constraint := range b.Constraints { - things = append(things, constraint) - } - + things = append(things, b.Constraints...) if thingLen := len(things); thingLen > 0 { str.WriteString(" ( ") for i, thing := range things { str.WriteString(thing) if i < thingLen-1 { str.WriteString(", ") } } str.WriteString(" )") } return str.String(), nil } diff --git a/email.go b/email.go new file mode 100644 index 0000000..da4590e --- /dev/null +++ b/email.go @@ -0,0 +1,462 @@ +/* + * Copyright © 2019-2021 Musing Studio LLC. + * + * This file is part of WriteFreely. + * + * WriteFreely is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License, included + * in the LICENSE file in this source code package. + */ + +package writefreely + +import ( + "database/sql" + "encoding/json" + "fmt" + "html/template" + "net/http" + "strings" + "time" + + "github.com/aymerick/douceur/inliner" + "github.com/gorilla/mux" + "github.com/mailgun/mailgun-go" + stripmd "github.com/writeas/go-strip-markdown/v2" + "github.com/writeas/impart" + "github.com/writeas/web-core/data" + "github.com/writeas/web-core/log" + "github.com/writefreely/writefreely/key" + "github.com/writefreely/writefreely/spam" +) + +const ( + emailSendDelay = 15 +) + +type ( + SubmittedSubscription struct { + CollAlias string + UserID int64 + + Email string `schema:"email" json:"email"` + Web bool `schema:"web" json:"web"` + Slug string `schema:"slug" json:"slug"` + From string `schema:"from" json:"from"` + } + + EmailSubscriber struct { + ID string + CollID int64 + UserID sql.NullInt64 + Email sql.NullString + Subscribed time.Time + Token string + Confirmed bool + AllowExport bool + acctEmail sql.NullString + } +) + +func (es *EmailSubscriber) FinalEmail(keys *key.Keychain) string { + if !es.UserID.Valid || es.Email.Valid { + return es.Email.String + } + + decEmail, err := data.Decrypt(keys.EmailKey, []byte(es.acctEmail.String)) + if err != nil { + log.Error("Error decrypting user email: %v", err) + return "" + } + return string(decEmail) +} + +func (es *EmailSubscriber) SubscribedFriendly() string { + return es.Subscribed.Format("January 2, 2006") +} + +func handleCreateEmailSubscription(app *App, w http.ResponseWriter, r *http.Request) error { + reqJSON := IsJSON(r) + vars := mux.Vars(r) + var err error + + ss := SubmittedSubscription{ + CollAlias: vars["alias"], + } + u := getUserSession(app, r) + if u != nil { + ss.UserID = u.ID + } + if reqJSON { + // Decode JSON request + decoder := json.NewDecoder(r.Body) + err = decoder.Decode(&ss) + if err != nil { + log.Error("Couldn't parse new subscription JSON request: %v\n", err) + return ErrBadJSON + } + } else { + err = r.ParseForm() + if err != nil { + log.Error("Couldn't parse new subscription form request: %v\n", err) + return ErrBadFormData + } + + err = app.formDecoder.Decode(&ss, r.PostForm) + if err != nil { + log.Error("Continuing, but error decoding new subscription form request: %v\n", err) + //return ErrBadFormData + } + } + + c, err := app.db.GetCollection(ss.CollAlias) + if err != nil { + log.Error("getCollection: %s", err) + return err + } + c.hostName = app.cfg.App.Host + + from := c.CanonicalURL() + isAuthorBanned, err := app.db.IsUserSilenced(c.OwnerID) + if isAuthorBanned { + log.Info("Author is silenced, so subscription is blocked.") + return impart.HTTPError{http.StatusFound, from} + } + + if ss.Web { + if u != nil && u.ID == c.OwnerID { + from = "/" + c.Alias + "/" + } + from += ss.Slug + } + + if r.FormValue(spam.HoneypotFieldName()) != "" || r.FormValue("fake_password") != "" { + log.Info("Honeypot field was filled out! Not subscribing.") + return impart.HTTPError{http.StatusFound, from} + } + + if ss.Email == "" && ss.UserID < 1 { + log.Info("No subscriber data. Not subscribing.") + return impart.HTTPError{http.StatusFound, from} + } + + confirmed := app.db.IsSubscriberConfirmed(ss.Email) + es, err := app.db.AddEmailSubscription(c.ID, ss.UserID, ss.Email, confirmed) + if err != nil { + log.Error("addEmailSubscription: %s", err) + return err + } + + // Send confirmation email if needed + if !confirmed { + err = sendSubConfirmEmail(app, c, ss.Email, es.ID, es.Token) + if err != nil { + log.Error("Failed to send subscription confirmation email: %s", err) + return err + } + } + + if ss.Web { + session, err := app.sessionStore.Get(r, userEmailCookieName) + if err != nil { + // The cookie should still save, even if there's an error. + // Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144 + log.Error("Getting user email cookie: %v; ignoring", err) + } + if confirmed { + addSessionFlash(app, w, r, "Subscribed. You'll now receive future blog posts via email.", nil) + } else { + addSessionFlash(app, w, r, "Please check your email and click the confirmation link to subscribe.", nil) + } + session.Values[userEmailCookieVal] = ss.Email + err = session.Save(r, w) + if err != nil { + log.Error("save email cookie: %s", err) + return err + } + + return impart.HTTPError{http.StatusFound, from} + } + return impart.WriteSuccess(w, "", http.StatusAccepted) +} + +func handleDeleteEmailSubscription(app *App, w http.ResponseWriter, r *http.Request) error { + alias := collectionAliasFromReq(r) + + vars := mux.Vars(r) + subID := vars["subscriber"] + email := r.FormValue("email") + token := r.FormValue("t") + slug := r.FormValue("slug") + isWeb := r.Method == "GET" + + // Display collection if this is a collection + var c *Collection + var err error + if app.cfg.App.SingleUser { + c, err = app.db.GetCollectionByID(1) + } else { + c, err = app.db.GetCollection(alias) + } + if err != nil { + log.Error("Get collection: %s", err) + return err + } + + from := c.CanonicalURL() + + if subID != "" { + // User unsubscribing via email, so assume action is taken by either current + // user or not current user, and only use the request's information to + // satisfy this unsubscribe, i.e. subscriberID and token. + err = app.db.DeleteEmailSubscriber(subID, token) + } else { + // User unsubscribing through the web app, so assume action is taken by + // currently-auth'd user. + var userID int64 + u := getUserSession(app, r) + if u != nil { + // User is logged in + userID = u.ID + if userID == c.OwnerID { + from = "/" + c.Alias + "/" + } + } + if email == "" && userID <= 0 { + // Get email address from saved cookie + session, err := app.sessionStore.Get(r, userEmailCookieName) + if err != nil { + log.Error("Unable to get email cookie: %s", err) + } else { + email = session.Values[userEmailCookieVal].(string) + } + } + + if email == "" && userID <= 0 { + err = fmt.Errorf("No subscriber given.") + log.Error("Not deleting subscription: %s", err) + return err + } + + err = app.db.DeleteEmailSubscriberByUser(email, userID, c.ID) + } + if err != nil { + log.Error("Unable to delete subscriber: %v", err) + return err + } + + if isWeb { + from += slug + addSessionFlash(app, w, r, "Unsubscribed. You will no longer receive these blog posts via email.", nil) + return impart.HTTPError{http.StatusFound, from} + } + return impart.WriteSuccess(w, "", http.StatusAccepted) +} + +func handleConfirmEmailSubscription(app *App, w http.ResponseWriter, r *http.Request) error { + alias := collectionAliasFromReq(r) + subID := mux.Vars(r)["subscriber"] + token := r.FormValue("t") + + var c *Collection + var err error + if app.cfg.App.SingleUser { + c, err = app.db.GetCollectionByID(1) + } else { + c, err = app.db.GetCollection(alias) + } + if err != nil { + log.Error("Get collection: %s", err) + return err + } + + from := c.CanonicalURL() + + err = app.db.UpdateSubscriberConfirmed(subID, token) + if err != nil { + addSessionFlash(app, w, r, err.Error(), nil) + return impart.HTTPError{http.StatusFound, from} + } + + addSessionFlash(app, w, r, "Confirmed! Thanks. Now you'll receive future blog posts via email.", nil) + return impart.HTTPError{http.StatusFound, from} +} + +func emailPost(app *App, p *PublicPost, collID int64) error { + p.augmentContent() + + // Do some shortcode replacement. + // Since the user is receiving this email, we can assume they're subscribed via email. + p.Content = strings.Replace(p.Content, "", `

You're subscribed to email updates.

`, -1) + + if p.HTMLContent == template.HTML("") { + p.formatContent(app.cfg, false, false) + } + p.augmentReadingDestination() + + title := p.Title.String + if title != "" { + title = p.Title.String + "\n\n" + } + plainMsg := title + "A new post from " + p.CanonicalURL(app.cfg.App.Host) + "\n\n" + stripmd.Strip(p.Content) + plainMsg += ` + +--------------------------------------------------------------------------------- + +Originally published on ` + p.Collection.DisplayTitle() + ` (` + p.Collection.CanonicalURL() + `), a blog you subscribe to. + +Sent to %recipient.to%. Unsubscribe: ` + p.Collection.CanonicalURL() + `email/unsubscribe/%recipient.id%?t=%recipient.token%` + + gun := mailgun.NewMailgun(app.cfg.Email.Domain, app.cfg.Email.MailgunPrivate) + m := mailgun.NewMessage(p.Collection.DisplayTitle()+" <"+p.Collection.Alias+"@"+app.cfg.Email.Domain+">", stripmd.Strip(p.DisplayTitle()), plainMsg) + replyTo := app.db.GetCollectionAttribute(collID, collAttrLetterReplyTo) + if replyTo != "" { + m.SetReplyTo(replyTo) + } + + subs, err := app.db.GetEmailSubscribers(collID, true) + if err != nil { + log.Error("Unable to get email subscribers: %v", err) + return err + } + if len(subs) == 0 { + return nil + } + + if title != "" { + title = string(`

` + p.FormattedDisplayTitle() + `

`) + } + m.AddTag("New post") + + fontFam := "Lora, Palatino, Baskerville, serif" + if p.IsSans() { + fontFam = `"Open Sans", Tahoma, Arial, sans-serif` + } else if p.IsMonospace() { + fontFam = `Hack, consolas, Menlo-Regular, Menlo, Monaco, monospace, monospace` + } + + // TODO: move this to a templated file and LESS-generated stylesheet + fullHTML := ` + + + + +
` + title + `

From ` + p.DisplayCanonicalURL() + `

+ +` + string(p.HTMLContent) + `
+
+ + +` + + // inline CSS + html, err := inliner.Inline(fullHTML) + if err != nil { + log.Error("Unable to inline email HTML: %v", err) + return err + } + + m.SetHtml(html) + + log.Info("[email] Adding %d recipient(s)", len(subs)) + for _, s := range subs { + e := s.FinalEmail(app.keys) + log.Info("[email] Adding %s", e) + err = m.AddRecipientAndVariables(e, map[string]interface{}{ + "id": s.ID, + "to": e, + "token": s.Token, + }) + if err != nil { + log.Error("Unable to add receipient %s: %s", e, err) + } + } + + res, _, err := gun.Send(m) + log.Info("[email] Send result: %s", res) + if err != nil { + log.Error("Unable to send post email: %v", err) + return err + } + + return nil +} + +func sendSubConfirmEmail(app *App, c *Collection, email, subID, token string) error { + if email == "" { + return fmt.Errorf("You must supply an email to verify.") + } + + // Send email + gun := mailgun.NewMailgun(app.cfg.Email.Domain, app.cfg.Email.MailgunPrivate) + + plainMsg := "Confirm your subscription to " + c.DisplayTitle() + ` (` + c.CanonicalURL() + `) to start receiving future posts. Simply click the following link (or copy and paste it into your browser): + +` + c.CanonicalURL() + "email/confirm/" + subID + "?t=" + token + ` + +If you didn't subscribe to this site or you're not sure why you're getting this email, you can delete it. You won't be subscribed or receive any future emails.` + m := mailgun.NewMessage(c.DisplayTitle()+" <"+c.Alias+"@"+app.cfg.Email.Domain+">", "Confirm your subscription to "+c.DisplayTitle(), plainMsg, fmt.Sprintf("<%s>", email)) + m.AddTag("Email Verification") + + m.SetHtml(` + +
+

Confirm your subscription to ` + c.DisplayTitle() + ` to start receiving future posts:

+

Subscribe to ` + c.DisplayTitle() + `

+

If you didn't subscribe to this site or you're not sure why you're getting this email, you can delete it. You won't be subscribed or receive any future emails.

+
+ +`) + gun.Send(m) + + return nil +} diff --git a/errors.go b/errors.go index cf52df1..f0d3099 100644 --- a/errors.go +++ b/errors.go @@ -1,62 +1,62 @@ /* - * Copyright © 2018-2020 A Bunch Tell LLC. + * Copyright © 2018-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "net/http" "github.com/writeas/impart" ) // Commonly returned HTTP errors var ( ErrBadFormData = impart.HTTPError{http.StatusBadRequest, "Expected valid form data."} ErrBadJSON = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON object."} ErrBadJSONArray = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON array."} ErrBadAccessToken = impart.HTTPError{http.StatusUnauthorized, "Invalid access token."} ErrNoAccessToken = impart.HTTPError{http.StatusBadRequest, "Authorization token required."} ErrNotLoggedIn = impart.HTTPError{http.StatusUnauthorized, "Not logged in."} ErrForbiddenCollection = impart.HTTPError{http.StatusForbidden, "You don't have permission to add to this collection."} ErrForbiddenEditPost = impart.HTTPError{http.StatusForbidden, "You don't have permission to update this post."} ErrUnauthorizedEditPost = impart.HTTPError{http.StatusUnauthorized, "Invalid editing credentials."} ErrUnauthorizedGeneral = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to do that."} ErrBadRequestedType = impart.HTTPError{http.StatusNotAcceptable, "Bad requested Content-Type."} ErrCollectionUnauthorizedRead = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to access this collection."} ErrNoPublishableContent = impart.HTTPError{http.StatusBadRequest, "Supply something to publish."} ErrInternalGeneral = impart.HTTPError{http.StatusInternalServerError, "The humans messed something up. They've been notified."} ErrInternalCookieSession = impart.HTTPError{http.StatusInternalServerError, "Could not get cookie session."} ErrUnavailable = impart.HTTPError{http.StatusServiceUnavailable, "Service temporarily unavailable due to high load."} ErrCollectionNotFound = impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."} ErrCollectionGone = impart.HTTPError{http.StatusGone, "This blog was unpublished."} ErrCollectionPageNotFound = impart.HTTPError{http.StatusNotFound, "Collection page doesn't exist."} ErrPostNotFound = impart.HTTPError{Status: http.StatusNotFound, Message: "Post not found."} ErrPostBanned = impart.HTTPError{Status: http.StatusGone, Message: "Post removed."} ErrPostUnpublished = impart.HTTPError{Status: http.StatusGone, Message: "Post unpublished by author."} ErrPostFetchError = impart.HTTPError{Status: http.StatusInternalServerError, Message: "We encountered an error getting the post. The humans have been alerted."} ErrUserNotFound = impart.HTTPError{http.StatusNotFound, "User doesn't exist."} ErrRemoteUserNotFound = impart.HTTPError{http.StatusNotFound, "Remote user not found."} ErrUserNotFoundEmail = impart.HTTPError{http.StatusNotFound, "Please enter your username instead of your email address."} ErrUserSilenced = impart.HTTPError{http.StatusForbidden, "Account is silenced."} ErrDisabledPasswordAuth = impart.HTTPError{http.StatusForbidden, "Password authentication is disabled."} ) // Post operation errors var ( ErrPostNoUpdatableVals = impart.HTTPError{http.StatusBadRequest, "Supply some properties to update."} ) diff --git a/export.go b/export.go index bdfd7c4..e6a09c1 100644 --- a/export.go +++ b/export.go @@ -1,132 +1,132 @@ /* - * Copyright © 2018-2019 A Bunch Tell LLC. + * Copyright © 2018-2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "archive/zip" "bytes" "encoding/csv" "strings" "time" "github.com/writeas/web-core/log" ) func exportPostsCSV(hostName string, u *User, posts *[]PublicPost) []byte { var b bytes.Buffer r := [][]string{ {"id", "slug", "blog", "url", "created", "title", "body"}, } for _, p := range *posts { var blog string if p.Collection != nil { blog = p.Collection.Alias p.Collection.hostName = hostName } f := []string{p.ID, p.Slug.String, blog, p.CanonicalURL(hostName), p.Created8601(), p.Title.String, strings.Replace(p.Content, "\n", "\\n", -1)} r = append(r, f) } w := csv.NewWriter(&b) w.WriteAll(r) // calls Flush internally if err := w.Error(); err != nil { log.Info("error writing csv: %v", err) } return b.Bytes() } type exportedTxt struct { Name, Title, Body string Mod time.Time } func exportPostsZip(u *User, posts *[]PublicPost) []byte { // Create a buffer to write our archive to. b := new(bytes.Buffer) // Create a new zip archive. w := zip.NewWriter(b) // Add some files to the archive. var filename string files := []exportedTxt{} for _, p := range *posts { filename = "" if p.Collection != nil { filename += p.Collection.Alias + "/" } if p.Slug.String != "" { filename += p.Slug.String + "_" } filename += p.ID + ".txt" files = append(files, exportedTxt{filename, p.Title.String, p.Content, p.Created}) } for _, file := range files { head := &zip.FileHeader{Name: file.Name} head.SetModTime(file.Mod) f, err := w.CreateHeader(head) if err != nil { log.Error("export zip header: %v", err) } var fullPost string if file.Title != "" { fullPost = "# " + file.Title + "\n\n" } fullPost += file.Body _, err = f.Write([]byte(fullPost)) if err != nil { log.Error("export zip write: %v", err) } } // Make sure to check the error on Close. err := w.Close() if err != nil { log.Error("export zip close: %v", err) } return b.Bytes() } func compileFullExport(app *App, u *User) *ExportUser { exportUser := &ExportUser{ User: u, } colls, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } posts, err := app.db.GetAnonymousPosts(u, 0) if err != nil { log.Error("unable to fetch anon posts: %v", err) } exportUser.AnonymousPosts = *posts var collObjs []CollectionObj for _, c := range *colls { co := &CollectionObj{Collection: c} co.Posts, err = app.db.GetPosts(app.cfg, &c, 0, true, false, true) if err != nil { log.Error("unable to get collection posts: %v", err) } app.db.GetPostsCount(co, true) collObjs = append(collObjs, *co) } exportUser.Collections = &collObjs return exportUser } diff --git a/feed.go b/feed.go index d85baf8..68dd2c0 100644 --- a/feed.go +++ b/feed.go @@ -1,125 +1,125 @@ /* - * Copyright © 2018-2020 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "fmt" "net/http" "time" - . "github.com/gorilla/feeds" + "github.com/gorilla/feeds" "github.com/gorilla/mux" stripmd "github.com/writeas/go-strip-markdown/v2" "github.com/writeas/web-core/log" ) func ViewFeed(app *App, w http.ResponseWriter, req *http.Request) error { alias := collectionAliasFromReq(req) // Display collection if this is a collection var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { return nil } silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("view feed: get user: %v", err) return ErrInternalGeneral } if silenced { return ErrCollectionNotFound } c.hostName = app.cfg.App.Host if c.IsPrivate() || c.IsProtected() { return ErrCollectionNotFound } // Fetch extra data about the Collection // TODO: refactor out this logic, shared in collection.go:fetchCollection() coll := &DisplayCollection{CollectionObj: &CollectionObj{Collection: *c}} if c.PublicOwner { u, err := app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } else { coll.Owner = u } } tag := mux.Vars(req)["tag"] if tag != "" { coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, 1, false) } else { coll.Posts, _ = app.db.GetPosts(app.cfg, c, 1, false, true, false) } author := "" if coll.Owner != nil { author = coll.Owner.Username } collectionTitle := coll.DisplayTitle() if tag != "" { collectionTitle = tag + " — " + collectionTitle } baseUrl := coll.CanonicalURL() basePermalinkUrl := baseUrl siteURL := baseUrl if tag != "" { siteURL += "tag:" + tag } - feed := &Feed{ + feed := &feeds.Feed{ Title: collectionTitle, - Link: &Link{Href: siteURL}, + Link: &feeds.Link{Href: siteURL}, Description: coll.Description, - Author: &Author{author, ""}, + Author: &feeds.Author{author, ""}, Created: time.Now(), } var title, permalink string for _, p := range *coll.Posts { // Add necessary path back to the web browser for Web Monetization if needed p.Collection = coll.CollectionObj // augmentReadingDestination requires a populated Collection field p.augmentReadingDestination() // Create the item for the feed title = p.PlainDisplayTitle() permalink = fmt.Sprintf("%s%s", baseUrl, p.Slug.String) - feed.Items = append(feed.Items, &Item{ + feed.Items = append(feed.Items, &feeds.Item{ Id: fmt.Sprintf("%s%s", basePermalinkUrl, p.Slug.String), Title: title, - Link: &Link{Href: permalink}, + Link: &feeds.Link{Href: permalink}, Description: "", Content: string(p.HTMLContent), - Author: &Author{author, ""}, + Author: &feeds.Author{author, ""}, Created: p.Created, Updated: p.Updated, }) } rss, err := feed.ToRss() if err != nil { return err } fmt.Fprint(w, rss) return nil } diff --git a/go.mod b/go.mod index 395e5ec..1006487 100644 --- a/go.mod +++ b/go.mod @@ -1,49 +1,92 @@ module github.com/writefreely/writefreely require ( - git.mills.io/prologic/go-gopher v0.0.0-20210712135410-b7ebb55feece + github.com/PuerkitoBio/goquery v1.7.0 // indirect + github.com/aymerick/douceur v0.2.0 github.com/clbanning/mxj v1.8.4 // indirect - github.com/dustin/go-humanize v1.0.0 - github.com/fatih/color v1.10.0 - github.com/go-sql-driver/mysql v1.6.0 + github.com/dustin/go-humanize v1.0.1 + github.com/facebookgo/ensure v0.0.0-20200202191622-63f1cf65ac4c // indirect + github.com/facebookgo/stack v0.0.0-20160209184415-751773369052 // indirect + github.com/facebookgo/subset v0.0.0-20200203212716-c811ad88dec4 // indirect + github.com/fatih/color v1.15.0 + github.com/go-ini/ini v1.67.0 + github.com/go-sql-driver/mysql v1.7.1 github.com/go-test/deep v1.0.1 // indirect + github.com/gobuffalo/envy v1.9.0 // indirect github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e // indirect - github.com/gorilla/csrf v1.7.0 + github.com/gorilla/csrf v1.7.1 github.com/gorilla/feeds v1.1.1 github.com/gorilla/mux v1.8.0 github.com/gorilla/schema v1.2.0 - github.com/gorilla/sessions v1.2.0 - github.com/guregu/null v3.5.0+incompatible + github.com/gorilla/sessions v1.2.1 + github.com/guregu/null v4.0.0+incompatible github.com/hashicorp/go-multierror v1.1.1 github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2 - github.com/jtolds/gls v4.2.1+incompatible // indirect github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec - github.com/lunixbochs/vtclean v1.0.0 // indirect - github.com/manifoldco/promptui v0.8.0 - github.com/mattn/go-sqlite3 v1.14.6 - github.com/microcosm-cc/bluemonday v1.0.5 + github.com/mailgun/mailgun-go v2.0.0+incompatible + github.com/manifoldco/promptui v0.9.0 + github.com/mattn/go-sqlite3 v1.14.17 + github.com/microcosm-cc/bluemonday v1.0.25 github.com/mitchellh/go-wordwrap v1.0.1 github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d + github.com/onsi/ginkgo v1.16.4 // indirect + github.com/onsi/gomega v1.13.0 // indirect github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be // indirect github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304 // indirect github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c // indirect - github.com/stretchr/testify v1.7.0 - github.com/urfave/cli/v2 v2.3.0 + github.com/stretchr/testify v1.8.4 + github.com/urfave/cli/v2 v2.25.7 github.com/writeas/activity v0.1.2 - github.com/writeas/activityserve v0.0.0-20200409150223-d7ab3eaa4481 + github.com/writeas/activityserve v0.0.0-20230428180247-dc13a4f4d835 github.com/writeas/go-strip-markdown/v2 v2.1.1 github.com/writeas/go-webfinger v1.1.0 github.com/writeas/httpsig v1.0.0 github.com/writeas/impart v1.1.1 github.com/writeas/import v0.2.1 - github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219 + github.com/writeas/monday v1.3.0 github.com/writeas/saturday v1.7.2-0.20200427193424-392b95a03320 github.com/writeas/slug v1.2.0 - github.com/writeas/web-core v1.3.1-0.20210330164422-95a3a717ed8f + github.com/writeas/web-core v1.6.0 + github.com/writefreely/go-gopher v0.0.0-20220429181814-40127126f83b github.com/writefreely/go-nodeinfo v1.2.0 - golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9 - golang.org/x/net v0.0.0-20200707034311-ab3426394381 - gopkg.in/ini.v1 v1.62.0 + golang.org/x/crypto v0.13.0 + golang.org/x/net v0.15.0 +) + +require ( + code.as/core/socks v1.0.0 // indirect + github.com/andybalholm/cascadia v1.1.0 // indirect + github.com/beevik/etree v1.1.0 // indirect + github.com/captncraig/cors v0.0.0-20190703115713-e80254a89df1 // indirect + github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e // indirect + github.com/cpuguy83/go-md2man/v2 v2.0.2 // indirect + github.com/davecgh/go-spew v1.1.1 // indirect + github.com/dchest/uniuri v0.0.0-20200228104902-7aecb25e1fe5 // indirect + github.com/fatih/structs v1.1.0 // indirect + github.com/go-fed/httpsig v0.1.1-0.20200204213531-0ef28562fabe // indirect + github.com/gofrs/uuid v3.3.0+incompatible // indirect + github.com/gologme/log v1.2.0 // indirect + github.com/gorilla/css v1.0.0 // indirect + github.com/gorilla/securecookie v1.1.1 // indirect + github.com/hashicorp/errwrap v1.0.0 // indirect + github.com/joho/godotenv v1.3.0 // indirect + github.com/jtolds/gls v4.2.1+incompatible // indirect + github.com/mattn/go-colorable v0.1.13 // indirect + github.com/mattn/go-isatty v0.0.17 // indirect + github.com/petermattis/goid v0.0.0-20180202154549-b0b1615b78e5 // indirect + github.com/pkg/errors v0.9.1 // indirect + github.com/pmezard/go-difflib v1.0.0 // indirect + github.com/rogpeppe/go-internal v1.3.2 // indirect + github.com/russross/blackfriday/v2 v2.1.0 // indirect + github.com/sasha-s/go-deadlock v0.3.1 // indirect + github.com/shurcooL/sanitized_anchor_name v1.0.0 // indirect + github.com/writeas/go-writeas/v2 v2.0.2 // indirect + github.com/writeas/openssl-go v1.0.0 // indirect + github.com/xrash/smetrics v0.0.0-20201216005158-039620a65673 // indirect + golang.org/x/sys v0.12.0 // indirect + golang.org/x/text v0.13.0 // indirect + gopkg.in/ini.v1 v1.62.0 // indirect + gopkg.in/yaml.v3 v3.0.1 // indirect ) -go 1.15 +go 1.19 diff --git a/go.sum b/go.sum index 9411d34..0666a70 100644 --- a/go.sum +++ b/go.sum @@ -1,184 +1,314 @@ code.as/core/socks v1.0.0 h1:SPQXNp4SbEwjOAP9VzUahLHak8SDqy5n+9cm9tpjZOs= code.as/core/socks v1.0.0/go.mod h1:BAXBy5O9s2gmw6UxLqNJcVbWY7C/UPs+801CcSsfWOY= -git.mills.io/prologic/go-gopher v0.0.0-20210712135410-b7ebb55feece h1:0esmnntqeuM1iBgHH0HOeSynsLA1l28p2K3h/WZuIfQ= -git.mills.io/prologic/go-gopher v0.0.0-20210712135410-b7ebb55feece/go.mod h1:EMXlYOIbYJQhPTtIltgaaHtCYDawV/HL0dYf8ShzAck= -github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/PuerkitoBio/goquery v1.7.0 h1:O5SP3b9JWqMSVMG69zMfj577zwkSNpxrFf7ybS74eiw= +github.com/PuerkitoBio/goquery v1.7.0/go.mod h1:GsLWisAFVj4WgDibEWF4pvYnkVQBpKBKeU+7zCJoLcc= +github.com/andybalholm/cascadia v1.1.0 h1:BuuO6sSfQNFRu1LppgbD25Hr2vLYW25JvxHs5zzsLTo= +github.com/andybalholm/cascadia v1.1.0/go.mod h1:GsXiBklL0woXo1j/WYWtSYYC4ouU9PqHO0sqidkEA4Y= github.com/aymerick/douceur v0.2.0 h1:Mv+mAeH1Q+n9Fr+oyamOlAkUNPWPlA8PPGR0QAaYuPk= github.com/aymerick/douceur v0.2.0/go.mod h1:wlT5vV2O3h55X9m7iVYN0TBM0NH/MmbLnd30/FjWUq4= github.com/beevik/etree v1.1.0 h1:T0xke/WvNtMoCqgzPhkX2r4rjY3GDZFi+FjpRZY2Jbs= github.com/beevik/etree v1.1.0/go.mod h1:r8Aw8JqVegEf0w2fDnATrX9VpkMcyFeM0FhwO62wh+A= github.com/captncraig/cors v0.0.0-20190703115713-e80254a89df1 h1:AFSJaASPGYNbkUa5c8ZybrcW9pP3Cy7+z5dnpcc/qG8= github.com/captncraig/cors v0.0.0-20190703115713-e80254a89df1/go.mod h1:EIlIeMufZ8nqdUhnesledB15xLRl4wIJUppwDLPrdrQ= -github.com/chris-ramon/douceur v0.2.0 h1:IDMEdxlEUUBYBKE4z/mJnFyVXox+MjuEVDJNN27glkU= -github.com/chris-ramon/douceur v0.2.0/go.mod h1:wDW5xjJdeoMm1mRt4sD4c/LbF/mWdEpRXQKjTR8nIBE= github.com/chzyer/logex v1.1.10 h1:Swpa1K6QvQznwJRcfTfQJmTE72DqScAa40E+fbHEXEE= github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI= github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e h1:fY5BOSpyZCqRo5OhCuC+XN+r/bBCmeuuJtjz+bCNIf8= github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI= github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1 h1:q763qf9huN11kDQavWsoZXJNW3xEE4JJyHa5Q25/sd8= github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU= github.com/clbanning/mxj v1.8.3/go.mod h1:BVjHeAH+rl9rs6f+QIpeRl0tfu10SXn1pUSa5PVGJng= github.com/clbanning/mxj v1.8.4 h1:HuhwZtbyvyOw+3Z1AowPkU87JkJUSv751ELWaiTpj8I= github.com/clbanning/mxj v1.8.4/go.mod h1:BVjHeAH+rl9rs6f+QIpeRl0tfu10SXn1pUSa5PVGJng= -github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d h1:U+s90UTSYgptZMwQh2aRr3LuazLJIa+Pg3Kc1ylSYVY= -github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= +github.com/cpuguy83/go-md2man/v2 v2.0.2 h1:p1EgwI/C7NhT0JmVkwCD2ZBK8j4aeHQX2pMHHBfMQ6w= +github.com/cpuguy83/go-md2man/v2 v2.0.2/go.mod h1:tgQtvFlXSQOSOSIRvRPT7W67SCa46tRHOmNcaadrF8o= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/dchest/uniuri v0.0.0-20200228104902-7aecb25e1fe5 h1:RAV05c0xOkJ3dZGS0JFybxFKZ2WMLabgx3uXnd7rpGs= github.com/dchest/uniuri v0.0.0-20200228104902-7aecb25e1fe5/go.mod h1:GgB8SF9nRG+GqaDtLcwJZsQFhcogVCJ79j4EdT0c2V4= -github.com/dustin/go-humanize v1.0.0 h1:VSnTsYCnlFHaM2/igO1h6X3HA71jcobQuxemgkq4zYo= -github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= -github.com/fatih/color v1.10.0 h1:s36xzo75JdqLaaWoiEHk767eHiwo0598uUxyfiPkDsg= -github.com/fatih/color v1.10.0/go.mod h1:ELkj/draVOlAH/xkhN6mQ50Qd0MPOk5AAr3maGEBuJM= +github.com/dustin/go-humanize v1.0.1 h1:GzkhY7T5VNhEkwH0PVJgjz+fX1rhBrR7pRT3mDkpeCY= +github.com/dustin/go-humanize v1.0.1/go.mod h1:Mu1zIs6XwVuF/gI1OepvI0qD18qycQx+mFykh5fBlto= +github.com/facebookgo/ensure v0.0.0-20200202191622-63f1cf65ac4c h1:8ISkoahWXwZR41ois5lSJBSVw4D0OV19Ht/JSTzvSv0= +github.com/facebookgo/ensure v0.0.0-20200202191622-63f1cf65ac4c/go.mod h1:Yg+htXGokKKdzcwhuNDwVvN+uBxDGXJ7G/VN1d8fa64= +github.com/facebookgo/stack v0.0.0-20160209184415-751773369052 h1:JWuenKqqX8nojtoVVWjGfOF9635RETekkoH6Cc9SX0A= +github.com/facebookgo/stack v0.0.0-20160209184415-751773369052/go.mod h1:UbMTZqLaRiH3MsBH8va0n7s1pQYcu3uTb8G4tygF4Zg= +github.com/facebookgo/subset v0.0.0-20200203212716-c811ad88dec4 h1:7HZCaLC5+BZpmbhCOZJ293Lz68O7PYrF2EzeiFMwCLk= +github.com/facebookgo/subset v0.0.0-20200203212716-c811ad88dec4/go.mod h1:5tD+neXqOorC30/tWg0LCSkrqj/AR6gu8yY8/fpw1q0= +github.com/fatih/color v1.15.0 h1:kOqh6YHBtK8aywxGerMG2Eq3H6Qgoqeo13Bk2Mv/nBs= +github.com/fatih/color v1.15.0/go.mod h1:0h5ZqXfHYED7Bhv2ZJamyIOUej9KtShiJESRwBDUSsw= github.com/fatih/structs v1.1.0 h1:Q7juDM0QtcnhCpeyLGQKyg4TOIghuNXrkL32pHAUMxo= github.com/fatih/structs v1.1.0/go.mod h1:9NiDSp5zOcgEDl+j00MP/WkGVPOlPRLejGD8Ga6PJ7M= +github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= +github.com/fsnotify/fsnotify v1.4.9 h1:hsms1Qyu0jgnwNXIxa+/V/PDsU6CfLf6CNO8H7IWoS4= +github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ= github.com/go-fed/httpsig v0.1.0/go.mod h1:T56HUNYZUQ1AGUzhAYPugZfp36sKApVnGBgKlIY+aIE= github.com/go-fed/httpsig v0.1.1-0.20200204213531-0ef28562fabe h1:U71giCx5NjRn4Lb71UuprPHqhjxGv3Jqonb9fgcaJH8= github.com/go-fed/httpsig v0.1.1-0.20200204213531-0ef28562fabe/go.mod h1:T56HUNYZUQ1AGUzhAYPugZfp36sKApVnGBgKlIY+aIE= -github.com/go-sql-driver/mysql v1.6.0 h1:BCTh4TKNUYmOmMUcQ3IipzF5prigylS7XXjEkfCHuOE= -github.com/go-sql-driver/mysql v1.6.0/go.mod h1:DCzpHaOWr8IXmIStZouvnhqoel9Qv2LBy8hT2VhHyBg= +github.com/go-ini/ini v1.67.0 h1:z6ZrTEZqSWOTyH2FlglNbNgARyHG8oLW9gMELqKr06A= +github.com/go-ini/ini v1.67.0/go.mod h1:ByCAeIL28uOIIG0E3PJtZPDL8WnHpFKFOtgjp+3Ies8= +github.com/go-sql-driver/mysql v1.7.1 h1:lUIinVbN1DY0xBg0eMOzmmtGoHwWBbvnWubQUrtU8EI= +github.com/go-sql-driver/mysql v1.7.1/go.mod h1:OXbVy3sEdcQ2Doequ6Z5BW6fXNQTmx+9S1MCJN5yJMI= +github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0/go.mod h1:fyg7847qk6SyHyPtNmDHnmrv/HOrqktSC+C9fM+CJOE= github.com/go-test/deep v1.0.1 h1:UQhStjbkDClarlmv0am7OXXO4/GaPdCGiUiMTvi28sg= github.com/go-test/deep v1.0.1/go.mod h1:wGDj63lr65AM2AQyKZd/NYHGb0R+1RLqB8NKt3aSFNA= +github.com/gobuffalo/envy v1.9.0 h1:eZR0DuEgVLfeIb1zIKt3bT4YovIMf9O9LXQeCZLXpqE= +github.com/gobuffalo/envy v1.9.0/go.mod h1:FurDp9+EDPE4aIUS3ZLyD+7/9fpx7YRt/ukY6jIHf0w= github.com/gofrs/uuid v3.3.0+incompatible h1:8K4tyRfvU1CYPgJsveYFQMhpFd/wXNM7iK6rR7UHz84= github.com/gofrs/uuid v3.3.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8= +github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA= +github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs= +github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w= +github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0= +github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= +github.com/golang/protobuf v1.5.0/go.mod h1:FsONVRAS9T7sI+LIUmWTfcYkHO4aIWwzhcaSAoJOfIk= +github.com/golang/protobuf v1.5.2/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY= github.com/gologme/log v1.2.0 h1:Ya5Ip/KD6FX7uH0S31QO87nCCSucKtF44TLbTtO7V4c= github.com/gologme/log v1.2.0/go.mod h1:gq31gQ8wEHkR+WekdWsqDuf8pXTUZA9BnnzTuPz1Y9U= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e h1:JKmoR8x90Iww1ks85zJ1lfDGgIiMDuIptTOhJq+zKyg= github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= -github.com/gorilla/csrf v1.7.0 h1:mMPjV5/3Zd460xCavIkppUdvnl5fPXMpv2uz2Zyg7/Y= -github.com/gorilla/csrf v1.7.0/go.mod h1:+a/4tCmqhG6/w4oafeAZ9pEa3/NZOWYVbD9fV0FwIQA= +github.com/gorilla/csrf v1.7.1 h1:Ir3o2c1/Uzj6FBxMlAUB6SivgVMy1ONXwYgXn+/aHPE= +github.com/gorilla/csrf v1.7.1/go.mod h1:+a/4tCmqhG6/w4oafeAZ9pEa3/NZOWYVbD9fV0FwIQA= github.com/gorilla/css v1.0.0 h1:BQqNyPTi50JCFMTw/b67hByjMVXZRwGha6wxVGkeihY= github.com/gorilla/css v1.0.0/go.mod h1:Dn721qIggHpt4+EFCcTLTU/vk5ySda2ReITrtgBl60c= github.com/gorilla/feeds v1.1.1 h1:HwKXxqzcRNg9to+BbvJog4+f3s/xzvtZXICcQGutYfY= github.com/gorilla/feeds v1.1.1/go.mod h1:Nk0jZrvPFZX1OBe5NPiddPw7CfwF6Q9eqzaBbaightA= github.com/gorilla/mux v1.7.4/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So= github.com/gorilla/mux v1.8.0 h1:i40aqfkR1h2SlN9hojwV5ZA91wcXFOvkdNIeFDP5koI= github.com/gorilla/mux v1.8.0/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So= github.com/gorilla/schema v1.2.0 h1:YufUaxZYCKGFuAq3c96BOhjgd5nmXiOY9NGzF247Tsc= github.com/gorilla/schema v1.2.0/go.mod h1:kgLaKoK1FELgZqMAVxx/5cbj0kT+57qxUrAlIO2eleU= github.com/gorilla/securecookie v1.1.1 h1:miw7JPhV+b/lAHSXz4qd/nN9jRiAFV5FwjeKyCS8BvQ= github.com/gorilla/securecookie v1.1.1/go.mod h1:ra0sb63/xPlUeL+yeDciTfxMRAA+MP+HVt/4epWDjd4= -github.com/gorilla/sessions v1.2.0 h1:S7P+1Hm5V/AT9cjEcUD5uDaQSX0OE577aCXgoaKpYbQ= -github.com/gorilla/sessions v1.2.0/go.mod h1:dk2InVEVJ0sfLlnXv9EAgkf6ecYs/i80K/zI+bUmuGM= -github.com/guregu/null v3.5.0+incompatible h1:fSdvRTQtmBA4B4YDZXhLtxTIJZYuUxBFTTHS4B9djG4= -github.com/guregu/null v3.5.0+incompatible/go.mod h1:ePGpQaN9cw0tj45IR5E5ehMvsFlLlQZAkkOXZurJ3NM= +github.com/gorilla/sessions v1.2.1 h1:DHd3rPN5lE3Ts3D8rKkQ8x/0kqfeNmBAaiSi+o7FsgI= +github.com/gorilla/sessions v1.2.1/go.mod h1:dk2InVEVJ0sfLlnXv9EAgkf6ecYs/i80K/zI+bUmuGM= +github.com/guregu/null v4.0.0+incompatible h1:4zw0ckM7ECd6FNNddc3Fu4aty9nTlpkkzH7dPn4/4Gw= +github.com/guregu/null v4.0.0+incompatible/go.mod h1:ePGpQaN9cw0tj45IR5E5ehMvsFlLlQZAkkOXZurJ3NM= github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= github.com/hashicorp/go-multierror v1.1.1 h1:H5DkEtf6CXdFp0N0Em5UCwQpXMWke8IA0+lD48awMYo= github.com/hashicorp/go-multierror v1.1.1/go.mod h1:iw975J/qwKPdAO1clOe2L8331t/9/fmwbPZ6JB6eMoM= +github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2 h1:wIdDEle9HEy7vBPjC6oKz6ejs3Ut+jmsYvuOoAW2pSM= github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2/go.mod h1:WtaVKD9TeruTED9ydiaOJU08qGoEPP/LyzTKiD3jEsw= +github.com/joho/godotenv v1.3.0 h1:Zjp+RcGpHhGlrMbJzXTrZZPrWj+1vfm90La1wgB6Bhc= +github.com/joho/godotenv v1.3.0/go.mod h1:7hK45KPybAkOC6peb+G5yklZfMxEjkZhHbwpqxOKXbg= github.com/jtolds/gls v4.2.1+incompatible h1:fSuqC+Gmlu6l/ZYAoZzx2pyucC8Xza35fpRVWLVmUEE= github.com/jtolds/gls v4.2.1+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU= -github.com/juju/ansiterm v0.0.0-20180109212912-720a0952cc2a h1:FaWFmfWdAUKbSCtOU2QjDaorUexogfaMgbipgYATUMU= -github.com/juju/ansiterm v0.0.0-20180109212912-720a0952cc2a/go.mod h1:UJSiEoRfvx3hP73CvoARgeLjaIOjybY9vj8PUPPFGeU= -github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI= github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= +github.com/kr/pretty v0.2.1 h1:Fmg33tUaq4/8ym9TJN1x7sLJnHVwhP33CNkpYV/7rwI= +github.com/kr/pretty v0.2.1/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI= github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE= github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec h1:ZXWuspqypleMuJy4bzYEqlMhJnGAYpLrWe5p7W3CdvI= github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec/go.mod h1:voECJzdraJmolzPBgL9Z7ANwXf4oMXaTCsIkdiPpR/g= -github.com/lunixbochs/vtclean v0.0.0-20180621232353-2d01aacdc34a/go.mod h1:pHhQNgMf3btfWnGBVipUOjRYhoOsdGqdm/+2c2E2WMI= -github.com/lunixbochs/vtclean v1.0.0 h1:xu2sLAri4lGiovBDQKxl5mrXyESr3gUr5m5SM5+LVb8= -github.com/lunixbochs/vtclean v1.0.0/go.mod h1:pHhQNgMf3btfWnGBVipUOjRYhoOsdGqdm/+2c2E2WMI= -github.com/manifoldco/promptui v0.8.0 h1:R95mMF+McvXZQ7j1g8ucVZE1gLP3Sv6j9vlF9kyRqQo= -github.com/manifoldco/promptui v0.8.0/go.mod h1:n4zTdgP0vr0S3w7/O/g98U+e0gwLScEXGwov2nIKuGQ= -github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= -github.com/mattn/go-colorable v0.1.8 h1:c1ghPdyEDarC70ftn0y+A/Ee++9zz8ljHG1b13eJ0s8= -github.com/mattn/go-colorable v0.1.8/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc= -github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= -github.com/mattn/go-isatty v0.0.12 h1:wuysRhFDzyxgEmMf5xjvJ2M9dZoWAXNNr5LSBS7uHXY= -github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU= -github.com/mattn/go-sqlite3 v1.14.6 h1:dNPt6NO46WmLVt2DLNpwczCmdV5boIZ6g/tlDrlRUbg= -github.com/mattn/go-sqlite3 v1.14.6/go.mod h1:NyWgC/yNuGj7Q9rpYnZvas74GogHl5/Z4A/KQRfk6bU= -github.com/microcosm-cc/bluemonday v1.0.2/go.mod h1:iVP4YcDBq+n/5fb23BhYFvIMq/leAFZyRl6bYmGDlGc= -github.com/microcosm-cc/bluemonday v1.0.5 h1:cF59UCKMmmUgqN1baLvqU/B1ZsMori+duLVTLpgiG3w= -github.com/microcosm-cc/bluemonday v1.0.5/go.mod h1:8iwZnFn2CDDNZ0r6UXhF4xawGvzaqzCRa1n3/lO3W2w= +github.com/mailgun/mailgun-go v2.0.0+incompatible h1:0FoRHWwMUctnd8KIR3vtZbqdfjpIMxOZgcSa51s8F8o= +github.com/mailgun/mailgun-go v2.0.0+incompatible/go.mod h1:NWTyU+O4aczg/nsGhQnvHL6v2n5Gy6Sv5tNDVvC6FbU= +github.com/manifoldco/promptui v0.9.0 h1:3V4HzJk1TtXW1MTZMP7mdlwbBpIinw3HztaIlYthEiA= +github.com/manifoldco/promptui v0.9.0/go.mod h1:ka04sppxSGFAtxX0qhlYQjISsg9mR4GWtQEhdbn6Pgg= +github.com/mattn/go-colorable v0.1.13 h1:fFA4WZxdEF4tXPZVKMLwD8oUnCTTo08duU7wxecdEvA= +github.com/mattn/go-colorable v0.1.13/go.mod h1:7S9/ev0klgBDR4GtXTXX8a3vIGJpMovkB8vQcUbaXHg= +github.com/mattn/go-isatty v0.0.16/go.mod h1:kYGgaQfpe5nmfYZH+SKPsOc2e4SrIfOl2e/yFXSvRLM= +github.com/mattn/go-isatty v0.0.17 h1:BTarxUcIeDqL27Mc+vyvdWYSL28zpIhv3RoTdsLMPng= +github.com/mattn/go-isatty v0.0.17/go.mod h1:kYGgaQfpe5nmfYZH+SKPsOc2e4SrIfOl2e/yFXSvRLM= +github.com/mattn/go-sqlite3 v1.14.17 h1:mCRHCLDUBXgpKAqIKsaAaAsrAlbkeomtRFKXh2L6YIM= +github.com/mattn/go-sqlite3 v1.14.17/go.mod h1:2eHXhiwb8IkHr+BDWZGa96P6+rkvnG63S2DGjv9HUNg= +github.com/microcosm-cc/bluemonday v1.0.23/go.mod h1:mN70sk7UkkF8TUr2IGBpNN0jAgStuPzlK76QuruE/z4= +github.com/microcosm-cc/bluemonday v1.0.25 h1:4NEwSfiJ+Wva0VxN5B8OwMicaJvD8r9tlJWm9rtloEg= +github.com/microcosm-cc/bluemonday v1.0.25/go.mod h1:ZIOjCQp1OrzBBPIJmfX4qDYFuhU02nx4bn030ixfHLE= github.com/mitchellh/go-wordwrap v1.0.1 h1:TLuKupo69TCn6TQSyGxwI1EblZZEsQ0vMlAFQflz0v0= github.com/mitchellh/go-wordwrap v1.0.1/go.mod h1:R62XHJLzvMFRBbcrT7m7WgmE1eOyTSsCt+hzestvNj0= github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ= github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U= +github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A= +github.com/nxadm/tail v1.4.8 h1:nPr65rt6Y5JFSKQO7qToXr7pePgD6Gwiw05lkbyAQTE= +github.com/nxadm/tail v1.4.8/go.mod h1:+ncqLTQzXmGhMZNUePPaPqPvBxHAIsmXswZKocGu+AU= +github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.12.1/go.mod h1:zj2OWP4+oCPe1qIXoGWkgMRwljMUYCdkwsT2108oapk= +github.com/onsi/ginkgo v1.16.2/go.mod h1:CObGmKUOKaSC0RjmoAK7tKyn4Azo5P2IWuoMnvwxz1E= +github.com/onsi/ginkgo v1.16.4 h1:29JGrr5oVBm5ulCWet69zQkzWipVXIol6ygQUe/EzNc= +github.com/onsi/ginkgo v1.16.4/go.mod h1:dX+/inL/fNMqNlz0e9LfyB9TswhZpCVdJM/Z6Vvnwo0= +github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY= +github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo= +github.com/onsi/gomega v1.13.0 h1:7lLHu94wT9Ij0o6EWWclhu0aOh32VxhkwEJvzuWPeak= +github.com/onsi/gomega v1.13.0/go.mod h1:lRk9szgn8TxENtWd0Tp4c3wjlRfMTMH27I+3Je41yGY= +github.com/petermattis/goid v0.0.0-20180202154549-b0b1615b78e5 h1:q2e307iGHPdTGp0hoxKjt1H5pDo6utceo3dQVK3I5XQ= +github.com/petermattis/goid v0.0.0-20180202154549-b0b1615b78e5/go.mod h1:jvVRKCrJTQWu0XVbaOlby/2lO20uSCHEMzzplHXte1o= github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4= github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be h1:ta7tUOvsPHVHGom5hKW5VXNc2xZIkfCKP8iaqOyYtUQ= github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be/go.mod h1:MIDFMn7db1kT65GmV94GzpX9Qdi7N/pQlwb+AN8wh+Q= -github.com/russross/blackfriday/v2 v2.0.1 h1:lPqVAte+HuHNfhJ/0LC98ESWRz8afy9tM/0RK8m9o+Q= -github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= +github.com/rogpeppe/go-internal v1.3.2 h1:XU784Pr0wdahMY2bYcyK6N1KuaRAdLtqD4qd8D18Bfs= +github.com/rogpeppe/go-internal v1.3.2/go.mod h1:xXDCJY+GAPziupqXw64V24skbSoqbTEfhy4qGm1nDQc= +github.com/russross/blackfriday/v2 v2.1.0 h1:JIOH55/0cWyOuilr9/qlrm0BSXldqnqwMsf35Ld67mk= +github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= +github.com/sasha-s/go-deadlock v0.3.1 h1:sqv7fDNShgjcaxkO0JNcOAlr8B9+cV5Ey/OB71efZx0= +github.com/sasha-s/go-deadlock v0.3.1/go.mod h1:F73l+cr82YSh10GxyRI6qZiCgK64VaZjwesgfQ1/iLM= github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo= github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304 h1:Jpy1PXuP99tXNrhbq2BaPz9B+jNAvH1JPQQpG/9GCXY= github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc= github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c h1:Ho+uVpkel/udgjbwB5Lktg9BtvJSh2DT0Hi6LPSyI2w= github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c/go.mod h1:XDJAKZRPZ1CvBcN2aX5YOUTYGHki24fSF0Iv48Ibg0s= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= -github.com/stretchr/testify v1.7.0 h1:nwc3DEeHmmLAfoZucVR881uASk0Mfjw8xYJ99tb5CcY= +github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA= github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= -github.com/urfave/cli/v2 v2.3.0 h1:qph92Y649prgesehzOrQjdWyxFOp/QVM+6imKHad91M= -github.com/urfave/cli/v2 v2.3.0/go.mod h1:LJmUH05zAU44vOAcrfzZQKsZbVcdbOG8rtL3/XcUArI= +github.com/stretchr/testify v1.8.4 h1:CcVxjf3Q8PM0mHUKJCdn+eZZtm5yQwehR5yeSVQQcUk= +github.com/stretchr/testify v1.8.4/go.mod h1:sz/lmYIOXD/1dqDmKjjqLyZ2RngseejIcXlSw2iwfAo= +github.com/urfave/cli/v2 v2.25.7 h1:VAzn5oq403l5pHjc4OhD54+XGO9cdKVL/7lDjF+iKUs= +github.com/urfave/cli/v2 v2.25.7/go.mod h1:8qnjx1vcq5s2/wpsqoZFndg2CE5tNFyrTvS6SinrnYQ= github.com/writeas/activity v0.1.2 h1:Y12B5lIrabfqKE7e7HFCWiXrlfXljr9tlkFm2mp7DgY= github.com/writeas/activity v0.1.2/go.mod h1:mYYgiewmEM+8tlifirK/vl6tmB2EbjYaxwb+ndUw5T0= github.com/writeas/activityserve v0.0.0-20200409150223-d7ab3eaa4481 h1:BiSivIxLQFcKoUorpNN3rNwwFG5bITPnqUSyIccfdh0= github.com/writeas/activityserve v0.0.0-20200409150223-d7ab3eaa4481/go.mod h1:4akDJSl+sSp+QhrQKMqzAqdV1gJ1pPx6XPI77zgMM8o= +github.com/writeas/activityserve v0.0.0-20230428180247-dc13a4f4d835 h1:bm/7gYo6y3GxtTa1qyUFyCk29CTnBAKt7z4D2MASYrw= +github.com/writeas/activityserve v0.0.0-20230428180247-dc13a4f4d835/go.mod h1:4akDJSl+sSp+QhrQKMqzAqdV1gJ1pPx6XPI77zgMM8o= github.com/writeas/go-strip-markdown/v2 v2.1.1 h1:hAxUM21Uhznf/FnbVGiJciqzska6iLei22Ijc3q2e28= github.com/writeas/go-strip-markdown/v2 v2.1.1/go.mod h1:UvvgPJgn1vvN8nWuE5e7v/+qmDu3BSVnKAB6Gl7hFzA= github.com/writeas/go-webfinger v1.1.0 h1:MzNyt0ry/GMsRmJGftn2o9mPwqK1Q5MLdh4VuJCfb1Q= github.com/writeas/go-webfinger v1.1.0/go.mod h1:w2VxyRO/J5vfNjJHYVubsjUGHd3RLDoVciz0DE3ApOc= -github.com/writeas/go-writeas v1.1.0 h1:WHGm6wriBkxYAOGbvriXH8DlMUGOi6jhSZLUZKQ+4mQ= github.com/writeas/go-writeas v1.1.0/go.mod h1:oh9U1rWaiE0p3kzdKwwvOpNXgp0P0IELI7OLOwV4fkA= github.com/writeas/go-writeas/v2 v2.0.2 h1:akvdMg89U5oBJiCkBwOXljVLTqP354uN6qnG2oOMrbk= github.com/writeas/go-writeas/v2 v2.0.2/go.mod h1:9sjczQJKmru925fLzg0usrU1R1tE4vBmQtGnItUMR0M= github.com/writeas/httpsig v1.0.0 h1:peIAoIA3DmlP8IG8tMNZqI4YD1uEnWBmkcC9OFPjt3A= github.com/writeas/httpsig v1.0.0/go.mod h1:7ClMGSrSVXJbmiLa17bZ1LrG1oibGZmUMlh3402flPY= github.com/writeas/impart v1.1.0/go.mod h1:g0MpxdnTOHHrl+Ca/2oMXUHJ0PcRAEWtkCzYCJUXC9Y= github.com/writeas/impart v1.1.1 h1:RyA9+CqbdbDuz53k+nXCWUY+NlEkdyw6+nWanxSBl5o= github.com/writeas/impart v1.1.1/go.mod h1:g0MpxdnTOHHrl+Ca/2oMXUHJ0PcRAEWtkCzYCJUXC9Y= github.com/writeas/import v0.2.1 h1:3k+bDNCyqaWdZinyUZtEO4je3mR6fr/nE4ozTh9/9Wg= github.com/writeas/import v0.2.1/go.mod h1:gFe0Pl7ZWYiXbI0TJxeMMyylPGZmhVvCfQxhMEc8CxM= -github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219 h1:baEp0631C8sT2r/hqwypIw2snCFZa6h7U6TojoLHu/c= -github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219/go.mod h1:NyM35ayknT7lzO6O/1JpfgGyv+0W9Z9q7aE0J8bXxfQ= +github.com/writeas/monday v1.3.0 h1:h51wJ0DULXIDZ1w11zutLL7YCBRO5LznXISSzqVLZeA= +github.com/writeas/monday v1.3.0/go.mod h1:9/CdGLDdIeAvzvf4oeihX++PE/qXUT2+tUlPQKCfRWY= github.com/writeas/openssl-go v1.0.0 h1:YXM1tDXeYOlTyJjoMlYLQH1xOloUimSR1WMF8kjFc5o= github.com/writeas/openssl-go v1.0.0/go.mod h1:WsKeK5jYl0B5y8ggOmtVjbmb+3rEGqSD25TppjJnETA= -github.com/writeas/saturday v1.6.0/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ= +github.com/writeas/saturday v1.7.1/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ= github.com/writeas/saturday v1.7.2-0.20200427193424-392b95a03320 h1:PozPZ29CQ/xt6ym/+FvIz+KvKEObSSc5ye+95zbTjVU= github.com/writeas/saturday v1.7.2-0.20200427193424-392b95a03320/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ= github.com/writeas/slug v1.2.0 h1:EMQ+cwLiOcA6EtFwUgyw3Ge18x9uflUnOnR6bp/J+/g= github.com/writeas/slug v1.2.0/go.mod h1:RE8shOqQP3YhsfsQe0L3RnuejfQ4Mk+JjY5YJQFubfQ= -github.com/writeas/web-core v1.3.1-0.20210330164422-95a3a717ed8f h1:ItBZYzdIbBmmqn8BZGWww00MBFgcUKy5ei0gJrzRDFk= -github.com/writeas/web-core v1.3.1-0.20210330164422-95a3a717ed8f/go.mod h1:DzNxa0YLV/wNeeWeHFPNa/nHmyJBFIIzXN/m9PpDm5c= +github.com/writeas/web-core v1.6.0 h1:qOcnbB4RE/kG9g+3ycMRqepj2PljDg2whG/K4A0QB48= +github.com/writeas/web-core v1.6.0/go.mod h1:7+idL4Y4woF7MnUfNX2mvkaQ8nLIJXths2y5iYPtA3k= +github.com/writefreely/go-gopher v0.0.0-20220429181814-40127126f83b h1:h3NzB8OZ50NNi5k9yrFeyFszt3LyqyVK4+xUHFYY8B0= +github.com/writefreely/go-gopher v0.0.0-20220429181814-40127126f83b/go.mod h1:T2UVVzt+R5KSSZe2xRSytnwc2M9AoDegi7foeIsik+M= github.com/writefreely/go-nodeinfo v1.2.0 h1:La+YbTCvmpTwFhBSlebWDDL81N88Qf/SCAvRLR7F8ss= github.com/writefreely/go-nodeinfo v1.2.0/go.mod h1:UTvE78KpcjYOlRHupZIiSEFcXHioTXuacCbHU+CAcPg= +github.com/xrash/smetrics v0.0.0-20201216005158-039620a65673 h1:bAn7/zixMGCfxrRTfdpNzjtPYqr8smhKouy9mxVdGPU= +github.com/xrash/smetrics v0.0.0-20201216005158-039620a65673/go.mod h1:N3UwUGtsrSj3ccvlPHLoLsHnpR27oXr4ZE984MbSER8= +github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= +github.com/yuin/goldmark v1.4.13/go.mod h1:6yULJ656Px+3vBD8DxQVa3kxgyrAnzto9xy5taEt/CY= golang.org/x/crypto v0.0.0-20180527072434-ab813273cd59/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= -golang.org/x/crypto v0.0.0-20190131182504-b8fe1690c613/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= -golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9 h1:psW17arqaxU48Z5kZ0CQnkZWQJsqcURM6tKiBApRjXI= +golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= +golang.org/x/crypto v0.1.0/go.mod h1:RecgLatLF4+eUMCP1PoPZQb+cVrJcOPbHkTkbkB9sbw= +golang.org/x/crypto v0.13.0 h1:mvySKfSWJ+UKUii46M40LOvyWfN0s2U+46/jDd0e6Ck= +golang.org/x/crypto v0.13.0/go.mod h1:y6Z2r+Rw4iayiXXAIxJIDAJ1zMW4yaTpebo8fPOliYc= +golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= +golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4= +golang.org/x/mod v0.8.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= +golang.org/x/net v0.0.0-20180218175443-cbe0f9307d01/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= -golang.org/x/net v0.0.0-20200707034311-ab3426394381 h1:VXak5I6aEWmAXeQjA+QSZzlgNrpq9mjcfDemuexIKsU= -golang.org/x/net v0.0.0-20200707034311-ab3426394381/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA= +golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200202094626-16171245cfb2/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200520004742-59133d7f0dd7/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A= +golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= +golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= +golang.org/x/net v0.0.0-20210428140749-89ef3d95e781/go.mod h1:OJAsFXCWl8Ukc7SiCT/9KSuxbyM7479/AVlXFRxuMCk= +golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= +golang.org/x/net v0.1.0/go.mod h1:Cx3nUiGt4eDBEyega/BKRp+/AlGL8hYe7U9odMt2Cco= +golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs= +golang.org/x/net v0.8.0/go.mod h1:QVkue5JL9kW//ek3r6jTKnTFis1tRmNAW2P1shuFdJc= +golang.org/x/net v0.15.0 h1:ugBLEUaxABaB5AJqW9enI0ACdci2RUd4eP51NTBvuJ8= +golang.org/x/net v0.15.0/go.mod h1:idbUs1IY1+zTqbi8yxTbhexhEEk5ur9LInksu6HrEpk= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20180525142821-c11f84a56e43/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181122145206-62eef0e2fa9b/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd h1:xhmwyvizuTgC2qz7ZlMluP20uW+C3Rm0FD/WLDX8884= +golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210112080510-489259a85091/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.0.0-20220811171246-fbc7d0a398ab/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.5.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.12.0 h1:CM0HF96J0hcLAwsHPJZjfdNzs0gftsLfgKt57wWHJ0o= +golang.org/x/sys v0.12.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= +golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= +golang.org/x/term v0.1.0/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= +golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k= +golang.org/x/term v0.6.0/go.mod h1:m6U89DPEgQRMq3DNkDClhWw02AUbt2daBVO4cn4Hv9U= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= +golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= +golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ= +golang.org/x/text v0.4.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= +golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= +golang.org/x/text v0.8.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= +golang.org/x/text v0.13.0 h1:ablQoSUd0tRdKxZewP80B+BaqeKJuVhuRxj/dkrun3k= +golang.org/x/text v0.13.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20201224043029-2b0845dc783e/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= +golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc= +golang.org/x/tools v0.6.0/go.mod h1:Xwgl3UAJ/d3gWutnCtw505GrjyAbvKui8lOU390QaIU= +golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= +google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= +google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM= +google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE= +google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo= +google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= +google.golang.org/protobuf v1.26.0-rc.1/go.mod h1:jlhhOSvTdKEhbULTjvd4ARK9grFBp09yW+WbY/TyQbw= +google.golang.org/protobuf v1.26.0/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= -gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk= +gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q= +gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI= +gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys= gopkg.in/ini.v1 v1.55.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= gopkg.in/ini.v1 v1.62.0 h1:duBzk771uxoUuOlyRLkHsygud9+5lrlGjdFBb4mSKDU= gopkg.in/ini.v1 v1.62.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= +gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ= +gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw= gopkg.in/yaml.v1 v1.0.0-20140924161607-9f9df34309c0 h1:POO/ycCATvegFmVuPpQzZFJ+pGZeX22Ufu6fibxDVjU= gopkg.in/yaml.v1 v1.0.0-20140924161607-9f9df34309c0/go.mod h1:WDnlLJ4WF5VGsH/HVa3CI79GS0ol3YnhVnKP89i0kNg= -gopkg.in/yaml.v2 v2.2.3/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c h1:dUUwHk2QECo/6vqA44rthZ8ie2QXMNeKRTHCNY2nXvo= +gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY= +gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ= gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= +gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA= +gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= diff --git a/gopher.go b/gopher.go index 7d86632..2ac1590 100644 --- a/gopher.go +++ b/gopher.go @@ -1,167 +1,167 @@ /* - * Copyright © 2020 A Bunch Tell LLC. + * Copyright © 2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "bytes" "fmt" "io" "net/url" "regexp" "strings" - "git.mills.io/prologic/go-gopher" "github.com/writeas/web-core/log" + "github.com/writefreely/go-gopher" ) func initGopher(apper Apper) { handler := NewWFHandler(apper) gopher.HandleFunc("/", handler.Gopher(handleGopher)) log.Info("Serving on gopher://localhost:%d", apper.App().Config().Server.GopherPort) gopher.ListenAndServe(fmt.Sprintf(":%d", apper.App().Config().Server.GopherPort), nil) } // Utility function to strip the URL from the hostname provided by app.cfg.App.Host func stripHostProtocol(app *App) string { u, err := url.Parse(app.cfg.App.Host) if err != nil { // Fall back to host, with scheme stripped return string(regexp.MustCompile("^.*://").ReplaceAll([]byte(app.cfg.App.Host), []byte(""))) } return u.Hostname() } func handleGopher(app *App, w gopher.ResponseWriter, r *gopher.Request) error { parts := strings.Split(r.Selector, "/") if app.cfg.App.SingleUser { if parts[1] != "" { return handleGopherCollectionPost(app, w, r) } return handleGopherCollection(app, w, r) } // Show all public collections (a gopher Reader view, essentially) if len(parts) == 3 { return handleGopherCollection(app, w, r) } w.WriteInfo(fmt.Sprintf("Welcome to %s", app.cfg.App.SiteName)) colls, err := app.db.GetPublicCollections(app.cfg.App.Host) if err != nil { return err } for _, c := range *colls { w.WriteItem(&gopher.Item{ Host: stripHostProtocol(app), Port: app.cfg.Server.GopherPort, Type: gopher.DIRECTORY, Description: c.DisplayTitle(), Selector: "/" + c.Alias + "/", }) } return w.End() } func handleGopherCollection(app *App, w gopher.ResponseWriter, r *gopher.Request) error { var collAlias, slug string var c *Collection var err error var baseSel = "/" parts := strings.Split(r.Selector, "/") if app.cfg.App.SingleUser { // sanity check slug = parts[1] if slug != "" { return handleGopherCollectionPost(app, w, r) } c, err = app.db.GetCollectionByID(1) if err != nil { return err } } else { collAlias = parts[1] slug = parts[2] if slug != "" { return handleGopherCollectionPost(app, w, r) } c, err = app.db.GetCollection(collAlias) if err != nil { return err } baseSel = "/" + c.Alias + "/" } c.hostName = app.cfg.App.Host w.WriteInfo(c.DisplayTitle()) if c.Description != "" { w.WriteInfo(c.Description) } posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false) if err != nil { return err } for _, p := range *posts { w.WriteItem(&gopher.Item{ Port: app.cfg.Server.GopherPort, Host: stripHostProtocol(app), Type: gopher.FILE, Description: p.CreatedDate() + " - " + p.DisplayTitle(), Selector: baseSel + p.Slug.String, }) } return w.End() } func handleGopherCollectionPost(app *App, w gopher.ResponseWriter, r *gopher.Request) error { var collAlias, slug string var c *Collection var err error parts := strings.Split(r.Selector, "/") if app.cfg.App.SingleUser { slug = parts[1] c, err = app.db.GetCollectionByID(1) if err != nil { return err } } else { collAlias = parts[1] slug = parts[2] c, err = app.db.GetCollection(collAlias) if err != nil { return err } } c.hostName = app.cfg.App.Host p, err := app.db.GetPost(slug, c.ID) if err != nil { return err } b := bytes.Buffer{} if p.Title.String != "" { b.WriteString(p.Title.String + "\n") } b.WriteString(p.DisplayDate + "\n\n") b.WriteString(p.Content) io.Copy(w, &b) return w.End() } diff --git a/handle.go b/handle.go index d746feb..7537b61 100644 --- a/handle.go +++ b/handle.go @@ -1,1007 +1,1013 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "fmt" "html/template" "net/http" "net/url" "runtime/debug" "strconv" "strings" "time" - "git.mills.io/prologic/go-gopher" "github.com/gorilla/sessions" "github.com/writeas/impart" "github.com/writeas/web-core/log" + "github.com/writefreely/go-gopher" "github.com/writefreely/writefreely/config" "github.com/writefreely/writefreely/page" ) // UserLevel represents the required user level for accessing an endpoint type UserLevel int const ( UserLevelNoneType UserLevel = iota // user or not -- ignored UserLevelOptionalType // user or not -- object fetched if user UserLevelNoneRequiredType // non-user (required) UserLevelUserType // user (required) ) func UserLevelNone(cfg *config.Config) UserLevel { return UserLevelNoneType } func UserLevelOptional(cfg *config.Config) UserLevel { return UserLevelOptionalType } func UserLevelNoneRequired(cfg *config.Config) UserLevel { return UserLevelNoneRequiredType } func UserLevelUser(cfg *config.Config) UserLevel { return UserLevelUserType } // UserLevelReader returns the permission level required for any route where // users can read published content. func UserLevelReader(cfg *config.Config) UserLevel { if cfg.App.Private { return UserLevelUserType } return UserLevelOptionalType } type ( handlerFunc func(app *App, w http.ResponseWriter, r *http.Request) error gopherFunc func(app *App, w gopher.ResponseWriter, r *gopher.Request) error userHandlerFunc func(app *App, u *User, w http.ResponseWriter, r *http.Request) error userApperHandlerFunc func(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error dataHandlerFunc func(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) authFunc func(app *App, r *http.Request) (*User, error) UserLevelFunc func(cfg *config.Config) UserLevel ) type Handler struct { errors *ErrorPages sessionStore sessions.Store app Apper } // ErrorPages hold template HTML error pages for displaying errors to the user. // In each, there should be a defined template named "base". type ErrorPages struct { NotFound *template.Template Gone *template.Template InternalServerError *template.Template UnavailableError *template.Template Blank *template.Template } // NewHandler returns a new Handler instance, using the given StaticPage data, // and saving alias to the application's CookieStore. func NewHandler(apper Apper) *Handler { h := &Handler{ errors: &ErrorPages{ NotFound: template.Must(template.New("").Parse("{{define \"base\"}}404

Not found.

{{end}}")), Gone: template.Must(template.New("").Parse("{{define \"base\"}}410

Gone.

{{end}}")), InternalServerError: template.Must(template.New("").Parse("{{define \"base\"}}500

Internal server error.

{{end}}")), UnavailableError: template.Must(template.New("").Parse("{{define \"base\"}}503

Service is temporarily unavailable.

{{end}}")), Blank: template.Must(template.New("").Parse("{{define \"base\"}}{{.Title}}

{{.Content}}

{{end}}")), }, sessionStore: apper.App().SessionStore(), app: apper, } return h } // NewWFHandler returns a new Handler instance, using WriteFreely template files. // You MUST call writefreely.InitTemplates() before this. func NewWFHandler(apper Apper) *Handler { h := NewHandler(apper) h.SetErrorPages(&ErrorPages{ NotFound: pages["404-general.tmpl"], Gone: pages["410.tmpl"], InternalServerError: pages["500.tmpl"], UnavailableError: pages["503.tmpl"], Blank: pages["blank.tmpl"], }) return h } // SetErrorPages sets the given set of ErrorPages as templates for any errors // that come up. func (h *Handler) SetErrorPages(e *ErrorPages) { h.errors = e } // User handles requests made in the web application by the authenticated user. // This provides user-friendly HTML pages and actions that work in the browser. func (h *Handler) User(f userHandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = http.StatusInternalServerError } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u := getUserSession(h.app.App(), r) if u == nil { err := ErrNotLoggedIn status = err.Status return err } err := f(h.app.App(), u, w, r) if err == nil { status = http.StatusOK - } else if err, ok := err.(impart.HTTPError); ok { - status = err.Status + } else if impErr, ok := err.(impart.HTTPError); ok { + status = impErr.Status + if impErr == ErrUserNotFound { + log.Info("Logged-in user not found. Logging out.") + sendRedirect(w, http.StatusFound, "/me/logout?to="+h.app.App().cfg.App.LandingPath()) + // Reset err so handleHTTPError does nothing + err = nil + } } else { status = http.StatusInternalServerError } return err }()) } } // Admin handles requests on /admin routes func (h *Handler) Admin(f userHandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = http.StatusInternalServerError } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u := getUserSession(h.app.App(), r) if u == nil || !u.IsAdmin() { err := impart.HTTPError{http.StatusNotFound, ""} status = err.Status return err } err := f(h.app.App(), u, w, r) if err == nil { status = http.StatusOK } else if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = http.StatusInternalServerError } return err }()) } } // AdminApper handles requests on /admin routes that require an Apper. func (h *Handler) AdminApper(f userApperHandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = http.StatusInternalServerError } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u := getUserSession(h.app.App(), r) if u == nil || !u.IsAdmin() { err := impart.HTTPError{http.StatusNotFound, ""} status = err.Status return err } err := f(h.app, u, w, r) if err == nil { status = http.StatusOK } else if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = http.StatusInternalServerError } return err }()) } } func apiAuth(app *App, r *http.Request) (*User, error) { // Authorize user from Authorization header t := r.Header.Get("Authorization") if t == "" { return nil, ErrNoAccessToken } u := &User{ID: app.db.GetUserID(t)} if u.ID == -1 { return nil, ErrBadAccessToken } return u, nil } -// optionaAPIAuth is used for endpoints that accept authenticated requests via +// optionalAPIAuth is used for endpoints that accept authenticated requests via // Authorization header or cookie, unlike apiAuth. It returns a different err // in the case where no Authorization header is present. func optionalAPIAuth(app *App, r *http.Request) (*User, error) { // Authorize user from Authorization header t := r.Header.Get("Authorization") if t == "" { return nil, ErrNotLoggedIn } u := &User{ID: app.db.GetUserID(t)} if u.ID == -1 { return nil, ErrBadAccessToken } return u, nil } func webAuth(app *App, r *http.Request) (*User, error) { u := getUserSession(app, r) if u == nil { return nil, ErrNotLoggedIn } return u, nil } // UserAPI handles requests made in the API by the authenticated user. // This provides user-friendly HTML pages and actions that work in the browser. func (h *Handler) UserAPI(f userHandlerFunc) http.HandlerFunc { return h.UserAll(false, f, apiAuth) } // UserWebAPI handles endpoints that accept a user authorized either via the web (cookies) or an Authorization header. func (h *Handler) UserWebAPI(f userHandlerFunc) http.HandlerFunc { return h.UserAll(false, f, func(app *App, r *http.Request) (*User, error) { // Authorize user via cookies u := getUserSession(app, r) if u != nil { return u, nil } // Fall back to access token, since user isn't logged in via web var err error u, err = apiAuth(app, r) if err != nil { return nil, err } return u, nil }) } func (h *Handler) UserAll(web bool, f userHandlerFunc, a authFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { handleFunc := func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() u, err := a(h.app.App(), r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } err = f(h.app.App(), u, w, r) if err == nil { status = 200 } else if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } if web { h.handleHTTPError(w, r, handleFunc()) } else { h.handleError(w, r, handleFunc()) } } } func (h *Handler) RedirectOnErr(f handlerFunc, loc string) handlerFunc { return func(app *App, w http.ResponseWriter, r *http.Request) error { err := f(app, w, r) if err != nil { if ie, ok := err.(impart.HTTPError); ok { // Override default redirect with returned error's, if it's a // redirect error. if ie.Status == http.StatusFound { return ie } } return impart.HTTPError{http.StatusFound, loc} } return nil } } func (h *Handler) Page(n string) http.HandlerFunc { return h.Web(func(app *App, w http.ResponseWriter, r *http.Request) error { t, ok := pages[n] if !ok { return impart.HTTPError{http.StatusNotFound, "Page not found."} } sp := pageForReq(app, r) err := t.ExecuteTemplate(w, "base", sp) if err != nil { log.Error("Unable to render page: %v", err) } return err }, UserLevelOptional) } func (h *Handler) WebErrors(f handlerFunc, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { // TODO: factor out this logic shared with Web() h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { u := getUserSession(h.app.App(), r) username := "None" if u != nil { username = u.Username } log.Error("User: %s\n\n%s: %s", username, e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() var session *sessions.Session var err error if ul(h.app.App().cfg) != UserLevelNoneType { session, err = h.sessionStore.Get(r, cookieName) if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) { // Cookie is required, but we can ignore this error log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err) } _, gotUser := session.Values[cookieUserVal].(*User) if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser { to := correctPageFromLoginAttempt(r) log.Info("Handler: Required NO user, but got one. Redirecting to %s", to) err := impart.HTTPError{http.StatusFound, to} status = err.Status return err } else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser { log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.") err := ErrNotLoggedIn status = err.Status return err } } // TODO: pass User object to function err = f(h.app.App(), w, r) if err == nil { status = 200 } else if httpErr, ok := err.(impart.HTTPError); ok { status = httpErr.Status if status < 300 || status > 399 { addSessionFlash(h.app.App(), w, r, httpErr.Message, session) return impart.HTTPError{http.StatusFound, r.Referer()} } } else { e := fmt.Sprintf("[Web handler] 500: %v", err) if !strings.HasSuffix(e, "write: broken pipe") { log.Error(e) } else { log.Error(e) } log.Info("Web handler internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } return err }()) } } func (h *Handler) CollectionPostOrStatic(w http.ResponseWriter, r *http.Request) { if strings.Contains(r.URL.Path, ".") && !isRaw(r) { start := time.Now() status := 200 defer func() { log.Info(h.app.ReqLog(r, status, time.Since(start))) }() // Serve static file h.app.App().shttp.ServeHTTP(w, r) return } h.Web(viewCollectionPost, UserLevelReader)(w, r) } // Web handles requests made in the web application. This provides user- // friendly HTML pages and actions that work in the browser. func (h *Handler) Web(f handlerFunc, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { u := getUserSession(h.app.App(), r) username := "None" if u != nil { username = u.Username } log.Error("User: %s\n\n%s: %s", username, e, debug.Stack()) log.Info("Web deferred internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() if ul(h.app.App().cfg) != UserLevelNoneType { session, err := h.sessionStore.Get(r, cookieName) if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) { // Cookie is required, but we can ignore this error log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err) } _, gotUser := session.Values[cookieUserVal].(*User) if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser { to := correctPageFromLoginAttempt(r) log.Info("Handler: Required NO user, but got one. Redirecting to %s", to) err := impart.HTTPError{http.StatusFound, to} status = err.Status return err } else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser { log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.") err := ErrNotLoggedIn status = err.Status return err } } // TODO: pass User object to function err := f(h.app.App(), w, r) if err == nil { status = 200 } else if httpErr, ok := err.(impart.HTTPError); ok { status = httpErr.Status } else { e := fmt.Sprintf("[Web handler] 500: %v", err) log.Error(e) log.Info("Web internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } return err }()) } } func (h *Handler) All(f handlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleError(w, r, func() error { // TODO: return correct "success" status status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s:\n%s", e, debug.Stack()) impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() // TODO: do any needed authentication err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } } return err }()) } } func (h *Handler) PlainTextAPI(f handlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleTextError(w, r, func() error { // TODO: return correct "success" status status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s:\n%s", e, debug.Stack()) status = http.StatusInternalServerError w.WriteHeader(status) fmt.Fprintf(w, "Something didn't work quite right. The robots have alerted the humans.") } log.Info(fmt.Sprintf("\"%s %s\" %d %s \"%s\" \"%s\"", r.Method, r.RequestURI, status, time.Since(start), r.UserAgent(), r.Host)) }() err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = http.StatusInternalServerError } } return err }()) } } func (h *Handler) OAuth(f handlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleOAuthError(w, r, func() error { // TODO: return correct "success" status status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s:\n%s", e, debug.Stack()) impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } } return err }()) } } func (h *Handler) AllReader(f handlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleError(w, r, func() error { status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s:\n%s", e, debug.Stack()) impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."}) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() // Allow any origin, as public endpoints are handled in here w.Header().Set("Access-Control-Allow-Origin", "*") if h.app.App().cfg.App.Private { // This instance is private, so ensure it's being accessed by a valid user // Check if authenticated with an access token _, apiErr := optionalAPIAuth(h.app.App(), r) if apiErr != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } if apiErr == ErrNotLoggedIn { // Fall back to web auth since there was no access token given _, err := webAuth(h.app.App(), r) if err != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } } else { return apiErr } } } err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } } return err }()) } } func (h *Handler) Download(f dataHandlerFunc, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { var status int start := time.Now() defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } log.Info(h.app.ReqLog(r, status, time.Since(start))) }() data, filename, err := f(h.app.App(), w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } ext := ".json" ct := "application/json" if strings.HasSuffix(r.URL.Path, ".csv") { ext = ".csv" ct = "text/csv" } else if strings.HasSuffix(r.URL.Path, ".zip") { ext = ".zip" ct = "application/zip" } w.Header().Set("Content-Disposition", fmt.Sprintf("attachment; filename=%s%s", filename, ext)) w.Header().Set("Content-Type", ct) w.Header().Set("Content-Length", strconv.Itoa(len(data))) fmt.Fprint(w, string(data)) status = 200 return nil }()) } } func (h *Handler) Redirect(url string, ul UserLevelFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { start := time.Now() var status int if ul(h.app.App().cfg) != UserLevelNoneType { session, err := h.sessionStore.Get(r, cookieName) if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType || ul(h.app.App().cfg) == UserLevelUserType) { // Cookie is required, but we can ignore this error log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err) } _, gotUser := session.Values[cookieUserVal].(*User) if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser { to := correctPageFromLoginAttempt(r) log.Info("Handler: Required NO user, but got one. Redirecting to %s", to) err := impart.HTTPError{http.StatusFound, to} status = err.Status return err } else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser { log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.") err := ErrNotLoggedIn status = err.Status return err } } status = sendRedirect(w, http.StatusFound, url) log.Info(h.app.ReqLog(r, status, time.Since(start))) return nil }()) } } func (h *Handler) handleHTTPError(w http.ResponseWriter, r *http.Request, err error) { if err == nil { return } if err, ok := err.(impart.HTTPError); ok { if err.Status >= 300 && err.Status < 400 { sendRedirect(w, err.Status, err.Message) return } else if err.Status == http.StatusUnauthorized { q := "" if r.URL.RawQuery != "" { q = url.QueryEscape("?" + r.URL.RawQuery) } sendRedirect(w, http.StatusFound, "/login?to="+r.URL.Path+q) return } else if err.Status == http.StatusGone { w.WriteHeader(err.Status) p := &struct { page.StaticPage Content *template.HTML }{ StaticPage: pageForReq(h.app.App(), r), } if err.Message != "" { co := template.HTML(err.Message) p.Content = &co } h.errors.Gone.ExecuteTemplate(w, "base", p) return } else if err.Status == http.StatusNotFound { w.WriteHeader(err.Status) if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { // This is a fediverse request; simply return the header return } h.errors.NotFound.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) return } else if err.Status == http.StatusInternalServerError { w.WriteHeader(err.Status) log.Info("handleHTTPErorr internal error render") h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) return } else if err.Status == http.StatusServiceUnavailable { w.WriteHeader(err.Status) h.errors.UnavailableError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) return } else if err.Status == http.StatusAccepted { impart.WriteSuccess(w, "", err.Status) return } else { p := &struct { page.StaticPage Title string Content template.HTML }{ pageForReq(h.app.App(), r), fmt.Sprintf("Uh oh (%d)", err.Status), template.HTML(fmt.Sprintf("

%s

", err.Message)), } h.errors.Blank.ExecuteTemplate(w, "base", p) return } impart.WriteError(w, err) return } impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."}) } func (h *Handler) handleError(w http.ResponseWriter, r *http.Request, err error) { if err == nil { return } if err, ok := err.(impart.HTTPError); ok { if err.Status >= 300 && err.Status < 400 { sendRedirect(w, err.Status, err.Message) return } // if strings.Contains(r.Header.Get("Accept"), "text/html") { impart.WriteError(w, err) // } return } if IsJSON(r) { impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."}) return } h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) } func (h *Handler) handleTextError(w http.ResponseWriter, r *http.Request, err error) { if err == nil { return } if err, ok := err.(impart.HTTPError); ok { if err.Status >= 300 && err.Status < 400 { sendRedirect(w, err.Status, err.Message) return } w.WriteHeader(err.Status) fmt.Fprintf(w, http.StatusText(err.Status)) return } w.WriteHeader(http.StatusInternalServerError) fmt.Fprintf(w, "This is an unhelpful error message for a miscellaneous internal error.") } func (h *Handler) handleOAuthError(w http.ResponseWriter, r *http.Request, err error) { if err == nil { return } if err, ok := err.(impart.HTTPError); ok { if err.Status >= 300 && err.Status < 400 { sendRedirect(w, err.Status, err.Message) return } impart.WriteOAuthError(w, err) return } impart.WriteOAuthError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."}) return } func correctPageFromLoginAttempt(r *http.Request) string { to := r.FormValue("to") if to == "" { to = "/" } else if !strings.HasPrefix(to, "/") { to = "/" + to } return to } func (h *Handler) LogHandlerFunc(f http.HandlerFunc) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { h.handleHTTPError(w, r, func() error { status := 200 start := time.Now() defer func() { if e := recover(); e != nil { log.Error("Handler.LogHandlerFunc\n\n%s: %s", e, debug.Stack()) h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r)) status = 500 } // TODO: log actual status code returned log.Info(h.app.ReqLog(r, status, time.Since(start))) }() if h.app.App().cfg.App.Private { // This instance is private, so ensure it's being accessed by a valid user // Check if authenticated with an access token _, apiErr := optionalAPIAuth(h.app.App(), r) if apiErr != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } if apiErr == ErrNotLoggedIn { // Fall back to web auth since there was no access token given _, err := webAuth(h.app.App(), r) if err != nil { if err, ok := apiErr.(impart.HTTPError); ok { status = err.Status } else { status = 500 } return err } } else { return apiErr } } } f(w, r) return nil }()) } } func (h *Handler) Gopher(f gopherFunc) gopher.HandlerFunc { return func(w gopher.ResponseWriter, r *gopher.Request) { defer func() { if e := recover(); e != nil { log.Error("%s: %s", e, debug.Stack()) w.WriteError("An internal error occurred") } log.Info("gopher: %s", r.Selector) }() err := f(h.app.App(), w, r) if err != nil { log.Error("failed: %s", err) w.WriteError("the page failed for some reason (see logs)") } } } func sendRedirect(w http.ResponseWriter, code int, location string) int { w.Header().Set("Location", location) w.WriteHeader(code) return code } func cacheControl(next http.Handler) http.Handler { return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) { w.Header().Set("Cache-Control", "public, max-age=604800, immutable") next.ServeHTTP(w, r) }) } diff --git a/hostmeta.go b/hostmeta.go index 4f452c3..9152bec 100644 --- a/hostmeta.go +++ b/hostmeta.go @@ -1,29 +1,29 @@ /* - * Copyright © 2018-2019 A Bunch Tell LLC. + * Copyright © 2018-2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "fmt" "net/http" ) func handleViewHostMeta(app *App, w http.ResponseWriter, r *http.Request) error { w.Header().Set("Server", serverSoftware) w.Header().Set("Content-Type", "application/xrd+xml; charset=utf-8") meta := ` ` fmt.Fprintf(w, meta) return nil } diff --git a/instance.go b/instance.go index 6805a6e..bc6e063 100644 --- a/instance.go +++ b/instance.go @@ -1,16 +1,16 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely type InstanceStats struct { NumPosts int64 NumBlogs int64 } diff --git a/invites.go b/invites.go index 4024634..72f4890 100644 --- a/invites.go +++ b/invites.go @@ -1,203 +1,206 @@ /* - * Copyright © 2019-2021 A Bunch Tell LLC. + * Copyright © 2019-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "html/template" "net/http" "strconv" "time" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/id" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/page" ) type Invite struct { ID string MaxUses sql.NullInt64 Created time.Time Expires *time.Time Inactive bool uses int64 } func (i Invite) Uses() int64 { return i.uses } func (i Invite) Expired() bool { return i.Expires != nil && i.Expires.Before(time.Now()) } func (i Invite) Active(db *datastore) bool { if i.Expired() { return false } if i.MaxUses.Valid && i.MaxUses.Int64 > 0 { if c := db.GetUsersInvitedCount(i.ID); c >= i.MaxUses.Int64 { return false } } return true } func (i Invite) ExpiresFriendly() string { return i.Expires.Format("January 2, 2006, 3:04 PM") } func handleViewUserInvites(app *App, u *User, w http.ResponseWriter, r *http.Request) error { // Don't show page if instance doesn't allow it if !(app.cfg.App.UserInvites != "" && (u.IsAdmin() || app.cfg.App.UserInvites != "admin")) { return impart.HTTPError{http.StatusNotFound, ""} } f, _ := getSessionFlashes(app, w, r, nil) p := struct { *UserPage Invites *[]Invite Silenced bool }{ UserPage: NewUserPage(app, r, u, "Invite People", f), } var err error p.Silenced, err = app.db.IsUserSilenced(u.ID) if err != nil { + if err == ErrUserNotFound { + return err + } log.Error("view invites: %v", err) } p.Invites, err = app.db.GetUserInvites(u.ID) if err != nil { return err } for i := range *p.Invites { (*p.Invites)[i].uses = app.db.GetUsersInvitedCount((*p.Invites)[i].ID) } showUserPage(w, "invite", p) return nil } func handleCreateUserInvite(app *App, u *User, w http.ResponseWriter, r *http.Request) error { muVal := r.FormValue("uses") expVal := r.FormValue("expires") if u.IsSilenced() { return ErrUserSilenced } var err error var maxUses int if muVal != "0" { maxUses, err = strconv.Atoi(muVal) if err != nil { return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'max_uses'"} } } var expDate *time.Time var expires int if expVal != "0" { expires, err = strconv.Atoi(expVal) if err != nil { return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'expires'"} } ed := time.Now().Add(time.Duration(expires) * time.Minute) expDate = &ed } inviteID := id.GenerateRandomString("0123456789BCDFGHJKLMNPQRSTVWXYZbcdfghjklmnpqrstvwxyz", 6) err = app.db.CreateUserInvite(inviteID, u.ID, maxUses, expDate) if err != nil { return err } return impart.HTTPError{http.StatusFound, "/me/invites"} } func handleViewInvite(app *App, w http.ResponseWriter, r *http.Request) error { inviteCode := mux.Vars(r)["code"] i, err := app.db.GetUserInvite(inviteCode) if err != nil { return err } expired := i.Expired() if !expired && i.MaxUses.Valid && i.MaxUses.Int64 > 0 { // Invite has a max-use number, so check if we're past that limit i.uses = app.db.GetUsersInvitedCount(inviteCode) expired = i.uses >= i.MaxUses.Int64 } if u := getUserSession(app, r); u != nil { // check if invite belongs to another user // error can be ignored as not important in this case if ownInvite, _ := app.db.IsUsersInvite(inviteCode, u.ID); !ownInvite { addSessionFlash(app, w, r, "You're already registered and logged in.", nil) // show homepage return impart.HTTPError{http.StatusFound, "/me/settings"} } // show invite instructions p := struct { *UserPage Invite *Invite Expired bool }{ UserPage: NewUserPage(app, r, u, "Invite to "+app.cfg.App.SiteName, nil), Invite: i, Expired: expired, } showUserPage(w, "invite-help", p) return nil } p := struct { page.StaticPage *OAuthButtons Error string Flashes []template.HTML Invite string }{ StaticPage: pageForReq(app, r), OAuthButtons: NewOAuthButtons(app.cfg), Invite: inviteCode, } if expired { p.Error = "This invite link has expired." } // Tell search engines not to index invite links w.Header().Set("X-Robots-Tag", "noindex") // Get error messages session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session in handleViewInvite; ignoring: %v", err) } flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } // Show landing page return renderPage(w, "signup.tmpl", p) } diff --git a/jobs.go b/jobs.go new file mode 100644 index 0000000..251b82d --- /dev/null +++ b/jobs.go @@ -0,0 +1,72 @@ +package writefreely + +import ( + "github.com/writeas/web-core/log" + "time" +) + +type PostJob struct { + ID int64 + PostID string + Action string + Delay int64 +} + +func addJob(app *App, p *PublicPost, action string, delay int64) error { + j := &PostJob{ + PostID: p.ID, + Action: action, + Delay: delay, + } + return app.db.InsertJob(j) +} + +func startPublishJobsQueue(app *App) { + t := time.NewTicker(62 * time.Second) + for { + log.Info("[jobs] Done.") + <-t.C + log.Info("[jobs] Fetching email publish jobs...") + jobs, err := app.db.GetJobsToRun("email") + if err != nil { + log.Error("[jobs] %s - Skipping.", err) + continue + } + log.Info("[jobs] Running %d email publish jobs...", len(jobs)) + err = runJobs(app, jobs, true) + if err != nil { + log.Error("[jobs] Failed: %s", err) + } + } +} + +func runJobs(app *App, jobs []*PostJob, reqColl bool) error { + for _, j := range jobs { + p, err := app.db.GetPost(j.PostID, 0) + if err != nil { + log.Info("[job #%d] Unable to get post: %s", j.ID, err) + continue + } + if !p.CollectionID.Valid && reqColl { + log.Info("[job #%d] Post %s not part of a collection", j.ID, p.ID) + app.db.DeleteJob(j.ID) + continue + } + coll, err := app.db.GetCollectionByID(p.CollectionID.Int64) + if err != nil { + log.Info("[job #%d] Unable to get collection: %s", j.ID, err) + continue + } + coll.hostName = app.cfg.App.Host + coll.ForPublic() + p.Collection = &CollectionObj{Collection: *coll} + err = emailPost(app, p, p.Collection.ID) + if err != nil { + log.Error("[job #%d] Failed to email post %s", j.ID, p.ID) + continue + } + log.Info("[job #%d] Success for post %s.", j.ID, p.ID) + app.db.DeleteJob(j.ID) + } + return nil +} diff --git a/key/key.go b/key/key.go index 25490ca..1fa5625 100644 --- a/key/key.go +++ b/key/key.go @@ -1,69 +1,69 @@ /* - * Copyright © 2019, 2021 A Bunch Tell LLC. + * Copyright © 2019, 2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // Package key holds application keys and utilities around generating them. package key import ( "crypto/rand" ) const ( EncKeysBytes = 32 ) type Keychain struct { EmailKey, CookieAuthKey, CookieKey, CSRFKey []byte } // GenerateKeys generates necessary keys for the app on the given Keychain, // skipping any that already exist. func (keys *Keychain) GenerateKeys() error { // Generate keys only if they don't already exist // TODO: use something like https://github.com/hashicorp/go-multierror to return errors var err, keyErrs error if len(keys.EmailKey) == 0 { keys.EmailKey, err = GenerateBytes(EncKeysBytes) if err != nil { keyErrs = err } } if len(keys.CookieAuthKey) == 0 { keys.CookieAuthKey, err = GenerateBytes(EncKeysBytes) if err != nil { keyErrs = err } } if len(keys.CookieKey) == 0 { keys.CookieKey, err = GenerateBytes(EncKeysBytes) if err != nil { keyErrs = err } } if len(keys.CSRFKey) == 0 { keys.CSRFKey, err = GenerateBytes(EncKeysBytes) if err != nil { keyErrs = err } } return keyErrs } // GenerateBytes returns securely generated random bytes. func GenerateBytes(n int) ([]byte, error) { b := make([]byte, n) _, err := rand.Read(b) if err != nil { return nil, err } return b, nil } diff --git a/keys.go b/keys.go index 1b43d0b..b5896f7 100644 --- a/keys.go +++ b/keys.go @@ -1,75 +1,74 @@ /* - * Copyright © 2018-2019, 2021 A Bunch Tell LLC. + * Copyright © 2018-2019, 2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/key" - "io/ioutil" "os" "path/filepath" ) const ( keysDir = "keys" ) var ( emailKeyPath = filepath.Join(keysDir, "email.aes256") cookieAuthKeyPath = filepath.Join(keysDir, "cookies_auth.aes256") cookieKeyPath = filepath.Join(keysDir, "cookies_enc.aes256") csrfKeyPath = filepath.Join(keysDir, "csrf.aes256") ) // InitKeys loads encryption keys into memory via the given Apper interface func InitKeys(apper Apper) error { log.Info("Loading encryption keys...") err := apper.LoadKeys() if err != nil { return err } return nil } func initKeyPaths(app *App) { emailKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, emailKeyPath) cookieAuthKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, cookieAuthKeyPath) cookieKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, cookieKeyPath) csrfKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, csrfKeyPath) } // generateKey generates a key at the given path used for the encryption of // certain user data. Because user data becomes unrecoverable without these // keys, this won't overwrite any existing key, and instead outputs a message. func generateKey(path string) error { // Check if key file exists if _, err := os.Stat(path); err == nil { - log.Info("%s already exists. rm the file if you understand the consquences.", path) + log.Info("%s already exists. rm the file if you understand the consequences.", path) return nil } else if !os.IsNotExist(err) { log.Error("%s", err) return err } log.Info("Generating %s.", path) b, err := key.GenerateBytes(key.EncKeysBytes) if err != nil { log.Error("FAILED. %s. Run writefreely --gen-keys again.", err) return err } - err = ioutil.WriteFile(path, b, 0600) + err = os.WriteFile(path, b, 0600) if err != nil { log.Error("FAILED writing file: %s", err) return err } log.Info("Success.") return nil } diff --git a/less/admin.less b/less/admin.less index 86dc9ff..673a03b 100644 --- a/less/admin.less +++ b/less/admin.less @@ -1,99 +1,128 @@ .edit-page { font-size: 1em; min-height: 12em; } header.admin { margin: 0; h1 + a { margin-left: 1em; } } nav#admin { display: block; margin: 0.5em 0; a { margin-left: 0; .rounded(.25em); border: 0; &.selected { background: #dedede; font-weight: bold; .blip { color: black; } } } .blip { font-weight: bold; } } .pager { display: flex; justify-content: center; &:not(.pages) { display: block; margin: 0.5em 0; a { margin-left: 0; .rounded(.25em); &+a { margin-left: 0.5em; } } } a { color: #333; font-family: @sansFont; font-size: 0.86em; padding: 0.5em 1em; border: 1px solid #ccc; &:hover { text-decoration: none; background: #efefef; } &.selected { cursor: default; background: #ccc; } } + + &.sub { + margin: 1em 0 2em; + a:not(.toggle) { + border: 0; + border-bottom: 2px transparent solid; + .rounded(0); + padding: 0.5em; + margin-left: 0.5em; + margin-right: 0.5em; + + &:hover { + color: @primary; + background: transparent; + } + &.selected { + color: @primary; + background: transparent; + border-bottom-color: @primary; + } + &+a { + margin-left: 1em; + } + } + a.toggle { + margin-top: -0.5em; + float: right; + } + } } .admin-actions { .btn { font-family: @sansFont; font-size: 0.86em; } } .features { margin: 1em 0; div { &:first-child { font-weight: bold; } &+div { padding-left: 1em; } p { font-weight: normal; margin: 0.5rem 0; font-size: 0.86em; color: #666; } } } @media (max-width: 600px) { div.row.features { align-items: start; } .features div + div { padding-left: 0; } } \ No newline at end of file diff --git a/less/core.less b/less/core.less index 75a801b..1b418ba 100644 --- a/less/core.less +++ b/less/core.less @@ -1,1620 +1,1637 @@ body { font-family: @serifFont; font-size-adjust: 0.5; -webkit-font-smoothing: antialiased; -moz-osx-font-smoothing: grayscale; background-color: white; color: #111; h1, header h2 { a { color: @headerTextColor; .transition-duration(0.2s); &:hover { color: #303030; text-decoration: none; } } } h1, h2, h3 { line-height: 1.2; } &#post article, &#collection article p, &#subpage article p { display: block; unicode-bidi: embed; white-space: pre; } &#post { #wrapper, pre { max-width: 40em; margin: 0 auto; a:hover { text-decoration: underline; } } blockquote { p + p { margin: -2em 0 0.5em; } } article { margin-bottom: 2em !important; h1, h2, h3, h4, h5, h6, p, ul, ol, code { display: inline; margin: 0; } hr + p, ol, ul { display: block; margin-top: -1rem; margin-bottom: -1rem; } ol, ul { margin: 2rem 0 -1rem; ol, ul { margin: 1.25rem 0 -0.5rem; } } li { margin-top: -0.5rem; margin-bottom: -0.5rem; } h2#title { .article-title; } h1 { font-size: 1.5em; } h2 { font-size: 1.4em; } } header { nav { span, a { &.pinned { &.selected { font-weight: bold; } &+.views { margin-left: 2em; } } } } } .owner-visible { display: none; } } &#post, &#collection, &#subpage { code { .article-code; } img, video, audio { max-width: 100%; } audio { width: 100%; white-space: initial; } pre { .code-block; code { background: transparent; border: 0; padding: 0; font-size: 1em; white-space: pre-wrap; /* CSS 3 */ white-space: -moz-pre-wrap; /* Mozilla, since 1999 */ white-space: -pre-wrap; /* Opera 4-6 */ white-space: -o-pre-wrap; /* Opera 7 */ word-wrap: break-word; /* Internet Explorer 5.5+ */ } } blockquote { .article-blockquote; } article { hr { margin-top: 0; margin-bottom: 0; } p.badge { background-color: #aaa; display: inline-block; padding: 0.25em 0.5em; margin: 0; float: right; color: white; .rounded(.25em); } } header { nav { span, a { &.pinned { &+.pinned { margin-left: 1.5em; } } } } } footer { nav { a { margin-top: 0; } } } } &#collection { #welcome, .access { margin: 0 auto; max-width: 35em; h2 { font-weight: normal; margin-bottom: 1em; } p { font-size: 1.2em; line-height: 1.6; } } .access { margin: 8em auto; text-align: center; h2, ul.errors { font-size: 1.2em; margin-bottom: 1.5em !important; } } header { padding: 0 1em; text-align: center; max-width: 50em; margin: 3em auto 4em; .writeas-prefix { a { color: #aaa; } display: block; margin-bottom: 0.5em; } nav { display: block; margin: 1em 0; a:first-child { margin: 0; } } } nav#manage { position: absolute; top: 1em; left: 1.5em; li a.write { font-family: @serifFont; padding-top: 0.2em; padding-bottom: 0.2em; } } pre { line-height: 1.5; } + .flash { + text-align: center; + margin-bottom: 4em; + } } &#subpage { #wrapper { h1 { font-size: 2.5em; letter-spacing: -2px; padding: 0 2rem 2rem; } } } &#post { pre { font-size: 0.75em; } } &#collection, &#subpage { #wrapper { margin-left: auto; margin-right: auto; article { margin-bottom: 4em; &:hover { .hidden { .opacity(1); } } } h2 { margin-top: 0em; margin-bottom: 0.25em; &+time { display: block; margin-top: 0.25em; margin-bottom: 0.25em; } } time { font-size: 1.1em; &+p { margin-top: 0.25em; } } footer { text-align: left; padding: 0; } } #paging { overflow: visible; padding: 1em 6em 0; } a.read-more { color: #666; } } &#me #official-writing { h2 { font-weight: normal; a { font-size: 0.6em; margin-left: 1em; } a[name] { margin-left: 0; } a:link, a:visited { color: @textLinkColor; } a:hover { text-decoration: underline; } } } &#promo { div.heading { margin: 8em 0; } div.heading, div.attention-form { h1 { font-size: 3.5em; } input { padding-left: 0.75em; padding-right: 0.75em; &[type=email] { max-width: 16em; } &[type=submit] { padding-left: 1.5em; padding-right: 1.5em; } } } h2 { margin-bottom: 0; font-size: 1.8em; font-weight: normal; span.write-as { color: black; } &.soon { color: lighten(@subheaders, 50%); span { &.write-as { color: lighten(#000, 50%); } &.note { color: lighten(#333, 50%); font-variant: small-caps; margin-left: 0.5em; } } } } .half-col a { margin-left: 1em; margin-right: 1em; } } nav#top-nav { display: inline; position: absolute; top: 1.5em; right: 1.5em; font-size: 0.95rem; font-family: @sansFont; text-transform: uppercase; a { color: #777; } a + a { margin-left: 1em; } } footer { nav, ul { a { display: inline-block; margin-top: 0.8em; .transition-duration(0.1s); text-decoration: none; + a { margin-left: 0.8em; } &:link, &:visited { color: #999; } &:hover { color: #666; text-decoration: none; } } } a.home { &:link, &:visited { color: #333; } font-weight: bold; text-decoration: none; &:hover { color: #000; } } ul { list-style: none; text-align: left; padding-left: 0 !important; margin-left: 0 !important; .icons img { height: 16px; width: 16px; fill: #999; } } } } img { &.paid { height: 0.86em; vertical-align: middle; margin-bottom: 0.1em; } } nav#full-nav { margin: 0; .left-side { display: inline-block; a:first-child { margin-left: 0; } } .right-side { float: right; } } nav#full-nav a.simple-btn, .tool button { font-family: @sansFont; border: 1px solid #ccc !important; padding: .5rem 1rem; margin: 0; .rounded(.25em); text-decoration: none; } .post-title { a { &:link { color: #333; } &:visited { color: #444; } } time, time a:link, time a:visited, &+.time { color: #999; } } .hidden { -moz-transition-property: opacity; -webkit-transition-property: opacity; -o-transition-property: opacity; transition-property: opacity; .transition-duration(0.4s); .opacity(0); } a { text-decoration: none; &:hover { text-decoration: underline; } &.subdued { color: #999; &:hover { border-bottom: 1px solid #999; text-decoration: none; } } &.danger { color: @dangerCol; font-size: 0.86em; } &.simple-cta { text-decoration: none; border-bottom: 1px solid #ccc; color: #333; padding-bottom: 2px; &:hover { text-decoration: none; } } &.action-btn { font-family: @sansFont; text-transform: uppercase; .rounded(.25em); background-color: red; color: white; font-weight: bold; padding: 0.5em 0.75em; &:hover { background-color: lighten(#f00, 5%); text-decoration: none; } } &.hashtag:hover { text-decoration: none; span + span { text-decoration: underline; } } &.hashtag { span:first-child { color: #999; margin-right: 0.1em; font-size: 0.86em; text-decoration: none; } } } abbr { border-bottom: 1px dotted #999; text-decoration: none; cursor: help; } body#collection article p, body#subpage article p { .article-p; } pre, body#post article, #post .alert, #subpage .alert, body#collection article, body#subpage article, body#subpage #wrapper h1 { max-width: 40rem; margin: 0 auto; } #collection header .alert, #post .alert, #subpage .alert { margin-bottom: 1em; p { text-align: left; line-height: 1.5; } } textarea, input#title, pre, body#post article, body#collection article p { &.norm, &.sans, &.wrap { line-height: 1.5; white-space: pre-wrap; /* CSS 3 */ white-space: -moz-pre-wrap; /* Mozilla, since 1999 */ white-space: -pre-wrap; /* Opera 4-6 */ white-space: -o-pre-wrap; /* Opera 7 */ word-wrap: break-word; /* Internet Explorer 5.5+ */ } } textarea, input#title, pre, body#post article, body#collection article, body#subpage article, span, .font { &.norm { font-family: @serifFont; } &.sans { font-family: @sansFont; } &.mono, &.wrap, &.code { font-family: @monoFont; } &.mono, &.code { max-width: none !important; } } textarea { &.section { border: 1px solid #ccc; padding: 0.65em 0.75em; .rounded(.25em); &.codable { height: 12em; resize: vertical; } } } .ace_editor { height: 12em; border: 1px solid #333; max-width: initial; width: 100%; font-size: 0.86em !important; border: 1px solid #ccc; padding: 0.65em 0.75em; margin: 0; .rounded(.25em); } p { -webkit-font-smoothing: antialiased; -moz-osx-font-smoothing: grayscale; &.intro { font-size: 1.25em; text-align: center; } &.upgrade-prompt { font-size: 0.9em; color: #444; } &.text-cta { font-size: 1.2em; text-align: center; margin-bottom: 0.5em; &+ p { text-align: center; font-size: 0.7em; margin-top: 0; color: #666; } } &.error { font-style: italic; color: @errUrgentCol; } &.headeresque { font-size: 2em; } } table.classy { width: 95%; border-collapse: collapse; margin-bottom: 2em; tr + tr { border-top: 1px solid #ccc; } th { text-transform: uppercase; font-weight: normal; font-size: 95%; font-family: @sansFont; padding: 1rem 0.75rem; text-align: center; } td { height: 3.5rem; } p { margin-top: 0 !important; margin-bottom: 0 !important; } &.export { .disabled { color: #999; } .disabled, a { text-transform: lowercase; } } } article table { border-spacing: 0; border-collapse: collapse; width: 100%; th { border-width: 1px 1px 2px 1px; border-style: solid; border-color: #ccc; } td { border-width: 0 1px 1px 1px; border-style: solid; border-color: #ccc; padding: .25rem .5rem; } } body#collection article, body#subpage article { padding-top: 0; padding-bottom: 0; .book { h2 { font-size: 1.4em; } a.hidden.action { color: #666; float: right; font-size: 1em; margin-left: 1em; margin-bottom: 1em; } } } body#post article { p.badge { font-size: 0.9em; } } article { h2.post-title a[rel=nofollow]::after { content: '\a0 \2934'; } } table.downloads { width: 100%; td { text-align: center; } img.os { width: 48px; vertical-align: middle; margin-bottom: 6px; } } select.inputform, textarea.inputform { border: 1px solid #999; + background: white; } input, button, select.inputform, textarea.inputform, a.btn { padding: 0.5em; font-family: @serifFont; font-size: 100%; .rounded(.25em); &[type=submit], &.submit, &.cta { border: 1px solid @primary; background: @primary; color: white; .transition(0.2s); &:hover { background-color: lighten(@primary, 3%); text-decoration: none; } &:disabled { cursor: default; background-color: desaturate(@primary, 100%) !important; border-color: desaturate(@primary, 100%) !important; } } &.error[type=text], textarea.error { -webkit-transition: all 0.30s ease-in-out; -moz-transition: all 0.30s ease-in-out; -ms-transition: all 0.30s ease-in-out; -o-transition: all 0.30s ease-in-out; outline: none; } &.danger { border: 1px solid @dangerCol; background: @dangerCol; color: white; &:hover { background-color: lighten(@dangerCol, 3%); } } &.error[type=text]:focus, textarea.error:focus { box-shadow: 0 0 5px @errUrgentCol; border: 1px solid @errUrgentCol; } } .btn.pager { border: 1px solid @lightNavBorder; font-size: .86em; padding: .5em 1em; white-space: nowrap; font-family: @sansFont; &:hover { text-decoration: none; background: @lightNavBorder; } } .btn.cta.secondary, input[type=submit].secondary { background: transparent; color: @primary; &:hover { background-color: #f9f9f9; } } .btn.cta.disabled { background-color: desaturate(@primary, 100%) !important; border-color: desaturate(@primary, 100%) !important; } div.flat-select { display: inline-block; position: relative; select { border: 0; background: 0; -webkit-appearance: none; -moz-appearance: none; appearance: none; position: absolute; top: 0; left: 0; right: 0; bottom: 0; width: 100%; height: 100%; opacity: 0; } &.action { &:hover { label { text-decoration: underline; } } label, select { cursor: pointer; } } } input { &.underline{ border: none; border-bottom: 1px solid #ccc; padding: 0 .2em .2em; font-size: 0.9em; color: #333; } &.inline { padding: 0.2rem 0.2rem; margin-left: 0; font-size: 1em; border: 0 !important; border-bottom: 1px solid #999 !important; width: 7em; .rounded(0); } &[type=tel], &[type=text], &[type=email], &[type=password] { border: 1px solid #999; } &.boxy { border: 1px solid #999 !important; } } #beta, .content-container { max-width: 50em; margin: 0 auto 3em; font-size: 1.2em; &.tight { max-width: 30em; } &.snug { max-width: 40em; } .app { + .app { margin-top: 1.5em; } h2 { margin-bottom: 0.25em; } p { margin-top: 0.25em; } } h2.intro { font-weight: normal; } p { line-height: 1.5; } li { margin: 0.3em 0; } h2 { &.light { font-weight: normal; } a { .transition-duration(0.2s); -moz-transition-property: color; -webkit-transition-property: color; -o-transition-property: color; transition-property: color; &:link, &:visited, &:hover { color: @subheaders; } &:hover { color: lighten(@subheaders, 10%); text-decoration: none; } } } } .content-container { &#pricing { button { cursor: pointer; color: white; margin-top: 1em; margin-bottom: 1em; padding-left: 1.5em; padding-right: 1.5em; border: 0; background: @primary; .rounded(.25em); .transition(0.2s); &:hover { background-color: lighten(@primary, 5%); } &.unselected { cursor: pointer; } } h2 span { font-weight: normal; } .half { margin: 0 0 1em 0; text-align: center; } } div.blurbs { >h2 { text-align: center; color: #333; font-weight: normal; } p.price { font-size: 1.2em; margin-bottom: 0; color: #333; margin-top: 0.5em; &+p { margin-top: 0; font-size: 0.8em; } } p.text-cta { font-size: 1em; } } } footer div.blurbs { display: flex; flex-flow: row; flex-wrap: wrap; } div.blurbs { .half, .third, .fourth { font-size: 0.86em; h3 { font-weight: normal; } p, ul { color: #595959; } hr { margin: 1em 0; } } .half { padding: 0 1em 0 0; width: ~"calc(50% - 1em)"; &+.half { padding: 0 0 0 1em; } } .third { padding: 0; width: ~"calc(33% - 1em)"; &+.third { padding: 0 0 0 1em; } } .fourth { flex: 1 1 25%; -webkit-flex: 1 1 25%; h3 { margin-bottom: 0.5em; } ul { margin-top: 0.5em; } } } .contain-me { text-align: left; margin: 0 auto 4em; max-width: 50em; h2 + p, h2 + p + p, p.describe-me { margin-left: 1.5em; margin-right: 1.5em; color: #333; } } footer.contain-me { font-size: 1.1em; } #official-writing, #wrapper { h2, h3, h4 { color: @subheaders; } ul { &.collections { padding-left: 0; margin-left: 0; h3 { margin-top: 0; font-weight: normal; } li { &.collection { a.title { &:link, &:visited { color: @headerTextColor; } } } a.create { color: #444; } } & + p { margin-top: 2em; margin-left: 1em; } } } } #official-writing, #wrapper { h2 { &.major { color: #222; } &.bugfix { color: #666; } +.android-version { a { color: #999; &:hover { text-decoration: underline; } } } } } li { line-height: 1.5; .item-desc, .prog-lang { font-size: 0.6em; font-family: 'Open Sans', sans-serif; font-weight: bold; margin-left: 0.5em; margin-right: 0.5em; text-transform: uppercase; color: #999; } } .success { color: darken(@proSelectedCol, 20%); } .alert { padding: 1em; margin-bottom: 1.25em; border: 1px solid transparent; .rounded(.25em); &.info { color: #31708f; background-color: #d9edf7; border-color: #bce8f1; } &.success { color: #3c763d; background-color: #dff0d8; border-color: #d6e9c6; } &.danger { border-color: #856404; background-color: white; h3 { margin: 0 0 0.5em 0; font-size: 1em; font-weight: bold; color: black !important; } h3 + p, button { font-size: 0.86em; } } p { margin: 0; &+p { margin-top: 0.5em; } } p.dismiss { font-family: @sansFont; text-align: right; font-size: 0.86em; text-transform: uppercase; } } ul.errors { padding: 0; text-indent: 0; li.urgent { list-style: none; font-style: italic; text-align: center; color: @errUrgentCol; a:link, a:visited { color: purple; } } li.info { list-style: none; font-size: 1.1em; text-align: center; } } body#pad #target a.upgrade-prompt { padding-left: 1em; padding-right: 1em; text-align: center; font-style: italic; color: @primary; } body#pad-sub #posts, .atoms { margin-top: 1.5em; h3 { margin-bottom: 0.25em; &+ h4 { margin-top: 0.25em; margin-bottom: 0.5em; &+ p { margin-top: 0.5em; } } .electron { font-weight: normal; font-size: 0.86em; margin-left: 0.75rem; } } h3, h4 { a { .transition-duration(0.2s); -moz-transition-property: color; -webkit-transition-property: color; -o-transition-property: color; transition-property: color; } } h4 { font-size: 0.9em; font-weight: normal; } date, .electron { margin-right: 0.5em; } .action { font-size: 1em; } #more-posts p { text-align: center; font-size: 1.1em; } p { font-size: 0.86em; } .error { display: inline-block; font-size: 0.8em; font-style: italic; color: @errUrgentCol; strong { font-style: normal; } } .error + nav { display: inline-block; font-size: 0.8em; margin-left: 1em; a + a { margin-left: 0.75em; } } } h2 { a, time { &+.action { margin-left: 0.5em; } } } .action { font-size: 0.7em; font-weight: normal; font-family: @serifFont; &+ .action { margin-left: 0.5em; } &.new-post { font-weight: bold; } } article.moved { p { font-size: 1.2em; color: #999; } } span.as { .opacity(0.2); font-weight: normal; } span.ras { .opacity(0.6); font-weight: normal; } header { nav { .username { font-size: 2em; font-weight: normal; color: #555; } &#user-nav { margin-left: 0; & > a, .tabs > a { &.selected { cursor: default; font-weight: bold; &:hover { text-decoration: none; } } & + a { margin-left: 2em; } } a { font-size: 1.2em; font-family: @sansFont; span { font-size: 0.7em; color: #999; text-transform: uppercase; margin-left: 0.5em; margin-right: 0.5em; } &.title { font-size: 1.6em; font-family: @serifFont; font-weight: bold; } } nav > ul > li:first-child { &> a { display: inline-block; } img { position: relative; top: -0.5em; right: 0.3em; } } ul ul { font-size: 0.8em; a { padding-top: 0.25em; padding-bottom: 0.25em; } } li { line-height: 1.5; } } &.tabs { margin: 0 0 0 1em; } &+ nav.tabs { margin: 0; } } &.singleuser { margin: 0.5em 1em 0.5em 0.25em; nav#user-nav { nav > ul > li:first-child { img { top: -0.75em; } } } .right-side { padding-top: 0.5em; } } .dash-nav { font-weight: bold; } } li#create-collection { display: none; h4 { margin-top: 0px; margin-bottom: 0px; } input[type=submit] { margin-left: 0.5em; } } #collection-options { .option { textarea { font-size: 0.86em; font-family: @monoFont; } .section > p.explain { font-size: 0.8em; } } } .img-placeholder { text-align: center; img { max-width: 100%; } } dl { &.admin-dl-horizontal { dt { font-weight: bolder; width: 360px; } dd { line-height: 1.5; } } } dt { float: left; clear: left; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; } form { dt, dd { padding: 0.5rem 0; } dt { line-height: 1.8; } dd { font-size: 0.86em; line-height: 2; } &.prominent { margin: 1em 0; label { font-weight: bold; } input, select { width: 100%; } select { font-size: 1em; padding: 0.5rem; display: block; border-radius: 0.25rem; margin: 0.5rem 0; } } } div.row { display: flex; align-items: center; > div { flex: 1; } } .check, .blip { font-size: 1.125em; color: #71D571; } .ex.failure { font-weight: bold; color: @dangerCol; } @media all and (max-width: 450px) { body#post { header { nav { .xtra-feature { display: none; } } } } } @media all and (min-width: 1280px) { body#promo { div.heading { margin: 10em 0; } } } @media all and (min-width: 1600px) { body#promo { div.heading { margin: 14em 0; } } } @media all and (max-width: 900px) { .half.big { padding: 0 !important; width: 100% !important; } .third { padding: 0 !important; float: none; width: 100% !important; p.introduction { font-size: 0.86em; } } div.blurbs { .fourth { flex: 1 1 15em; -webkit-flex: 1 1 15em; } } .blurbs .third, .blurbs .half { p, ul { text-align: left; } } .half-col, .big { float: none; text-align: center; &+.half-col, &+.big { margin-top: 4em !important; margin-left: 0; } } #beta, .content-container { font-size: 1.15em; } } @media all and (max-width: 600px) { div.row:not(.admin-actions) { flex-direction: column; } .half { padding: 0 !important; width: 100% !important; } .third { width: 100% !important; float: none; } body#promo { div.heading { margin: 6em 0; } h2 { font-size: 1.6em; } .half-col a + a { margin-left: 1em; } .half-col a.channel { margin-left: auto !important; margin-right: auto !important; } } ul.add-integrations { li { display: list-item; &+ li { margin-left: 0; } } } } @media all and (max-height: 500px) { body#promo { div.heading { margin: 5em 0; } } } @media all and (max-height: 400px) { body#promo { div.heading { margin: 0em 0; } } } /* Smartphones (portrait and landscape) ----------- */ @media only screen and (min-device-width : 320px) and (max-device-width : 480px) { header { .opacity(1); } } /* Smartphones (portrait) ----------- */ @media only screen and (max-width : 320px) { .content-container#pricing { .half { float: none; width: 100%; } } header { .opacity(1); } } /* iPads (portrait and landscape) ----------- */ @media only screen and (min-device-width : 768px) and (max-device-width : 1024px) { header { .opacity(1); } } @media (pointer: coarse) { body footer nav a:not(.pubd) { padding: 0.8em 1em; margin-left: 0; margin-top: 0; } article { .hidden { .opacity(1); } } } @media print { h1 { page-break-before: always; } h1, h2, h3, h4, h5, h6 { page-break-after: avoid; } table, figure { page-break-inside: avoid; } header, footer { display: none; } article#post-body { margin-top: 2em; margin-left: 0; margin-right: 0; } hr { border: 1px solid #ccc; } } .code-block { padding: 0; max-width: 100%; margin: 0; background: #f8f8f8; border: 1px solid #ccc; padding: 0.375em 0.625em; font-size: 0.86em; .rounded(.25em); } pre.code-block { overflow-x: auto; } +#emailsub { + text-align: center; +} +p#emailsub { + display: inline-block !important; + width: 100%; + font-style: italic; +} +#subscribe-btn { + margin-left: 0.5em; +} + #org-nav { font-family: @sansFont; font-size: 1.1em; color: #888; em, strong { color: #000; } &+h1 { margin-top: 0.5em; } a:link, a:visited, a:hover { color: @accent; } a:first-child { margin-right: 0.25em; } a.coll-name { font-weight: bold; margin-left: 0.25em; } } \ No newline at end of file diff --git a/less/fonts.less b/less/fonts.less index 7ee5356..e4b2659 100644 --- a/less/fonts.less +++ b/less/fonts.less @@ -1,66 +1,61 @@ /* open-sans-regular - latin */ @font-face { font-family: 'Open Sans'; font-style: normal; font-weight: 400; - font-display: optional; src: url('/fonts/open-sans-v13-latin-regular.eot'); /* IE9 Compat Modes */ src: local('Open Sans'), local('OpenSans'), url('/fonts/open-sans-v13-latin-regular.eot?#iefix') format('embedded-opentype'), /* IE6-IE8 */ url('/fonts/open-sans-v13-latin-regular.woff2') format('woff2'), /* Super Modern Browsers */ url('/fonts/open-sans-v13-latin-regular.woff') format('woff'), /* Modern Browsers */ url('/fonts/open-sans-v13-latin-regular.ttf') format('truetype'), /* Safari, Android, iOS */ url('/fonts/open-sans-v13-latin-regular.svg#OpenSans') format('svg'); /* Legacy iOS */ } /* open-sans-700 - latin */ @font-face { font-family: 'Open Sans'; font-style: normal; font-weight: 700; - font-display: optional; src: url('/fonts/open-sans-v13-latin-700.eot'); /* IE9 Compat Modes */ src: local('Open Sans Bold'), local('OpenSans-Bold'), url('/fonts/open-sans-v13-latin-700.eot?#iefix') format('embedded-opentype'), /* IE6-IE8 */ url('/fonts/open-sans-v13-latin-700.woff2') format('woff2'), /* Super Modern Browsers */ url('/fonts/open-sans-v13-latin-700.woff') format('woff'), /* Modern Browsers */ url('/fonts/open-sans-v13-latin-700.ttf') format('truetype'), /* Safari, Android, iOS */ url('/fonts/open-sans-v13-latin-700.svg#OpenSans') format('svg'); /* Legacy iOS */ } /* lora-regular - latin */ @font-face { font-family: 'Lora'; font-style: normal; font-weight: 400; - font-display: optional; src: url('/fonts/Lora-Regular.eot'); /* IE9 Compat Modes */ src: local('Lora'), local('Lora-Regular'), url('/fonts/Lora-Regular.eot?#iefix') format('embedded-opentype'), /* IE6-IE8 */ url('/fonts/Lora-Regular.woff2') format('woff2'), /* Super Modern Browsers */ url('/fonts/Lora-Regular.woff') format('woff'), /* Modern Browsers */ url('/fonts/Lora-Regular.ttf') format('truetype'); /* Safari, Android, iOS */ } /* lora-700 - latin */ @font-face { font-family: 'Lora'; font-style: normal; font-weight: 700; - font-display: optional; src: url('/fonts/Lora-Bold.eot'); /* IE9 Compat Modes */ src: local('Lora Bold'), local('Lora-Bold'), url('/fonts/Lora-Bold.eot?#iefix') format('embedded-opentype'), /* IE6-IE8 */ url('/fonts/Lora-Bold.woff2') format('woff2'), /* Super Modern Browsers */ url('/fonts/Lora-Bold.woff') format('woff'), /* Modern Browsers */ url('/fonts/Lora-Bold.ttf') format('truetype'); /* Safari, Android, iOS */ } @font-face { font-family: 'Lora'; font-style: italic; font-weight: 400; - font-display: optional; src: url('/fonts/Lora-Italic.eot'); /* IE9 Compat Modes */ src: local('Lora Italic'), local('Lora-Italic'), url('/fonts/Lora-Italic.eot?#iefix') format('embedded-opentype'), /* IE6-IE8 */ url('/fonts/Lora-Italic.woff2') format('woff2'), /* Super Modern Browsers */ url('/fonts/Lora-Italic.woff') format('woff'), /* Modern Browsers */ url('/fonts/Lora-Italic.ttf') format('truetype'); /* Safari, Android, iOS */ } diff --git a/less/login.less b/less/login.less index fefeb12..df6f246 100644 --- a/less/login.less +++ b/less/login.less @@ -1,91 +1,91 @@ /* - * Copyright © 2020 A Bunch Tell LLC. + * Copyright © 2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ .row.signinbtns { justify-content: center; font-size: 1em; margin-top: 2em; margin-bottom: 1em; flex-wrap: wrap; .loginbtn { height: 40px; margin: 0.5em; &.btn { box-sizing: border-box; font-size: 17px; white-space: nowrap; img { height: 1.5em; vertical-align: middle; } } &#writeas-login, &#slack-login { img { margin-top: -0.2em; } } &#gitlab-login { background-color: #fc6d26; border-color: #fc6d26; &:hover { background-color: darken(#fc6d26, 5%); border-color: darken(#fc6d26, 5%); } } &#gitea-login { background-color: #2ecc71; border-color: #2ecc71; &:hover { background-color: #2cc26b; border-color: #2cc26b; } } &#slack-login, &#gitlab-login, &#gitea-login, &#generic-oauth-login { font-size: 0.86em; font-family: @sansFont; } &#slack-login, &#generic-oauth-login { color: @lightTextColor; background-color: @lightNavBG; border-color: @lightNavBorder; &:hover { background-color: @lightNavHoverBG; } } } } .or { text-align: center; margin-bottom: 3.5em; p { display: inline-block; background-color: white; padding: 0 1em; } hr { margin-top: -1.6em; margin-bottom: 0; } hr.short { max-width: 30rem; } } \ No newline at end of file diff --git a/migrations/drivers.go b/migrations/drivers.go index 1399411..800d2a6 100644 --- a/migrations/drivers.go +++ b/migrations/drivers.go @@ -1,87 +1,103 @@ /* - * Copyright © 2019 A Bunch Tell LLC. + * Copyright © 2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations import ( "fmt" ) // TODO: use now() from writefreely pkg func (db *datastore) now() string { if db.driverName == driverSQLite { return "strftime('%Y-%m-%d %H:%M:%S','now')" } return "NOW()" } func (db *datastore) typeInt() string { if db.driverName == driverSQLite { return "INTEGER" } return "INT" } func (db *datastore) typeSmallInt() string { if db.driverName == driverSQLite { return "INTEGER" } return "SMALLINT" } +func (db *datastore) typeTinyInt() string { + if db.driverName == driverSQLite { + return "INTEGER" + } + return "TINYINT" +} + func (db *datastore) typeText() string { return "TEXT" } func (db *datastore) typeChar(l int) string { if db.driverName == driverSQLite { return "TEXT" } return fmt.Sprintf("CHAR(%d)", l) } func (db *datastore) typeVarChar(l int) string { if db.driverName == driverSQLite { return "TEXT" } return fmt.Sprintf("VARCHAR(%d)", l) } func (db *datastore) typeBool() string { if db.driverName == driverSQLite { return "INTEGER" } return "TINYINT(1)" } func (db *datastore) typeDateTime() string { return "DATETIME" } +func (db *datastore) typeIntPrimaryKey() string { + if db.driverName == driverSQLite { + // From docs: "In SQLite, a column with type INTEGER PRIMARY KEY is an alias for the ROWID (except in WITHOUT + // ROWID tables) which is always a 64-bit signed integer." + return "INTEGER PRIMARY KEY" + } + return "INT AUTO_INCREMENT PRIMARY KEY" +} + func (db *datastore) collateMultiByte() string { if db.driverName == driverSQLite { return "" } return " COLLATE utf8_bin" } func (db *datastore) engine() string { if db.driverName == driverSQLite { return "" } return " ENGINE = InnoDB" } func (db *datastore) after(colName string) string { if db.driverName == driverSQLite { return "" } return " AFTER " + colName } diff --git a/migrations/migrations.go b/migrations/migrations.go index b3ebcc0..d4f9d4b 100644 --- a/migrations/migrations.go +++ b/migrations/migrations.go @@ -1,145 +1,148 @@ /* - * Copyright © 2019 A Bunch Tell LLC. + * Copyright © 2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // Package migrations contains database migrations for WriteFreely package migrations import ( "database/sql" "github.com/writeas/web-core/log" ) // TODO: refactor to use the datastore struct from writefreely pkg type datastore struct { *sql.DB driverName string } func NewDatastore(db *sql.DB, dn string) *datastore { return &datastore{db, dn} } // TODO: use these consts from writefreely pkg const ( driverMySQL = "mysql" driverSQLite = "sqlite3" ) type Migration interface { Description() string Migrate(db *datastore) error } type migration struct { description string migrate func(db *datastore) error } func New(d string, fn func(db *datastore) error) Migration { return &migration{d, fn} } func (m *migration) Description() string { return m.description } func (m *migration) Migrate(db *datastore) error { return m.migrate(db) } var migrations = []Migration{ New("support user invites", supportUserInvites), // -> V1 (v0.8.0) New("support dynamic instance pages", supportInstancePages), // V1 -> V2 (v0.9.0) New("support users suspension", supportUserStatus), // V2 -> V3 (v0.11.0) New("support oauth", oauth), // V3 -> V4 New("support slack oauth", oauthSlack), // V4 -> v5 New("support ActivityPub mentions", supportActivityPubMentions), // V5 -> V6 New("support oauth attach", oauthAttach), // V6 -> V7 New("support oauth via invite", oauthInvites), // V7 -> V8 (v0.12.0) New("optimize drafts retrieval", optimizeDrafts), // V8 -> V9 - New("support post signatures", supportPostSignatures), // V9 -> V10 + New("support post signatures", supportPostSignatures), // V9 -> V10 (v0.13.0) + New("Widen oauth_users.access_token", widenOauthAcceesToken), // V10 -> V11 + New("support verifying fedi profile", fediverseVerifyProfile), // V11 -> V12 (v0.14.0) + New("support newsletters", supportLetters), // V12 -> V13 } // CurrentVer returns the current migration version the application is on func CurrentVer() int { return len(migrations) } func SetInitialMigrations(db *datastore) error { // Included schema files represent changes up to V1, so note that in the database _, err := db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", 1, "") if err != nil { return err } return nil } func Migrate(db *datastore) error { var version int var err error if db.tableExists("appmigrations") { err = db.QueryRow("SELECT MAX(version) FROM appmigrations").Scan(&version) if err != nil { return err } } else { log.Info("Initializing appmigrations table...") version = 0 _, err = db.Exec(`CREATE TABLE appmigrations ( version ` + db.typeInt() + ` NOT NULL, migrated ` + db.typeDateTime() + ` NOT NULL, result ` + db.typeText() + ` NOT NULL ) ` + db.engine() + `;`) if err != nil { return err } } if len(migrations[version:]) > 0 { for i, m := range migrations[version:] { curVer := version + i + 1 log.Info("Migrating to V%d: %s", curVer, m.Description()) err = m.Migrate(db) if err != nil { return err } // Update migrations table _, err = db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", curVer, "") if err != nil { return err } } } else { log.Info("Database up-to-date. No migrations to run.") } return nil } func (db *datastore) tableExists(t string) bool { var dummy string var err error if db.driverName == driverSQLite { err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = ?", t).Scan(&dummy) } else { err = db.QueryRow("SHOW TABLES LIKE '" + t + "'").Scan(&dummy) } switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SHOW TABLES: %v", err) return false } return true } diff --git a/migrations/v1.go b/migrations/v1.go index ef3a579..dcc956d 100644 --- a/migrations/v1.go +++ b/migrations/v1.go @@ -1,49 +1,49 @@ /* - * Copyright © 2019 A Bunch Tell LLC. + * Copyright © 2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations func supportUserInvites(db *datastore) error { t, err := db.Begin() if err != nil { return err } _, err = t.Exec(`CREATE TABLE userinvites ( id ` + db.typeChar(6) + ` NOT NULL , owner_id ` + db.typeInt() + ` NOT NULL , max_uses ` + db.typeSmallInt() + ` NULL , created ` + db.typeDateTime() + ` NOT NULL , expires ` + db.typeDateTime() + ` NULL , inactive ` + db.typeBool() + ` NOT NULL , PRIMARY KEY (id) ) ` + db.engine() + `;`) if err != nil { t.Rollback() return err } _, err = t.Exec(`CREATE TABLE usersinvited ( invite_id ` + db.typeChar(6) + ` NOT NULL , user_id ` + db.typeInt() + ` NOT NULL , PRIMARY KEY (invite_id, user_id) ) ` + db.engine() + `;`) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } diff --git a/migrations/v10.go b/migrations/v10.go index 9c84a01..25a4a28 100644 --- a/migrations/v10.go +++ b/migrations/v10.go @@ -1,33 +1,33 @@ /* - * Copyright © 2020 A Bunch Tell LLC. + * Copyright © 2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations func supportPostSignatures(db *datastore) error { t, err := db.Begin() if err != nil { t.Rollback() return err } _, err = t.Exec(`ALTER TABLE collections ADD COLUMN post_signature ` + db.typeText() + db.collateMultiByte() + ` NULL` + db.after("script")) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } diff --git a/migrations/v11.go b/migrations/v11.go new file mode 100644 index 0000000..412c648 --- /dev/null +++ b/migrations/v11.go @@ -0,0 +1,38 @@ +/* + * Copyright © 2020 Musing Studio LLC. + * + * This file is part of WriteFreely. + * + * WriteFreely is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License, included + * in the LICENSE file in this source code package. + */ + +package migrations + +/** + * Widen `oauth_users.access_token`, necessary only for mysql + */ +func widenOauthAcceesToken(db *datastore) error { + if db.driverName == driverMySQL { + t, err := db.Begin() + if err != nil { + t.Rollback() + return err + } + + _, err = t.Exec(`ALTER TABLE oauth_users MODIFY COLUMN access_token ` + db.typeText() + db.collateMultiByte() + ` NULL`) + if err != nil { + t.Rollback() + return err + } + + err = t.Commit() + if err != nil { + t.Rollback() + return err + } + } + + return nil +} diff --git a/migrations/v10.go b/migrations/v12.go similarity index 66% copy from migrations/v10.go copy to migrations/v12.go index 9c84a01..bed93fd 100644 --- a/migrations/v10.go +++ b/migrations/v12.go @@ -1,33 +1,33 @@ /* - * Copyright © 2020 A Bunch Tell LLC. + * Copyright © 2023 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations -func supportPostSignatures(db *datastore) error { +func fediverseVerifyProfile(db *datastore) error { t, err := db.Begin() if err != nil { t.Rollback() return err } - _, err = t.Exec(`ALTER TABLE collections ADD COLUMN post_signature ` + db.typeText() + db.collateMultiByte() + ` NULL` + db.after("script")) + _, err = t.Exec(`ALTER TABLE remoteusers ADD COLUMN url ` + db.typeVarChar(255) + ` NULL` + db.after("shared_inbox")) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } diff --git a/migrations/v13.go b/migrations/v13.go new file mode 100644 index 0000000..908ceac --- /dev/null +++ b/migrations/v13.go @@ -0,0 +1,58 @@ +/* + * Copyright © 2021 Musing Studio LLC. + * + * This file is part of WriteFreely. + * + * WriteFreely is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License, included + * in the LICENSE file in this source code package. + */ + +package migrations + +func supportLetters(db *datastore) error { + t, err := db.Begin() + if err != nil { + t.Rollback() + return err + } + + _, err = t.Exec(`CREATE TABLE publishjobs ( + id ` + db.typeIntPrimaryKey() + `, + post_id ` + db.typeVarChar(16) + ` not null, + action ` + db.typeVarChar(16) + ` not null, + delay ` + db.typeTinyInt() + ` not null +)`) + if err != nil { + t.Rollback() + return err + } + + _, err = t.Exec(`CREATE TABLE emailsubscribers ( + id ` + db.typeChar(8) + ` not null, + collection_id ` + db.typeInt() + ` not null, + user_id ` + db.typeInt() + ` null, + email ` + db.typeVarChar(255) + ` null, + subscribed ` + db.typeDateTime() + ` not null, + token ` + db.typeChar(16) + ` not null, + confirmed ` + db.typeBool() + ` default 0 not null, + allow_export ` + db.typeBool() + ` default 0 not null, + constraint eu_coll_email + unique (collection_id, email), + constraint eu_coll_user + unique (collection_id, user_id), + PRIMARY KEY (id) +)`) + if err != nil { + t.Rollback() + return err + } + + err = t.Commit() + if err != nil { + t.Rollback() + return err + } + + return nil +} diff --git a/migrations/v2.go b/migrations/v2.go index d282ec7..fb742b5 100644 --- a/migrations/v2.go +++ b/migrations/v2.go @@ -1,38 +1,38 @@ /* - * Copyright © 2019 A Bunch Tell LLC. + * Copyright © 2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations func supportInstancePages(db *datastore) error { t, err := db.Begin() if err != nil { return err } _, err = t.Exec(`ALTER TABLE appcontent ADD COLUMN title ` + db.typeVarChar(255) + db.collateMultiByte() + ` NULL`) if err != nil { t.Rollback() return err } _, err = t.Exec(`ALTER TABLE appcontent ADD COLUMN content_type ` + db.typeVarChar(36) + ` DEFAULT 'page' NOT NULL`) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } diff --git a/migrations/v3.go b/migrations/v3.go index e36b9d0..6236ae3 100644 --- a/migrations/v3.go +++ b/migrations/v3.go @@ -1,32 +1,32 @@ /* - * Copyright © 2019 A Bunch Tell LLC. + * Copyright © 2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations func supportUserStatus(db *datastore) error { t, err := db.Begin() if err != nil { return err } _, err = t.Exec(`ALTER TABLE users ADD COLUMN status ` + db.typeInt() + ` DEFAULT '0' NOT NULL`) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } diff --git a/migrations/v4.go b/migrations/v4.go index c69dce1..4ae267d 100644 --- a/migrations/v4.go +++ b/migrations/v4.go @@ -1,54 +1,54 @@ /* - * Copyright © 2019-2021 A Bunch Tell LLC. + * Copyright © 2019-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations import ( "context" "database/sql" wf_db "github.com/writefreely/writefreely/db" ) func oauth(db *datastore) error { dialect := wf_db.DialectMySQL if db.driverName == driverSQLite { dialect = wf_db.DialectSQLite } return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { createTableUsersOauth, err := dialect. Table("oauth_users"). SetIfNotExists(false). Column(dialect.Column("user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)). Column(dialect.Column("remote_user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)). ToSQL() if err != nil { return err } createTableOauthClientState, err := dialect. Table("oauth_client_states"). SetIfNotExists(false). Column(dialect.Column("state", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 255})). Column(dialect.Column("used", wf_db.ColumnTypeBool, wf_db.UnsetSize)). Column(dialect.Column("created_at", wf_db.ColumnTypeDateTime, wf_db.UnsetSize).SetDefaultCurrentTimestamp()). UniqueConstraint("state"). ToSQL() if err != nil { return err } for _, table := range []string{createTableUsersOauth, createTableOauthClientState} { if _, err := tx.ExecContext(ctx, table); err != nil { return err } } return nil }) } diff --git a/migrations/v5.go b/migrations/v5.go index 1fe3e30..db18fa1 100644 --- a/migrations/v5.go +++ b/migrations/v5.go @@ -1,88 +1,88 @@ /* - * Copyright © 2019-2021 A Bunch Tell LLC. + * Copyright © 2019-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations import ( "context" "database/sql" wf_db "github.com/writefreely/writefreely/db" ) func oauthSlack(db *datastore) error { dialect := wf_db.DialectMySQL if db.driverName == driverSQLite { dialect = wf_db.DialectSQLite } return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { builders := []wf_db.SQLBuilder{ dialect. AlterTable("oauth_client_states"). AddColumn(dialect. Column( "provider", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 24}).SetDefault("")), dialect. AlterTable("oauth_client_states"). AddColumn(dialect. Column( "client_id", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 128}).SetDefault("")), dialect. AlterTable("oauth_users"). AddColumn(dialect. Column( "provider", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 24}).SetDefault("")), dialect. AlterTable("oauth_users"). AddColumn(dialect. Column( "client_id", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 128}).SetDefault("")), dialect. AlterTable("oauth_users"). AddColumn(dialect. Column( "access_token", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 512}).SetDefault("")), dialect.CreateUniqueIndex("oauth_users_uk", "oauth_users", "user_id", "provider", "client_id"), } if dialect != wf_db.DialectSQLite { // This updates the length of the `remote_user_id` column. It isn't needed for SQLite databases. builders = append(builders, dialect. AlterTable("oauth_users"). ChangeColumn("remote_user_id", dialect. Column( "remote_user_id", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 128}))) } for _, builder := range builders { query, err := builder.ToSQL() if err != nil { return err } if _, err := tx.ExecContext(ctx, query); err != nil { return err } } return nil }) } diff --git a/migrations/v6.go b/migrations/v6.go index 074f446..885d445 100644 --- a/migrations/v6.go +++ b/migrations/v6.go @@ -1,32 +1,32 @@ /* - * Copyright © 2019-2020 A Bunch Tell LLC. + * Copyright © 2019-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations func supportActivityPubMentions(db *datastore) error { t, err := db.Begin() if err != nil { return err } _, err = t.Exec(`ALTER TABLE remoteusers ADD COLUMN handle ` + db.typeVarChar(255) + ` NULL`) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } diff --git a/migrations/v7.go b/migrations/v7.go index 5737b21..2056aa0 100644 --- a/migrations/v7.go +++ b/migrations/v7.go @@ -1,46 +1,46 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations import ( "context" "database/sql" wf_db "github.com/writefreely/writefreely/db" ) func oauthAttach(db *datastore) error { dialect := wf_db.DialectMySQL if db.driverName == driverSQLite { dialect = wf_db.DialectSQLite } return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { builders := []wf_db.SQLBuilder{ dialect. AlterTable("oauth_client_states"). AddColumn(dialect. Column( "attach_user_id", wf_db.ColumnTypeInteger, wf_db.OptionalInt{Set: true, Value: 24}).SetNullable(true)), } for _, builder := range builders { query, err := builder.ToSQL() if err != nil { return err } if _, err := tx.ExecContext(ctx, query); err != nil { return err } } return nil }) } diff --git a/migrations/v8.go b/migrations/v8.go index 28af523..36001af 100644 --- a/migrations/v8.go +++ b/migrations/v8.go @@ -1,45 +1,45 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations import ( "context" "database/sql" wf_db "github.com/writefreely/writefreely/db" ) func oauthInvites(db *datastore) error { dialect := wf_db.DialectMySQL if db.driverName == driverSQLite { dialect = wf_db.DialectSQLite } return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error { builders := []wf_db.SQLBuilder{ dialect. AlterTable("oauth_client_states"). AddColumn(dialect.Column("invite_code", wf_db.ColumnTypeChar, wf_db.OptionalInt{ Set: true, Value: 6, }).SetNullable(true)), } for _, builder := range builders { query, err := builder.ToSQL() if err != nil { return err } if _, err := tx.ExecContext(ctx, query); err != nil { return err } } return nil }) } diff --git a/migrations/v9.go b/migrations/v9.go index c6b832e..f542189 100644 --- a/migrations/v9.go +++ b/migrations/v9.go @@ -1,37 +1,37 @@ /* - * Copyright © 2020 A Bunch Tell LLC. + * Copyright © 2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package migrations func optimizeDrafts(db *datastore) error { t, err := db.Begin() if err != nil { t.Rollback() return err } if db.driverName == driverSQLite { _, err = t.Exec(`CREATE INDEX key_owner_post_id ON posts (owner_id, id)`) } else { _, err = t.Exec(`ALTER TABLE posts ADD INDEX(owner_id, id)`) } if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } diff --git a/monetization.go b/monetization.go index 92375c2..4d6b42b 100644 --- a/monetization.go +++ b/monetization.go @@ -1,160 +1,160 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "bytes" "fmt" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/log" - "io/ioutil" + "io" "net/http" "net/url" "os" "strings" ) func displayMonetization(monetization, alias string) string { if monetization == "" { return "" } ptrURL, err := url.Parse(strings.Replace(monetization, "$", "https://", 1)) if err == nil { if strings.HasSuffix(ptrURL.Host, ".xrptipbot.com") { // xrp tip bot doesn't support stream receipts, so return plain pointer return monetization } } u := os.Getenv("PAYMENT_HOST") if u == "" { return "$webmonetization.org/api/receipts/" + url.PathEscape(monetization) } u += "/" + alias return u } func handleSPSPEndpoint(app *App, w http.ResponseWriter, r *http.Request) error { idStr := r.FormValue("id") id, err := url.QueryUnescape(idStr) if err != nil { log.Error("Unable to unescape: %s", err) return err } var c *Collection if strings.IndexRune(id, '.') > 0 && app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(id) } if err != nil { return err } pointer := c.Monetization if pointer == "" { err := impart.HTTPError{http.StatusNotFound, "No monetization pointer."} return err } fmt.Fprintf(w, pointer) return nil } func handleGetSplitContent(app *App, w http.ResponseWriter, r *http.Request) error { var collID int64 var collLookupID string var coll *Collection var err error vars := mux.Vars(r) if collAlias := vars["alias"]; collAlias != "" { // Fetch collection information, since an alias is provided coll, err = app.db.GetCollection(collAlias) if err != nil { return err } collID = coll.ID collLookupID = coll.Alias } p, err := app.db.GetPost(vars["post"], collID) if err != nil { return err } receipt := r.FormValue("receipt") if receipt == "" { return impart.HTTPError{http.StatusBadRequest, "No `receipt` given."} } err = verifyReceipt(receipt, collLookupID) if err != nil { return err } d := struct { Content string `json:"body"` HTMLContent string `json:"html_body"` }{} if exc := strings.Index(p.Content, shortCodePaid); exc > -1 { baseURL := "" if coll != nil { baseURL = coll.CanonicalURL() } d.Content = p.Content[exc+len(shortCodePaid):] d.HTMLContent = applyMarkdown([]byte(d.Content), baseURL, app.cfg) } return impart.WriteSuccess(w, d, http.StatusOK) } func verifyReceipt(receipt, id string) error { receiptsHost := os.Getenv("RECEIPTS_HOST") if receiptsHost == "" { receiptsHost = "https://webmonetization.org/api/receipts/verify?id=" + id } else { receiptsHost = fmt.Sprintf("%s/receipts?id=%s", receiptsHost, id) } log.Info("Verifying receipt %s at %s", receipt, receiptsHost) r, err := http.NewRequest("POST", receiptsHost, bytes.NewBufferString(receipt)) if err != nil { log.Error("Unable to create new request to %s: %s", receiptsHost, err) return err } resp, err := http.DefaultClient.Do(r) if err != nil { log.Error("Unable to Do() request to %s: %s", receiptsHost, err) return err } if resp != nil && resp.Body != nil { defer resp.Body.Close() } - body, err := ioutil.ReadAll(resp.Body) + body, err := io.ReadAll(resp.Body) if err != nil { log.Error("Unable to read %s response body: %s", receiptsHost, err) return err } log.Info("Status : %s", resp.Status) log.Info("Response: %s", body) if resp.StatusCode != http.StatusOK { log.Error("Bad response from %s:\nStatus: %d\n%s", receiptsHost, resp.StatusCode, string(body)) return impart.HTTPError{resp.StatusCode, string(body)} } return nil } diff --git a/nodeinfo.go b/nodeinfo.go index f0c0b5e..6ce3572 100644 --- a/nodeinfo.go +++ b/nodeinfo.go @@ -1,115 +1,121 @@ /* - * Copyright © 2018-2019, 2021 A Bunch Tell LLC. + * Copyright © 2018-2019, 2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "github.com/writeas/web-core/log" "github.com/writefreely/go-nodeinfo" "github.com/writefreely/writefreely/config" "strings" ) type nodeInfoResolver struct { cfg *config.Config db *datastore } func nodeInfoConfig(db *datastore, cfg *config.Config) *nodeinfo.Config { name := cfg.App.SiteName desc := cfg.App.SiteDesc if desc == "" { desc = "Minimal, federated blogging platform." } if cfg.App.SingleUser { // Fetch blog information, instead coll, err := db.GetCollectionByID(1) if err == nil { desc = coll.Description } } return &nodeinfo.Config{ BaseURL: cfg.App.Host, InfoURL: "/api/nodeinfo", Metadata: nodeinfo.Metadata{ NodeName: name, NodeDescription: desc, Private: cfg.App.Private, Software: nodeinfo.SoftwareMeta{ HomePage: softwareURL, GitHub: "https://github.com/writefreely/writefreely", Follow: "https://writing.exchange/@write_as", }, MaxBlogs: cfg.App.MaxBlogs, PublicReader: cfg.App.LocalTimeline, Invites: cfg.App.UserInvites != "", }, Protocols: []nodeinfo.NodeProtocol{ nodeinfo.ProtocolActivityPub, }, Services: nodeinfo.Services{ Inbound: []nodeinfo.NodeService{}, Outbound: []nodeinfo.NodeService{ nodeinfo.ServiceRSS, }, }, Software: nodeinfo.SoftwareInfo{ Name: strings.ToLower(serverSoftware), Version: softwareVer, }, } } func (r nodeInfoResolver) IsOpenRegistration() (bool, error) { return r.cfg.App.OpenRegistration, nil } func (r nodeInfoResolver) Usage() (nodeinfo.Usage, error) { var collCount, postCount int64 var activeHalfYear, activeMonth int var err error collCount, err = r.db.GetTotalCollections() if err != nil { collCount = 0 } postCount, err = r.db.GetTotalPosts() if err != nil { log.Error("Unable to fetch post counts: %v", err) } if r.cfg.App.PublicStats { // Display bi-yearly / monthly stats err = r.db.QueryRow(`SELECT COUNT(*) FROM ( SELECT DISTINCT collection_id FROM posts INNER JOIN collections c ON collection_id = c.id WHERE collection_id IS NOT NULL AND updated > DATE_SUB(NOW(), INTERVAL 6 MONTH)) co`).Scan(&activeHalfYear) + if err != nil { + log.Error("Failed getting 6-month active user stats: %s", err) + } err = r.db.QueryRow(`SELECT COUNT(*) FROM ( SELECT DISTINCT collection_id FROM posts -INNER JOIN FROM collections c +INNER JOIN collections c ON collection_id = c.id WHERE collection_id IS NOT NULL AND updated > DATE_SUB(NOW(), INTERVAL 1 MONTH)) co`).Scan(&activeMonth) + if err != nil { + log.Error("Failed getting 1-month active user stats: %s", err) + } } return nodeinfo.Usage{ Users: nodeinfo.UsageUsers{ Total: int(collCount), ActiveHalfYear: activeHalfYear, ActiveMonth: activeMonth, }, LocalPosts: int(postCount), }, nil } diff --git a/oauth.go b/oauth.go index 2958721..06a2d20 100644 --- a/oauth.go +++ b/oauth.go @@ -1,467 +1,472 @@ /* - * Copyright © 2019-2021 A Bunch Tell LLC. + * Copyright © 2019-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "context" "encoding/json" "fmt" "io" - "io/ioutil" "net/http" "net/url" "strings" "time" "github.com/gorilla/mux" "github.com/gorilla/sessions" "github.com/writeas/impart" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/config" ) // OAuthButtons holds display information for different OAuth providers we support. type OAuthButtons struct { SlackEnabled bool WriteAsEnabled bool GitLabEnabled bool GitLabDisplayName string GiteaEnabled bool GiteaDisplayName string GenericEnabled bool GenericDisplayName string } // NewOAuthButtons creates a new OAuthButtons struct based on our app configuration. func NewOAuthButtons(cfg *config.Config) *OAuthButtons { return &OAuthButtons{ SlackEnabled: cfg.SlackOauth.ClientID != "", WriteAsEnabled: cfg.WriteAsOauth.ClientID != "", GitLabEnabled: cfg.GitlabOauth.ClientID != "", GitLabDisplayName: config.OrDefaultString(cfg.GitlabOauth.DisplayName, gitlabDisplayName), GiteaEnabled: cfg.GiteaOauth.ClientID != "", GiteaDisplayName: config.OrDefaultString(cfg.GiteaOauth.DisplayName, giteaDisplayName), GenericEnabled: cfg.GenericOauth.ClientID != "", GenericDisplayName: config.OrDefaultString(cfg.GenericOauth.DisplayName, genericOauthDisplayName), } } // TokenResponse contains data returned when a token is created either // through a code exchange or using a refresh token. type TokenResponse struct { AccessToken string `json:"access_token"` ExpiresIn int `json:"expires_in"` RefreshToken string `json:"refresh_token"` TokenType string `json:"token_type"` Error string `json:"error"` } // InspectResponse contains data returned when an access token is inspected. type InspectResponse struct { ClientID string `json:"client_id"` UserID string `json:"user_id"` ExpiresAt time.Time `json:"expires_at"` Username string `json:"username"` DisplayName string `json:"-"` Email string `json:"email"` Error string `json:"error"` } // tokenRequestMaxLen is the most bytes that we'll read from the /oauth/token // endpoint. One megabyte is plenty. const tokenRequestMaxLen = 1000000 // infoRequestMaxLen is the most bytes that we'll read from the // /oauth/inspect endpoint. const infoRequestMaxLen = 1000000 // OAuthDatastoreProvider provides a minimal interface of data store, config, // and session store for use with the oauth handlers. type OAuthDatastoreProvider interface { DB() OAuthDatastore Config() *config.Config SessionStore() sessions.Store } // OAuthDatastore provides a minimal interface of data store methods used in // oauth functionality. type OAuthDatastore interface { GetIDForRemoteUser(context.Context, string, string, string) (int64, error) RecordRemoteUserID(context.Context, int64, string, string, string, string) error ValidateOAuthState(context.Context, string) (string, string, int64, string, error) GenerateOAuthState(context.Context, string, string, int64, string) (string, error) CreateUser(*config.Config, *User, string, string) error GetUserByID(int64) (*User, error) } type HttpClient interface { Do(req *http.Request) (*http.Response, error) } type oauthClient interface { GetProvider() string GetClientID() string GetCallbackLocation() string buildLoginURL(state string) (string, error) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) } type callbackProxyClient struct { server string callbackLocation string httpClient HttpClient } type oauthHandler struct { Config *config.Config DB OAuthDatastore Store sessions.Store EmailKey []byte oauthClient oauthClient callbackProxy *callbackProxyClient } func (h oauthHandler) viewOauthInit(app *App, w http.ResponseWriter, r *http.Request) error { ctx := r.Context() var attachUser int64 if attach := r.URL.Query().Get("attach"); attach == "t" { user, _ := getUserAndSession(app, r) if user == nil { return impart.HTTPError{http.StatusInternalServerError, "cannot attach auth to user: user not found in session"} } attachUser = user.ID } state, err := h.DB.GenerateOAuthState(ctx, h.oauthClient.GetProvider(), h.oauthClient.GetClientID(), attachUser, r.FormValue("invite_code")) if err != nil { log.Error("viewOauthInit error: %s", err) return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"} } if h.callbackProxy != nil { if err := h.callbackProxy.register(ctx, state); err != nil { log.Error("viewOauthInit error: %s", err) return impart.HTTPError{http.StatusInternalServerError, "could not register state server"} } } location, err := h.oauthClient.buildLoginURL(state) if err != nil { log.Error("viewOauthInit error: %s", err) return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"} } return impart.HTTPError{http.StatusTemporaryRedirect, location} } func configureSlackOauth(parentHandler *Handler, r *mux.Router, app *App) { if app.Config().SlackOauth.ClientID != "" { callbackLocation := app.Config().App.Host + "/oauth/callback/slack" var stateRegisterClient *callbackProxyClient = nil if app.Config().SlackOauth.CallbackProxyAPI != "" { stateRegisterClient = &callbackProxyClient{ server: app.Config().SlackOauth.CallbackProxyAPI, callbackLocation: app.Config().App.Host + "/oauth/callback/slack", httpClient: config.DefaultHTTPClient(), } callbackLocation = app.Config().SlackOauth.CallbackProxy } oauthClient := slackOauthClient{ ClientID: app.Config().SlackOauth.ClientID, ClientSecret: app.Config().SlackOauth.ClientSecret, TeamID: app.Config().SlackOauth.TeamID, HttpClient: config.DefaultHTTPClient(), CallbackLocation: callbackLocation, } configureOauthRoutes(parentHandler, r, app, oauthClient, stateRegisterClient) } } func configureWriteAsOauth(parentHandler *Handler, r *mux.Router, app *App) { if app.Config().WriteAsOauth.ClientID != "" { callbackLocation := app.Config().App.Host + "/oauth/callback/write.as" var callbackProxy *callbackProxyClient = nil if app.Config().WriteAsOauth.CallbackProxy != "" { callbackProxy = &callbackProxyClient{ server: app.Config().WriteAsOauth.CallbackProxyAPI, callbackLocation: app.Config().App.Host + "/oauth/callback/write.as", httpClient: config.DefaultHTTPClient(), } callbackLocation = app.Config().WriteAsOauth.CallbackProxy } oauthClient := writeAsOauthClient{ ClientID: app.Config().WriteAsOauth.ClientID, ClientSecret: app.Config().WriteAsOauth.ClientSecret, ExchangeLocation: config.OrDefaultString(app.Config().WriteAsOauth.TokenLocation, writeAsExchangeLocation), InspectLocation: config.OrDefaultString(app.Config().WriteAsOauth.InspectLocation, writeAsIdentityLocation), AuthLocation: config.OrDefaultString(app.Config().WriteAsOauth.AuthLocation, writeAsAuthLocation), HttpClient: config.DefaultHTTPClient(), CallbackLocation: callbackLocation, } configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy) } } func configureGitlabOauth(parentHandler *Handler, r *mux.Router, app *App) { if app.Config().GitlabOauth.ClientID != "" { callbackLocation := app.Config().App.Host + "/oauth/callback/gitlab" var callbackProxy *callbackProxyClient = nil if app.Config().GitlabOauth.CallbackProxy != "" { callbackProxy = &callbackProxyClient{ server: app.Config().GitlabOauth.CallbackProxyAPI, callbackLocation: app.Config().App.Host + "/oauth/callback/gitlab", httpClient: config.DefaultHTTPClient(), } callbackLocation = app.Config().GitlabOauth.CallbackProxy } address := config.OrDefaultString(app.Config().GitlabOauth.Host, gitlabHost) oauthClient := gitlabOauthClient{ ClientID: app.Config().GitlabOauth.ClientID, ClientSecret: app.Config().GitlabOauth.ClientSecret, ExchangeLocation: address + "/oauth/token", InspectLocation: address + "/api/v4/user", AuthLocation: address + "/oauth/authorize", HttpClient: config.DefaultHTTPClient(), CallbackLocation: callbackLocation, } configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy) } } func configureGenericOauth(parentHandler *Handler, r *mux.Router, app *App) { if app.Config().GenericOauth.ClientID != "" { callbackLocation := app.Config().App.Host + "/oauth/callback/generic" var callbackProxy *callbackProxyClient = nil if app.Config().GenericOauth.CallbackProxy != "" { callbackProxy = &callbackProxyClient{ server: app.Config().GenericOauth.CallbackProxyAPI, callbackLocation: app.Config().App.Host + "/oauth/callback/generic", httpClient: config.DefaultHTTPClient(), } callbackLocation = app.Config().GenericOauth.CallbackProxy } oauthClient := genericOauthClient{ ClientID: app.Config().GenericOauth.ClientID, ClientSecret: app.Config().GenericOauth.ClientSecret, ExchangeLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.TokenEndpoint, InspectLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.InspectEndpoint, AuthLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.AuthEndpoint, HttpClient: config.DefaultHTTPClient(), CallbackLocation: callbackLocation, Scope: config.OrDefaultString(app.Config().GenericOauth.Scope, "read_user"), MapUserID: config.OrDefaultString(app.Config().GenericOauth.MapUserID, "user_id"), MapUsername: config.OrDefaultString(app.Config().GenericOauth.MapUsername, "username"), MapDisplayName: config.OrDefaultString(app.Config().GenericOauth.MapDisplayName, "-"), MapEmail: config.OrDefaultString(app.Config().GenericOauth.MapEmail, "email"), } configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy) } } func configureGiteaOauth(parentHandler *Handler, r *mux.Router, app *App) { if app.Config().GiteaOauth.ClientID != "" { callbackLocation := app.Config().App.Host + "/oauth/callback/gitea" var callbackProxy *callbackProxyClient = nil if app.Config().GiteaOauth.CallbackProxy != "" { callbackProxy = &callbackProxyClient{ server: app.Config().GiteaOauth.CallbackProxyAPI, callbackLocation: app.Config().App.Host + "/oauth/callback/gitea", httpClient: config.DefaultHTTPClient(), } callbackLocation = app.Config().GiteaOauth.CallbackProxy } oauthClient := giteaOauthClient{ ClientID: app.Config().GiteaOauth.ClientID, ClientSecret: app.Config().GiteaOauth.ClientSecret, ExchangeLocation: app.Config().GiteaOauth.Host + "/login/oauth/access_token", - InspectLocation: app.Config().GiteaOauth.Host + "/api/v1/user", + InspectLocation: app.Config().GiteaOauth.Host + "/login/oauth/userinfo", AuthLocation: app.Config().GiteaOauth.Host + "/login/oauth/authorize", HttpClient: config.DefaultHTTPClient(), CallbackLocation: callbackLocation, + Scope: "openid profile email", + MapUserID: "sub", + MapUsername: "login", + MapDisplayName: "full_name", + MapEmail: "email", } configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy) } } func configureOauthRoutes(parentHandler *Handler, r *mux.Router, app *App, oauthClient oauthClient, callbackProxy *callbackProxyClient) { handler := &oauthHandler{ Config: app.Config(), DB: app.DB(), Store: app.SessionStore(), oauthClient: oauthClient, EmailKey: app.keys.EmailKey, callbackProxy: callbackProxy, } r.HandleFunc("/oauth/"+oauthClient.GetProvider(), parentHandler.OAuth(handler.viewOauthInit)).Methods("GET") r.HandleFunc("/oauth/callback/"+oauthClient.GetProvider(), parentHandler.OAuth(handler.viewOauthCallback)).Methods("GET") r.HandleFunc("/oauth/signup", parentHandler.OAuth(handler.viewOauthSignup)).Methods("POST") } func (h oauthHandler) viewOauthCallback(app *App, w http.ResponseWriter, r *http.Request) error { ctx := r.Context() code := r.FormValue("code") state := r.FormValue("state") provider, clientID, attachUserID, inviteCode, err := h.DB.ValidateOAuthState(ctx, state) if err != nil { log.Error("Unable to ValidateOAuthState: %s", err) return impart.HTTPError{http.StatusInternalServerError, err.Error()} } tokenResponse, err := h.oauthClient.exchangeOauthCode(ctx, code) if err != nil { log.Error("Unable to exchangeOauthCode: %s", err) // TODO: show user friendly message if needed // TODO: show NO message for cases like user pressing "Cancel" on authorize step addSessionFlash(app, w, r, err.Error(), nil) if attachUserID > 0 { return impart.HTTPError{http.StatusFound, "/me/settings"} } return impart.HTTPError{http.StatusInternalServerError, err.Error()} } // Now that we have the access token, let's use it real quick to make sure // it really really works. tokenInfo, err := h.oauthClient.inspectOauthAccessToken(ctx, tokenResponse.AccessToken) if err != nil { log.Error("Unable to inspectOauthAccessToken: %s", err) return impart.HTTPError{http.StatusInternalServerError, err.Error()} } localUserID, err := h.DB.GetIDForRemoteUser(ctx, tokenInfo.UserID, provider, clientID) if err != nil { log.Error("Unable to GetIDForRemoteUser: %s", err) return impart.HTTPError{http.StatusInternalServerError, err.Error()} } if localUserID != -1 && attachUserID > 0 { - if err = addSessionFlash(app, w, r, "This Slack account is already attached to another user.", nil); err != nil { + if err = addSessionFlash(app, w, r, "This OAuth account is already attached to another user.", nil); err != nil { return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()} } return impart.HTTPError{http.StatusFound, "/me/settings"} } if localUserID != -1 { // Existing user, so log in now user, err := h.DB.GetUserByID(localUserID) if err != nil { log.Error("Unable to GetUserByID %d: %s", localUserID, err) return impart.HTTPError{http.StatusInternalServerError, err.Error()} } if err = loginOrFail(h.Store, w, r, user); err != nil { log.Error("Unable to loginOrFail %d: %s", localUserID, err) return impart.HTTPError{http.StatusInternalServerError, err.Error()} } return nil } if attachUserID > 0 { log.Info("attaching to user %d", attachUserID) + log.Info("OAuth userid: %s", tokenInfo.UserID) err = h.DB.RecordRemoteUserID(r.Context(), attachUserID, tokenInfo.UserID, provider, clientID, tokenResponse.AccessToken) if err != nil { return impart.HTTPError{http.StatusInternalServerError, err.Error()} } return impart.HTTPError{http.StatusFound, "/me/settings"} } // New user registration below. // First, verify that user is allowed to register if inviteCode != "" { // Verify invite code is valid i, err := app.db.GetUserInvite(inviteCode) if err != nil { return impart.HTTPError{http.StatusInternalServerError, err.Error()} } if !i.Active(app.db) { return impart.HTTPError{http.StatusNotFound, "Invite link has expired."} } } else if !app.cfg.App.OpenRegistration { addSessionFlash(app, w, r, ErrUserNotFound.Error(), nil) return impart.HTTPError{http.StatusFound, "/login"} } displayName := tokenInfo.DisplayName if len(displayName) == 0 { displayName = tokenInfo.Username } tp := &oauthSignupPageParams{ AccessToken: tokenResponse.AccessToken, TokenUsername: tokenInfo.Username, TokenAlias: tokenInfo.DisplayName, TokenEmail: tokenInfo.Email, TokenRemoteUser: tokenInfo.UserID, Provider: provider, ClientID: clientID, InviteCode: inviteCode, } tp.TokenHash = tp.HashTokenParams(h.Config.Server.HashSeed) return h.showOauthSignupPage(app, w, r, tp, nil) } func (r *callbackProxyClient) register(ctx context.Context, state string) error { form := url.Values{} form.Add("state", state) form.Add("location", r.callbackLocation) req, err := http.NewRequestWithContext(ctx, "POST", r.server, strings.NewReader(form.Encode())) if err != nil { return err } req.Header.Set("User-Agent", ServerUserAgent("")) req.Header.Set("Accept", "application/json") req.Header.Set("Content-Type", "application/x-www-form-urlencoded") resp, err := r.httpClient.Do(req) if err != nil { return err } if resp.StatusCode != http.StatusCreated { return fmt.Errorf("unable register state location: %d", resp.StatusCode) } return nil } func limitedJsonUnmarshal(body io.ReadCloser, n int, thing interface{}) error { lr := io.LimitReader(body, int64(n+1)) - data, err := ioutil.ReadAll(lr) + data, err := io.ReadAll(lr) if err != nil { return err } if len(data) == n+1 { return fmt.Errorf("content larger than max read allowance: %d", n) } return json.Unmarshal(data, thing) } func loginOrFail(store sessions.Store, w http.ResponseWriter, r *http.Request, user *User) error { // An error may be returned, but a valid session should always be returned. session, _ := store.Get(r, cookieName) session.Values[cookieUserVal] = user.Cookie() if err := session.Save(r, w); err != nil { fmt.Println("error saving session", err) return err } http.Redirect(w, r, "/", http.StatusTemporaryRedirect) return nil } diff --git a/oauth_generic.go b/oauth_generic.go index ccf6a0f..25c162b 100644 --- a/oauth_generic.go +++ b/oauth_generic.go @@ -1,142 +1,142 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC and respective authors. + * Copyright © 2020-2021 Musing Studio LLC and respective authors. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "context" "errors" "fmt" "github.com/writeas/web-core/log" "net/http" "net/url" "strings" ) type genericOauthClient struct { ClientID string ClientSecret string AuthLocation string ExchangeLocation string InspectLocation string CallbackLocation string Scope string MapUserID string MapUsername string MapDisplayName string MapEmail string HttpClient HttpClient } var _ oauthClient = genericOauthClient{} const ( genericOauthDisplayName = "OAuth" ) func (c genericOauthClient) GetProvider() string { return "generic" } func (c genericOauthClient) GetClientID() string { return c.ClientID } func (c genericOauthClient) GetCallbackLocation() string { return c.CallbackLocation } func (c genericOauthClient) buildLoginURL(state string) (string, error) { u, err := url.Parse(c.AuthLocation) if err != nil { return "", err } q := u.Query() q.Set("client_id", c.ClientID) q.Set("redirect_uri", c.CallbackLocation) q.Set("response_type", "code") q.Set("state", state) q.Set("scope", c.Scope) u.RawQuery = q.Encode() return u.String(), nil } func (c genericOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) { form := url.Values{} form.Add("grant_type", "authorization_code") form.Add("redirect_uri", c.CallbackLocation) form.Add("scope", c.Scope) form.Add("code", code) req, err := http.NewRequest("POST", c.ExchangeLocation, strings.NewReader(form.Encode())) if err != nil { return nil, err } req.WithContext(ctx) req.Header.Set("User-Agent", ServerUserAgent("")) req.Header.Set("Accept", "application/json") req.Header.Set("Content-Type", "application/x-www-form-urlencoded") req.SetBasicAuth(c.ClientID, c.ClientSecret) resp, err := c.HttpClient.Do(req) if err != nil { return nil, err } if resp.StatusCode != http.StatusOK { return nil, errors.New("unable to exchange code for access token") } var tokenResponse TokenResponse if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil { return nil, err } if tokenResponse.Error != "" { return nil, errors.New(tokenResponse.Error) } return &tokenResponse, nil } func (c genericOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) { req, err := http.NewRequest("GET", c.InspectLocation, nil) if err != nil { return nil, err } req.WithContext(ctx) req.Header.Set("User-Agent", ServerUserAgent("")) req.Header.Set("Accept", "application/json") req.Header.Set("Authorization", "Bearer "+accessToken) resp, err := c.HttpClient.Do(req) if err != nil { return nil, err } if resp.StatusCode != http.StatusOK { return nil, errors.New("unable to inspect access token") } // since we don't know what the JSON from the server will look like, we create a // generic interface and then map manually to values set in the config var genericInterface map[string]interface{} if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &genericInterface); err != nil { return nil, err } // map each relevant field in inspectResponse to the mapped field from the config var inspectResponse InspectResponse inspectResponse.UserID, _ = genericInterface[c.MapUserID].(string) if inspectResponse.UserID == "" { log.Error("[CONFIGURATION ERROR] Generic OAuth provider returned empty UserID value (`%s`).\n Do you need to configure a different `map_user_id` value for this provider?", c.MapUserID) return nil, fmt.Errorf("no UserID (`%s`) value returned", c.MapUserID) } inspectResponse.Username, _ = genericInterface[c.MapUsername].(string) inspectResponse.DisplayName, _ = genericInterface[c.MapDisplayName].(string) inspectResponse.Email, _ = genericInterface[c.MapEmail].(string) return &inspectResponse, nil } diff --git a/oauth_gitea.go b/oauth_gitea.go index a9b7741..3ecd4a7 100644 --- a/oauth_gitea.go +++ b/oauth_gitea.go @@ -1,114 +1,133 @@ package writefreely import ( "context" "errors" + "fmt" + "github.com/writeas/web-core/log" "net/http" "net/url" "strings" ) type giteaOauthClient struct { ClientID string ClientSecret string AuthLocation string ExchangeLocation string InspectLocation string CallbackLocation string + Scope string + MapUserID string + MapUsername string + MapDisplayName string + MapEmail string HttpClient HttpClient } var _ oauthClient = giteaOauthClient{} const ( giteaDisplayName = "Gitea" ) func (c giteaOauthClient) GetProvider() string { return "gitea" } func (c giteaOauthClient) GetClientID() string { return c.ClientID } func (c giteaOauthClient) GetCallbackLocation() string { return c.CallbackLocation } func (c giteaOauthClient) buildLoginURL(state string) (string, error) { u, err := url.Parse(c.AuthLocation) if err != nil { return "", err } q := u.Query() q.Set("client_id", c.ClientID) q.Set("redirect_uri", c.CallbackLocation) q.Set("response_type", "code") q.Set("state", state) - // q.Set("scope", "read_user") + q.Set("scope", c.Scope) u.RawQuery = q.Encode() return u.String(), nil } func (c giteaOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) { form := url.Values{} form.Add("grant_type", "authorization_code") form.Add("redirect_uri", c.CallbackLocation) - // form.Add("scope", "read_user") + form.Add("scope", c.Scope) form.Add("code", code) req, err := http.NewRequest("POST", c.ExchangeLocation, strings.NewReader(form.Encode())) if err != nil { return nil, err } req.WithContext(ctx) req.Header.Set("User-Agent", ServerUserAgent("")) req.Header.Set("Accept", "application/json") req.Header.Set("Content-Type", "application/x-www-form-urlencoded") req.SetBasicAuth(c.ClientID, c.ClientSecret) resp, err := c.HttpClient.Do(req) if err != nil { return nil, err } if resp.StatusCode != http.StatusOK { return nil, errors.New("unable to exchange code for access token") } var tokenResponse TokenResponse if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil { return nil, err } if tokenResponse.Error != "" { return nil, errors.New(tokenResponse.Error) } return &tokenResponse, nil } func (c giteaOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) { req, err := http.NewRequest("GET", c.InspectLocation, nil) if err != nil { return nil, err } req.WithContext(ctx) req.Header.Set("User-Agent", ServerUserAgent("")) req.Header.Set("Accept", "application/json") req.Header.Set("Authorization", "Bearer "+accessToken) resp, err := c.HttpClient.Do(req) if err != nil { return nil, err } if resp.StatusCode != http.StatusOK { return nil, errors.New("unable to inspect access token") } - var inspectResponse InspectResponse - if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &inspectResponse); err != nil { + // since we don't know what the JSON from the server will look like, we create a + // generic interface and then map manually to values set in the config + var genericInterface map[string]interface{} + if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &genericInterface); err != nil { return nil, err } - if inspectResponse.Error != "" { - return nil, errors.New(inspectResponse.Error) + + // map each relevant field in inspectResponse to the mapped field from the config + var inspectResponse InspectResponse + inspectResponse.UserID, _ = genericInterface[c.MapUserID].(string) + // log.Info("Userid from Gitea: %s", inspectResponse.UserID) + if inspectResponse.UserID == "" { + log.Error("[CONFIGURATION ERROR] Gitea OAuth provider returned empty UserID value (`%s`).\n Do you need to configure a different `map_user_id` value for this provider?", c.MapUserID) + return nil, fmt.Errorf("no UserID (`%s`) value returned", c.MapUserID) } + inspectResponse.Username, _ = genericInterface[c.MapUsername].(string) + inspectResponse.DisplayName, _ = genericInterface[c.MapDisplayName].(string) + inspectResponse.Email, _ = genericInterface[c.MapEmail].(string) + return &inspectResponse, nil } diff --git a/oauth_signup.go b/oauth_signup.go index 8dff416..b9b52c5 100644 --- a/oauth_signup.go +++ b/oauth_signup.go @@ -1,231 +1,231 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "crypto/sha256" "encoding/hex" "fmt" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/page" "html/template" "net/http" "strings" "time" ) type viewOauthSignupVars struct { page.StaticPage To string Message template.HTML Flashes []template.HTML AccessToken string TokenUsername string TokenAlias string // TODO: rename this to match the data it represents: the collection title TokenEmail string TokenRemoteUser string Provider string ClientID string TokenHash string InviteCode string LoginUsername string Alias string // TODO: rename this to match the data it represents: the collection title Email string } const ( oauthParamAccessToken = "access_token" oauthParamTokenUsername = "token_username" oauthParamTokenAlias = "token_alias" oauthParamTokenEmail = "token_email" oauthParamTokenRemoteUserID = "token_remote_user" oauthParamClientID = "client_id" oauthParamProvider = "provider" oauthParamHash = "signature" oauthParamUsername = "username" oauthParamAlias = "alias" oauthParamEmail = "email" oauthParamPassword = "password" oauthParamInviteCode = "invite_code" ) type oauthSignupPageParams struct { AccessToken string TokenUsername string TokenAlias string // TODO: rename this to match the data it represents: the collection title TokenEmail string TokenRemoteUser string ClientID string Provider string TokenHash string InviteCode string } func (p oauthSignupPageParams) HashTokenParams(key string) string { hasher := sha256.New() hasher.Write([]byte(key)) hasher.Write([]byte(p.AccessToken)) hasher.Write([]byte(p.TokenUsername)) hasher.Write([]byte(p.TokenAlias)) hasher.Write([]byte(p.TokenEmail)) hasher.Write([]byte(p.TokenRemoteUser)) hasher.Write([]byte(p.ClientID)) hasher.Write([]byte(p.Provider)) return hex.EncodeToString(hasher.Sum(nil)) } func (h oauthHandler) viewOauthSignup(app *App, w http.ResponseWriter, r *http.Request) error { tp := &oauthSignupPageParams{ AccessToken: r.FormValue(oauthParamAccessToken), TokenUsername: r.FormValue(oauthParamTokenUsername), TokenAlias: r.FormValue(oauthParamTokenAlias), TokenEmail: r.FormValue(oauthParamTokenEmail), TokenRemoteUser: r.FormValue(oauthParamTokenRemoteUserID), ClientID: r.FormValue(oauthParamClientID), Provider: r.FormValue(oauthParamProvider), InviteCode: r.FormValue(oauthParamInviteCode), } if tp.HashTokenParams(h.Config.Server.HashSeed) != r.FormValue(oauthParamHash) { return impart.HTTPError{Status: http.StatusBadRequest, Message: "Request has been tampered with."} } tp.TokenHash = tp.HashTokenParams(h.Config.Server.HashSeed) if err := h.validateOauthSignup(r); err != nil { return h.showOauthSignupPage(app, w, r, tp, err) } var err error hashedPass := []byte{} clearPass := r.FormValue(oauthParamPassword) hasPass := clearPass != "" if hasPass { hashedPass, err = auth.HashPass([]byte(clearPass)) if err != nil { return h.showOauthSignupPage(app, w, r, tp, fmt.Errorf("unable to hash password")) } } newUser := &User{ Username: r.FormValue(oauthParamUsername), HashedPass: hashedPass, HasPass: hasPass, Email: prepareUserEmail(r.FormValue(oauthParamEmail), h.EmailKey), Created: time.Now().Truncate(time.Second).UTC(), } displayName := r.FormValue(oauthParamAlias) if len(displayName) == 0 { displayName = r.FormValue(oauthParamUsername) } err = h.DB.CreateUser(h.Config, newUser, displayName, "") if err != nil { return h.showOauthSignupPage(app, w, r, tp, err) } // Log invite if needed if tp.InviteCode != "" { err = app.db.CreateInvitedUser(tp.InviteCode, newUser.ID) if err != nil { return err } } err = h.DB.RecordRemoteUserID(r.Context(), newUser.ID, r.FormValue(oauthParamTokenRemoteUserID), r.FormValue(oauthParamProvider), r.FormValue(oauthParamClientID), r.FormValue(oauthParamAccessToken)) if err != nil { return h.showOauthSignupPage(app, w, r, tp, err) } if err := loginOrFail(h.Store, w, r, newUser); err != nil { return h.showOauthSignupPage(app, w, r, tp, err) } return nil } func (h oauthHandler) validateOauthSignup(r *http.Request) error { username := r.FormValue(oauthParamUsername) if len(username) < h.Config.App.MinUsernameLen { return impart.HTTPError{Status: http.StatusBadRequest, Message: "Username is too short."} } if len(username) > 100 { return impart.HTTPError{Status: http.StatusBadRequest, Message: "Username is too long."} } collTitle := r.FormValue(oauthParamAlias) if len(collTitle) == 0 { collTitle = username } email := r.FormValue(oauthParamEmail) if len(email) > 0 { parts := strings.Split(email, "@") if len(parts) != 2 || (len(parts[0]) < 1 || len(parts[1]) < 1) { return impart.HTTPError{Status: http.StatusBadRequest, Message: "Invalid email address"} } } return nil } func (h oauthHandler) showOauthSignupPage(app *App, w http.ResponseWriter, r *http.Request, tp *oauthSignupPageParams, errMsg error) error { username := tp.TokenUsername collTitle := tp.TokenAlias email := tp.TokenEmail session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session; ignoring: %v", err) } if tmpValue := r.FormValue(oauthParamUsername); len(tmpValue) > 0 { username = tmpValue } if tmpValue := r.FormValue(oauthParamAlias); len(tmpValue) > 0 { collTitle = tmpValue } if tmpValue := r.FormValue(oauthParamEmail); len(tmpValue) > 0 { email = tmpValue } p := &viewOauthSignupVars{ StaticPage: pageForReq(app, r), To: r.FormValue("to"), Flashes: []template.HTML{}, AccessToken: tp.AccessToken, TokenUsername: tp.TokenUsername, TokenAlias: tp.TokenAlias, TokenEmail: tp.TokenEmail, TokenRemoteUser: tp.TokenRemoteUser, Provider: tp.Provider, ClientID: tp.ClientID, TokenHash: tp.TokenHash, InviteCode: tp.InviteCode, LoginUsername: username, Alias: collTitle, Email: email, } // Display any error messages flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } if errMsg != nil { p.Flashes = append(p.Flashes, template.HTML(errMsg.Error())) } err = pages["signup-oauth.tmpl"].ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render signup-oauth: %v", err) return err } return nil } diff --git a/oauth_slack.go b/oauth_slack.go index bad3775..a2752db 100644 --- a/oauth_slack.go +++ b/oauth_slack.go @@ -1,178 +1,178 @@ /* - * Copyright © 2019-2020 A Bunch Tell LLC. + * Copyright © 2019-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "context" "errors" "github.com/writeas/slug" "net/http" "net/url" "strings" ) type slackOauthClient struct { ClientID string ClientSecret string TeamID string CallbackLocation string HttpClient HttpClient } type slackExchangeResponse struct { OK bool `json:"ok"` AccessToken string `json:"access_token"` Scope string `json:"scope"` TeamName string `json:"team_name"` TeamID string `json:"team_id"` Error string `json:"error"` } type slackIdentity struct { Name string `json:"name"` ID string `json:"id"` Email string `json:"email"` } type slackTeam struct { Name string `json:"name"` ID string `json:"id"` } type slackUserIdentityResponse struct { OK bool `json:"ok"` User slackIdentity `json:"user"` Team slackTeam `json:"team"` Error string `json:"error"` } const ( slackAuthLocation = "https://slack.com/oauth/authorize" slackExchangeLocation = "https://slack.com/api/oauth.access" slackIdentityLocation = "https://slack.com/api/users.identity" ) var _ oauthClient = slackOauthClient{} func (c slackOauthClient) GetProvider() string { return "slack" } func (c slackOauthClient) GetClientID() string { return c.ClientID } func (c slackOauthClient) GetCallbackLocation() string { return c.CallbackLocation } func (c slackOauthClient) buildLoginURL(state string) (string, error) { u, err := url.Parse(slackAuthLocation) if err != nil { return "", err } q := u.Query() q.Set("client_id", c.ClientID) q.Set("scope", "identity.basic identity.email identity.team") q.Set("redirect_uri", c.CallbackLocation) q.Set("state", state) // If this param is not set, the user can select which team they // authenticate through and then we'd have to match the configured team // against the profile get. That is extra work in the post-auth phase // that we don't want to do. q.Set("team", c.TeamID) // The Slack OAuth docs don't explicitly list this one, but it is part of // the spec, so we include it anyway. q.Set("response_type", "code") u.RawQuery = q.Encode() return u.String(), nil } func (c slackOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) { form := url.Values{} // The oauth.access documentation doesn't explicitly mention this // parameter, but it is part of the spec, so we include it anyway. // https://api.slack.com/methods/oauth.access form.Add("grant_type", "authorization_code") form.Add("redirect_uri", c.CallbackLocation) form.Add("code", code) req, err := http.NewRequest("POST", slackExchangeLocation, strings.NewReader(form.Encode())) if err != nil { return nil, err } req.WithContext(ctx) req.Header.Set("User-Agent", ServerUserAgent("")) req.Header.Set("Accept", "application/json") req.Header.Set("Content-Type", "application/x-www-form-urlencoded") req.SetBasicAuth(c.ClientID, c.ClientSecret) resp, err := c.HttpClient.Do(req) if err != nil { return nil, err } if resp.StatusCode != http.StatusOK { return nil, errors.New("unable to exchange code for access token") } var tokenResponse slackExchangeResponse if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil { return nil, err } if !tokenResponse.OK { return nil, errors.New(tokenResponse.Error) } return tokenResponse.TokenResponse(), nil } func (c slackOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) { req, err := http.NewRequest("GET", slackIdentityLocation, nil) if err != nil { return nil, err } req.WithContext(ctx) req.Header.Set("User-Agent", ServerUserAgent("")) req.Header.Set("Accept", "application/json") req.Header.Set("Authorization", "Bearer "+accessToken) resp, err := c.HttpClient.Do(req) if err != nil { return nil, err } if resp.StatusCode != http.StatusOK { return nil, errors.New("unable to inspect access token") } var inspectResponse slackUserIdentityResponse if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &inspectResponse); err != nil { return nil, err } if !inspectResponse.OK { return nil, errors.New(inspectResponse.Error) } return inspectResponse.InspectResponse(), nil } func (resp slackUserIdentityResponse) InspectResponse() *InspectResponse { return &InspectResponse{ UserID: resp.User.ID, Username: slug.Make(resp.User.Name), DisplayName: resp.User.Name, Email: resp.User.Email, } } func (resp slackExchangeResponse) TokenResponse() *TokenResponse { return &TokenResponse{ AccessToken: resp.AccessToken, } } diff --git a/oauth_test.go b/oauth_test.go index 553c1cb..1bd0bfc 100644 --- a/oauth_test.go +++ b/oauth_test.go @@ -1,261 +1,261 @@ /* - * Copyright © 2019-2021 A Bunch Tell LLC. + * Copyright © 2019-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "context" "fmt" "github.com/gorilla/sessions" "github.com/stretchr/testify/assert" "github.com/writeas/impart" "github.com/writeas/web-core/id" "github.com/writefreely/writefreely/config" "net/http" "net/http/httptest" "net/url" "strings" "testing" ) type MockOAuthDatastoreProvider struct { DoDB func() OAuthDatastore DoConfig func() *config.Config DoSessionStore func() sessions.Store } type MockOAuthDatastore struct { DoGenerateOAuthState func(context.Context, string, string, int64, string) (string, error) DoValidateOAuthState func(context.Context, string) (string, string, int64, string, error) DoGetIDForRemoteUser func(context.Context, string, string, string) (int64, error) DoCreateUser func(*config.Config, *User, string) error DoRecordRemoteUserID func(context.Context, int64, string, string, string, string) error DoGetUserByID func(int64) (*User, error) } var _ OAuthDatastore = &MockOAuthDatastore{} type StringReadCloser struct { *strings.Reader } func (src *StringReadCloser) Close() error { return nil } type MockHTTPClient struct { DoDo func(req *http.Request) (*http.Response, error) } func (m *MockHTTPClient) Do(req *http.Request) (*http.Response, error) { if m.DoDo != nil { return m.DoDo(req) } return &http.Response{}, nil } func (m *MockOAuthDatastoreProvider) SessionStore() sessions.Store { if m.DoSessionStore != nil { return m.DoSessionStore() } return sessions.NewCookieStore([]byte("secret-key")) } func (m *MockOAuthDatastoreProvider) DB() OAuthDatastore { if m.DoDB != nil { return m.DoDB() } return &MockOAuthDatastore{} } func (m *MockOAuthDatastoreProvider) Config() *config.Config { if m.DoConfig != nil { return m.DoConfig() } cfg := config.New() cfg.UseSQLite(true) cfg.WriteAsOauth = config.WriteAsOauthCfg{ ClientID: "development", ClientSecret: "development", AuthLocation: "https://write.as/oauth/login", TokenLocation: "https://write.as/oauth/token", InspectLocation: "https://write.as/oauth/inspect", } cfg.SlackOauth = config.SlackOauthCfg{ ClientID: "development", ClientSecret: "development", TeamID: "development", } return cfg } func (m *MockOAuthDatastore) ValidateOAuthState(ctx context.Context, state string) (string, string, int64, string, error) { if m.DoValidateOAuthState != nil { return m.DoValidateOAuthState(ctx, state) } return "", "", 0, "", nil } func (m *MockOAuthDatastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) { if m.DoGetIDForRemoteUser != nil { return m.DoGetIDForRemoteUser(ctx, remoteUserID, provider, clientID) } return -1, nil } func (m *MockOAuthDatastore) CreateUser(cfg *config.Config, u *User, username, description string) error { if m.DoCreateUser != nil { return m.DoCreateUser(cfg, u, username) } u.ID = 1 return nil } func (m *MockOAuthDatastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error { if m.DoRecordRemoteUserID != nil { return m.DoRecordRemoteUserID(ctx, localUserID, remoteUserID, provider, clientID, accessToken) } return nil } func (m *MockOAuthDatastore) GetUserByID(userID int64) (*User, error) { if m.DoGetUserByID != nil { return m.DoGetUserByID(userID) } user := &User{} return user, nil } func (m *MockOAuthDatastore) GenerateOAuthState(ctx context.Context, provider string, clientID string, attachUserID int64, inviteCode string) (string, error) { if m.DoGenerateOAuthState != nil { return m.DoGenerateOAuthState(ctx, provider, clientID, attachUserID, inviteCode) } return id.Generate62RandomString(14), nil } func TestViewOauthInit(t *testing.T) { t.Run("success", func(t *testing.T) { app := &MockOAuthDatastoreProvider{} h := oauthHandler{ Config: app.Config(), DB: app.DB(), Store: app.SessionStore(), EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd}, oauthClient: writeAsOauthClient{ ClientID: app.Config().WriteAsOauth.ClientID, ClientSecret: app.Config().WriteAsOauth.ClientSecret, ExchangeLocation: app.Config().WriteAsOauth.TokenLocation, InspectLocation: app.Config().WriteAsOauth.InspectLocation, AuthLocation: app.Config().WriteAsOauth.AuthLocation, CallbackLocation: "http://localhost/oauth/callback", HttpClient: nil, }, } req, err := http.NewRequest("GET", "/oauth/client", nil) assert.NoError(t, err) rr := httptest.NewRecorder() err = h.viewOauthInit(nil, rr, req) assert.NotNil(t, err) httpErr, ok := err.(impart.HTTPError) assert.True(t, ok) assert.Equal(t, http.StatusTemporaryRedirect, httpErr.Status) assert.NotEmpty(t, httpErr.Message) locURI, err := url.Parse(httpErr.Message) assert.NoError(t, err) assert.Equal(t, "/oauth/login", locURI.Path) assert.Equal(t, "development", locURI.Query().Get("client_id")) assert.Equal(t, "http://localhost/oauth/callback", locURI.Query().Get("redirect_uri")) assert.Equal(t, "code", locURI.Query().Get("response_type")) assert.NotEmpty(t, locURI.Query().Get("state")) }) t.Run("state failure", func(t *testing.T) { app := &MockOAuthDatastoreProvider{ DoDB: func() OAuthDatastore { return &MockOAuthDatastore{ DoGenerateOAuthState: func(ctx context.Context, provider, clientID string, attachUserID int64, inviteCode string) (string, error) { return "", fmt.Errorf("pretend unable to write state error") }, } }, } h := oauthHandler{ Config: app.Config(), DB: app.DB(), Store: app.SessionStore(), EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd}, oauthClient: writeAsOauthClient{ ClientID: app.Config().WriteAsOauth.ClientID, ClientSecret: app.Config().WriteAsOauth.ClientSecret, ExchangeLocation: app.Config().WriteAsOauth.TokenLocation, InspectLocation: app.Config().WriteAsOauth.InspectLocation, AuthLocation: app.Config().WriteAsOauth.AuthLocation, CallbackLocation: "http://localhost/oauth/callback", HttpClient: nil, }, } req, err := http.NewRequest("GET", "/oauth/client", nil) assert.NoError(t, err) rr := httptest.NewRecorder() err = h.viewOauthInit(nil, rr, req) httpErr, ok := err.(impart.HTTPError) assert.True(t, ok) assert.NotEmpty(t, httpErr.Message) assert.Equal(t, http.StatusInternalServerError, httpErr.Status) assert.Equal(t, "could not prepare oauth redirect url", httpErr.Message) }) } func TestViewOauthCallback(t *testing.T) { t.Run("success", func(t *testing.T) { app := &MockOAuthDatastoreProvider{} h := oauthHandler{ Config: app.Config(), DB: app.DB(), Store: app.SessionStore(), EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd}, oauthClient: writeAsOauthClient{ ClientID: app.Config().WriteAsOauth.ClientID, ClientSecret: app.Config().WriteAsOauth.ClientSecret, ExchangeLocation: app.Config().WriteAsOauth.TokenLocation, InspectLocation: app.Config().WriteAsOauth.InspectLocation, AuthLocation: app.Config().WriteAsOauth.AuthLocation, CallbackLocation: "http://localhost/oauth/callback", HttpClient: &MockHTTPClient{ DoDo: func(req *http.Request) (*http.Response, error) { switch req.URL.String() { case "https://write.as/oauth/token": return &http.Response{ StatusCode: 200, Body: &StringReadCloser{strings.NewReader(`{"access_token": "access_token", "expires_in": 1000, "refresh_token": "refresh_token", "token_type": "access"}`)}, }, nil case "https://write.as/oauth/inspect": return &http.Response{ StatusCode: 200, Body: &StringReadCloser{strings.NewReader(`{"client_id": "development", "user_id": "1", "expires_at": "2019-12-19T11:42:01Z", "username": "nick", "email": "nick@testing.write.as"}`)}, }, nil } return &http.Response{ StatusCode: http.StatusNotFound, }, nil }, }, }, } req, err := http.NewRequest("GET", "/oauth/callback", nil) assert.NoError(t, err) rr := httptest.NewRecorder() err = h.viewOauthCallback(&App{cfg: app.Config(), sessionStore: app.SessionStore()}, rr, req) assert.NoError(t, err) assert.Equal(t, http.StatusTemporaryRedirect, rr.Code) }) } diff --git a/ossl_legacy.cnf b/ossl_legacy.cnf new file mode 100644 index 0000000..90c36f2 --- /dev/null +++ b/ossl_legacy.cnf @@ -0,0 +1,10 @@ + +[provider_sect] +default = default_sect +legacy = legacy_sect + +[default_sect] +activate = 1 + +[legacy_sect] +activate = 1 diff --git a/pad.go b/pad.go index d150334..55dde70 100644 --- a/pad.go +++ b/pad.go @@ -1,190 +1,193 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "net/http" "strings" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/page" ) func handleViewPad(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) action := vars["action"] slug := vars["slug"] collAlias := vars["collection"] if app.cfg.App.SingleUser { // TODO: refactor all of this, especially for single-user blogs c, err := app.db.GetCollectionByID(1) if err != nil { return err } collAlias = c.Alias } appData := &struct { page.StaticPage Post *RawPost User *User Blogs *[]Collection Silenced bool Editing bool // True if we're modifying an existing post EditCollection *Collection // Collection of the post we're editing, if any }{ StaticPage: pageForReq(app, r), Post: &RawPost{Font: "norm"}, User: getUserSession(app, r), } var err error if appData.User != nil { appData.Blogs, err = app.db.GetPublishableCollections(appData.User, app.cfg.App.Host) if err != nil { log.Error("Unable to get user's blogs for Pad: %v", err) } appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID) if err != nil { + if err == ErrUserNotFound { + return err + } log.Error("Unable to get user status for Pad: %v", err) } } padTmpl := app.cfg.App.Editor if templates[padTmpl] == nil { if padTmpl != "" { log.Info("No template '%s' found. Falling back to default 'pad' template.", padTmpl) } padTmpl = "pad" } if action == "" && slug == "" { // Not editing any post; simply render the Pad if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } // Retrieve post information for editing appData.Editing = true // Make sure this isn't cached, so user doesn't accidentally lose data w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT") if slug != "" { // TODO: refactor all of this, especially for single-user blogs appData.Post = getRawCollectionPost(app, slug, collAlias) if appData.Post.OwnerID != appData.User.ID { // TODO: add ErrForbiddenEditPost message to flashes return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/edit")]} } appData.EditCollection, err = app.db.GetCollectionForPad(collAlias) if err != nil { log.Error("Unable to GetCollectionForPad: %s", err) return err } appData.EditCollection.hostName = app.cfg.App.Host } else { // Editing a floating article appData.Post = getRawPost(app, action) appData.Post.Id = action } if appData.Post.Gone { return ErrPostUnpublished } else if appData.Post.Found && (appData.Post.Title != "" || appData.Post.Content != "") { // Got the post } else if appData.Post.Found { log.Error("Found post, but other conditions failed.") return ErrPostFetchError } else { return ErrPostNotFound } if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } func handleViewMeta(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) action := vars["action"] slug := vars["slug"] collAlias := vars["collection"] appData := &struct { page.StaticPage Post *RawPost User *User EditCollection *Collection // Collection of the post we're editing, if any Flashes []string NeedsToken bool Silenced bool }{ StaticPage: pageForReq(app, r), Post: &RawPost{Font: "norm"}, User: getUserSession(app, r), } var err error appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID) if err != nil { log.Error("view meta: get user status: %v", err) return ErrInternalGeneral } if action == "" && slug == "" { return ErrPostNotFound } // Make sure this isn't cached, so user doesn't accidentally lose data w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 28 Jul 1989 12:00:00 GMT") if slug != "" { appData.Post = getRawCollectionPost(app, slug, collAlias) if appData.Post.OwnerID != appData.User.ID { // TODO: add ErrForbiddenEditPost message to flashes return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/meta")]} } if app.cfg.App.SingleUser { // TODO: optimize this query just like we do in GetCollectionForPad (?) appData.EditCollection, err = app.db.GetCollectionByID(1) } else { appData.EditCollection, err = app.db.GetCollectionForPad(collAlias) } if err != nil { return err } appData.EditCollection.hostName = app.cfg.App.Host } else { // Editing a floating article appData.Post = getRawPost(app, action) appData.Post.Id = action } appData.NeedsToken = appData.User == nil || appData.User.ID != appData.Post.OwnerID if appData.Post.Gone { return ErrPostUnpublished } else if appData.Post.Found && appData.Post.Content != "" { // Got the post } else if appData.Post.Found { return ErrPostFetchError } else { return ErrPostNotFound } appData.Flashes, _ = getSessionFlashes(app, w, r, nil) if err = templates["edit-meta"].ExecuteTemplate(w, "edit-meta", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } diff --git a/page/page.go b/page/page.go index 2cfb6cc..5ab7750 100644 --- a/page/page.go +++ b/page/page.go @@ -1,47 +1,48 @@ /* - * Copyright © 2018-2019, 2021 A Bunch Tell LLC. + * Copyright © 2018-2019, 2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // package page provides mechanisms and data for generating a WriteFreely page. package page import ( "github.com/writefreely/writefreely/config" "strings" ) type StaticPage struct { // App configuration config.AppCfg Version string HeaderNav bool + CustomCSS bool // Request values Path string Username string Values map[string]string Flashes []string CanViewReader bool IsAdmin bool CanInvite bool } // SanitizeHost alters the StaticPage to contain a real hostname. This is // especially important for the Tor hidden service, as it can be served over // proxies, messing up the apparent hostname. func (sp *StaticPage) SanitizeHost(cfg *config.Config) { if cfg.Server.HiddenHost != "" && strings.HasPrefix(sp.Host, cfg.Server.HiddenHost) { sp.Host = cfg.Server.HiddenHost } } func (sp StaticPage) OfficialVersion() string { p := strings.Split(sp.Version, "-") return p[0] } diff --git a/pages.go b/pages.go index f871882..6ebc3dc 100644 --- a/pages.go +++ b/pages.go @@ -1,164 +1,198 @@ /* - * Copyright © 2018-2019, 2021 A Bunch Tell LLC. + * Copyright © 2018-2019, 2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "github.com/writefreely/writefreely/config" "time" ) var defaultPageUpdatedTime = time.Date(2018, 11, 8, 12, 0, 0, 0, time.Local) func getAboutPage(app *App) (*instanceContent, error) { c, err := app.db.GetDynamicContent("about") if err != nil { return nil, err } if c == nil { c = &instanceContent{ ID: "about", Type: "page", Content: defaultAboutPage(app.cfg), } } if !c.Title.Valid { c.Title = defaultAboutTitle(app.cfg) } return c, nil } func defaultAboutTitle(cfg *config.Config) sql.NullString { return sql.NullString{String: "About " + cfg.App.SiteName, Valid: true} } +func getContactPage(app *App) (*instanceContent, error) { + c, err := app.db.GetDynamicContent("contact") + if err != nil { + return nil, err + } + if c == nil { + c = &instanceContent{ + ID: "contact", + Type: "page", + Content: defaultContactPage(app), + } + } + if !c.Title.Valid { + c.Title = defaultContactTitle() + } + return c, nil +} + +func defaultContactTitle() sql.NullString { + return sql.NullString{String: "Contact Us", Valid: true} +} + func getPrivacyPage(app *App) (*instanceContent, error) { c, err := app.db.GetDynamicContent("privacy") if err != nil { return nil, err } if c == nil { c = &instanceContent{ ID: "privacy", Type: "page", Content: defaultPrivacyPolicy(app.cfg), Updated: defaultPageUpdatedTime, } } if !c.Title.Valid { c.Title = defaultPrivacyTitle() } return c, nil } func defaultPrivacyTitle() sql.NullString { return sql.NullString{String: "Privacy Policy", Valid: true} } func defaultAboutPage(cfg *config.Config) string { if cfg.App.Federation { return `_` + cfg.App.SiteName + `_ is an interconnected place for you to write and publish, powered by [WriteFreely](https://writefreely.org) and ActivityPub.` } return `_` + cfg.App.SiteName + `_ is a place for you to write and publish, powered by [WriteFreely](https://writefreely.org).` } +func defaultContactPage(app *App) string { + c, err := app.db.GetCollectionByID(1) + if err != nil { + return "" + } + return `_` + app.cfg.App.SiteName + `_ is administered by: [**` + c.Alias + `**](/` + c.Alias + `/). + +Contact them at this email address: _EMAIL GOES HERE_. + +You can also reach them here...` +} + func defaultPrivacyPolicy(cfg *config.Config) string { return `[WriteFreely](https://writefreely.org), the software that powers this site, is built to enforce your right to privacy by default. It retains as little data about you as possible, not even requiring an email address to sign up. However, if you _do_ give us your email address, it is stored encrypted in our database. We salt and hash your account's password. -We store log files, or data about what happens on our servers. We also use cookies to keep you logged in to your account. +We store log files, or data about what happens on our servers. We also use cookies to keep you logged into your account. Beyond this, it's important that you trust whoever runs **` + cfg.App.SiteName + `**. Software can only do so much to protect you -- your level of privacy protections will ultimately fall on the humans that run this particular service.` } func getLandingBanner(app *App) (*instanceContent, error) { c, err := app.db.GetDynamicContent("landing-banner") if err != nil { return nil, err } if c == nil { c = &instanceContent{ ID: "landing-banner", Type: "section", Content: defaultLandingBanner(app.cfg), Updated: defaultPageUpdatedTime, } } return c, nil } func getLandingBody(app *App) (*instanceContent, error) { c, err := app.db.GetDynamicContent("landing-body") if err != nil { return nil, err } if c == nil { c = &instanceContent{ ID: "landing-body", Type: "section", Content: defaultLandingBody(app.cfg), Updated: defaultPageUpdatedTime, } } return c, nil } func defaultLandingBanner(cfg *config.Config) string { if cfg.App.Federation { return "# Start your blog in the fediverse" } return "# Start your blog" } func defaultLandingBody(cfg *config.Config) string { if cfg.App.Federation { return `## Join the Fediverse The fediverse is a large network of platforms that all speak a common language. Imagine if you could reply to Instagram posts from Twitter, or interact with your favorite Medium blogs from Facebook -- federated alternatives like [PixelFed](https://pixelfed.org), [Mastodon](https://joinmastodon.org), and WriteFreely enable you to do these types of things.
## Write More Socially WriteFreely can communicate with other federated platforms like Mastodon, so people can follow your blogs, bookmark their favorite posts, and boost them to their followers. Sign up above to create a blog and join the fediverse.` } return "" } func getReaderSection(app *App) (*instanceContent, error) { c, err := app.db.GetDynamicContent("reader") if err != nil { return nil, err } if c == nil { c = &instanceContent{ ID: "reader", Type: "section", Content: defaultReaderBanner(app.cfg), Updated: defaultPageUpdatedTime, } } if !c.Title.Valid { c.Title = defaultReaderTitle(app.cfg) } return c, nil } func defaultReaderTitle(cfg *config.Config) sql.NullString { return sql.NullString{String: "Reader", Valid: true} } func defaultReaderBanner(cfg *config.Config) string { return "Read the latest posts from " + cfg.App.SiteName + "." } diff --git a/pages/404-general.tmpl b/pages/404-general.tmpl index dfc4653..07f2549 100644 --- a/pages/404-general.tmpl +++ b/pages/404-general.tmpl @@ -1,7 +1,6 @@ {{define "head"}}Page not found — {{.SiteName}}{{end}} {{define "content"}}
-

This page is missing.

-

Are you sure it was ever here?

+

Page not found.

{{end}} diff --git a/pages/500.tmpl b/pages/500.tmpl index e148fb5..4240348 100644 --- a/pages/500.tmpl +++ b/pages/500.tmpl @@ -1,10 +1,8 @@ {{define "head"}}Server error — {{.SiteName}}{{end}} {{define "content"}}

Server error 😵

-

Please contact the human authors of this software and remind them of their many shortcomings.

-

Be gentle, though. They are fragile mortal beings.

-

Also, unlike the AI that will soon replace them, you will need to include an error log from the server in your report. (Utterly primitive, we know.)

+

There seems to be an issue with this server. Please contact the admin and let them know they'll need to fix it.

– {{.SiteName}} 🤖

{{end}} diff --git a/pages/contact.tmpl b/pages/contact.tmpl new file mode 100644 index 0000000..8dff9ae --- /dev/null +++ b/pages/contact.tmpl @@ -0,0 +1,8 @@ +{{define "head"}}{{.ContentTitle}} — {{.SiteName}} + +{{end}} +{{define "content"}}
+

{{.ContentTitle}}

+ {{.Content}} +
+{{end}} diff --git a/pages/login.tmpl b/pages/login.tmpl index f0a54eb..0fe29a1 100644 --- a/pages/login.tmpl +++ b/pages/login.tmpl @@ -1,36 +1,36 @@ {{define "head"}}Log in — {{.SiteName}} - - + + {{end}} {{define "content"}}
-

Log in to {{.SiteName}}

+

Log into {{.SiteName}}

{{if .Flashes}}
    {{range .Flashes}}
  • {{.}}
  • {{end}}
{{end}} {{template "oauth-buttons" .}} {{if not .DisablePasswordAuth}}


{{if .To}}{{end}}
{{if and (not .SingleUser) .OpenRegistration}}

{{if .Message}}{{.Message}}{{else}}No account yet? Sign up to start a blog.{{end}}

{{end}} {{end}} {{end}} diff --git a/parse/posts.go b/parse/posts.go index f660e08..6a9a910 100644 --- a/parse/posts.go +++ b/parse/posts.go @@ -1,82 +1,82 @@ /* - * Copyright © 2018-2020 A Bunch Tell LLC. + * Copyright © 2018-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // Package parse assists in the parsing of plain text posts package parse import ( "github.com/writeas/web-core/stringmanip" "regexp" "strings" ) var ( titleElementReg = regexp.MustCompile("") urlReg = regexp.MustCompile("https?://") imgReg = regexp.MustCompile(`!\[([^]]+)\]\([^)]+\)`) ) // PostLede attempts to extract the first thought of the given post, generally // contained within the first line or sentence of text. func PostLede(t string, includePunc bool) string { // Adjust where we truncate if we want to include punctuation iAdj := 0 if includePunc { iAdj = 1 } // Find lede within first line of text nl := strings.IndexRune(t, '\n') if nl > -1 { t = t[:nl] } // Strip certain HTML tags t = titleElementReg.ReplaceAllString(t, "") // Strip URL protocols t = urlReg.ReplaceAllString(t, "") // Strip image URL, leaving only alt text t = imgReg.ReplaceAllString(t, " $1 ") // Find lede within first sentence punc := strings.Index(t, ". ") if punc > -1 { t = t[:punc+iAdj] } punc = stringmanip.IndexRune(t, '。') if punc > -1 { c := []rune(t) t = string(c[:punc+iAdj]) } punc = stringmanip.IndexRune(t, '?') if punc > -1 { c := []rune(t) t = string(c[:punc+iAdj]) } return t } // TruncToWord truncates the given text to the provided limit. func TruncToWord(s string, l int) (string, bool) { truncated := false c := []rune(s) if len(c) > l { truncated = true s = string(c[:l]) spaceIdx := strings.LastIndexByte(s, ' ') if spaceIdx > -1 { s = s[:spaceIdx] } } return s, truncated } diff --git a/parse/posts_test.go b/parse/posts_test.go index 8f0d8b3..c377f57 100644 --- a/parse/posts_test.go +++ b/parse/posts_test.go @@ -1,55 +1,55 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package parse import "testing" func TestPostLede(t *testing.T) { text := map[string]string{ "早安。跨出舒適圈,才能前往": "早安。", "早安。This is my post. It is great.": "早安。", "Hello. 早安。": "Hello.", "Sup? Everyone says punctuation is punctuation.": "Sup?", "Humans are humans, and society is full of good and bad actors. Technology, at the most fundamental level, is a neutral tool that can be used by either to meet any ends. ": "Humans are humans, and society is full of good and bad actors.", `Online Domino Is Must For Everyone Do you want to understand how to play poker online?`: "Online Domino Is Must For Everyone", `おはようございます 私は日本から帰ったばかりです。`: "おはようございます", "Hello, we say, おはよう. We say \"good morning\"": "Hello, we say, おはよう.", } c := 1 for i, o := range text { if s := PostLede(i, true); s != o { t.Errorf("#%d: Got '%s' from '%s'; expected '%s'", c, s, i, o) } c++ } } func TestTruncToWord(t *testing.T) { text := map[string]string{ "Можливо, ми можемо використовувати інтернет-інструменти, щоб виготовити якийсь текст, який би міг бути і на, і в кінцевому підсумку, буде скорочено, тому що це тривало так довго.": "Можливо, ми можемо використовувати інтернет-інструменти, щоб виготовити якийсь", "早安。This is my post. It is great. It is a long post that is great that is a post that is great.": "早安。This is my post. It is great. It is a long post that is great that is a post", "Sup? Everyone says punctuation is punctuation.": "Sup? Everyone says punctuation is punctuation.", "I arrived in Japan six days ago. Tired from a 10-hour flight after a night-long layover in Calgary, I wandered wide-eyed around Narita airport looking for an ATM.": "I arrived in Japan six days ago. Tired from a 10-hour flight after a night-long", } c := 1 for i, o := range text { if s, _ := TruncToWord(i, 80); s != o { t.Errorf("#%d: Got '%s' from '%s'; expected '%s'", c, s, i, o) } c++ } } diff --git a/postrender.go b/postrender.go index 13bf02e..2156649 100644 --- a/postrender.go +++ b/postrender.go @@ -1,358 +1,363 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "bytes" "encoding/json" "fmt" "html" "html/template" "net/http" "net/url" "regexp" "strings" "unicode" "unicode/utf8" "github.com/microcosm-cc/bluemonday" stripmd "github.com/writeas/go-strip-markdown/v2" "github.com/writeas/impart" blackfriday "github.com/writeas/saturday" "github.com/writeas/web-core/log" "github.com/writeas/web-core/stringmanip" "github.com/writefreely/writefreely/config" "github.com/writefreely/writefreely/parse" ) var ( blockReg = regexp.MustCompile("<(ul|ol|blockquote)>\n") endBlockReg = regexp.MustCompile("\n") youtubeReg = regexp.MustCompile("(https?://www.youtube.com/embed/[a-zA-Z0-9\\-_]+)(\\?[^\t\n\f\r \"']+)?") titleElementReg = regexp.MustCompile("") hashtagReg = regexp.MustCompile(`{{\[\[\|\|([^|]+)\|\|\]\]}}`) markeddownReg = regexp.MustCompile("

(.+)

") mentionReg = regexp.MustCompile(`@([A-Za-z0-9._%+-]+)(@[A-Za-z0-9.-]+\.[A-Za-z]+)\b`) ) func (p *Post) handlePremiumContent(c *Collection, isOwner, postPage bool, cfg *config.Config) { if c.Monetization != "" { // User has Web Monetization enabled, so split content if it exists spl := strings.Index(p.Content, shortCodePaid) p.IsPaid = spl > -1 if postPage { // We're viewing the individual post if isOwner { p.Content = strings.Replace(p.Content, shortCodePaid, "\n\n"+`

Your subscriber content begins here.

`+"\n\n", 1) } else { if spl > -1 { p.Content = p.Content[:spl+len(shortCodePaid)] p.Content = strings.Replace(p.Content, shortCodePaid, "\n\n"+`

Continue reading with a Coil membership.

`+"\n\n", 1) } } } else { // We've viewing the post on the collection landing if spl > -1 { baseURL := c.CanonicalURL() if isOwner { baseURL = "/" + c.Alias + "/" } p.Content = p.Content[:spl+len(shortCodePaid)] p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:spl]), baseURL, cfg)) } } } } func (p *Post) formatContent(cfg *config.Config, c *Collection, isOwner bool, isPostPage bool) { baseURL := c.CanonicalURL() // TODO: redundant if !isSingleUser { baseURL = "/" + c.Alias + "/" } p.handlePremiumContent(c, isOwner, isPostPage, cfg) p.Content = strings.Replace(p.Content, "<!--paid-->", "", 1) p.HTMLTitle = template.HTML(applyBasicMarkdown([]byte(p.Title.String))) p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), baseURL, cfg)) if exc := strings.Index(string(p.Content), ""); exc > -1 { p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:exc]), baseURL, cfg)) } } func (p *PublicPost) formatContent(cfg *config.Config, isOwner bool, isPostPage bool) { p.Post.formatContent(cfg, &p.Collection.Collection, isOwner, isPostPage) } func (p *Post) augmentContent(c *Collection) { if p.PinnedPosition.Valid { // Don't augment posts that are pinned return } if strings.Index(p.Content, "") > -1 { // Don't augment posts with the special "nosig" shortcode return } // Add post signatures if c.Signature != "" { p.Content += "\n\n" + c.Signature } } func (p *PublicPost) augmentContent() { p.Post.augmentContent(&p.Collection.Collection) } func (p *PublicPost) augmentReadingDestination() { if p.IsPaid { p.HTMLContent += template.HTML("\n\n" + `

` + localStr("Read more...", p.Language.String) + ` ($)

`) } } func applyMarkdown(data []byte, baseURL string, cfg *config.Config) string { - return applyMarkdownSpecial(data, false, baseURL, cfg) + return applyMarkdownSpecial(data, baseURL, cfg, cfg.App.SingleUser) } func disableYoutubeAutoplay(outHTML string) string { for _, match := range youtubeReg.FindAllString(outHTML, -1) { u, err := url.Parse(match) if err != nil { continue } u.RawQuery = html.UnescapeString(u.RawQuery) q := u.Query() // Set Youtube autoplay url parameter, if any, to 0 if len(q["autoplay"]) == 1 { q.Set("autoplay", "0") } u.RawQuery = q.Encode() cleanURL := u.String() outHTML = strings.Replace(outHTML, match, cleanURL, 1) } return outHTML } -func applyMarkdownSpecial(data []byte, skipNoFollow bool, baseURL string, cfg *config.Config) string { +func applyMarkdownSpecial(data []byte, baseURL string, cfg *config.Config, skipNoFollow bool) string { mdExtensions := 0 | blackfriday.EXTENSION_TABLES | blackfriday.EXTENSION_FENCED_CODE | blackfriday.EXTENSION_AUTOLINK | blackfriday.EXTENSION_STRIKETHROUGH | blackfriday.EXTENSION_SPACE_HEADERS | blackfriday.EXTENSION_AUTO_HEADER_IDS htmlFlags := 0 | blackfriday.HTML_USE_SMARTYPANTS | blackfriday.HTML_SMARTYPANTS_DASHES if baseURL != "" { htmlFlags |= blackfriday.HTML_HASHTAGS } // Generate Markdown md := blackfriday.Markdown([]byte(data), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions) if baseURL != "" { // Replace special text generated by Markdown parser tagPrefix := baseURL + "tag:" if cfg.App.Chorus { tagPrefix = "/read/t/" } md = []byte(hashtagReg.ReplaceAll(md, []byte("#$1"))) handlePrefix := cfg.App.Host + "/@/" md = []byte(mentionReg.ReplaceAll(md, []byte("@$1$2"))) } // Strip out bad HTML policy := getSanitizationPolicy() policy.RequireNoFollowOnLinks(!skipNoFollow) outHTML := string(policy.SanitizeBytes(md)) // Strip newlines on certain block elements that render with them outHTML = blockReg.ReplaceAllString(outHTML, "<$1>") outHTML = endBlockReg.ReplaceAllString(outHTML, "") outHTML = disableYoutubeAutoplay(outHTML) return outHTML } func applyBasicMarkdown(data []byte) string { if len(bytes.TrimSpace(data)) == 0 { return "" } mdExtensions := 0 | blackfriday.EXTENSION_STRIKETHROUGH | blackfriday.EXTENSION_SPACE_HEADERS | blackfriday.EXTENSION_HEADER_IDS htmlFlags := 0 | blackfriday.HTML_SKIP_HTML | blackfriday.HTML_USE_SMARTYPANTS | blackfriday.HTML_SMARTYPANTS_DASHES // Generate Markdown // This passes the supplied title into blackfriday.Markdown() as an H1 header, so we only render HTML that // belongs in an H1. md := blackfriday.Markdown(append([]byte("# "), data...), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions) // Remove H1 markup md = bytes.TrimSpace(md) // blackfriday.Markdown adds a newline at the end of the

+ if len(md) == 0 { + return "" + } md = md[len("

") : len(md)-len("

")] // Strip out bad HTML policy := bluemonday.UGCPolicy() policy.AllowAttrs("class", "id").Globally() outHTML := string(policy.SanitizeBytes(md)) outHTML = markeddownReg.ReplaceAllString(outHTML, "$1") outHTML = strings.TrimRightFunc(outHTML, unicode.IsSpace) return outHTML } func postTitle(content, friendlyId string) string { const maxTitleLen = 80 content = stripHTMLWithoutEscaping(content) content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace) eol := strings.IndexRune(content, '\n') blankLine := strings.Index(content, "\n\n") if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen { return strings.TrimSpace(content[:blankLine]) } else if utf8.RuneCountInString(content) <= maxTitleLen { return content } return friendlyId } // TODO: fix duplicated code from postTitle. postTitle is a widely used func we // don't have time to investigate right now. func friendlyPostTitle(content, friendlyId string) string { const maxTitleLen = 80 content = stripHTMLWithoutEscaping(content) content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace) eol := strings.IndexRune(content, '\n') blankLine := strings.Index(content, "\n\n") if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen { return strings.TrimSpace(content[:blankLine]) } else if eol == -1 && utf8.RuneCountInString(content) <= maxTitleLen { return content } title, truncd := parse.TruncToWord(parse.PostLede(content, true), maxTitleLen) if truncd { title += "..." } return title } // Strip HTML tags with bluemonday's StrictPolicy, then unescape the HTML // entities added in by sanitizing the content. func stripHTMLWithoutEscaping(content string) string { return html.UnescapeString(bluemonday.StrictPolicy().Sanitize(content)) } func getSanitizationPolicy() *bluemonday.Policy { policy := bluemonday.UGCPolicy() policy.AllowAttrs("src", "style").OnElements("iframe", "video", "audio") policy.AllowAttrs("src", "type").OnElements("source") policy.AllowAttrs("frameborder", "width", "height").Matching(bluemonday.Integer).OnElements("iframe") policy.AllowAttrs("allowfullscreen").OnElements("iframe") policy.AllowAttrs("controls", "loop", "muted", "autoplay").OnElements("video") policy.AllowAttrs("controls", "loop", "muted", "autoplay", "preload").OnElements("audio") policy.AllowAttrs("target").OnElements("a") policy.AllowAttrs("title").OnElements("abbr") policy.AllowAttrs("style", "class", "id").Globally() + policy.AllowAttrs("alt").OnElements("img") policy.AllowElements("header", "footer") policy.AllowURLSchemes("http", "https", "mailto", "xmpp") return policy } func sanitizePost(content string) string { return strings.Replace(content, "<", "<", -1) } // postDescription generates a description based on the given post content, // title, and post ID. This doesn't consider a V2 post field, `title` when // choosing what to generate. In case a post has a title, this function will // fail, and logic should instead be implemented to skip this when there's no // title, like so: -// var desc string -// if title == "" { -// desc = postDescription(content, title, friendlyId) -// } else { -// desc = shortPostDescription(content) -// } +// +// var desc string +// if title == "" { +// desc = postDescription(content, title, friendlyId) +// } else { +// desc = shortPostDescription(content) +// } func postDescription(content, title, friendlyId string) string { maxLen := 140 if content == "" { content = "WriteFreely is a painless, simple, federated blogging platform." } else { fmtStr := "%s" truncation := 0 if utf8.RuneCountInString(content) > maxLen { // Post is longer than the max description, so let's show a better description fmtStr = "%s..." truncation = 3 } if title == friendlyId { // No specific title was found; simply truncate the post, starting at the beginning content = fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1)) } else { // There was a title, so return a real description blankLine := strings.Index(content, "\n\n") if blankLine < 0 { blankLine = 0 } truncd := stringmanip.Substring(content, blankLine, blankLine+maxLen-truncation) contentNoNL := strings.Replace(truncd, "\n", " ", -1) content = strings.TrimSpace(fmt.Sprintf(fmtStr, contentNoNL)) } } return content } func shortPostDescription(content string) string { maxLen := 140 fmtStr := "%s" truncation := 0 if utf8.RuneCountInString(content) > maxLen { // Post is longer than the max description, so let's show a better description fmtStr = "%s..." truncation = 3 } return strings.TrimSpace(fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1))) } func handleRenderMarkdown(app *App, w http.ResponseWriter, r *http.Request) error { if !IsJSON(r) { return impart.HTTPError{Status: http.StatusUnsupportedMediaType, Message: "Markdown API only supports JSON requests"} } in := struct { CollectionURL string `json:"collection_url"` RawBody string `json:"raw_body"` }{} decoder := json.NewDecoder(r.Body) err := decoder.Decode(&in) if err != nil { log.Error("Couldn't parse markdown JSON request: %v", err) return ErrBadJSON } out := struct { Body string `json:"body"` }{ Body: applyMarkdown([]byte(in.RawBody), in.CollectionURL, app.cfg), } return impart.WriteSuccess(w, out, http.StatusOK) } diff --git a/postrender_test.go b/postrender_test.go index 531c0f1..ec6bbdd 100644 --- a/postrender_test.go +++ b/postrender_test.go @@ -1,43 +1,43 @@ /* - * Copyright © 2021 A Bunch Tell LLC. + * Copyright © 2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import "testing" func TestApplyBasicMarkdown(t *testing.T) { tests := []struct { name string in string result string }{ {"empty", "", ""}, {"empty spaces", " ", ""}, {"empty tabs", "\t", ""}, {"empty newline", "\n", ""}, {"nums", "123", "123"}, {"dot", ".", "."}, {"dash", "-", "-"}, {"plain", "Hello, World!", "Hello, World!"}, {"multibyte", "こんにちは", `こんにちは`}, {"bold", "**안녕하세요**", `안녕하세요`}, {"link", "[WriteFreely](https://writefreely.org)", `WriteFreely`}, {"date", "12. April", `12. April`}, {"table", "| Hi | There |", `| Hi | There |`}, } for _, test := range tests { t.Run(test.name, func(t *testing.T) { res := applyBasicMarkdown([]byte(test.in)) if res != test.result { t.Errorf("%s: wanted %s, got %s", test.name, test.result, res) } }) } } diff --git a/posts.go b/posts.go index 21b66b9..1a44d28 100644 --- a/posts.go +++ b/posts.go @@ -1,1656 +1,1702 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "encoding/json" "fmt" + "github.com/writefreely/writefreely/spam" "html/template" "net/http" "net/url" "regexp" "strings" "time" "github.com/gorilla/mux" "github.com/guregu/null" "github.com/guregu/null/zero" "github.com/kylemcc/twitter-text-go/extract" "github.com/microcosm-cc/bluemonday" stripmd "github.com/writeas/go-strip-markdown/v2" "github.com/writeas/impart" "github.com/writeas/monday" "github.com/writeas/slug" "github.com/writeas/web-core/activitystreams" "github.com/writeas/web-core/bots" "github.com/writeas/web-core/converter" "github.com/writeas/web-core/i18n" "github.com/writeas/web-core/log" "github.com/writeas/web-core/tags" "github.com/writefreely/writefreely/page" "github.com/writefreely/writefreely/parse" ) const ( // Post ID length bounds minIDLen = 10 maxIDLen = 10 userPostIDLen = 10 postIDLen = 10 postMetaDateFormat = "2006-01-02 15:04:05" shortCodePaid = "" ) type ( AnonymousPost struct { ID string Content string HTMLContent template.HTML Font string Language string Direction string Title string GenTitle string Description string Author string Views int64 Images []string IsPlainText bool IsCode bool IsLinkable bool } AuthenticatedPost struct { ID string `json:"id" schema:"id"` Web bool `json:"web" schema:"web"` *SubmittedPost } // SubmittedPost represents a post supplied by a client for publishing or // updating. Since Title and Content can be updated to "", they are // pointers that can be easily tested to detect changes. SubmittedPost struct { Slug *string `json:"slug" schema:"slug"` Title *string `json:"title" schema:"title"` Content *string `json:"body" schema:"body"` Font string `json:"font" schema:"font"` IsRTL converter.NullJSONBool `json:"rtl" schema:"rtl"` Language converter.NullJSONString `json:"lang" schema:"lang"` Created *string `json:"created" schema:"created"` } // Post represents a post as found in the database. Post struct { ID string `db:"id" json:"id"` Slug null.String `db:"slug" json:"slug,omitempty"` Font string `db:"text_appearance" json:"appearance"` Language zero.String `db:"language" json:"language"` RTL zero.Bool `db:"rtl" json:"rtl"` Privacy int64 `db:"privacy" json:"-"` OwnerID null.Int `db:"owner_id" json:"-"` CollectionID null.Int `db:"collection_id" json:"-"` PinnedPosition null.Int `db:"pinned_position" json:"-"` Created time.Time `db:"created" json:"created"` Updated time.Time `db:"updated" json:"updated"` ViewCount int64 `db:"view_count" json:"-"` Title zero.String `db:"title" json:"title"` HTMLTitle template.HTML `db:"title" json:"-"` Content string `db:"content" json:"body"` HTMLContent template.HTML `db:"content" json:"-"` HTMLExcerpt template.HTML `db:"content" json:"-"` Tags []string `json:"tags"` Images []string `json:"images,omitempty"` IsPaid bool `json:"paid"` OwnerName string `json:"owner,omitempty"` } // PublicPost holds properties for a publicly returned post, i.e. a post in // a context where the viewer may not be the owner. As such, sensitive // metadata for the post is hidden and properties supporting the display of // the post are added. PublicPost struct { *Post IsSubdomain bool `json:"-"` IsTopLevel bool `json:"-"` DisplayDate string `json:"-"` Views int64 `json:"views"` Owner *PublicUser `json:"-"` IsOwner bool `json:"-"` URL string `json:"url,omitempty"` Collection *CollectionObj `json:"collection,omitempty"` } CollectionPostPage struct { *PublicPost page.StaticPage IsOwner bool IsPinned bool IsCustomDomain bool Monetization string + Verification string PinnedPosts *[]PublicPost IsFound bool IsAdmin bool CanInvite bool Silenced bool // Helper field for Chorus mode CollAlias string } RawPost struct { Id, Slug string Title string Content string Views int64 Font string Created time.Time Updated time.Time IsRTL sql.NullBool Language sql.NullString OwnerID int64 CollectionID sql.NullInt64 Found bool Gone bool } AnonymousAuthPost struct { ID string `json:"id"` Token string `json:"token"` } ClaimPostRequest struct { *AnonymousAuthPost CollectionAlias string `json:"collection"` CreateCollection bool `json:"create_collection"` // Generated properties Slug string `json:"-"` } ClaimPostResult struct { ID string `json:"id,omitempty"` Code int `json:"code,omitempty"` ErrorMessage string `json:"error_msg,omitempty"` Post *PublicPost `json:"post,omitempty"` } ) func (p *Post) Direction() string { if p.RTL.Valid { if p.RTL.Bool { return "rtl" } return "ltr" } return "auto" } // DisplayTitle dynamically generates a title from the Post's contents if it // doesn't already have an explicit title. func (p *Post) DisplayTitle() string { if p.Title.String != "" { return p.Title.String } t := friendlyPostTitle(p.Content, p.ID) return t } // PlainDisplayTitle dynamically generates a title from the Post's contents if it // doesn't already have an explicit title. func (p *Post) PlainDisplayTitle() string { if t := stripmd.Strip(p.DisplayTitle()); t != "" { return t } return p.ID } // FormattedDisplayTitle dynamically generates a title from the Post's contents if it // doesn't already have an explicit title. func (p *Post) FormattedDisplayTitle() template.HTML { if p.HTMLTitle != "" { return p.HTMLTitle } return template.HTML(p.DisplayTitle()) } // Summary gives a shortened summary of the post based on the post's title, // especially for display in a longer list of posts. It extracts a summary for // posts in the Title\n\nBody format, returning nothing if the entire was short // enough that the extracted title == extracted summary. func (p Post) Summary() string { if p.Content == "" { return "" } p.Content = stripHTMLWithoutEscaping(p.Content) // and Markdown p.Content = stripmd.StripOptions(p.Content, stripmd.Options{SkipImages: true}) title := p.Title.String var desc string if title == "" { // No title, so generate one title = friendlyPostTitle(p.Content, p.ID) desc = postDescription(p.Content, title, p.ID) if desc == title { return "" } return desc } return shortPostDescription(p.Content) } func (p Post) SummaryHTML() template.HTML { return template.HTML(p.Summary()) } // Excerpt shows any text that comes before a (more) tag. // TODO: use HTMLExcerpt in templates instead of this method func (p *Post) Excerpt() template.HTML { return p.HTMLExcerpt } func (p *Post) CreatedDate() string { return p.Created.Format("2006-01-02") } func (p *Post) Created8601() string { return p.Created.Format("2006-01-02T15:04:05Z") } func (p *Post) IsScheduled() bool { return p.Created.After(time.Now()) } func (p *Post) HasTag(tag string) bool { // Regexp looks for tag and has a non-capturing group at the end looking // for the end of the word. // Assisted by: https://stackoverflow.com/a/35192941/1549194 hasTag, _ := regexp.MatchString("#"+tag+`(?:[[:punct:]]|\s|\z)`, p.Content) return hasTag } func (p *Post) HasTitleLink() bool { if p.Title.String == "" { return false } hasLink, _ := regexp.MatchString(`([^!]+|^)\[.+\]\(.+\)`, p.Title.String) return hasLink } func (c CollectionPostPage) DisplayMonetization() string { if c.Collection == nil { log.Info("CollectionPostPage.DisplayMonetization: c.Collection is nil") return "" } return displayMonetization(c.Monetization, c.Collection.Alias) } func handleViewPost(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) friendlyID := vars["post"] // NOTE: until this is done better, be sure to keep this in parity with // isRaw() and viewCollectionPost() isJSON := strings.HasSuffix(friendlyID, ".json") isXML := strings.HasSuffix(friendlyID, ".xml") isCSS := strings.HasSuffix(friendlyID, ".css") isMarkdown := strings.HasSuffix(friendlyID, ".md") isRaw := strings.HasSuffix(friendlyID, ".txt") || isJSON || isXML || isCSS || isMarkdown // Display reserved page if that is requested resource if t, ok := pages[r.URL.Path[1:]+".tmpl"]; ok { return handleTemplatedPage(app, w, r, t) } else if (strings.Contains(r.URL.Path, ".") && !isRaw && !isMarkdown) || r.URL.Path == "/robots.txt" || r.URL.Path == "/manifest.json" { // Serve static file app.shttp.ServeHTTP(w, r) return nil } // Display collection if this is a collection c, _ := app.db.GetCollection(friendlyID) if c != nil { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", friendlyID)} } // Normalize the URL, redirecting user to consistent post URL if friendlyID != strings.ToLower(friendlyID) { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s", strings.ToLower(friendlyID))} } ext := "" if isRaw { parts := strings.Split(friendlyID, ".") friendlyID = parts[0] if len(parts) > 1 { ext = "." + parts[1] } } var ownerID sql.NullInt64 var collectionID sql.NullInt64 var title string var content string var font string var language []byte var rtl []byte var views int64 var post *AnonymousPost var found bool var gone bool fixedID := slug.Make(friendlyID) if fixedID != friendlyID { return impart.HTTPError{http.StatusFound, fmt.Sprintf("/%s%s", fixedID, ext)} } - err := app.db.QueryRow(fmt.Sprintf("SELECT owner_id, collection_id, title, content, text_appearance, view_count, language, rtl FROM posts WHERE id = ?"), friendlyID).Scan(&ownerID, &collectionID, &title, &content, &font, &views, &language, &rtl) + err := app.db.QueryRow("SELECT owner_id, collection_id, title, content, text_appearance, view_count, language, rtl FROM posts WHERE id = ?", friendlyID).Scan(&ownerID, &collectionID, &title, &content, &font, &views, &language, &rtl) switch { case err == sql.ErrNoRows: found = false // Output the error in the correct format if isJSON { content = "{\"error\": \"Post not found.\"}" } else if isRaw { content = "Post not found." } else { return ErrPostNotFound } case err != nil: found = false log.Error("Post loading err: %s\n", err) return ErrInternalGeneral default: found = true var d string if len(rtl) == 0 { d = "auto" } else if rtl[0] == 49 { // TODO: find a cleaner way to get this (possibly NULL) value d = "rtl" } else { d = "ltr" } generatedTitle := friendlyPostTitle(content, friendlyID) sanitizedContent := content if font != "code" { sanitizedContent = template.HTMLEscapeString(content) } var desc string if title == "" { desc = postDescription(content, title, friendlyID) } else { desc = shortPostDescription(content) } post = &AnonymousPost{ ID: friendlyID, Content: sanitizedContent, Title: title, GenTitle: generatedTitle, Description: desc, Author: "", Font: font, IsPlainText: isRaw, IsCode: font == "code", IsLinkable: font != "code", Views: views, Language: string(language), Direction: d, } if !isRaw { post.HTMLContent = template.HTML(applyMarkdown([]byte(content), "", app.cfg)) post.Images = extractImages(post.Content) } } var silenced bool if found { silenced, err = app.db.IsUserSilenced(ownerID.Int64) if err != nil { log.Error("view post: %v", err) } } var protectDraft bool if found && collectionID.Valid { collection, err := app.db.GetCollectionByID(collectionID.Int64) if err != nil { log.Error("view post: %v", err) } protectDraft = (collection.IsPrivate() || collection.IsProtected()) } else { protectDraft = true } // Check if post has been unpublished if title == "" && content == "" { gone = true if isJSON { content = "{\"error\": \"Post was unpublished.\"}" } else if isCSS { content = "" } else if isRaw { content = "Post was unpublished." } else { return ErrPostUnpublished } } var u = &User{} if isRaw { contentType := "text/plain" if isJSON { contentType = "application/json" } else if isCSS { contentType = "text/css" } else if isXML { contentType = "application/xml" } else if isMarkdown { contentType = "text/markdown" } w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType)) if isMarkdown && post.Title != "" { fmt.Fprintf(w, "%s\n", post.Title) for i := 1; i <= len(post.Title); i++ { fmt.Fprintf(w, "=") } fmt.Fprintf(w, "\n\n") } fmt.Fprint(w, content) if !found { return ErrPostNotFound } else if gone { return ErrPostUnpublished } } else { var err error page := struct { *AnonymousPost page.StaticPage Username string IsOwner bool SiteURL string Silenced bool }{ AnonymousPost: post, StaticPage: pageForReq(app, r), SiteURL: app.cfg.App.Host, } if u = getUserSession(app, r); u != nil { page.Username = u.Username page.IsOwner = ownerID.Valid && ownerID.Int64 == u.ID } if !page.IsOwner && silenced { return ErrPostNotFound } if !page.IsOwner && protectDraft { return ErrPostNotFound } page.Silenced = silenced err = templates["post"].ExecuteTemplate(w, "post", page) if err != nil { log.Error("Post template execute error: %v", err) } } go func() { if u != nil && ownerID.Valid && ownerID.Int64 == u.ID { // Post is owned by someone; skip view increment since that person is viewing this post. return } // Update stats for non-raw post views if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) { _, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE id = ?", friendlyID) if err != nil { log.Error("Unable to update posts count: %v", err) } } }() return nil } // API v2 funcs // newPost creates a new post with or without an owning Collection. // // Endpoints: -// /posts -// /posts?collection={alias} -// ? /collections/{alias}/posts +// - /posts +// - /posts?collection={alias} +// - ? /collections/{alias}/posts func newPost(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) vars := mux.Vars(r) collAlias := vars["alias"] if collAlias == "" { collAlias = r.FormValue("collection") } accessToken := r.Header.Get("Authorization") if accessToken == "" { // TODO: remove this accessToken = r.FormValue("access_token") } // FIXME: determine web submission with Content-Type header var u *User var userID int64 = -1 var username string if accessToken == "" { u = getUserSession(app, r) if u != nil { userID = u.ID username = u.Username } } else { userID = app.db.GetUserID(accessToken) } silenced, err := app.db.IsUserSilenced(userID) if err != nil { log.Error("new post: %v", err) } if silenced { return ErrUserSilenced } if userID == -1 { return ErrNotLoggedIn } if accessToken == "" && u == nil && collAlias != "" { return impart.HTTPError{http.StatusBadRequest, "Parameter `access_token` required."} } // Get post data var p *SubmittedPost if reqJSON { decoder := json.NewDecoder(r.Body) err = decoder.Decode(&p) if err != nil { log.Error("Couldn't parse new post JSON request: %v\n", err) return ErrBadJSON } if p.Title == nil { t := "" p.Title = &t } if strings.TrimSpace(*(p.Title)) == "" && (p.Content == nil || strings.TrimSpace(*(p.Content)) == "") { return ErrNoPublishableContent } if p.Content == nil { c := "" p.Content = &c } } else { post := r.FormValue("body") appearance := r.FormValue("font") title := r.FormValue("title") rtlValue := r.FormValue("rtl") langValue := r.FormValue("lang") if strings.TrimSpace(post) == "" { return ErrNoPublishableContent } var isRTL, rtlValid bool if rtlValue == "auto" && langValue != "" { isRTL = i18n.LangIsRTL(langValue) rtlValid = true } else { isRTL = rtlValue == "true" rtlValid = rtlValue != "" && langValue != "" } // Create a new post p = &SubmittedPost{ Title: &title, Content: &post, Font: appearance, IsRTL: converter.NullJSONBool{sql.NullBool{Bool: isRTL, Valid: rtlValid}}, Language: converter.NullJSONString{sql.NullString{String: langValue, Valid: langValue != ""}}, } } if !p.isFontValid() { p.Font = "norm" } var newPost *PublicPost = &PublicPost{} var coll *Collection if accessToken != "" { newPost, err = app.db.CreateOwnedPost(p, accessToken, collAlias, app.cfg.App.Host) } else { //return ErrNotLoggedIn // TODO: verify user is logged in var collID int64 if collAlias != "" { coll, err = app.db.GetCollection(collAlias) if err != nil { return err } coll.hostName = app.cfg.App.Host if coll.OwnerID != u.ID { return ErrForbiddenCollection } collID = coll.ID } // TODO: return PublicPost from createPost newPost.Post, err = app.db.CreatePost(userID, collID, p) } if err != nil { return err } if coll != nil { coll.ForPublic() newPost.Collection = &CollectionObj{Collection: *coll} } newPost.extractData() newPost.OwnerName = username newPost.URL = newPost.CanonicalURL(app.cfg.App.Host) // Write success now response := impart.WriteSuccess(w, newPost, http.StatusCreated) - if newPost.Collection != nil && !app.cfg.App.Private && app.cfg.App.Federation && !newPost.Created.After(time.Now()) { - go federatePost(app, newPost, newPost.Collection.ID, false) + if newPost.Collection != nil { + if !app.cfg.App.Private && app.cfg.App.Federation && !newPost.Created.After(time.Now()) { + go federatePost(app, newPost, newPost.Collection.ID, false) + } + if app.cfg.Email.Enabled() && newPost.Collection.EmailSubsEnabled() { + go app.db.InsertJob(&PostJob{ + PostID: newPost.ID, + Action: "email", + Delay: emailSendDelay, + }) + } } return response } func existingPost(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) vars := mux.Vars(r) postID := vars["post"] p := AuthenticatedPost{ID: postID} var err error if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err = decoder.Decode(&p) if err != nil { log.Error("Couldn't parse post update JSON request: %v\n", err) return ErrBadJSON } } else { err = r.ParseForm() if err != nil { log.Error("Couldn't parse post update form request: %v\n", err) return ErrBadFormData } // Can't decode to a nil SubmittedPost property, so create instance now p.SubmittedPost = &SubmittedPost{} err = app.formDecoder.Decode(&p, r.PostForm) if err != nil { log.Error("Couldn't decode post update form request: %v\n", err) return ErrBadFormData } } if p.Web { p.IsRTL.Valid = true } if p.SubmittedPost == nil { return ErrPostNoUpdatableVals } // Ensure an access token was given accessToken := r.Header.Get("Authorization") // Get user's cookie session if there's no token var u *User //var username string if accessToken == "" { u = getUserSession(app, r) if u != nil { //username = u.Username } } if u == nil && accessToken == "" { return ErrNoAccessToken } // Get user ID from current session or given access token, if one was given. var userID int64 if u != nil { userID = u.ID } else if accessToken != "" { userID, err = AuthenticateUser(app.db, accessToken) if err != nil { return err } } silenced, err := app.db.IsUserSilenced(userID) if err != nil { log.Error("existing post: %v", err) } if silenced { return ErrUserSilenced } // Modify post struct p.ID = postID err = app.db.UpdateOwnedPost(&p, userID) if err != nil { if reqJSON { return err } if err, ok := err.(impart.HTTPError); ok { addSessionFlash(app, w, r, err.Message, nil) } else { addSessionFlash(app, w, r, err.Error(), nil) } } var pRes *PublicPost pRes, err = app.db.GetPost(p.ID, 0) if reqJSON { if err != nil { return err } pRes.extractData() } if pRes.CollectionID.Valid { coll, err := app.db.GetCollectionBy("id = ?", pRes.CollectionID.Int64) if err == nil && !app.cfg.App.Private && app.cfg.App.Federation { coll.hostName = app.cfg.App.Host pRes.Collection = &CollectionObj{Collection: *coll} go federatePost(app, pRes, pRes.Collection.ID, true) } } // Write success now if reqJSON { return impart.WriteSuccess(w, pRes, http.StatusOK) } addSessionFlash(app, w, r, "Changes saved.", nil) collectionAlias := vars["alias"] redirect := "/" + postID + "/meta" if collectionAlias != "" { collPre := "/" + collectionAlias if app.cfg.App.SingleUser { collPre = "" } redirect = collPre + "/" + pRes.Slug.String + "/edit/meta" } else { if app.cfg.App.SingleUser { redirect = "/d" + redirect } } w.Header().Set("Location", redirect) w.WriteHeader(http.StatusFound) return nil } func deletePost(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) friendlyID := vars["post"] editToken := r.FormValue("token") var ownerID int64 var u *User accessToken := r.Header.Get("Authorization") if accessToken == "" && editToken == "" { u = getUserSession(app, r) if u == nil { return ErrNoAccessToken } } var res sql.Result var t *sql.Tx var err error var collID sql.NullInt64 var coll *Collection var pp *PublicPost if editToken != "" { // TODO: SELECT owner_id, as well, and return appropriate error if NULL instead of running two queries var dummy int64 err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ?", friendlyID).Scan(&dummy) switch { case err == sql.ErrNoRows: return impart.HTTPError{http.StatusNotFound, "Post not found."} } err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND owner_id IS NULL", friendlyID).Scan(&dummy) switch { case err == sql.ErrNoRows: // Post already has an owner. This could provide a bad experience // for the user, but it's more important to ensure data isn't lost // unexpectedly. So prevent deletion via token. return impart.HTTPError{http.StatusConflict, "This post belongs to some user (hopefully yours). Please log in and delete it from that user's account."} } res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND modify_token = ? AND owner_id IS NULL", friendlyID, editToken) } else if accessToken != "" || u != nil { // Caller provided some way to authenticate; assume caller expects the // post to be deleted based on a specific post owner, thus we should // return corresponding errors. if accessToken != "" { ownerID = app.db.GetUserID(accessToken) if ownerID == -1 { return ErrBadAccessToken } } else { ownerID = u.ID } // TODO: don't make two queries var realOwnerID sql.NullInt64 err = app.db.QueryRow("SELECT collection_id, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&collID, &realOwnerID) if err != nil { return err } if !collID.Valid { // There's no collection; simply delete the post res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID) } else { // Post belongs to a collection; do any additional clean up coll, err = app.db.GetCollectionBy("id = ?", collID.Int64) if err != nil { log.Error("Unable to get collection: %v", err) return err } if app.cfg.App.Federation { // First fetch full post for federation pp, err = app.db.GetOwnedPost(friendlyID, ownerID) if err != nil { log.Error("Unable to get owned post: %v", err) return err } collObj := &CollectionObj{Collection: *coll} pp.Collection = collObj } t, err = app.db.Begin() if err != nil { log.Error("No begin: %v", err) return err } res, err = t.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID) } } else { return impart.HTTPError{http.StatusBadRequest, "No authenticated user or post token given."} } if err != nil { return err } affected, err := res.RowsAffected() if err != nil { if t != nil { t.Rollback() log.Error("Rows affected err! Rolling back") } return err } else if affected == 0 { if t != nil { t.Rollback() log.Error("No rows affected! Rolling back") } return impart.HTTPError{http.StatusForbidden, "Post not found, or you're not the owner."} } if t != nil { t.Commit() } if coll != nil && !app.cfg.App.Private && app.cfg.App.Federation { go deleteFederatedPost(app, pp, collID.Int64) } return impart.HTTPError{Status: http.StatusNoContent} } // addPost associates a post with the authenticated user. func addPost(app *App, w http.ResponseWriter, r *http.Request) error { var ownerID int64 // Authenticate user at := r.Header.Get("Authorization") if at != "" { ownerID = app.db.GetUserID(at) if ownerID == -1 { return ErrBadAccessToken } } else { u := getUserSession(app, r) if u == nil { return ErrNotLoggedIn } ownerID = u.ID } silenced, err := app.db.IsUserSilenced(ownerID) if err != nil { log.Error("add post: %v", err) } if silenced { return ErrUserSilenced } // Parse claimed posts in format: // [{"id": "...", "token": "..."}] var claims *[]ClaimPostRequest decoder := json.NewDecoder(r.Body) err = decoder.Decode(&claims) if err != nil { return ErrBadJSONArray } vars := mux.Vars(r) collAlias := vars["alias"] // Update all given posts res, err := app.db.ClaimPosts(app.cfg, ownerID, collAlias, claims) if err != nil { return err } - if !app.cfg.App.Private && app.cfg.App.Federation { - for _, pRes := range *res { - if pRes.Code != http.StatusOK { - continue - } + for _, pRes := range *res { + if pRes.Code != http.StatusOK { + continue + } + if !app.cfg.App.Private && app.cfg.App.Federation { if !pRes.Post.Created.After(time.Now()) { pRes.Post.Collection.hostName = app.cfg.App.Host go federatePost(app, pRes.Post, pRes.Post.Collection.ID, false) } } + if app.cfg.Email.Enabled() && pRes.Post.Collection.EmailSubsEnabled() { + go app.db.InsertJob(&PostJob{ + PostID: pRes.Post.ID, + Action: "email", + Delay: emailSendDelay, + }) + } } return impart.WriteSuccess(w, res, http.StatusOK) } func dispersePost(app *App, w http.ResponseWriter, r *http.Request) error { var ownerID int64 // Authenticate user at := r.Header.Get("Authorization") if at != "" { ownerID = app.db.GetUserID(at) if ownerID == -1 { return ErrBadAccessToken } } else { u := getUserSession(app, r) if u == nil { return ErrNotLoggedIn } ownerID = u.ID } // Parse posts in format: // ["..."] var postIDs []string decoder := json.NewDecoder(r.Body) err := decoder.Decode(&postIDs) if err != nil { return ErrBadJSONArray } // Update all given posts res, err := app.db.DispersePosts(ownerID, postIDs) if err != nil { return err } return impart.WriteSuccess(w, res, http.StatusOK) } type ( PinPostResult struct { ID string `json:"id,omitempty"` Code int `json:"code,omitempty"` ErrorMessage string `json:"error_msg,omitempty"` } ) // pinPost pins a post to a blog func pinPost(app *App, w http.ResponseWriter, r *http.Request) error { var userID int64 // Authenticate user at := r.Header.Get("Authorization") if at != "" { userID = app.db.GetUserID(at) if userID == -1 { return ErrBadAccessToken } } else { u := getUserSession(app, r) if u == nil { return ErrNotLoggedIn } userID = u.ID } silenced, err := app.db.IsUserSilenced(userID) if err != nil { log.Error("pin post: %v", err) } if silenced { return ErrUserSilenced } // Parse request var posts []struct { ID string `json:"id"` Position int64 `json:"position"` } decoder := json.NewDecoder(r.Body) err = decoder.Decode(&posts) if err != nil { return ErrBadJSONArray } // Validate data vars := mux.Vars(r) collAlias := vars["alias"] coll, err := app.db.GetCollection(collAlias) if err != nil { return err } if coll.OwnerID != userID { return ErrForbiddenCollection } // Do (un)pinning isPinning := r.URL.Path[strings.LastIndex(r.URL.Path, "/"):] == "/pin" res := []PinPostResult{} for _, p := range posts { err = app.db.UpdatePostPinState(isPinning, p.ID, coll.ID, userID, p.Position) ppr := PinPostResult{ID: p.ID} if err != nil { ppr.Code = http.StatusInternalServerError - // TODO: set error messsage + // TODO: set error message } else { ppr.Code = http.StatusOK } res = append(res, ppr) } return impart.WriteSuccess(w, res, http.StatusOK) } func fetchPost(app *App, w http.ResponseWriter, r *http.Request) error { var collID int64 var coll *Collection var err error vars := mux.Vars(r) if collAlias := vars["alias"]; collAlias != "" { // Fetch collection information, since an alias is provided coll, err = app.db.GetCollection(collAlias) if err != nil { return err } collID = coll.ID } p, err := app.db.GetPost(vars["post"], collID) if err != nil { return err } if coll == nil && p.CollectionID.Valid { // Collection post is getting fetched by post ID, not coll alias + post slug, so get coll info now. coll, err = app.db.GetCollectionByID(p.CollectionID.Int64) if err != nil { return err } } if coll != nil { coll.hostName = app.cfg.App.Host _, err = apiCheckCollectionPermissions(app, r, coll) if err != nil { return err } } silenced, err := app.db.IsUserSilenced(p.OwnerID.Int64) if err != nil { log.Error("fetch post: %v", err) } if silenced { return ErrPostNotFound } p.extractData() - accept := r.Header.Get("Accept") - if strings.Contains(accept, "application/activity+json") { + if IsActivityPubRequest(r) { if coll == nil { // This is a draft post; 404 for now // TODO: return ActivityObject return impart.HTTPError{http.StatusNotFound, ""} } p.Collection = &CollectionObj{Collection: *coll} po := p.ActivityObject(app) po.Context = []interface{}{activitystreams.Namespace} setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, po, http.StatusOK) } return impart.WriteSuccess(w, p, http.StatusOK) } func fetchPostProperty(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) p, err := app.db.GetPostProperty(vars["post"], 0, vars["property"]) if err != nil { return err } return impart.WriteSuccess(w, p, http.StatusOK) } func (p *Post) processPost() PublicPost { res := &PublicPost{Post: p, Views: 0} res.Views = p.ViewCount // TODO: move to own function loc := monday.FuzzyLocale(p.Language.String) res.DisplayDate = monday.Format(p.Created, monday.LongFormatsByLocale[loc], loc) return *res } func (p *PublicPost) CanonicalURL(hostName string) string { if p.Collection == nil || p.Collection.Alias == "" { return hostName + "/" + p.ID + ".md" } return p.Collection.CanonicalURL() + p.Slug.String } +func (pp *PublicPost) DisplayCanonicalURL() string { + us := pp.CanonicalURL(pp.Collection.hostName) + u, err := url.Parse(us) + if err != nil { + return us + } + return u.Hostname() + u.Path +} + func (p *PublicPost) ActivityObject(app *App) *activitystreams.Object { cfg := app.cfg var o *activitystreams.Object if cfg.App.NotesOnly || strings.Index(p.Content, "\n\n") == -1 { o = activitystreams.NewNoteObject() } else { o = activitystreams.NewArticleObject() } o.ID = p.Collection.FederatedAPIBase() + "api/posts/" + p.ID o.Published = p.Created o.URL = p.CanonicalURL(cfg.App.Host) o.AttributedTo = p.Collection.FederatedAccount() o.CC = []string{ p.Collection.FederatedAccount() + "/followers", } o.Name = p.DisplayTitle() p.augmentContent() if p.HTMLContent == template.HTML("") { p.formatContent(cfg, false, false) p.augmentReadingDestination() } o.Content = string(p.HTMLContent) if p.Language.Valid { o.ContentMap = map[string]string{ p.Language.String: string(p.HTMLContent), } } if len(p.Tags) == 0 { o.Tag = []activitystreams.Tag{} } else { var tagBaseURL string if isSingleUser { tagBaseURL = p.Collection.CanonicalURL() + "tag:" } else { if cfg.App.Chorus { tagBaseURL = fmt.Sprintf("%s/read/t/", p.Collection.hostName) } else { tagBaseURL = fmt.Sprintf("%s/%s/tag:", p.Collection.hostName, p.Collection.Alias) } } for _, t := range p.Tags { o.Tag = append(o.Tag, activitystreams.Tag{ Type: activitystreams.TagHashtag, HRef: tagBaseURL + t, Name: "#" + t, }) } } if len(p.Images) > 0 { for _, i := range p.Images { o.Attachment = append(o.Attachment, activitystreams.NewImageAttachment(i)) } } // Find mentioned users mentionedUsers := make(map[string]string) stripper := bluemonday.StrictPolicy() content := stripper.Sanitize(p.Content) mentions := mentionReg.FindAllString(content, -1) for _, handle := range mentions { actorIRI, err := app.db.GetProfilePageFromHandle(app, handle) if err != nil { log.Info("Couldn't find user '%s' locally or remotely", handle) continue } mentionedUsers[handle] = actorIRI } for handle, iri := range mentionedUsers { o.CC = append(o.CC, iri) o.Tag = append(o.Tag, activitystreams.Tag{Type: "Mention", HRef: iri, Name: handle}) } return o } // TODO: merge this into getSlugFromPost or phase it out func getSlug(title, lang string) string { return getSlugFromPost("", title, lang) } func getSlugFromPost(title, body, lang string) string { if title == "" { + // Remove Markdown, so e.g. link URLs and image alt text don't make it into the slug + body = strings.TrimSpace(stripmd.StripOptions(body, stripmd.Options{SkipImages: true})) title = postTitle(body, body) } title = parse.PostLede(title, false) // Truncate lede if needed title, _ = parse.TruncToWord(title, 80) var s string if lang != "" && len(lang) == 2 { s = slug.MakeLang(title, lang) } else { s = slug.Make(title) } // Transliteration may cause the slug to expand past the limit, so truncate again s, _ = parse.TruncToWord(s, 80) return strings.TrimFunc(s, func(r rune) bool { // TruncToWord doesn't respect words in a slug, since spaces are replaced // with hyphens. So remove any trailing hyphens. return r == '-' }) } // isFontValid returns whether or not the submitted post's appearance is valid. func (p *SubmittedPost) isFontValid() bool { validFonts := map[string]bool{ "norm": true, "sans": true, "mono": true, "wrap": true, "code": true, } _, valid := validFonts[p.Font] return valid } func getRawPost(app *App, friendlyID string) *RawPost { var content, font, title string var isRTL sql.NullBool var lang sql.NullString var ownerID sql.NullInt64 var created, updated time.Time err := app.db.QueryRow("SELECT title, content, text_appearance, language, rtl, created, updated, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&title, &content, &font, &lang, &isRTL, &created, &updated, &ownerID) switch { case err == sql.ErrNoRows: return &RawPost{Content: "", Found: false, Gone: false} case err != nil: log.Error("Unable to fetch getRawPost: %s", err) return &RawPost{Content: "", Found: true, Gone: false} } return &RawPost{ Title: title, Content: content, Font: font, Created: created, Updated: updated, IsRTL: isRTL, Language: lang, OwnerID: ownerID.Int64, Found: true, Gone: content == "" && title == "", } } // TODO; return a Post! func getRawCollectionPost(app *App, slug, collAlias string) *RawPost { var id, title, content, font string var isRTL sql.NullBool var lang sql.NullString var created, updated time.Time var ownerID null.Int var views int64 var err error if app.cfg.App.SingleUser { err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = 1", slug).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID) } else { err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = (SELECT id FROM collections WHERE alias = ?)", slug, collAlias).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID) } switch { case err == sql.ErrNoRows: return &RawPost{Content: "", Found: false, Gone: false} case err != nil: log.Error("Unable to fetch getRawCollectionPost: %s", err) return &RawPost{Content: "", Found: true, Gone: false} } return &RawPost{ Id: id, Slug: slug, Title: title, Content: content, Font: font, Created: created, Updated: updated, IsRTL: isRTL, Language: lang, OwnerID: ownerID.Int64, Found: true, Gone: content == "" && title == "", Views: views, } } func isRaw(r *http.Request) bool { vars := mux.Vars(r) slug := vars["slug"] // NOTE: until this is done better, be sure to keep this in parity with // isRaw in viewCollectionPost() and handleViewPost() isJSON := strings.HasSuffix(slug, ".json") isXML := strings.HasSuffix(slug, ".xml") isMarkdown := strings.HasSuffix(slug, ".md") return strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown } func viewCollectionPost(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] // NOTE: until this is done better, be sure to keep this in parity with // isRaw() and handleViewPost() isJSON := strings.HasSuffix(slug, ".json") isXML := strings.HasSuffix(slug, ".xml") isMarkdown := strings.HasSuffix(slug, ".md") isRaw := strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } // Check for hellbanned users u, err := checkUserForCollection(app, cr, r, true) if err != nil { return err } // Normalize the URL, redirecting user to consistent post URL if slug != strings.ToLower(slug) { loc := fmt.Sprintf("/%s", strings.ToLower(slug)) if !app.cfg.App.SingleUser { loc = "/" + cr.alias + loc } return impart.HTTPError{http.StatusMovedPermanently, loc} } // Display collection if this is a collection var c *Collection if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(cr.alias) } if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { // Redirect if necessary newAlias := app.db.GetCollectionRedirect(cr.alias) if newAlias != "" { return impart.HTTPError{http.StatusFound, "/" + newAlias + "/" + slug} } } } return err } c.hostName = app.cfg.App.Host silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("view collection post: %v", err) } // Check collection permissions if c.IsPrivate() && (u == nil || u.ID != c.OwnerID) { return ErrPostNotFound } if c.IsProtected() && (u == nil || u.ID != c.OwnerID) { if silenced { return ErrPostNotFound } else if !isAuthorizedForCollection(app, c.Alias, r) { return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/?g=" + slug} } } cr.isCollOwner = u != nil && c.OwnerID == u.ID if isRaw { slug = strings.Split(slug, ".")[0] } // Fetch extra data about the Collection // TODO: refactor out this logic, shared in collection.go:fetchCollection() coll := NewCollectionObj(c) owner, err := app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } else { coll.Owner = owner } postFound := true p, err := app.db.GetPost(slug, coll.ID) if err != nil { if err == ErrCollectionPageNotFound { postFound = false if slug == "feed" { // User tried to access blog feed without a trailing slash, and // there's no post with a slug "feed" return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "feed/"} } po := &Post{ Slug: null.NewString(slug, true), Font: "norm", Language: zero.NewString("en", true), RTL: zero.NewBool(false, true), Content: `

This page is missing.

Are you sure it was ever here?`, } pp := po.processPost() p = &pp } else { return err } } // Check if the authenticated user is the post owner p.IsOwner = u != nil && u.ID == p.OwnerID.Int64 p.Collection = coll p.IsTopLevel = app.cfg.App.SingleUser // Only allow a post owner or admin to view a post for silenced collections if silenced && !p.IsOwner && (u == nil || !u.IsAdmin()) { return ErrPostNotFound } // Check if post has been unpublished if p.Content == "" && p.Title.String == "" { return impart.HTTPError{http.StatusGone, "Post was unpublished."} } p.augmentContent() // Serve collection post if isRaw { contentType := "text/plain" if isJSON { contentType = "application/json" } else if isXML { contentType = "application/xml" } else if isMarkdown { contentType = "text/markdown" } w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType)) if !postFound { w.WriteHeader(http.StatusNotFound) fmt.Fprintf(w, "Post not found.") // TODO: return error instead, so status is correctly reflected in logs return nil } if isMarkdown && p.Title.String != "" { fmt.Fprintf(w, "# %s\n\n", p.Title.String) } fmt.Fprint(w, p.Content) } else if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { if !postFound { return ErrCollectionPageNotFound } p.extractData() ap := p.ActivityObject(app) ap.Context = []interface{}{activitystreams.Namespace} setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, ap, http.StatusOK) } else { p.extractData() p.Content = strings.Replace(p.Content, "", "", 1) + if app.cfg.Email.Enabled() && c.EmailSubsEnabled() { + // TODO: indicate plan is inactive or subs disabled when OWNER is viewing their own post. + if u != nil && u.IsEmailSubscriber(app, c.ID) { + p.Content = strings.Replace(p.Content, "", `

You're subscribed to email updates. Unsubscribe.

`, -1) + } else { + p.Content = strings.Replace(p.Content, "", `
`, -1) + } + } + p.Content = strings.Replace(p.Content, "<!--emailsub-->", "", 1) // TODO: move this to function p.formatContent(app.cfg, cr.isCollOwner, true) tp := CollectionPostPage{ PublicPost: p, StaticPage: pageForReq(app, r), IsOwner: cr.isCollOwner, IsCustomDomain: cr.isCustomDomain, IsFound: postFound, Silenced: silenced, CollAlias: c.Alias, } tp.IsAdmin = u != nil && u.IsAdmin() tp.CanInvite = canUserInvite(app.cfg, tp.IsAdmin) tp.PinnedPosts, _ = app.db.GetPinnedPosts(coll, p.IsOwner) tp.IsPinned = len(*tp.PinnedPosts) > 0 && PostsContains(tp.PinnedPosts, p) - tp.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer") + tp.Monetization = coll.Monetization + tp.Verification = coll.Verification if !postFound { w.WriteHeader(http.StatusNotFound) } postTmpl := "collection-post" if app.cfg.App.Chorus { postTmpl = "chorus-collection-post" } if err := templates[postTmpl].ExecuteTemplate(w, "post", tp); err != nil { log.Error("Error in %s template: %v", postTmpl, err) } } go func() { if p.OwnerID.Valid { // Post is owned by someone. Don't update stats if owner is viewing the post. if u != nil && p.OwnerID.Int64 == u.ID { return } } // Update stats for non-raw post views if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) { _, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE slug = ? AND collection_id = ?", slug, coll.ID) if err != nil { log.Error("Unable to update posts count: %v", err) } } }() return nil } // TODO: move this to utils after making it more generic func PostsContains(sl *[]PublicPost, s *PublicPost) bool { for _, e := range *sl { if e.ID == s.ID { return true } } return false } func (p *Post) extractData() { p.Tags = tags.Extract(p.Content) p.extractImages() } +func (p *Post) IsSans() bool { + return p.Font == "sans" +} + +func (p *Post) IsMonospace() bool { + return p.Font == "mono" +} + func (rp *RawPost) UserFacingCreated() string { return rp.Created.Format(postMetaDateFormat) } func (rp *RawPost) Created8601() string { return rp.Created.Format("2006-01-02T15:04:05Z") } func (rp *RawPost) Updated8601() string { if rp.Updated.IsZero() { return "" } return rp.Updated.Format("2006-01-02T15:04:05Z") } var imageURLRegex = regexp.MustCompile(`(?i)[^ ]+\.(gif|png|jpg|jpeg|image)$`) func (p *Post) extractImages() { p.Images = extractImages(p.Content) } func extractImages(content string) []string { matches := extract.ExtractUrls(content) urls := map[string]bool{} for i := range matches { uRaw := matches[i].Text // Parse the extracted text so we can examine the path u, err := url.Parse(uRaw) if err != nil { continue } // Ensure the path looks like it leads to an image file if !imageURLRegex.MatchString(u.Path) { continue } urls[uRaw] = true } resURLs := make([]string, 0) for k := range urls { resURLs = append(resURLs, k) } return resURLs } diff --git a/posts_test.go b/posts_test.go index 0c9bc95..612c178 100644 --- a/posts_test.go +++ b/posts_test.go @@ -1,45 +1,45 @@ /* - * Copyright © 2020-2021 A Bunch Tell LLC. + * Copyright © 2020-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely_test import ( "testing" "github.com/guregu/null/zero" "github.com/stretchr/testify/assert" "github.com/writefreely/writefreely" ) func TestPostSummary(t *testing.T) { testCases := map[string]struct { given writefreely.Post expected string }{ "no special chars": {givenPost("Content."), "Content."}, "HTML content": {givenPost("Content

with a

paragraph."), "Content with a paragraph."}, "content with escaped char": {givenPost("Content's all OK."), "Content's all OK."}, "multiline content": {givenPost(`Content in multiple lines.`), "Content in multiple lines."}, } for name, test := range testCases { t.Run(name, func(t *testing.T) { actual := test.given.Summary() assert.Equal(t, test.expected, actual) }) } } func givenPost(content string) writefreely.Post { return writefreely.Post{Title: zero.StringFrom("Title"), Content: content} } diff --git a/prose/markdownSerializer.js b/prose/markdownSerializer.js index 6ccf6bc..685703c 100644 --- a/prose/markdownSerializer.js +++ b/prose/markdownSerializer.js @@ -1,128 +1,128 @@ import { MarkdownSerializer } from "prosemirror-markdown"; function backticksFor(node, side) { const ticks = /`+/g; let m; let len = 0; if (node.isText) while ((m = ticks.exec(node.text))) len = Math.max(len, m[0].length); let result = len > 0 && side > 0 ? " `" : "`"; for (let i = 0; i < len; i++) result += "`"; if (len > 0 && side < 0) result += " "; return result; } function isPlainURL(link, parent, index, side) { if (link.attrs.title || !/^\w+:/.test(link.attrs.href)) return false; const content = parent.child(index + (side < 0 ? -1 : 0)); if ( !content.isText || content.text != link.attrs.href || content.marks[content.marks.length - 1] != link ) return false; if (index == (side < 0 ? 1 : parent.childCount - 1)) return true; const next = parent.child(index + (side < 0 ? -2 : 1)); return !link.isInSet(next.marks); } export const writeFreelyMarkdownSerializer = new MarkdownSerializer( { readmore(state, node) { state.write("\n"); state.closeBlock(node); }, blockquote(state, node) { state.wrapBlock("> ", null, node, () => state.renderContent(node)); }, code_block(state, node) { state.write(`\`\`\`${node.attrs.params || ""}\n`); state.text(node.textContent, false); state.ensureNewLine(); state.write("```"); state.closeBlock(node); }, heading(state, node) { state.write(`${state.repeat("#", node.attrs.level)} `); state.renderInline(node); state.closeBlock(node); }, horizontal_rule: function horizontal_rule(state, node) { state.write(node.attrs.markup || "---"); state.closeBlock(node); }, bullet_list(state, node) { node.attrs.tight = true; state.renderList(node, " ", () => `${node.attrs.bullet || "*"} `); }, ordered_list(state, node) { const start = node.attrs.order || 1; const maxW = String(start + node.childCount - 1).length; const space = state.repeat(" ", maxW + 2); state.renderList(node, space, (i) => { const nStr = String(start + i); return `${state.repeat(" ", maxW - nStr.length) + nStr}. `; }); }, list_item(state, node) { state.renderContent(node); }, paragraph(state, node) { state.renderInline(node); state.closeBlock(node); }, image(state, node) { state.write( `![${state.esc(node.attrs.alt || "")}](${state.esc(node.attrs.src)}${ node.attrs.title ? ` ${state.quote(node.attrs.title)}` : "" })` ); }, hard_break(state, node, parent, index) { for (let i = index + 1; i < parent.childCount; i += 1) if (parent.child(i).type !== node.type) { state.write("\\\n"); return; } }, text(state, node) { state.text(node.text || ""); }, }, { em: { - open: "*", - close: "*", + open: "_", + close: "_", mixable: true, expelEnclosingWhitespace: true, }, strong: { open: "**", close: "**", mixable: true, expelEnclosingWhitespace: true, }, link: { open(_state, mark, parent, index) { return isPlainURL(mark, parent, index, 1) ? "<" : "["; }, close(state, mark, parent, index) { return isPlainURL(mark, parent, index, -1) ? ">" : `](${state.esc(mark.attrs.href)}${ mark.attrs.title ? ` ${state.quote(mark.attrs.title)}` : "" })`; }, }, code: { open(_state, _mark, parent, index) { return backticksFor(parent.child(index), -1); }, close(_state, _mark, parent, index) { return backticksFor(parent.child(index - 1), 1); }, escape: false, }, } ); diff --git a/prose/package-lock.json b/prose/package-lock.json index adcd161..e82ddc6 100644 --- a/prose/package-lock.json +++ b/prose/package-lock.json @@ -1,16278 +1,16280 @@ { "name": "prose", "version": "1.0.0", "lockfileVersion": 2, "requires": true, "packages": { "": { + "name": "prose", "version": "1.0.0", "license": "ISC", "dependencies": { "babel-core": "^6.26.3", "babel-preset-es2015": "^6.24.1", "markdown-it": "^12.0.4", - "prosemirror-example-setup": "^1.1.2", + "prosemirror-example-setup": "github:writefreely/prosemirror-example-setup", "prosemirror-keymap": "^1.1.4", - "prosemirror-markdown": "github:VV-EE/prosemirror-markdown", + "prosemirror-markdown": "github:writefreely/prosemirror-markdown", "prosemirror-model": "^1.9.1", "prosemirror-state": "^1.3.2", "prosemirror-view": "^1.14.2", "webpack": "^4.42.0", "webpack-cli": "^3.3.11" }, "devDependencies": { "@babel/core": "^7.8.7", "@babel/preset-env": "^7.9.0", "babel-loader": "^8.0.6", "prettier": "^2.2.1" } }, "node_modules/@babel/code-frame": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz", "integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==", "dev": true, "dependencies": { "@babel/highlight": "^7.8.3" } }, "node_modules/@babel/compat-data": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.11.0.tgz", "integrity": "sha512-TPSvJfv73ng0pfnEOh17bYMPQbI95+nGWc71Ss4vZdRBHTDqmM9Z8ZV4rYz8Ks7sfzc95n30k6ODIq5UGnXcYQ==", "dev": true, "dependencies": { "browserslist": "^4.12.0", "invariant": "^2.2.4", "semver": "^5.5.0" } }, "node_modules/@babel/core": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.8.7.tgz", "integrity": "sha512-rBlqF3Yko9cynC5CCFy6+K/w2N+Sq/ff2BPy+Krp7rHlABIr5epbA7OxVeKoMHB39LZOp1UY5SuLjy6uWi35yA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.8.3", "@babel/generator": "^7.8.7", "@babel/helpers": "^7.8.4", "@babel/parser": "^7.8.7", "@babel/template": "^7.8.6", "@babel/traverse": "^7.8.6", "@babel/types": "^7.8.7", "convert-source-map": "^1.7.0", "debug": "^4.1.0", "gensync": "^1.0.0-beta.1", "json5": "^2.1.0", "lodash": "^4.17.13", "resolve": "^1.3.2", "semver": "^5.4.1", "source-map": "^0.5.0" }, "engines": { "node": ">=6.9.0" } }, "node_modules/@babel/core/node_modules/debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "dependencies": { "ms": "^2.1.1" } }, "node_modules/@babel/core/node_modules/json5": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/json5/-/json5-2.1.1.tgz", "integrity": "sha512-l+3HXD0GEI3huGq1njuqtzYK8OYJyXMkOLtQ53pjWh89tvWS2h6l+1zMkYWqlb57+SiQodKZyvMEFb2X+KrFhQ==", "dev": true, "dependencies": { "minimist": "^1.2.0" }, "bin": { "json5": "lib/cli.js" }, "engines": { "node": ">=6" } }, "node_modules/@babel/core/node_modules/ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true }, "node_modules/@babel/generator": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.8.7.tgz", "integrity": "sha512-DQwjiKJqH4C3qGiyQCAExJHoZssn49JTMJgZ8SANGgVFdkupcUhLOdkAeoC6kmHZCPfoDG5M0b6cFlSN5wW7Ew==", "dev": true, "dependencies": { "@babel/types": "^7.8.7", "jsesc": "^2.5.1", "lodash": "^4.17.13", "source-map": "^0.5.0" } }, "node_modules/@babel/generator/node_modules/jsesc": { "version": "2.5.2", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", "dev": true, "bin": { "jsesc": "bin/jsesc" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-annotate-as-pure": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.10.4.tgz", "integrity": "sha512-XQlqKQP4vXFB7BN8fEEerrmYvHp3fK/rBkRFz9jaJbzK0B1DSfej9Kc7ZzE8Z/OnId1jpJdNAZ3BFQjWG68rcA==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-annotate-as-pure/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-annotate-as-pure/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-annotate-as-pure/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-builder-binary-assignment-operator-visitor": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.10.4.tgz", "integrity": "sha512-L0zGlFrGWZK4PbT8AszSfLTM5sDU1+Az/En9VrdT8/LmEiJt4zXt+Jve9DCAnQcbqDhCI+29y/L93mrDzddCcg==", "dev": true, "dependencies": { "@babel/helper-explode-assignable-expression": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-builder-binary-assignment-operator-visitor/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-builder-binary-assignment-operator-visitor/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-builder-binary-assignment-operator-visitor/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-compilation-targets": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.10.4.tgz", "integrity": "sha512-a3rYhlsGV0UHNDvrtOXBg8/OpfV0OKTkxKPzIplS1zpx7CygDcWWxckxZeDd3gzPzC4kUT0A4nVFDK0wGMh4MQ==", "dev": true, "dependencies": { "@babel/compat-data": "^7.10.4", "browserslist": "^4.12.0", "invariant": "^2.2.4", "levenary": "^1.1.1", "semver": "^5.5.0" } }, "node_modules/@babel/helper-create-class-features-plugin": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/helper-create-class-features-plugin/-/helper-create-class-features-plugin-7.10.5.tgz", "integrity": "sha512-0nkdeijB7VlZoLT3r/mY3bUkw3T8WG/hNw+FATs/6+pG2039IJWjTYL0VTISqsNHMUTEnwbVnc89WIJX9Qed0A==", "dev": true, "dependencies": { "@babel/helper-function-name": "^7.10.4", "@babel/helper-member-expression-to-functions": "^7.10.5", "@babel/helper-optimise-call-expression": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4", "@babel/helper-split-export-declaration": "^7.10.4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "dependencies": { "@babel/types": "^7.11.0" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-create-class-features-plugin/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-create-regexp-features-plugin": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-create-regexp-features-plugin/-/helper-create-regexp-features-plugin-7.10.4.tgz", "integrity": "sha512-2/hu58IEPKeoLF45DBwx3XFqsbCXmkdAay4spVr2x0jYgRxrSNp+ePwvSsy9g6YSaNDcKIQVPXk1Ov8S2edk2g==", "dev": true, "dependencies": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-regex": "^7.10.4", "regexpu-core": "^4.7.0" } }, "node_modules/@babel/helper-create-regexp-features-plugin/node_modules/jsesc": { "version": "0.5.0", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz", "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=", "dev": true, "bin": { "jsesc": "bin/jsesc" } }, "node_modules/@babel/helper-create-regexp-features-plugin/node_modules/regexpu-core": { "version": "4.7.0", "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-4.7.0.tgz", "integrity": "sha512-TQ4KXRnIn6tz6tjnrXEkD/sshygKH/j5KzK86X8MkeHyZ8qst/LZ89j3X4/8HEIfHANTFIP/AbXakeRhWIl5YQ==", "dev": true, "dependencies": { "regenerate": "^1.4.0", "regenerate-unicode-properties": "^8.2.0", "regjsgen": "^0.5.1", "regjsparser": "^0.6.4", "unicode-match-property-ecmascript": "^1.0.4", "unicode-match-property-value-ecmascript": "^1.2.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-create-regexp-features-plugin/node_modules/regjsgen": { "version": "0.5.2", "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.5.2.tgz", "integrity": "sha512-OFFT3MfrH90xIW8OOSyUrk6QHD5E9JOTeGodiJeBS3J6IwlgzJMNE/1bZklWz5oTg+9dCMyEetclvCVXOPoN3A==", "dev": true }, "node_modules/@babel/helper-create-regexp-features-plugin/node_modules/regjsparser": { "version": "0.6.4", "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.6.4.tgz", "integrity": "sha512-64O87/dPDgfk8/RQqC4gkZoGyyWFIEUTTh80CU6CWuK5vkCGyekIx+oKcEIYtP/RAxSQltCZHCNu/mdd7fqlJw==", "dev": true, "dependencies": { "jsesc": "~0.5.0" }, "bin": { "regjsparser": "bin/parser" } }, "node_modules/@babel/helper-define-map": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/helper-define-map/-/helper-define-map-7.10.5.tgz", "integrity": "sha512-fMw4kgFB720aQFXSVaXr79pjjcW5puTCM16+rECJ/plGS+zByelE8l9nCpV1GibxTnFVmUuYG9U8wYfQHdzOEQ==", "dev": true, "dependencies": { "@babel/helper-function-name": "^7.10.4", "@babel/types": "^7.10.5", "lodash": "^4.17.19" } }, "node_modules/@babel/helper-define-map/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/helper-define-map/node_modules/@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-define-map/node_modules/@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-define-map/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/helper-define-map/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/helper-define-map/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-define-map/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-define-map/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-define-map/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-define-map/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/helper-define-map/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-define-map/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-define-map/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-explode-assignable-expression": { "version": "7.11.4", "resolved": "https://registry.npmjs.org/@babel/helper-explode-assignable-expression/-/helper-explode-assignable-expression-7.11.4.tgz", "integrity": "sha512-ux9hm3zR4WV1Y3xXxXkdG/0gxF9nvI0YVmKVhvK9AfMoaQkemL3sJpXw+Xbz65azo8qJiEz2XVDUpK3KYhH3ZQ==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-explode-assignable-expression/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-explode-assignable-expression/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-explode-assignable-expression/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-function-name": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.8.3.tgz", "integrity": "sha512-BCxgX1BC2hD/oBlIFUgOCQDOPV8nSINxCwM3o93xP4P9Fq6aV5sgv2cOOITDMtCfQ+3PvHp3l689XZvAM9QyOA==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.8.3", "@babel/template": "^7.8.3", "@babel/types": "^7.8.3" } }, "node_modules/@babel/helper-get-function-arity": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.8.3.tgz", "integrity": "sha512-FVDR+Gd9iLjUMY1fzE2SR0IuaJToR4RkCDARVfsBBPSP53GEqSFjD8gNyxg246VUyc/ALRxFaAK8rVG7UT7xRA==", "dev": true, "dependencies": { "@babel/types": "^7.8.3" } }, "node_modules/@babel/helper-hoist-variables": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.10.4.tgz", "integrity": "sha512-wljroF5PgCk2juF69kanHVs6vrLwIPNp6DLD+Lrl3hoQ3PpPPikaDRNFA+0t81NOoMt2DL6WW/mdU8k4k6ZzuA==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-hoist-variables/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-hoist-variables/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-hoist-variables/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-member-expression-to-functions": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.11.0.tgz", "integrity": "sha512-JbFlKHFntRV5qKw3YC0CvQnDZ4XMwgzzBbld7Ly4Mj4cbFy3KywcR8NtNctRToMWJOVvLINJv525Gd6wwVEx/Q==", "dev": true, "dependencies": { "@babel/types": "^7.11.0" } }, "node_modules/@babel/helper-member-expression-to-functions/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-member-expression-to-functions/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-member-expression-to-functions/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-module-imports": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.10.4.tgz", "integrity": "sha512-nEQJHqYavI217oD9+s5MUBzk6x1IlvoS9WTPfgG43CbMEeStE0v+r+TucWdx8KFGowPGvyOkDT9+7DHedIDnVw==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-module-imports/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-module-imports/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-module-imports/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-module-transforms": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.11.0.tgz", "integrity": "sha512-02EVu8COMuTRO1TAzdMtpBPbe6aQ1w/8fePD2YgQmxZU4gpNWaL9gK3Jp7dxlkUlUCJOTaSeA+Hrm1BRQwqIhg==", "dev": true, "dependencies": { "@babel/helper-module-imports": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4", "@babel/helper-simple-access": "^7.10.4", "@babel/helper-split-export-declaration": "^7.11.0", "@babel/template": "^7.10.4", "@babel/types": "^7.11.0", "lodash": "^4.17.19" } }, "node_modules/@babel/helper-module-transforms/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/helper-module-transforms/node_modules/@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "dependencies": { "@babel/types": "^7.11.0" } }, "node_modules/@babel/helper-module-transforms/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/helper-module-transforms/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/helper-module-transforms/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-module-transforms/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-module-transforms/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-module-transforms/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-module-transforms/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/helper-module-transforms/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-module-transforms/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-module-transforms/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-optimise-call-expression": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.10.4.tgz", "integrity": "sha512-n3UGKY4VXwXThEiKrgRAoVPBMqeoPgHVqiHZOanAJCG9nQUL2pLRQirUzl0ioKclHGpGqRgIOkgcIJaIWLpygg==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-optimise-call-expression/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-optimise-call-expression/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-optimise-call-expression/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-plugin-utils": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.10.4.tgz", "integrity": "sha512-O4KCvQA6lLiMU9l2eawBPMf1xPP8xPfB3iEQw150hOVTqj/rfXz0ThTb4HEzqQfs2Bmo5Ay8BzxfzVtBrr9dVg==", "dev": true }, "node_modules/@babel/helper-regex": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/helper-regex/-/helper-regex-7.10.5.tgz", "integrity": "sha512-68kdUAzDrljqBrio7DYAEgCoJHxppJOERHOgOrDN7WjOzP0ZQ1LsSDRXcemzVZaLvjaJsJEESb6qt+znNuENDg==", "dev": true, "dependencies": { "lodash": "^4.17.19" } }, "node_modules/@babel/helper-regex/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-remap-async-to-generator": { "version": "7.11.4", "resolved": "https://registry.npmjs.org/@babel/helper-remap-async-to-generator/-/helper-remap-async-to-generator-7.11.4.tgz", "integrity": "sha512-tR5vJ/vBa9wFy3m5LLv2faapJLnDFxNWff2SAYkSE4rLUdbp7CdObYFgI7wK4T/Mj4UzpjPwzR8Pzmr5m7MHGA==", "dev": true, "dependencies": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-wrap-function": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-remap-async-to-generator/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-replace-supers": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.10.4.tgz", "integrity": "sha512-sPxZfFXocEymYTdVK1UNmFPBN+Hv5mJkLPsYWwGBxZAxaWfFu+xqp7b6qWD0yjNuNL2VKc6L5M18tOXUP7NU0A==", "dev": true, "dependencies": { "@babel/helper-member-expression-to-functions": "^7.10.4", "@babel/helper-optimise-call-expression": "^7.10.4", "@babel/traverse": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/generator": { "version": "7.11.6", "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz", "integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==", "dev": true, "dependencies": { "@babel/types": "^7.11.5", "jsesc": "^2.5.1", "source-map": "^0.5.0" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "dependencies": { "@babel/types": "^7.11.0" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/traverse": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz", "integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/generator": "^7.11.5", "@babel/helper-function-name": "^7.10.4", "@babel/helper-split-export-declaration": "^7.11.0", "@babel/parser": "^7.11.5", "@babel/types": "^7.11.5", "debug": "^4.1.0", "globals": "^11.1.0", "lodash": "^4.17.19" } }, "node_modules/@babel/helper-replace-supers/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-replace-supers/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-replace-supers/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-replace-supers/node_modules/debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "dependencies": { "ms": "^2.1.1" } }, "node_modules/@babel/helper-replace-supers/node_modules/globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-replace-supers/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/helper-replace-supers/node_modules/jsesc": { "version": "2.5.2", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", "dev": true, "bin": { "jsesc": "bin/jsesc" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-replace-supers/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-replace-supers/node_modules/ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true }, "node_modules/@babel/helper-replace-supers/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-replace-supers/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-simple-access": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.10.4.tgz", "integrity": "sha512-0fMy72ej/VEvF8ULmX6yb5MtHG4uH4Dbd6I/aHDb/JVg0bbivwt9Wg+h3uMvX+QSFtwr5MeItvazbrc4jtRAXw==", "dev": true, "dependencies": { "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-simple-access/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/helper-simple-access/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/helper-simple-access/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/helper-simple-access/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-simple-access/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-simple-access/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-simple-access/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-simple-access/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/helper-simple-access/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-simple-access/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-simple-access/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-skip-transparent-expression-wrappers": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.11.0.tgz", "integrity": "sha512-0XIdiQln4Elglgjbwo9wuJpL/K7AGCY26kmEt0+pRP0TAj4jjyNq1MjoRvikrTVqKcx4Gysxt4cXvVFXP/JO2Q==", "dev": true, "dependencies": { "@babel/types": "^7.11.0" } }, "node_modules/@babel/helper-skip-transparent-expression-wrappers/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-skip-transparent-expression-wrappers/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-skip-transparent-expression-wrappers/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-split-export-declaration": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.8.3.tgz", "integrity": "sha512-3x3yOeyBhW851hroze7ElzdkeRXQYQbFIb7gLK1WQYsw2GWDay5gAJNw1sWJ0VFP6z5J1whqeXH/WCdCjZv6dA==", "dev": true, "dependencies": { "@babel/types": "^7.8.3" } }, "node_modules/@babel/helper-validator-identifier": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz", "integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==", "dev": true }, "node_modules/@babel/helper-wrap-function": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-wrap-function/-/helper-wrap-function-7.10.4.tgz", "integrity": "sha512-6py45WvEF0MhiLrdxtRjKjufwLL1/ob2qDJgg5JgNdojBAZSAKnAjkyOCNug6n+OBl4VW76XjvgSFTdaMcW0Ug==", "dev": true, "dependencies": { "@babel/helper-function-name": "^7.10.4", "@babel/template": "^7.10.4", "@babel/traverse": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/generator": { "version": "7.11.6", "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz", "integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==", "dev": true, "dependencies": { "@babel/types": "^7.11.5", "jsesc": "^2.5.1", "source-map": "^0.5.0" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "dependencies": { "@babel/types": "^7.11.0" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/traverse": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz", "integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/generator": "^7.11.5", "@babel/helper-function-name": "^7.10.4", "@babel/helper-split-export-declaration": "^7.11.0", "@babel/parser": "^7.11.5", "@babel/types": "^7.11.5", "debug": "^4.1.0", "globals": "^11.1.0", "lodash": "^4.17.19" } }, "node_modules/@babel/helper-wrap-function/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/helper-wrap-function/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-wrap-function/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-wrap-function/node_modules/debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "dependencies": { "ms": "^2.1.1" } }, "node_modules/@babel/helper-wrap-function/node_modules/globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-wrap-function/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/helper-wrap-function/node_modules/jsesc": { "version": "2.5.2", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", "dev": true, "bin": { "jsesc": "bin/jsesc" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-wrap-function/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/helper-wrap-function/node_modules/ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true }, "node_modules/@babel/helper-wrap-function/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/helper-wrap-function/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/helpers": { "version": "7.8.4", "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.8.4.tgz", "integrity": "sha512-VPbe7wcQ4chu4TDQjimHv/5tj73qz88o12EPkO2ValS2QiQS/1F2SsjyIGNnAD0vF/nZS6Cf9i+vW6HIlnaR8w==", "dev": true, "dependencies": { "@babel/template": "^7.8.3", "@babel/traverse": "^7.8.4", "@babel/types": "^7.8.3" } }, "node_modules/@babel/highlight": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.8.3.tgz", "integrity": "sha512-PX4y5xQUvy0fnEVHrYOarRPXVWafSjTW9T0Hab8gVIawpl2Sj0ORyrygANq+KjcNlSSTw0YCLSNA8OyZ1I4yEg==", "dev": true, "dependencies": { "chalk": "^2.0.0", "esutils": "^2.0.2", "js-tokens": "^4.0.0" } }, "node_modules/@babel/highlight/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/highlight/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/highlight/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/highlight/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/parser": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.8.7.tgz", "integrity": "sha512-9JWls8WilDXFGxs0phaXAZgpxTZhSk/yOYH2hTHC0X1yC7Z78IJfvR1vJ+rmJKq3I35td2XzXzN6ZLYlna+r/A==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/plugin-proposal-async-generator-functions": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-async-generator-functions/-/plugin-proposal-async-generator-functions-7.10.5.tgz", "integrity": "sha512-cNMCVezQbrRGvXJwm9fu/1sJj9bHdGAgKodZdLqOQIpfoH3raqmRPBM17+lh7CzhiKRRBrGtZL9WcjxSoGYUSg==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-remap-async-to-generator": "^7.10.4", "@babel/plugin-syntax-async-generators": "^7.8.0" } }, "node_modules/@babel/plugin-proposal-class-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-class-properties/-/plugin-proposal-class-properties-7.10.4.tgz", "integrity": "sha512-vhwkEROxzcHGNu2mzUC0OFFNXdZ4M23ib8aRRcJSsW8BZK9pQMD7QB7csl97NBbgGZO7ZyHUyKDnxzOaP4IrCg==", "dev": true, "dependencies": { "@babel/helper-create-class-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-proposal-dynamic-import": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-dynamic-import/-/plugin-proposal-dynamic-import-7.10.4.tgz", "integrity": "sha512-up6oID1LeidOOASNXgv/CFbgBqTuKJ0cJjz6An5tWD+NVBNlp3VNSBxv2ZdU7SYl3NxJC7agAQDApZusV6uFwQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-dynamic-import": "^7.8.0" } }, "node_modules/@babel/plugin-proposal-export-namespace-from": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-export-namespace-from/-/plugin-proposal-export-namespace-from-7.10.4.tgz", "integrity": "sha512-aNdf0LY6/3WXkhh0Fdb6Zk9j1NMD8ovj3F6r0+3j837Pn1S1PdNtcwJ5EG9WkVPNHPxyJDaxMaAOVq4eki0qbg==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-export-namespace-from": "^7.8.3" } }, "node_modules/@babel/plugin-proposal-json-strings": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-json-strings/-/plugin-proposal-json-strings-7.10.4.tgz", "integrity": "sha512-fCL7QF0Jo83uy1K0P2YXrfX11tj3lkpN7l4dMv9Y9VkowkhkQDwFHFd8IiwyK5MZjE8UpbgokkgtcReH88Abaw==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-json-strings": "^7.8.0" } }, "node_modules/@babel/plugin-proposal-logical-assignment-operators": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-logical-assignment-operators/-/plugin-proposal-logical-assignment-operators-7.11.0.tgz", "integrity": "sha512-/f8p4z+Auz0Uaf+i8Ekf1iM7wUNLcViFUGiPxKeXvxTSl63B875YPiVdUDdem7hREcI0E0kSpEhS8tF5RphK7Q==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-logical-assignment-operators": "^7.10.4" } }, "node_modules/@babel/plugin-proposal-nullish-coalescing-operator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-nullish-coalescing-operator/-/plugin-proposal-nullish-coalescing-operator-7.10.4.tgz", "integrity": "sha512-wq5n1M3ZUlHl9sqT2ok1T2/MTt6AXE0e1Lz4WzWBr95LsAZ5qDXe4KnFuauYyEyLiohvXFMdbsOTMyLZs91Zlw==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0" } }, "node_modules/@babel/plugin-proposal-numeric-separator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-numeric-separator/-/plugin-proposal-numeric-separator-7.10.4.tgz", "integrity": "sha512-73/G7QoRoeNkLZFxsoCCvlg4ezE4eM+57PnOqgaPOozd5myfj7p0muD1mRVJvbUWbOzD+q3No2bWbaKy+DJ8DA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-numeric-separator": "^7.10.4" } }, "node_modules/@babel/plugin-proposal-object-rest-spread": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-object-rest-spread/-/plugin-proposal-object-rest-spread-7.11.0.tgz", "integrity": "sha512-wzch41N4yztwoRw0ak+37wxwJM2oiIiy6huGCoqkvSTA9acYWcPfn9Y4aJqmFFJ70KTJUu29f3DQ43uJ9HXzEA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-object-rest-spread": "^7.8.0", "@babel/plugin-transform-parameters": "^7.10.4" } }, "node_modules/@babel/plugin-proposal-optional-catch-binding": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-catch-binding/-/plugin-proposal-optional-catch-binding-7.10.4.tgz", "integrity": "sha512-LflT6nPh+GK2MnFiKDyLiqSqVHkQnVf7hdoAvyTnnKj9xB3docGRsdPuxp6qqqW19ifK3xgc9U5/FwrSaCNX5g==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-optional-catch-binding": "^7.8.0" } }, "node_modules/@babel/plugin-proposal-optional-chaining": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-chaining/-/plugin-proposal-optional-chaining-7.11.0.tgz", "integrity": "sha512-v9fZIu3Y8562RRwhm1BbMRxtqZNFmFA2EG+pT2diuU8PT3H6T/KXoZ54KgYisfOFZHV6PfvAiBIZ9Rcz+/JCxA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-skip-transparent-expression-wrappers": "^7.11.0", "@babel/plugin-syntax-optional-chaining": "^7.8.0" } }, "node_modules/@babel/plugin-proposal-private-methods": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-private-methods/-/plugin-proposal-private-methods-7.10.4.tgz", "integrity": "sha512-wh5GJleuI8k3emgTg5KkJK6kHNsGEr0uBTDBuQUBJwckk9xs1ez79ioheEVVxMLyPscB0LfkbVHslQqIzWV6Bw==", "dev": true, "dependencies": { "@babel/helper-create-class-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-proposal-unicode-property-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-unicode-property-regex/-/plugin-proposal-unicode-property-regex-7.10.4.tgz", "integrity": "sha512-H+3fOgPnEXFL9zGYtKQe4IDOPKYlZdF1kqFDQRRb8PK4B8af1vAGK04tF5iQAAsui+mHNBQSAtd2/ndEDe9wuA==", "dev": true, "dependencies": { "@babel/helper-create-regexp-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" }, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-syntax-async-generators": { "version": "7.8.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.8.4.tgz", "integrity": "sha512-tycmZxkGfZaxhMRbXlPXuVFpdWlXpir2W4AMhSJgRKzk/eDlIXOhb2LHWoLpDF7TEHylV5zNhykX6KAgHJmTNw==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.0" } }, "node_modules/@babel/plugin-syntax-class-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-class-properties/-/plugin-syntax-class-properties-7.10.4.tgz", "integrity": "sha512-GCSBF7iUle6rNugfURwNmCGG3Z/2+opxAMLs1nND4bhEG5PuxTIggDBoeYYSujAlLtsupzOHYJQgPS3pivwXIA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-syntax-dynamic-import": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-dynamic-import/-/plugin-syntax-dynamic-import-7.8.3.tgz", "integrity": "sha512-5gdGbFon+PszYzqs83S3E5mpi7/y/8M9eC90MRTZfduQOYW76ig6SOSPNe41IG5LoP3FGBn2N0RjVDSQiS94kQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.0" } }, "node_modules/@babel/plugin-syntax-export-namespace-from": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-export-namespace-from/-/plugin-syntax-export-namespace-from-7.8.3.tgz", "integrity": "sha512-MXf5laXo6c1IbEbegDmzGPwGNTsHZmEy6QGznu5Sh2UCWvueywb2ee+CCE4zQiZstxU9BMoQO9i6zUFSY0Kj0Q==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.3" } }, "node_modules/@babel/plugin-syntax-json-strings": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.8.3.tgz", "integrity": "sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.0" } }, "node_modules/@babel/plugin-syntax-logical-assignment-operators": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-logical-assignment-operators/-/plugin-syntax-logical-assignment-operators-7.10.4.tgz", "integrity": "sha512-d8waShlpFDinQ5MtvGU9xDAOzKH47+FFoney2baFIoMr952hKOLp1HR7VszoZvOsV/4+RRszNY7D17ba0te0ig==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-syntax-nullish-coalescing-operator": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-nullish-coalescing-operator/-/plugin-syntax-nullish-coalescing-operator-7.8.3.tgz", "integrity": "sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.0" } }, "node_modules/@babel/plugin-syntax-numeric-separator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-numeric-separator/-/plugin-syntax-numeric-separator-7.10.4.tgz", "integrity": "sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-syntax-object-rest-spread": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.8.3.tgz", "integrity": "sha512-XoqMijGZb9y3y2XskN+P1wUGiVwWZ5JmoDRwx5+3GmEplNyVM2s2Dg8ILFQm8rWM48orGy5YpI5Bl8U1y7ydlA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.0" } }, "node_modules/@babel/plugin-syntax-optional-catch-binding": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.8.3.tgz", "integrity": "sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.0" } }, "node_modules/@babel/plugin-syntax-optional-chaining": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-chaining/-/plugin-syntax-optional-chaining-7.8.3.tgz", "integrity": "sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.8.0" } }, "node_modules/@babel/plugin-syntax-top-level-await": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-top-level-await/-/plugin-syntax-top-level-await-7.10.4.tgz", "integrity": "sha512-ni1brg4lXEmWyafKr0ccFWkJG0CeMt4WV1oyeBW6EFObF4oOHclbkj5cARxAPQyAQ2UTuplJyK4nfkXIMMFvsQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-arrow-functions": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-arrow-functions/-/plugin-transform-arrow-functions-7.10.4.tgz", "integrity": "sha512-9J/oD1jV0ZCBcgnoFWFq1vJd4msoKb/TCpGNFyyLt0zABdcvgK3aYikZ8HjzB14c26bc7E3Q1yugpwGy2aTPNA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-async-to-generator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-async-to-generator/-/plugin-transform-async-to-generator-7.10.4.tgz", "integrity": "sha512-F6nREOan7J5UXTLsDsZG3DXmZSVofr2tGNwfdrVwkDWHfQckbQXnXSPfD7iO+c/2HGqycwyLST3DnZ16n+cBJQ==", "dev": true, "dependencies": { "@babel/helper-module-imports": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-remap-async-to-generator": "^7.10.4" } }, "node_modules/@babel/plugin-transform-block-scoped-functions": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoped-functions/-/plugin-transform-block-scoped-functions-7.10.4.tgz", "integrity": "sha512-WzXDarQXYYfjaV1szJvN3AD7rZgZzC1JtjJZ8dMHUyiK8mxPRahynp14zzNjU3VkPqPsO38CzxiWO1c9ARZ8JA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-block-scoping": { "version": "7.11.1", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoping/-/plugin-transform-block-scoping-7.11.1.tgz", "integrity": "sha512-00dYeDE0EVEHuuM+26+0w/SCL0BH2Qy7LwHuI4Hi4MH5gkC8/AqMN5uWFJIsoXZrAphiMm1iXzBw6L2T+eA0ew==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-classes": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-classes/-/plugin-transform-classes-7.10.4.tgz", "integrity": "sha512-2oZ9qLjt161dn1ZE0Ms66xBncQH4In8Sqw1YWgBUZuGVJJS5c0OFZXL6dP2MRHrkU/eKhWg8CzFJhRQl50rQxA==", "dev": true, "dependencies": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-define-map": "^7.10.4", "@babel/helper-function-name": "^7.10.4", "@babel/helper-optimise-call-expression": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4", "@babel/helper-split-export-declaration": "^7.10.4", "globals": "^11.1.0" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "dependencies": { "@babel/types": "^7.11.0" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/plugin-transform-classes/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/plugin-transform-classes/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/plugin-transform-classes/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-classes/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-computed-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-computed-properties/-/plugin-transform-computed-properties-7.10.4.tgz", "integrity": "sha512-JFwVDXcP/hM/TbyzGq3l/XWGut7p46Z3QvqFMXTfk6/09m7xZHJUN9xHfsv7vqqD4YnfI5ueYdSJtXqqBLyjBw==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-destructuring": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-destructuring/-/plugin-transform-destructuring-7.10.4.tgz", "integrity": "sha512-+WmfvyfsyF603iPa6825mq6Qrb7uLjTOsa3XOFzlYcYDHSS4QmpOWOL0NNBY5qMbvrcf3tq0Cw+v4lxswOBpgA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-dotall-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-dotall-regex/-/plugin-transform-dotall-regex-7.10.4.tgz", "integrity": "sha512-ZEAVvUTCMlMFAbASYSVQoxIbHm2OkG2MseW6bV2JjIygOjdVv8tuxrCTzj1+Rynh7ODb8GivUy7dzEXzEhuPaA==", "dev": true, "dependencies": { "@babel/helper-create-regexp-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-duplicate-keys": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-duplicate-keys/-/plugin-transform-duplicate-keys-7.10.4.tgz", "integrity": "sha512-GL0/fJnmgMclHiBTTWXNlYjYsA7rDrtsazHG6mglaGSTh0KsrW04qml+Bbz9FL0LcJIRwBWL5ZqlNHKTkU3xAA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-exponentiation-operator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-exponentiation-operator/-/plugin-transform-exponentiation-operator-7.10.4.tgz", "integrity": "sha512-S5HgLVgkBcRdyQAHbKj+7KyuWx8C6t5oETmUuwz1pt3WTWJhsUV0WIIXuVvfXMxl/QQyHKlSCNNtaIamG8fysw==", "dev": true, "dependencies": { "@babel/helper-builder-binary-assignment-operator-visitor": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-for-of": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-for-of/-/plugin-transform-for-of-7.10.4.tgz", "integrity": "sha512-ItdQfAzu9AlEqmusA/65TqJ79eRcgGmpPPFvBnGILXZH975G0LNjP1yjHvGgfuCxqrPPueXOPe+FsvxmxKiHHQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-function-name/-/plugin-transform-function-name-7.10.4.tgz", "integrity": "sha512-OcDCq2y5+E0dVD5MagT5X+yTRbcvFjDI2ZVAottGH6tzqjx/LKpgkUepu3hp/u4tZBzxxpNGwLsAvGBvQ2mJzg==", "dev": true, "dependencies": { "@babel/helper-function-name": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "dependencies": { "@babel/highlight": "^7.10.4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true, "bin": { "parser": "bin/babel-parser.js" }, "engines": { "node": ">=6.0.0" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "dependencies": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "node_modules/@babel/plugin-transform-function-name/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/plugin-transform-function-name/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-function-name/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-literals": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-literals/-/plugin-transform-literals-7.10.4.tgz", "integrity": "sha512-Xd/dFSTEVuUWnyZiMu76/InZxLTYilOSr1UlHV+p115Z/Le2Fi1KXkJUYz0b42DfndostYlPub3m8ZTQlMaiqQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-member-expression-literals": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-member-expression-literals/-/plugin-transform-member-expression-literals-7.10.4.tgz", "integrity": "sha512-0bFOvPyAoTBhtcJLr9VcwZqKmSjFml1iVxvPL0ReomGU53CX53HsM4h2SzckNdkQcHox1bpAqzxBI1Y09LlBSw==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-modules-amd": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-amd/-/plugin-transform-modules-amd-7.10.5.tgz", "integrity": "sha512-elm5uruNio7CTLFItVC/rIzKLfQ17+fX7EVz5W0TMgIHFo1zY0Ozzx+lgwhL4plzl8OzVn6Qasx5DeEFyoNiRw==", "dev": true, "dependencies": { "@babel/helper-module-transforms": "^7.10.5", "@babel/helper-plugin-utils": "^7.10.4", "babel-plugin-dynamic-import-node": "^2.3.3" } }, "node_modules/@babel/plugin-transform-modules-commonjs": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.10.4.tgz", "integrity": "sha512-Xj7Uq5o80HDLlW64rVfDBhao6OX89HKUmb+9vWYaLXBZOma4gA6tw4Ni1O5qVDoZWUV0fxMYA0aYzOawz0l+1w==", "dev": true, "dependencies": { "@babel/helper-module-transforms": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-simple-access": "^7.10.4", "babel-plugin-dynamic-import-node": "^2.3.3" } }, "node_modules/@babel/plugin-transform-modules-systemjs": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.10.5.tgz", "integrity": "sha512-f4RLO/OL14/FP1AEbcsWMzpbUz6tssRaeQg11RH1BP/XnPpRoVwgeYViMFacnkaw4k4wjRSjn3ip1Uw9TaXuMw==", "dev": true, "dependencies": { "@babel/helper-hoist-variables": "^7.10.4", "@babel/helper-module-transforms": "^7.10.5", "@babel/helper-plugin-utils": "^7.10.4", "babel-plugin-dynamic-import-node": "^2.3.3" } }, "node_modules/@babel/plugin-transform-modules-umd": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-umd/-/plugin-transform-modules-umd-7.10.4.tgz", "integrity": "sha512-mohW5q3uAEt8T45YT7Qc5ws6mWgJAaL/8BfWD9Dodo1A3RKWli8wTS+WiQ/knF+tXlPirW/1/MqzzGfCExKECA==", "dev": true, "dependencies": { "@babel/helper-module-transforms": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-named-capturing-groups-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-named-capturing-groups-regex/-/plugin-transform-named-capturing-groups-regex-7.10.4.tgz", "integrity": "sha512-V6LuOnD31kTkxQPhKiVYzYC/Jgdq53irJC/xBSmqcNcqFGV+PER4l6rU5SH2Vl7bH9mLDHcc0+l9HUOe4RNGKA==", "dev": true, "dependencies": { "@babel/helper-create-regexp-features-plugin": "^7.10.4" } }, "node_modules/@babel/plugin-transform-new-target": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-new-target/-/plugin-transform-new-target-7.10.4.tgz", "integrity": "sha512-YXwWUDAH/J6dlfwqlWsztI2Puz1NtUAubXhOPLQ5gjR/qmQ5U96DY4FQO8At33JN4XPBhrjB8I4eMmLROjjLjw==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-object-super": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-object-super/-/plugin-transform-object-super-7.10.4.tgz", "integrity": "sha512-5iTw0JkdRdJvr7sY0vHqTpnruUpTea32JHmq/atIWqsnNussbRzjEDyWep8UNztt1B5IusBYg8Irb0bLbiEBCQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4" } }, "node_modules/@babel/plugin-transform-parameters": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-parameters/-/plugin-transform-parameters-7.10.5.tgz", "integrity": "sha512-xPHwUj5RdFV8l1wuYiu5S9fqWGM2DrYc24TMvUiRrPVm+SM3XeqU9BcokQX/kEUe+p2RBwy+yoiR1w/Blq6ubw==", "dev": true, "dependencies": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-parameters/node_modules/@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "dependencies": { "@babel/types": "^7.10.4" } }, "node_modules/@babel/plugin-transform-parameters/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/plugin-transform-parameters/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/plugin-transform-parameters/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/plugin-transform-property-literals": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-property-literals/-/plugin-transform-property-literals-7.10.4.tgz", "integrity": "sha512-ofsAcKiUxQ8TY4sScgsGeR2vJIsfrzqvFb9GvJ5UdXDzl+MyYCaBj/FGzXuv7qE0aJcjWMILny1epqelnFlz8g==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-regenerator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-regenerator/-/plugin-transform-regenerator-7.10.4.tgz", "integrity": "sha512-3thAHwtor39A7C04XucbMg17RcZ3Qppfxr22wYzZNcVIkPHfpM9J0SO8zuCV6SZa265kxBJSrfKTvDCYqBFXGw==", "dev": true, "dependencies": { "regenerator-transform": "^0.14.2" } }, "node_modules/@babel/plugin-transform-regenerator/node_modules/regenerator-transform": { "version": "0.14.5", "resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.14.5.tgz", "integrity": "sha512-eOf6vka5IO151Jfsw2NO9WpGX58W6wWmefK3I1zEGr0lOD0u8rwPaNqQL1aRxUaxLeKO3ArNh3VYg1KbaD+FFw==", "dev": true, "dependencies": { "@babel/runtime": "^7.8.4" } }, "node_modules/@babel/plugin-transform-reserved-words": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-reserved-words/-/plugin-transform-reserved-words-7.10.4.tgz", "integrity": "sha512-hGsw1O6Rew1fkFbDImZIEqA8GoidwTAilwCyWqLBM9f+e/u/sQMQu7uX6dyokfOayRuuVfKOW4O7HvaBWM+JlQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-shorthand-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-shorthand-properties/-/plugin-transform-shorthand-properties-7.10.4.tgz", "integrity": "sha512-AC2K/t7o07KeTIxMoHneyX90v3zkm5cjHJEokrPEAGEy3UCp8sLKfnfOIGdZ194fyN4wfX/zZUWT9trJZ0qc+Q==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-spread": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-spread/-/plugin-transform-spread-7.11.0.tgz", "integrity": "sha512-UwQYGOqIdQJe4aWNyS7noqAnN2VbaczPLiEtln+zPowRNlD+79w3oi2TWfYe0eZgd+gjZCbsydN7lzWysDt+gw==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-skip-transparent-expression-wrappers": "^7.11.0" } }, "node_modules/@babel/plugin-transform-sticky-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-sticky-regex/-/plugin-transform-sticky-regex-7.10.4.tgz", "integrity": "sha512-Ddy3QZfIbEV0VYcVtFDCjeE4xwVTJWTmUtorAJkn6u/92Z/nWJNV+mILyqHKrUxXYKA2EoCilgoPePymKL4DvQ==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-regex": "^7.10.4" } }, "node_modules/@babel/plugin-transform-template-literals": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-template-literals/-/plugin-transform-template-literals-7.10.5.tgz", "integrity": "sha512-V/lnPGIb+KT12OQikDvgSuesRX14ck5FfJXt6+tXhdkJ+Vsd0lDCVtF6jcB4rNClYFzaB2jusZ+lNISDk2mMMw==", "dev": true, "dependencies": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-typeof-symbol": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-typeof-symbol/-/plugin-transform-typeof-symbol-7.10.4.tgz", "integrity": "sha512-QqNgYwuuW0y0H+kUE/GWSR45t/ccRhe14Fs/4ZRouNNQsyd4o3PG4OtHiIrepbM2WKUBDAXKCAK/Lk4VhzTaGA==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-unicode-escapes": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-escapes/-/plugin-transform-unicode-escapes-7.10.4.tgz", "integrity": "sha512-y5XJ9waMti2J+e7ij20e+aH+fho7Wb7W8rNuu72aKRwCHFqQdhkdU2lo3uZ9tQuboEJcUFayXdARhcxLQ3+6Fg==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/plugin-transform-unicode-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-regex/-/plugin-transform-unicode-regex-7.10.4.tgz", "integrity": "sha512-wNfsc4s8N2qnIwpO/WP2ZiSyjfpTamT2C9V9FDH/Ljub9zw6P3SjkXcFmc0RQUt96k2fmIvtla2MMjgTwIAC+A==", "dev": true, "dependencies": { "@babel/helper-create-regexp-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "node_modules/@babel/preset-env": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/preset-env/-/preset-env-7.11.5.tgz", "integrity": "sha512-kXqmW1jVcnB2cdueV+fyBM8estd5mlNfaQi6lwLgRwCby4edpavgbFhiBNjmWA3JpB/yZGSISa7Srf+TwxDQoA==", "dev": true, "dependencies": { "@babel/compat-data": "^7.11.0", "@babel/helper-compilation-targets": "^7.10.4", "@babel/helper-module-imports": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-proposal-async-generator-functions": "^7.10.4", "@babel/plugin-proposal-class-properties": "^7.10.4", "@babel/plugin-proposal-dynamic-import": "^7.10.4", "@babel/plugin-proposal-export-namespace-from": "^7.10.4", "@babel/plugin-proposal-json-strings": "^7.10.4", "@babel/plugin-proposal-logical-assignment-operators": "^7.11.0", "@babel/plugin-proposal-nullish-coalescing-operator": "^7.10.4", "@babel/plugin-proposal-numeric-separator": "^7.10.4", "@babel/plugin-proposal-object-rest-spread": "^7.11.0", "@babel/plugin-proposal-optional-catch-binding": "^7.10.4", "@babel/plugin-proposal-optional-chaining": "^7.11.0", "@babel/plugin-proposal-private-methods": "^7.10.4", "@babel/plugin-proposal-unicode-property-regex": "^7.10.4", "@babel/plugin-syntax-async-generators": "^7.8.0", "@babel/plugin-syntax-class-properties": "^7.10.4", "@babel/plugin-syntax-dynamic-import": "^7.8.0", "@babel/plugin-syntax-export-namespace-from": "^7.8.3", "@babel/plugin-syntax-json-strings": "^7.8.0", "@babel/plugin-syntax-logical-assignment-operators": "^7.10.4", "@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0", "@babel/plugin-syntax-numeric-separator": "^7.10.4", "@babel/plugin-syntax-object-rest-spread": "^7.8.0", "@babel/plugin-syntax-optional-catch-binding": "^7.8.0", "@babel/plugin-syntax-optional-chaining": "^7.8.0", "@babel/plugin-syntax-top-level-await": "^7.10.4", "@babel/plugin-transform-arrow-functions": "^7.10.4", "@babel/plugin-transform-async-to-generator": "^7.10.4", "@babel/plugin-transform-block-scoped-functions": "^7.10.4", "@babel/plugin-transform-block-scoping": "^7.10.4", "@babel/plugin-transform-classes": "^7.10.4", "@babel/plugin-transform-computed-properties": "^7.10.4", "@babel/plugin-transform-destructuring": "^7.10.4", "@babel/plugin-transform-dotall-regex": "^7.10.4", "@babel/plugin-transform-duplicate-keys": "^7.10.4", "@babel/plugin-transform-exponentiation-operator": "^7.10.4", "@babel/plugin-transform-for-of": "^7.10.4", "@babel/plugin-transform-function-name": "^7.10.4", "@babel/plugin-transform-literals": "^7.10.4", "@babel/plugin-transform-member-expression-literals": "^7.10.4", "@babel/plugin-transform-modules-amd": "^7.10.4", "@babel/plugin-transform-modules-commonjs": "^7.10.4", "@babel/plugin-transform-modules-systemjs": "^7.10.4", "@babel/plugin-transform-modules-umd": "^7.10.4", "@babel/plugin-transform-named-capturing-groups-regex": "^7.10.4", "@babel/plugin-transform-new-target": "^7.10.4", "@babel/plugin-transform-object-super": "^7.10.4", "@babel/plugin-transform-parameters": "^7.10.4", "@babel/plugin-transform-property-literals": "^7.10.4", "@babel/plugin-transform-regenerator": "^7.10.4", "@babel/plugin-transform-reserved-words": "^7.10.4", "@babel/plugin-transform-shorthand-properties": "^7.10.4", "@babel/plugin-transform-spread": "^7.11.0", "@babel/plugin-transform-sticky-regex": "^7.10.4", "@babel/plugin-transform-template-literals": "^7.10.4", "@babel/plugin-transform-typeof-symbol": "^7.10.4", "@babel/plugin-transform-unicode-escapes": "^7.10.4", "@babel/plugin-transform-unicode-regex": "^7.10.4", "@babel/preset-modules": "^0.1.3", "@babel/types": "^7.11.5", "browserslist": "^4.12.0", "core-js-compat": "^3.6.2", "invariant": "^2.2.2", "levenary": "^1.1.1", "semver": "^5.5.0" } }, "node_modules/@babel/preset-env/node_modules/@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "dependencies": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/preset-env/node_modules/lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "node_modules/@babel/preset-env/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/preset-modules": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/@babel/preset-modules/-/preset-modules-0.1.4.tgz", "integrity": "sha512-J36NhwnfdzpmH41M1DrnkkgAqhZaqr/NBdPfQ677mLzlaXo+oDiv1deyCDtgAhz8p328otdob0Du7+xgHGZbKg==", "dev": true, "dependencies": { "@babel/helper-plugin-utils": "^7.0.0", "@babel/plugin-proposal-unicode-property-regex": "^7.4.4", "@babel/plugin-transform-dotall-regex": "^7.4.4", "@babel/types": "^7.4.4", "esutils": "^2.0.2" } }, "node_modules/@babel/runtime": { "version": "7.11.2", "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.11.2.tgz", "integrity": "sha512-TeWkU52so0mPtDcaCTxNBI/IHiz0pZgr8VEFqXFtZWpYD08ZB6FaSwVAS8MKRQAP3bYKiVjwysOJgMFY28o6Tw==", "dev": true, "dependencies": { "regenerator-runtime": "^0.13.4" } }, "node_modules/@babel/runtime/node_modules/regenerator-runtime": { "version": "0.13.7", "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.7.tgz", "integrity": "sha512-a54FxoJDIr27pgf7IgeQGxmqUNYrcV338lf/6gH456HZ/PhX+5BcwHXG9ajESmwe6WRO0tAzRUrRmNONWgkrew==", "dev": true }, "node_modules/@babel/template": { "version": "7.8.6", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.8.6.tgz", "integrity": "sha512-zbMsPMy/v0PWFZEhQJ66bqjhH+z0JgMoBWuikXybgG3Gkd/3t5oQ1Rw2WQhnSrsOmsKXnZOx15tkC4qON/+JPg==", "dev": true, "dependencies": { "@babel/code-frame": "^7.8.3", "@babel/parser": "^7.8.6", "@babel/types": "^7.8.6" } }, "node_modules/@babel/traverse": { "version": "7.8.6", "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.8.6.tgz", "integrity": "sha512-2B8l0db/DPi8iinITKuo7cbPznLCEk0kCxDoB9/N6gGNg/gxOXiR/IcymAFPiBwk5w6TtQ27w4wpElgp9btR9A==", "dev": true, "dependencies": { "@babel/code-frame": "^7.8.3", "@babel/generator": "^7.8.6", "@babel/helper-function-name": "^7.8.3", "@babel/helper-split-export-declaration": "^7.8.3", "@babel/parser": "^7.8.6", "@babel/types": "^7.8.6", "debug": "^4.1.0", "globals": "^11.1.0", "lodash": "^4.17.13" } }, "node_modules/@babel/traverse/node_modules/debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "dependencies": { "ms": "^2.1.1" } }, "node_modules/@babel/traverse/node_modules/globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@babel/traverse/node_modules/ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true }, "node_modules/@babel/types": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.8.7.tgz", "integrity": "sha512-k2TreEHxFA4CjGkL+GYjRyx35W0Mr7DP5+9q6WMkyKXB+904bYmG40syjMFV0oLlhhFCwWl0vA0DyzTDkwAiJw==", "dev": true, "dependencies": { "esutils": "^2.0.2", "lodash": "^4.17.13", "to-fast-properties": "^2.0.0" } }, "node_modules/@babel/types/node_modules/to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true, "engines": { "node": ">=4" } }, "node_modules/@webassemblyjs/ast": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.8.5.tgz", "integrity": "sha512-aJMfngIZ65+t71C3y2nBBg5FFG0Okt9m0XEgWZ7Ywgn1oMAT8cNwx00Uv1cQyHtidq0Xn94R4TAywO+LCQ+ZAQ==", "dependencies": { "@webassemblyjs/helper-module-context": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/wast-parser": "1.8.5" } }, "node_modules/@webassemblyjs/floating-point-hex-parser": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.8.5.tgz", "integrity": "sha512-9p+79WHru1oqBh9ewP9zW95E3XAo+90oth7S5Re3eQnECGq59ly1Ri5tsIipKGpiStHsUYmY3zMLqtk3gTcOtQ==" }, "node_modules/@webassemblyjs/helper-api-error": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.8.5.tgz", "integrity": "sha512-Za/tnzsvnqdaSPOUXHyKJ2XI7PDX64kWtURyGiJJZKVEdFOsdKUCPTNEVFZq3zJ2R0G5wc2PZ5gvdTRFgm81zA==" }, "node_modules/@webassemblyjs/helper-buffer": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.8.5.tgz", "integrity": "sha512-Ri2R8nOS0U6G49Q86goFIPNgjyl6+oE1abW1pS84BuhP1Qcr5JqMwRFT3Ah3ADDDYGEgGs1iyb1DGX+kAi/c/Q==" }, "node_modules/@webassemblyjs/helper-code-frame": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.8.5.tgz", "integrity": "sha512-VQAadSubZIhNpH46IR3yWO4kZZjMxN1opDrzePLdVKAZ+DFjkGD/rf4v1jap744uPVU6yjL/smZbRIIJTOUnKQ==", "dependencies": { "@webassemblyjs/wast-printer": "1.8.5" } }, "node_modules/@webassemblyjs/helper-fsm": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.8.5.tgz", "integrity": "sha512-kRuX/saORcg8se/ft6Q2UbRpZwP4y7YrWsLXPbbmtepKr22i8Z4O3V5QE9DbZK908dh5Xya4Un57SDIKwB9eow==" }, "node_modules/@webassemblyjs/helper-module-context": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.8.5.tgz", "integrity": "sha512-/O1B236mN7UNEU4t9X7Pj38i4VoU8CcMHyy3l2cV/kIF4U5KoHXDVqcDuOs1ltkac90IM4vZdHc52t1x8Yfs3g==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "mamacro": "^0.0.3" } }, "node_modules/@webassemblyjs/helper-wasm-bytecode": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.8.5.tgz", "integrity": "sha512-Cu4YMYG3Ddl72CbmpjU/wbP6SACcOPVbHN1dI4VJNJVgFwaKf1ppeFJrwydOG3NDHxVGuCfPlLZNyEdIYlQ6QQ==" }, "node_modules/@webassemblyjs/helper-wasm-section": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.8.5.tgz", "integrity": "sha512-VV083zwR+VTrIWWtgIUpqfvVdK4ff38loRmrdDBgBT8ADXYsEZ5mPQ4Nde90N3UYatHdYoDIFb7oHzMncI02tA==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-buffer": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/wasm-gen": "1.8.5" } }, "node_modules/@webassemblyjs/ieee754": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.8.5.tgz", "integrity": "sha512-aaCvQYrvKbY/n6wKHb/ylAJr27GglahUO89CcGXMItrOBqRarUMxWLJgxm9PJNuKULwN5n1csT9bYoMeZOGF3g==", "dependencies": { "@xtuc/ieee754": "^1.2.0" } }, "node_modules/@webassemblyjs/leb128": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.8.5.tgz", "integrity": "sha512-plYUuUwleLIziknvlP8VpTgO4kqNaH57Y3JnNa6DLpu/sGcP6hbVdfdX5aHAV716pQBKrfuU26BJK29qY37J7A==", "dependencies": { "@xtuc/long": "4.2.2" } }, "node_modules/@webassemblyjs/utf8": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.8.5.tgz", "integrity": "sha512-U7zgftmQriw37tfD934UNInokz6yTmn29inT2cAetAsaU9YeVCveWEwhKL1Mg4yS7q//NGdzy79nlXh3bT8Kjw==" }, "node_modules/@webassemblyjs/wasm-edit": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.8.5.tgz", "integrity": "sha512-A41EMy8MWw5yvqj7MQzkDjU29K7UJq1VrX2vWLzfpRHt3ISftOXqrtojn7nlPsZ9Ijhp5NwuODuycSvfAO/26Q==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-buffer": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/helper-wasm-section": "1.8.5", "@webassemblyjs/wasm-gen": "1.8.5", "@webassemblyjs/wasm-opt": "1.8.5", "@webassemblyjs/wasm-parser": "1.8.5", "@webassemblyjs/wast-printer": "1.8.5" } }, "node_modules/@webassemblyjs/wasm-gen": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.8.5.tgz", "integrity": "sha512-BCZBT0LURC0CXDzj5FXSc2FPTsxwp3nWcqXQdOZE4U7h7i8FqtFK5Egia6f9raQLpEKT1VL7zr4r3+QX6zArWg==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/ieee754": "1.8.5", "@webassemblyjs/leb128": "1.8.5", "@webassemblyjs/utf8": "1.8.5" } }, "node_modules/@webassemblyjs/wasm-opt": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.8.5.tgz", "integrity": "sha512-HKo2mO/Uh9A6ojzu7cjslGaHaUU14LdLbGEKqTR7PBKwT6LdPtLLh9fPY33rmr5wcOMrsWDbbdCHq4hQUdd37Q==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-buffer": "1.8.5", "@webassemblyjs/wasm-gen": "1.8.5", "@webassemblyjs/wasm-parser": "1.8.5" } }, "node_modules/@webassemblyjs/wasm-parser": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.8.5.tgz", "integrity": "sha512-pi0SYE9T6tfcMkthwcgCpL0cM9nRYr6/6fjgDtL6q/ZqKHdMWvxitRi5JcZ7RI4SNJJYnYNaWy5UUrHQy998lw==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-api-error": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/ieee754": "1.8.5", "@webassemblyjs/leb128": "1.8.5", "@webassemblyjs/utf8": "1.8.5" } }, "node_modules/@webassemblyjs/wast-parser": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.8.5.tgz", "integrity": "sha512-daXC1FyKWHF1i11obK086QRlsMsY4+tIOKgBqI1lxAnkp9xe9YMcgOxm9kLe+ttjs5aWV2KKE1TWJCN57/Btsg==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/floating-point-hex-parser": "1.8.5", "@webassemblyjs/helper-api-error": "1.8.5", "@webassemblyjs/helper-code-frame": "1.8.5", "@webassemblyjs/helper-fsm": "1.8.5", "@xtuc/long": "4.2.2" } }, "node_modules/@webassemblyjs/wast-printer": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.8.5.tgz", "integrity": "sha512-w0U0pD4EhlnvRyeJzBqaVSJAo9w/ce7/WPogeXLzGkO6hzhr4GnQIZ4W4uUt5b9ooAaXPtnXlj0gzsXEOUNYMg==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/wast-parser": "1.8.5", "@xtuc/long": "4.2.2" } }, "node_modules/@xtuc/ieee754": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/@xtuc/ieee754/-/ieee754-1.2.0.tgz", "integrity": "sha512-DX8nKgqcGwsc0eJSqYt5lwP4DH5FlHnmuWWBRy7X0NcaGR0ZtuyeESgMwTYVEtxmsNGY+qit4QYT/MIYTOTPeA==" }, "node_modules/@xtuc/long": { "version": "4.2.2", "resolved": "https://registry.npmjs.org/@xtuc/long/-/long-4.2.2.tgz", "integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ==" }, "node_modules/acorn": { "version": "6.4.1", "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.1.tgz", "integrity": "sha512-ZVA9k326Nwrj3Cj9jlh3wGFutC2ZornPNARZwsNYqQYgN0EsV2d53w5RN/co65Ohn4sUAUtb1rSUAOD6XN9idA==", "bin": { "acorn": "bin/acorn" }, "engines": { "node": ">=0.4.0" } }, "node_modules/ajv": { "version": "6.12.0", "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.0.tgz", "integrity": "sha512-D6gFiFA0RRLyUbvijN74DWAjXSFxWKaWP7mldxkVhyhAV3+SWA9HEJPHQ2c9soIeTFJqcSdFDGFgdqs1iUU2Hw==", "dependencies": { "fast-deep-equal": "^3.1.1", "fast-json-stable-stringify": "^2.0.0", "json-schema-traverse": "^0.4.1", "uri-js": "^4.2.2" } }, "node_modules/ajv-errors": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.1.tgz", "integrity": "sha512-DCRfO/4nQ+89p/RK43i8Ezd41EqdGIU4ld7nGF8OQ14oc/we5rEntLCUa7+jrn3nn83BosfwZA0wb4pon2o8iQ==" }, "node_modules/ajv-keywords": { "version": "3.4.1", "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.4.1.tgz", "integrity": "sha512-RO1ibKvd27e6FEShVFfPALuHI3WjSVNeK5FIsmme/LYRNxjKuNj+Dt7bucLa6NdSv3JcVTyMlm9kGR84z1XpaQ==" }, "node_modules/ansi-regex": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", "engines": { "node": ">=0.10.0" } }, "node_modules/ansi-styles": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=", "engines": { "node": ">=0.10.0" } }, "node_modules/anymatch": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", "dependencies": { "micromatch": "^3.1.4", "normalize-path": "^2.1.1" } }, "node_modules/anymatch/node_modules/normalize-path": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", "dependencies": { "remove-trailing-separator": "^1.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/aproba": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==" }, "node_modules/argparse": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==" }, "node_modules/arr-diff": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz", "integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=", "engines": { "node": ">=0.10.0" } }, "node_modules/arr-flatten": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz", "integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==", "engines": { "node": ">=0.10.0" } }, "node_modules/arr-union": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz", "integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=", "engines": { "node": ">=0.10.0" } }, "node_modules/array-unique": { "version": "0.3.2", "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz", "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=", "engines": { "node": ">=0.10.0" } }, "node_modules/asn1.js": { "version": "4.10.1", "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-4.10.1.tgz", "integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==", "dependencies": { "bn.js": "^4.0.0", "inherits": "^2.0.1", "minimalistic-assert": "^1.0.0" } }, "node_modules/assert": { "version": "1.5.0", "resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz", "integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==", "dependencies": { "object-assign": "^4.1.1", "util": "0.10.3" } }, "node_modules/assert/node_modules/inherits": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz", "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=" }, "node_modules/assert/node_modules/util": { "version": "0.10.3", "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz", "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=", "dependencies": { "inherits": "2.0.1" } }, "node_modules/assign-symbols": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz", "integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=", "engines": { "node": ">=0.10.0" } }, "node_modules/async-each": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.3.tgz", "integrity": "sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ==" }, "node_modules/atob": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz", "integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==", "bin": { "atob": "bin/atob.js" }, "engines": { "node": ">= 4.5.0" } }, "node_modules/babel-code-frame": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-code-frame/-/babel-code-frame-6.26.0.tgz", "integrity": "sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=", "dependencies": { "chalk": "^1.1.3", "esutils": "^2.0.2", "js-tokens": "^3.0.2" } }, "node_modules/babel-core": { "version": "6.26.3", "resolved": "https://registry.npmjs.org/babel-core/-/babel-core-6.26.3.tgz", "integrity": "sha512-6jyFLuDmeidKmUEb3NM+/yawG0M2bDZ9Z1qbZP59cyHLz8kYGKYwpJP0UwUKKUiTRNvxfLesJnTedqczP7cTDA==", "dependencies": { "babel-code-frame": "^6.26.0", "babel-generator": "^6.26.0", "babel-helpers": "^6.24.1", "babel-messages": "^6.23.0", "babel-register": "^6.26.0", "babel-runtime": "^6.26.0", "babel-template": "^6.26.0", "babel-traverse": "^6.26.0", "babel-types": "^6.26.0", "babylon": "^6.18.0", "convert-source-map": "^1.5.1", "debug": "^2.6.9", "json5": "^0.5.1", "lodash": "^4.17.4", "minimatch": "^3.0.4", "path-is-absolute": "^1.0.1", "private": "^0.1.8", "slash": "^1.0.0", "source-map": "^0.5.7" } }, "node_modules/babel-core/node_modules/json5": { "version": "0.5.1", "resolved": "https://registry.npmjs.org/json5/-/json5-0.5.1.tgz", "integrity": "sha1-Hq3nrMASA0rYTiOWdn6tn6VJWCE=", "bin": { "json5": "lib/cli.js" } }, "node_modules/babel-generator": { "version": "6.26.1", "resolved": "https://registry.npmjs.org/babel-generator/-/babel-generator-6.26.1.tgz", "integrity": "sha512-HyfwY6ApZj7BYTcJURpM5tznulaBvyio7/0d4zFOeMPUmfxkCjHocCuoLa2SAGzBI8AREcH3eP3758F672DppA==", "dependencies": { "babel-messages": "^6.23.0", "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "detect-indent": "^4.0.0", "jsesc": "^1.3.0", "lodash": "^4.17.4", "source-map": "^0.5.7", "trim-right": "^1.0.1" } }, "node_modules/babel-helper-call-delegate": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz", "integrity": "sha1-7Oaqzdx25Bw0YfiL/Fdb0Nqi340=", "dependencies": { "babel-helper-hoist-variables": "^6.24.1", "babel-runtime": "^6.22.0", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "node_modules/babel-helper-define-map": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-helper-define-map/-/babel-helper-define-map-6.26.0.tgz", "integrity": "sha1-pfVtq0GiX5fstJjH66ypgZ+Vvl8=", "dependencies": { "babel-helper-function-name": "^6.24.1", "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "lodash": "^4.17.4" } }, "node_modules/babel-helper-function-name": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz", "integrity": "sha1-00dbjAPtmCQqJbSDUasYOZ01gKk=", "dependencies": { "babel-helper-get-function-arity": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "node_modules/babel-helper-get-function-arity": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz", "integrity": "sha1-j3eCqpNAfEHTqlCQj4mwMbG2hT0=", "dependencies": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-helper-hoist-variables": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz", "integrity": "sha1-HssnaJydJVE+rbyZFKc/VAi+enY=", "dependencies": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-helper-optimise-call-expression": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-optimise-call-expression/-/babel-helper-optimise-call-expression-6.24.1.tgz", "integrity": "sha1-96E0J7qfc/j0+pk8VKl4gtEkQlc=", "dependencies": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-helper-regex": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz", "integrity": "sha1-MlxZ+QL4LyS3T6zu0DY5VPZJXnI=", "dependencies": { "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "lodash": "^4.17.4" } }, "node_modules/babel-helper-replace-supers": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-replace-supers/-/babel-helper-replace-supers-6.24.1.tgz", "integrity": "sha1-v22/5Dk40XNpohPKiov3S2qQqxo=", "dependencies": { "babel-helper-optimise-call-expression": "^6.24.1", "babel-messages": "^6.23.0", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "node_modules/babel-helpers": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helpers/-/babel-helpers-6.24.1.tgz", "integrity": "sha1-NHHenK7DiOXIUOWX5Yom3fN2ArI=", "dependencies": { "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "node_modules/babel-loader": { "version": "8.0.6", "resolved": "https://registry.npmjs.org/babel-loader/-/babel-loader-8.0.6.tgz", "integrity": "sha512-4BmWKtBOBm13uoUwd08UwjZlaw3O9GWf456R9j+5YykFZ6LUIjIKLc0zEZf+hauxPOJs96C8k6FvYD09vWzhYw==", "dev": true, "dependencies": { "find-cache-dir": "^2.0.0", "loader-utils": "^1.0.2", "mkdirp": "^0.5.1", "pify": "^4.0.1" }, "engines": { "node": ">= 6.9" } }, "node_modules/babel-messages": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-messages/-/babel-messages-6.23.0.tgz", "integrity": "sha1-8830cDhYA1sqKVHG7F7fbGLyYw4=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-check-es2015-constants": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz", "integrity": "sha1-NRV7EBQm/S/9PaP3XH0ekYNbv4o=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-dynamic-import-node": { "version": "2.3.3", "resolved": "https://registry.npmjs.org/babel-plugin-dynamic-import-node/-/babel-plugin-dynamic-import-node-2.3.3.tgz", "integrity": "sha512-jZVI+s9Zg3IqA/kdi0i6UDCybUI3aSBLnglhYbSSjKlV7yF1F/5LWv8MakQmvYpnbJDS6fcBL2KzHSxNCMtWSQ==", "dev": true, "dependencies": { "object.assign": "^4.1.0" } }, "node_modules/babel-plugin-transform-es2015-arrow-functions": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-arrow-functions/-/babel-plugin-transform-es2015-arrow-functions-6.22.0.tgz", "integrity": "sha1-RSaSy3EdX3ncf4XkQM5BufJE0iE=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-block-scoped-functions": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoped-functions/-/babel-plugin-transform-es2015-block-scoped-functions-6.22.0.tgz", "integrity": "sha1-u8UbSflk1wy42OC5ToICRs46YUE=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-block-scoping": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoping/-/babel-plugin-transform-es2015-block-scoping-6.26.0.tgz", "integrity": "sha1-1w9SmcEwjQXBL0Y4E7CgnnOxiV8=", "dependencies": { "babel-runtime": "^6.26.0", "babel-template": "^6.26.0", "babel-traverse": "^6.26.0", "babel-types": "^6.26.0", "lodash": "^4.17.4" } }, "node_modules/babel-plugin-transform-es2015-classes": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-classes/-/babel-plugin-transform-es2015-classes-6.24.1.tgz", "integrity": "sha1-WkxYpQyclGHlZLSyo7+ryXolhNs=", "dependencies": { "babel-helper-define-map": "^6.24.1", "babel-helper-function-name": "^6.24.1", "babel-helper-optimise-call-expression": "^6.24.1", "babel-helper-replace-supers": "^6.24.1", "babel-messages": "^6.23.0", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-computed-properties": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-computed-properties/-/babel-plugin-transform-es2015-computed-properties-6.24.1.tgz", "integrity": "sha1-b+Ko0WiV1WNPTNmZttNICjCBWbM=", "dependencies": { "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-destructuring": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz", "integrity": "sha1-mXux8auWf2gtKwh2/jWNYOdlxW0=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-duplicate-keys": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-duplicate-keys/-/babel-plugin-transform-es2015-duplicate-keys-6.24.1.tgz", "integrity": "sha1-c+s9MQypaePvnskcU3QabxV2Qj4=", "dependencies": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-for-of": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-for-of/-/babel-plugin-transform-es2015-for-of-6.23.0.tgz", "integrity": "sha1-9HyVsrYT3x0+zC/bdXNiPHUkhpE=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-function-name": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz", "integrity": "sha1-g0yJhTvDaxrw86TF26qU/Y6sqos=", "dependencies": { "babel-helper-function-name": "^6.24.1", "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-literals": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-literals/-/babel-plugin-transform-es2015-literals-6.22.0.tgz", "integrity": "sha1-T1SgLWzWbPkVKAAZox0xklN3yi4=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-modules-amd": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-amd/-/babel-plugin-transform-es2015-modules-amd-6.24.1.tgz", "integrity": "sha1-Oz5UAXI5hC1tGcMBHEvS8AoA0VQ=", "dependencies": { "babel-plugin-transform-es2015-modules-commonjs": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-modules-commonjs": { "version": "6.26.2", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.2.tgz", "integrity": "sha512-CV9ROOHEdrjcwhIaJNBGMBCodN+1cfkwtM1SbUHmvyy35KGT7fohbpOxkE2uLz1o6odKK2Ck/tz47z+VqQfi9Q==", "dependencies": { "babel-plugin-transform-strict-mode": "^6.24.1", "babel-runtime": "^6.26.0", "babel-template": "^6.26.0", "babel-types": "^6.26.0" } }, "node_modules/babel-plugin-transform-es2015-modules-systemjs": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-systemjs/-/babel-plugin-transform-es2015-modules-systemjs-6.24.1.tgz", "integrity": "sha1-/4mhQrkRmpBhlfXxBuzzBdlAfSM=", "dependencies": { "babel-helper-hoist-variables": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-modules-umd": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-umd/-/babel-plugin-transform-es2015-modules-umd-6.24.1.tgz", "integrity": "sha1-rJl+YoXNGO1hdq22B9YCNErThGg=", "dependencies": { "babel-plugin-transform-es2015-modules-amd": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-object-super": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-object-super/-/babel-plugin-transform-es2015-object-super-6.24.1.tgz", "integrity": "sha1-JM72muIcuDp/hgPa0CH1cusnj40=", "dependencies": { "babel-helper-replace-supers": "^6.24.1", "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-parameters": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz", "integrity": "sha1-V6w1GrScrxSpfNE7CfZv3wpiXys=", "dependencies": { "babel-helper-call-delegate": "^6.24.1", "babel-helper-get-function-arity": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-shorthand-properties": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-shorthand-properties/-/babel-plugin-transform-es2015-shorthand-properties-6.24.1.tgz", "integrity": "sha1-JPh11nIch2YbvZmkYi5R8U3jiqA=", "dependencies": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-spread": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz", "integrity": "sha1-1taKmfia7cRTbIGlQujdnxdG+NE=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-sticky-regex": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz", "integrity": "sha1-AMHNsaynERLN8M9hJsLta0V8zbw=", "dependencies": { "babel-helper-regex": "^6.24.1", "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-plugin-transform-es2015-template-literals": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-template-literals/-/babel-plugin-transform-es2015-template-literals-6.22.0.tgz", "integrity": "sha1-qEs0UPfp+PH2g51taH2oS7EjbY0=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-typeof-symbol": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-typeof-symbol/-/babel-plugin-transform-es2015-typeof-symbol-6.23.0.tgz", "integrity": "sha1-3sCfHN3/lLUqxz1QXITfWdzOs3I=", "dependencies": { "babel-runtime": "^6.22.0" } }, "node_modules/babel-plugin-transform-es2015-unicode-regex": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz", "integrity": "sha1-04sS9C6nMj9yk4fxinxa4frrNek=", "dependencies": { "babel-helper-regex": "^6.24.1", "babel-runtime": "^6.22.0", "regexpu-core": "^2.0.0" } }, "node_modules/babel-plugin-transform-regenerator": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.26.0.tgz", "integrity": "sha1-4HA2lvveJ/Cj78rPi03KL3s6jy8=", "dependencies": { "regenerator-transform": "^0.10.0" } }, "node_modules/babel-plugin-transform-strict-mode": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz", "integrity": "sha1-1fr3qleKZbvlkc9e2uBKDGcCB1g=", "dependencies": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "node_modules/babel-preset-es2015": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-preset-es2015/-/babel-preset-es2015-6.24.1.tgz", "integrity": "sha1-1EBQ1rwsn+6nAqrzjXJ6AhBTiTk=", "dependencies": { "babel-plugin-check-es2015-constants": "^6.22.0", "babel-plugin-transform-es2015-arrow-functions": "^6.22.0", "babel-plugin-transform-es2015-block-scoped-functions": "^6.22.0", "babel-plugin-transform-es2015-block-scoping": "^6.24.1", "babel-plugin-transform-es2015-classes": "^6.24.1", "babel-plugin-transform-es2015-computed-properties": "^6.24.1", "babel-plugin-transform-es2015-destructuring": "^6.22.0", "babel-plugin-transform-es2015-duplicate-keys": "^6.24.1", "babel-plugin-transform-es2015-for-of": "^6.22.0", "babel-plugin-transform-es2015-function-name": "^6.24.1", "babel-plugin-transform-es2015-literals": "^6.22.0", "babel-plugin-transform-es2015-modules-amd": "^6.24.1", "babel-plugin-transform-es2015-modules-commonjs": "^6.24.1", "babel-plugin-transform-es2015-modules-systemjs": "^6.24.1", "babel-plugin-transform-es2015-modules-umd": "^6.24.1", "babel-plugin-transform-es2015-object-super": "^6.24.1", "babel-plugin-transform-es2015-parameters": "^6.24.1", "babel-plugin-transform-es2015-shorthand-properties": "^6.24.1", "babel-plugin-transform-es2015-spread": "^6.22.0", "babel-plugin-transform-es2015-sticky-regex": "^6.24.1", "babel-plugin-transform-es2015-template-literals": "^6.22.0", "babel-plugin-transform-es2015-typeof-symbol": "^6.22.0", "babel-plugin-transform-es2015-unicode-regex": "^6.24.1", "babel-plugin-transform-regenerator": "^6.24.1" } }, "node_modules/babel-register": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-register/-/babel-register-6.26.0.tgz", "integrity": "sha1-btAhFz4vy0htestFxgCahW9kcHE=", "dependencies": { "babel-core": "^6.26.0", "babel-runtime": "^6.26.0", "core-js": "^2.5.0", "home-or-tmp": "^2.0.0", "lodash": "^4.17.4", "mkdirp": "^0.5.1", "source-map-support": "^0.4.15" } }, "node_modules/babel-register/node_modules/source-map-support": { "version": "0.4.18", "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.4.18.tgz", "integrity": "sha512-try0/JqxPLF9nOjvSta7tVondkP5dwgyLDjVoyMDlmjugT2lRZ1OfsrYTkCd2hkDnJTKRbO/Rl3orm8vlsUzbA==", "dependencies": { "source-map": "^0.5.6" } }, "node_modules/babel-runtime": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-runtime/-/babel-runtime-6.26.0.tgz", "integrity": "sha1-llxwWGaOgrVde/4E/yM3vItWR/4=", "dependencies": { "core-js": "^2.4.0", "regenerator-runtime": "^0.11.0" } }, "node_modules/babel-template": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-template/-/babel-template-6.26.0.tgz", "integrity": "sha1-3gPi0WOWsGn0bdn/+FIfsaDjXgI=", "dependencies": { "babel-runtime": "^6.26.0", "babel-traverse": "^6.26.0", "babel-types": "^6.26.0", "babylon": "^6.18.0", "lodash": "^4.17.4" } }, "node_modules/babel-traverse": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-traverse/-/babel-traverse-6.26.0.tgz", "integrity": "sha1-RqnL1+3MYsjlwGTi0tjQ9ANXZu4=", "dependencies": { "babel-code-frame": "^6.26.0", "babel-messages": "^6.23.0", "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "babylon": "^6.18.0", "debug": "^2.6.8", "globals": "^9.18.0", "invariant": "^2.2.2", "lodash": "^4.17.4" } }, "node_modules/babel-types": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-types/-/babel-types-6.26.0.tgz", "integrity": "sha1-o7Bz+Uq0nrb6Vc1lInozQ4BjJJc=", "dependencies": { "babel-runtime": "^6.26.0", "esutils": "^2.0.2", "lodash": "^4.17.4", "to-fast-properties": "^1.0.3" } }, "node_modules/babylon": { "version": "6.18.0", "resolved": "https://registry.npmjs.org/babylon/-/babylon-6.18.0.tgz", "integrity": "sha512-q/UEjfGJ2Cm3oKV71DJz9d25TPnq5rhBVL2Q4fA5wcC3jcrdn7+SssEybFIxwAvvP+YCsCYNKughoF33GxgycQ==", "bin": { "babylon": "bin/babylon.js" } }, "node_modules/balanced-match": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=" }, "node_modules/base": { "version": "0.11.2", "resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz", "integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==", "dependencies": { "cache-base": "^1.0.1", "class-utils": "^0.3.5", "component-emitter": "^1.2.1", "define-property": "^1.0.0", "isobject": "^3.0.1", "mixin-deep": "^1.2.0", "pascalcase": "^0.1.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/base/node_modules/define-property": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "dependencies": { "is-descriptor": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/base/node_modules/is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/base/node_modules/is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/base/node_modules/is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "dependencies": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/base64-js": { "version": "1.3.1", "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.1.tgz", "integrity": "sha512-mLQ4i2QO1ytvGWFWmcngKO//JXAQueZvwEKtjgQFM4jIK0kU+ytMfplL8j+n5mspOfjHwoAg+9yhb7BwAHm36g==" }, "node_modules/big.js": { "version": "5.2.2", "resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz", "integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ==", "engines": { "node": "*" } }, "node_modules/binary-extensions": { "version": "1.13.1", "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", "engines": { "node": ">=0.10.0" } }, "node_modules/bindings": { "version": "1.5.0", "resolved": "https://registry.npmjs.org/bindings/-/bindings-1.5.0.tgz", "integrity": "sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==", "optional": true, "dependencies": { "file-uri-to-path": "1.0.0" } }, "node_modules/bluebird": { "version": "3.7.2", "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.7.2.tgz", "integrity": "sha512-XpNj6GDQzdfW+r2Wnn7xiSAd7TM3jzkxGXBGTtWKuSXv1xUV+azxAm8jdWZN06QTQk+2N2XB9jRDkvbmQmcRtg==" }, "node_modules/bn.js": { "version": "4.11.8", "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.8.tgz", "integrity": "sha512-ItfYfPLkWHUjckQCk8xC+LwxgK8NYcXywGigJgSwOP8Y2iyWT4f2vsZnoOXTTbo+o5yXmIUJ4gn5538SO5S3gA==" }, "node_modules/brace-expansion": { "version": "1.1.11", "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", "dependencies": { "balanced-match": "^1.0.0", "concat-map": "0.0.1" } }, "node_modules/braces": { "version": "2.3.2", "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", "dependencies": { "arr-flatten": "^1.1.0", "array-unique": "^0.3.2", "extend-shallow": "^2.0.1", "fill-range": "^4.0.0", "isobject": "^3.0.1", "repeat-element": "^1.1.2", "snapdragon": "^0.8.1", "snapdragon-node": "^2.0.1", "split-string": "^3.0.2", "to-regex": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/braces/node_modules/extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "dependencies": { "is-extendable": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/brorand": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz", "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=" }, "node_modules/browserify-aes": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==", "dependencies": { "buffer-xor": "^1.0.3", "cipher-base": "^1.0.0", "create-hash": "^1.1.0", "evp_bytestokey": "^1.0.3", "inherits": "^2.0.1", "safe-buffer": "^5.0.1" } }, "node_modules/browserify-cipher": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz", "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==", "dependencies": { "browserify-aes": "^1.0.4", "browserify-des": "^1.0.0", "evp_bytestokey": "^1.0.0" } }, "node_modules/browserify-des": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz", "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==", "dependencies": { "cipher-base": "^1.0.1", "des.js": "^1.0.0", "inherits": "^2.0.1", "safe-buffer": "^5.1.2" } }, "node_modules/browserify-rsa": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz", "integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=", "dependencies": { "bn.js": "^4.1.0", "randombytes": "^2.0.1" } }, "node_modules/browserify-sign": { "version": "4.0.4", "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.0.4.tgz", "integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=", "dependencies": { "bn.js": "^4.1.1", "browserify-rsa": "^4.0.0", "create-hash": "^1.1.0", "create-hmac": "^1.1.2", "elliptic": "^6.0.0", "inherits": "^2.0.1", "parse-asn1": "^5.0.0" } }, "node_modules/browserify-zlib": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz", "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==", "dependencies": { "pako": "~1.0.5" } }, "node_modules/browserslist": { "version": "4.14.1", "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.14.1.tgz", "integrity": "sha512-zyBTIHydW37pnb63c7fHFXUG6EcqWOqoMdDx6cdyaDFriZ20EoVxcE95S54N+heRqY8m8IUgB5zYta/gCwSaaA==", "dev": true, "dependencies": { "caniuse-lite": "^1.0.30001124", "electron-to-chromium": "^1.3.562", "escalade": "^3.0.2", "node-releases": "^1.1.60" }, "bin": { "browserslist": "cli.js" }, "engines": { "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" } }, "node_modules/buffer": { "version": "4.9.2", "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", "dependencies": { "base64-js": "^1.0.2", "ieee754": "^1.1.4", "isarray": "^1.0.0" } }, "node_modules/buffer-from": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz", "integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==" }, "node_modules/buffer-xor": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz", "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=" }, "node_modules/builtin-status-codes": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz", "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=" }, "node_modules/cacache": { "version": "12.0.3", "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.3.tgz", "integrity": "sha512-kqdmfXEGFepesTuROHMs3MpFLWrPkSSpRqOw80RCflZXy/khxaArvFrQ7uJxSUduzAufc6G0g1VUCOZXxWavPw==", "dependencies": { "bluebird": "^3.5.5", "chownr": "^1.1.1", "figgy-pudding": "^3.5.1", "glob": "^7.1.4", "graceful-fs": "^4.1.15", "infer-owner": "^1.0.3", "lru-cache": "^5.1.1", "mississippi": "^3.0.0", "mkdirp": "^0.5.1", "move-concurrently": "^1.0.1", "promise-inflight": "^1.0.1", "rimraf": "^2.6.3", "ssri": "^6.0.1", "unique-filename": "^1.1.1", "y18n": "^4.0.0" } }, "node_modules/cache-base": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz", "integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==", "dependencies": { "collection-visit": "^1.0.0", "component-emitter": "^1.2.1", "get-value": "^2.0.6", "has-value": "^1.0.0", "isobject": "^3.0.1", "set-value": "^2.0.0", "to-object-path": "^0.3.0", "union-value": "^1.0.0", "unset-value": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/camelcase": { "version": "5.3.1", "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", "engines": { "node": ">=6" } }, "node_modules/caniuse-lite": { "version": "1.0.30001125", "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001125.tgz", "integrity": "sha512-9f+r7BW8Qli917mU3j0fUaTweT3f3vnX/Lcs+1C73V+RADmFme+Ih0Br8vONQi3X0lseOe6ZHfsZLCA8MSjxUA==", "dev": true }, "node_modules/chalk": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", "dependencies": { "ansi-styles": "^2.2.1", "escape-string-regexp": "^1.0.2", "has-ansi": "^2.0.0", "strip-ansi": "^3.0.0", "supports-color": "^2.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/chokidar": { "version": "2.1.8", "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", "dependencies": { "anymatch": "^2.0.0", "async-each": "^1.0.1", "braces": "^2.3.2", "glob-parent": "^3.1.0", "inherits": "^2.0.3", "is-binary-path": "^1.0.0", "is-glob": "^4.0.0", "normalize-path": "^3.0.0", "path-is-absolute": "^1.0.0", "readdirp": "^2.2.1", "upath": "^1.1.1" }, "optionalDependencies": { "fsevents": "^1.2.7" } }, "node_modules/chownr": { "version": "1.1.4", "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.4.tgz", "integrity": "sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg==" }, "node_modules/chrome-trace-event": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-1.0.2.tgz", "integrity": "sha512-9e/zx1jw7B4CO+c/RXoCsfg/x1AfUBioy4owYH0bJprEYAx5hRFLRhWBqHAG57D0ZM4H7vxbP7bPe0VwhQRYDQ==", "dependencies": { "tslib": "^1.9.0" }, "engines": { "node": ">=6.0" } }, "node_modules/cipher-base": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz", "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==", "dependencies": { "inherits": "^2.0.1", "safe-buffer": "^5.0.1" } }, "node_modules/class-utils": { "version": "0.3.6", "resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz", "integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==", "dependencies": { "arr-union": "^3.1.0", "define-property": "^0.2.5", "isobject": "^3.0.0", "static-extend": "^0.1.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/class-utils/node_modules/define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "dependencies": { "is-descriptor": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/cliui": { "version": "5.0.0", "resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", "integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==", "dependencies": { "string-width": "^3.1.0", "strip-ansi": "^5.2.0", "wrap-ansi": "^5.1.0" } }, "node_modules/cliui/node_modules/ansi-regex": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", "engines": { "node": ">=6" } }, "node_modules/cliui/node_modules/strip-ansi": { "version": "5.2.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "dependencies": { "ansi-regex": "^4.1.0" }, "engines": { "node": ">=6" } }, "node_modules/collection-visit": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz", "integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=", "dependencies": { "map-visit": "^1.0.0", "object-visit": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/color-convert": { "version": "1.9.3", "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", "dependencies": { "color-name": "1.1.3" } }, "node_modules/color-name": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" }, "node_modules/commander": { "version": "2.20.3", "resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz", "integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==" }, "node_modules/commondir": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz", "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=" }, "node_modules/component-emitter": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz", "integrity": "sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg==" }, "node_modules/concat-map": { "version": "0.0.1", "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=" }, "node_modules/concat-stream": { "version": "1.6.2", "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz", "integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==", "engines": [ "node >= 0.8" ], "dependencies": { "buffer-from": "^1.0.0", "inherits": "^2.0.3", "readable-stream": "^2.2.2", "typedarray": "^0.0.6" } }, "node_modules/console-browserify": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz", "integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA==" }, "node_modules/constants-browserify": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz", "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=" }, "node_modules/convert-source-map": { "version": "1.7.0", "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", "dependencies": { "safe-buffer": "~5.1.1" } }, "node_modules/copy-concurrently": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz", "integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==", "dependencies": { "aproba": "^1.1.1", "fs-write-stream-atomic": "^1.0.8", "iferr": "^0.1.5", "mkdirp": "^0.5.1", "rimraf": "^2.5.4", "run-queue": "^1.0.0" } }, "node_modules/copy-descriptor": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz", "integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=", "engines": { "node": ">=0.10.0" } }, "node_modules/core-js": { "version": "2.6.11", "resolved": "https://registry.npmjs.org/core-js/-/core-js-2.6.11.tgz", "integrity": "sha512-5wjnpaT/3dV+XB4borEsnAYQchn00XSgTAWKDkEqv+K8KevjbzmofK6hfJ9TZIlpj2N0xQpazy7PiRQiWHqzWg==", "hasInstallScript": true }, "node_modules/core-js-compat": { "version": "3.6.5", "resolved": "https://registry.npmjs.org/core-js-compat/-/core-js-compat-3.6.5.tgz", "integrity": "sha512-7ItTKOhOZbznhXAQ2g/slGg1PJV5zDO/WdkTwi7UEOJmkvsE32PWvx6mKtDjiMpjnR2CNf6BAD6sSxIlv7ptng==", "dev": true, "dependencies": { "browserslist": "^4.8.5", "semver": "7.0.0" } }, "node_modules/core-js-compat/node_modules/semver": { "version": "7.0.0", "resolved": "https://registry.npmjs.org/semver/-/semver-7.0.0.tgz", "integrity": "sha512-+GB6zVA9LWh6zovYQLALHwv5rb2PHGlJi3lfiqIHxR0uuwCgefcOJc59v9fv1w8GbStwxuuqqAjI9NMAOOgq1A==", "dev": true, "bin": { "semver": "bin/semver.js" } }, "node_modules/core-util-is": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=" }, "node_modules/create-ecdh": { "version": "4.0.3", "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.3.tgz", "integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==", "dependencies": { "bn.js": "^4.1.0", "elliptic": "^6.0.0" } }, "node_modules/create-hash": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==", "dependencies": { "cipher-base": "^1.0.1", "inherits": "^2.0.1", "md5.js": "^1.3.4", "ripemd160": "^2.0.1", "sha.js": "^2.4.0" } }, "node_modules/create-hmac": { "version": "1.1.7", "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==", "dependencies": { "cipher-base": "^1.0.3", "create-hash": "^1.1.0", "inherits": "^2.0.1", "ripemd160": "^2.0.0", "safe-buffer": "^5.0.1", "sha.js": "^2.4.8" } }, "node_modules/crel": { "version": "4.2.0", "resolved": "https://registry.npmjs.org/crel/-/crel-4.2.0.tgz", "integrity": "sha512-ZBVhTmtapdjEn8rTcTR/ePE0JSNfHzZfDkD3eAnsQEBmkQW9r14mzq6tK5Hkw6r26l7XxlU2Ox1nfHsmGIj0zQ==" }, "node_modules/cross-spawn": { "version": "6.0.5", "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz", "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", "dependencies": { "nice-try": "^1.0.4", "path-key": "^2.0.1", "semver": "^5.5.0", "shebang-command": "^1.2.0", "which": "^1.2.9" }, "engines": { "node": ">=4.8" } }, "node_modules/crypto-browserify": { "version": "3.12.0", "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz", "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==", "dependencies": { "browserify-cipher": "^1.0.0", "browserify-sign": "^4.0.0", "create-ecdh": "^4.0.0", "create-hash": "^1.1.0", "create-hmac": "^1.1.0", "diffie-hellman": "^5.0.0", "inherits": "^2.0.1", "pbkdf2": "^3.0.3", "public-encrypt": "^4.0.0", "randombytes": "^2.0.0", "randomfill": "^1.0.3" }, "engines": { "node": "*" } }, "node_modules/cyclist": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz", "integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk=" }, "node_modules/debug": { "version": "2.6.9", "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", "dependencies": { "ms": "2.0.0" } }, "node_modules/decamelize": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=", "engines": { "node": ">=0.10.0" } }, "node_modules/decode-uri-component": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz", "integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=", "engines": { "node": ">=0.10" } }, "node_modules/define-properties": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz", "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==", "dev": true, "dependencies": { "object-keys": "^1.0.12" }, "engines": { "node": ">= 0.4" } }, "node_modules/define-property": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz", "integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==", "dependencies": { "is-descriptor": "^1.0.2", "isobject": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/define-property/node_modules/is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/define-property/node_modules/is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/define-property/node_modules/is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "dependencies": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/des.js": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz", "integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==", "dependencies": { "inherits": "^2.0.1", "minimalistic-assert": "^1.0.0" } }, "node_modules/detect-file": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/detect-file/-/detect-file-1.0.0.tgz", "integrity": "sha1-8NZtA2cqglyxtzvbP+YjEMjlUrc=", "engines": { "node": ">=0.10.0" } }, "node_modules/detect-indent": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/detect-indent/-/detect-indent-4.0.0.tgz", "integrity": "sha1-920GQ1LN9Docts5hnE7jqUdd4gg=", "dependencies": { "repeating": "^2.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/diffie-hellman": { "version": "5.0.3", "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==", "dependencies": { "bn.js": "^4.1.0", "miller-rabin": "^4.0.0", "randombytes": "^2.0.0" } }, "node_modules/domain-browser": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz", "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==", "engines": { "node": ">=0.4", "npm": ">=1.2" } }, "node_modules/duplexify": { "version": "3.7.1", "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz", "integrity": "sha512-07z8uv2wMyS51kKhD1KsdXJg5WQ6t93RneqRxUHnskXVtlYYkLqM0gqStQZ3pj073g687jPCHrqNfCzawLYh5g==", "dependencies": { "end-of-stream": "^1.0.0", "inherits": "^2.0.1", "readable-stream": "^2.0.0", "stream-shift": "^1.0.0" } }, "node_modules/electron-to-chromium": { "version": "1.3.564", "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.564.tgz", "integrity": "sha512-fNaYN3EtKQWLQsrKXui8mzcryJXuA0LbCLoizeX6oayG2emBaS5MauKjCPAvc29NEY4FpLHIUWiP+Y0Bfrs5dg==", "dev": true }, "node_modules/elliptic": { "version": "6.5.2", "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.2.tgz", "integrity": "sha512-f4x70okzZbIQl/NSRLkI/+tteV/9WqL98zx+SQ69KbXxmVrmjwsNUPn/gYJJ0sHvEak24cZgHIPegRePAtA/xw==", "dependencies": { "bn.js": "^4.4.0", "brorand": "^1.0.1", "hash.js": "^1.0.0", "hmac-drbg": "^1.0.0", "inherits": "^2.0.1", "minimalistic-assert": "^1.0.0", "minimalistic-crypto-utils": "^1.0.0" } }, "node_modules/emoji-regex": { "version": "7.0.3", "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==" }, "node_modules/emojis-list": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-3.0.0.tgz", "integrity": "sha512-/kyM18EfinwXZbno9FyUGeFh87KC8HRQBQGildHZbEuRyWFOmv1U10o9BBp8XVZDVNNuQKyIGIu5ZYAAXJ0V2Q==", "engines": { "node": ">= 4" } }, "node_modules/end-of-stream": { "version": "1.4.4", "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz", "integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==", "dependencies": { "once": "^1.4.0" } }, "node_modules/enhanced-resolve": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.1.tgz", "integrity": "sha512-98p2zE+rL7/g/DzMHMTF4zZlCgeVdJ7yr6xzEpJRYwFYrGi9ANdn5DnJURg6RpBkyk60XYDnWIv51VfIhfNGuA==", "dependencies": { "graceful-fs": "^4.1.2", "memory-fs": "^0.5.0", "tapable": "^1.0.0" }, "engines": { "node": ">=6.9.0" } }, "node_modules/enhanced-resolve/node_modules/memory-fs": { "version": "0.5.0", "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.5.0.tgz", "integrity": "sha512-jA0rdU5KoQMC0e6ppoNRtpp6vjFq6+NY7r8hywnC7V+1Xj/MtHwGIbB1QaK/dunyjWteJzmkpd7ooeWg10T7GA==", "dependencies": { "errno": "^0.1.3", "readable-stream": "^2.0.1" }, "engines": { "node": ">=4.3.0 <5.0.0 || >=5.10" } }, "node_modules/entities": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/entities/-/entities-2.1.0.tgz", "integrity": "sha512-hCx1oky9PFrJ611mf0ifBLBRW8lUUVRlFolb5gWRfIELabBlbp9xZvrqZLZAs+NxFnbfQoeGd8wDkygjg7U85w==" }, "node_modules/errno": { "version": "0.1.7", "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz", "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==", "dependencies": { "prr": "~1.0.1" }, "bin": { "errno": "cli.js" } }, "node_modules/escalade": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.0.2.tgz", "integrity": "sha512-gPYAU37hYCUhW5euPeR+Y74F7BL+IBsV93j5cvGriSaD1aG6MGsqsV1yamRdrWrb2j3aiZvb0X+UBOWpx3JWtQ==", "dev": true, "engines": { "node": ">=6" } }, "node_modules/escape-string-regexp": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=", "engines": { "node": ">=0.8.0" } }, "node_modules/eslint-scope": { "version": "4.0.3", "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-4.0.3.tgz", "integrity": "sha512-p7VutNr1O/QrxysMo3E45FjYDTeXBy0iTltPFNSqKAIfjDSXC+4dj+qfyuD8bfAXrW/y6lW3O76VaYNPKfpKrg==", "dependencies": { "esrecurse": "^4.1.0", "estraverse": "^4.1.1" }, "engines": { "node": ">=4.0.0" } }, "node_modules/esrecurse": { "version": "4.2.1", "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.2.1.tgz", "integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==", "dependencies": { "estraverse": "^4.1.0" }, "engines": { "node": ">=4.0" } }, "node_modules/estraverse": { "version": "4.3.0", "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.3.0.tgz", "integrity": "sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==", "engines": { "node": ">=4.0" } }, "node_modules/esutils": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", "engines": { "node": ">=0.10.0" } }, "node_modules/events": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/events/-/events-3.1.0.tgz", "integrity": "sha512-Rv+u8MLHNOdMjTAFeT3nCjHn2aGlx435FP/sDHNaRhDEMwyI/aB22Kj2qIN8R0cw3z28psEQLYwxVKLsKrMgWg==", "engines": { "node": ">=0.8.x" } }, "node_modules/evp_bytestokey": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz", "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==", "dependencies": { "md5.js": "^1.3.4", "safe-buffer": "^5.1.1" } }, "node_modules/execa": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/execa/-/execa-1.0.0.tgz", "integrity": "sha512-adbxcyWV46qiHyvSp50TKt05tB4tK3HcmF7/nxfAdhnox83seTDbwnaqKO4sXRy7roHAIFqJP/Rw/AuEbX61LA==", "dependencies": { "cross-spawn": "^6.0.0", "get-stream": "^4.0.0", "is-stream": "^1.1.0", "npm-run-path": "^2.0.0", "p-finally": "^1.0.0", "signal-exit": "^3.0.0", "strip-eof": "^1.0.0" }, "engines": { "node": ">=6" } }, "node_modules/expand-brackets": { "version": "2.1.4", "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz", "integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=", "dependencies": { "debug": "^2.3.3", "define-property": "^0.2.5", "extend-shallow": "^2.0.1", "posix-character-classes": "^0.1.0", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/expand-brackets/node_modules/define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "dependencies": { "is-descriptor": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/expand-brackets/node_modules/extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "dependencies": { "is-extendable": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/expand-tilde": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/expand-tilde/-/expand-tilde-2.0.2.tgz", "integrity": "sha1-l+gBqgUt8CRU3kawK/YhZCzchQI=", "dependencies": { "homedir-polyfill": "^1.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extend-shallow": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz", "integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=", "dependencies": { "assign-symbols": "^1.0.0", "is-extendable": "^1.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extend-shallow/node_modules/is-extendable": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", "dependencies": { "is-plain-object": "^2.0.4" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extglob": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz", "integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==", "dependencies": { "array-unique": "^0.3.2", "define-property": "^1.0.0", "expand-brackets": "^2.1.4", "extend-shallow": "^2.0.1", "fragment-cache": "^0.2.1", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extglob/node_modules/define-property": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "dependencies": { "is-descriptor": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extglob/node_modules/extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "dependencies": { "is-extendable": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extglob/node_modules/is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extglob/node_modules/is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/extglob/node_modules/is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "dependencies": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/fast-deep-equal": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.1.tgz", "integrity": "sha512-8UEa58QDLauDNfpbrX55Q9jrGHThw2ZMdOky5Gl1CDtVeJDPVrG4Jxx1N8jw2gkWaff5UUuX1KJd+9zGe2B+ZA==" }, "node_modules/fast-json-stable-stringify": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==" }, "node_modules/figgy-pudding": { "version": "3.5.1", "resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.1.tgz", "integrity": "sha512-vNKxJHTEKNThjfrdJwHc7brvM6eVevuO5nTj6ez8ZQ1qbXTvGthucRF7S4vf2cr71QVnT70V34v0S1DyQsti0w==" }, "node_modules/file-uri-to-path": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz", "integrity": "sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==", "optional": true }, "node_modules/fill-range": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", "dependencies": { "extend-shallow": "^2.0.1", "is-number": "^3.0.0", "repeat-string": "^1.6.1", "to-regex-range": "^2.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/fill-range/node_modules/extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "dependencies": { "is-extendable": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/find-cache-dir": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz", "integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==", "dependencies": { "commondir": "^1.0.1", "make-dir": "^2.0.0", "pkg-dir": "^3.0.0" }, "engines": { "node": ">=6" } }, "node_modules/find-up": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", "dependencies": { "locate-path": "^3.0.0" }, "engines": { "node": ">=6" } }, "node_modules/findup-sync": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/findup-sync/-/findup-sync-3.0.0.tgz", "integrity": "sha512-YbffarhcicEhOrm4CtrwdKBdCuz576RLdhJDsIfvNtxUuhdRet1qZcsMjqbePtAseKdAnDyM/IyXbu7PRPRLYg==", "dependencies": { "detect-file": "^1.0.0", "is-glob": "^4.0.0", "micromatch": "^3.0.4", "resolve-dir": "^1.0.1" }, "engines": { "node": ">= 0.10" } }, "node_modules/flush-write-stream": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.1.1.tgz", "integrity": "sha512-3Z4XhFZ3992uIq0XOqb9AreonueSYphE6oYbpt5+3u06JWklbsPkNv3ZKkP9Bz/r+1MWCaMoSQ28P85+1Yc77w==", "dependencies": { "inherits": "^2.0.3", "readable-stream": "^2.3.6" } }, "node_modules/for-in": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz", "integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=", "engines": { "node": ">=0.10.0" } }, "node_modules/fragment-cache": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz", "integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=", "dependencies": { "map-cache": "^0.2.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/from2": { "version": "2.3.0", "resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz", "integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=", "dependencies": { "inherits": "^2.0.1", "readable-stream": "^2.0.0" } }, "node_modules/fs-write-stream-atomic": { "version": "1.0.10", "resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz", "integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=", "dependencies": { "graceful-fs": "^4.1.2", "iferr": "^0.1.5", "imurmurhash": "^0.1.4", "readable-stream": "1 || 2" } }, "node_modules/fs.realpath": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=" }, "node_modules/fsevents": { "version": "1.2.11", "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.11.tgz", "integrity": "sha512-+ux3lx6peh0BpvY0JebGyZoiR4D+oYzdPZMKJwkZ+sFkNJzpL7tXc/wehS49gUAxg3tmMHPHZkA8JU2rhhgDHw==", "bundleDependencies": [ "abbrev", "ansi-regex", "aproba", "are-we-there-yet", "balanced-match", "brace-expansion", "chownr", "code-point-at", "concat-map", "console-control-strings", "core-util-is", "debug", "deep-extend", "delegates", "detect-libc", "fs-minipass", "fs.realpath", "gauge", "glob", "has-unicode", "iconv-lite", "ignore-walk", "inflight", "inherits", "ini", "is-fullwidth-code-point", "isarray", "minimatch", "minimist", "minipass", "minizlib", "mkdirp", "ms", "needle", "node-pre-gyp", "nopt", "npm-bundled", "npm-normalize-package-bin", "npm-packlist", "npmlog", "number-is-nan", "object-assign", "once", "os-homedir", "os-tmpdir", "osenv", "path-is-absolute", "process-nextick-args", "rc", "readable-stream", "rimraf", "safe-buffer", "safer-buffer", "sax", "semver", "set-blocking", "signal-exit", "string-width", "string_decoder", "strip-ansi", "strip-json-comments", "tar", "util-deprecate", "wide-align", "wrappy", "yallist" ], "hasInstallScript": true, "optional": true, "os": [ "darwin" ], "dependencies": { "bindings": "^1.5.0", "nan": "^2.12.1", "node-pre-gyp": "*" }, "engines": { "node": ">=4.0" } }, "node_modules/fsevents/node_modules/abbrev": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz", "integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/ansi-regex": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/aproba": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/are-we-there-yet": { "version": "1.1.5", "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz", "integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "delegates": "^1.0.0", "readable-stream": "^2.0.6" } }, "node_modules/fsevents/node_modules/balanced-match": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/brace-expansion": { "version": "1.1.11", "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "balanced-match": "^1.0.0", "concat-map": "0.0.1" } }, "node_modules/fsevents/node_modules/chownr": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.3.tgz", "integrity": "sha512-i70fVHhmV3DtTl6nqvZOnIjbY0Pe4kAUjwHj8z0zAdgBtYrJyYwLKCCuRBQ5ppkyL0AkN7HKRnETdmdp1zqNXw==", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/code-point-at": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz", "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/concat-map": { "version": "0.0.1", "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/console-control-strings": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz", "integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/core-util-is": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/debug": { "version": "3.2.6", "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz", "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "ms": "^2.1.1" } }, "node_modules/fsevents/node_modules/deep-extend": { "version": "0.6.0", "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz", "integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=4.0.0" } }, "node_modules/fsevents/node_modules/delegates": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz", "integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/detect-libc": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-1.0.3.tgz", "integrity": "sha1-+hN8S9aY7fVc1c0CrFWfkaTEups=", "inBundle": true, "license": "Apache-2.0", "optional": true, "bin": { "detect-libc": "bin/detect-libc.js" }, "engines": { "node": ">=0.10" } }, "node_modules/fsevents/node_modules/fs-minipass": { "version": "1.2.7", "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-1.2.7.tgz", "integrity": "sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "minipass": "^2.6.0" } }, "node_modules/fsevents/node_modules/fs.realpath": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/gauge": { "version": "2.7.4", "resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz", "integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "aproba": "^1.0.3", "console-control-strings": "^1.0.0", "has-unicode": "^2.0.0", "object-assign": "^4.1.0", "signal-exit": "^3.0.0", "string-width": "^1.0.1", "strip-ansi": "^3.0.1", "wide-align": "^1.1.0" } }, "node_modules/fsevents/node_modules/glob": { "version": "7.1.6", "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "fs.realpath": "^1.0.0", "inflight": "^1.0.4", "inherits": "2", "minimatch": "^3.0.4", "once": "^1.3.0", "path-is-absolute": "^1.0.0" }, "engines": { "node": "*" }, "funding": { "url": "https://github.com/sponsors/isaacs" } }, "node_modules/fsevents/node_modules/has-unicode": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz", "integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/iconv-lite": { "version": "0.4.24", "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "safer-buffer": ">= 2.1.2 < 3" }, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/ignore-walk": { "version": "3.0.3", "resolved": "https://registry.npmjs.org/ignore-walk/-/ignore-walk-3.0.3.tgz", "integrity": "sha512-m7o6xuOaT1aqheYHKf8W6J5pYH85ZI9w077erOzLje3JsB1gkafkAhHHY19dqjulgIZHFm32Cp5uNZgcQqdJKw==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "minimatch": "^3.0.4" } }, "node_modules/fsevents/node_modules/inflight": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "once": "^1.3.0", "wrappy": "1" } }, "node_modules/fsevents/node_modules/inherits": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/ini": { "version": "1.3.5", "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz", "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==", "inBundle": true, "license": "ISC", "optional": true, "engines": { "node": "*" } }, "node_modules/fsevents/node_modules/is-fullwidth-code-point": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "number-is-nan": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/isarray": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/minimatch": { "version": "3.0.4", "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz", "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "brace-expansion": "^1.1.7" }, "engines": { "node": "*" } }, "node_modules/fsevents/node_modules/minimist": { "version": "0.0.8", "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz", "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/minipass": { "version": "2.9.0", "resolved": "https://registry.npmjs.org/minipass/-/minipass-2.9.0.tgz", "integrity": "sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "safe-buffer": "^5.1.2", "yallist": "^3.0.0" } }, "node_modules/fsevents/node_modules/minizlib": { "version": "1.3.3", "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-1.3.3.tgz", "integrity": "sha512-6ZYMOEnmVsdCeTJVE0W9ZD+pVnE8h9Hma/iOwwRDsdQoePpoX56/8B6z3P9VNwppJuBKNRuFDRNRqRWexT9G9Q==", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "minipass": "^2.9.0" } }, "node_modules/fsevents/node_modules/mkdirp": { "version": "0.5.1", "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "minimist": "0.0.8" }, "bin": { "mkdirp": "bin/cmd.js" } }, "node_modules/fsevents/node_modules/ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/needle": { "version": "2.4.0", "resolved": "https://registry.npmjs.org/needle/-/needle-2.4.0.tgz", "integrity": "sha512-4Hnwzr3mi5L97hMYeNl8wRW/Onhy4nUKR/lVemJ8gJedxxUyBLm9kkrDColJvoSfwi0jCNhD+xCdOtiGDQiRZg==", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "debug": "^3.2.6", "iconv-lite": "^0.4.4", "sax": "^1.2.4" }, "bin": { "needle": "bin/needle" }, "engines": { "node": ">= 4.4.x" } }, "node_modules/fsevents/node_modules/node-pre-gyp": { "version": "0.14.0", "resolved": "https://registry.npmjs.org/node-pre-gyp/-/node-pre-gyp-0.14.0.tgz", "integrity": "sha512-+CvDC7ZttU/sSt9rFjix/P05iS43qHCOOGzcr3Ry99bXG7VX953+vFyEuph/tfqoYu8dttBkE86JSKBO2OzcxA==", "inBundle": true, "license": "BSD-3-Clause", "optional": true, "dependencies": { "detect-libc": "^1.0.2", "mkdirp": "^0.5.1", "needle": "^2.2.1", "nopt": "^4.0.1", "npm-packlist": "^1.1.6", "npmlog": "^4.0.2", "rc": "^1.2.7", "rimraf": "^2.6.1", "semver": "^5.3.0", "tar": "^4.4.2" }, "bin": { "node-pre-gyp": "bin/node-pre-gyp" } }, "node_modules/fsevents/node_modules/nopt": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/nopt/-/nopt-4.0.1.tgz", "integrity": "sha1-0NRoWv1UFRk8jHUFYC0NF81kR00=", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "abbrev": "1", "osenv": "^0.1.4" }, "bin": { "nopt": "bin/nopt.js" } }, "node_modules/fsevents/node_modules/npm-bundled": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/npm-bundled/-/npm-bundled-1.1.1.tgz", "integrity": "sha512-gqkfgGePhTpAEgUsGEgcq1rqPXA+tv/aVBlgEzfXwA1yiUJF7xtEt3CtVwOjNYQOVknDk0F20w58Fnm3EtG0fA==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "npm-normalize-package-bin": "^1.0.1" } }, "node_modules/fsevents/node_modules/npm-normalize-package-bin": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/npm-normalize-package-bin/-/npm-normalize-package-bin-1.0.1.tgz", "integrity": "sha512-EPfafl6JL5/rU+ot6P3gRSCpPDW5VmIzX959Ob1+ySFUuuYHWHekXpwdUZcKP5C+DS4GEtdJluwBjnsNDl+fSA==", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/npm-packlist": { "version": "1.4.7", "resolved": "https://registry.npmjs.org/npm-packlist/-/npm-packlist-1.4.7.tgz", "integrity": "sha512-vAj7dIkp5NhieaGZxBJB8fF4R0078rqsmhJcAfXZ6O7JJhjhPK96n5Ry1oZcfLXgfun0GWTZPOxaEyqv8GBykQ==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "ignore-walk": "^3.0.1", "npm-bundled": "^1.0.1" } }, "node_modules/fsevents/node_modules/npmlog": { "version": "4.1.2", "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz", "integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "are-we-there-yet": "~1.1.2", "console-control-strings": "~1.1.0", "gauge": "~2.7.3", "set-blocking": "~2.0.0" } }, "node_modules/fsevents/node_modules/number-is-nan": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz", "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/object-assign": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/once": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "wrappy": "1" } }, "node_modules/fsevents/node_modules/os-homedir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/os-tmpdir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/osenv": { "version": "0.1.5", "resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz", "integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "os-homedir": "^1.0.0", "os-tmpdir": "^1.0.0" } }, "node_modules/fsevents/node_modules/path-is-absolute": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/process-nextick-args": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/rc": { "version": "1.2.8", "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz", "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==", "inBundle": true, "license": "(BSD-2-Clause OR MIT OR Apache-2.0)", "optional": true, "dependencies": { "deep-extend": "^0.6.0", "ini": "~1.3.0", "minimist": "^1.2.0", "strip-json-comments": "~2.0.1" }, "bin": { "rc": "cli.js" } }, "node_modules/fsevents/node_modules/rc/node_modules/minimist": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/readable-stream": { "version": "2.3.6", "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz", "integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "core-util-is": "~1.0.0", "inherits": "~2.0.3", "isarray": "~1.0.0", "process-nextick-args": "~2.0.0", "safe-buffer": "~5.1.1", "string_decoder": "~1.1.1", "util-deprecate": "~1.0.1" } }, "node_modules/fsevents/node_modules/rimraf": { "version": "2.7.1", "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "glob": "^7.1.3" }, "bin": { "rimraf": "bin.js" } }, "node_modules/fsevents/node_modules/safe-buffer": { "version": "5.1.2", "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/safer-buffer": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/sax": { "version": "1.2.4", "resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz", "integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/semver": { "version": "5.7.1", "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", "inBundle": true, "license": "ISC", "optional": true, "bin": { "semver": "bin/semver" } }, "node_modules/fsevents/node_modules/set-blocking": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/signal-exit": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz", "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/string_decoder": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "safe-buffer": "~5.1.0" } }, "node_modules/fsevents/node_modules/string-width": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "code-point-at": "^1.0.0", "is-fullwidth-code-point": "^1.0.0", "strip-ansi": "^3.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/strip-ansi": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", "inBundle": true, "license": "MIT", "optional": true, "dependencies": { "ansi-regex": "^2.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/strip-json-comments": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz", "integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=", "inBundle": true, "license": "MIT", "optional": true, "engines": { "node": ">=0.10.0" } }, "node_modules/fsevents/node_modules/tar": { "version": "4.4.13", "resolved": "https://registry.npmjs.org/tar/-/tar-4.4.13.tgz", "integrity": "sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "chownr": "^1.1.1", "fs-minipass": "^1.2.5", "minipass": "^2.8.6", "minizlib": "^1.2.1", "mkdirp": "^0.5.0", "safe-buffer": "^5.1.2", "yallist": "^3.0.3" }, "engines": { "node": ">=4.5" } }, "node_modules/fsevents/node_modules/util-deprecate": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=", "inBundle": true, "license": "MIT", "optional": true }, "node_modules/fsevents/node_modules/wide-align": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz", "integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==", "inBundle": true, "license": "ISC", "optional": true, "dependencies": { "string-width": "^1.0.2 || 2" } }, "node_modules/fsevents/node_modules/wrappy": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/fsevents/node_modules/yallist": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", "inBundle": true, "license": "ISC", "optional": true }, "node_modules/function-bind": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==", "dev": true }, "node_modules/gensync": { "version": "1.0.0-beta.1", "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.1.tgz", "integrity": "sha512-r8EC6NO1sngH/zdD9fiRDLdcgnbayXah+mLgManTaIZJqEC1MZstmnox8KpnI2/fxQwrp5OpCOYWLp4rBl4Jcg==", "dev": true, "engines": { "node": ">=6.9.0" } }, "node_modules/get-caller-file": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", "engines": { "node": "6.* || 8.* || >= 10.*" } }, "node_modules/get-stream": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz", "integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==", "dependencies": { "pump": "^3.0.0" }, "engines": { "node": ">=6" } }, "node_modules/get-value": { "version": "2.0.6", "resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz", "integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=", "engines": { "node": ">=0.10.0" } }, "node_modules/glob": { "version": "7.1.6", "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", "dependencies": { "fs.realpath": "^1.0.0", "inflight": "^1.0.4", "inherits": "2", "minimatch": "^3.0.4", "once": "^1.3.0", "path-is-absolute": "^1.0.0" }, "engines": { "node": "*" } }, "node_modules/glob-parent": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", "dependencies": { "is-glob": "^3.1.0", "path-dirname": "^1.0.0" } }, "node_modules/glob-parent/node_modules/is-glob": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", "dependencies": { "is-extglob": "^2.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/global-modules": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz", "integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==", "dependencies": { "global-prefix": "^3.0.0" }, "engines": { "node": ">=6" } }, "node_modules/global-modules/node_modules/global-prefix": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz", "integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==", "dependencies": { "ini": "^1.3.5", "kind-of": "^6.0.2", "which": "^1.3.1" }, "engines": { "node": ">=6" } }, "node_modules/global-prefix": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-1.0.2.tgz", "integrity": "sha1-2/dDxsFJklk8ZVVoy2btMsASLr4=", "dependencies": { "expand-tilde": "^2.0.2", "homedir-polyfill": "^1.0.1", "ini": "^1.3.4", "is-windows": "^1.0.1", "which": "^1.2.14" }, "engines": { "node": ">=0.10.0" } }, "node_modules/globals": { "version": "9.18.0", "resolved": "https://registry.npmjs.org/globals/-/globals-9.18.0.tgz", "integrity": "sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==", "engines": { "node": ">=0.10.0" } }, "node_modules/graceful-fs": { "version": "4.2.3", "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==" }, "node_modules/has-ansi": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz", "integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=", "dependencies": { "ansi-regex": "^2.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/has-flag": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=", "engines": { "node": ">=4" } }, "node_modules/has-symbols": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", "dev": true, "engines": { "node": ">= 0.4" } }, "node_modules/has-value": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz", "integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=", "dependencies": { "get-value": "^2.0.6", "has-values": "^1.0.0", "isobject": "^3.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/has-values": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz", "integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=", "dependencies": { "is-number": "^3.0.0", "kind-of": "^4.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/has-values/node_modules/kind-of": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz", "integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=", "dependencies": { "is-buffer": "^1.1.5" }, "engines": { "node": ">=0.10.0" } }, "node_modules/hash-base": { "version": "3.0.4", "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.0.4.tgz", "integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=", "dependencies": { "inherits": "^2.0.1", "safe-buffer": "^5.0.1" }, "engines": { "node": ">=4" } }, "node_modules/hash.js": { "version": "1.1.7", "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz", "integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==", "dependencies": { "inherits": "^2.0.3", "minimalistic-assert": "^1.0.1" } }, "node_modules/hmac-drbg": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz", "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=", "dependencies": { "hash.js": "^1.0.3", "minimalistic-assert": "^1.0.0", "minimalistic-crypto-utils": "^1.0.1" } }, "node_modules/home-or-tmp": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/home-or-tmp/-/home-or-tmp-2.0.0.tgz", "integrity": "sha1-42w/LSyufXRqhX440Y1fMqeILbg=", "dependencies": { "os-homedir": "^1.0.0", "os-tmpdir": "^1.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/homedir-polyfill": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/homedir-polyfill/-/homedir-polyfill-1.0.3.tgz", "integrity": "sha512-eSmmWE5bZTK2Nou4g0AI3zZ9rswp7GRKoKXS1BLUkvPviOqs4YTN1djQIqrXy9k5gEtdLPy86JjRwsNM9tnDcA==", "dependencies": { "parse-passwd": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/https-browserify": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz", "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=" }, "node_modules/ieee754": { "version": "1.1.13", "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.13.tgz", "integrity": "sha512-4vf7I2LYV/HaWerSo3XmlMkp5eZ83i+/CDluXi/IGTs/O1sejBNhTtnxzmRZfvOUqj7lZjqHkeTvpgSFDlWZTg==" }, "node_modules/iferr": { "version": "0.1.5", "resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz", "integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE=" }, "node_modules/import-local": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz", "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", "dependencies": { "pkg-dir": "^3.0.0", "resolve-cwd": "^2.0.0" }, "bin": { "import-local-fixture": "fixtures/cli.js" }, "engines": { "node": ">=6" } }, "node_modules/imurmurhash": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=", "engines": { "node": ">=0.8.19" } }, "node_modules/infer-owner": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz", "integrity": "sha512-IClj+Xz94+d7irH5qRyfJonOdfTzuDaifE6ZPWfx0N0+/ATZCbuTPq2prFl526urkQd90WyUKIh1DfBQ2hMz9A==" }, "node_modules/inflight": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", "dependencies": { "once": "^1.3.0", "wrappy": "1" } }, "node_modules/inherits": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" }, "node_modules/ini": { "version": "1.3.5", "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz", "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==", "engines": { "node": "*" } }, "node_modules/interpret": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/interpret/-/interpret-1.2.0.tgz", "integrity": "sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==", "engines": { "node": ">= 0.10" } }, "node_modules/invariant": { "version": "2.2.4", "resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz", "integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==", "dependencies": { "loose-envify": "^1.0.0" } }, "node_modules/invert-kv": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-2.0.0.tgz", "integrity": "sha512-wPVv/y/QQ/Uiirj/vh3oP+1Ww+AWehmi1g5fFWGPF6IpCBCDVrhgHRMvrLfdYcwDh3QJbGXDW4JAuzxElLSqKA==", "engines": { "node": ">=4" } }, "node_modules/is-accessor-descriptor": { "version": "0.1.6", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", "integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=", "dependencies": { "kind-of": "^3.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-accessor-descriptor/node_modules/kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "dependencies": { "is-buffer": "^1.1.5" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-binary-path": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", "dependencies": { "binary-extensions": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-buffer": { "version": "1.1.6", "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" }, "node_modules/is-data-descriptor": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", "integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=", "dependencies": { "kind-of": "^3.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-data-descriptor/node_modules/kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "dependencies": { "is-buffer": "^1.1.5" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-descriptor": { "version": "0.1.6", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", "dependencies": { "is-accessor-descriptor": "^0.1.6", "is-data-descriptor": "^0.1.4", "kind-of": "^5.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-descriptor/node_modules/kind-of": { "version": "5.1.0", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", "engines": { "node": ">=0.10.0" } }, "node_modules/is-extendable": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", "engines": { "node": ">=0.10.0" } }, "node_modules/is-extglob": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=", "engines": { "node": ">=0.10.0" } }, "node_modules/is-finite": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.1.0.tgz", "integrity": "sha512-cdyMtqX/BOqqNBBiKlIVkytNHm49MtMlYyn1zxzvJKWmFMlGzm+ry5BBfYyeY9YmNKbRSo/o7OX9w9ale0wg3w==", "engines": { "node": ">=0.10.0" } }, "node_modules/is-fullwidth-code-point": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", "engines": { "node": ">=4" } }, "node_modules/is-glob": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz", "integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==", "dependencies": { "is-extglob": "^2.1.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-number": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", "dependencies": { "kind-of": "^3.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-number/node_modules/kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "dependencies": { "is-buffer": "^1.1.5" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-plain-object": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz", "integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==", "dependencies": { "isobject": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/is-stream": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz", "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=", "engines": { "node": ">=0.10.0" } }, "node_modules/is-windows": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz", "integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==", "engines": { "node": ">=0.10.0" } }, "node_modules/is-wsl": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=", "engines": { "node": ">=4" } }, "node_modules/isarray": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=" }, "node_modules/isexe": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=" }, "node_modules/isobject": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz", "integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8=", "engines": { "node": ">=0.10.0" } }, "node_modules/js-tokens": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-3.0.2.tgz", "integrity": "sha1-mGbfOVECEw449/mWvOtlRDIJwls=" }, "node_modules/jsesc": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-1.3.0.tgz", "integrity": "sha1-RsP+yMGJKxKwgz25vHYiF226s0s=", "bin": { "jsesc": "bin/jsesc" } }, "node_modules/json-parse-better-errors": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz", "integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw==" }, "node_modules/json-schema-traverse": { "version": "0.4.1", "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==" }, "node_modules/json5": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", "dependencies": { "minimist": "^1.2.0" }, "bin": { "json5": "lib/cli.js" } }, "node_modules/kind-of": { "version": "6.0.3", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.3.tgz", "integrity": "sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw==", "engines": { "node": ">=0.10.0" } }, "node_modules/lcid": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/lcid/-/lcid-2.0.0.tgz", "integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==", "dependencies": { "invert-kv": "^2.0.0" }, "engines": { "node": ">=6" } }, "node_modules/leven": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/leven/-/leven-3.1.0.tgz", "integrity": "sha512-qsda+H8jTaUaN/x5vzW2rzc+8Rw4TAQ/4KjB46IwK5VH+IlVeeeje/EoZRpiXvIqjFgK84QffqPztGI3VBLG1A==", "dev": true, "engines": { "node": ">=6" } }, "node_modules/levenary": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/levenary/-/levenary-1.1.1.tgz", "integrity": "sha512-mkAdOIt79FD6irqjYSs4rdbnlT5vRonMEvBVPVb3XmevfS8kgRXwfes0dhPdEtzTWD/1eNE/Bm/G1iRt6DcnQQ==", "dev": true, "dependencies": { "leven": "^3.1.0" }, "engines": { "node": ">= 6" } }, "node_modules/linkify-it": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-3.0.2.tgz", "integrity": "sha512-gDBO4aHNZS6coiZCKVhSNh43F9ioIL4JwRjLZPkoLIY4yZFwg264Y5lu2x6rb1Js42Gh6Yqm2f6L2AJcnkzinQ==", "dependencies": { "uc.micro": "^1.0.1" } }, "node_modules/loader-runner": { "version": "2.4.0", "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz", "integrity": "sha512-Jsmr89RcXGIwivFY21FcRrisYZfvLMTWx5kOLc+JTxtpBOG6xML0vzbc6SEQG2FO9/4Fc3wW4LVcB5DmGflaRw==", "engines": { "node": ">=4.3.0 <5.0.0 || >=5.10" } }, "node_modules/loader-utils": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", "dependencies": { "big.js": "^5.2.2", "emojis-list": "^3.0.0", "json5": "^1.0.1" }, "engines": { "node": ">=4.0.0" } }, "node_modules/locate-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", "dependencies": { "p-locate": "^3.0.0", "path-exists": "^3.0.0" }, "engines": { "node": ">=6" } }, "node_modules/lodash": { "version": "4.17.15", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.15.tgz", "integrity": "sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==" }, "node_modules/loose-envify": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", "dependencies": { "js-tokens": "^3.0.0 || ^4.0.0" }, "bin": { "loose-envify": "cli.js" } }, "node_modules/lru-cache": { "version": "5.1.1", "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", "dependencies": { "yallist": "^3.0.2" } }, "node_modules/make-dir": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz", "integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==", "dependencies": { "pify": "^4.0.1", "semver": "^5.6.0" }, "engines": { "node": ">=6" } }, "node_modules/mamacro": { "version": "0.0.3", "resolved": "https://registry.npmjs.org/mamacro/-/mamacro-0.0.3.tgz", "integrity": "sha512-qMEwh+UujcQ+kbz3T6V+wAmO2U8veoq2w+3wY8MquqwVA3jChfwY+Tk52GZKDfACEPjuZ7r2oJLejwpt8jtwTA==" }, "node_modules/map-age-cleaner": { "version": "0.1.3", "resolved": "https://registry.npmjs.org/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz", "integrity": "sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w==", "dependencies": { "p-defer": "^1.0.0" }, "engines": { "node": ">=6" } }, "node_modules/map-cache": { "version": "0.2.2", "resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz", "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=", "engines": { "node": ">=0.10.0" } }, "node_modules/map-visit": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz", "integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=", "dependencies": { "object-visit": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/markdown-it": { "version": "12.0.4", "resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-12.0.4.tgz", "integrity": "sha512-34RwOXZT8kyuOJy25oJNJoulO8L0bTHYWXcdZBYZqFnjIy3NgjeoM3FmPXIOFQ26/lSHYMr8oc62B6adxXcb3Q==", "dependencies": { "argparse": "^2.0.1", "entities": "~2.1.0", "linkify-it": "^3.0.1", "mdurl": "^1.0.1", "uc.micro": "^1.0.5" }, "bin": { "markdown-it": "bin/markdown-it.js" } }, "node_modules/md5.js": { "version": "1.3.5", "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz", "integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==", "dependencies": { "hash-base": "^3.0.0", "inherits": "^2.0.1", "safe-buffer": "^5.1.2" } }, "node_modules/mdurl": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/mdurl/-/mdurl-1.0.1.tgz", "integrity": "sha1-/oWy7HWlkDfyrf7BAP1sYBdhFS4=" }, "node_modules/mem": { "version": "4.3.0", "resolved": "https://registry.npmjs.org/mem/-/mem-4.3.0.tgz", "integrity": "sha512-qX2bG48pTqYRVmDB37rn/6PT7LcR8T7oAX3bf99u1Tt1nzxYfxkgqDwUwolPlXweM0XzBOBFzSx4kfp7KP1s/w==", "dependencies": { "map-age-cleaner": "^0.1.1", "mimic-fn": "^2.0.0", "p-is-promise": "^2.0.0" }, "engines": { "node": ">=6" } }, "node_modules/memory-fs": { "version": "0.4.1", "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz", "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=", "dependencies": { "errno": "^0.1.3", "readable-stream": "^2.0.1" } }, "node_modules/micromatch": { "version": "3.1.10", "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", "dependencies": { "arr-diff": "^4.0.0", "array-unique": "^0.3.2", "braces": "^2.3.1", "define-property": "^2.0.2", "extend-shallow": "^3.0.2", "extglob": "^2.0.4", "fragment-cache": "^0.2.1", "kind-of": "^6.0.2", "nanomatch": "^1.2.9", "object.pick": "^1.3.0", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/miller-rabin": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz", "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==", "dependencies": { "bn.js": "^4.0.0", "brorand": "^1.0.1" }, "bin": { "miller-rabin": "bin/miller-rabin" } }, "node_modules/mimic-fn": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/mimic-fn/-/mimic-fn-2.1.0.tgz", "integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==", "engines": { "node": ">=6" } }, "node_modules/minimalistic-assert": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==" }, "node_modules/minimalistic-crypto-utils": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz", "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=" }, "node_modules/minimatch": { "version": "3.0.4", "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz", "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==", "dependencies": { "brace-expansion": "^1.1.7" }, "engines": { "node": "*" } }, "node_modules/minimist": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=" }, "node_modules/mississippi": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz", "integrity": "sha512-x471SsVjUtBRtcvd4BzKE9kFC+/2TeWgKCgw0bZcw1b9l2X3QX5vCWgF+KaZaYm87Ss//rHnWryupDrgLvmSkA==", "dependencies": { "concat-stream": "^1.5.0", "duplexify": "^3.4.2", "end-of-stream": "^1.1.0", "flush-write-stream": "^1.0.0", "from2": "^2.1.0", "parallel-transform": "^1.1.0", "pump": "^3.0.0", "pumpify": "^1.3.3", "stream-each": "^1.1.0", "through2": "^2.0.0" }, "engines": { "node": ">=4.0.0" } }, "node_modules/mixin-deep": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.2.tgz", "integrity": "sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==", "dependencies": { "for-in": "^1.0.2", "is-extendable": "^1.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/mixin-deep/node_modules/is-extendable": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", "dependencies": { "is-plain-object": "^2.0.4" }, "engines": { "node": ">=0.10.0" } }, "node_modules/mkdirp": { "version": "0.5.1", "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=", "dependencies": { "minimist": "0.0.8" }, "bin": { "mkdirp": "bin/cmd.js" } }, "node_modules/mkdirp/node_modules/minimist": { "version": "0.0.8", "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz", "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=" }, "node_modules/move-concurrently": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz", "integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=", "dependencies": { "aproba": "^1.1.1", "copy-concurrently": "^1.0.0", "fs-write-stream-atomic": "^1.0.8", "mkdirp": "^0.5.1", "rimraf": "^2.5.4", "run-queue": "^1.0.3" } }, "node_modules/ms": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" }, "node_modules/nan": { "version": "2.14.0", "resolved": "https://registry.npmjs.org/nan/-/nan-2.14.0.tgz", "integrity": "sha512-INOFj37C7k3AfaNTtX8RhsTw7qRy7eLET14cROi9+5HAVbbHuIWUHEauBv5qT4Av2tWasiTY1Jw6puUNqRJXQg==", "optional": true }, "node_modules/nanomatch": { "version": "1.2.13", "resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz", "integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==", "dependencies": { "arr-diff": "^4.0.0", "array-unique": "^0.3.2", "define-property": "^2.0.2", "extend-shallow": "^3.0.2", "fragment-cache": "^0.2.1", "is-windows": "^1.0.2", "kind-of": "^6.0.2", "object.pick": "^1.3.0", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/neo-async": { "version": "2.6.1", "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.1.tgz", "integrity": "sha512-iyam8fBuCUpWeKPGpaNMetEocMt364qkCsfL9JuhjXX6dRnguRVOfk2GZaDpPjcOKiiXCPINZC1GczQ7iTq3Zw==" }, "node_modules/nice-try": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz", "integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==" }, "node_modules/node-libs-browser": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz", "integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==", "dependencies": { "assert": "^1.1.1", "browserify-zlib": "^0.2.0", "buffer": "^4.3.0", "console-browserify": "^1.1.0", "constants-browserify": "^1.0.0", "crypto-browserify": "^3.11.0", "domain-browser": "^1.1.1", "events": "^3.0.0", "https-browserify": "^1.0.0", "os-browserify": "^0.3.0", "path-browserify": "0.0.1", "process": "^0.11.10", "punycode": "^1.2.4", "querystring-es3": "^0.2.0", "readable-stream": "^2.3.3", "stream-browserify": "^2.0.1", "stream-http": "^2.7.2", "string_decoder": "^1.0.0", "timers-browserify": "^2.0.4", "tty-browserify": "0.0.0", "url": "^0.11.0", "util": "^0.11.0", "vm-browserify": "^1.0.1" } }, "node_modules/node-libs-browser/node_modules/punycode": { "version": "1.4.1", "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz", "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=" }, "node_modules/node-releases": { "version": "1.1.61", "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-1.1.61.tgz", "integrity": "sha512-DD5vebQLg8jLCOzwupn954fbIiZht05DAZs0k2u8NStSe6h9XdsuIQL8hSRKYiU8WUQRznmSDrKGbv3ObOmC7g==", "dev": true }, "node_modules/normalize-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", "engines": { "node": ">=0.10.0" } }, "node_modules/npm-run-path": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz", "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=", "dependencies": { "path-key": "^2.0.0" }, "engines": { "node": ">=4" } }, "node_modules/object-assign": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=", "engines": { "node": ">=0.10.0" } }, "node_modules/object-copy": { "version": "0.1.0", "resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz", "integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=", "dependencies": { "copy-descriptor": "^0.1.0", "define-property": "^0.2.5", "kind-of": "^3.0.3" }, "engines": { "node": ">=0.10.0" } }, "node_modules/object-copy/node_modules/define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "dependencies": { "is-descriptor": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/object-copy/node_modules/kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "dependencies": { "is-buffer": "^1.1.5" }, "engines": { "node": ">=0.10.0" } }, "node_modules/object-keys": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==", "dev": true, "engines": { "node": ">= 0.4" } }, "node_modules/object-visit": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz", "integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=", "dependencies": { "isobject": "^3.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/object.assign": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.0.tgz", "integrity": "sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==", "dev": true, "dependencies": { "define-properties": "^1.1.2", "function-bind": "^1.1.1", "has-symbols": "^1.0.0", "object-keys": "^1.0.11" }, "engines": { "node": ">= 0.4" } }, "node_modules/object.pick": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz", "integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=", "dependencies": { "isobject": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/once": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", "dependencies": { "wrappy": "1" } }, "node_modules/orderedmap": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/orderedmap/-/orderedmap-1.1.1.tgz", "integrity": "sha512-3Ux8um0zXbVacKUkcytc0u3HgC0b0bBLT+I60r2J/En72cI0nZffqrA7Xtf2Hqs27j1g82llR5Mhbd0Z1XW4AQ==" }, "node_modules/os-browserify": { "version": "0.3.0", "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz", "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=" }, "node_modules/os-homedir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=", "engines": { "node": ">=0.10.0" } }, "node_modules/os-locale": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-3.1.0.tgz", "integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==", "dependencies": { "execa": "^1.0.0", "lcid": "^2.0.0", "mem": "^4.0.0" }, "engines": { "node": ">=6" } }, "node_modules/os-tmpdir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=", "engines": { "node": ">=0.10.0" } }, "node_modules/p-defer": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/p-defer/-/p-defer-1.0.0.tgz", "integrity": "sha1-n26xgvbJqozXQwBKfU+WsZaw+ww=", "engines": { "node": ">=4" } }, "node_modules/p-finally": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz", "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=", "engines": { "node": ">=4" } }, "node_modules/p-is-promise": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/p-is-promise/-/p-is-promise-2.1.0.tgz", "integrity": "sha512-Y3W0wlRPK8ZMRbNq97l4M5otioeA5lm1z7bkNkxCka8HSPjR0xRWmpCmc9utiaLP9Jb1eD8BgeIxTW4AIF45Pg==", "engines": { "node": ">=6" } }, "node_modules/p-limit": { "version": "2.2.2", "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", "integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==", "dependencies": { "p-try": "^2.0.0" }, "engines": { "node": ">=6" } }, "node_modules/p-locate": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", "dependencies": { "p-limit": "^2.0.0" }, "engines": { "node": ">=6" } }, "node_modules/p-try": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", "engines": { "node": ">=6" } }, "node_modules/pako": { "version": "1.0.11", "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz", "integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==" }, "node_modules/parallel-transform": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.2.0.tgz", "integrity": "sha512-P2vSmIu38uIlvdcU7fDkyrxj33gTUy/ABO5ZUbGowxNCopBq/OoD42bP4UmMrJoPyk4Uqf0mu3mtWBhHCZD8yg==", "dependencies": { "cyclist": "^1.0.1", "inherits": "^2.0.3", "readable-stream": "^2.1.5" } }, "node_modules/parse-asn1": { "version": "5.1.5", "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.5.tgz", "integrity": "sha512-jkMYn1dcJqF6d5CpU689bq7w/b5ALS9ROVSpQDPrZsqqesUJii9qutvoT5ltGedNXMO2e16YUWIghG9KxaViTQ==", "dependencies": { "asn1.js": "^4.0.0", "browserify-aes": "^1.0.0", "create-hash": "^1.1.0", "evp_bytestokey": "^1.0.0", "pbkdf2": "^3.0.3", "safe-buffer": "^5.1.1" } }, "node_modules/parse-passwd": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/parse-passwd/-/parse-passwd-1.0.0.tgz", "integrity": "sha1-bVuTSkVpk7I9N/QKOC1vFmao5cY=", "engines": { "node": ">=0.10.0" } }, "node_modules/pascalcase": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz", "integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=", "engines": { "node": ">=0.10.0" } }, "node_modules/path-browserify": { "version": "0.0.1", "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz", "integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ==" }, "node_modules/path-dirname": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz", "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=" }, "node_modules/path-exists": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", "engines": { "node": ">=4" } }, "node_modules/path-is-absolute": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=", "engines": { "node": ">=0.10.0" } }, "node_modules/path-key": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz", "integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=", "engines": { "node": ">=4" } }, "node_modules/path-parse": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz", "integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==", "dev": true }, "node_modules/pbkdf2": { "version": "3.0.17", "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.0.17.tgz", "integrity": "sha512-U/il5MsrZp7mGg3mSQfn742na2T+1/vHDCG5/iTI3X9MKUuYUZVLQhyRsg06mCgDBTd57TxzgZt7P+fYfjRLtA==", "dependencies": { "create-hash": "^1.1.2", "create-hmac": "^1.1.4", "ripemd160": "^2.0.1", "safe-buffer": "^5.0.1", "sha.js": "^2.4.8" }, "engines": { "node": ">=0.12" } }, "node_modules/pify": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz", "integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==", "engines": { "node": ">=6" } }, "node_modules/pkg-dir": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", "dependencies": { "find-up": "^3.0.0" }, "engines": { "node": ">=6" } }, "node_modules/posix-character-classes": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz", "integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=", "engines": { "node": ">=0.10.0" } }, "node_modules/prettier": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/prettier/-/prettier-2.2.1.tgz", "integrity": "sha512-PqyhM2yCjg/oKkFPtTGUojv7gnZAoG80ttl45O6x2Ug/rMJw4wcc9k6aaf2hibP7BGVCCM33gZoGjyvt9mm16Q==", "dev": true, "bin": { "prettier": "bin-prettier.js" }, "engines": { "node": ">=10.13.0" } }, "node_modules/private": { "version": "0.1.8", "resolved": "https://registry.npmjs.org/private/-/private-0.1.8.tgz", "integrity": "sha512-VvivMrbvd2nKkiG38qjULzlc+4Vx4wm/whI9pQD35YrARNnhxeiRktSOhSukRLFNlzg6Br/cJPet5J/u19r/mg==", "engines": { "node": ">= 0.6" } }, "node_modules/process": { "version": "0.11.10", "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz", "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=", "engines": { "node": ">= 0.6.0" } }, "node_modules/process-nextick-args": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==" }, "node_modules/promise-inflight": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz", "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=" }, "node_modules/prosemirror-commands": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-commands/-/prosemirror-commands-1.1.3.tgz", "integrity": "sha512-YVbKwTR4likoyhuwIUC9egbzHvnFrFUNbiesB0DB/HZ8hBcopQ42Tb4KGlYrS3n+pNDTFObN73CLFY6mYLN2IQ==", "dependencies": { "prosemirror-model": "^1.0.0", "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "node_modules/prosemirror-dropcursor": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/prosemirror-dropcursor/-/prosemirror-dropcursor-1.3.2.tgz", "integrity": "sha512-4c94OUGyobGnwcQI70OXyMhE/9T4aTgjU+CHxkd5c7D+jH/J0mKM/lk+jneFVKt7+E4/M0D9HzRPifu8U28Thw==", "dependencies": { "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.1.0", "prosemirror-view": "^1.1.0" } }, "node_modules/prosemirror-example-setup": { "version": "1.1.2", - "resolved": "https://registry.npmjs.org/prosemirror-example-setup/-/prosemirror-example-setup-1.1.2.tgz", - "integrity": "sha512-MTpIMyqk08jFnzxeRMCinCEMtVSTUtxKgQBGxfCbVe9C6zIOqp9qZZJz5Ojaad1GETySyuj8+OIHHvQsIaaaGQ==", + "resolved": "git+ssh://git@github.com/writefreely/prosemirror-example-setup.git#aaea7d62ebc2fa769139faf8a097449441c8237c", + "license": "MIT", "dependencies": { "prosemirror-commands": "^1.0.0", "prosemirror-dropcursor": "^1.0.0", "prosemirror-gapcursor": "^1.0.0", "prosemirror-history": "^1.0.0", "prosemirror-inputrules": "^1.0.0", "prosemirror-keymap": "^1.0.0", "prosemirror-menu": "^1.0.0", "prosemirror-schema-list": "^1.0.0", "prosemirror-state": "^1.0.0" } }, "node_modules/prosemirror-gapcursor": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-gapcursor/-/prosemirror-gapcursor-1.1.3.tgz", "integrity": "sha512-/lgWvt2AdHjsM6oEsF65z0lhdQJGl6sQSfXSOX8/xjpd8ycfOolhgKZd4TPYpikwnh85JF4l5eIyiFZsl/RQQA==", "dependencies": { "prosemirror-keymap": "^1.0.0", "prosemirror-model": "^1.0.0", "prosemirror-state": "^1.0.0", "prosemirror-view": "^1.0.0" } }, "node_modules/prosemirror-history": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-history/-/prosemirror-history-1.1.3.tgz", "integrity": "sha512-zGDotijea+vnfnyyUGyiy1wfOQhf0B/b6zYcCouBV8yo6JmrE9X23M5q7Nf/nATywEZbgRLG70R4DmfSTC+gfg==", "dependencies": { "prosemirror-state": "^1.2.2", "prosemirror-transform": "^1.0.0", "rope-sequence": "^1.3.0" } }, "node_modules/prosemirror-inputrules": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/prosemirror-inputrules/-/prosemirror-inputrules-1.1.2.tgz", "integrity": "sha512-Ja5Z3BWestlHYGvtSGqyvxMeB8QEuBjlHM8YnKtLGUXMDp965qdDV4goV8lJb17kIWHk7e7JNj6Catuoa3302g==", "dependencies": { "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "node_modules/prosemirror-keymap": { "version": "1.1.4", "resolved": "https://registry.npmjs.org/prosemirror-keymap/-/prosemirror-keymap-1.1.4.tgz", "integrity": "sha512-Al8cVUOnDFL4gcI5IDlG6xbZ0aOD/i3B17VT+1JbHWDguCgt/lBHVTHUBcKvvbSg6+q/W4Nj1Fu6bwZSca3xjg==", "dependencies": { "prosemirror-state": "^1.0.0", "w3c-keyname": "^2.2.0" } }, "node_modules/prosemirror-markdown": { - "resolved": "git+ssh://git@github.com/VV-EE/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2", + "version": "1.5.1", + "resolved": "git+ssh://git@github.com/writefreely/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2", + "license": "MIT", "dependencies": { "markdown-it": "^10.0.0", "prosemirror-model": "^1.0.0" } }, "node_modules/prosemirror-markdown/node_modules/argparse": { "version": "1.0.10", "resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz", "integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==", "dependencies": { "sprintf-js": "~1.0.2" } }, "node_modules/prosemirror-markdown/node_modules/entities": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/entities/-/entities-2.0.3.tgz", "integrity": "sha512-MyoZ0jgnLvB2X3Lg5HqpFmn1kybDiIfEQmKzTb5apr51Rb+T3KdmMiqa70T+bhGnyv7bQ6WMj2QMHpGMmlrUYQ==" }, "node_modules/prosemirror-markdown/node_modules/linkify-it": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-2.2.0.tgz", "integrity": "sha512-GnAl/knGn+i1U/wjBz3akz2stz+HrHLsxMwHQGofCDfPvlf+gDKN58UtfmUquTY4/MXeE2x7k19KQmeoZi94Iw==", "dependencies": { "uc.micro": "^1.0.1" } }, "node_modules/prosemirror-markdown/node_modules/markdown-it": { "version": "10.0.0", "resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-10.0.0.tgz", "integrity": "sha512-YWOP1j7UbDNz+TumYP1kpwnP0aEa711cJjrAQrzd0UXlbJfc5aAq0F/PZHjiioqDC1NKgvIMX+o+9Bk7yuM2dg==", "dependencies": { "argparse": "^1.0.7", "entities": "~2.0.0", "linkify-it": "^2.0.0", "mdurl": "^1.0.1", "uc.micro": "^1.0.5" }, "bin": { "markdown-it": "bin/markdown-it.js" } }, "node_modules/prosemirror-menu": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-menu/-/prosemirror-menu-1.1.3.tgz", "integrity": "sha512-G+XiTdiVi1uGeiBR1OqtiVP3p0XyCKec4DYLk75G7J2R/N8OThHt/1StJYDlXPNzqYsQFZfQyPp/UwOL8hD6AA==", "dependencies": { "crel": "^4.2.0", "prosemirror-commands": "^1.0.0", "prosemirror-history": "^1.0.0", "prosemirror-state": "^1.0.0" } }, "node_modules/prosemirror-model": { "version": "1.9.1", "resolved": "https://registry.npmjs.org/prosemirror-model/-/prosemirror-model-1.9.1.tgz", "integrity": "sha512-Qblh8pm1c7Ll64sYLauwwzjimo/tFg1zW3Q3IWhKRhvfOEgRKqa6dC5pRrAa+XHOIjBFEYrqbi52J5bqA2dV8Q==", "dependencies": { "orderedmap": "^1.1.0" } }, "node_modules/prosemirror-schema-list": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/prosemirror-schema-list/-/prosemirror-schema-list-1.1.2.tgz", "integrity": "sha512-dgM9PwtM4twa5WsgSYMB+J8bwjnR43DAD3L9MsR9rKm/nZR5Y85xcjB7gusVMSsbQ2NomMZF03RE6No6mTnclQ==", "dependencies": { "prosemirror-model": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "node_modules/prosemirror-state": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/prosemirror-state/-/prosemirror-state-1.3.2.tgz", "integrity": "sha512-t/JqE3aR0SV9QrzFVkAXsQwsgrQBNs/BDbcFH20RssW0xauqNNdjTXxy/J/kM7F+0zYi6+BRmz7cMMQQFU3mwQ==", "dependencies": { "prosemirror-model": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "node_modules/prosemirror-transform": { "version": "1.2.4", "resolved": "https://registry.npmjs.org/prosemirror-transform/-/prosemirror-transform-1.2.4.tgz", "integrity": "sha512-0A668uf0EN89L9O9brE05kHcqp7FHmT5YN7Tom58Kj926QqOBs7iNRHDLWxrSaQB5MNZtzDOD9T3EyJ88YDcBg==", "dependencies": { "prosemirror-model": "^1.0.0" } }, "node_modules/prosemirror-view": { "version": "1.14.2", "resolved": "https://registry.npmjs.org/prosemirror-view/-/prosemirror-view-1.14.2.tgz", "integrity": "sha512-9yPVH6OLyaEraHjWHbSk2DB0R/1TsEE6AA1LI+vmCypXXA+zTzNrktUFzBhSJHehXDoEJcQfnl1Wdp5GPSh2+g==", "dependencies": { "prosemirror-model": "^1.1.0", "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.1.0" } }, "node_modules/prr": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz", "integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY=" }, "node_modules/public-encrypt": { "version": "4.0.3", "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz", "integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==", "dependencies": { "bn.js": "^4.1.0", "browserify-rsa": "^4.0.0", "create-hash": "^1.1.0", "parse-asn1": "^5.0.0", "randombytes": "^2.0.1", "safe-buffer": "^5.1.2" } }, "node_modules/pump": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", "dependencies": { "end-of-stream": "^1.1.0", "once": "^1.3.1" } }, "node_modules/pumpify": { "version": "1.5.1", "resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz", "integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==", "dependencies": { "duplexify": "^3.6.0", "inherits": "^2.0.3", "pump": "^2.0.0" } }, "node_modules/pumpify/node_modules/pump": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz", "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", "dependencies": { "end-of-stream": "^1.1.0", "once": "^1.3.1" } }, "node_modules/punycode": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz", "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==", "engines": { "node": ">=6" } }, "node_modules/querystring": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz", "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=", "engines": { "node": ">=0.4.x" } }, "node_modules/querystring-es3": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz", "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=", "engines": { "node": ">=0.4.x" } }, "node_modules/randombytes": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", "integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==", "dependencies": { "safe-buffer": "^5.1.0" } }, "node_modules/randomfill": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz", "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==", "dependencies": { "randombytes": "^2.0.5", "safe-buffer": "^5.1.0" } }, "node_modules/readable-stream": { "version": "2.3.7", "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", "dependencies": { "core-util-is": "~1.0.0", "inherits": "~2.0.3", "isarray": "~1.0.0", "process-nextick-args": "~2.0.0", "safe-buffer": "~5.1.1", "string_decoder": "~1.1.1", "util-deprecate": "~1.0.1" } }, "node_modules/readdirp": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", "dependencies": { "graceful-fs": "^4.1.11", "micromatch": "^3.1.10", "readable-stream": "^2.0.2" }, "engines": { "node": ">=0.10" } }, "node_modules/regenerate": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/regenerate/-/regenerate-1.4.0.tgz", "integrity": "sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg==" }, "node_modules/regenerate-unicode-properties": { "version": "8.2.0", "resolved": "https://registry.npmjs.org/regenerate-unicode-properties/-/regenerate-unicode-properties-8.2.0.tgz", "integrity": "sha512-F9DjY1vKLo/tPePDycuH3dn9H1OTPIkVD9Kz4LODu+F2C75mgjAJ7x/gwy6ZcSNRAAkhNlJSOHRe8k3p+K9WhA==", "dev": true, "dependencies": { "regenerate": "^1.4.0" }, "engines": { "node": ">=4" } }, "node_modules/regenerator-runtime": { "version": "0.11.1", "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz", "integrity": "sha512-MguG95oij0fC3QV3URf4V2SDYGJhJnJGqvIIgdECeODCT98wSWDAJ94SSuVpYQUoTcGUIL6L4yNB7j1DFFHSBg==" }, "node_modules/regenerator-transform": { "version": "0.10.1", "resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.10.1.tgz", "integrity": "sha512-PJepbvDbuK1xgIgnau7Y90cwaAmO/LCLMI2mPvaXq2heGMR3aWW5/BQvYrhJ8jgmQjXewXvBjzfqKcVOmhjZ6Q==", "dependencies": { "babel-runtime": "^6.18.0", "babel-types": "^6.19.0", "private": "^0.1.6" } }, "node_modules/regex-not": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz", "integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==", "dependencies": { "extend-shallow": "^3.0.2", "safe-regex": "^1.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/regexpu-core": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-2.0.0.tgz", "integrity": "sha1-SdA4g3uNz4v6W5pCE5k45uoq4kA=", "dependencies": { "regenerate": "^1.2.1", "regjsgen": "^0.2.0", "regjsparser": "^0.1.4" } }, "node_modules/regjsgen": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz", "integrity": "sha1-bAFq3qxVT3WCP+N6wFuS1aTtsfc=" }, "node_modules/regjsparser": { "version": "0.1.5", "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz", "integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=", "dependencies": { "jsesc": "~0.5.0" }, "bin": { "regjsparser": "bin/parser" } }, "node_modules/regjsparser/node_modules/jsesc": { "version": "0.5.0", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz", "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=", "bin": { "jsesc": "bin/jsesc" } }, "node_modules/remove-trailing-separator": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz", "integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8=" }, "node_modules/repeat-element": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz", "integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==", "engines": { "node": ">=0.10.0" } }, "node_modules/repeat-string": { "version": "1.6.1", "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz", "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=", "engines": { "node": ">=0.10" } }, "node_modules/repeating": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz", "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=", "dependencies": { "is-finite": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/require-directory": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=", "engines": { "node": ">=0.10.0" } }, "node_modules/require-main-filename": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" }, "node_modules/resolve": { "version": "1.15.1", "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.15.1.tgz", "integrity": "sha512-84oo6ZTtoTUpjgNEr5SJyzQhzL72gaRodsSfyxC/AXRvwu0Yse9H8eF9IpGo7b8YetZhlI6v7ZQ6bKBFV/6S7w==", "dev": true, "dependencies": { "path-parse": "^1.0.6" } }, "node_modules/resolve-cwd": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz", "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", "dependencies": { "resolve-from": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/resolve-dir": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/resolve-dir/-/resolve-dir-1.0.1.tgz", "integrity": "sha1-eaQGRMNivoLybv/nOcm7U4IEb0M=", "dependencies": { "expand-tilde": "^2.0.0", "global-modules": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/resolve-dir/node_modules/global-modules": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz", "integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==", "dependencies": { "global-prefix": "^1.0.1", "is-windows": "^1.0.1", "resolve-dir": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/resolve-from": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=", "engines": { "node": ">=4" } }, "node_modules/resolve-url": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz", "integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=" }, "node_modules/ret": { "version": "0.1.15", "resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz", "integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==", "engines": { "node": ">=0.12" } }, "node_modules/rimraf": { "version": "2.7.1", "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", "dependencies": { "glob": "^7.1.3" }, "bin": { "rimraf": "bin.js" } }, "node_modules/ripemd160": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz", "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==", "dependencies": { "hash-base": "^3.0.0", "inherits": "^2.0.1" } }, "node_modules/rope-sequence": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/rope-sequence/-/rope-sequence-1.3.2.tgz", "integrity": "sha512-ku6MFrwEVSVmXLvy3dYph3LAMNS0890K7fabn+0YIRQ2T96T9F4gkFf0vf0WW0JUraNWwGRtInEpH7yO4tbQZg==" }, "node_modules/run-queue": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz", "integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=", "dependencies": { "aproba": "^1.1.1" } }, "node_modules/safe-buffer": { "version": "5.1.2", "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" }, "node_modules/safe-regex": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz", "integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=", "dependencies": { "ret": "~0.1.10" } }, "node_modules/schema-utils": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", "dependencies": { "ajv": "^6.1.0", "ajv-errors": "^1.0.0", "ajv-keywords": "^3.1.0" }, "engines": { "node": ">= 4" } }, "node_modules/semver": { "version": "5.7.1", "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", "bin": { "semver": "bin/semver" } }, "node_modules/serialize-javascript": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-2.1.2.tgz", "integrity": "sha512-rs9OggEUF0V4jUSecXazOYsLfu7OGK2qIn3c7IPBiffz32XniEp/TX9Xmc9LQfK2nQ2QKHvZ2oygKUGU0lG4jQ==" }, "node_modules/set-blocking": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=" }, "node_modules/set-value": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.1.tgz", "integrity": "sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==", "dependencies": { "extend-shallow": "^2.0.1", "is-extendable": "^0.1.1", "is-plain-object": "^2.0.3", "split-string": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/set-value/node_modules/extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "dependencies": { "is-extendable": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/setimmediate": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz", "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=" }, "node_modules/sha.js": { "version": "2.4.11", "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", "dependencies": { "inherits": "^2.0.1", "safe-buffer": "^5.0.1" }, "bin": { "sha.js": "bin.js" } }, "node_modules/shebang-command": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz", "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=", "dependencies": { "shebang-regex": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/shebang-regex": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz", "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=", "engines": { "node": ">=0.10.0" } }, "node_modules/signal-exit": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz", "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=" }, "node_modules/slash": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz", "integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU=", "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon": { "version": "0.8.2", "resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz", "integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==", "dependencies": { "base": "^0.11.1", "debug": "^2.2.0", "define-property": "^0.2.5", "extend-shallow": "^2.0.1", "map-cache": "^0.2.2", "source-map": "^0.5.6", "source-map-resolve": "^0.5.0", "use": "^3.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon-node": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz", "integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==", "dependencies": { "define-property": "^1.0.0", "isobject": "^3.0.0", "snapdragon-util": "^3.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon-node/node_modules/define-property": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "dependencies": { "is-descriptor": "^1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon-node/node_modules/is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon-node/node_modules/is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "dependencies": { "kind-of": "^6.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon-node/node_modules/is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "dependencies": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon-util": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz", "integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==", "dependencies": { "kind-of": "^3.2.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon-util/node_modules/kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "dependencies": { "is-buffer": "^1.1.5" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon/node_modules/define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "dependencies": { "is-descriptor": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/snapdragon/node_modules/extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "dependencies": { "is-extendable": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/source-list-map": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.1.tgz", "integrity": "sha512-qnQ7gVMxGNxsiL4lEuJwe/To8UnK7fAnmbGEEH8RpLouuKbeEm0lhbQVFIrNSuB+G7tVrAlVsZgETT5nljf+Iw==" }, "node_modules/source-map": { "version": "0.5.7", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", "engines": { "node": ">=0.10.0" } }, "node_modules/source-map-resolve": { "version": "0.5.3", "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.3.tgz", "integrity": "sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw==", "dependencies": { "atob": "^2.1.2", "decode-uri-component": "^0.2.0", "resolve-url": "^0.2.1", "source-map-url": "^0.4.0", "urix": "^0.1.0" } }, "node_modules/source-map-support": { "version": "0.5.16", "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.16.tgz", "integrity": "sha512-efyLRJDr68D9hBBNIPWFjhpFzURh+KJykQwvMyW5UiZzYwoF6l4YMMDIJJEyFWxWCqfyxLzz6tSfUFR+kXXsVQ==", "dependencies": { "buffer-from": "^1.0.0", "source-map": "^0.6.0" } }, "node_modules/source-map-support/node_modules/source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", "engines": { "node": ">=0.10.0" } }, "node_modules/source-map-url": { "version": "0.4.0", "resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz", "integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=" }, "node_modules/split-string": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz", "integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==", "dependencies": { "extend-shallow": "^3.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/sprintf-js": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz", "integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=" }, "node_modules/ssri": { "version": "6.0.1", "resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz", "integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==", "dependencies": { "figgy-pudding": "^3.5.1" } }, "node_modules/static-extend": { "version": "0.1.2", "resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz", "integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=", "dependencies": { "define-property": "^0.2.5", "object-copy": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/static-extend/node_modules/define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "dependencies": { "is-descriptor": "^0.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/stream-browserify": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz", "integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==", "dependencies": { "inherits": "~2.0.1", "readable-stream": "^2.0.2" } }, "node_modules/stream-each": { "version": "1.2.3", "resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz", "integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==", "dependencies": { "end-of-stream": "^1.1.0", "stream-shift": "^1.0.0" } }, "node_modules/stream-http": { "version": "2.8.3", "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz", "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==", "dependencies": { "builtin-status-codes": "^3.0.0", "inherits": "^2.0.1", "readable-stream": "^2.3.6", "to-arraybuffer": "^1.0.0", "xtend": "^4.0.0" } }, "node_modules/stream-shift": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.1.tgz", "integrity": "sha512-AiisoFqQ0vbGcZgQPY1cdP2I76glaVA/RauYR4G4thNFgkTqr90yXTo4LYX60Jl+sIlPNHHdGSwo01AvbKUSVQ==" }, "node_modules/string_decoder": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", "dependencies": { "safe-buffer": "~5.1.0" } }, "node_modules/string-width": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", "dependencies": { "emoji-regex": "^7.0.1", "is-fullwidth-code-point": "^2.0.0", "strip-ansi": "^5.1.0" }, "engines": { "node": ">=6" } }, "node_modules/string-width/node_modules/ansi-regex": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", "engines": { "node": ">=6" } }, "node_modules/string-width/node_modules/strip-ansi": { "version": "5.2.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "dependencies": { "ansi-regex": "^4.1.0" }, "engines": { "node": ">=6" } }, "node_modules/strip-ansi": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", "dependencies": { "ansi-regex": "^2.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/strip-eof": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=", "engines": { "node": ">=0.10.0" } }, "node_modules/supports-color": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=", "engines": { "node": ">=0.8.0" } }, "node_modules/tapable": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/tapable/-/tapable-1.1.3.tgz", "integrity": "sha512-4WK/bYZmj8xLr+HUCODHGF1ZFzsYffasLUgEiMBY4fgtltdO6B4WJtlSbPaDTLpYTcGVwM2qLnFTICEcNxs3kA==", "engines": { "node": ">=6" } }, "node_modules/terser": { "version": "4.6.6", "resolved": "https://registry.npmjs.org/terser/-/terser-4.6.6.tgz", "integrity": "sha512-4lYPyeNmstjIIESr/ysHg2vUPRGf2tzF9z2yYwnowXVuVzLEamPN1Gfrz7f8I9uEPuHcbFlW4PLIAsJoxXyJ1g==", "dependencies": { "commander": "^2.20.0", "source-map": "~0.6.1", "source-map-support": "~0.5.12" }, "bin": { "terser": "bin/terser" }, "engines": { "node": ">=6.0.0" } }, "node_modules/terser-webpack-plugin": { "version": "1.4.3", "resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.3.tgz", "integrity": "sha512-QMxecFz/gHQwteWwSo5nTc6UaICqN1bMedC5sMtUc7y3Ha3Q8y6ZO0iCR8pq4RJC8Hjf0FEPEHZqcMB/+DFCrA==", "dependencies": { "cacache": "^12.0.2", "find-cache-dir": "^2.1.0", "is-wsl": "^1.1.0", "schema-utils": "^1.0.0", "serialize-javascript": "^2.1.2", "source-map": "^0.6.1", "terser": "^4.1.2", "webpack-sources": "^1.4.0", "worker-farm": "^1.7.0" }, "engines": { "node": ">= 6.9.0" } }, "node_modules/terser-webpack-plugin/node_modules/source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", "engines": { "node": ">=0.10.0" } }, "node_modules/terser/node_modules/source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", "engines": { "node": ">=0.10.0" } }, "node_modules/through2": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", "dependencies": { "readable-stream": "~2.3.6", "xtend": "~4.0.1" } }, "node_modules/timers-browserify": { "version": "2.0.11", "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.11.tgz", "integrity": "sha512-60aV6sgJ5YEbzUdn9c8kYGIqOubPoUdqQCul3SBAsRCZ40s6Y5cMcrW4dt3/k/EsbLVJNl9n6Vz3fTc+k2GeKQ==", "dependencies": { "setimmediate": "^1.0.4" }, "engines": { "node": ">=0.6.0" } }, "node_modules/to-arraybuffer": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz", "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=" }, "node_modules/to-fast-properties": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.3.tgz", "integrity": "sha1-uDVx+k2MJbguIxsG46MFXeTKGkc=", "engines": { "node": ">=0.10.0" } }, "node_modules/to-object-path": { "version": "0.3.0", "resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz", "integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=", "dependencies": { "kind-of": "^3.0.2" }, "engines": { "node": ">=0.10.0" } }, "node_modules/to-object-path/node_modules/kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "dependencies": { "is-buffer": "^1.1.5" }, "engines": { "node": ">=0.10.0" } }, "node_modules/to-regex": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz", "integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==", "dependencies": { "define-property": "^2.0.2", "extend-shallow": "^3.0.2", "regex-not": "^1.0.2", "safe-regex": "^1.1.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/to-regex-range": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", "dependencies": { "is-number": "^3.0.0", "repeat-string": "^1.6.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/trim-right": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/trim-right/-/trim-right-1.0.1.tgz", "integrity": "sha1-yy4SAwZ+DI3h9hQJS5/kVwTqYAM=", "engines": { "node": ">=0.10.0" } }, "node_modules/tslib": { "version": "1.11.1", "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz", "integrity": "sha512-aZW88SY8kQbU7gpV19lN24LtXh/yD4ZZg6qieAJDDg+YBsJcSmLGK9QpnUjAKVG/xefmvJGd1WUmfpT/g6AJGA==" }, "node_modules/tty-browserify": { "version": "0.0.0", "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=" }, "node_modules/typedarray": { "version": "0.0.6", "resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz", "integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=" }, "node_modules/uc.micro": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/uc.micro/-/uc.micro-1.0.6.tgz", "integrity": "sha512-8Y75pvTYkLJW2hWQHXxoqRgV7qb9B+9vFEtidML+7koHUFapnVJAZ6cKs+Qjz5Aw3aZWHMC6u0wJE3At+nSGwA==" }, "node_modules/unicode-canonical-property-names-ecmascript": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-1.0.4.tgz", "integrity": "sha512-jDrNnXWHd4oHiTZnx/ZG7gtUTVp+gCcTTKr8L0HjlwphROEW3+Him+IpvC+xcJEFegapiMZyZe02CyuOnRmbnQ==", "dev": true, "engines": { "node": ">=4" } }, "node_modules/unicode-match-property-ecmascript": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/unicode-match-property-ecmascript/-/unicode-match-property-ecmascript-1.0.4.tgz", "integrity": "sha512-L4Qoh15vTfntsn4P1zqnHulG0LdXgjSO035fEpdtp6YxXhMT51Q6vgM5lYdG/5X3MjS+k/Y9Xw4SFCY9IkR0rg==", "dev": true, "dependencies": { "unicode-canonical-property-names-ecmascript": "^1.0.4", "unicode-property-aliases-ecmascript": "^1.0.4" }, "engines": { "node": ">=4" } }, "node_modules/unicode-match-property-value-ecmascript": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/unicode-match-property-value-ecmascript/-/unicode-match-property-value-ecmascript-1.2.0.tgz", "integrity": "sha512-wjuQHGQVofmSJv1uVISKLE5zO2rNGzM/KCYZch/QQvez7C1hUhBIuZ701fYXExuufJFMPhv2SyL8CyoIfMLbIQ==", "dev": true, "engines": { "node": ">=4" } }, "node_modules/unicode-property-aliases-ecmascript": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/unicode-property-aliases-ecmascript/-/unicode-property-aliases-ecmascript-1.1.0.tgz", "integrity": "sha512-PqSoPh/pWetQ2phoj5RLiaqIk4kCNwoV3CI+LfGmWLKI3rE3kl1h59XpX2BjgDrmbxD9ARtQobPGU1SguCYuQg==", "dev": true, "engines": { "node": ">=4" } }, "node_modules/union-value": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.1.tgz", "integrity": "sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==", "dependencies": { "arr-union": "^3.1.0", "get-value": "^2.0.6", "is-extendable": "^0.1.1", "set-value": "^2.0.1" }, "engines": { "node": ">=0.10.0" } }, "node_modules/unique-filename": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz", "integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==", "dependencies": { "unique-slug": "^2.0.0" } }, "node_modules/unique-slug": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz", "integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==", "dependencies": { "imurmurhash": "^0.1.4" } }, "node_modules/unset-value": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz", "integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=", "dependencies": { "has-value": "^0.3.1", "isobject": "^3.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/unset-value/node_modules/has-value": { "version": "0.3.1", "resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz", "integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=", "dependencies": { "get-value": "^2.0.3", "has-values": "^0.1.4", "isobject": "^2.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/unset-value/node_modules/has-value/node_modules/isobject": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz", "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=", "dependencies": { "isarray": "1.0.0" }, "engines": { "node": ">=0.10.0" } }, "node_modules/unset-value/node_modules/has-values": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz", "integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E=", "engines": { "node": ">=0.10.0" } }, "node_modules/upath": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/upath/-/upath-1.2.0.tgz", "integrity": "sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg==", "engines": { "node": ">=4", "yarn": "*" } }, "node_modules/uri-js": { "version": "4.2.2", "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.2.2.tgz", "integrity": "sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==", "dependencies": { "punycode": "^2.1.0" } }, "node_modules/urix": { "version": "0.1.0", "resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz", "integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=" }, "node_modules/url": { "version": "0.11.0", "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz", "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=", "dependencies": { "punycode": "1.3.2", "querystring": "0.2.0" } }, "node_modules/url/node_modules/punycode": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz", "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=" }, "node_modules/use": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz", "integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==", "engines": { "node": ">=0.10.0" } }, "node_modules/util": { "version": "0.11.1", "resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz", "integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==", "dependencies": { "inherits": "2.0.3" } }, "node_modules/util-deprecate": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=" }, "node_modules/util/node_modules/inherits": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" }, "node_modules/v8-compile-cache": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.0.3.tgz", "integrity": "sha512-CNmdbwQMBjwr9Gsmohvm0pbL954tJrNzf6gWL3K+QMQf00PF7ERGrEiLgjuU3mKreLC2MeGhUsNV9ybTbLgd3w==" }, "node_modules/vm-browserify": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz", "integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ==" }, "node_modules/w3c-keyname": { "version": "2.2.4", "resolved": "https://registry.npmjs.org/w3c-keyname/-/w3c-keyname-2.2.4.tgz", "integrity": "sha512-tOhfEwEzFLJzf6d1ZPkYfGj+FWhIpBux9ppoP3rlclw3Z0BZv3N7b7030Z1kYth+6rDuAsXUFr+d0VE6Ed1ikw==" }, "node_modules/watchpack": { "version": "1.6.0", "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.6.0.tgz", "integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==", "dependencies": { "chokidar": "^2.0.2", "graceful-fs": "^4.1.2", "neo-async": "^2.5.0" } }, "node_modules/webpack": { "version": "4.42.0", "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.42.0.tgz", "integrity": "sha512-EzJRHvwQyBiYrYqhyjW9AqM90dE4+s1/XtCfn7uWg6cS72zH+2VPFAlsnW0+W0cDi0XRjNKUMoJtpSi50+Ph6w==", "dependencies": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-module-context": "1.8.5", "@webassemblyjs/wasm-edit": "1.8.5", "@webassemblyjs/wasm-parser": "1.8.5", "acorn": "^6.2.1", "ajv": "^6.10.2", "ajv-keywords": "^3.4.1", "chrome-trace-event": "^1.0.2", "enhanced-resolve": "^4.1.0", "eslint-scope": "^4.0.3", "json-parse-better-errors": "^1.0.2", "loader-runner": "^2.4.0", "loader-utils": "^1.2.3", "memory-fs": "^0.4.1", "micromatch": "^3.1.10", "mkdirp": "^0.5.1", "neo-async": "^2.6.1", "node-libs-browser": "^2.2.1", "schema-utils": "^1.0.0", "tapable": "^1.1.3", "terser-webpack-plugin": "^1.4.3", "watchpack": "^1.6.0", "webpack-sources": "^1.4.1" }, "bin": { "webpack": "bin/webpack.js" }, "engines": { "node": ">=6.11.5" } }, "node_modules/webpack-cli": { "version": "3.3.11", "resolved": "https://registry.npmjs.org/webpack-cli/-/webpack-cli-3.3.11.tgz", "integrity": "sha512-dXlfuml7xvAFwYUPsrtQAA9e4DOe58gnzSxhgrO/ZM/gyXTBowrsYeubyN4mqGhYdpXMFNyQ6emjJS9M7OBd4g==", "dependencies": { "chalk": "2.4.2", "cross-spawn": "6.0.5", "enhanced-resolve": "4.1.0", "findup-sync": "3.0.0", "global-modules": "2.0.0", "import-local": "2.0.0", "interpret": "1.2.0", "loader-utils": "1.2.3", "supports-color": "6.1.0", "v8-compile-cache": "2.0.3", "yargs": "13.2.4" }, "bin": { "webpack-cli": "bin/cli.js" }, "engines": { "node": ">=6.11.5" } }, "node_modules/webpack-cli/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/webpack-cli/node_modules/chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dependencies": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "engines": { "node": ">=4" } }, "node_modules/webpack-cli/node_modules/chalk/node_modules/supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=4" } }, "node_modules/webpack-cli/node_modules/emojis-list": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz", "integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=", "engines": { "node": ">= 0.10" } }, "node_modules/webpack-cli/node_modules/enhanced-resolve": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.0.tgz", "integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==", "dependencies": { "graceful-fs": "^4.1.2", "memory-fs": "^0.4.0", "tapable": "^1.0.0" }, "engines": { "node": ">=6.9.0" } }, "node_modules/webpack-cli/node_modules/loader-utils": { "version": "1.2.3", "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz", "integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==", "dependencies": { "big.js": "^5.2.2", "emojis-list": "^2.0.0", "json5": "^1.0.1" }, "engines": { "node": ">=4.0.0" } }, "node_modules/webpack-cli/node_modules/supports-color": { "version": "6.1.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", "dependencies": { "has-flag": "^3.0.0" }, "engines": { "node": ">=6" } }, "node_modules/webpack-sources": { "version": "1.4.3", "resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.4.3.tgz", "integrity": "sha512-lgTS3Xhv1lCOKo7SA5TjKXMjpSM4sBjNV5+q2bqesbSPs5FjGmU6jjtBSkX9b4qW87vDIsCIlUPOEhbZrMdjeQ==", "dependencies": { "source-list-map": "^2.0.0", "source-map": "~0.6.1" } }, "node_modules/webpack-sources/node_modules/source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", "engines": { "node": ">=0.10.0" } }, "node_modules/which": { "version": "1.3.1", "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz", "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==", "dependencies": { "isexe": "^2.0.0" }, "bin": { "which": "bin/which" } }, "node_modules/which-module": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=" }, "node_modules/worker-farm": { "version": "1.7.0", "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz", "integrity": "sha512-rvw3QTZc8lAxyVrqcSGVm5yP/IJ2UcB3U0graE3LCFoZ0Yn2x4EoVSqJKdB/T5M+FLcRPjz4TDacRf3OCfNUzw==", "dependencies": { "errno": "~0.1.7" } }, "node_modules/wrap-ansi": { "version": "5.1.0", "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz", "integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==", "dependencies": { "ansi-styles": "^3.2.0", "string-width": "^3.0.0", "strip-ansi": "^5.0.0" }, "engines": { "node": ">=6" } }, "node_modules/wrap-ansi/node_modules/ansi-regex": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", "engines": { "node": ">=6" } }, "node_modules/wrap-ansi/node_modules/ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dependencies": { "color-convert": "^1.9.0" }, "engines": { "node": ">=4" } }, "node_modules/wrap-ansi/node_modules/strip-ansi": { "version": "5.2.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "dependencies": { "ansi-regex": "^4.1.0" }, "engines": { "node": ">=6" } }, "node_modules/wrappy": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=" }, "node_modules/xtend": { "version": "4.0.2", "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz", "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==", "engines": { "node": ">=0.4" } }, "node_modules/y18n": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==" }, "node_modules/yallist": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==" }, "node_modules/yargs": { "version": "13.2.4", "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.2.4.tgz", "integrity": "sha512-HG/DWAJa1PAnHT9JAhNa8AbAv3FPaiLzioSjCcmuXXhP8MlpHO5vwls4g4j6n30Z74GVQj8Xa62dWVx1QCGklg==", "dependencies": { "cliui": "^5.0.0", "find-up": "^3.0.0", "get-caller-file": "^2.0.1", "os-locale": "^3.1.0", "require-directory": "^2.1.1", "require-main-filename": "^2.0.0", "set-blocking": "^2.0.0", "string-width": "^3.0.0", "which-module": "^2.0.0", "y18n": "^4.0.0", "yargs-parser": "^13.1.0" } }, "node_modules/yargs-parser": { "version": "13.1.1", "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.1.tgz", "integrity": "sha512-oVAVsHz6uFrg3XQheFII8ESO2ssAf9luWuAd6Wexsu4F3OtIW0o8IribPXYrD4WC24LWtPrJlGy87y5udK+dxQ==", "dependencies": { "camelcase": "^5.0.0", "decamelize": "^1.2.0" } } }, "dependencies": { "@babel/code-frame": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz", "integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==", "dev": true, "requires": { "@babel/highlight": "^7.8.3" } }, "@babel/compat-data": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.11.0.tgz", "integrity": "sha512-TPSvJfv73ng0pfnEOh17bYMPQbI95+nGWc71Ss4vZdRBHTDqmM9Z8ZV4rYz8Ks7sfzc95n30k6ODIq5UGnXcYQ==", "dev": true, "requires": { "browserslist": "^4.12.0", "invariant": "^2.2.4", "semver": "^5.5.0" } }, "@babel/core": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.8.7.tgz", "integrity": "sha512-rBlqF3Yko9cynC5CCFy6+K/w2N+Sq/ff2BPy+Krp7rHlABIr5epbA7OxVeKoMHB39LZOp1UY5SuLjy6uWi35yA==", "dev": true, "requires": { "@babel/code-frame": "^7.8.3", "@babel/generator": "^7.8.7", "@babel/helpers": "^7.8.4", "@babel/parser": "^7.8.7", "@babel/template": "^7.8.6", "@babel/traverse": "^7.8.6", "@babel/types": "^7.8.7", "convert-source-map": "^1.7.0", "debug": "^4.1.0", "gensync": "^1.0.0-beta.1", "json5": "^2.1.0", "lodash": "^4.17.13", "resolve": "^1.3.2", "semver": "^5.4.1", "source-map": "^0.5.0" }, "dependencies": { "debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "requires": { "ms": "^2.1.1" } }, "json5": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/json5/-/json5-2.1.1.tgz", "integrity": "sha512-l+3HXD0GEI3huGq1njuqtzYK8OYJyXMkOLtQ53pjWh89tvWS2h6l+1zMkYWqlb57+SiQodKZyvMEFb2X+KrFhQ==", "dev": true, "requires": { "minimist": "^1.2.0" } }, "ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true } } }, "@babel/generator": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.8.7.tgz", "integrity": "sha512-DQwjiKJqH4C3qGiyQCAExJHoZssn49JTMJgZ8SANGgVFdkupcUhLOdkAeoC6kmHZCPfoDG5M0b6cFlSN5wW7Ew==", "dev": true, "requires": { "@babel/types": "^7.8.7", "jsesc": "^2.5.1", "lodash": "^4.17.13", "source-map": "^0.5.0" }, "dependencies": { "jsesc": { "version": "2.5.2", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", "dev": true } } }, "@babel/helper-annotate-as-pure": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.10.4.tgz", "integrity": "sha512-XQlqKQP4vXFB7BN8fEEerrmYvHp3fK/rBkRFz9jaJbzK0B1DSfej9Kc7ZzE8Z/OnId1jpJdNAZ3BFQjWG68rcA==", "dev": true, "requires": { "@babel/types": "^7.10.4" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-builder-binary-assignment-operator-visitor": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.10.4.tgz", "integrity": "sha512-L0zGlFrGWZK4PbT8AszSfLTM5sDU1+Az/En9VrdT8/LmEiJt4zXt+Jve9DCAnQcbqDhCI+29y/L93mrDzddCcg==", "dev": true, "requires": { "@babel/helper-explode-assignable-expression": "^7.10.4", "@babel/types": "^7.10.4" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-compilation-targets": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.10.4.tgz", "integrity": "sha512-a3rYhlsGV0UHNDvrtOXBg8/OpfV0OKTkxKPzIplS1zpx7CygDcWWxckxZeDd3gzPzC4kUT0A4nVFDK0wGMh4MQ==", "dev": true, "requires": { "@babel/compat-data": "^7.10.4", "browserslist": "^4.12.0", "invariant": "^2.2.4", "levenary": "^1.1.1", "semver": "^5.5.0" } }, "@babel/helper-create-class-features-plugin": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/helper-create-class-features-plugin/-/helper-create-class-features-plugin-7.10.5.tgz", "integrity": "sha512-0nkdeijB7VlZoLT3r/mY3bUkw3T8WG/hNw+FATs/6+pG2039IJWjTYL0VTISqsNHMUTEnwbVnc89WIJX9Qed0A==", "dev": true, "requires": { "@babel/helper-function-name": "^7.10.4", "@babel/helper-member-expression-to-functions": "^7.10.5", "@babel/helper-optimise-call-expression": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4", "@babel/helper-split-export-declaration": "^7.10.4" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { "@babel/types": "^7.10.4" } }, "@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "requires": { "@babel/types": "^7.11.0" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-create-regexp-features-plugin": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-create-regexp-features-plugin/-/helper-create-regexp-features-plugin-7.10.4.tgz", "integrity": "sha512-2/hu58IEPKeoLF45DBwx3XFqsbCXmkdAay4spVr2x0jYgRxrSNp+ePwvSsy9g6YSaNDcKIQVPXk1Ov8S2edk2g==", "dev": true, "requires": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-regex": "^7.10.4", "regexpu-core": "^4.7.0" }, "dependencies": { "jsesc": { "version": "0.5.0", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz", "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=", "dev": true }, "regexpu-core": { "version": "4.7.0", "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-4.7.0.tgz", "integrity": "sha512-TQ4KXRnIn6tz6tjnrXEkD/sshygKH/j5KzK86X8MkeHyZ8qst/LZ89j3X4/8HEIfHANTFIP/AbXakeRhWIl5YQ==", "dev": true, "requires": { "regenerate": "^1.4.0", "regenerate-unicode-properties": "^8.2.0", "regjsgen": "^0.5.1", "regjsparser": "^0.6.4", "unicode-match-property-ecmascript": "^1.0.4", "unicode-match-property-value-ecmascript": "^1.2.0" } }, "regjsgen": { "version": "0.5.2", "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.5.2.tgz", "integrity": "sha512-OFFT3MfrH90xIW8OOSyUrk6QHD5E9JOTeGodiJeBS3J6IwlgzJMNE/1bZklWz5oTg+9dCMyEetclvCVXOPoN3A==", "dev": true }, "regjsparser": { "version": "0.6.4", "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.6.4.tgz", "integrity": "sha512-64O87/dPDgfk8/RQqC4gkZoGyyWFIEUTTh80CU6CWuK5vkCGyekIx+oKcEIYtP/RAxSQltCZHCNu/mdd7fqlJw==", "dev": true, "requires": { "jsesc": "~0.5.0" } } } }, "@babel/helper-define-map": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/helper-define-map/-/helper-define-map-7.10.5.tgz", "integrity": "sha512-fMw4kgFB720aQFXSVaXr79pjjcW5puTCM16+rECJ/plGS+zByelE8l9nCpV1GibxTnFVmUuYG9U8wYfQHdzOEQ==", "dev": true, "requires": { "@babel/helper-function-name": "^7.10.4", "@babel/types": "^7.10.5", "lodash": "^4.17.19" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { "@babel/types": "^7.10.4" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-explode-assignable-expression": { "version": "7.11.4", "resolved": "https://registry.npmjs.org/@babel/helper-explode-assignable-expression/-/helper-explode-assignable-expression-7.11.4.tgz", "integrity": "sha512-ux9hm3zR4WV1Y3xXxXkdG/0gxF9nvI0YVmKVhvK9AfMoaQkemL3sJpXw+Xbz65azo8qJiEz2XVDUpK3KYhH3ZQ==", "dev": true, "requires": { "@babel/types": "^7.10.4" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-function-name": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.8.3.tgz", "integrity": "sha512-BCxgX1BC2hD/oBlIFUgOCQDOPV8nSINxCwM3o93xP4P9Fq6aV5sgv2cOOITDMtCfQ+3PvHp3l689XZvAM9QyOA==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.8.3", "@babel/template": "^7.8.3", "@babel/types": "^7.8.3" } }, "@babel/helper-get-function-arity": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.8.3.tgz", "integrity": "sha512-FVDR+Gd9iLjUMY1fzE2SR0IuaJToR4RkCDARVfsBBPSP53GEqSFjD8gNyxg246VUyc/ALRxFaAK8rVG7UT7xRA==", "dev": true, "requires": { "@babel/types": "^7.8.3" } }, "@babel/helper-hoist-variables": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.10.4.tgz", "integrity": "sha512-wljroF5PgCk2juF69kanHVs6vrLwIPNp6DLD+Lrl3hoQ3PpPPikaDRNFA+0t81NOoMt2DL6WW/mdU8k4k6ZzuA==", "dev": true, "requires": { "@babel/types": "^7.10.4" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-member-expression-to-functions": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.11.0.tgz", "integrity": "sha512-JbFlKHFntRV5qKw3YC0CvQnDZ4XMwgzzBbld7Ly4Mj4cbFy3KywcR8NtNctRToMWJOVvLINJv525Gd6wwVEx/Q==", "dev": true, "requires": { "@babel/types": "^7.11.0" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-module-imports": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.10.4.tgz", "integrity": "sha512-nEQJHqYavI217oD9+s5MUBzk6x1IlvoS9WTPfgG43CbMEeStE0v+r+TucWdx8KFGowPGvyOkDT9+7DHedIDnVw==", "dev": true, "requires": { "@babel/types": "^7.10.4" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-module-transforms": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.11.0.tgz", "integrity": "sha512-02EVu8COMuTRO1TAzdMtpBPbe6aQ1w/8fePD2YgQmxZU4gpNWaL9gK3Jp7dxlkUlUCJOTaSeA+Hrm1BRQwqIhg==", "dev": true, "requires": { "@babel/helper-module-imports": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4", "@babel/helper-simple-access": "^7.10.4", "@babel/helper-split-export-declaration": "^7.11.0", "@babel/template": "^7.10.4", "@babel/types": "^7.11.0", "lodash": "^4.17.19" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "requires": { "@babel/types": "^7.11.0" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-optimise-call-expression": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.10.4.tgz", "integrity": "sha512-n3UGKY4VXwXThEiKrgRAoVPBMqeoPgHVqiHZOanAJCG9nQUL2pLRQirUzl0ioKclHGpGqRgIOkgcIJaIWLpygg==", "dev": true, "requires": { "@babel/types": "^7.10.4" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-plugin-utils": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.10.4.tgz", "integrity": "sha512-O4KCvQA6lLiMU9l2eawBPMf1xPP8xPfB3iEQw150hOVTqj/rfXz0ThTb4HEzqQfs2Bmo5Ay8BzxfzVtBrr9dVg==", "dev": true }, "@babel/helper-regex": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/helper-regex/-/helper-regex-7.10.5.tgz", "integrity": "sha512-68kdUAzDrljqBrio7DYAEgCoJHxppJOERHOgOrDN7WjOzP0ZQ1LsSDRXcemzVZaLvjaJsJEESb6qt+znNuENDg==", "dev": true, "requires": { "lodash": "^4.17.19" }, "dependencies": { "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true } } }, "@babel/helper-remap-async-to-generator": { "version": "7.11.4", "resolved": "https://registry.npmjs.org/@babel/helper-remap-async-to-generator/-/helper-remap-async-to-generator-7.11.4.tgz", "integrity": "sha512-tR5vJ/vBa9wFy3m5LLv2faapJLnDFxNWff2SAYkSE4rLUdbp7CdObYFgI7wK4T/Mj4UzpjPwzR8Pzmr5m7MHGA==", "dev": true, "requires": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-wrap-function": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-replace-supers": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.10.4.tgz", "integrity": "sha512-sPxZfFXocEymYTdVK1UNmFPBN+Hv5mJkLPsYWwGBxZAxaWfFu+xqp7b6qWD0yjNuNL2VKc6L5M18tOXUP7NU0A==", "dev": true, "requires": { "@babel/helper-member-expression-to-functions": "^7.10.4", "@babel/helper-optimise-call-expression": "^7.10.4", "@babel/traverse": "^7.10.4", "@babel/types": "^7.10.4" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/generator": { "version": "7.11.6", "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz", "integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==", "dev": true, "requires": { "@babel/types": "^7.11.5", "jsesc": "^2.5.1", "source-map": "^0.5.0" } }, "@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { "@babel/types": "^7.10.4" } }, "@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "requires": { "@babel/types": "^7.11.0" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/traverse": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz", "integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/generator": "^7.11.5", "@babel/helper-function-name": "^7.10.4", "@babel/helper-split-export-declaration": "^7.11.0", "@babel/parser": "^7.11.5", "@babel/types": "^7.11.5", "debug": "^4.1.0", "globals": "^11.1.0", "lodash": "^4.17.19" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "requires": { "ms": "^2.1.1" } }, "globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "jsesc": { "version": "2.5.2", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-simple-access": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.10.4.tgz", "integrity": "sha512-0fMy72ej/VEvF8ULmX6yb5MtHG4uH4Dbd6I/aHDb/JVg0bbivwt9Wg+h3uMvX+QSFtwr5MeItvazbrc4jtRAXw==", "dev": true, "requires": { "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-skip-transparent-expression-wrappers": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.11.0.tgz", "integrity": "sha512-0XIdiQln4Elglgjbwo9wuJpL/K7AGCY26kmEt0+pRP0TAj4jjyNq1MjoRvikrTVqKcx4Gysxt4cXvVFXP/JO2Q==", "dev": true, "requires": { "@babel/types": "^7.11.0" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helper-split-export-declaration": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.8.3.tgz", "integrity": "sha512-3x3yOeyBhW851hroze7ElzdkeRXQYQbFIb7gLK1WQYsw2GWDay5gAJNw1sWJ0VFP6z5J1whqeXH/WCdCjZv6dA==", "dev": true, "requires": { "@babel/types": "^7.8.3" } }, "@babel/helper-validator-identifier": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz", "integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==", "dev": true }, "@babel/helper-wrap-function": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-wrap-function/-/helper-wrap-function-7.10.4.tgz", "integrity": "sha512-6py45WvEF0MhiLrdxtRjKjufwLL1/ob2qDJgg5JgNdojBAZSAKnAjkyOCNug6n+OBl4VW76XjvgSFTdaMcW0Ug==", "dev": true, "requires": { "@babel/helper-function-name": "^7.10.4", "@babel/template": "^7.10.4", "@babel/traverse": "^7.10.4", "@babel/types": "^7.10.4" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/generator": { "version": "7.11.6", "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz", "integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==", "dev": true, "requires": { "@babel/types": "^7.11.5", "jsesc": "^2.5.1", "source-map": "^0.5.0" } }, "@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { "@babel/types": "^7.10.4" } }, "@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "requires": { "@babel/types": "^7.11.0" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/traverse": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz", "integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/generator": "^7.11.5", "@babel/helper-function-name": "^7.10.4", "@babel/helper-split-export-declaration": "^7.11.0", "@babel/parser": "^7.11.5", "@babel/types": "^7.11.5", "debug": "^4.1.0", "globals": "^11.1.0", "lodash": "^4.17.19" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "requires": { "ms": "^2.1.1" } }, "globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "jsesc": { "version": "2.5.2", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/helpers": { "version": "7.8.4", "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.8.4.tgz", "integrity": "sha512-VPbe7wcQ4chu4TDQjimHv/5tj73qz88o12EPkO2ValS2QiQS/1F2SsjyIGNnAD0vF/nZS6Cf9i+vW6HIlnaR8w==", "dev": true, "requires": { "@babel/template": "^7.8.3", "@babel/traverse": "^7.8.4", "@babel/types": "^7.8.3" } }, "@babel/highlight": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.8.3.tgz", "integrity": "sha512-PX4y5xQUvy0fnEVHrYOarRPXVWafSjTW9T0Hab8gVIawpl2Sj0ORyrygANq+KjcNlSSTw0YCLSNA8OyZ1I4yEg==", "dev": true, "requires": { "chalk": "^2.0.0", "esutils": "^2.0.2", "js-tokens": "^4.0.0" }, "dependencies": { "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } } } }, "@babel/parser": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.8.7.tgz", "integrity": "sha512-9JWls8WilDXFGxs0phaXAZgpxTZhSk/yOYH2hTHC0X1yC7Z78IJfvR1vJ+rmJKq3I35td2XzXzN6ZLYlna+r/A==", "dev": true }, "@babel/plugin-proposal-async-generator-functions": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-async-generator-functions/-/plugin-proposal-async-generator-functions-7.10.5.tgz", "integrity": "sha512-cNMCVezQbrRGvXJwm9fu/1sJj9bHdGAgKodZdLqOQIpfoH3raqmRPBM17+lh7CzhiKRRBrGtZL9WcjxSoGYUSg==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-remap-async-to-generator": "^7.10.4", "@babel/plugin-syntax-async-generators": "^7.8.0" } }, "@babel/plugin-proposal-class-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-class-properties/-/plugin-proposal-class-properties-7.10.4.tgz", "integrity": "sha512-vhwkEROxzcHGNu2mzUC0OFFNXdZ4M23ib8aRRcJSsW8BZK9pQMD7QB7csl97NBbgGZO7ZyHUyKDnxzOaP4IrCg==", "dev": true, "requires": { "@babel/helper-create-class-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-proposal-dynamic-import": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-dynamic-import/-/plugin-proposal-dynamic-import-7.10.4.tgz", "integrity": "sha512-up6oID1LeidOOASNXgv/CFbgBqTuKJ0cJjz6An5tWD+NVBNlp3VNSBxv2ZdU7SYl3NxJC7agAQDApZusV6uFwQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-dynamic-import": "^7.8.0" } }, "@babel/plugin-proposal-export-namespace-from": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-export-namespace-from/-/plugin-proposal-export-namespace-from-7.10.4.tgz", "integrity": "sha512-aNdf0LY6/3WXkhh0Fdb6Zk9j1NMD8ovj3F6r0+3j837Pn1S1PdNtcwJ5EG9WkVPNHPxyJDaxMaAOVq4eki0qbg==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-export-namespace-from": "^7.8.3" } }, "@babel/plugin-proposal-json-strings": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-json-strings/-/plugin-proposal-json-strings-7.10.4.tgz", "integrity": "sha512-fCL7QF0Jo83uy1K0P2YXrfX11tj3lkpN7l4dMv9Y9VkowkhkQDwFHFd8IiwyK5MZjE8UpbgokkgtcReH88Abaw==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-json-strings": "^7.8.0" } }, "@babel/plugin-proposal-logical-assignment-operators": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-logical-assignment-operators/-/plugin-proposal-logical-assignment-operators-7.11.0.tgz", "integrity": "sha512-/f8p4z+Auz0Uaf+i8Ekf1iM7wUNLcViFUGiPxKeXvxTSl63B875YPiVdUDdem7hREcI0E0kSpEhS8tF5RphK7Q==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-logical-assignment-operators": "^7.10.4" } }, "@babel/plugin-proposal-nullish-coalescing-operator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-nullish-coalescing-operator/-/plugin-proposal-nullish-coalescing-operator-7.10.4.tgz", "integrity": "sha512-wq5n1M3ZUlHl9sqT2ok1T2/MTt6AXE0e1Lz4WzWBr95LsAZ5qDXe4KnFuauYyEyLiohvXFMdbsOTMyLZs91Zlw==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0" } }, "@babel/plugin-proposal-numeric-separator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-numeric-separator/-/plugin-proposal-numeric-separator-7.10.4.tgz", "integrity": "sha512-73/G7QoRoeNkLZFxsoCCvlg4ezE4eM+57PnOqgaPOozd5myfj7p0muD1mRVJvbUWbOzD+q3No2bWbaKy+DJ8DA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-numeric-separator": "^7.10.4" } }, "@babel/plugin-proposal-object-rest-spread": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-object-rest-spread/-/plugin-proposal-object-rest-spread-7.11.0.tgz", "integrity": "sha512-wzch41N4yztwoRw0ak+37wxwJM2oiIiy6huGCoqkvSTA9acYWcPfn9Y4aJqmFFJ70KTJUu29f3DQ43uJ9HXzEA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-object-rest-spread": "^7.8.0", "@babel/plugin-transform-parameters": "^7.10.4" } }, "@babel/plugin-proposal-optional-catch-binding": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-catch-binding/-/plugin-proposal-optional-catch-binding-7.10.4.tgz", "integrity": "sha512-LflT6nPh+GK2MnFiKDyLiqSqVHkQnVf7hdoAvyTnnKj9xB3docGRsdPuxp6qqqW19ifK3xgc9U5/FwrSaCNX5g==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-syntax-optional-catch-binding": "^7.8.0" } }, "@babel/plugin-proposal-optional-chaining": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-chaining/-/plugin-proposal-optional-chaining-7.11.0.tgz", "integrity": "sha512-v9fZIu3Y8562RRwhm1BbMRxtqZNFmFA2EG+pT2diuU8PT3H6T/KXoZ54KgYisfOFZHV6PfvAiBIZ9Rcz+/JCxA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-skip-transparent-expression-wrappers": "^7.11.0", "@babel/plugin-syntax-optional-chaining": "^7.8.0" } }, "@babel/plugin-proposal-private-methods": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-private-methods/-/plugin-proposal-private-methods-7.10.4.tgz", "integrity": "sha512-wh5GJleuI8k3emgTg5KkJK6kHNsGEr0uBTDBuQUBJwckk9xs1ez79ioheEVVxMLyPscB0LfkbVHslQqIzWV6Bw==", "dev": true, "requires": { "@babel/helper-create-class-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-proposal-unicode-property-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-unicode-property-regex/-/plugin-proposal-unicode-property-regex-7.10.4.tgz", "integrity": "sha512-H+3fOgPnEXFL9zGYtKQe4IDOPKYlZdF1kqFDQRRb8PK4B8af1vAGK04tF5iQAAsui+mHNBQSAtd2/ndEDe9wuA==", "dev": true, "requires": { "@babel/helper-create-regexp-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-syntax-async-generators": { "version": "7.8.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.8.4.tgz", "integrity": "sha512-tycmZxkGfZaxhMRbXlPXuVFpdWlXpir2W4AMhSJgRKzk/eDlIXOhb2LHWoLpDF7TEHylV5zNhykX6KAgHJmTNw==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.0" } }, "@babel/plugin-syntax-class-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-class-properties/-/plugin-syntax-class-properties-7.10.4.tgz", "integrity": "sha512-GCSBF7iUle6rNugfURwNmCGG3Z/2+opxAMLs1nND4bhEG5PuxTIggDBoeYYSujAlLtsupzOHYJQgPS3pivwXIA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-syntax-dynamic-import": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-dynamic-import/-/plugin-syntax-dynamic-import-7.8.3.tgz", "integrity": "sha512-5gdGbFon+PszYzqs83S3E5mpi7/y/8M9eC90MRTZfduQOYW76ig6SOSPNe41IG5LoP3FGBn2N0RjVDSQiS94kQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.0" } }, "@babel/plugin-syntax-export-namespace-from": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-export-namespace-from/-/plugin-syntax-export-namespace-from-7.8.3.tgz", "integrity": "sha512-MXf5laXo6c1IbEbegDmzGPwGNTsHZmEy6QGznu5Sh2UCWvueywb2ee+CCE4zQiZstxU9BMoQO9i6zUFSY0Kj0Q==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.3" } }, "@babel/plugin-syntax-json-strings": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.8.3.tgz", "integrity": "sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.0" } }, "@babel/plugin-syntax-logical-assignment-operators": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-logical-assignment-operators/-/plugin-syntax-logical-assignment-operators-7.10.4.tgz", "integrity": "sha512-d8waShlpFDinQ5MtvGU9xDAOzKH47+FFoney2baFIoMr952hKOLp1HR7VszoZvOsV/4+RRszNY7D17ba0te0ig==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-syntax-nullish-coalescing-operator": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-nullish-coalescing-operator/-/plugin-syntax-nullish-coalescing-operator-7.8.3.tgz", "integrity": "sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.0" } }, "@babel/plugin-syntax-numeric-separator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-numeric-separator/-/plugin-syntax-numeric-separator-7.10.4.tgz", "integrity": "sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-syntax-object-rest-spread": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.8.3.tgz", "integrity": "sha512-XoqMijGZb9y3y2XskN+P1wUGiVwWZ5JmoDRwx5+3GmEplNyVM2s2Dg8ILFQm8rWM48orGy5YpI5Bl8U1y7ydlA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.0" } }, "@babel/plugin-syntax-optional-catch-binding": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.8.3.tgz", "integrity": "sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.0" } }, "@babel/plugin-syntax-optional-chaining": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-chaining/-/plugin-syntax-optional-chaining-7.8.3.tgz", "integrity": "sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.8.0" } }, "@babel/plugin-syntax-top-level-await": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-top-level-await/-/plugin-syntax-top-level-await-7.10.4.tgz", "integrity": "sha512-ni1brg4lXEmWyafKr0ccFWkJG0CeMt4WV1oyeBW6EFObF4oOHclbkj5cARxAPQyAQ2UTuplJyK4nfkXIMMFvsQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-arrow-functions": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-arrow-functions/-/plugin-transform-arrow-functions-7.10.4.tgz", "integrity": "sha512-9J/oD1jV0ZCBcgnoFWFq1vJd4msoKb/TCpGNFyyLt0zABdcvgK3aYikZ8HjzB14c26bc7E3Q1yugpwGy2aTPNA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-async-to-generator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-async-to-generator/-/plugin-transform-async-to-generator-7.10.4.tgz", "integrity": "sha512-F6nREOan7J5UXTLsDsZG3DXmZSVofr2tGNwfdrVwkDWHfQckbQXnXSPfD7iO+c/2HGqycwyLST3DnZ16n+cBJQ==", "dev": true, "requires": { "@babel/helper-module-imports": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-remap-async-to-generator": "^7.10.4" } }, "@babel/plugin-transform-block-scoped-functions": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoped-functions/-/plugin-transform-block-scoped-functions-7.10.4.tgz", "integrity": "sha512-WzXDarQXYYfjaV1szJvN3AD7rZgZzC1JtjJZ8dMHUyiK8mxPRahynp14zzNjU3VkPqPsO38CzxiWO1c9ARZ8JA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-block-scoping": { "version": "7.11.1", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoping/-/plugin-transform-block-scoping-7.11.1.tgz", "integrity": "sha512-00dYeDE0EVEHuuM+26+0w/SCL0BH2Qy7LwHuI4Hi4MH5gkC8/AqMN5uWFJIsoXZrAphiMm1iXzBw6L2T+eA0ew==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-classes": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-classes/-/plugin-transform-classes-7.10.4.tgz", "integrity": "sha512-2oZ9qLjt161dn1ZE0Ms66xBncQH4In8Sqw1YWgBUZuGVJJS5c0OFZXL6dP2MRHrkU/eKhWg8CzFJhRQl50rQxA==", "dev": true, "requires": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-define-map": "^7.10.4", "@babel/helper-function-name": "^7.10.4", "@babel/helper-optimise-call-expression": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4", "@babel/helper-split-export-declaration": "^7.10.4", "globals": "^11.1.0" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { "@babel/types": "^7.10.4" } }, "@babel/helper-split-export-declaration": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", "dev": true, "requires": { "@babel/types": "^7.11.0" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/plugin-transform-computed-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-computed-properties/-/plugin-transform-computed-properties-7.10.4.tgz", "integrity": "sha512-JFwVDXcP/hM/TbyzGq3l/XWGut7p46Z3QvqFMXTfk6/09m7xZHJUN9xHfsv7vqqD4YnfI5ueYdSJtXqqBLyjBw==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-destructuring": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-destructuring/-/plugin-transform-destructuring-7.10.4.tgz", "integrity": "sha512-+WmfvyfsyF603iPa6825mq6Qrb7uLjTOsa3XOFzlYcYDHSS4QmpOWOL0NNBY5qMbvrcf3tq0Cw+v4lxswOBpgA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-dotall-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-dotall-regex/-/plugin-transform-dotall-regex-7.10.4.tgz", "integrity": "sha512-ZEAVvUTCMlMFAbASYSVQoxIbHm2OkG2MseW6bV2JjIygOjdVv8tuxrCTzj1+Rynh7ODb8GivUy7dzEXzEhuPaA==", "dev": true, "requires": { "@babel/helper-create-regexp-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-duplicate-keys": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-duplicate-keys/-/plugin-transform-duplicate-keys-7.10.4.tgz", "integrity": "sha512-GL0/fJnmgMclHiBTTWXNlYjYsA7rDrtsazHG6mglaGSTh0KsrW04qml+Bbz9FL0LcJIRwBWL5ZqlNHKTkU3xAA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-exponentiation-operator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-exponentiation-operator/-/plugin-transform-exponentiation-operator-7.10.4.tgz", "integrity": "sha512-S5HgLVgkBcRdyQAHbKj+7KyuWx8C6t5oETmUuwz1pt3WTWJhsUV0WIIXuVvfXMxl/QQyHKlSCNNtaIamG8fysw==", "dev": true, "requires": { "@babel/helper-builder-binary-assignment-operator-visitor": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-for-of": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-for-of/-/plugin-transform-for-of-7.10.4.tgz", "integrity": "sha512-ItdQfAzu9AlEqmusA/65TqJ79eRcgGmpPPFvBnGILXZH975G0LNjP1yjHvGgfuCxqrPPueXOPe+FsvxmxKiHHQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-function-name/-/plugin-transform-function-name-7.10.4.tgz", "integrity": "sha512-OcDCq2y5+E0dVD5MagT5X+yTRbcvFjDI2ZVAottGH6tzqjx/LKpgkUepu3hp/u4tZBzxxpNGwLsAvGBvQ2mJzg==", "dev": true, "requires": { "@babel/helper-function-name": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" }, "dependencies": { "@babel/code-frame": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { "@babel/highlight": "^7.10.4" } }, "@babel/helper-function-name": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/template": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { "@babel/types": "^7.10.4" } }, "@babel/highlight": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", "js-tokens": "^4.0.0" } }, "@babel/parser": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz", "integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==", "dev": true }, "@babel/template": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz", "integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.10.4", "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" } }, "js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", "dev": true }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { "has-flag": "^3.0.0" } }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/plugin-transform-literals": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-literals/-/plugin-transform-literals-7.10.4.tgz", "integrity": "sha512-Xd/dFSTEVuUWnyZiMu76/InZxLTYilOSr1UlHV+p115Z/Le2Fi1KXkJUYz0b42DfndostYlPub3m8ZTQlMaiqQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-member-expression-literals": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-member-expression-literals/-/plugin-transform-member-expression-literals-7.10.4.tgz", "integrity": "sha512-0bFOvPyAoTBhtcJLr9VcwZqKmSjFml1iVxvPL0ReomGU53CX53HsM4h2SzckNdkQcHox1bpAqzxBI1Y09LlBSw==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-modules-amd": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-amd/-/plugin-transform-modules-amd-7.10.5.tgz", "integrity": "sha512-elm5uruNio7CTLFItVC/rIzKLfQ17+fX7EVz5W0TMgIHFo1zY0Ozzx+lgwhL4plzl8OzVn6Qasx5DeEFyoNiRw==", "dev": true, "requires": { "@babel/helper-module-transforms": "^7.10.5", "@babel/helper-plugin-utils": "^7.10.4", "babel-plugin-dynamic-import-node": "^2.3.3" } }, "@babel/plugin-transform-modules-commonjs": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.10.4.tgz", "integrity": "sha512-Xj7Uq5o80HDLlW64rVfDBhao6OX89HKUmb+9vWYaLXBZOma4gA6tw4Ni1O5qVDoZWUV0fxMYA0aYzOawz0l+1w==", "dev": true, "requires": { "@babel/helper-module-transforms": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-simple-access": "^7.10.4", "babel-plugin-dynamic-import-node": "^2.3.3" } }, "@babel/plugin-transform-modules-systemjs": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.10.5.tgz", "integrity": "sha512-f4RLO/OL14/FP1AEbcsWMzpbUz6tssRaeQg11RH1BP/XnPpRoVwgeYViMFacnkaw4k4wjRSjn3ip1Uw9TaXuMw==", "dev": true, "requires": { "@babel/helper-hoist-variables": "^7.10.4", "@babel/helper-module-transforms": "^7.10.5", "@babel/helper-plugin-utils": "^7.10.4", "babel-plugin-dynamic-import-node": "^2.3.3" } }, "@babel/plugin-transform-modules-umd": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-umd/-/plugin-transform-modules-umd-7.10.4.tgz", "integrity": "sha512-mohW5q3uAEt8T45YT7Qc5ws6mWgJAaL/8BfWD9Dodo1A3RKWli8wTS+WiQ/knF+tXlPirW/1/MqzzGfCExKECA==", "dev": true, "requires": { "@babel/helper-module-transforms": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-named-capturing-groups-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-named-capturing-groups-regex/-/plugin-transform-named-capturing-groups-regex-7.10.4.tgz", "integrity": "sha512-V6LuOnD31kTkxQPhKiVYzYC/Jgdq53irJC/xBSmqcNcqFGV+PER4l6rU5SH2Vl7bH9mLDHcc0+l9HUOe4RNGKA==", "dev": true, "requires": { "@babel/helper-create-regexp-features-plugin": "^7.10.4" } }, "@babel/plugin-transform-new-target": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-new-target/-/plugin-transform-new-target-7.10.4.tgz", "integrity": "sha512-YXwWUDAH/J6dlfwqlWsztI2Puz1NtUAubXhOPLQ5gjR/qmQ5U96DY4FQO8At33JN4XPBhrjB8I4eMmLROjjLjw==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-object-super": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-object-super/-/plugin-transform-object-super-7.10.4.tgz", "integrity": "sha512-5iTw0JkdRdJvr7sY0vHqTpnruUpTea32JHmq/atIWqsnNussbRzjEDyWep8UNztt1B5IusBYg8Irb0bLbiEBCQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-replace-supers": "^7.10.4" } }, "@babel/plugin-transform-parameters": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-parameters/-/plugin-transform-parameters-7.10.5.tgz", "integrity": "sha512-xPHwUj5RdFV8l1wuYiu5S9fqWGM2DrYc24TMvUiRrPVm+SM3XeqU9BcokQX/kEUe+p2RBwy+yoiR1w/Blq6ubw==", "dev": true, "requires": { "@babel/helper-get-function-arity": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" }, "dependencies": { "@babel/helper-get-function-arity": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { "@babel/types": "^7.10.4" } }, "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/plugin-transform-property-literals": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-property-literals/-/plugin-transform-property-literals-7.10.4.tgz", "integrity": "sha512-ofsAcKiUxQ8TY4sScgsGeR2vJIsfrzqvFb9GvJ5UdXDzl+MyYCaBj/FGzXuv7qE0aJcjWMILny1epqelnFlz8g==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-regenerator": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-regenerator/-/plugin-transform-regenerator-7.10.4.tgz", "integrity": "sha512-3thAHwtor39A7C04XucbMg17RcZ3Qppfxr22wYzZNcVIkPHfpM9J0SO8zuCV6SZa265kxBJSrfKTvDCYqBFXGw==", "dev": true, "requires": { "regenerator-transform": "^0.14.2" }, "dependencies": { "regenerator-transform": { "version": "0.14.5", "resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.14.5.tgz", "integrity": "sha512-eOf6vka5IO151Jfsw2NO9WpGX58W6wWmefK3I1zEGr0lOD0u8rwPaNqQL1aRxUaxLeKO3ArNh3VYg1KbaD+FFw==", "dev": true, "requires": { "@babel/runtime": "^7.8.4" } } } }, "@babel/plugin-transform-reserved-words": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-reserved-words/-/plugin-transform-reserved-words-7.10.4.tgz", "integrity": "sha512-hGsw1O6Rew1fkFbDImZIEqA8GoidwTAilwCyWqLBM9f+e/u/sQMQu7uX6dyokfOayRuuVfKOW4O7HvaBWM+JlQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-shorthand-properties": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-shorthand-properties/-/plugin-transform-shorthand-properties-7.10.4.tgz", "integrity": "sha512-AC2K/t7o07KeTIxMoHneyX90v3zkm5cjHJEokrPEAGEy3UCp8sLKfnfOIGdZ194fyN4wfX/zZUWT9trJZ0qc+Q==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-spread": { "version": "7.11.0", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-spread/-/plugin-transform-spread-7.11.0.tgz", "integrity": "sha512-UwQYGOqIdQJe4aWNyS7noqAnN2VbaczPLiEtln+zPowRNlD+79w3oi2TWfYe0eZgd+gjZCbsydN7lzWysDt+gw==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-skip-transparent-expression-wrappers": "^7.11.0" } }, "@babel/plugin-transform-sticky-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-sticky-regex/-/plugin-transform-sticky-regex-7.10.4.tgz", "integrity": "sha512-Ddy3QZfIbEV0VYcVtFDCjeE4xwVTJWTmUtorAJkn6u/92Z/nWJNV+mILyqHKrUxXYKA2EoCilgoPePymKL4DvQ==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4", "@babel/helper-regex": "^7.10.4" } }, "@babel/plugin-transform-template-literals": { "version": "7.10.5", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-template-literals/-/plugin-transform-template-literals-7.10.5.tgz", "integrity": "sha512-V/lnPGIb+KT12OQikDvgSuesRX14ck5FfJXt6+tXhdkJ+Vsd0lDCVtF6jcB4rNClYFzaB2jusZ+lNISDk2mMMw==", "dev": true, "requires": { "@babel/helper-annotate-as-pure": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-typeof-symbol": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-typeof-symbol/-/plugin-transform-typeof-symbol-7.10.4.tgz", "integrity": "sha512-QqNgYwuuW0y0H+kUE/GWSR45t/ccRhe14Fs/4ZRouNNQsyd4o3PG4OtHiIrepbM2WKUBDAXKCAK/Lk4VhzTaGA==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-unicode-escapes": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-escapes/-/plugin-transform-unicode-escapes-7.10.4.tgz", "integrity": "sha512-y5XJ9waMti2J+e7ij20e+aH+fho7Wb7W8rNuu72aKRwCHFqQdhkdU2lo3uZ9tQuboEJcUFayXdARhcxLQ3+6Fg==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/plugin-transform-unicode-regex": { "version": "7.10.4", "resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-regex/-/plugin-transform-unicode-regex-7.10.4.tgz", "integrity": "sha512-wNfsc4s8N2qnIwpO/WP2ZiSyjfpTamT2C9V9FDH/Ljub9zw6P3SjkXcFmc0RQUt96k2fmIvtla2MMjgTwIAC+A==", "dev": true, "requires": { "@babel/helper-create-regexp-features-plugin": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4" } }, "@babel/preset-env": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/preset-env/-/preset-env-7.11.5.tgz", "integrity": "sha512-kXqmW1jVcnB2cdueV+fyBM8estd5mlNfaQi6lwLgRwCby4edpavgbFhiBNjmWA3JpB/yZGSISa7Srf+TwxDQoA==", "dev": true, "requires": { "@babel/compat-data": "^7.11.0", "@babel/helper-compilation-targets": "^7.10.4", "@babel/helper-module-imports": "^7.10.4", "@babel/helper-plugin-utils": "^7.10.4", "@babel/plugin-proposal-async-generator-functions": "^7.10.4", "@babel/plugin-proposal-class-properties": "^7.10.4", "@babel/plugin-proposal-dynamic-import": "^7.10.4", "@babel/plugin-proposal-export-namespace-from": "^7.10.4", "@babel/plugin-proposal-json-strings": "^7.10.4", "@babel/plugin-proposal-logical-assignment-operators": "^7.11.0", "@babel/plugin-proposal-nullish-coalescing-operator": "^7.10.4", "@babel/plugin-proposal-numeric-separator": "^7.10.4", "@babel/plugin-proposal-object-rest-spread": "^7.11.0", "@babel/plugin-proposal-optional-catch-binding": "^7.10.4", "@babel/plugin-proposal-optional-chaining": "^7.11.0", "@babel/plugin-proposal-private-methods": "^7.10.4", "@babel/plugin-proposal-unicode-property-regex": "^7.10.4", "@babel/plugin-syntax-async-generators": "^7.8.0", "@babel/plugin-syntax-class-properties": "^7.10.4", "@babel/plugin-syntax-dynamic-import": "^7.8.0", "@babel/plugin-syntax-export-namespace-from": "^7.8.3", "@babel/plugin-syntax-json-strings": "^7.8.0", "@babel/plugin-syntax-logical-assignment-operators": "^7.10.4", "@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0", "@babel/plugin-syntax-numeric-separator": "^7.10.4", "@babel/plugin-syntax-object-rest-spread": "^7.8.0", "@babel/plugin-syntax-optional-catch-binding": "^7.8.0", "@babel/plugin-syntax-optional-chaining": "^7.8.0", "@babel/plugin-syntax-top-level-await": "^7.10.4", "@babel/plugin-transform-arrow-functions": "^7.10.4", "@babel/plugin-transform-async-to-generator": "^7.10.4", "@babel/plugin-transform-block-scoped-functions": "^7.10.4", "@babel/plugin-transform-block-scoping": "^7.10.4", "@babel/plugin-transform-classes": "^7.10.4", "@babel/plugin-transform-computed-properties": "^7.10.4", "@babel/plugin-transform-destructuring": "^7.10.4", "@babel/plugin-transform-dotall-regex": "^7.10.4", "@babel/plugin-transform-duplicate-keys": "^7.10.4", "@babel/plugin-transform-exponentiation-operator": "^7.10.4", "@babel/plugin-transform-for-of": "^7.10.4", "@babel/plugin-transform-function-name": "^7.10.4", "@babel/plugin-transform-literals": "^7.10.4", "@babel/plugin-transform-member-expression-literals": "^7.10.4", "@babel/plugin-transform-modules-amd": "^7.10.4", "@babel/plugin-transform-modules-commonjs": "^7.10.4", "@babel/plugin-transform-modules-systemjs": "^7.10.4", "@babel/plugin-transform-modules-umd": "^7.10.4", "@babel/plugin-transform-named-capturing-groups-regex": "^7.10.4", "@babel/plugin-transform-new-target": "^7.10.4", "@babel/plugin-transform-object-super": "^7.10.4", "@babel/plugin-transform-parameters": "^7.10.4", "@babel/plugin-transform-property-literals": "^7.10.4", "@babel/plugin-transform-regenerator": "^7.10.4", "@babel/plugin-transform-reserved-words": "^7.10.4", "@babel/plugin-transform-shorthand-properties": "^7.10.4", "@babel/plugin-transform-spread": "^7.11.0", "@babel/plugin-transform-sticky-regex": "^7.10.4", "@babel/plugin-transform-template-literals": "^7.10.4", "@babel/plugin-transform-typeof-symbol": "^7.10.4", "@babel/plugin-transform-unicode-escapes": "^7.10.4", "@babel/plugin-transform-unicode-regex": "^7.10.4", "@babel/preset-modules": "^0.1.3", "@babel/types": "^7.11.5", "browserslist": "^4.12.0", "core-js-compat": "^3.6.2", "invariant": "^2.2.2", "levenary": "^1.1.1", "semver": "^5.5.0" }, "dependencies": { "@babel/types": { "version": "7.11.5", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz", "integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==", "dev": true, "requires": { "@babel/helper-validator-identifier": "^7.10.4", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, "lodash": { "version": "4.17.20", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@babel/preset-modules": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/@babel/preset-modules/-/preset-modules-0.1.4.tgz", "integrity": "sha512-J36NhwnfdzpmH41M1DrnkkgAqhZaqr/NBdPfQ677mLzlaXo+oDiv1deyCDtgAhz8p328otdob0Du7+xgHGZbKg==", "dev": true, "requires": { "@babel/helper-plugin-utils": "^7.0.0", "@babel/plugin-proposal-unicode-property-regex": "^7.4.4", "@babel/plugin-transform-dotall-regex": "^7.4.4", "@babel/types": "^7.4.4", "esutils": "^2.0.2" } }, "@babel/runtime": { "version": "7.11.2", "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.11.2.tgz", "integrity": "sha512-TeWkU52so0mPtDcaCTxNBI/IHiz0pZgr8VEFqXFtZWpYD08ZB6FaSwVAS8MKRQAP3bYKiVjwysOJgMFY28o6Tw==", "dev": true, "requires": { "regenerator-runtime": "^0.13.4" }, "dependencies": { "regenerator-runtime": { "version": "0.13.7", "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.7.tgz", "integrity": "sha512-a54FxoJDIr27pgf7IgeQGxmqUNYrcV338lf/6gH456HZ/PhX+5BcwHXG9ajESmwe6WRO0tAzRUrRmNONWgkrew==", "dev": true } } }, "@babel/template": { "version": "7.8.6", "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.8.6.tgz", "integrity": "sha512-zbMsPMy/v0PWFZEhQJ66bqjhH+z0JgMoBWuikXybgG3Gkd/3t5oQ1Rw2WQhnSrsOmsKXnZOx15tkC4qON/+JPg==", "dev": true, "requires": { "@babel/code-frame": "^7.8.3", "@babel/parser": "^7.8.6", "@babel/types": "^7.8.6" } }, "@babel/traverse": { "version": "7.8.6", "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.8.6.tgz", "integrity": "sha512-2B8l0db/DPi8iinITKuo7cbPznLCEk0kCxDoB9/N6gGNg/gxOXiR/IcymAFPiBwk5w6TtQ27w4wpElgp9btR9A==", "dev": true, "requires": { "@babel/code-frame": "^7.8.3", "@babel/generator": "^7.8.6", "@babel/helper-function-name": "^7.8.3", "@babel/helper-split-export-declaration": "^7.8.3", "@babel/parser": "^7.8.6", "@babel/types": "^7.8.6", "debug": "^4.1.0", "globals": "^11.1.0", "lodash": "^4.17.13" }, "dependencies": { "debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "requires": { "ms": "^2.1.1" } }, "globals": { "version": "11.12.0", "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", "dev": true }, "ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "dev": true } } }, "@babel/types": { "version": "7.8.7", "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.8.7.tgz", "integrity": "sha512-k2TreEHxFA4CjGkL+GYjRyx35W0Mr7DP5+9q6WMkyKXB+904bYmG40syjMFV0oLlhhFCwWl0vA0DyzTDkwAiJw==", "dev": true, "requires": { "esutils": "^2.0.2", "lodash": "^4.17.13", "to-fast-properties": "^2.0.0" }, "dependencies": { "to-fast-properties": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", "dev": true } } }, "@webassemblyjs/ast": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.8.5.tgz", "integrity": "sha512-aJMfngIZ65+t71C3y2nBBg5FFG0Okt9m0XEgWZ7Ywgn1oMAT8cNwx00Uv1cQyHtidq0Xn94R4TAywO+LCQ+ZAQ==", "requires": { "@webassemblyjs/helper-module-context": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/wast-parser": "1.8.5" } }, "@webassemblyjs/floating-point-hex-parser": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.8.5.tgz", "integrity": "sha512-9p+79WHru1oqBh9ewP9zW95E3XAo+90oth7S5Re3eQnECGq59ly1Ri5tsIipKGpiStHsUYmY3zMLqtk3gTcOtQ==" }, "@webassemblyjs/helper-api-error": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.8.5.tgz", "integrity": "sha512-Za/tnzsvnqdaSPOUXHyKJ2XI7PDX64kWtURyGiJJZKVEdFOsdKUCPTNEVFZq3zJ2R0G5wc2PZ5gvdTRFgm81zA==" }, "@webassemblyjs/helper-buffer": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.8.5.tgz", "integrity": "sha512-Ri2R8nOS0U6G49Q86goFIPNgjyl6+oE1abW1pS84BuhP1Qcr5JqMwRFT3Ah3ADDDYGEgGs1iyb1DGX+kAi/c/Q==" }, "@webassemblyjs/helper-code-frame": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.8.5.tgz", "integrity": "sha512-VQAadSubZIhNpH46IR3yWO4kZZjMxN1opDrzePLdVKAZ+DFjkGD/rf4v1jap744uPVU6yjL/smZbRIIJTOUnKQ==", "requires": { "@webassemblyjs/wast-printer": "1.8.5" } }, "@webassemblyjs/helper-fsm": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.8.5.tgz", "integrity": "sha512-kRuX/saORcg8se/ft6Q2UbRpZwP4y7YrWsLXPbbmtepKr22i8Z4O3V5QE9DbZK908dh5Xya4Un57SDIKwB9eow==" }, "@webassemblyjs/helper-module-context": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.8.5.tgz", "integrity": "sha512-/O1B236mN7UNEU4t9X7Pj38i4VoU8CcMHyy3l2cV/kIF4U5KoHXDVqcDuOs1ltkac90IM4vZdHc52t1x8Yfs3g==", "requires": { "@webassemblyjs/ast": "1.8.5", "mamacro": "^0.0.3" } }, "@webassemblyjs/helper-wasm-bytecode": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.8.5.tgz", "integrity": "sha512-Cu4YMYG3Ddl72CbmpjU/wbP6SACcOPVbHN1dI4VJNJVgFwaKf1ppeFJrwydOG3NDHxVGuCfPlLZNyEdIYlQ6QQ==" }, "@webassemblyjs/helper-wasm-section": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.8.5.tgz", "integrity": "sha512-VV083zwR+VTrIWWtgIUpqfvVdK4ff38loRmrdDBgBT8ADXYsEZ5mPQ4Nde90N3UYatHdYoDIFb7oHzMncI02tA==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-buffer": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/wasm-gen": "1.8.5" } }, "@webassemblyjs/ieee754": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.8.5.tgz", "integrity": "sha512-aaCvQYrvKbY/n6wKHb/ylAJr27GglahUO89CcGXMItrOBqRarUMxWLJgxm9PJNuKULwN5n1csT9bYoMeZOGF3g==", "requires": { "@xtuc/ieee754": "^1.2.0" } }, "@webassemblyjs/leb128": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.8.5.tgz", "integrity": "sha512-plYUuUwleLIziknvlP8VpTgO4kqNaH57Y3JnNa6DLpu/sGcP6hbVdfdX5aHAV716pQBKrfuU26BJK29qY37J7A==", "requires": { "@xtuc/long": "4.2.2" } }, "@webassemblyjs/utf8": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.8.5.tgz", "integrity": "sha512-U7zgftmQriw37tfD934UNInokz6yTmn29inT2cAetAsaU9YeVCveWEwhKL1Mg4yS7q//NGdzy79nlXh3bT8Kjw==" }, "@webassemblyjs/wasm-edit": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.8.5.tgz", "integrity": "sha512-A41EMy8MWw5yvqj7MQzkDjU29K7UJq1VrX2vWLzfpRHt3ISftOXqrtojn7nlPsZ9Ijhp5NwuODuycSvfAO/26Q==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-buffer": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/helper-wasm-section": "1.8.5", "@webassemblyjs/wasm-gen": "1.8.5", "@webassemblyjs/wasm-opt": "1.8.5", "@webassemblyjs/wasm-parser": "1.8.5", "@webassemblyjs/wast-printer": "1.8.5" } }, "@webassemblyjs/wasm-gen": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.8.5.tgz", "integrity": "sha512-BCZBT0LURC0CXDzj5FXSc2FPTsxwp3nWcqXQdOZE4U7h7i8FqtFK5Egia6f9raQLpEKT1VL7zr4r3+QX6zArWg==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/ieee754": "1.8.5", "@webassemblyjs/leb128": "1.8.5", "@webassemblyjs/utf8": "1.8.5" } }, "@webassemblyjs/wasm-opt": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.8.5.tgz", "integrity": "sha512-HKo2mO/Uh9A6ojzu7cjslGaHaUU14LdLbGEKqTR7PBKwT6LdPtLLh9fPY33rmr5wcOMrsWDbbdCHq4hQUdd37Q==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-buffer": "1.8.5", "@webassemblyjs/wasm-gen": "1.8.5", "@webassemblyjs/wasm-parser": "1.8.5" } }, "@webassemblyjs/wasm-parser": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.8.5.tgz", "integrity": "sha512-pi0SYE9T6tfcMkthwcgCpL0cM9nRYr6/6fjgDtL6q/ZqKHdMWvxitRi5JcZ7RI4SNJJYnYNaWy5UUrHQy998lw==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-api-error": "1.8.5", "@webassemblyjs/helper-wasm-bytecode": "1.8.5", "@webassemblyjs/ieee754": "1.8.5", "@webassemblyjs/leb128": "1.8.5", "@webassemblyjs/utf8": "1.8.5" } }, "@webassemblyjs/wast-parser": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.8.5.tgz", "integrity": "sha512-daXC1FyKWHF1i11obK086QRlsMsY4+tIOKgBqI1lxAnkp9xe9YMcgOxm9kLe+ttjs5aWV2KKE1TWJCN57/Btsg==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/floating-point-hex-parser": "1.8.5", "@webassemblyjs/helper-api-error": "1.8.5", "@webassemblyjs/helper-code-frame": "1.8.5", "@webassemblyjs/helper-fsm": "1.8.5", "@xtuc/long": "4.2.2" } }, "@webassemblyjs/wast-printer": { "version": "1.8.5", "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.8.5.tgz", "integrity": "sha512-w0U0pD4EhlnvRyeJzBqaVSJAo9w/ce7/WPogeXLzGkO6hzhr4GnQIZ4W4uUt5b9ooAaXPtnXlj0gzsXEOUNYMg==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/wast-parser": "1.8.5", "@xtuc/long": "4.2.2" } }, "@xtuc/ieee754": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/@xtuc/ieee754/-/ieee754-1.2.0.tgz", "integrity": "sha512-DX8nKgqcGwsc0eJSqYt5lwP4DH5FlHnmuWWBRy7X0NcaGR0ZtuyeESgMwTYVEtxmsNGY+qit4QYT/MIYTOTPeA==" }, "@xtuc/long": { "version": "4.2.2", "resolved": "https://registry.npmjs.org/@xtuc/long/-/long-4.2.2.tgz", "integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ==" }, "acorn": { "version": "6.4.1", "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.1.tgz", "integrity": "sha512-ZVA9k326Nwrj3Cj9jlh3wGFutC2ZornPNARZwsNYqQYgN0EsV2d53w5RN/co65Ohn4sUAUtb1rSUAOD6XN9idA==" }, "ajv": { "version": "6.12.0", "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.0.tgz", "integrity": "sha512-D6gFiFA0RRLyUbvijN74DWAjXSFxWKaWP7mldxkVhyhAV3+SWA9HEJPHQ2c9soIeTFJqcSdFDGFgdqs1iUU2Hw==", "requires": { "fast-deep-equal": "^3.1.1", "fast-json-stable-stringify": "^2.0.0", "json-schema-traverse": "^0.4.1", "uri-js": "^4.2.2" } }, "ajv-errors": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.1.tgz", "integrity": "sha512-DCRfO/4nQ+89p/RK43i8Ezd41EqdGIU4ld7nGF8OQ14oc/we5rEntLCUa7+jrn3nn83BosfwZA0wb4pon2o8iQ==" }, "ajv-keywords": { "version": "3.4.1", "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.4.1.tgz", "integrity": "sha512-RO1ibKvd27e6FEShVFfPALuHI3WjSVNeK5FIsmme/LYRNxjKuNj+Dt7bucLa6NdSv3JcVTyMlm9kGR84z1XpaQ==" }, "ansi-regex": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=" }, "ansi-styles": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=" }, "anymatch": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", "requires": { "micromatch": "^3.1.4", "normalize-path": "^2.1.1" }, "dependencies": { "normalize-path": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", "requires": { "remove-trailing-separator": "^1.0.1" } } } }, "aproba": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==" }, "argparse": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==" }, "arr-diff": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz", "integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=" }, "arr-flatten": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz", "integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==" }, "arr-union": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz", "integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=" }, "array-unique": { "version": "0.3.2", "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz", "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=" }, "asn1.js": { "version": "4.10.1", "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-4.10.1.tgz", "integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==", "requires": { "bn.js": "^4.0.0", "inherits": "^2.0.1", "minimalistic-assert": "^1.0.0" } }, "assert": { "version": "1.5.0", "resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz", "integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==", "requires": { "object-assign": "^4.1.1", "util": "0.10.3" }, "dependencies": { "inherits": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz", "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=" }, "util": { "version": "0.10.3", "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz", "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=", "requires": { "inherits": "2.0.1" } } } }, "assign-symbols": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz", "integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=" }, "async-each": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.3.tgz", "integrity": "sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ==" }, "atob": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz", "integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==" }, "babel-code-frame": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-code-frame/-/babel-code-frame-6.26.0.tgz", "integrity": "sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=", "requires": { "chalk": "^1.1.3", "esutils": "^2.0.2", "js-tokens": "^3.0.2" } }, "babel-core": { "version": "6.26.3", "resolved": "https://registry.npmjs.org/babel-core/-/babel-core-6.26.3.tgz", "integrity": "sha512-6jyFLuDmeidKmUEb3NM+/yawG0M2bDZ9Z1qbZP59cyHLz8kYGKYwpJP0UwUKKUiTRNvxfLesJnTedqczP7cTDA==", "requires": { "babel-code-frame": "^6.26.0", "babel-generator": "^6.26.0", "babel-helpers": "^6.24.1", "babel-messages": "^6.23.0", "babel-register": "^6.26.0", "babel-runtime": "^6.26.0", "babel-template": "^6.26.0", "babel-traverse": "^6.26.0", "babel-types": "^6.26.0", "babylon": "^6.18.0", "convert-source-map": "^1.5.1", "debug": "^2.6.9", "json5": "^0.5.1", "lodash": "^4.17.4", "minimatch": "^3.0.4", "path-is-absolute": "^1.0.1", "private": "^0.1.8", "slash": "^1.0.0", "source-map": "^0.5.7" }, "dependencies": { "json5": { "version": "0.5.1", "resolved": "https://registry.npmjs.org/json5/-/json5-0.5.1.tgz", "integrity": "sha1-Hq3nrMASA0rYTiOWdn6tn6VJWCE=" } } }, "babel-generator": { "version": "6.26.1", "resolved": "https://registry.npmjs.org/babel-generator/-/babel-generator-6.26.1.tgz", "integrity": "sha512-HyfwY6ApZj7BYTcJURpM5tznulaBvyio7/0d4zFOeMPUmfxkCjHocCuoLa2SAGzBI8AREcH3eP3758F672DppA==", "requires": { "babel-messages": "^6.23.0", "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "detect-indent": "^4.0.0", "jsesc": "^1.3.0", "lodash": "^4.17.4", "source-map": "^0.5.7", "trim-right": "^1.0.1" } }, "babel-helper-call-delegate": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz", "integrity": "sha1-7Oaqzdx25Bw0YfiL/Fdb0Nqi340=", "requires": { "babel-helper-hoist-variables": "^6.24.1", "babel-runtime": "^6.22.0", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "babel-helper-define-map": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-helper-define-map/-/babel-helper-define-map-6.26.0.tgz", "integrity": "sha1-pfVtq0GiX5fstJjH66ypgZ+Vvl8=", "requires": { "babel-helper-function-name": "^6.24.1", "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "lodash": "^4.17.4" } }, "babel-helper-function-name": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz", "integrity": "sha1-00dbjAPtmCQqJbSDUasYOZ01gKk=", "requires": { "babel-helper-get-function-arity": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "babel-helper-get-function-arity": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz", "integrity": "sha1-j3eCqpNAfEHTqlCQj4mwMbG2hT0=", "requires": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-helper-hoist-variables": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz", "integrity": "sha1-HssnaJydJVE+rbyZFKc/VAi+enY=", "requires": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-helper-optimise-call-expression": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-optimise-call-expression/-/babel-helper-optimise-call-expression-6.24.1.tgz", "integrity": "sha1-96E0J7qfc/j0+pk8VKl4gtEkQlc=", "requires": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-helper-regex": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz", "integrity": "sha1-MlxZ+QL4LyS3T6zu0DY5VPZJXnI=", "requires": { "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "lodash": "^4.17.4" } }, "babel-helper-replace-supers": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helper-replace-supers/-/babel-helper-replace-supers-6.24.1.tgz", "integrity": "sha1-v22/5Dk40XNpohPKiov3S2qQqxo=", "requires": { "babel-helper-optimise-call-expression": "^6.24.1", "babel-messages": "^6.23.0", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "babel-helpers": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-helpers/-/babel-helpers-6.24.1.tgz", "integrity": "sha1-NHHenK7DiOXIUOWX5Yom3fN2ArI=", "requires": { "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "babel-loader": { "version": "8.0.6", "resolved": "https://registry.npmjs.org/babel-loader/-/babel-loader-8.0.6.tgz", "integrity": "sha512-4BmWKtBOBm13uoUwd08UwjZlaw3O9GWf456R9j+5YykFZ6LUIjIKLc0zEZf+hauxPOJs96C8k6FvYD09vWzhYw==", "dev": true, "requires": { "find-cache-dir": "^2.0.0", "loader-utils": "^1.0.2", "mkdirp": "^0.5.1", "pify": "^4.0.1" } }, "babel-messages": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-messages/-/babel-messages-6.23.0.tgz", "integrity": "sha1-8830cDhYA1sqKVHG7F7fbGLyYw4=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-check-es2015-constants": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz", "integrity": "sha1-NRV7EBQm/S/9PaP3XH0ekYNbv4o=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-dynamic-import-node": { "version": "2.3.3", "resolved": "https://registry.npmjs.org/babel-plugin-dynamic-import-node/-/babel-plugin-dynamic-import-node-2.3.3.tgz", "integrity": "sha512-jZVI+s9Zg3IqA/kdi0i6UDCybUI3aSBLnglhYbSSjKlV7yF1F/5LWv8MakQmvYpnbJDS6fcBL2KzHSxNCMtWSQ==", "dev": true, "requires": { "object.assign": "^4.1.0" } }, "babel-plugin-transform-es2015-arrow-functions": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-arrow-functions/-/babel-plugin-transform-es2015-arrow-functions-6.22.0.tgz", "integrity": "sha1-RSaSy3EdX3ncf4XkQM5BufJE0iE=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-block-scoped-functions": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoped-functions/-/babel-plugin-transform-es2015-block-scoped-functions-6.22.0.tgz", "integrity": "sha1-u8UbSflk1wy42OC5ToICRs46YUE=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-block-scoping": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoping/-/babel-plugin-transform-es2015-block-scoping-6.26.0.tgz", "integrity": "sha1-1w9SmcEwjQXBL0Y4E7CgnnOxiV8=", "requires": { "babel-runtime": "^6.26.0", "babel-template": "^6.26.0", "babel-traverse": "^6.26.0", "babel-types": "^6.26.0", "lodash": "^4.17.4" } }, "babel-plugin-transform-es2015-classes": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-classes/-/babel-plugin-transform-es2015-classes-6.24.1.tgz", "integrity": "sha1-WkxYpQyclGHlZLSyo7+ryXolhNs=", "requires": { "babel-helper-define-map": "^6.24.1", "babel-helper-function-name": "^6.24.1", "babel-helper-optimise-call-expression": "^6.24.1", "babel-helper-replace-supers": "^6.24.1", "babel-messages": "^6.23.0", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "babel-plugin-transform-es2015-computed-properties": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-computed-properties/-/babel-plugin-transform-es2015-computed-properties-6.24.1.tgz", "integrity": "sha1-b+Ko0WiV1WNPTNmZttNICjCBWbM=", "requires": { "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "babel-plugin-transform-es2015-destructuring": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz", "integrity": "sha1-mXux8auWf2gtKwh2/jWNYOdlxW0=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-duplicate-keys": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-duplicate-keys/-/babel-plugin-transform-es2015-duplicate-keys-6.24.1.tgz", "integrity": "sha1-c+s9MQypaePvnskcU3QabxV2Qj4=", "requires": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-plugin-transform-es2015-for-of": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-for-of/-/babel-plugin-transform-es2015-for-of-6.23.0.tgz", "integrity": "sha1-9HyVsrYT3x0+zC/bdXNiPHUkhpE=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-function-name": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz", "integrity": "sha1-g0yJhTvDaxrw86TF26qU/Y6sqos=", "requires": { "babel-helper-function-name": "^6.24.1", "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-plugin-transform-es2015-literals": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-literals/-/babel-plugin-transform-es2015-literals-6.22.0.tgz", "integrity": "sha1-T1SgLWzWbPkVKAAZox0xklN3yi4=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-modules-amd": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-amd/-/babel-plugin-transform-es2015-modules-amd-6.24.1.tgz", "integrity": "sha1-Oz5UAXI5hC1tGcMBHEvS8AoA0VQ=", "requires": { "babel-plugin-transform-es2015-modules-commonjs": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "babel-plugin-transform-es2015-modules-commonjs": { "version": "6.26.2", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.2.tgz", "integrity": "sha512-CV9ROOHEdrjcwhIaJNBGMBCodN+1cfkwtM1SbUHmvyy35KGT7fohbpOxkE2uLz1o6odKK2Ck/tz47z+VqQfi9Q==", "requires": { "babel-plugin-transform-strict-mode": "^6.24.1", "babel-runtime": "^6.26.0", "babel-template": "^6.26.0", "babel-types": "^6.26.0" } }, "babel-plugin-transform-es2015-modules-systemjs": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-systemjs/-/babel-plugin-transform-es2015-modules-systemjs-6.24.1.tgz", "integrity": "sha1-/4mhQrkRmpBhlfXxBuzzBdlAfSM=", "requires": { "babel-helper-hoist-variables": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "babel-plugin-transform-es2015-modules-umd": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-umd/-/babel-plugin-transform-es2015-modules-umd-6.24.1.tgz", "integrity": "sha1-rJl+YoXNGO1hdq22B9YCNErThGg=", "requires": { "babel-plugin-transform-es2015-modules-amd": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1" } }, "babel-plugin-transform-es2015-object-super": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-object-super/-/babel-plugin-transform-es2015-object-super-6.24.1.tgz", "integrity": "sha1-JM72muIcuDp/hgPa0CH1cusnj40=", "requires": { "babel-helper-replace-supers": "^6.24.1", "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-parameters": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz", "integrity": "sha1-V6w1GrScrxSpfNE7CfZv3wpiXys=", "requires": { "babel-helper-call-delegate": "^6.24.1", "babel-helper-get-function-arity": "^6.24.1", "babel-runtime": "^6.22.0", "babel-template": "^6.24.1", "babel-traverse": "^6.24.1", "babel-types": "^6.24.1" } }, "babel-plugin-transform-es2015-shorthand-properties": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-shorthand-properties/-/babel-plugin-transform-es2015-shorthand-properties-6.24.1.tgz", "integrity": "sha1-JPh11nIch2YbvZmkYi5R8U3jiqA=", "requires": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-plugin-transform-es2015-spread": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz", "integrity": "sha1-1taKmfia7cRTbIGlQujdnxdG+NE=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-sticky-regex": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz", "integrity": "sha1-AMHNsaynERLN8M9hJsLta0V8zbw=", "requires": { "babel-helper-regex": "^6.24.1", "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-plugin-transform-es2015-template-literals": { "version": "6.22.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-template-literals/-/babel-plugin-transform-es2015-template-literals-6.22.0.tgz", "integrity": "sha1-qEs0UPfp+PH2g51taH2oS7EjbY0=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-typeof-symbol": { "version": "6.23.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-typeof-symbol/-/babel-plugin-transform-es2015-typeof-symbol-6.23.0.tgz", "integrity": "sha1-3sCfHN3/lLUqxz1QXITfWdzOs3I=", "requires": { "babel-runtime": "^6.22.0" } }, "babel-plugin-transform-es2015-unicode-regex": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz", "integrity": "sha1-04sS9C6nMj9yk4fxinxa4frrNek=", "requires": { "babel-helper-regex": "^6.24.1", "babel-runtime": "^6.22.0", "regexpu-core": "^2.0.0" } }, "babel-plugin-transform-regenerator": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.26.0.tgz", "integrity": "sha1-4HA2lvveJ/Cj78rPi03KL3s6jy8=", "requires": { "regenerator-transform": "^0.10.0" } }, "babel-plugin-transform-strict-mode": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz", "integrity": "sha1-1fr3qleKZbvlkc9e2uBKDGcCB1g=", "requires": { "babel-runtime": "^6.22.0", "babel-types": "^6.24.1" } }, "babel-preset-es2015": { "version": "6.24.1", "resolved": "https://registry.npmjs.org/babel-preset-es2015/-/babel-preset-es2015-6.24.1.tgz", "integrity": "sha1-1EBQ1rwsn+6nAqrzjXJ6AhBTiTk=", "requires": { "babel-plugin-check-es2015-constants": "^6.22.0", "babel-plugin-transform-es2015-arrow-functions": "^6.22.0", "babel-plugin-transform-es2015-block-scoped-functions": "^6.22.0", "babel-plugin-transform-es2015-block-scoping": "^6.24.1", "babel-plugin-transform-es2015-classes": "^6.24.1", "babel-plugin-transform-es2015-computed-properties": "^6.24.1", "babel-plugin-transform-es2015-destructuring": "^6.22.0", "babel-plugin-transform-es2015-duplicate-keys": "^6.24.1", "babel-plugin-transform-es2015-for-of": "^6.22.0", "babel-plugin-transform-es2015-function-name": "^6.24.1", "babel-plugin-transform-es2015-literals": "^6.22.0", "babel-plugin-transform-es2015-modules-amd": "^6.24.1", "babel-plugin-transform-es2015-modules-commonjs": "^6.24.1", "babel-plugin-transform-es2015-modules-systemjs": "^6.24.1", "babel-plugin-transform-es2015-modules-umd": "^6.24.1", "babel-plugin-transform-es2015-object-super": "^6.24.1", "babel-plugin-transform-es2015-parameters": "^6.24.1", "babel-plugin-transform-es2015-shorthand-properties": "^6.24.1", "babel-plugin-transform-es2015-spread": "^6.22.0", "babel-plugin-transform-es2015-sticky-regex": "^6.24.1", "babel-plugin-transform-es2015-template-literals": "^6.22.0", "babel-plugin-transform-es2015-typeof-symbol": "^6.22.0", "babel-plugin-transform-es2015-unicode-regex": "^6.24.1", "babel-plugin-transform-regenerator": "^6.24.1" } }, "babel-register": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-register/-/babel-register-6.26.0.tgz", "integrity": "sha1-btAhFz4vy0htestFxgCahW9kcHE=", "requires": { "babel-core": "^6.26.0", "babel-runtime": "^6.26.0", "core-js": "^2.5.0", "home-or-tmp": "^2.0.0", "lodash": "^4.17.4", "mkdirp": "^0.5.1", "source-map-support": "^0.4.15" }, "dependencies": { "source-map-support": { "version": "0.4.18", "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.4.18.tgz", "integrity": "sha512-try0/JqxPLF9nOjvSta7tVondkP5dwgyLDjVoyMDlmjugT2lRZ1OfsrYTkCd2hkDnJTKRbO/Rl3orm8vlsUzbA==", "requires": { "source-map": "^0.5.6" } } } }, "babel-runtime": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-runtime/-/babel-runtime-6.26.0.tgz", "integrity": "sha1-llxwWGaOgrVde/4E/yM3vItWR/4=", "requires": { "core-js": "^2.4.0", "regenerator-runtime": "^0.11.0" } }, "babel-template": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-template/-/babel-template-6.26.0.tgz", "integrity": "sha1-3gPi0WOWsGn0bdn/+FIfsaDjXgI=", "requires": { "babel-runtime": "^6.26.0", "babel-traverse": "^6.26.0", "babel-types": "^6.26.0", "babylon": "^6.18.0", "lodash": "^4.17.4" } }, "babel-traverse": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-traverse/-/babel-traverse-6.26.0.tgz", "integrity": "sha1-RqnL1+3MYsjlwGTi0tjQ9ANXZu4=", "requires": { "babel-code-frame": "^6.26.0", "babel-messages": "^6.23.0", "babel-runtime": "^6.26.0", "babel-types": "^6.26.0", "babylon": "^6.18.0", "debug": "^2.6.8", "globals": "^9.18.0", "invariant": "^2.2.2", "lodash": "^4.17.4" } }, "babel-types": { "version": "6.26.0", "resolved": "https://registry.npmjs.org/babel-types/-/babel-types-6.26.0.tgz", "integrity": "sha1-o7Bz+Uq0nrb6Vc1lInozQ4BjJJc=", "requires": { "babel-runtime": "^6.26.0", "esutils": "^2.0.2", "lodash": "^4.17.4", "to-fast-properties": "^1.0.3" } }, "babylon": { "version": "6.18.0", "resolved": "https://registry.npmjs.org/babylon/-/babylon-6.18.0.tgz", "integrity": "sha512-q/UEjfGJ2Cm3oKV71DJz9d25TPnq5rhBVL2Q4fA5wcC3jcrdn7+SssEybFIxwAvvP+YCsCYNKughoF33GxgycQ==" }, "balanced-match": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=" }, "base": { "version": "0.11.2", "resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz", "integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==", "requires": { "cache-base": "^1.0.1", "class-utils": "^0.3.5", "component-emitter": "^1.2.1", "define-property": "^1.0.0", "isobject": "^3.0.1", "mixin-deep": "^1.2.0", "pascalcase": "^0.1.1" }, "dependencies": { "define-property": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "requires": { "is-descriptor": "^1.0.0" } }, "is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { "kind-of": "^6.0.0" } }, "is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { "kind-of": "^6.0.0" } }, "is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" } } } }, "base64-js": { "version": "1.3.1", "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.1.tgz", "integrity": "sha512-mLQ4i2QO1ytvGWFWmcngKO//JXAQueZvwEKtjgQFM4jIK0kU+ytMfplL8j+n5mspOfjHwoAg+9yhb7BwAHm36g==" }, "big.js": { "version": "5.2.2", "resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz", "integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ==" }, "binary-extensions": { "version": "1.13.1", "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==" }, "bindings": { "version": "1.5.0", "resolved": "https://registry.npmjs.org/bindings/-/bindings-1.5.0.tgz", "integrity": "sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==", "optional": true, "requires": { "file-uri-to-path": "1.0.0" } }, "bluebird": { "version": "3.7.2", "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.7.2.tgz", "integrity": "sha512-XpNj6GDQzdfW+r2Wnn7xiSAd7TM3jzkxGXBGTtWKuSXv1xUV+azxAm8jdWZN06QTQk+2N2XB9jRDkvbmQmcRtg==" }, "bn.js": { "version": "4.11.8", "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.8.tgz", "integrity": "sha512-ItfYfPLkWHUjckQCk8xC+LwxgK8NYcXywGigJgSwOP8Y2iyWT4f2vsZnoOXTTbo+o5yXmIUJ4gn5538SO5S3gA==" }, "brace-expansion": { "version": "1.1.11", "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", "requires": { "balanced-match": "^1.0.0", "concat-map": "0.0.1" } }, "braces": { "version": "2.3.2", "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", "requires": { "arr-flatten": "^1.1.0", "array-unique": "^0.3.2", "extend-shallow": "^2.0.1", "fill-range": "^4.0.0", "isobject": "^3.0.1", "repeat-element": "^1.1.2", "snapdragon": "^0.8.1", "snapdragon-node": "^2.0.1", "split-string": "^3.0.2", "to-regex": "^3.0.1" }, "dependencies": { "extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { "is-extendable": "^0.1.0" } } } }, "brorand": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz", "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=" }, "browserify-aes": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==", "requires": { "buffer-xor": "^1.0.3", "cipher-base": "^1.0.0", "create-hash": "^1.1.0", "evp_bytestokey": "^1.0.3", "inherits": "^2.0.1", "safe-buffer": "^5.0.1" } }, "browserify-cipher": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz", "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==", "requires": { "browserify-aes": "^1.0.4", "browserify-des": "^1.0.0", "evp_bytestokey": "^1.0.0" } }, "browserify-des": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz", "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==", "requires": { "cipher-base": "^1.0.1", "des.js": "^1.0.0", "inherits": "^2.0.1", "safe-buffer": "^5.1.2" } }, "browserify-rsa": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz", "integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=", "requires": { "bn.js": "^4.1.0", "randombytes": "^2.0.1" } }, "browserify-sign": { "version": "4.0.4", "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.0.4.tgz", "integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=", "requires": { "bn.js": "^4.1.1", "browserify-rsa": "^4.0.0", "create-hash": "^1.1.0", "create-hmac": "^1.1.2", "elliptic": "^6.0.0", "inherits": "^2.0.1", "parse-asn1": "^5.0.0" } }, "browserify-zlib": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz", "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==", "requires": { "pako": "~1.0.5" } }, "browserslist": { "version": "4.14.1", "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.14.1.tgz", "integrity": "sha512-zyBTIHydW37pnb63c7fHFXUG6EcqWOqoMdDx6cdyaDFriZ20EoVxcE95S54N+heRqY8m8IUgB5zYta/gCwSaaA==", "dev": true, "requires": { "caniuse-lite": "^1.0.30001124", "electron-to-chromium": "^1.3.562", "escalade": "^3.0.2", "node-releases": "^1.1.60" } }, "buffer": { "version": "4.9.2", "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", "requires": { "base64-js": "^1.0.2", "ieee754": "^1.1.4", "isarray": "^1.0.0" } }, "buffer-from": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz", "integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==" }, "buffer-xor": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz", "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=" }, "builtin-status-codes": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz", "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=" }, "cacache": { "version": "12.0.3", "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.3.tgz", "integrity": "sha512-kqdmfXEGFepesTuROHMs3MpFLWrPkSSpRqOw80RCflZXy/khxaArvFrQ7uJxSUduzAufc6G0g1VUCOZXxWavPw==", "requires": { "bluebird": "^3.5.5", "chownr": "^1.1.1", "figgy-pudding": "^3.5.1", "glob": "^7.1.4", "graceful-fs": "^4.1.15", "infer-owner": "^1.0.3", "lru-cache": "^5.1.1", "mississippi": "^3.0.0", "mkdirp": "^0.5.1", "move-concurrently": "^1.0.1", "promise-inflight": "^1.0.1", "rimraf": "^2.6.3", "ssri": "^6.0.1", "unique-filename": "^1.1.1", "y18n": "^4.0.0" } }, "cache-base": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz", "integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==", "requires": { "collection-visit": "^1.0.0", "component-emitter": "^1.2.1", "get-value": "^2.0.6", "has-value": "^1.0.0", "isobject": "^3.0.1", "set-value": "^2.0.0", "to-object-path": "^0.3.0", "union-value": "^1.0.0", "unset-value": "^1.0.0" } }, "camelcase": { "version": "5.3.1", "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==" }, "caniuse-lite": { "version": "1.0.30001125", "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001125.tgz", "integrity": "sha512-9f+r7BW8Qli917mU3j0fUaTweT3f3vnX/Lcs+1C73V+RADmFme+Ih0Br8vONQi3X0lseOe6ZHfsZLCA8MSjxUA==", "dev": true }, "chalk": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", "requires": { "ansi-styles": "^2.2.1", "escape-string-regexp": "^1.0.2", "has-ansi": "^2.0.0", "strip-ansi": "^3.0.0", "supports-color": "^2.0.0" } }, "chokidar": { "version": "2.1.8", "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", "requires": { "anymatch": "^2.0.0", "async-each": "^1.0.1", "braces": "^2.3.2", "fsevents": "^1.2.7", "glob-parent": "^3.1.0", "inherits": "^2.0.3", "is-binary-path": "^1.0.0", "is-glob": "^4.0.0", "normalize-path": "^3.0.0", "path-is-absolute": "^1.0.0", "readdirp": "^2.2.1", "upath": "^1.1.1" } }, "chownr": { "version": "1.1.4", "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.4.tgz", "integrity": "sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg==" }, "chrome-trace-event": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-1.0.2.tgz", "integrity": "sha512-9e/zx1jw7B4CO+c/RXoCsfg/x1AfUBioy4owYH0bJprEYAx5hRFLRhWBqHAG57D0ZM4H7vxbP7bPe0VwhQRYDQ==", "requires": { "tslib": "^1.9.0" } }, "cipher-base": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz", "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==", "requires": { "inherits": "^2.0.1", "safe-buffer": "^5.0.1" } }, "class-utils": { "version": "0.3.6", "resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz", "integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==", "requires": { "arr-union": "^3.1.0", "define-property": "^0.2.5", "isobject": "^3.0.0", "static-extend": "^0.1.1" }, "dependencies": { "define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { "is-descriptor": "^0.1.0" } } } }, "cliui": { "version": "5.0.0", "resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", "integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==", "requires": { "string-width": "^3.1.0", "strip-ansi": "^5.2.0", "wrap-ansi": "^5.1.0" }, "dependencies": { "ansi-regex": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==" }, "strip-ansi": { "version": "5.2.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "requires": { "ansi-regex": "^4.1.0" } } } }, "collection-visit": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz", "integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=", "requires": { "map-visit": "^1.0.0", "object-visit": "^1.0.0" } }, "color-convert": { "version": "1.9.3", "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", "requires": { "color-name": "1.1.3" } }, "color-name": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" }, "commander": { "version": "2.20.3", "resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz", "integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==" }, "commondir": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz", "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=" }, "component-emitter": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz", "integrity": "sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg==" }, "concat-map": { "version": "0.0.1", "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=" }, "concat-stream": { "version": "1.6.2", "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz", "integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==", "requires": { "buffer-from": "^1.0.0", "inherits": "^2.0.3", "readable-stream": "^2.2.2", "typedarray": "^0.0.6" } }, "console-browserify": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz", "integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA==" }, "constants-browserify": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz", "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=" }, "convert-source-map": { "version": "1.7.0", "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", "requires": { "safe-buffer": "~5.1.1" } }, "copy-concurrently": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz", "integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==", "requires": { "aproba": "^1.1.1", "fs-write-stream-atomic": "^1.0.8", "iferr": "^0.1.5", "mkdirp": "^0.5.1", "rimraf": "^2.5.4", "run-queue": "^1.0.0" } }, "copy-descriptor": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz", "integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=" }, "core-js": { "version": "2.6.11", "resolved": "https://registry.npmjs.org/core-js/-/core-js-2.6.11.tgz", "integrity": "sha512-5wjnpaT/3dV+XB4borEsnAYQchn00XSgTAWKDkEqv+K8KevjbzmofK6hfJ9TZIlpj2N0xQpazy7PiRQiWHqzWg==" }, "core-js-compat": { "version": "3.6.5", "resolved": "https://registry.npmjs.org/core-js-compat/-/core-js-compat-3.6.5.tgz", "integrity": "sha512-7ItTKOhOZbznhXAQ2g/slGg1PJV5zDO/WdkTwi7UEOJmkvsE32PWvx6mKtDjiMpjnR2CNf6BAD6sSxIlv7ptng==", "dev": true, "requires": { "browserslist": "^4.8.5", "semver": "7.0.0" }, "dependencies": { "semver": { "version": "7.0.0", "resolved": "https://registry.npmjs.org/semver/-/semver-7.0.0.tgz", "integrity": "sha512-+GB6zVA9LWh6zovYQLALHwv5rb2PHGlJi3lfiqIHxR0uuwCgefcOJc59v9fv1w8GbStwxuuqqAjI9NMAOOgq1A==", "dev": true } } }, "core-util-is": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=" }, "create-ecdh": { "version": "4.0.3", "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.3.tgz", "integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==", "requires": { "bn.js": "^4.1.0", "elliptic": "^6.0.0" } }, "create-hash": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==", "requires": { "cipher-base": "^1.0.1", "inherits": "^2.0.1", "md5.js": "^1.3.4", "ripemd160": "^2.0.1", "sha.js": "^2.4.0" } }, "create-hmac": { "version": "1.1.7", "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==", "requires": { "cipher-base": "^1.0.3", "create-hash": "^1.1.0", "inherits": "^2.0.1", "ripemd160": "^2.0.0", "safe-buffer": "^5.0.1", "sha.js": "^2.4.8" } }, "crel": { "version": "4.2.0", "resolved": "https://registry.npmjs.org/crel/-/crel-4.2.0.tgz", "integrity": "sha512-ZBVhTmtapdjEn8rTcTR/ePE0JSNfHzZfDkD3eAnsQEBmkQW9r14mzq6tK5Hkw6r26l7XxlU2Ox1nfHsmGIj0zQ==" }, "cross-spawn": { "version": "6.0.5", "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz", "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", "requires": { "nice-try": "^1.0.4", "path-key": "^2.0.1", "semver": "^5.5.0", "shebang-command": "^1.2.0", "which": "^1.2.9" } }, "crypto-browserify": { "version": "3.12.0", "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz", "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==", "requires": { "browserify-cipher": "^1.0.0", "browserify-sign": "^4.0.0", "create-ecdh": "^4.0.0", "create-hash": "^1.1.0", "create-hmac": "^1.1.0", "diffie-hellman": "^5.0.0", "inherits": "^2.0.1", "pbkdf2": "^3.0.3", "public-encrypt": "^4.0.0", "randombytes": "^2.0.0", "randomfill": "^1.0.3" } }, "cyclist": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz", "integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk=" }, "debug": { "version": "2.6.9", "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", "requires": { "ms": "2.0.0" } }, "decamelize": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=" }, "decode-uri-component": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz", "integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=" }, "define-properties": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz", "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==", "dev": true, "requires": { "object-keys": "^1.0.12" } }, "define-property": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz", "integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==", "requires": { "is-descriptor": "^1.0.2", "isobject": "^3.0.1" }, "dependencies": { "is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { "kind-of": "^6.0.0" } }, "is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { "kind-of": "^6.0.0" } }, "is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" } } } }, "des.js": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz", "integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==", "requires": { "inherits": "^2.0.1", "minimalistic-assert": "^1.0.0" } }, "detect-file": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/detect-file/-/detect-file-1.0.0.tgz", "integrity": "sha1-8NZtA2cqglyxtzvbP+YjEMjlUrc=" }, "detect-indent": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/detect-indent/-/detect-indent-4.0.0.tgz", "integrity": "sha1-920GQ1LN9Docts5hnE7jqUdd4gg=", "requires": { "repeating": "^2.0.0" } }, "diffie-hellman": { "version": "5.0.3", "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==", "requires": { "bn.js": "^4.1.0", "miller-rabin": "^4.0.0", "randombytes": "^2.0.0" } }, "domain-browser": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz", "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==" }, "duplexify": { "version": "3.7.1", "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz", "integrity": "sha512-07z8uv2wMyS51kKhD1KsdXJg5WQ6t93RneqRxUHnskXVtlYYkLqM0gqStQZ3pj073g687jPCHrqNfCzawLYh5g==", "requires": { "end-of-stream": "^1.0.0", "inherits": "^2.0.1", "readable-stream": "^2.0.0", "stream-shift": "^1.0.0" } }, "electron-to-chromium": { "version": "1.3.564", "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.564.tgz", "integrity": "sha512-fNaYN3EtKQWLQsrKXui8mzcryJXuA0LbCLoizeX6oayG2emBaS5MauKjCPAvc29NEY4FpLHIUWiP+Y0Bfrs5dg==", "dev": true }, "elliptic": { "version": "6.5.2", "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.2.tgz", "integrity": "sha512-f4x70okzZbIQl/NSRLkI/+tteV/9WqL98zx+SQ69KbXxmVrmjwsNUPn/gYJJ0sHvEak24cZgHIPegRePAtA/xw==", "requires": { "bn.js": "^4.4.0", "brorand": "^1.0.1", "hash.js": "^1.0.0", "hmac-drbg": "^1.0.0", "inherits": "^2.0.1", "minimalistic-assert": "^1.0.0", "minimalistic-crypto-utils": "^1.0.0" } }, "emoji-regex": { "version": "7.0.3", "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==" }, "emojis-list": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-3.0.0.tgz", "integrity": "sha512-/kyM18EfinwXZbno9FyUGeFh87KC8HRQBQGildHZbEuRyWFOmv1U10o9BBp8XVZDVNNuQKyIGIu5ZYAAXJ0V2Q==" }, "end-of-stream": { "version": "1.4.4", "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz", "integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==", "requires": { "once": "^1.4.0" } }, "enhanced-resolve": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.1.tgz", "integrity": "sha512-98p2zE+rL7/g/DzMHMTF4zZlCgeVdJ7yr6xzEpJRYwFYrGi9ANdn5DnJURg6RpBkyk60XYDnWIv51VfIhfNGuA==", "requires": { "graceful-fs": "^4.1.2", "memory-fs": "^0.5.0", "tapable": "^1.0.0" }, "dependencies": { "memory-fs": { "version": "0.5.0", "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.5.0.tgz", "integrity": "sha512-jA0rdU5KoQMC0e6ppoNRtpp6vjFq6+NY7r8hywnC7V+1Xj/MtHwGIbB1QaK/dunyjWteJzmkpd7ooeWg10T7GA==", "requires": { "errno": "^0.1.3", "readable-stream": "^2.0.1" } } } }, "entities": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/entities/-/entities-2.1.0.tgz", "integrity": "sha512-hCx1oky9PFrJ611mf0ifBLBRW8lUUVRlFolb5gWRfIELabBlbp9xZvrqZLZAs+NxFnbfQoeGd8wDkygjg7U85w==" }, "errno": { "version": "0.1.7", "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz", "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==", "requires": { "prr": "~1.0.1" } }, "escalade": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.0.2.tgz", "integrity": "sha512-gPYAU37hYCUhW5euPeR+Y74F7BL+IBsV93j5cvGriSaD1aG6MGsqsV1yamRdrWrb2j3aiZvb0X+UBOWpx3JWtQ==", "dev": true }, "escape-string-regexp": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=" }, "eslint-scope": { "version": "4.0.3", "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-4.0.3.tgz", "integrity": "sha512-p7VutNr1O/QrxysMo3E45FjYDTeXBy0iTltPFNSqKAIfjDSXC+4dj+qfyuD8bfAXrW/y6lW3O76VaYNPKfpKrg==", "requires": { "esrecurse": "^4.1.0", "estraverse": "^4.1.1" } }, "esrecurse": { "version": "4.2.1", "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.2.1.tgz", "integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==", "requires": { "estraverse": "^4.1.0" } }, "estraverse": { "version": "4.3.0", "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.3.0.tgz", "integrity": "sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==" }, "esutils": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==" }, "events": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/events/-/events-3.1.0.tgz", "integrity": "sha512-Rv+u8MLHNOdMjTAFeT3nCjHn2aGlx435FP/sDHNaRhDEMwyI/aB22Kj2qIN8R0cw3z28psEQLYwxVKLsKrMgWg==" }, "evp_bytestokey": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz", "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==", "requires": { "md5.js": "^1.3.4", "safe-buffer": "^5.1.1" } }, "execa": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/execa/-/execa-1.0.0.tgz", "integrity": "sha512-adbxcyWV46qiHyvSp50TKt05tB4tK3HcmF7/nxfAdhnox83seTDbwnaqKO4sXRy7roHAIFqJP/Rw/AuEbX61LA==", "requires": { "cross-spawn": "^6.0.0", "get-stream": "^4.0.0", "is-stream": "^1.1.0", "npm-run-path": "^2.0.0", "p-finally": "^1.0.0", "signal-exit": "^3.0.0", "strip-eof": "^1.0.0" } }, "expand-brackets": { "version": "2.1.4", "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz", "integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=", "requires": { "debug": "^2.3.3", "define-property": "^0.2.5", "extend-shallow": "^2.0.1", "posix-character-classes": "^0.1.0", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.1" }, "dependencies": { "define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { "is-descriptor": "^0.1.0" } }, "extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { "is-extendable": "^0.1.0" } } } }, "expand-tilde": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/expand-tilde/-/expand-tilde-2.0.2.tgz", "integrity": "sha1-l+gBqgUt8CRU3kawK/YhZCzchQI=", "requires": { "homedir-polyfill": "^1.0.1" } }, "extend-shallow": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz", "integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=", "requires": { "assign-symbols": "^1.0.0", "is-extendable": "^1.0.1" }, "dependencies": { "is-extendable": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", "requires": { "is-plain-object": "^2.0.4" } } } }, "extglob": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz", "integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==", "requires": { "array-unique": "^0.3.2", "define-property": "^1.0.0", "expand-brackets": "^2.1.4", "extend-shallow": "^2.0.1", "fragment-cache": "^0.2.1", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.1" }, "dependencies": { "define-property": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "requires": { "is-descriptor": "^1.0.0" } }, "extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { "is-extendable": "^0.1.0" } }, "is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { "kind-of": "^6.0.0" } }, "is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { "kind-of": "^6.0.0" } }, "is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" } } } }, "fast-deep-equal": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.1.tgz", "integrity": "sha512-8UEa58QDLauDNfpbrX55Q9jrGHThw2ZMdOky5Gl1CDtVeJDPVrG4Jxx1N8jw2gkWaff5UUuX1KJd+9zGe2B+ZA==" }, "fast-json-stable-stringify": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==" }, "figgy-pudding": { "version": "3.5.1", "resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.1.tgz", "integrity": "sha512-vNKxJHTEKNThjfrdJwHc7brvM6eVevuO5nTj6ez8ZQ1qbXTvGthucRF7S4vf2cr71QVnT70V34v0S1DyQsti0w==" }, "file-uri-to-path": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz", "integrity": "sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==", "optional": true }, "fill-range": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", "requires": { "extend-shallow": "^2.0.1", "is-number": "^3.0.0", "repeat-string": "^1.6.1", "to-regex-range": "^2.1.0" }, "dependencies": { "extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { "is-extendable": "^0.1.0" } } } }, "find-cache-dir": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz", "integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==", "requires": { "commondir": "^1.0.1", "make-dir": "^2.0.0", "pkg-dir": "^3.0.0" } }, "find-up": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", "requires": { "locate-path": "^3.0.0" } }, "findup-sync": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/findup-sync/-/findup-sync-3.0.0.tgz", "integrity": "sha512-YbffarhcicEhOrm4CtrwdKBdCuz576RLdhJDsIfvNtxUuhdRet1qZcsMjqbePtAseKdAnDyM/IyXbu7PRPRLYg==", "requires": { "detect-file": "^1.0.0", "is-glob": "^4.0.0", "micromatch": "^3.0.4", "resolve-dir": "^1.0.1" } }, "flush-write-stream": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.1.1.tgz", "integrity": "sha512-3Z4XhFZ3992uIq0XOqb9AreonueSYphE6oYbpt5+3u06JWklbsPkNv3ZKkP9Bz/r+1MWCaMoSQ28P85+1Yc77w==", "requires": { "inherits": "^2.0.3", "readable-stream": "^2.3.6" } }, "for-in": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz", "integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=" }, "fragment-cache": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz", "integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=", "requires": { "map-cache": "^0.2.2" } }, "from2": { "version": "2.3.0", "resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz", "integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=", "requires": { "inherits": "^2.0.1", "readable-stream": "^2.0.0" } }, "fs-write-stream-atomic": { "version": "1.0.10", "resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz", "integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=", "requires": { "graceful-fs": "^4.1.2", "iferr": "^0.1.5", "imurmurhash": "^0.1.4", "readable-stream": "1 || 2" } }, "fs.realpath": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=" }, "fsevents": { "version": "1.2.11", "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.11.tgz", "integrity": "sha512-+ux3lx6peh0BpvY0JebGyZoiR4D+oYzdPZMKJwkZ+sFkNJzpL7tXc/wehS49gUAxg3tmMHPHZkA8JU2rhhgDHw==", "optional": true, "requires": { "bindings": "^1.5.0", "nan": "^2.12.1", "node-pre-gyp": "*" }, "dependencies": { "abbrev": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz", "integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==", "bundled": true, "optional": true }, "ansi-regex": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", "bundled": true, "optional": true }, "aproba": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==", "bundled": true, "optional": true }, "are-we-there-yet": { "version": "1.1.5", "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz", "integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==", "bundled": true, "optional": true, "requires": { "delegates": "^1.0.0", "readable-stream": "^2.0.6" } }, "balanced-match": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=", "bundled": true, "optional": true }, "brace-expansion": { "version": "1.1.11", "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", "bundled": true, "optional": true, "requires": { "balanced-match": "^1.0.0", "concat-map": "0.0.1" } }, "chownr": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.3.tgz", "integrity": "sha512-i70fVHhmV3DtTl6nqvZOnIjbY0Pe4kAUjwHj8z0zAdgBtYrJyYwLKCCuRBQ5ppkyL0AkN7HKRnETdmdp1zqNXw==", "bundled": true, "optional": true }, "code-point-at": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz", "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=", "bundled": true, "optional": true }, "concat-map": { "version": "0.0.1", "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=", "bundled": true, "optional": true }, "console-control-strings": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz", "integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=", "bundled": true, "optional": true }, "core-util-is": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=", "bundled": true, "optional": true }, "debug": { "version": "3.2.6", "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz", "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", "bundled": true, "optional": true, "requires": { "ms": "^2.1.1" } }, "deep-extend": { "version": "0.6.0", "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz", "integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==", "bundled": true, "optional": true }, "delegates": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz", "integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=", "bundled": true, "optional": true }, "detect-libc": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-1.0.3.tgz", "integrity": "sha1-+hN8S9aY7fVc1c0CrFWfkaTEups=", "bundled": true, "optional": true }, "fs-minipass": { "version": "1.2.7", "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-1.2.7.tgz", "integrity": "sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==", "bundled": true, "optional": true, "requires": { "minipass": "^2.6.0" } }, "fs.realpath": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=", "bundled": true, "optional": true }, "gauge": { "version": "2.7.4", "resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz", "integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=", "bundled": true, "optional": true, "requires": { "aproba": "^1.0.3", "console-control-strings": "^1.0.0", "has-unicode": "^2.0.0", "object-assign": "^4.1.0", "signal-exit": "^3.0.0", "string-width": "^1.0.1", "strip-ansi": "^3.0.1", "wide-align": "^1.1.0" } }, "glob": { "version": "7.1.6", "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", "bundled": true, "optional": true, "requires": { "fs.realpath": "^1.0.0", "inflight": "^1.0.4", "inherits": "2", "minimatch": "^3.0.4", "once": "^1.3.0", "path-is-absolute": "^1.0.0" } }, "has-unicode": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz", "integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=", "bundled": true, "optional": true }, "iconv-lite": { "version": "0.4.24", "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", "bundled": true, "optional": true, "requires": { "safer-buffer": ">= 2.1.2 < 3" } }, "ignore-walk": { "version": "3.0.3", "resolved": "https://registry.npmjs.org/ignore-walk/-/ignore-walk-3.0.3.tgz", "integrity": "sha512-m7o6xuOaT1aqheYHKf8W6J5pYH85ZI9w077erOzLje3JsB1gkafkAhHHY19dqjulgIZHFm32Cp5uNZgcQqdJKw==", "bundled": true, "optional": true, "requires": { "minimatch": "^3.0.4" } }, "inflight": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", "bundled": true, "optional": true, "requires": { "once": "^1.3.0", "wrappy": "1" } }, "inherits": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", "bundled": true, "optional": true }, "ini": { "version": "1.3.5", "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz", "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==", "bundled": true, "optional": true }, "is-fullwidth-code-point": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", "bundled": true, "optional": true, "requires": { "number-is-nan": "^1.0.0" } }, "isarray": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=", "bundled": true, "optional": true }, "minimatch": { "version": "3.0.4", "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz", "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==", "bundled": true, "optional": true, "requires": { "brace-expansion": "^1.1.7" } }, "minimist": { "version": "0.0.8", "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz", "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=", "bundled": true, "optional": true }, "minipass": { "version": "2.9.0", "resolved": "https://registry.npmjs.org/minipass/-/minipass-2.9.0.tgz", "integrity": "sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==", "bundled": true, "optional": true, "requires": { "safe-buffer": "^5.1.2", "yallist": "^3.0.0" } }, "minizlib": { "version": "1.3.3", "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-1.3.3.tgz", "integrity": "sha512-6ZYMOEnmVsdCeTJVE0W9ZD+pVnE8h9Hma/iOwwRDsdQoePpoX56/8B6z3P9VNwppJuBKNRuFDRNRqRWexT9G9Q==", "bundled": true, "optional": true, "requires": { "minipass": "^2.9.0" } }, "mkdirp": { "version": "0.5.1", "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=", "bundled": true, "optional": true, "requires": { "minimist": "0.0.8" } }, "ms": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", "bundled": true, "optional": true }, "needle": { "version": "2.4.0", "resolved": "https://registry.npmjs.org/needle/-/needle-2.4.0.tgz", "integrity": "sha512-4Hnwzr3mi5L97hMYeNl8wRW/Onhy4nUKR/lVemJ8gJedxxUyBLm9kkrDColJvoSfwi0jCNhD+xCdOtiGDQiRZg==", "bundled": true, "optional": true, "requires": { "debug": "^3.2.6", "iconv-lite": "^0.4.4", "sax": "^1.2.4" } }, "node-pre-gyp": { "version": "0.14.0", "resolved": "https://registry.npmjs.org/node-pre-gyp/-/node-pre-gyp-0.14.0.tgz", "integrity": "sha512-+CvDC7ZttU/sSt9rFjix/P05iS43qHCOOGzcr3Ry99bXG7VX953+vFyEuph/tfqoYu8dttBkE86JSKBO2OzcxA==", "bundled": true, "optional": true, "requires": { "detect-libc": "^1.0.2", "mkdirp": "^0.5.1", "needle": "^2.2.1", "nopt": "^4.0.1", "npm-packlist": "^1.1.6", "npmlog": "^4.0.2", "rc": "^1.2.7", "rimraf": "^2.6.1", "semver": "^5.3.0", "tar": "^4.4.2" } }, "nopt": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/nopt/-/nopt-4.0.1.tgz", "integrity": "sha1-0NRoWv1UFRk8jHUFYC0NF81kR00=", "bundled": true, "optional": true, "requires": { "abbrev": "1", "osenv": "^0.1.4" } }, "npm-bundled": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/npm-bundled/-/npm-bundled-1.1.1.tgz", "integrity": "sha512-gqkfgGePhTpAEgUsGEgcq1rqPXA+tv/aVBlgEzfXwA1yiUJF7xtEt3CtVwOjNYQOVknDk0F20w58Fnm3EtG0fA==", "bundled": true, "optional": true, "requires": { "npm-normalize-package-bin": "^1.0.1" } }, "npm-normalize-package-bin": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/npm-normalize-package-bin/-/npm-normalize-package-bin-1.0.1.tgz", "integrity": "sha512-EPfafl6JL5/rU+ot6P3gRSCpPDW5VmIzX959Ob1+ySFUuuYHWHekXpwdUZcKP5C+DS4GEtdJluwBjnsNDl+fSA==", "bundled": true, "optional": true }, "npm-packlist": { "version": "1.4.7", "resolved": "https://registry.npmjs.org/npm-packlist/-/npm-packlist-1.4.7.tgz", "integrity": "sha512-vAj7dIkp5NhieaGZxBJB8fF4R0078rqsmhJcAfXZ6O7JJhjhPK96n5Ry1oZcfLXgfun0GWTZPOxaEyqv8GBykQ==", "bundled": true, "optional": true, "requires": { "ignore-walk": "^3.0.1", "npm-bundled": "^1.0.1" } }, "npmlog": { "version": "4.1.2", "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz", "integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==", "bundled": true, "optional": true, "requires": { "are-we-there-yet": "~1.1.2", "console-control-strings": "~1.1.0", "gauge": "~2.7.3", "set-blocking": "~2.0.0" } }, "number-is-nan": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz", "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=", "bundled": true, "optional": true }, "object-assign": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=", "bundled": true, "optional": true }, "once": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", "bundled": true, "optional": true, "requires": { "wrappy": "1" } }, "os-homedir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=", "bundled": true, "optional": true }, "os-tmpdir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=", "bundled": true, "optional": true }, "osenv": { "version": "0.1.5", "resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz", "integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==", "bundled": true, "optional": true, "requires": { "os-homedir": "^1.0.0", "os-tmpdir": "^1.0.0" } }, "path-is-absolute": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=", "bundled": true, "optional": true }, "process-nextick-args": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==", "bundled": true, "optional": true }, "rc": { "version": "1.2.8", "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz", "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==", "bundled": true, "optional": true, "requires": { "deep-extend": "^0.6.0", "ini": "~1.3.0", "minimist": "^1.2.0", "strip-json-comments": "~2.0.1" }, "dependencies": { "minimist": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", "bundled": true, "optional": true } } }, "readable-stream": { "version": "2.3.6", "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz", "integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==", "bundled": true, "optional": true, "requires": { "core-util-is": "~1.0.0", "inherits": "~2.0.3", "isarray": "~1.0.0", "process-nextick-args": "~2.0.0", "safe-buffer": "~5.1.1", "string_decoder": "~1.1.1", "util-deprecate": "~1.0.1" } }, "rimraf": { "version": "2.7.1", "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", "bundled": true, "optional": true, "requires": { "glob": "^7.1.3" } }, "safe-buffer": { "version": "5.1.2", "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", "bundled": true, "optional": true }, "safer-buffer": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==", "bundled": true, "optional": true }, "sax": { "version": "1.2.4", "resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz", "integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==", "bundled": true, "optional": true }, "semver": { "version": "5.7.1", "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", "bundled": true, "optional": true }, "set-blocking": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=", "bundled": true, "optional": true }, "signal-exit": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz", "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=", "bundled": true, "optional": true }, "string_decoder": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", "bundled": true, "optional": true, "requires": { "safe-buffer": "~5.1.0" } }, "string-width": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", "bundled": true, "optional": true, "requires": { "code-point-at": "^1.0.0", "is-fullwidth-code-point": "^1.0.0", "strip-ansi": "^3.0.0" } }, "strip-ansi": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", "bundled": true, "optional": true, "requires": { "ansi-regex": "^2.0.0" } }, "strip-json-comments": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz", "integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=", "bundled": true, "optional": true }, "tar": { "version": "4.4.13", "resolved": "https://registry.npmjs.org/tar/-/tar-4.4.13.tgz", "integrity": "sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==", "bundled": true, "optional": true, "requires": { "chownr": "^1.1.1", "fs-minipass": "^1.2.5", "minipass": "^2.8.6", "minizlib": "^1.2.1", "mkdirp": "^0.5.0", "safe-buffer": "^5.1.2", "yallist": "^3.0.3" } }, "util-deprecate": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=", "bundled": true, "optional": true }, "wide-align": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz", "integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==", "bundled": true, "optional": true, "requires": { "string-width": "^1.0.2 || 2" } }, "wrappy": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=", "bundled": true, "optional": true }, "yallist": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", "bundled": true, "optional": true } } }, "function-bind": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==", "dev": true }, "gensync": { "version": "1.0.0-beta.1", "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.1.tgz", "integrity": "sha512-r8EC6NO1sngH/zdD9fiRDLdcgnbayXah+mLgManTaIZJqEC1MZstmnox8KpnI2/fxQwrp5OpCOYWLp4rBl4Jcg==", "dev": true }, "get-caller-file": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==" }, "get-stream": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz", "integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==", "requires": { "pump": "^3.0.0" } }, "get-value": { "version": "2.0.6", "resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz", "integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=" }, "glob": { "version": "7.1.6", "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", "requires": { "fs.realpath": "^1.0.0", "inflight": "^1.0.4", "inherits": "2", "minimatch": "^3.0.4", "once": "^1.3.0", "path-is-absolute": "^1.0.0" } }, "glob-parent": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", "requires": { "is-glob": "^3.1.0", "path-dirname": "^1.0.0" }, "dependencies": { "is-glob": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", "requires": { "is-extglob": "^2.1.0" } } } }, "global-modules": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz", "integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==", "requires": { "global-prefix": "^3.0.0" }, "dependencies": { "global-prefix": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz", "integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==", "requires": { "ini": "^1.3.5", "kind-of": "^6.0.2", "which": "^1.3.1" } } } }, "global-prefix": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-1.0.2.tgz", "integrity": "sha1-2/dDxsFJklk8ZVVoy2btMsASLr4=", "requires": { "expand-tilde": "^2.0.2", "homedir-polyfill": "^1.0.1", "ini": "^1.3.4", "is-windows": "^1.0.1", "which": "^1.2.14" } }, "globals": { "version": "9.18.0", "resolved": "https://registry.npmjs.org/globals/-/globals-9.18.0.tgz", "integrity": "sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==" }, "graceful-fs": { "version": "4.2.3", "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==" }, "has-ansi": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz", "integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=", "requires": { "ansi-regex": "^2.0.0" } }, "has-flag": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=" }, "has-symbols": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", "dev": true }, "has-value": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz", "integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=", "requires": { "get-value": "^2.0.6", "has-values": "^1.0.0", "isobject": "^3.0.0" } }, "has-values": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz", "integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=", "requires": { "is-number": "^3.0.0", "kind-of": "^4.0.0" }, "dependencies": { "kind-of": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz", "integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=", "requires": { "is-buffer": "^1.1.5" } } } }, "hash-base": { "version": "3.0.4", "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.0.4.tgz", "integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=", "requires": { "inherits": "^2.0.1", "safe-buffer": "^5.0.1" } }, "hash.js": { "version": "1.1.7", "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz", "integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==", "requires": { "inherits": "^2.0.3", "minimalistic-assert": "^1.0.1" } }, "hmac-drbg": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz", "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=", "requires": { "hash.js": "^1.0.3", "minimalistic-assert": "^1.0.0", "minimalistic-crypto-utils": "^1.0.1" } }, "home-or-tmp": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/home-or-tmp/-/home-or-tmp-2.0.0.tgz", "integrity": "sha1-42w/LSyufXRqhX440Y1fMqeILbg=", "requires": { "os-homedir": "^1.0.0", "os-tmpdir": "^1.0.1" } }, "homedir-polyfill": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/homedir-polyfill/-/homedir-polyfill-1.0.3.tgz", "integrity": "sha512-eSmmWE5bZTK2Nou4g0AI3zZ9rswp7GRKoKXS1BLUkvPviOqs4YTN1djQIqrXy9k5gEtdLPy86JjRwsNM9tnDcA==", "requires": { "parse-passwd": "^1.0.0" } }, "https-browserify": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz", "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=" }, "ieee754": { "version": "1.1.13", "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.13.tgz", "integrity": "sha512-4vf7I2LYV/HaWerSo3XmlMkp5eZ83i+/CDluXi/IGTs/O1sejBNhTtnxzmRZfvOUqj7lZjqHkeTvpgSFDlWZTg==" }, "iferr": { "version": "0.1.5", "resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz", "integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE=" }, "import-local": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz", "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", "requires": { "pkg-dir": "^3.0.0", "resolve-cwd": "^2.0.0" } }, "imurmurhash": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=" }, "infer-owner": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz", "integrity": "sha512-IClj+Xz94+d7irH5qRyfJonOdfTzuDaifE6ZPWfx0N0+/ATZCbuTPq2prFl526urkQd90WyUKIh1DfBQ2hMz9A==" }, "inflight": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", "requires": { "once": "^1.3.0", "wrappy": "1" } }, "inherits": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" }, "ini": { "version": "1.3.5", "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz", "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==" }, "interpret": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/interpret/-/interpret-1.2.0.tgz", "integrity": "sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==" }, "invariant": { "version": "2.2.4", "resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz", "integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==", "requires": { "loose-envify": "^1.0.0" } }, "invert-kv": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-2.0.0.tgz", "integrity": "sha512-wPVv/y/QQ/Uiirj/vh3oP+1Ww+AWehmi1g5fFWGPF6IpCBCDVrhgHRMvrLfdYcwDh3QJbGXDW4JAuzxElLSqKA==" }, "is-accessor-descriptor": { "version": "0.1.6", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", "integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=", "requires": { "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { "is-buffer": "^1.1.5" } } } }, "is-binary-path": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", "requires": { "binary-extensions": "^1.0.0" } }, "is-buffer": { "version": "1.1.6", "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" }, "is-data-descriptor": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", "integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=", "requires": { "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { "is-buffer": "^1.1.5" } } } }, "is-descriptor": { "version": "0.1.6", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", "requires": { "is-accessor-descriptor": "^0.1.6", "is-data-descriptor": "^0.1.4", "kind-of": "^5.0.0" }, "dependencies": { "kind-of": { "version": "5.1.0", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==" } } }, "is-extendable": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=" }, "is-extglob": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=" }, "is-finite": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.1.0.tgz", "integrity": "sha512-cdyMtqX/BOqqNBBiKlIVkytNHm49MtMlYyn1zxzvJKWmFMlGzm+ry5BBfYyeY9YmNKbRSo/o7OX9w9ale0wg3w==" }, "is-fullwidth-code-point": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=" }, "is-glob": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz", "integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==", "requires": { "is-extglob": "^2.1.1" } }, "is-number": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", "requires": { "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { "is-buffer": "^1.1.5" } } } }, "is-plain-object": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz", "integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==", "requires": { "isobject": "^3.0.1" } }, "is-stream": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz", "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=" }, "is-windows": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz", "integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==" }, "is-wsl": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=" }, "isarray": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=" }, "isexe": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=" }, "isobject": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz", "integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8=" }, "js-tokens": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-3.0.2.tgz", "integrity": "sha1-mGbfOVECEw449/mWvOtlRDIJwls=" }, "jsesc": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-1.3.0.tgz", "integrity": "sha1-RsP+yMGJKxKwgz25vHYiF226s0s=" }, "json-parse-better-errors": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz", "integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw==" }, "json-schema-traverse": { "version": "0.4.1", "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==" }, "json5": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", "requires": { "minimist": "^1.2.0" } }, "kind-of": { "version": "6.0.3", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.3.tgz", "integrity": "sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw==" }, "lcid": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/lcid/-/lcid-2.0.0.tgz", "integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==", "requires": { "invert-kv": "^2.0.0" } }, "leven": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/leven/-/leven-3.1.0.tgz", "integrity": "sha512-qsda+H8jTaUaN/x5vzW2rzc+8Rw4TAQ/4KjB46IwK5VH+IlVeeeje/EoZRpiXvIqjFgK84QffqPztGI3VBLG1A==", "dev": true }, "levenary": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/levenary/-/levenary-1.1.1.tgz", "integrity": "sha512-mkAdOIt79FD6irqjYSs4rdbnlT5vRonMEvBVPVb3XmevfS8kgRXwfes0dhPdEtzTWD/1eNE/Bm/G1iRt6DcnQQ==", "dev": true, "requires": { "leven": "^3.1.0" } }, "linkify-it": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-3.0.2.tgz", "integrity": "sha512-gDBO4aHNZS6coiZCKVhSNh43F9ioIL4JwRjLZPkoLIY4yZFwg264Y5lu2x6rb1Js42Gh6Yqm2f6L2AJcnkzinQ==", "requires": { "uc.micro": "^1.0.1" } }, "loader-runner": { "version": "2.4.0", "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz", "integrity": "sha512-Jsmr89RcXGIwivFY21FcRrisYZfvLMTWx5kOLc+JTxtpBOG6xML0vzbc6SEQG2FO9/4Fc3wW4LVcB5DmGflaRw==" }, "loader-utils": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", "requires": { "big.js": "^5.2.2", "emojis-list": "^3.0.0", "json5": "^1.0.1" } }, "locate-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", "requires": { "p-locate": "^3.0.0", "path-exists": "^3.0.0" } }, "lodash": { "version": "4.17.15", "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.15.tgz", "integrity": "sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==" }, "loose-envify": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", "requires": { "js-tokens": "^3.0.0 || ^4.0.0" } }, "lru-cache": { "version": "5.1.1", "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", "requires": { "yallist": "^3.0.2" } }, "make-dir": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz", "integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==", "requires": { "pify": "^4.0.1", "semver": "^5.6.0" } }, "mamacro": { "version": "0.0.3", "resolved": "https://registry.npmjs.org/mamacro/-/mamacro-0.0.3.tgz", "integrity": "sha512-qMEwh+UujcQ+kbz3T6V+wAmO2U8veoq2w+3wY8MquqwVA3jChfwY+Tk52GZKDfACEPjuZ7r2oJLejwpt8jtwTA==" }, "map-age-cleaner": { "version": "0.1.3", "resolved": "https://registry.npmjs.org/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz", "integrity": "sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w==", "requires": { "p-defer": "^1.0.0" } }, "map-cache": { "version": "0.2.2", "resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz", "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=" }, "map-visit": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz", "integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=", "requires": { "object-visit": "^1.0.0" } }, "markdown-it": { "version": "12.0.4", "resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-12.0.4.tgz", "integrity": "sha512-34RwOXZT8kyuOJy25oJNJoulO8L0bTHYWXcdZBYZqFnjIy3NgjeoM3FmPXIOFQ26/lSHYMr8oc62B6adxXcb3Q==", "requires": { "argparse": "^2.0.1", "entities": "~2.1.0", "linkify-it": "^3.0.1", "mdurl": "^1.0.1", "uc.micro": "^1.0.5" } }, "md5.js": { "version": "1.3.5", "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz", "integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==", "requires": { "hash-base": "^3.0.0", "inherits": "^2.0.1", "safe-buffer": "^5.1.2" } }, "mdurl": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/mdurl/-/mdurl-1.0.1.tgz", "integrity": "sha1-/oWy7HWlkDfyrf7BAP1sYBdhFS4=" }, "mem": { "version": "4.3.0", "resolved": "https://registry.npmjs.org/mem/-/mem-4.3.0.tgz", "integrity": "sha512-qX2bG48pTqYRVmDB37rn/6PT7LcR8T7oAX3bf99u1Tt1nzxYfxkgqDwUwolPlXweM0XzBOBFzSx4kfp7KP1s/w==", "requires": { "map-age-cleaner": "^0.1.1", "mimic-fn": "^2.0.0", "p-is-promise": "^2.0.0" } }, "memory-fs": { "version": "0.4.1", "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz", "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=", "requires": { "errno": "^0.1.3", "readable-stream": "^2.0.1" } }, "micromatch": { "version": "3.1.10", "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", "requires": { "arr-diff": "^4.0.0", "array-unique": "^0.3.2", "braces": "^2.3.1", "define-property": "^2.0.2", "extend-shallow": "^3.0.2", "extglob": "^2.0.4", "fragment-cache": "^0.2.1", "kind-of": "^6.0.2", "nanomatch": "^1.2.9", "object.pick": "^1.3.0", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.2" } }, "miller-rabin": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz", "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==", "requires": { "bn.js": "^4.0.0", "brorand": "^1.0.1" } }, "mimic-fn": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/mimic-fn/-/mimic-fn-2.1.0.tgz", "integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==" }, "minimalistic-assert": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==" }, "minimalistic-crypto-utils": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz", "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=" }, "minimatch": { "version": "3.0.4", "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz", "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==", "requires": { "brace-expansion": "^1.1.7" } }, "minimist": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=" }, "mississippi": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz", "integrity": "sha512-x471SsVjUtBRtcvd4BzKE9kFC+/2TeWgKCgw0bZcw1b9l2X3QX5vCWgF+KaZaYm87Ss//rHnWryupDrgLvmSkA==", "requires": { "concat-stream": "^1.5.0", "duplexify": "^3.4.2", "end-of-stream": "^1.1.0", "flush-write-stream": "^1.0.0", "from2": "^2.1.0", "parallel-transform": "^1.1.0", "pump": "^3.0.0", "pumpify": "^1.3.3", "stream-each": "^1.1.0", "through2": "^2.0.0" } }, "mixin-deep": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.2.tgz", "integrity": "sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==", "requires": { "for-in": "^1.0.2", "is-extendable": "^1.0.1" }, "dependencies": { "is-extendable": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", "requires": { "is-plain-object": "^2.0.4" } } } }, "mkdirp": { "version": "0.5.1", "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=", "requires": { "minimist": "0.0.8" }, "dependencies": { "minimist": { "version": "0.0.8", "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz", "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=" } } }, "move-concurrently": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz", "integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=", "requires": { "aproba": "^1.1.1", "copy-concurrently": "^1.0.0", "fs-write-stream-atomic": "^1.0.8", "mkdirp": "^0.5.1", "rimraf": "^2.5.4", "run-queue": "^1.0.3" } }, "ms": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" }, "nan": { "version": "2.14.0", "resolved": "https://registry.npmjs.org/nan/-/nan-2.14.0.tgz", "integrity": "sha512-INOFj37C7k3AfaNTtX8RhsTw7qRy7eLET14cROi9+5HAVbbHuIWUHEauBv5qT4Av2tWasiTY1Jw6puUNqRJXQg==", "optional": true }, "nanomatch": { "version": "1.2.13", "resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz", "integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==", "requires": { "arr-diff": "^4.0.0", "array-unique": "^0.3.2", "define-property": "^2.0.2", "extend-shallow": "^3.0.2", "fragment-cache": "^0.2.1", "is-windows": "^1.0.2", "kind-of": "^6.0.2", "object.pick": "^1.3.0", "regex-not": "^1.0.0", "snapdragon": "^0.8.1", "to-regex": "^3.0.1" } }, "neo-async": { "version": "2.6.1", "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.1.tgz", "integrity": "sha512-iyam8fBuCUpWeKPGpaNMetEocMt364qkCsfL9JuhjXX6dRnguRVOfk2GZaDpPjcOKiiXCPINZC1GczQ7iTq3Zw==" }, "nice-try": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz", "integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==" }, "node-libs-browser": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz", "integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==", "requires": { "assert": "^1.1.1", "browserify-zlib": "^0.2.0", "buffer": "^4.3.0", "console-browserify": "^1.1.0", "constants-browserify": "^1.0.0", "crypto-browserify": "^3.11.0", "domain-browser": "^1.1.1", "events": "^3.0.0", "https-browserify": "^1.0.0", "os-browserify": "^0.3.0", "path-browserify": "0.0.1", "process": "^0.11.10", "punycode": "^1.2.4", "querystring-es3": "^0.2.0", "readable-stream": "^2.3.3", "stream-browserify": "^2.0.1", "stream-http": "^2.7.2", "string_decoder": "^1.0.0", "timers-browserify": "^2.0.4", "tty-browserify": "0.0.0", "url": "^0.11.0", "util": "^0.11.0", "vm-browserify": "^1.0.1" }, "dependencies": { "punycode": { "version": "1.4.1", "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz", "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=" } } }, "node-releases": { "version": "1.1.61", "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-1.1.61.tgz", "integrity": "sha512-DD5vebQLg8jLCOzwupn954fbIiZht05DAZs0k2u8NStSe6h9XdsuIQL8hSRKYiU8WUQRznmSDrKGbv3ObOmC7g==", "dev": true }, "normalize-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==" }, "npm-run-path": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz", "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=", "requires": { "path-key": "^2.0.0" } }, "object-assign": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=" }, "object-copy": { "version": "0.1.0", "resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz", "integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=", "requires": { "copy-descriptor": "^0.1.0", "define-property": "^0.2.5", "kind-of": "^3.0.3" }, "dependencies": { "define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { "is-descriptor": "^0.1.0" } }, "kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { "is-buffer": "^1.1.5" } } } }, "object-keys": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==", "dev": true }, "object-visit": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz", "integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=", "requires": { "isobject": "^3.0.0" } }, "object.assign": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.0.tgz", "integrity": "sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==", "dev": true, "requires": { "define-properties": "^1.1.2", "function-bind": "^1.1.1", "has-symbols": "^1.0.0", "object-keys": "^1.0.11" } }, "object.pick": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz", "integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=", "requires": { "isobject": "^3.0.1" } }, "once": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", "requires": { "wrappy": "1" } }, "orderedmap": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/orderedmap/-/orderedmap-1.1.1.tgz", "integrity": "sha512-3Ux8um0zXbVacKUkcytc0u3HgC0b0bBLT+I60r2J/En72cI0nZffqrA7Xtf2Hqs27j1g82llR5Mhbd0Z1XW4AQ==" }, "os-browserify": { "version": "0.3.0", "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz", "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=" }, "os-homedir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=" }, "os-locale": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-3.1.0.tgz", "integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==", "requires": { "execa": "^1.0.0", "lcid": "^2.0.0", "mem": "^4.0.0" } }, "os-tmpdir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=" }, "p-defer": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/p-defer/-/p-defer-1.0.0.tgz", "integrity": "sha1-n26xgvbJqozXQwBKfU+WsZaw+ww=" }, "p-finally": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz", "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=" }, "p-is-promise": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/p-is-promise/-/p-is-promise-2.1.0.tgz", "integrity": "sha512-Y3W0wlRPK8ZMRbNq97l4M5otioeA5lm1z7bkNkxCka8HSPjR0xRWmpCmc9utiaLP9Jb1eD8BgeIxTW4AIF45Pg==" }, "p-limit": { "version": "2.2.2", "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", "integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==", "requires": { "p-try": "^2.0.0" } }, "p-locate": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", "requires": { "p-limit": "^2.0.0" } }, "p-try": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==" }, "pako": { "version": "1.0.11", "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz", "integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==" }, "parallel-transform": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.2.0.tgz", "integrity": "sha512-P2vSmIu38uIlvdcU7fDkyrxj33gTUy/ABO5ZUbGowxNCopBq/OoD42bP4UmMrJoPyk4Uqf0mu3mtWBhHCZD8yg==", "requires": { "cyclist": "^1.0.1", "inherits": "^2.0.3", "readable-stream": "^2.1.5" } }, "parse-asn1": { "version": "5.1.5", "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.5.tgz", "integrity": "sha512-jkMYn1dcJqF6d5CpU689bq7w/b5ALS9ROVSpQDPrZsqqesUJii9qutvoT5ltGedNXMO2e16YUWIghG9KxaViTQ==", "requires": { "asn1.js": "^4.0.0", "browserify-aes": "^1.0.0", "create-hash": "^1.1.0", "evp_bytestokey": "^1.0.0", "pbkdf2": "^3.0.3", "safe-buffer": "^5.1.1" } }, "parse-passwd": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/parse-passwd/-/parse-passwd-1.0.0.tgz", "integrity": "sha1-bVuTSkVpk7I9N/QKOC1vFmao5cY=" }, "pascalcase": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz", "integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=" }, "path-browserify": { "version": "0.0.1", "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz", "integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ==" }, "path-dirname": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz", "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=" }, "path-exists": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=" }, "path-is-absolute": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=" }, "path-key": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz", "integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=" }, "path-parse": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz", "integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==", "dev": true }, "pbkdf2": { "version": "3.0.17", "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.0.17.tgz", "integrity": "sha512-U/il5MsrZp7mGg3mSQfn742na2T+1/vHDCG5/iTI3X9MKUuYUZVLQhyRsg06mCgDBTd57TxzgZt7P+fYfjRLtA==", "requires": { "create-hash": "^1.1.2", "create-hmac": "^1.1.4", "ripemd160": "^2.0.1", "safe-buffer": "^5.0.1", "sha.js": "^2.4.8" } }, "pify": { "version": "4.0.1", "resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz", "integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==" }, "pkg-dir": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", "requires": { "find-up": "^3.0.0" } }, "posix-character-classes": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz", "integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=" }, "prettier": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/prettier/-/prettier-2.2.1.tgz", "integrity": "sha512-PqyhM2yCjg/oKkFPtTGUojv7gnZAoG80ttl45O6x2Ug/rMJw4wcc9k6aaf2hibP7BGVCCM33gZoGjyvt9mm16Q==", "dev": true }, "private": { "version": "0.1.8", "resolved": "https://registry.npmjs.org/private/-/private-0.1.8.tgz", "integrity": "sha512-VvivMrbvd2nKkiG38qjULzlc+4Vx4wm/whI9pQD35YrARNnhxeiRktSOhSukRLFNlzg6Br/cJPet5J/u19r/mg==" }, "process": { "version": "0.11.10", "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz", "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=" }, "process-nextick-args": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==" }, "promise-inflight": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz", "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=" }, "prosemirror-commands": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-commands/-/prosemirror-commands-1.1.3.tgz", "integrity": "sha512-YVbKwTR4likoyhuwIUC9egbzHvnFrFUNbiesB0DB/HZ8hBcopQ42Tb4KGlYrS3n+pNDTFObN73CLFY6mYLN2IQ==", "requires": { "prosemirror-model": "^1.0.0", "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "prosemirror-dropcursor": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/prosemirror-dropcursor/-/prosemirror-dropcursor-1.3.2.tgz", "integrity": "sha512-4c94OUGyobGnwcQI70OXyMhE/9T4aTgjU+CHxkd5c7D+jH/J0mKM/lk+jneFVKt7+E4/M0D9HzRPifu8U28Thw==", "requires": { "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.1.0", "prosemirror-view": "^1.1.0" } }, "prosemirror-example-setup": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/prosemirror-example-setup/-/prosemirror-example-setup-1.1.2.tgz", - "integrity": "sha512-MTpIMyqk08jFnzxeRMCinCEMtVSTUtxKgQBGxfCbVe9C6zIOqp9qZZJz5Ojaad1GETySyuj8+OIHHvQsIaaaGQ==", + "version": "git+ssh://git@github.com/writefreely/prosemirror-example-setup.git#aaea7d62ebc2fa769139faf8a097449441c8237c", + "from": "prosemirror-example-setup@github:writefreely/prosemirror-example-setup", "requires": { "prosemirror-commands": "^1.0.0", "prosemirror-dropcursor": "^1.0.0", "prosemirror-gapcursor": "^1.0.0", "prosemirror-history": "^1.0.0", "prosemirror-inputrules": "^1.0.0", "prosemirror-keymap": "^1.0.0", "prosemirror-menu": "^1.0.0", "prosemirror-schema-list": "^1.0.0", "prosemirror-state": "^1.0.0" } }, "prosemirror-gapcursor": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-gapcursor/-/prosemirror-gapcursor-1.1.3.tgz", "integrity": "sha512-/lgWvt2AdHjsM6oEsF65z0lhdQJGl6sQSfXSOX8/xjpd8ycfOolhgKZd4TPYpikwnh85JF4l5eIyiFZsl/RQQA==", "requires": { "prosemirror-keymap": "^1.0.0", "prosemirror-model": "^1.0.0", "prosemirror-state": "^1.0.0", "prosemirror-view": "^1.0.0" } }, "prosemirror-history": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-history/-/prosemirror-history-1.1.3.tgz", "integrity": "sha512-zGDotijea+vnfnyyUGyiy1wfOQhf0B/b6zYcCouBV8yo6JmrE9X23M5q7Nf/nATywEZbgRLG70R4DmfSTC+gfg==", "requires": { "prosemirror-state": "^1.2.2", "prosemirror-transform": "^1.0.0", "rope-sequence": "^1.3.0" } }, "prosemirror-inputrules": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/prosemirror-inputrules/-/prosemirror-inputrules-1.1.2.tgz", "integrity": "sha512-Ja5Z3BWestlHYGvtSGqyvxMeB8QEuBjlHM8YnKtLGUXMDp965qdDV4goV8lJb17kIWHk7e7JNj6Catuoa3302g==", "requires": { "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "prosemirror-keymap": { "version": "1.1.4", "resolved": "https://registry.npmjs.org/prosemirror-keymap/-/prosemirror-keymap-1.1.4.tgz", "integrity": "sha512-Al8cVUOnDFL4gcI5IDlG6xbZ0aOD/i3B17VT+1JbHWDguCgt/lBHVTHUBcKvvbSg6+q/W4Nj1Fu6bwZSca3xjg==", "requires": { "prosemirror-state": "^1.0.0", "w3c-keyname": "^2.2.0" } }, "prosemirror-markdown": { - "version": "git+ssh://git@github.com/VV-EE/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2", - "from": "prosemirror-markdown@github:VV-EE/prosemirror-markdown", + "version": "git+ssh://git@github.com/writefreely/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2", + "from": "prosemirror-markdown@github:writefreely/prosemirror-markdown", "requires": { "markdown-it": "^10.0.0", "prosemirror-model": "^1.0.0" }, "dependencies": { "argparse": { "version": "1.0.10", "resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz", "integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==", "requires": { "sprintf-js": "~1.0.2" } }, "entities": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/entities/-/entities-2.0.3.tgz", "integrity": "sha512-MyoZ0jgnLvB2X3Lg5HqpFmn1kybDiIfEQmKzTb5apr51Rb+T3KdmMiqa70T+bhGnyv7bQ6WMj2QMHpGMmlrUYQ==" }, "linkify-it": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-2.2.0.tgz", "integrity": "sha512-GnAl/knGn+i1U/wjBz3akz2stz+HrHLsxMwHQGofCDfPvlf+gDKN58UtfmUquTY4/MXeE2x7k19KQmeoZi94Iw==", "requires": { "uc.micro": "^1.0.1" } }, "markdown-it": { "version": "10.0.0", "resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-10.0.0.tgz", "integrity": "sha512-YWOP1j7UbDNz+TumYP1kpwnP0aEa711cJjrAQrzd0UXlbJfc5aAq0F/PZHjiioqDC1NKgvIMX+o+9Bk7yuM2dg==", "requires": { "argparse": "^1.0.7", "entities": "~2.0.0", "linkify-it": "^2.0.0", "mdurl": "^1.0.1", "uc.micro": "^1.0.5" } } } }, "prosemirror-menu": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/prosemirror-menu/-/prosemirror-menu-1.1.3.tgz", "integrity": "sha512-G+XiTdiVi1uGeiBR1OqtiVP3p0XyCKec4DYLk75G7J2R/N8OThHt/1StJYDlXPNzqYsQFZfQyPp/UwOL8hD6AA==", "requires": { "crel": "^4.2.0", "prosemirror-commands": "^1.0.0", "prosemirror-history": "^1.0.0", "prosemirror-state": "^1.0.0" } }, "prosemirror-model": { "version": "1.9.1", "resolved": "https://registry.npmjs.org/prosemirror-model/-/prosemirror-model-1.9.1.tgz", "integrity": "sha512-Qblh8pm1c7Ll64sYLauwwzjimo/tFg1zW3Q3IWhKRhvfOEgRKqa6dC5pRrAa+XHOIjBFEYrqbi52J5bqA2dV8Q==", "requires": { "orderedmap": "^1.1.0" } }, "prosemirror-schema-list": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/prosemirror-schema-list/-/prosemirror-schema-list-1.1.2.tgz", "integrity": "sha512-dgM9PwtM4twa5WsgSYMB+J8bwjnR43DAD3L9MsR9rKm/nZR5Y85xcjB7gusVMSsbQ2NomMZF03RE6No6mTnclQ==", "requires": { "prosemirror-model": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "prosemirror-state": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/prosemirror-state/-/prosemirror-state-1.3.2.tgz", "integrity": "sha512-t/JqE3aR0SV9QrzFVkAXsQwsgrQBNs/BDbcFH20RssW0xauqNNdjTXxy/J/kM7F+0zYi6+BRmz7cMMQQFU3mwQ==", "requires": { "prosemirror-model": "^1.0.0", "prosemirror-transform": "^1.0.0" } }, "prosemirror-transform": { "version": "1.2.4", "resolved": "https://registry.npmjs.org/prosemirror-transform/-/prosemirror-transform-1.2.4.tgz", "integrity": "sha512-0A668uf0EN89L9O9brE05kHcqp7FHmT5YN7Tom58Kj926QqOBs7iNRHDLWxrSaQB5MNZtzDOD9T3EyJ88YDcBg==", "requires": { "prosemirror-model": "^1.0.0" } }, "prosemirror-view": { "version": "1.14.2", "resolved": "https://registry.npmjs.org/prosemirror-view/-/prosemirror-view-1.14.2.tgz", "integrity": "sha512-9yPVH6OLyaEraHjWHbSk2DB0R/1TsEE6AA1LI+vmCypXXA+zTzNrktUFzBhSJHehXDoEJcQfnl1Wdp5GPSh2+g==", "requires": { "prosemirror-model": "^1.1.0", "prosemirror-state": "^1.0.0", "prosemirror-transform": "^1.1.0" } }, "prr": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz", "integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY=" }, "public-encrypt": { "version": "4.0.3", "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz", "integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==", "requires": { "bn.js": "^4.1.0", "browserify-rsa": "^4.0.0", "create-hash": "^1.1.0", "parse-asn1": "^5.0.0", "randombytes": "^2.0.1", "safe-buffer": "^5.1.2" } }, "pump": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", "requires": { "end-of-stream": "^1.1.0", "once": "^1.3.1" } }, "pumpify": { "version": "1.5.1", "resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz", "integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==", "requires": { "duplexify": "^3.6.0", "inherits": "^2.0.3", "pump": "^2.0.0" }, "dependencies": { "pump": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz", "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", "requires": { "end-of-stream": "^1.1.0", "once": "^1.3.1" } } } }, "punycode": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz", "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==" }, "querystring": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz", "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=" }, "querystring-es3": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz", "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=" }, "randombytes": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", "integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==", "requires": { "safe-buffer": "^5.1.0" } }, "randomfill": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz", "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==", "requires": { "randombytes": "^2.0.5", "safe-buffer": "^5.1.0" } }, "readable-stream": { "version": "2.3.7", "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", "requires": { "core-util-is": "~1.0.0", "inherits": "~2.0.3", "isarray": "~1.0.0", "process-nextick-args": "~2.0.0", "safe-buffer": "~5.1.1", "string_decoder": "~1.1.1", "util-deprecate": "~1.0.1" } }, "readdirp": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", "requires": { "graceful-fs": "^4.1.11", "micromatch": "^3.1.10", "readable-stream": "^2.0.2" } }, "regenerate": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/regenerate/-/regenerate-1.4.0.tgz", "integrity": "sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg==" }, "regenerate-unicode-properties": { "version": "8.2.0", "resolved": "https://registry.npmjs.org/regenerate-unicode-properties/-/regenerate-unicode-properties-8.2.0.tgz", "integrity": "sha512-F9DjY1vKLo/tPePDycuH3dn9H1OTPIkVD9Kz4LODu+F2C75mgjAJ7x/gwy6ZcSNRAAkhNlJSOHRe8k3p+K9WhA==", "dev": true, "requires": { "regenerate": "^1.4.0" } }, "regenerator-runtime": { "version": "0.11.1", "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz", "integrity": "sha512-MguG95oij0fC3QV3URf4V2SDYGJhJnJGqvIIgdECeODCT98wSWDAJ94SSuVpYQUoTcGUIL6L4yNB7j1DFFHSBg==" }, "regenerator-transform": { "version": "0.10.1", "resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.10.1.tgz", "integrity": "sha512-PJepbvDbuK1xgIgnau7Y90cwaAmO/LCLMI2mPvaXq2heGMR3aWW5/BQvYrhJ8jgmQjXewXvBjzfqKcVOmhjZ6Q==", "requires": { "babel-runtime": "^6.18.0", "babel-types": "^6.19.0", "private": "^0.1.6" } }, "regex-not": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz", "integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==", "requires": { "extend-shallow": "^3.0.2", "safe-regex": "^1.1.0" } }, "regexpu-core": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-2.0.0.tgz", "integrity": "sha1-SdA4g3uNz4v6W5pCE5k45uoq4kA=", "requires": { "regenerate": "^1.2.1", "regjsgen": "^0.2.0", "regjsparser": "^0.1.4" } }, "regjsgen": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz", "integrity": "sha1-bAFq3qxVT3WCP+N6wFuS1aTtsfc=" }, "regjsparser": { "version": "0.1.5", "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz", "integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=", "requires": { "jsesc": "~0.5.0" }, "dependencies": { "jsesc": { "version": "0.5.0", "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz", "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=" } } }, "remove-trailing-separator": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz", "integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8=" }, "repeat-element": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz", "integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==" }, "repeat-string": { "version": "1.6.1", "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz", "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=" }, "repeating": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz", "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=", "requires": { "is-finite": "^1.0.0" } }, "require-directory": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=" }, "require-main-filename": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" }, "resolve": { "version": "1.15.1", "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.15.1.tgz", "integrity": "sha512-84oo6ZTtoTUpjgNEr5SJyzQhzL72gaRodsSfyxC/AXRvwu0Yse9H8eF9IpGo7b8YetZhlI6v7ZQ6bKBFV/6S7w==", "dev": true, "requires": { "path-parse": "^1.0.6" } }, "resolve-cwd": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz", "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", "requires": { "resolve-from": "^3.0.0" } }, "resolve-dir": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/resolve-dir/-/resolve-dir-1.0.1.tgz", "integrity": "sha1-eaQGRMNivoLybv/nOcm7U4IEb0M=", "requires": { "expand-tilde": "^2.0.0", "global-modules": "^1.0.0" }, "dependencies": { "global-modules": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz", "integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==", "requires": { "global-prefix": "^1.0.1", "is-windows": "^1.0.1", "resolve-dir": "^1.0.0" } } } }, "resolve-from": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=" }, "resolve-url": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz", "integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=" }, "ret": { "version": "0.1.15", "resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz", "integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==" }, "rimraf": { "version": "2.7.1", "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", "requires": { "glob": "^7.1.3" } }, "ripemd160": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz", "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==", "requires": { "hash-base": "^3.0.0", "inherits": "^2.0.1" } }, "rope-sequence": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/rope-sequence/-/rope-sequence-1.3.2.tgz", "integrity": "sha512-ku6MFrwEVSVmXLvy3dYph3LAMNS0890K7fabn+0YIRQ2T96T9F4gkFf0vf0WW0JUraNWwGRtInEpH7yO4tbQZg==" }, "run-queue": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz", "integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=", "requires": { "aproba": "^1.1.1" } }, "safe-buffer": { "version": "5.1.2", "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" }, "safe-regex": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz", "integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=", "requires": { "ret": "~0.1.10" } }, "schema-utils": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", "requires": { "ajv": "^6.1.0", "ajv-errors": "^1.0.0", "ajv-keywords": "^3.1.0" } }, "semver": { "version": "5.7.1", "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==" }, "serialize-javascript": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-2.1.2.tgz", "integrity": "sha512-rs9OggEUF0V4jUSecXazOYsLfu7OGK2qIn3c7IPBiffz32XniEp/TX9Xmc9LQfK2nQ2QKHvZ2oygKUGU0lG4jQ==" }, "set-blocking": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=" }, "set-value": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.1.tgz", "integrity": "sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==", "requires": { "extend-shallow": "^2.0.1", "is-extendable": "^0.1.1", "is-plain-object": "^2.0.3", "split-string": "^3.0.1" }, "dependencies": { "extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { "is-extendable": "^0.1.0" } } } }, "setimmediate": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz", "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=" }, "sha.js": { "version": "2.4.11", "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", "requires": { "inherits": "^2.0.1", "safe-buffer": "^5.0.1" } }, "shebang-command": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz", "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=", "requires": { "shebang-regex": "^1.0.0" } }, "shebang-regex": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz", "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=" }, "signal-exit": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz", "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=" }, "slash": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz", "integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU=" }, "snapdragon": { "version": "0.8.2", "resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz", "integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==", "requires": { "base": "^0.11.1", "debug": "^2.2.0", "define-property": "^0.2.5", "extend-shallow": "^2.0.1", "map-cache": "^0.2.2", "source-map": "^0.5.6", "source-map-resolve": "^0.5.0", "use": "^3.1.0" }, "dependencies": { "define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { "is-descriptor": "^0.1.0" } }, "extend-shallow": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { "is-extendable": "^0.1.0" } } } }, "snapdragon-node": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz", "integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==", "requires": { "define-property": "^1.0.0", "isobject": "^3.0.0", "snapdragon-util": "^3.0.1" }, "dependencies": { "define-property": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "requires": { "is-descriptor": "^1.0.0" } }, "is-accessor-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { "kind-of": "^6.0.0" } }, "is-data-descriptor": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { "kind-of": "^6.0.0" } }, "is-descriptor": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { "is-accessor-descriptor": "^1.0.0", "is-data-descriptor": "^1.0.0", "kind-of": "^6.0.2" } } } }, "snapdragon-util": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz", "integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==", "requires": { "kind-of": "^3.2.0" }, "dependencies": { "kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { "is-buffer": "^1.1.5" } } } }, "source-list-map": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.1.tgz", "integrity": "sha512-qnQ7gVMxGNxsiL4lEuJwe/To8UnK7fAnmbGEEH8RpLouuKbeEm0lhbQVFIrNSuB+G7tVrAlVsZgETT5nljf+Iw==" }, "source-map": { "version": "0.5.7", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=" }, "source-map-resolve": { "version": "0.5.3", "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.3.tgz", "integrity": "sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw==", "requires": { "atob": "^2.1.2", "decode-uri-component": "^0.2.0", "resolve-url": "^0.2.1", "source-map-url": "^0.4.0", "urix": "^0.1.0" } }, "source-map-support": { "version": "0.5.16", "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.16.tgz", "integrity": "sha512-efyLRJDr68D9hBBNIPWFjhpFzURh+KJykQwvMyW5UiZzYwoF6l4YMMDIJJEyFWxWCqfyxLzz6tSfUFR+kXXsVQ==", "requires": { "buffer-from": "^1.0.0", "source-map": "^0.6.0" }, "dependencies": { "source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==" } } }, "source-map-url": { "version": "0.4.0", "resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz", "integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=" }, "split-string": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz", "integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==", "requires": { "extend-shallow": "^3.0.0" } }, "sprintf-js": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz", "integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=" }, "ssri": { "version": "6.0.1", "resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz", "integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==", "requires": { "figgy-pudding": "^3.5.1" } }, "static-extend": { "version": "0.1.2", "resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz", "integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=", "requires": { "define-property": "^0.2.5", "object-copy": "^0.1.0" }, "dependencies": { "define-property": { "version": "0.2.5", "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { "is-descriptor": "^0.1.0" } } } }, "stream-browserify": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz", "integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==", "requires": { "inherits": "~2.0.1", "readable-stream": "^2.0.2" } }, "stream-each": { "version": "1.2.3", "resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz", "integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==", "requires": { "end-of-stream": "^1.1.0", "stream-shift": "^1.0.0" } }, "stream-http": { "version": "2.8.3", "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz", "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==", "requires": { "builtin-status-codes": "^3.0.0", "inherits": "^2.0.1", "readable-stream": "^2.3.6", "to-arraybuffer": "^1.0.0", "xtend": "^4.0.0" } }, "stream-shift": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.1.tgz", "integrity": "sha512-AiisoFqQ0vbGcZgQPY1cdP2I76glaVA/RauYR4G4thNFgkTqr90yXTo4LYX60Jl+sIlPNHHdGSwo01AvbKUSVQ==" }, "string_decoder": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", "requires": { "safe-buffer": "~5.1.0" } }, "string-width": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", "requires": { "emoji-regex": "^7.0.1", "is-fullwidth-code-point": "^2.0.0", "strip-ansi": "^5.1.0" }, "dependencies": { "ansi-regex": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==" }, "strip-ansi": { "version": "5.2.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "requires": { "ansi-regex": "^4.1.0" } } } }, "strip-ansi": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", "requires": { "ansi-regex": "^2.0.0" } }, "strip-eof": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=" }, "supports-color": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=" }, "tapable": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/tapable/-/tapable-1.1.3.tgz", "integrity": "sha512-4WK/bYZmj8xLr+HUCODHGF1ZFzsYffasLUgEiMBY4fgtltdO6B4WJtlSbPaDTLpYTcGVwM2qLnFTICEcNxs3kA==" }, "terser": { "version": "4.6.6", "resolved": "https://registry.npmjs.org/terser/-/terser-4.6.6.tgz", "integrity": "sha512-4lYPyeNmstjIIESr/ysHg2vUPRGf2tzF9z2yYwnowXVuVzLEamPN1Gfrz7f8I9uEPuHcbFlW4PLIAsJoxXyJ1g==", "requires": { "commander": "^2.20.0", "source-map": "~0.6.1", "source-map-support": "~0.5.12" }, "dependencies": { "source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==" } } }, "terser-webpack-plugin": { "version": "1.4.3", "resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.3.tgz", "integrity": "sha512-QMxecFz/gHQwteWwSo5nTc6UaICqN1bMedC5sMtUc7y3Ha3Q8y6ZO0iCR8pq4RJC8Hjf0FEPEHZqcMB/+DFCrA==", "requires": { "cacache": "^12.0.2", "find-cache-dir": "^2.1.0", "is-wsl": "^1.1.0", "schema-utils": "^1.0.0", "serialize-javascript": "^2.1.2", "source-map": "^0.6.1", "terser": "^4.1.2", "webpack-sources": "^1.4.0", "worker-farm": "^1.7.0" }, "dependencies": { "source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==" } } }, "through2": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", "requires": { "readable-stream": "~2.3.6", "xtend": "~4.0.1" } }, "timers-browserify": { "version": "2.0.11", "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.11.tgz", "integrity": "sha512-60aV6sgJ5YEbzUdn9c8kYGIqOubPoUdqQCul3SBAsRCZ40s6Y5cMcrW4dt3/k/EsbLVJNl9n6Vz3fTc+k2GeKQ==", "requires": { "setimmediate": "^1.0.4" } }, "to-arraybuffer": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz", "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=" }, "to-fast-properties": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.3.tgz", "integrity": "sha1-uDVx+k2MJbguIxsG46MFXeTKGkc=" }, "to-object-path": { "version": "0.3.0", "resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz", "integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=", "requires": { "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { "version": "3.2.2", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { "is-buffer": "^1.1.5" } } } }, "to-regex": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz", "integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==", "requires": { "define-property": "^2.0.2", "extend-shallow": "^3.0.2", "regex-not": "^1.0.2", "safe-regex": "^1.1.0" } }, "to-regex-range": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", "requires": { "is-number": "^3.0.0", "repeat-string": "^1.6.1" } }, "trim-right": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/trim-right/-/trim-right-1.0.1.tgz", "integrity": "sha1-yy4SAwZ+DI3h9hQJS5/kVwTqYAM=" }, "tslib": { "version": "1.11.1", "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz", "integrity": "sha512-aZW88SY8kQbU7gpV19lN24LtXh/yD4ZZg6qieAJDDg+YBsJcSmLGK9QpnUjAKVG/xefmvJGd1WUmfpT/g6AJGA==" }, "tty-browserify": { "version": "0.0.0", "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=" }, "typedarray": { "version": "0.0.6", "resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz", "integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=" }, "uc.micro": { "version": "1.0.6", "resolved": "https://registry.npmjs.org/uc.micro/-/uc.micro-1.0.6.tgz", "integrity": "sha512-8Y75pvTYkLJW2hWQHXxoqRgV7qb9B+9vFEtidML+7koHUFapnVJAZ6cKs+Qjz5Aw3aZWHMC6u0wJE3At+nSGwA==" }, "unicode-canonical-property-names-ecmascript": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-1.0.4.tgz", "integrity": "sha512-jDrNnXWHd4oHiTZnx/ZG7gtUTVp+gCcTTKr8L0HjlwphROEW3+Him+IpvC+xcJEFegapiMZyZe02CyuOnRmbnQ==", "dev": true }, "unicode-match-property-ecmascript": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/unicode-match-property-ecmascript/-/unicode-match-property-ecmascript-1.0.4.tgz", "integrity": "sha512-L4Qoh15vTfntsn4P1zqnHulG0LdXgjSO035fEpdtp6YxXhMT51Q6vgM5lYdG/5X3MjS+k/Y9Xw4SFCY9IkR0rg==", "dev": true, "requires": { "unicode-canonical-property-names-ecmascript": "^1.0.4", "unicode-property-aliases-ecmascript": "^1.0.4" } }, "unicode-match-property-value-ecmascript": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/unicode-match-property-value-ecmascript/-/unicode-match-property-value-ecmascript-1.2.0.tgz", "integrity": "sha512-wjuQHGQVofmSJv1uVISKLE5zO2rNGzM/KCYZch/QQvez7C1hUhBIuZ701fYXExuufJFMPhv2SyL8CyoIfMLbIQ==", "dev": true }, "unicode-property-aliases-ecmascript": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/unicode-property-aliases-ecmascript/-/unicode-property-aliases-ecmascript-1.1.0.tgz", "integrity": "sha512-PqSoPh/pWetQ2phoj5RLiaqIk4kCNwoV3CI+LfGmWLKI3rE3kl1h59XpX2BjgDrmbxD9ARtQobPGU1SguCYuQg==", "dev": true }, "union-value": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.1.tgz", "integrity": "sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==", "requires": { "arr-union": "^3.1.0", "get-value": "^2.0.6", "is-extendable": "^0.1.1", "set-value": "^2.0.1" } }, "unique-filename": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz", "integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==", "requires": { "unique-slug": "^2.0.0" } }, "unique-slug": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz", "integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==", "requires": { "imurmurhash": "^0.1.4" } }, "unset-value": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz", "integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=", "requires": { "has-value": "^0.3.1", "isobject": "^3.0.0" }, "dependencies": { "has-value": { "version": "0.3.1", "resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz", "integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=", "requires": { "get-value": "^2.0.3", "has-values": "^0.1.4", "isobject": "^2.0.0" }, "dependencies": { "isobject": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz", "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=", "requires": { "isarray": "1.0.0" } } } }, "has-values": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz", "integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E=" } } }, "upath": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/upath/-/upath-1.2.0.tgz", "integrity": "sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg==" }, "uri-js": { "version": "4.2.2", "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.2.2.tgz", "integrity": "sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==", "requires": { "punycode": "^2.1.0" } }, "urix": { "version": "0.1.0", "resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz", "integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=" }, "url": { "version": "0.11.0", "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz", "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=", "requires": { "punycode": "1.3.2", "querystring": "0.2.0" }, "dependencies": { "punycode": { "version": "1.3.2", "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz", "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=" } } }, "use": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz", "integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==" }, "util": { "version": "0.11.1", "resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz", "integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==", "requires": { "inherits": "2.0.3" }, "dependencies": { "inherits": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" } } }, "util-deprecate": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=" }, "v8-compile-cache": { "version": "2.0.3", "resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.0.3.tgz", "integrity": "sha512-CNmdbwQMBjwr9Gsmohvm0pbL954tJrNzf6gWL3K+QMQf00PF7ERGrEiLgjuU3mKreLC2MeGhUsNV9ybTbLgd3w==" }, "vm-browserify": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz", "integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ==" }, "w3c-keyname": { "version": "2.2.4", "resolved": "https://registry.npmjs.org/w3c-keyname/-/w3c-keyname-2.2.4.tgz", "integrity": "sha512-tOhfEwEzFLJzf6d1ZPkYfGj+FWhIpBux9ppoP3rlclw3Z0BZv3N7b7030Z1kYth+6rDuAsXUFr+d0VE6Ed1ikw==" }, "watchpack": { "version": "1.6.0", "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.6.0.tgz", "integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==", "requires": { "chokidar": "^2.0.2", "graceful-fs": "^4.1.2", "neo-async": "^2.5.0" } }, "webpack": { "version": "4.42.0", "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.42.0.tgz", "integrity": "sha512-EzJRHvwQyBiYrYqhyjW9AqM90dE4+s1/XtCfn7uWg6cS72zH+2VPFAlsnW0+W0cDi0XRjNKUMoJtpSi50+Ph6w==", "requires": { "@webassemblyjs/ast": "1.8.5", "@webassemblyjs/helper-module-context": "1.8.5", "@webassemblyjs/wasm-edit": "1.8.5", "@webassemblyjs/wasm-parser": "1.8.5", "acorn": "^6.2.1", "ajv": "^6.10.2", "ajv-keywords": "^3.4.1", "chrome-trace-event": "^1.0.2", "enhanced-resolve": "^4.1.0", "eslint-scope": "^4.0.3", "json-parse-better-errors": "^1.0.2", "loader-runner": "^2.4.0", "loader-utils": "^1.2.3", "memory-fs": "^0.4.1", "micromatch": "^3.1.10", "mkdirp": "^0.5.1", "neo-async": "^2.6.1", "node-libs-browser": "^2.2.1", "schema-utils": "^1.0.0", "tapable": "^1.1.3", "terser-webpack-plugin": "^1.4.3", "watchpack": "^1.6.0", "webpack-sources": "^1.4.1" } }, "webpack-cli": { "version": "3.3.11", "resolved": "https://registry.npmjs.org/webpack-cli/-/webpack-cli-3.3.11.tgz", "integrity": "sha512-dXlfuml7xvAFwYUPsrtQAA9e4DOe58gnzSxhgrO/ZM/gyXTBowrsYeubyN4mqGhYdpXMFNyQ6emjJS9M7OBd4g==", "requires": { "chalk": "2.4.2", "cross-spawn": "6.0.5", "enhanced-resolve": "4.1.0", "findup-sync": "3.0.0", "global-modules": "2.0.0", "import-local": "2.0.0", "interpret": "1.2.0", "loader-utils": "1.2.3", "supports-color": "6.1.0", "v8-compile-cache": "2.0.3", "yargs": "13.2.4" }, "dependencies": { "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "requires": { "color-convert": "^1.9.0" } }, "chalk": { "version": "2.4.2", "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "requires": { "ansi-styles": "^3.2.1", "escape-string-regexp": "^1.0.5", "supports-color": "^5.3.0" }, "dependencies": { "supports-color": { "version": "5.5.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "requires": { "has-flag": "^3.0.0" } } } }, "emojis-list": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz", "integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=" }, "enhanced-resolve": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.0.tgz", "integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==", "requires": { "graceful-fs": "^4.1.2", "memory-fs": "^0.4.0", "tapable": "^1.0.0" } }, "loader-utils": { "version": "1.2.3", "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz", "integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==", "requires": { "big.js": "^5.2.2", "emojis-list": "^2.0.0", "json5": "^1.0.1" } }, "supports-color": { "version": "6.1.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", "requires": { "has-flag": "^3.0.0" } } } }, "webpack-sources": { "version": "1.4.3", "resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.4.3.tgz", "integrity": "sha512-lgTS3Xhv1lCOKo7SA5TjKXMjpSM4sBjNV5+q2bqesbSPs5FjGmU6jjtBSkX9b4qW87vDIsCIlUPOEhbZrMdjeQ==", "requires": { "source-list-map": "^2.0.0", "source-map": "~0.6.1" }, "dependencies": { "source-map": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==" } } }, "which": { "version": "1.3.1", "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz", "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==", "requires": { "isexe": "^2.0.0" } }, "which-module": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=" }, "worker-farm": { "version": "1.7.0", "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz", "integrity": "sha512-rvw3QTZc8lAxyVrqcSGVm5yP/IJ2UcB3U0graE3LCFoZ0Yn2x4EoVSqJKdB/T5M+FLcRPjz4TDacRf3OCfNUzw==", "requires": { "errno": "~0.1.7" } }, "wrap-ansi": { "version": "5.1.0", "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz", "integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==", "requires": { "ansi-styles": "^3.2.0", "string-width": "^3.0.0", "strip-ansi": "^5.0.0" }, "dependencies": { "ansi-regex": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==" }, "ansi-styles": { "version": "3.2.1", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "requires": { "color-convert": "^1.9.0" } }, "strip-ansi": { "version": "5.2.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "requires": { "ansi-regex": "^4.1.0" } } } }, "wrappy": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=" }, "xtend": { "version": "4.0.2", "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz", "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==" }, "y18n": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==" }, "yallist": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==" }, "yargs": { "version": "13.2.4", "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.2.4.tgz", "integrity": "sha512-HG/DWAJa1PAnHT9JAhNa8AbAv3FPaiLzioSjCcmuXXhP8MlpHO5vwls4g4j6n30Z74GVQj8Xa62dWVx1QCGklg==", "requires": { "cliui": "^5.0.0", "find-up": "^3.0.0", "get-caller-file": "^2.0.1", "os-locale": "^3.1.0", "require-directory": "^2.1.1", "require-main-filename": "^2.0.0", "set-blocking": "^2.0.0", "string-width": "^3.0.0", "which-module": "^2.0.0", "y18n": "^4.0.0", "yargs-parser": "^13.1.0" } }, "yargs-parser": { "version": "13.1.1", "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.1.tgz", "integrity": "sha512-oVAVsHz6uFrg3XQheFII8ESO2ssAf9luWuAd6Wexsu4F3OtIW0o8IribPXYrD4WC24LWtPrJlGy87y5udK+dxQ==", "requires": { "camelcase": "^5.0.0", "decamelize": "^1.2.0" } } } } diff --git a/prose/prose.js b/prose/prose.js index ae8b3ce..cb39c6d 100644 --- a/prose/prose.js +++ b/prose/prose.js @@ -1,112 +1,120 @@ // class MarkdownView { // constructor(target, content) { // this.textarea = target.appendChild(document.createElement("textarea")) // this.textarea.value = content // } // get content() { return this.textarea.value } // focus() { this.textarea.focus() } // destroy() { this.textarea.remove() } // } import { EditorView } from "prosemirror-view"; import { EditorState, TextSelection } from "prosemirror-state"; import { exampleSetup } from "prosemirror-example-setup"; import { keymap } from "prosemirror-keymap"; import { writeFreelyMarkdownParser } from "./markdownParser"; import { writeFreelyMarkdownSerializer } from "./markdownSerializer"; import { writeFreelySchema } from "./schema"; import { getMenu } from "./menu"; let $title = document.querySelector("#title"); let $content = document.querySelector("#content"); // Bugs: // 1. When there's just an empty line and a hard break is inserted with shift-enter then two enters are inserted // which do not show up in the markdown ( maybe bc. they are training enters ) class ProseMirrorView { constructor(target, content) { let typingTimer; let localDraft = localStorage.getItem(window.draftKey); if (localDraft != null) { content = localDraft; } if (content.indexOf("# ") === 0) { let eol = content.indexOf("\n"); let title = content.substring("# ".length, eol); content = content.substring(eol + "\n\n".length); $title.value = title; } const doc = writeFreelyMarkdownParser.parse(content) this.view = new EditorView(target, { state: EditorState.create({ doc, plugins: [ keymap({ "Mod-Enter": () => { document.getElementById("publish").click(); return true; }, "Mod-k": () => { const linkButton = document.querySelector( ".ProseMirror-icon[title='Add or remove link']" ); linkButton.dispatchEvent(new Event("mousedown")); return true; }, }), ...exampleSetup({ schema: writeFreelySchema, menuContent: getMenu(), }), ], }), dispatchTransaction(transaction) { let newState = this.state.apply(transaction); const newContent = writeFreelyMarkdownSerializer .serialize(newState.doc) // Replace all \\\ns ( not followed by a \n ) with \n .replace(/(\\\n)(\n{0,1})/g, (match, p1, p2) => p2 !== "\n" ? "\n" + p2 : match ); $content.value = newContent; let draft = ""; if ($title.value != null && $title.value !== "") { draft = "# " + $title.value + "\n\n"; } draft += newContent; clearTimeout(typingTimer); typingTimer = setTimeout(doneTyping, doneTypingInterval); this.updateState(newState); }, + handleDOMEvents: { + drop: (view, event) => { + // If a file is dropped externally into the editor, do not insert anything. This will not trigger if an image has been inserted after upload and is dragged and dropped internally to change its position. + if (event.dataTransfer.files.length > 0) { + event.preventDefault(); + } + } + }, }); // Editor is focused to the last position. This is a workaround for a bug: // 1. 1 type something in an existing entry // 2. reload - works fine, the draft is reloaded // 3. reload again - the draft is somehow removed from localStorage and the original content is loaded // When the editor is focused the content is re-saved to localStorage // This is also useful for editing, so it's not a bad thing even const lastPosition = this.view.state.doc.content.size; const selection = TextSelection.create(this.view.state.doc, lastPosition); this.view.dispatch(this.view.state.tr.setSelection(selection)); this.view.focus(); } get content() { return writeFreelyMarkdownSerializer.serialize(this.view.state.doc); } focus() { this.view.focus(); } destroy() { this.view.destroy(); } } let place = document.querySelector("#editor"); let view = new ProseMirrorView(place, $content.value); diff --git a/read.go b/read.go index f2706a9..a8c2352 100644 --- a/read.go +++ b/read.go @@ -1,342 +1,342 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "fmt" "html/template" "math" "net/http" "strconv" "time" . "github.com/gorilla/feeds" "github.com/gorilla/mux" stripmd "github.com/writeas/go-strip-markdown/v2" "github.com/writeas/impart" "github.com/writeas/web-core/log" "github.com/writeas/web-core/memo" "github.com/writefreely/writefreely/page" ) const ( tlFeedLimit = 100 tlAPIPageLimit = 10 tlMaxAuthorPosts = 5 tlPostsPerPage = 16 tlMaxPostCache = 250 tlCacheDur = 10 * time.Minute ) type localTimeline struct { m *memo.Memo posts *[]PublicPost // Configuration values postsPerPage int } type readPublication struct { page.StaticPage Posts *[]PublicPost CurrentPage int TotalPages int SelTopic string IsAdmin bool CanInvite bool // Customizable page content ContentTitle string Content template.HTML } func initLocalTimeline(app *App) { app.timeline = &localTimeline{ postsPerPage: tlPostsPerPage, m: memo.New(app.FetchPublicPosts, tlCacheDur), } } // satisfies memo.Func func (app *App) FetchPublicPosts() (interface{}, error) { // Conditions limit := fmt.Sprintf("LIMIT %d", tlMaxPostCache) // This is better than the hard limit when limiting posts from individual authors // ageCond := `p.created >= ` + app.db.dateSub(3, "month") + ` AND ` // Finds all public posts and posts in a public collection published during the owner's active subscription period and within the last 3 months rows, err := app.db.Query(`SELECT p.id, c.id, alias, c.title, p.slug, p.title, p.content, p.text_appearance, p.language, p.rtl, p.created, p.updated FROM collections c LEFT JOIN posts p ON p.collection_id = c.id LEFT JOIN users u ON u.id = p.owner_id WHERE c.privacy = 1 AND (p.created <= ` + app.db.now() + ` AND pinned_position IS NULL) AND u.status = 0 ORDER BY p.created DESC ` + limit) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts." + err.Error()} } defer rows.Close() ap := map[string]uint{} posts := []PublicPost{} for rows.Next() { p := &Post{} c := &Collection{} var alias, title sql.NullString err = rows.Scan(&p.ID, &c.ID, &alias, &title, &p.Slug, &p.Title, &p.Content, &p.Font, &p.Language, &p.RTL, &p.Created, &p.Updated) if err != nil { log.Error("[READ] Unable to scan row, skipping: %v", err) continue } c.hostName = app.cfg.App.Host isCollectionPost := alias.Valid if isCollectionPost { c.Alias = alias.String if c.Alias != "" && ap[c.Alias] == tlMaxAuthorPosts { // Don't add post if we've hit the post-per-author limit continue } c.Public = true c.Title = title.String c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer") } p.extractData() p.handlePremiumContent(c, false, false, app.cfg) p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), "", app.cfg)) fp := p.processPost() if isCollectionPost { fp.Collection = &CollectionObj{Collection: *c} } posts = append(posts, fp) ap[c.Alias]++ } return posts, nil } func viewLocalTimelineAPI(app *App, w http.ResponseWriter, r *http.Request) error { updateTimelineCache(app.timeline, false) skip, _ := strconv.Atoi(r.FormValue("skip")) posts := []PublicPost{} for i := skip; i < skip+tlAPIPageLimit && i < len(*app.timeline.posts); i++ { posts = append(posts, (*app.timeline.posts)[i]) } return impart.WriteSuccess(w, posts, http.StatusOK) } func viewLocalTimeline(app *App, w http.ResponseWriter, r *http.Request) error { if !app.cfg.App.LocalTimeline { return impart.HTTPError{http.StatusNotFound, "Page doesn't exist."} } vars := mux.Vars(r) var p int page := 1 p, _ = strconv.Atoi(vars["page"]) if p > 0 { page = p } return showLocalTimeline(app, w, r, page, vars["author"], vars["tag"]) } // updateTimelineCache will reset and update the cache if it is stale or // the boolean passed in is true. func updateTimelineCache(tl *localTimeline, reset bool) { if reset { tl.m.Reset() } // Fetch posts if the cache is empty, has been reset or enough time has // passed since last cache. if tl.posts == nil || reset || tl.m.Invalidate() { log.Info("[READ] Updating post cache") postsInterfaces, err := tl.m.Get() if err != nil { log.Error("[READ] Unable to cache posts: %v", err) } else { castPosts := postsInterfaces.([]PublicPost) tl.posts = &castPosts } } } func showLocalTimeline(app *App, w http.ResponseWriter, r *http.Request, page int, author, tag string) error { updateTimelineCache(app.timeline, false) pl := len(*(app.timeline.posts)) ttlPages := int(math.Ceil(float64(pl) / float64(app.timeline.postsPerPage))) start := 0 if page > 1 { start = app.timeline.postsPerPage * (page - 1) if start > pl { return impart.HTTPError{http.StatusFound, fmt.Sprintf("/read/p/%d", ttlPages)} } } end := app.timeline.postsPerPage * page if end > pl { end = pl } var posts []PublicPost if author != "" { posts = []PublicPost{} for _, p := range *app.timeline.posts { if author == "anonymous" { if p.Collection == nil { posts = append(posts, p) } } else if p.Collection != nil && p.Collection.Alias == author { posts = append(posts, p) } } } else if tag != "" { posts = []PublicPost{} for _, p := range *app.timeline.posts { if p.HasTag(tag) { posts = append(posts, p) } } } else { posts = *app.timeline.posts posts = posts[start:end] } d := &readPublication{ StaticPage: pageForReq(app, r), Posts: &posts, CurrentPage: page, TotalPages: ttlPages, SelTopic: tag, } if app.cfg.App.Chorus { u := getUserSession(app, r) d.IsAdmin = u != nil && u.IsAdmin() d.CanInvite = canUserInvite(app.cfg, d.IsAdmin) } c, err := getReaderSection(app) if err != nil { return err } d.ContentTitle = c.Title.String d.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg)) err = templates["read"].ExecuteTemplate(w, "base", d) if err != nil { log.Error("Unable to render reader: %v", err) fmt.Fprintf(w, ":(") } return nil } // NextPageURL provides a full URL for the next page of collection posts func (c *readPublication) NextPageURL(n int) string { return fmt.Sprintf("/read/p/%d", n+1) } // PrevPageURL provides a full URL for the previous page of collection posts, // returning a /page/N result for pages >1 func (c *readPublication) PrevPageURL(n int) string { if n == 2 { // Previous page is 1; no need for /p/ prefix return "/read" } return fmt.Sprintf("/read/p/%d", n-1) } // handlePostIDRedirect handles a route where a post ID is given and redirects // the user to the canonical post URL. func handlePostIDRedirect(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) postID := vars["post"] p, err := app.db.GetPost(postID, 0) if err != nil { return err } if !p.CollectionID.Valid { // No collection; send to normal URL // NOTE: not handling single user blogs here since this handler is only used for the Reader return impart.HTTPError{http.StatusFound, app.cfg.App.Host + "/" + postID + ".md"} } c, err := app.db.GetCollectionBy("id = ?", fmt.Sprintf("%d", p.CollectionID.Int64)) if err != nil { return err } c.hostName = app.cfg.App.Host // Retrieve collection information and send user to canonical URL return impart.HTTPError{http.StatusFound, c.CanonicalURL() + p.Slug.String} } func viewLocalTimelineFeed(app *App, w http.ResponseWriter, req *http.Request) error { if !app.cfg.App.LocalTimeline { return impart.HTTPError{http.StatusNotFound, "Page doesn't exist."} } updateTimelineCache(app.timeline, false) feed := &Feed{ Title: app.cfg.App.SiteName + " Reader", Link: &Link{Href: app.cfg.App.Host}, Description: "Read the latest posts from " + app.cfg.App.SiteName + ".", Created: time.Now(), } c := 0 var title, permalink, author string for _, p := range *app.timeline.posts { if c == tlFeedLimit { break } title = p.PlainDisplayTitle() permalink = p.CanonicalURL(app.cfg.App.Host) if p.Collection != nil { author = p.Collection.Title } else { author = "Anonymous" } i := &Item{ Id: app.cfg.App.Host + "/read/a/" + p.ID, Title: title, Link: &Link{Href: permalink}, Description: "", Content: applyMarkdown([]byte(p.Content), "", app.cfg), Author: &Author{author, ""}, Created: p.Created, Updated: p.Updated, } feed.Items = append(feed.Items, i) c++ } rss, err := feed.ToRss() if err != nil { return err } fmt.Fprint(w, rss) return nil } diff --git a/request.go b/request.go index 2eb29f5..9ff9983 100644 --- a/request.go +++ b/request.go @@ -1,22 +1,29 @@ /* - * Copyright © 2018 A Bunch Tell LLC. + * Copyright © 2018 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "mime" "net/http" + "strings" ) func IsJSON(r *http.Request) bool { ct, _, _ := mime.ParseMediaType(r.Header.Get("Content-Type")) accept := r.Header.Get("Accept") return ct == "application/json" || accept == "application/json" } + +func IsActivityPubRequest(r *http.Request) bool { + accept := r.Header.Get("Accept") + return strings.Contains(accept, "application/activity+json") || + accept == "application/ld+json; profile=\"https://www.w3.org/ns/activitystreams\"" +} diff --git a/routes.go b/routes.go index 213958d..dc2a3c1 100644 --- a/routes.go +++ b/routes.go @@ -1,237 +1,246 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "net/http" "net/url" "path/filepath" "strings" "github.com/gorilla/csrf" "github.com/gorilla/mux" "github.com/writeas/go-webfinger" "github.com/writeas/web-core/log" "github.com/writefreely/go-nodeinfo" ) // InitStaticRoutes adds routes for serving static files. // TODO: this should just be a func, not method func (app *App) InitStaticRoutes(r *mux.Router) { // Handle static files fs := http.FileServer(http.Dir(filepath.Join(app.cfg.Server.StaticParentDir, staticDir))) fs = cacheControl(fs) app.shttp = http.NewServeMux() app.shttp.Handle("/", fs) r.PathPrefix("/").Handler(fs) } // InitRoutes adds dynamic routes for the given mux.Router. func InitRoutes(apper Apper, r *mux.Router) *mux.Router { // Create handler handler := NewWFHandler(apper) // Set up routes hostSubroute := apper.App().cfg.App.Host[strings.Index(apper.App().cfg.App.Host, "://")+3:] if apper.App().cfg.App.SingleUser { hostSubroute = "{domain}" } else { if strings.HasPrefix(hostSubroute, "localhost") { hostSubroute = "localhost" } } if apper.App().cfg.App.SingleUser { log.Info("Adding %s routes (single user)...", hostSubroute) } else { log.Info("Adding %s routes (multi-user)...", hostSubroute) } // Primary app routes write := r.PathPrefix("/").Subrouter() // Federation endpoint configurations wf := webfinger.Default(wfResolver{apper.App().db, apper.App().cfg}) wf.NoTLSHandler = nil // Federation endpoints // host-meta write.HandleFunc("/.well-known/host-meta", handler.Web(handleViewHostMeta, UserLevelReader)) // webfinger write.HandleFunc(webfinger.WebFingerPath, handler.LogHandlerFunc(http.HandlerFunc(wf.Webfinger))) // nodeinfo niCfg := nodeInfoConfig(apper.App().db, apper.App().cfg) ni := nodeinfo.NewService(*niCfg, nodeInfoResolver{apper.App().cfg, apper.App().db}) write.HandleFunc(nodeinfo.NodeInfoPath, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfoDiscover))) write.HandleFunc(niCfg.InfoURL, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfo))) // handle mentions write.HandleFunc("/@/{handle}", handler.Web(handleViewMention, UserLevelReader)) configureSlackOauth(handler, write, apper.App()) configureWriteAsOauth(handler, write, apper.App()) configureGitlabOauth(handler, write, apper.App()) configureGenericOauth(handler, write, apper.App()) configureGiteaOauth(handler, write, apper.App()) - // Set up dyamic page handlers + // Set up dynamic page handlers // Handle auth auth := write.PathPrefix("/api/auth/").Subrouter() if apper.App().cfg.App.OpenRegistration { auth.HandleFunc("/signup", handler.All(apiSignup)).Methods("POST") } auth.HandleFunc("/login", handler.All(login)).Methods("POST") auth.HandleFunc("/read", handler.WebErrors(handleWebCollectionUnlock, UserLevelNone)).Methods("POST") auth.HandleFunc("/me", handler.All(handleAPILogout)).Methods("DELETE") // Handle logged in user sections me := write.PathPrefix("/me").Subrouter() me.HandleFunc("/", handler.Redirect("/me", UserLevelUser)) me.HandleFunc("/c", handler.Redirect("/me/c/", UserLevelUser)).Methods("GET") me.HandleFunc("/c/", handler.User(viewCollections)).Methods("GET") me.HandleFunc("/c/{collection}", handler.User(viewEditCollection)).Methods("GET") me.HandleFunc("/c/{collection}/stats", handler.User(viewStats)).Methods("GET") + me.HandleFunc("/c/{collection}/subscribers", handler.User(handleViewSubscribers)).Methods("GET") me.Path("/delete").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(handleUserDelete))).Methods("POST") me.HandleFunc("/posts", handler.Redirect("/me/posts/", UserLevelUser)).Methods("GET") me.HandleFunc("/posts/", handler.User(viewArticles)).Methods("GET") me.HandleFunc("/posts/export.csv", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET") me.HandleFunc("/posts/export.zip", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET") me.HandleFunc("/posts/export.json", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET") me.HandleFunc("/export", handler.User(viewExportOptions)).Methods("GET") me.HandleFunc("/export.json", handler.Download(viewExportFull, UserLevelUser)).Methods("GET") me.HandleFunc("/import", handler.User(viewImport)).Methods("GET") me.Path("/settings").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(viewSettings))).Methods("GET") me.HandleFunc("/invites", handler.User(handleViewUserInvites)).Methods("GET") me.HandleFunc("/logout", handler.Web(viewLogout, UserLevelNone)).Methods("GET") write.HandleFunc("/api/me", handler.All(viewMeAPI)).Methods("GET") apiMe := write.PathPrefix("/api/me/").Subrouter() apiMe.HandleFunc("/", handler.All(viewMeAPI)).Methods("GET") apiMe.HandleFunc("/posts", handler.UserWebAPI(viewMyPostsAPI)).Methods("GET") apiMe.HandleFunc("/collections", handler.UserAPI(viewMyCollectionsAPI)).Methods("GET") apiMe.HandleFunc("/password", handler.All(updatePassphrase)).Methods("POST") apiMe.HandleFunc("/self", handler.All(updateSettings)).Methods("POST") apiMe.HandleFunc("/invites", handler.User(handleCreateUserInvite)).Methods("POST") apiMe.HandleFunc("/import", handler.User(handleImport)).Methods("POST") apiMe.HandleFunc("/oauth/remove", handler.User(removeOauth)).Methods("POST") // Sign up validation write.HandleFunc("/api/alias", handler.All(handleUsernameCheck)).Methods("POST") write.HandleFunc("/api/markdown", handler.All(handleRenderMarkdown)).Methods("POST") instanceURL, _ := url.Parse(apper.App().Config().App.Host) host := instanceURL.Host // Handle collections write.HandleFunc("/api/collections", handler.All(newCollection)).Methods("POST") apiColls := write.PathPrefix("/api/collections/").Subrouter() apiColls.HandleFunc("/monetization-pointer", handler.PlainTextAPI(handleSPSPEndpoint)).Methods("GET") apiColls.HandleFunc("/"+host, handler.AllReader(fetchCollection)).Methods("GET") apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.AllReader(fetchCollection)).Methods("GET") apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.All(existingCollection)).Methods("POST", "DELETE") apiColls.HandleFunc("/{alias}/posts", handler.AllReader(fetchCollectionPosts)).Methods("GET") apiColls.HandleFunc("/{alias}/posts", handler.All(newPost)).Methods("POST") apiColls.HandleFunc("/{alias}/posts/{post}", handler.AllReader(fetchPost)).Methods("GET") apiColls.HandleFunc("/{alias}/posts/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST") apiColls.HandleFunc("/{alias}/posts/{post}/splitcontent", handler.AllReader(handleGetSplitContent)).Methods("GET", "POST") apiColls.HandleFunc("/{alias}/posts/{post}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET") apiColls.HandleFunc("/{alias}/collect", handler.All(addPost)).Methods("POST") apiColls.HandleFunc("/{alias}/pin", handler.All(pinPost)).Methods("POST") apiColls.HandleFunc("/{alias}/unpin", handler.All(pinPost)).Methods("POST") + apiColls.HandleFunc("/{alias}/email/subscribe", handler.All(handleCreateEmailSubscription)).Methods("POST") + apiColls.HandleFunc("/{alias}/email/subscribe", handler.All(handleDeleteEmailSubscription)).Methods("DELETE") + apiColls.HandleFunc("/{collection}/email/unsubscribe", handler.All(handleDeleteEmailSubscription)).Methods("GET") apiColls.HandleFunc("/{alias}/inbox", handler.All(handleFetchCollectionInbox)).Methods("POST") apiColls.HandleFunc("/{alias}/outbox", handler.AllReader(handleFetchCollectionOutbox)).Methods("GET") apiColls.HandleFunc("/{alias}/following", handler.AllReader(handleFetchCollectionFollowing)).Methods("GET") apiColls.HandleFunc("/{alias}/followers", handler.AllReader(handleFetchCollectionFollowers)).Methods("GET") // Handle posts write.HandleFunc("/api/posts", handler.All(newPost)).Methods("POST") posts := write.PathPrefix("/api/posts/").Subrouter() posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.AllReader(fetchPost)).Methods("GET") posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST", "PUT") posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(deletePost)).Methods("DELETE") posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET") posts.HandleFunc("/claim", handler.All(addPost)).Methods("POST") posts.HandleFunc("/disperse", handler.All(dispersePost)).Methods("POST") write.HandleFunc("/auth/signup", handler.Web(handleWebSignup, UserLevelNoneRequired)).Methods("POST") write.HandleFunc("/auth/login", handler.Web(webLogin, UserLevelNoneRequired)).Methods("POST") write.HandleFunc("/admin", handler.Admin(handleViewAdminDash)).Methods("GET") write.HandleFunc("/admin/monitor", handler.Admin(handleViewAdminMonitor)).Methods("GET") write.HandleFunc("/admin/settings", handler.Admin(handleViewAdminSettings)).Methods("GET") write.HandleFunc("/admin/users", handler.Admin(handleViewAdminUsers)).Methods("GET") write.HandleFunc("/admin/user/{username}", handler.Admin(handleViewAdminUser)).Methods("GET") write.HandleFunc("/admin/user/{username}/delete", handler.Admin(handleAdminDeleteUser)).Methods("POST") write.HandleFunc("/admin/user/{username}/status", handler.Admin(handleAdminToggleUserStatus)).Methods("POST") write.HandleFunc("/admin/user/{username}/passphrase", handler.Admin(handleAdminResetUserPass)).Methods("POST") write.HandleFunc("/admin/pages", handler.Admin(handleViewAdminPages)).Methods("GET") write.HandleFunc("/admin/page/{slug}", handler.Admin(handleViewAdminPage)).Methods("GET") write.HandleFunc("/admin/update/config", handler.AdminApper(handleAdminUpdateConfig)).Methods("POST") write.HandleFunc("/admin/update/{page}", handler.Admin(handleAdminUpdateSite)).Methods("POST") write.HandleFunc("/admin/updates", handler.Admin(handleViewAdminUpdates)).Methods("GET") // Handle special pages first write.HandleFunc("/login", handler.Web(viewLogin, UserLevelNoneRequired)) write.HandleFunc("/signup", handler.Web(handleViewLanding, UserLevelNoneRequired)) write.HandleFunc("/invite/{code:[a-zA-Z0-9]+}", handler.Web(handleViewInvite, UserLevelOptional)).Methods("GET") // TODO: show a reader-specific 404 page if the function is disabled write.HandleFunc("/read", handler.Web(viewLocalTimeline, UserLevelReader)) RouteRead(handler, UserLevelReader, write.PathPrefix("/read").Subrouter()) draftEditPrefix := "" if apper.App().cfg.App.SingleUser { draftEditPrefix = "/d" write.HandleFunc("/me/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET") } else { write.HandleFunc("/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET") } // All the existing stuff write.HandleFunc(draftEditPrefix+"/{action}/edit", handler.Web(handleViewPad, UserLevelUser)).Methods("GET") write.HandleFunc(draftEditPrefix+"/{action}/meta", handler.Web(handleViewMeta, UserLevelUser)).Methods("GET") // Collections if apper.App().cfg.App.SingleUser { RouteCollections(handler, write.PathPrefix("/").Subrouter()) } else { write.HandleFunc("/{prefix:[@~$!\\-+]}{collection}", handler.Web(handleViewCollection, UserLevelReader)) write.HandleFunc("/{collection}/", handler.Web(handleViewCollection, UserLevelReader)) RouteCollections(handler, write.PathPrefix("/{prefix:[@~$!\\-+]?}{collection}").Subrouter()) // Posts } write.HandleFunc(draftEditPrefix+"/{post}", handler.Web(handleViewPost, UserLevelOptional)) write.HandleFunc("/", handler.Web(handleViewHome, UserLevelOptional)) return r } func RouteCollections(handler *Handler, r *mux.Router) { r.HandleFunc("/logout", handler.Web(handleLogOutCollection, UserLevelOptional)) r.HandleFunc("/page/{page:[0-9]+}", handler.Web(handleViewCollection, UserLevelReader)) + r.HandleFunc("/lang:{lang:[a-z]{2}}", handler.Web(handleViewCollectionLang, UserLevelOptional)) + r.HandleFunc("/lang:{lang:[a-z]{2}}/page/{page:[0-9]+}", handler.Web(handleViewCollectionLang, UserLevelOptional)) r.HandleFunc("/tag:{tag}", handler.Web(handleViewCollectionTag, UserLevelReader)) + r.HandleFunc("/tag:{tag}/page/{page:[0-9]+}", handler.Web(handleViewCollectionTag, UserLevelReader)) r.HandleFunc("/tag:{tag}/feed/", handler.Web(ViewFeed, UserLevelReader)) r.HandleFunc("/sitemap.xml", handler.AllReader(handleViewSitemap)) r.HandleFunc("/feed/", handler.AllReader(ViewFeed)) + r.HandleFunc("/email/confirm/{subscriber}", handler.All(handleConfirmEmailSubscription)).Methods("GET") + r.HandleFunc("/email/unsubscribe/{subscriber}", handler.All(handleDeleteEmailSubscription)).Methods("GET") r.HandleFunc("/{slug}", handler.CollectionPostOrStatic) r.HandleFunc("/{slug}/edit", handler.Web(handleViewPad, UserLevelUser)) r.HandleFunc("/{slug}/edit/meta", handler.Web(handleViewMeta, UserLevelUser)) r.HandleFunc("/{slug}/", handler.Web(handleCollectionPostRedirect, UserLevelReader)).Methods("GET") } func RouteRead(handler *Handler, readPerm UserLevelFunc, r *mux.Router) { r.HandleFunc("/api/posts", handler.Web(viewLocalTimelineAPI, readPerm)) r.HandleFunc("/p/{page}", handler.Web(viewLocalTimeline, readPerm)) r.HandleFunc("/feed/", handler.Web(viewLocalTimelineFeed, readPerm)) r.HandleFunc("/t/{tag}", handler.Web(viewLocalTimeline, readPerm)) r.HandleFunc("/a/{post}", handler.Web(handlePostIDRedirect, readPerm)) r.HandleFunc("/{author}", handler.Web(viewLocalTimeline, readPerm)) r.HandleFunc("/", handler.Web(viewLocalTimeline, readPerm)) } diff --git a/scripts/invalidate-css.sh b/scripts/invalidate-css.sh index c411f70..295599e 100755 --- a/scripts/invalidate-css.sh +++ b/scripts/invalidate-css.sh @@ -1,37 +1,37 @@ #!/bin/bash # -# Copyright © 2020 A Bunch Tell LLC. +# Copyright © 2020 Musing Studio LLC. # # This file is part of WriteFreely. # # WriteFreely is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License, included # in the LICENSE file in this source code package. # ############################################################################### # # WriteFreely CSS invalidation script # # usage: ./invalidate-css.sh # # This script provides an automated way to invalidate stylesheets cached in the # browser. It uses the last git commit hashes of the most frequently modified # LESS files in the project and appends them to the stylesheet `href` in all # template files. # # This is designed to be used when building a WriteFreely release. # ############################################################################### # Get parent build directory from first argument buildDir=$1 # Get short hash of each primary LESS file's last commit cssHash=$(git log -n 1 --pretty=format:%h -- less/core.less) cssNewHash=$(git log -n 1 --pretty=format:%h -- less/new-core.less) cssPadHash=$(git log -n 1 --pretty=format:%h -- less/pad.less) echo "Adding write.css version ($cssHash $cssNewHash $cssPadHash) to .tmpl files..." cd "$buildDir/templates" || exit 1 find . -type f -name "*.tmpl" -print0 | xargs -0 sed -i "s/write.css/write.css?${cssHash}${cssNewHash}${cssPadHash}/g" find . -type f -name "*.tmpl" -print0 | xargs -0 sed -i "s/{{.Theme}}.css/{{.Theme}}.css?${cssHash}${cssNewHash}${cssPadHash}/g" \ No newline at end of file diff --git a/scripts/upgrade-server.sh b/scripts/upgrade-server.sh index 581085d..f010c94 100755 --- a/scripts/upgrade-server.sh +++ b/scripts/upgrade-server.sh @@ -1,108 +1,108 @@ #! /bin/bash ############################################################################### ## writefreely update script ## ## ## -## WARNING: running this script will overwrite any modifed assets or ## +## WARNING: running this script will overwrite any modified assets or ## ## template files. If you have any custom changes to these files you ## ## should back them up FIRST. ## ## ## ## This must be run from the web application root directory ## ## i.e. /var/www/writefreely, and operates under the assumption that you## ## have not installed the binary `writefreely` in another location. ## ############################################################################### # -# Copyright © 2019-2020 A Bunch Tell LLC. +# Copyright © 2019-2020 Musing Studio LLC. # # This file is part of WriteFreely. # # WriteFreely is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License, included # in the LICENSE file in this source code package. # # only execute as root, or use sudo if [[ `id -u` -ne 0 ]]; then echo "You must login as root, or execute this script with sudo" exit 10 fi # go ahead and check for the latest release on linux echo "Checking for updates..." url=`curl -s https://api.github.com/repos/writeas/writefreely/releases/latest | grep 'browser_' | grep 'linux' | grep 'amd64' | cut -d\" -f4` # check current version bin_output=`./writefreely -v` if [ -z "$bin_output" ]; then exit 1 fi current=${bin_output:12:5} echo "Current version is v$current" # grab latest version number IFS='/' read -ra parts <<< "$url" latest=${parts[-2]} echo "Latest release is $latest" IFS='.' read -ra cv <<< "$current" read -ra lv <<< "${latest#v}" IFS=' ' tempdir=$(mktemp -d) if [[ ${lv[0]} -gt ${cv[0]} ]]; then echo "New major version available." echo "Downloading..." `wget -P $tempdir -q --show-progress $url` elif [[ ${lv[0]} -eq ${cv[0]} ]] && [[ ${lv[1]} -gt ${cv[1]} ]]; then echo "New minor version available." echo "Downloading..." `wget -P $tempdir -q --show-progress $url` elif [[ ${lv[2]} -gt ${cv[2]} ]]; then echo "New patch version available." echo "Downloading..." `wget -P $tempdir -q --show-progress $url` else echo "Up to date." exit 0 fi filename=${parts[-1]} # extract echo "Extracting files..." tar -zxf $tempdir/$filename -C $tempdir # stop service echo "Stopping writefreely systemd service..." if `systemctl start writefreely`; then echo "Success, service stopped." else echo "Upgrade failed to stop the systemd service, exiting early." exit 1 fi # copy files echo "Copying files..." cp -r $tempdir/writefreely/{pages,static,templates,writefreely} . # migrate db ./writefreely -migrate # restart service echo "Starting writefreely systemd service..." if `systemctl start writefreely`; then echo "Success, version has been upgraded to $latest." else echo "Upgrade complete, but failed to restart service." exit 1 fi diff --git a/session.go b/session.go index 81d628f..03d3963 100644 --- a/session.go +++ b/session.go @@ -1,141 +1,146 @@ /* - * Copyright © 2018-2019 A Bunch Tell LLC. + * Copyright © 2018-2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "encoding/gob" "github.com/gorilla/sessions" "github.com/writeas/web-core/log" "net/http" "strings" ) const ( day = 86400 sessionLength = 180 * day + + userEmailCookieName = "ue" + userEmailCookieVal = "email" + cookieName = "wfu" cookieUserVal = "u" blogPassCookieName = "ub" ) // InitSession creates the cookie store. It depends on the keychain already // being loaded. func (app *App) InitSession() { // Register complex data types we'll be storing in cookies gob.Register(&User{}) // Create the cookie store store := sessions.NewCookieStore(app.keys.CookieAuthKey, app.keys.CookieKey) store.Options = &sessions.Options{ Path: "/", MaxAge: sessionLength, HttpOnly: true, Secure: strings.HasPrefix(app.cfg.App.Host, "https://"), } if store.Options.Secure { store.Options.SameSite = http.SameSiteNoneMode } app.sessionStore = store } func getSessionFlashes(app *App, w http.ResponseWriter, r *http.Request, session *sessions.Session) ([]string, error) { var err error if session == nil { session, err = app.sessionStore.Get(r, cookieName) if err != nil { return nil, err } } f := []string{} if flashes := session.Flashes(); len(flashes) > 0 { for _, flash := range flashes { if str, ok := flash.(string); ok { f = append(f, str) } } } saveUserSession(app, r, w) return f, nil } func addSessionFlash(app *App, w http.ResponseWriter, r *http.Request, m string, session *sessions.Session) error { var err error if session == nil { session, err = app.sessionStore.Get(r, cookieName) } if err != nil { log.Error("Unable to add flash '%s': %v", m, err) return err } session.AddFlash(m) saveUserSession(app, r, w) return nil } func getUserAndSession(app *App, r *http.Request) (*User, *sessions.Session) { session, err := app.sessionStore.Get(r, cookieName) if err == nil { // Got the currently logged-in user val := session.Values[cookieUserVal] var u = &User{} var ok bool if u, ok = val.(*User); ok { return u, session } } return nil, nil } func getUserSession(app *App, r *http.Request) *User { u, _ := getUserAndSession(app, r) return u } func saveUserSession(app *App, r *http.Request, w http.ResponseWriter) error { session, err := app.sessionStore.Get(r, cookieName) if err != nil { return ErrInternalCookieSession } // Extend the session session.Options.MaxAge = int(sessionLength) // Remove any information that accidentally got added // FIXME: find where Plan information is getting saved to cookie. val := session.Values[cookieUserVal] var u = &User{} var ok bool if u, ok = val.(*User); ok { session.Values[cookieUserVal] = u.Cookie() } err = session.Save(r, w) if err != nil { log.Error("Couldn't saveUserSession: %v", err) } return err } -func getFullUserSession(app *App, r *http.Request) *User { +func getFullUserSession(app *App, r *http.Request) (*User, error) { u := getUserSession(app, r) if u == nil { - return nil + return nil, nil } - u, _ = app.db.GetUserByID(u.ID) - return u + var err error + u, err = app.db.GetUserByID(u.ID) + return u, err } diff --git a/sitemap.go b/sitemap.go index 00e148f..0bbcefb 100644 --- a/sitemap.go +++ b/sitemap.go @@ -1,109 +1,109 @@ /* - * Copyright © 2018-2019 A Bunch Tell LLC. + * Copyright © 2018-2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "fmt" "net/http" "time" "github.com/gorilla/mux" "github.com/ikeikeikeike/go-sitemap-generator/v2/stm" "github.com/writeas/web-core/log" ) func buildSitemap(host, alias string) *stm.Sitemap { sm := stm.NewSitemap(0) sm.SetDefaultHost(host) if alias != "/" { sm.SetSitemapsPath(alias) } sm.Create() // Note: Do not call `sm.Finalize()` because it flushes // the underlying datastructure from memory to disk. return sm } func handleViewSitemap(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) // Determine canonical blog URL alias := vars["collection"] subdomain := vars["subdomain"] isSubdomain := subdomain != "" if isSubdomain { alias = subdomain } host := fmt.Sprintf("%s/%s/", app.cfg.App.Host, alias) var c *Collection var err error pre := "/" if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(alias) } if err != nil { return err } c.hostName = app.cfg.App.Host if !isSubdomain { pre += alias + "/" } host = c.CanonicalURL() sm := buildSitemap(host, pre) posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false) if err != nil { log.Error("Error getting posts: %v", err) return err } lastSiteMod := time.Now() for i, p := range *posts { if i == 0 { lastSiteMod = p.Updated } u := stm.URL{ {"loc", p.Slug.String}, {"changefreq", "weekly"}, {"mobile", true}, {"lastmod", p.Updated}, } if len(p.Images) > 0 { imgs := []stm.URL{} for _, i := range p.Images { imgs = append(imgs, stm.URL{ {"loc", i}, {"title", ""}, }) } u = append(u, []interface{}{"image", imgs}) } sm.Add(u) } // Add top URL sm.Add(stm.URL{ {"loc", pre}, {"changefreq", "daily"}, {"priority", "1.0"}, {"lastmod", lastSiteMod}, }) w.Write(sm.XMLContent()) return nil } diff --git a/spam/email.go b/spam/email.go new file mode 100644 index 0000000..de017ab --- /dev/null +++ b/spam/email.go @@ -0,0 +1,43 @@ +/* + * Copyright © 2020-2021 Musing Studio LLC. + * + * This file is part of WriteFreely. + * + * WriteFreely is free software: you can redistribute it and/or modify + * it under the terms of the GNU Affero General Public License, included + * in the LICENSE file in this source code package. + */ + +package spam + +import ( + "github.com/writeas/web-core/id" + "strings" +) + +var honeypotField string + +func HoneypotFieldName() string { + if honeypotField == "" { + honeypotField = id.Generate62RandomString(39) + } + return honeypotField +} + +// CleanEmail takes an email address and strips it down to a unique address that can be blocked. +func CleanEmail(email string) string { + emailParts := strings.Split(strings.ToLower(email), "@") + if len(emailParts) < 2 { + return "" + } + u := emailParts[0] + d := emailParts[1] + // Ignore anything after '+' + plusIdx := strings.IndexRune(u, '+') + if plusIdx > -1 { + u = u[:plusIdx] + } + // Strip dots in email address + u = strings.ReplaceAll(u, ".", "") + return u + "@" + d +} diff --git a/static/js/README.md b/static/js/README.md index 7e387db..8497b66 100644 --- a/static/js/README.md +++ b/static/js/README.md @@ -1,29 +1,29 @@ # static/js -This directory is for Javascript. +This directory is for JavaScript. ## Updating libraries Update instructions, for libraries that involve more than just downloading the latest version. ### highlightjs To update the highlightjs library, first download a plain package (no languages included) [from highlightjs.org](https://highlightjs.org/download/). The `highlight.pack.js` file in the archive should be moved into this `static/js/` directory and renamed to `highlight.min.js`. Then [download an archive](https://github.com/highlightjs/highlight.js/releases) of the latest version. Extract it to some directory, and replace **~/Downloads/highlight.js** below with the resulting directory. ```bash #!/bin/bash version=9.13.1 cd $GOPATH/src/github.com/writefreely/writefreely/static/js/highlightjs for f in $(ls ~/Downloads/highlight.js/src/languages); do # Use minified versions f=$(echo $f | sed 's/\.js/.min.js/') # Download the version wget "https://cdnjs.cloudflare.com/ajax/libs/highlight.js/$version/languages/$f" done ``` Commit the changes and you're done! diff --git a/static/js/modals.js b/static/js/modals.js index 6705afa..0910d7e 100644 --- a/static/js/modals.js +++ b/static/js/modals.js @@ -1,24 +1,24 @@ /* - * Copyright © 2016-2021 A Bunch Tell LLC. + * Copyright © 2016-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ function showModal(id) { document.getElementById('overlay').style.display = 'block'; document.getElementById('modal-'+id).style.display = 'block'; } var closeModals = function(e) { e.preventDefault(); document.getElementById('overlay').style.display = 'none'; var modals = document.querySelectorAll('.modal'); for (var i=0; iFor $5 per month, you can read this and other great writing across our site and other websites that support Web Monetization.

') $readmoreSell.insertAdjacentHTML("beforeend", '\n\n

Get started Learn more

') } function initMonetization() { let $content = document.querySelector('.e-content') let $post = document.getElementById('post-body') let $split = $post.querySelector('.split') if (document.monetization === undefined || $split == null) { if ($split) { showWMPaywall($content, $split) } return } document.monetization.addEventListener('monetizationstop', function(event) { if (pendingSplitContent) { // We've seen the 'pending' activity, so we can assume things will work document.monetization.removeEventListener('monetizationstop', progressHandler) return } // We're getting 'stop' without ever starting, so display the paywall. showWMPaywall($content, $split) }); document.monetization.addEventListener('monetizationpending', function (event) { pendingSplitContent = true }) let progressHandler = function(event) { if (unlockedSplitContent) { document.monetization.removeEventListener('monetizationprogress', progressHandler) return } if (!unlockingSplitContent && !unlockedSplitContent) { unlockingSplitContent = true getSplitContent(event.detail.receipt, function (status, data) { unlockingSplitContent = false if (status == 200) { $split.textContent = "Your subscriber perks start here." $split.insertAdjacentHTML("afterend", "\n\n"+data.data.html_body) } else { $split.textContent = "Something went wrong while unlocking subscriber content." } unlockedSplitContent = true }) } } function getSplitContent(receipt, callback) { let params = "receipt="+encodeURIComponent(receipt) let http = new XMLHttpRequest(); http.open("POST", "/api/collections/" + window.collAlias + "/posts/" + window.postSlug + "/splitcontent", true); // Send the proper header information along with the request http.setRequestHeader("Content-type", "application/x-www-form-urlencoded"); http.onreadystatechange = function () { if (http.readyState == 4) { callback(http.status, JSON.parse(http.responseText)); } } http.send(params); } document.monetization.addEventListener('monetizationstart', function() { if (!unlockedSplitContent) { $split.textContent = "Unlocking subscriber content..." } document.monetization.removeEventListener('monetizationstart', progressHandler) }); document.monetization.addEventListener('monetizationprogress', progressHandler); } \ No newline at end of file diff --git a/templates.go b/templates.go index e0c728e..3bb7d13 100644 --- a/templates.go +++ b/templates.go @@ -1,229 +1,240 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "errors" "html/template" "io" - "io/ioutil" - "net/http" "os" + "net/http" "path/filepath" "strings" "github.com/dustin/go-humanize" "github.com/writeas/web-core/l10n" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/config" ) var ( templates = map[string]*template.Template{} pages = map[string]*template.Template{} userPages = map[string]*template.Template{} funcMap = template.FuncMap{ "largeNumFmt": largeNumFmt, "pluralize": pluralize, "isRTL": isRTL, "isLTR": isLTR, "localstr": localStr, "localhtml": localHTML, "tolower": strings.ToLower, "title": strings.Title, "hasPrefix": strings.HasPrefix, "hasSuffix": strings.HasSuffix, "dict": dict, } ) const ( templatesDir = "templates" pagesDir = "pages" ) func showUserPage(w http.ResponseWriter, name string, obj interface{}) { if obj == nil { log.Error("showUserPage: data is nil!") return } if err := userPages[filepath.Join("user", name+".tmpl")].ExecuteTemplate(w, name, obj); err != nil { log.Error("Error parsing %s: %v", name, err) } } func initTemplate(parentDir, name string) { if debugging { log.Info(" " + filepath.Join(parentDir, templatesDir, name+".tmpl")) } files := []string{ filepath.Join(parentDir, templatesDir, name+".tmpl"), filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"), filepath.Join(parentDir, templatesDir, "base.tmpl"), filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"), } if name == "collection" || name == "collection-tags" || name == "chorus-collection" || name == "read" { // These pages list out collection posts, so we also parse templatesDir + "include/posts.tmpl" files = append(files, filepath.Join(parentDir, templatesDir, "include", "posts.tmpl")) } if name == "chorus-collection" || name == "chorus-collection-post" { files = append(files, filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl")) } if name == "collection" || name == "collection-tags" || name == "collection-post" || name == "post" || name == "chorus-collection" || name == "chorus-collection-post" { files = append(files, filepath.Join(parentDir, templatesDir, "include", "post-render.tmpl")) } templates[name] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...)) } func initPage(parentDir, path, key string) { if debugging { log.Info(" [%s] %s", key, path) } files := []string{ path, filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"), filepath.Join(parentDir, templatesDir, "base.tmpl"), filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"), } if key == "login.tmpl" || key == "landing.tmpl" || key == "signup.tmpl" { files = append(files, filepath.Join(parentDir, templatesDir, "include", "oauth.tmpl")) } pages[key] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...)) } func initUserPage(parentDir, path, key string) { if debugging { log.Info(" [%s] %s", key, path) } userPages[key] = template.Must(template.New(key).Funcs(funcMap).ParseFiles( path, filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"), filepath.Join(parentDir, templatesDir, "user", "include", "footer.tmpl"), filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"), filepath.Join(parentDir, templatesDir, "user", "include", "nav.tmpl"), )) } // InitTemplates loads all template files from the configured parent dir. func InitTemplates(cfg *config.Config) error { log.Info("Loading templates...") - tmplFiles, err := ioutil.ReadDir(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir)) + tmplFiles, err := os.ReadDir(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir)) if err != nil { return err } for _, f := range tmplFiles { if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") { parts := strings.Split(f.Name(), ".") key := parts[0] initTemplate(cfg.Server.TemplatesParentDir, key) } } log.Info("Loading pages...") // Initialize all static pages that use the base template - filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, pagesDir), func(path string, i os.FileInfo, err error) error { + err = filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, pagesDir), func(path string, i os.FileInfo, err error) error { + if err != nil { + return err + } if !i.IsDir() && !strings.HasPrefix(i.Name(), ".") { key := i.Name() initPage(cfg.Server.PagesParentDir, path, key) } return nil }) + if err != nil { + return err + } log.Info("Loading user pages...") // Initialize all user pages that use base templates - filepath.Walk(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir, "user"), func(path string, f os.FileInfo, err error) error { + err = filepath.Walk(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir, "user"), func(path string, f os.FileInfo, err error) error { + if err != nil { + return err + } if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") { corePath := path if cfg.Server.TemplatesParentDir != "" { corePath = corePath[len(cfg.Server.TemplatesParentDir)+1:] } parts := strings.Split(corePath, string(filepath.Separator)) key := f.Name() if len(parts) > 2 { key = filepath.Join(parts[1], f.Name()) } initUserPage(cfg.Server.TemplatesParentDir, path, key) } return nil }) + if err != nil { + return err + } return nil } // renderPage retrieves the given template and renders it to the given io.Writer. // If something goes wrong, the error is logged and returned. func renderPage(w io.Writer, tmpl string, data interface{}) error { err := pages[tmpl].ExecuteTemplate(w, "base", data) if err != nil { log.Error("%v", err) } return err } func largeNumFmt(n int64) string { return humanize.Comma(n) } func pluralize(singular, plural string, n int64) string { if n == 1 { return singular } return plural } func isRTL(d string) bool { return d == "rtl" } func isLTR(d string) bool { return d == "ltr" || d == "auto" } func localStr(term, lang string) string { s := l10n.Strings(lang)[term] if s == "" { s = l10n.Strings("")[term] } return s } func localHTML(term, lang string) template.HTML { s := l10n.Strings(lang)[term] if s == "" { s = l10n.Strings("")[term] } s = strings.Replace(s, "write.as", "writefreely", 1) return template.HTML(s) } // from: https://stackoverflow.com/a/18276968/1549194 func dict(values ...interface{}) (map[string]interface{}, error) { if len(values)%2 != 0 { return nil, errors.New("dict: invalid number of parameters") } dict := make(map[string]interface{}, len(values)/2) for i := 0; i < len(values); i += 2 { key, ok := values[i].(string) if !ok { return nil, errors.New("dict: keys must be strings") } dict[key] = values[i+1] } return dict, nil } diff --git a/templates/bare.tmpl b/templates/bare.tmpl index f76eed9..cd0fa8c 100644 --- a/templates/bare.tmpl +++ b/templates/bare.tmpl @@ -1,265 +1,266 @@ {{define "pad"}} {{if .Editing}}Editing {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}}{{else}}New Post{{end}} — {{.SiteName}} + {{if .CustomCSS}}{{end}}
{{if not .SingleUser}}

{{if .Chorus}}{{else}}{{end}}{{.SiteName}}

{{end}}
- +
{{if .Editing}}{{end}}
{{end}} diff --git a/templates/base.tmpl b/templates/base.tmpl index 604d0ff..273c2b9 100644 --- a/templates/base.tmpl +++ b/templates/base.tmpl @@ -1,93 +1,94 @@ {{define "base"}} {{ template "head" . }} - - + + {{if .CustomCSS}}{{end}} +
{{ if .Chorus }} {{end}}
{{ template "content" . }}
{{ template "footer" . }} {{if not .JSDisabled}} {{else}} - {{if .WebFonts}}{{end}} + {{if .WebFonts}}{{end}} {{end}} {{end}} {{define "body-attrs"}}{{end}} diff --git a/templates/chorus-collection-post.tmpl b/templates/chorus-collection-post.tmpl index 537e4ef..468455c 100644 --- a/templates/chorus-collection-post.tmpl +++ b/templates/chorus-collection-post.tmpl @@ -1,154 +1,155 @@ {{define "post"}} {{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{.Collection.DisplayTitle}} + {{if .CustomCSS}}{{end}} {{if gt .Views 1}} {{end}} {{if gt (len .Images) 0}}{{else}}{{end}} {{range .Images}}{{else}}{{end}} {{template "collection-meta" .}} {{if .Collection.StyleSheet}}{{end}} {{if .Collection.RenderMathJax}} {{template "mathjax" . }} {{end}} {{template "highlighting" .}}
{{template "user-navigation" .}} {{if .Silenced}} {{template "user-silenced"}} {{end}}
{{if .IsScheduled}}

Scheduled

{{end}}{{if .Title.String}}

{{.FormattedDisplayTitle}}

{{end}}{{if and $.Collection.Format.ShowDates (not .IsPinned)}}{{end}}
{{.HTMLContent}}
{{ if .Collection.ShowFooterBranding }}

Published by {{ if .IsOwner }} · {{largeNumFmt .Views}} {{pluralize "view" "views" .Views}} · Edit {{if .IsPinned}} · Unpin{{end}} {{ end }}


{{ end }} {{if .Collection.CanShowScript}} {{range .Collection.ExternalScripts}}{{end}} {{if .Collection.Script}}{{end}} {{end}} {{if and .Monetization (not .IsOwner)}} {{end}} {{end}} diff --git a/templates/chorus-collection.tmpl b/templates/chorus-collection.tmpl index d105dff..0fb5eaf 100644 --- a/templates/chorus-collection.tmpl +++ b/templates/chorus-collection.tmpl @@ -1,235 +1,236 @@ {{define "collection"}} {{.DisplayTitle}}{{if not .SingleUser}} — {{.SiteName}}{{end}} + {{if .CustomCSS}}{{end}} - {{if gt .CurrentPage 1}}{{end}} - {{if lt .CurrentPage .TotalPages}}{{end}} + {{if gt .CurrentPage 1}}{{end}} + {{if lt .CurrentPage .TotalPages}}{{end}} {{if not .IsPrivate}}{{end}} {{template "collection-meta" .}} {{if .StyleSheet}}{{end}} {{if .RenderMathJax}} {{template "mathjax" .}} {{end}} {{template "highlighting" . }} {{template "user-navigation" .}} {{if .Silenced}} {{template "user-silenced"}} {{end}}

{{.DisplayTitle}}

{{if .Description}}

{{.Description}}

{{end}} {{/*if not .Public/*}} {{/*end*/}} {{if .PinnedPosts}} {{end}}
{{if .Posts}}
{{else}}
{{end}} {{if .IsWelcome}}

Welcome, {{.Username}}!

This is your new blog.

Start writing, or customize your blog.

Check out our writing guide to see what else you can do, and get in touch anytime with questions or feedback.

{{end}} {{template "posts" .}} {{if gt .TotalPages 1}}{{end}} {{if .Posts}}
{{else}}
{{end}} {{if .ShowFooterBranding }} {{ end }} {{if .CanShowScript}} {{range .ExternalScripts}}{{end}} {{if .Script}}{{end}} {{end}} {{end}} diff --git a/templates/classic.tmpl b/templates/classic.tmpl index ecc8cb9..58f82c7 100644 --- a/templates/classic.tmpl +++ b/templates/classic.tmpl @@ -1,401 +1,402 @@ {{define "pad"}} {{if .Editing}}Editing {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}}{{else}}New Post{{end}} — {{.SiteName}} + {{if .CustomCSS}}{{end}}
{{if not .SingleUser}}

{{end}}
- +
{{if .Editing}}{{end}}
{{end}} diff --git a/templates/collection-post.tmpl b/templates/collection-post.tmpl index 5d56abd..54d5298 100644 --- a/templates/collection-post.tmpl +++ b/templates/collection-post.tmpl @@ -1,144 +1,145 @@ {{define "post"}} {{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{.Collection.DisplayTitle}} + {{if .CustomCSS}}{{end}} {{ if .IsFound }} {{if gt .Views 1}} {{end}} {{if gt (len .Images) 0}}{{else}}{{end}} {{range .Images}}{{else}}{{end}} {{ end }} {{template "collection-meta" .}} {{if .Collection.StyleSheet}}{{end}} {{if .Collection.RenderMathJax}} {{template "mathjax" . }} {{end}} {{template "highlighting" .}}

{{if .Silenced}} {{template "user-silenced"}} {{end}}
{{if .IsScheduled}}

Scheduled

{{end}}{{if .Title.String}}

{{.FormattedDisplayTitle}}

{{end}}{{if and $.Collection.Format.ShowDates (not .IsPinned) .IsFound}}{{end}}
{{.HTMLContent}}
{{ if .Collection.ShowFooterBranding }}

{{ end }} {{if .Collection.CanShowScript}} {{range .Collection.ExternalScripts}}{{end}} {{if .Collection.Script}}{{end}} {{end}} {{if and .Monetization (not .IsOwner)}} {{end}} {{end}} diff --git a/templates/collection-tags.tmpl b/templates/collection-tags.tmpl index e2f8962..c8e8a12 100644 --- a/templates/collection-tags.tmpl +++ b/templates/collection-tags.tmpl @@ -1,199 +1,211 @@ {{define "collection-tags"}} {{.Tag}} — {{.Collection.DisplayTitle}} + {{if .CustomCSS}}{{end}} {{if not .Collection.IsPrivate}}{{end}} {{if gt .Views 1}} {{end}} {{template "collection-meta" .}} {{if .Collection.StyleSheet}}{{end}} {{if .Collection.RenderMathJax}} {{template "mathjax" .}} {{end}} {{template "highlighting" . }}

{{.Collection.DisplayTitle}}

{{if .Silenced}} {{template "user-silenced"}} {{end}} {{if .Posts}}
{{else}}
{{end}}

{{.Tag}}

{{template "posts" .}} + + {{if gt .TotalPages 1}}{{end}} + {{if .Posts}}
{{else}}{{end}} {{ if .Collection.ShowFooterBranding }} {{ end }} {{if .CanShowScript}} {{range .ExternalScripts}}{{end}} {{if .Collection.Script}}{{end}} {{end}} {{if .IsOwner}} {{end}} {{end}} diff --git a/templates/collection.tmpl b/templates/collection.tmpl index 493e6b7..93a01c5 100644 --- a/templates/collection.tmpl +++ b/templates/collection.tmpl @@ -1,251 +1,261 @@ {{define "collection"}} {{.DisplayTitle}}{{if not .SingleUser}} — {{.SiteName}}{{end}} + {{if .CustomCSS}}{{end}} - {{if gt .CurrentPage 1}}{{end}} - {{if lt .CurrentPage .TotalPages}}{{end}} + {{if gt .CurrentPage 1}}{{end}} + {{if lt .CurrentPage .TotalPages}}{{end}} {{if not .IsPrivate}}{{end}} - + - + - + - + {{template "collection-meta" .}} {{if .StyleSheet}}{{end}} {{if .RenderMathJax}} {{template "mathjax" .}} {{end}} {{template "highlighting" . }} {{if or .IsOwner .SingleUser}} {{else if .IsCollLoggedIn}} {{end}}
{{if .Silenced}} {{template "user-silenced"}} {{end}}

{{if .Posts}}{{else}}write.as {{end}}{{.DisplayTitle}}

- {{if .Description}}

{{.Description}}

{{end}} + {{if .Description}}

{{.DisplayDescription}}

{{end}} {{/*if not .Public/*}} {{/*end*/}} {{if .PinnedPosts}} {{end}}
{{if .Posts}}
{{else}}
{{end}} {{if .IsWelcome}}

Welcome, {{.Username}}!

This is your new blog.

Start writing, or customize your blog.

Check out our writing guide to see what else you can do, and get in touch anytime with questions or feedback.

{{end}} + {{if .Flash}} +
+

{{.Flash}}

+
+ {{end}} + {{template "posts" .}} {{if gt .TotalPages 1}}{{end}} + {{if not .IsWelcome}}{{template "emailsubscribe" .}}{{end}} + {{if .Posts}}
{{else}}{{end}} {{if .ShowFooterBranding }} {{ end }} {{if .CanShowScript}} {{range .ExternalScripts}}{{end}} {{if .Script}}{{end}} {{end}} {{end}} diff --git a/templates/edit-meta.tmpl b/templates/edit-meta.tmpl index 9f7faed..d3f93a8 100644 --- a/templates/edit-meta.tmpl +++ b/templates/edit-meta.tmpl @@ -1,374 +1,375 @@ {{define "edit-meta"}} Edit metadata: {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}} — {{.SiteName}} + {{if .CustomCSS}}{{end}}

Edit metadata: {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}} view post

{{if .Flashes}}
    {{range .Flashes}}
  • {{.}}
  • {{end}}
{{end}}
{{if .EditCollection}}
{{end}}
-
UTC now

Date format should be: YYYY-MM-DD HH:MM:SS

 
{{end}} diff --git a/templates/include/post-render.tmpl b/templates/include/post-render.tmpl index 5b84845..4e98d80 100644 --- a/templates/include/post-render.tmpl +++ b/templates/include/post-render.tmpl @@ -1,104 +1,132 @@ - + {{define "collection-meta"}} {{if .Monetization -}} {{- end}} + {{if .Verification -}} + + {{- end}} {{end}} {{define "highlighting"}} {{end}} {{define "mathjax"}} {{end}} + +{{define "emailsubscribe"}} + {{if .EmailSubsEnabled}} +
+ {{if .IsSubscriber}} +

You're subscribed to email updates. Unsubscribe.

+ {{else}} +
+ +

Enter your email to subscribe to updates.

+ + +
+ + {{end}} +
+ {{end}} +{{end}} \ No newline at end of file diff --git a/templates/pad.tmpl b/templates/pad.tmpl index 8da063e..eb1afba 100644 --- a/templates/pad.tmpl +++ b/templates/pad.tmpl @@ -1,420 +1,421 @@ {{define "pad"}} {{if .Editing}}Editing {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}}{{else}}New Post{{end}} — {{.SiteName}} + {{if .CustomCSS}}{{end}}
{{if not .SingleUser}}

{{end}}
- +
{{if .Editing}}{{end}}
{{end}} diff --git a/templates/password-collection.tmpl b/templates/password-collection.tmpl index c1c9083..fde4edc 100644 --- a/templates/password-collection.tmpl +++ b/templates/password-collection.tmpl @@ -1,87 +1,88 @@ {{define "password-collection"}} {{.DisplayTitle}}{{if not .SingleUser}} — {{.SiteName}}{{end}} + {{if .CustomCSS}}{{end}} {{if .StyleSheet}}{{end}} {{if .SingleUser}} {{end}}

{{.DisplayTitle}}

{{if .Flashes}}
    {{range .Flashes}}
  • {{.}}
  • {{end}}
{{else}}

This blog requires a password.

{{end}}

{{if and .Script .CanShowScript}}{{end}} {{end}} diff --git a/templates/post.tmpl b/templates/post.tmpl index 15b479d..9398425 100644 --- a/templates/post.tmpl +++ b/templates/post.tmpl @@ -1,101 +1,102 @@ {{define "post"}} {{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}} {{localhtml "title dash" .Language}} {{.SiteName}} {{if .IsCode}} {{end}} + {{if .CustomCSS}}{{end}} {{if gt .Views 1}} {{end}} {{if gt (len .Images) 0}}{{else}}{{end}} {{range .Images}}{{else}}{{end}} {{if .Author}}{{end}} {{template "highlighting" .}}

{{.SiteName}}

{{if .Silenced}} {{template "user-silenced"}} {{end}}
{{if .Title}}

{{.Title}}

{{end}}{{ if .IsPlainText }}

{{.Content}}

{{ else }}
{{.HTMLContent}}
{{ end }}

{{if .IsCode}} {{else}} {{if .IsPlainText}}{{end}} {{end}} {{end}} diff --git a/templates/user/admin/users.tmpl b/templates/user/admin/users.tmpl index f6b218c..935d445 100644 --- a/templates/user/admin/users.tmpl +++ b/templates/user/admin/users.tmpl @@ -1,42 +1,42 @@ {{define "users"}} {{template "header" .}}
{{template "admin-header" .}} - + {{if .Flashes}}

{{range .Flashes}}{{.}}{{end}}

{{end}}
{{.TotalUsers}} {{pluralize "user" "users" .TotalUsers}} + Invite people
{{range .Users}} {{end}}
User Joined Type Status
{{.Username}} {{.CreatedFriendly}} {{if .IsAdmin}}Admin{{else}}User{{end}} {{if .IsSilenced}}Silenced{{else}}Active{{end}}
{{template "footer" .}} {{end}} diff --git a/templates/user/admin/view-page.tmpl b/templates/user/admin/view-page.tmpl index 161e40b..dfcf4cd 100644 --- a/templates/user/admin/view-page.tmpl +++ b/templates/user/admin/view-page.tmpl @@ -1,77 +1,79 @@ {{define "view-page"}} {{template "header" .}}
{{template "admin-header" .}}

{{if eq .Content.ID "landing"}}Home page{{else}}{{.Content.ID}} page{{end}}

{{if eq .Content.ID "about"}}

Describe what your instance is about.

+ {{else if eq .Content.ID "contact"}} +

Tell your users and outside visitors how to contact you.

{{else if eq .Content.ID "privacy"}}

Outline your privacy policy.

{{else if eq .Content.ID "reader"}}

Customize your Reader page.

{{else if eq .Content.ID "landing"}}

Customize your home page.

{{end}} {{if .Message}}

{{.Message}}

{{end}}
{{if .Banner}}

We suggest a header (e.g. # Welcome), optionally followed by a small bit of text. Accepts Markdown and HTML.

{{else}} {{end}}

Accepts Markdown and HTML.

{{template "footer" .}} {{end}} diff --git a/templates/user/admin/view-user.tmpl b/templates/user/admin/view-user.tmpl index dac88bf..4a06c03 100644 --- a/templates/user/admin/view-user.tmpl +++ b/templates/user/admin/view-user.tmpl @@ -1,215 +1,215 @@ {{define "view-user"}} {{template "header" .}}
{{template "admin-header" .}}

{{.User.Username}}

{{if .NewPassword}}

This user's password has been reset to:

-

They can use this new password to log in to their account. This will only be shown once, so be sure to copy it and send it to them now.

+

They can use this new password to log into their account. This will only be shown once, so be sure to copy it and send it to them now.

{{if .ClearEmail}}

Their email address is: {{.ClearEmail}}

{{end}}
{{end}}
No. {{.User.ID}}
Type {{if .User.IsAdmin}}Admin{{else}}User{{end}}
Username {{.User.Username}}
Joined {{.User.CreatedFriendly}}
Total Posts {{.TotalPosts}}
Last Post {{if .LastPost}}{{.LastPost}}{{else}}Never{{end}}
Status {{if .User.IsSilenced}}

Silenced

{{else}}

Active

{{end}}
Password {{if ne .Username .User.Username}}
{{else}} Change your password {{end}}

Blogs

{{range .Colls}}

{{.Title}}

{{if $.Config.Federation}} {{end}}
Alias {{.Alias}}
Title {{.Title}}
Description {{.Description}}
Visibility {{.FriendlyVisibility}}
Views {{.Views}}
Posts {{.TotalPosts}}
Last Post {{if .LastPost}}{{.LastPost}}{{else}}Never{{end}}
Fediverse Followers {{.Followers}}
{{end}} {{ if not .User.IsAdmin }}

Incinerator

Delete this user

Permanently erase all user data, with no way to recover it.

{{end}}
{{template "footer" .}} {{end}} diff --git a/templates/user/collection.tmpl b/templates/user/collection.tmpl index 041c107..c30b479 100644 --- a/templates/user/collection.tmpl +++ b/templates/user/collection.tmpl @@ -1,270 +1,320 @@ -{{define "upgrade"}} -

Upgrade for $40 / year to edit.

-{{end}} - {{define "collection"}} {{template "header" .}}
{{if .Silenced}} {{template "user-silenced"}} {{end}} {{template "collection-breadcrumbs" .}}

Customize

{{template "collection-nav" (dict "Alias" .Alias "Path" .Path "SingleUser" .SingleUser)}} {{if .Flashes}}
    {{range .Flashes}}
  • {{.}}
  • {{end}}
{{end}}

-

+

URL

{{if eq .Alias .Username}}

This blog uses your username in its URL{{if .Federation}} and fediverse handle{{end}}. You can change it in your Account Settings.

{{end}}
  • {{.FriendlyHost}}/{{.Alias}}/
  • @{{.Alias}}@{{.FriendlyHost}}

Publicity

  • This blog is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.

  • Only you may read this blog (while you're logged in).

  • A password is required to read this blog.

  • {{if not .SingleUser}}
  • {{if .LocalTimeline}}

    This blog is displayed on the public reader, and is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.

    {{else}}

    The public reader is currently turned off for this community.

    {{end}}
  • {{end}}
+
+

Updates

+
+

Keep readers updated with your latest posts wherever they are.

+
    +
  • + +

    Readers can subscribe to your blog's RSS feed with their favorite RSS reader.

    +
  • + {{if .EmailCfg.Enabled}} +
  • + +

    + Let readers subscribe to your blog via email, and optionally accept private replies. +

    +
    + Allow replies to this address: + +
    +
  • + {{end}} + {{if .Federation}} +
  • + + @{{.Alias}}@{{.FriendlyHost}} +

    Allow others to follow your blog and interact with your posts in the fediverse. See how it works.

    +
  • + {{end}} +
+
+
+

Display Format

Customize how your posts display on your page.

  • Dates are shown. Latest posts listed first.

  • No dates shown. Oldest posts first.

  • No dates shown. Latest posts first.

Text Rendering

Customize how plain text renders on your blog.

Custom CSS

See our guide on customization.

Post Signature

This content will be added to the end of every post on this blog, as if it were part of the post itself. Markdown, HTML, and shortcodes are allowed.

+
+

Verification

+
+

Verify that you own another site on the open web, fediverse, etc. For example, enter your Mastodon profile address here, then on Mastodon add a link back to this blog — it will show up as verified there.

+ +

This adds a rel="me" code in your blog's <head>.

+
+
+ {{if .UserPage.StaticPage.AppCfg.Monetization}}

Web Monetization

-

Web Monetization enables you to receive micropayments from readers that have a Coil membership. Add your payment pointer to enable Web Monetization on your blog.

+

Web Monetization enables you to receive micropayments from readers via Interledger. Add your payment pointer to enable Web Monetization on your blog.

{{end}}

View Blog

{{if ne .Alias .Username}}

Delete Blog...

{{end}}
{{template "footer" .}} {{end}} diff --git a/templates/user/include/header.tmpl b/templates/user/include/header.tmpl index 9c4effa..9b6912b 100644 --- a/templates/user/include/header.tmpl +++ b/templates/user/include/header.tmpl @@ -1,115 +1,117 @@ {{define "user-navigation"}}
{{end}} {{define "header"}} {{.PageTitle}} {{if .Separator}}{{.Separator}}{{else}}—{{end}} {{.SiteName}} + {{if .CustomCSS}}{{end}} {{template "user-navigation" .}}
{{end}} {{define "admin-header"}}

Admin

{{end}} diff --git a/templates/user/include/nav.tmpl b/templates/user/include/nav.tmpl index 057fc3c..735019d 100644 --- a/templates/user/include/nav.tmpl +++ b/templates/user/include/nav.tmpl @@ -1,16 +1,17 @@ {{define "collection-breadcrumbs"}} {{if and .Collection (not .SingleUser)}}{{end}} {{end}} {{define "collection-nav"}} {{if not .SingleUser}}
{{end}} {{end}} diff --git a/templates/user/settings.tmpl b/templates/user/settings.tmpl index 338ea9a..829e4be 100644 --- a/templates/user/settings.tmpl +++ b/templates/user/settings.tmpl @@ -1,231 +1,231 @@ {{define "settings"}} {{template "header" .}}
{{if .Silenced}} {{template "user-silenced"}} {{end}}

{{if .IsLogOut}}Before you go...{{else}}Account Settings{{end}}

{{if .Flashes}}
    {{range .Flashes}}
  • {{.}}
  • {{end}}
{{end}} {{ if .IsLogOut }}

Please add an email address and/or passphrase so you can log in again later.

{{ else }}

Change your account settings here.

Username

{{ end }} {{if not .DisablePasswordAuth}}

Passphrase

- {{if and (not .HasPass) (not .IsLogOut)}}

Add a passphrase to easily log in to your account.

{{end}} + {{if and (not .HasPass) (not .IsLogOut)}}

Add a passphrase to easily log into your account.

{{end}} {{if .HasPass}}

Current passphrase

New passphrase

{{end}} {{if .IsLogOut}}{{end}}

Email

{{if and (not .Email) (not .IsLogOut)}}

Add your email to get:

  • No-passphrase login
  • Account recovery if you forget your passphrase
{{end}}
{{end}} {{ if .OauthSection }} {{ if .OauthAccounts }}

Linked Accounts

These are your linked external accounts.

{{ range $oauth_account := .OauthAccounts }}
{{ if $oauth_account.DisplayName}} {{ if $oauth_account.AllowDisconnect}} {{else}} {{.DisplayName}} {{end}} {{else}} {{ $oauth_account.Provider | title }} {{end}}
{{ end }}
{{ end }} {{ if or .OauthSlack .OauthWriteAs .OauthGitLab .OauthGeneric .OauthGitea }}

Link External Accounts

Connect additional accounts to enable logging in with those providers, instead of using your username and password.

{{ if .OauthWriteAs }} {{ end }} {{ if .OauthSlack }} {{ end }} {{ if .OauthGitLab }} {{ end }} {{ if .OauthGitea }} {{ end }} {{ if .OauthGeneric }} {{ end }}
{{ end }} {{ end }} {{ if and .OpenDeletion (not .IsAdmin) }}

Incinerator

Delete your account

Permanently erase all your data, with no way to recover it.

{{end}}
{{template "footer" .}} {{end}} diff --git a/templates/user/stats.tmpl b/templates/user/stats.tmpl index f3e3dce..b7f3322 100644 --- a/templates/user/stats.tmpl +++ b/templates/user/stats.tmpl @@ -1,63 +1,65 @@ {{define "stats"}} {{template "header" .}}
{{if .Silenced}} {{template "user-silenced"}} {{end}} {{template "collection-breadcrumbs" .}}

Stats

{{if .Collection}} {{template "collection-nav" (dict "Alias" .Collection.Alias "Path" .Path "SingleUser" .SingleUser)}} {{end}}

Stats for all time.

- - {{if .Federation}} -

Fediverse stats

+ + {{if or .Federation .EmailEnabled}} +

Subscribers

- + {{if .Federation}}{{end}} + {{if .EmailEnabled}}{{end}} - + {{if .Federation}}{{end}} + {{if .EmailEnabled}}{{end}}
FollowersFediverse FollowersEmail Subscribers
{{.APFollowers}}{{.APFollowers}}{{.EmailSubscribers}}
{{end}}

Top {{len .TopPosts}} posts

{{if not .Collection}}{{end}} {{range .TopPosts}} - + {{ if not $.Collection }}{{ end }} {{end}}
PostBlogTotal Views
{{if ne .Title.String ""}}{{.Title.String}}{{else}}{{.ID}}{{end}}{{if ne .DisplayTitle ""}}{{.DisplayTitle}}{{else}}{{.ID}}{{end}}{{if .Collection}}{{.Collection.Title}}{{else}}Draft{{end}}{{.ViewCount}}
{{template "footer" .}} {{end}} diff --git a/templates/user/subscribers.tmpl b/templates/user/subscribers.tmpl new file mode 100644 index 0000000..1e79ddb --- /dev/null +++ b/templates/user/subscribers.tmpl @@ -0,0 +1,98 @@ +{{define "subscribers"}} +{{template "header" .}} + + + +
+ {{if .Silenced}} + {{template "user-silenced"}} + {{end}} + + {{if .Collection.Collection}}{{template "collection-breadcrumbs" .}}{{end}} + +

Subscribers

+ {{if .Collection.Collection}} + {{template "collection-nav" .Collection}} + + + {{end}} + + {{if .Flashes -}} +
    + {{range .Flashes}}
  • {{.}}
  • {{end}} +
+ {{- end}} + + {{ if eq .Filter "fediverse" }} + + + + + + + {{if and (gt (len .Followers) 0) (not .FederationEnabled)}} +
+

Federation is disabled on this server, so followers won't receive any new posts.

+
+ {{end}} + {{ if gt (len .Followers) 0 }} + {{range $el := .Followers}} + + + + + {{end}} + {{ else }} + + + + {{ end }} +
UsernameSince
@{{.EstimatedHandle}}{{.CreatedFriendly}}
No followers yet.
+ {{ else }} + {{if or .CanEmailSub .EmailSubs}} + {{if not .CanEmailSub}} +
+

Email subscriptions are disabled on this server, so no new emails will be sent out.

+
+ {{end}} + {{if not .EmailSubsEnabled}} +
+

Email subscriptions are disabled. {{if .EmailSubs}}No new emails will be sent out.{{end}} To enable email subscriptions, turn the option on from your blog's Customize page.

+
+ {{end}} + + + + + + + {{ if .EmailSubs }} + {{range $el := .EmailSubs}} + + + + + {{end}} + {{ else }} + + + + {{ end }} +
Email AddressSince
{{.Email.String}}{{.SubscribedFriendly}}
No subscribers yet.
+ {{end}} + {{ end }} + +
+ +{{template "foot" .}} + +{{template "body-end" .}} +{{end}} diff --git a/unregisteredusers.go b/unregisteredusers.go index b6f6ce6..9473c89 100644 --- a/unregisteredusers.go +++ b/unregisteredusers.go @@ -1,148 +1,148 @@ /* - * Copyright © 2018-2019 A Bunch Tell LLC. + * Copyright © 2018-2019 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "encoding/json" "net/http" "github.com/writeas/impart" "github.com/writeas/web-core/log" ) func handleWebSignup(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) // Get params var ur userRegistration if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&ur) if err != nil { log.Error("Couldn't parse signup JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse signup form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&ur, r.PostForm) if err != nil { log.Error("Couldn't decode signup form request: %v\n", err) return ErrBadFormData } } ur.Web = true ur.Normalize = true to := "/" if app.cfg.App.SimpleNav { to = "/new" } if ur.InviteCode != "" { to = "/invite/" + ur.InviteCode } _, err := signupWithRegistration(app, ur, w, r) if err != nil { if err, ok := err.(impart.HTTPError); ok { session, _ := app.sessionStore.Get(r, cookieName) if session != nil { session.AddFlash(err.Message) session.Save(r, w) return impart.HTTPError{http.StatusFound, to} } } return err } return impart.HTTPError{http.StatusFound, to} } // { "username": "asdf" } // result: { code: 204 } func handleUsernameCheck(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) // Get params var d struct { Username string `json:"username"` } if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&d) if err != nil { log.Error("Couldn't decode username check: %v\n", err) return ErrBadFormData } } else { return impart.HTTPError{http.StatusNotAcceptable, "Must be JSON request"} } // Check if username is okay finalUsername := getSlug(d.Username, "") if finalUsername == "" { errMsg := "Invalid username" if d.Username != "" { // Username was provided, but didn't convert into valid latin characters errMsg += " - must have at least 2 letters or numbers" } return impart.HTTPError{http.StatusBadRequest, errMsg + "."} } if app.db.PostIDExists(finalUsername) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } var un string err := app.db.QueryRow("SELECT username FROM users WHERE username = ?", finalUsername).Scan(&un) switch { case err == sql.ErrNoRows: return impart.WriteSuccess(w, finalUsername, http.StatusOK) case err != nil: log.Error("Couldn't SELECT username: %v", err) return impart.HTTPError{http.StatusInternalServerError, "We messed up."} } // Username was found, so it's taken return impart.HTTPError{http.StatusConflict, "Username is already taken."} } func getValidUsername(app *App, reqName, prevName string) (string, *impart.HTTPError) { // Check if username is okay finalUsername := getSlug(reqName, "") if finalUsername == "" { errMsg := "Invalid username" if reqName != "" { // Username was provided, but didn't convert into valid latin characters errMsg += " - must have at least 2 letters or numbers" } return "", &impart.HTTPError{http.StatusBadRequest, errMsg + "."} } if finalUsername == prevName { return "", &impart.HTTPError{http.StatusNotModified, "Username unchanged."} } if app.db.PostIDExists(finalUsername) { return "", &impart.HTTPError{http.StatusConflict, "Username is already taken."} } var un string err := app.db.QueryRow("SELECT username FROM users WHERE username = ?", finalUsername).Scan(&un) switch { case err == sql.ErrNoRows: return finalUsername, nil case err != nil: log.Error("Couldn't SELECT username: %v", err) return "", &impart.HTTPError{http.StatusInternalServerError, "We messed up."} } // Username was found, so it's taken return "", &impart.HTTPError{http.StatusConflict, "Username is already taken."} } diff --git a/updates.go b/updates.go index 8ecccf6..e29e13b 100644 --- a/updates.go +++ b/updates.go @@ -1,131 +1,131 @@ /* - * Copyright © 2019-2020 A Bunch Tell LLC. + * Copyright © 2019-2020 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "github.com/writeas/web-core/log" - "io/ioutil" + "io" "net/http" "strings" "sync" "time" ) // updatesCacheTime is the default interval between cache updates for new // software versions const defaultUpdatesCacheTime = 12 * time.Hour // updatesCache holds data about current and new releases of the writefreely // software type updatesCache struct { mu sync.Mutex frequency time.Duration lastCheck time.Time latestVersion string currentVersion string checkError error } // CheckNow asks for the latest released version of writefreely and updates // the cache last checked time. If the version postdates the current 'latest' // the version value is replaced. func (uc *updatesCache) CheckNow() error { if debugging { log.Info("[update check] Checking for update now.") } uc.mu.Lock() defer uc.mu.Unlock() uc.lastCheck = time.Now() latestRemote, err := newVersionCheck() if err != nil { log.Error("[update check] Failed: %v", err) uc.checkError = err return err } if CompareSemver(latestRemote, uc.latestVersion) == 1 { uc.latestVersion = latestRemote } return nil } // AreAvailable updates the cache if the frequency duration has passed // then returns if the latest release is newer than the current running version. func (uc updatesCache) AreAvailable() bool { if time.Since(uc.lastCheck) > uc.frequency { uc.CheckNow() } return CompareSemver(uc.latestVersion, uc.currentVersion) == 1 } // AreAvailableNoCheck returns if the latest release is newer than the current // running version. func (uc updatesCache) AreAvailableNoCheck() bool { return CompareSemver(uc.latestVersion, uc.currentVersion) == 1 } // LatestVersion returns the latest stored version available. func (uc updatesCache) LatestVersion() string { return uc.latestVersion } func (uc updatesCache) ReleaseURL() string { return "https://writefreely.org/releases/" + uc.latestVersion } // ReleaseNotesURL returns the full URL to the blog.writefreely.org release notes // for the latest version as stored in the cache. func (uc updatesCache) ReleaseNotesURL() string { return wfReleaseNotesURL(uc.latestVersion) } func wfReleaseNotesURL(v string) string { ver := strings.TrimPrefix(v, "v") ver = strings.TrimSuffix(ver, ".0") // hack until go 1.12 in build/travis seg := strings.Split(ver, ".") return "https://blog.writefreely.org/version-" + strings.Join(seg, "-") } // newUpdatesCache returns an initialized updates cache func newUpdatesCache(expiry time.Duration) *updatesCache { cache := updatesCache{ frequency: expiry, currentVersion: "v" + softwareVer, } go cache.CheckNow() return &cache } // InitUpdates initializes the updates cache, if the config value is set // It uses the defaultUpdatesCacheTime for the cache expiry func (app *App) InitUpdates() { if app.cfg.App.UpdateChecks { app.updates = newUpdatesCache(defaultUpdatesCacheTime) } } func newVersionCheck() (string, error) { res, err := http.Get("https://version.writefreely.org") if debugging { log.Info("[update check] GET https://version.writefreely.org") } // TODO: return error if statusCode != OK if err == nil && res.StatusCode == http.StatusOK { defer res.Body.Close() - body, err := ioutil.ReadAll(res.Body) + body, err := io.ReadAll(res.Body) if err != nil { return "", err } return string(body), nil } return "", err } diff --git a/users.go b/users.go index cc6764f..449427d 100644 --- a/users.go +++ b/users.go @@ -1,136 +1,140 @@ /* - * Copyright © 2018-2019, 2021 A Bunch Tell LLC. + * Copyright © 2018-2019, 2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "time" "github.com/guregu/null/zero" "github.com/writeas/web-core/data" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/key" ) type UserStatus int const ( UserActive = iota UserSilenced ) type ( userCredentials struct { Alias string `json:"alias" schema:"alias"` Pass string `json:"pass" schema:"pass"` Email string `json:"email" schema:"email"` Web bool `json:"web" schema:"-"` To string `json:"-" schema:"to"` EmailLogin bool `json:"via_email" schema:"via_email"` } userRegistration struct { userCredentials InviteCode string `json:"invite_code" schema:"invite_code"` Honeypot string `json:"fullname" schema:"fullname"` Normalize bool `json:"normalize" schema:"normalize"` Signup bool `json:"signup" schema:"signup"` // Feature fields Description string `json:"description" schema:"description"` Monetization string `json:"monetization" schema:"monetization"` } // AuthUser contains information for a newly authenticated user (either // from signing up or logging in). AuthUser struct { AccessToken string `json:"access_token,omitempty"` Password string `json:"password,omitempty"` User *User `json:"user"` // Verbose user data Posts *[]PublicPost `json:"posts,omitempty"` Collections *[]Collection `json:"collections,omitempty"` } // User is a consistent user object in the database and all contexts (auth // and non-auth) in the API. User struct { ID int64 `json:"-"` Username string `json:"username"` HashedPass []byte `json:"-"` HasPass bool `json:"has_pass"` Email zero.String `json:"email"` Created time.Time `json:"created"` Status UserStatus `json:"status"` clearEmail string `json:"email"` } userMeStats struct { TotalCollections, TotalArticles, CollectionPosts uint64 } ExportUser struct { *User Collections *[]CollectionObj `json:"collections"` AnonymousPosts []PublicPost `json:"posts"` } PublicUser struct { Username string `json:"username"` } ) // EmailClear decrypts and returns the user's email, caching it in the user // object. func (u *User) EmailClear(keys *key.Keychain) string { if u.clearEmail != "" { return u.clearEmail } if u.Email.Valid && u.Email.String != "" { email, err := data.Decrypt(keys.EmailKey, []byte(u.Email.String)) if err != nil { log.Error("Error decrypting user email: %v", err) } else { u.clearEmail = string(email) return u.clearEmail } } return "" } func (u User) CreatedFriendly() string { /* // TODO: accept a locale in this method and use that for the format var loc monday.Locale = monday.LocaleEnUS return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc) */ return u.Created.Format("January 2, 2006, 3:04 PM") } // Cookie strips down an AuthUser to contain only information necessary for // cookies. func (u User) Cookie() *User { u.HashedPass = []byte{} return &u } func (u *User) IsAdmin() bool { // TODO: get this from database return u.ID == 1 } func (u *User) IsSilenced() bool { return u.Status&UserSilenced != 0 } + +func (u *User) IsEmailSubscriber(app *App, collID int64) bool { + return app.db.IsEmailSubscriber("", u.ID, collID) +} diff --git a/webfinger.go b/webfinger.go index 6c1341f..0c52f72 100644 --- a/webfinger.go +++ b/webfinger.go @@ -1,145 +1,145 @@ /* - * Copyright © 2018-2021 A Bunch Tell LLC. + * Copyright © 2018-2021 Musing Studio LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "encoding/json" - "io/ioutil" + "io" "net/http" "strings" "github.com/writeas/go-webfinger" "github.com/writeas/impart" "github.com/writeas/web-core/log" "github.com/writefreely/writefreely/config" ) type wfResolver struct { db *datastore cfg *config.Config } var wfUserNotFoundErr = impart.HTTPError{http.StatusNotFound, "User not found."} func (wfr wfResolver) FindUser(username string, host, requestHost string, r []webfinger.Rel) (*webfinger.Resource, error) { var c *Collection var err error if username == host { c = instanceColl } else if wfr.cfg.App.SingleUser { c, err = wfr.db.GetCollectionByID(1) } else { c, err = wfr.db.GetCollection(username) } if err != nil { log.Error("Unable to get blog: %v", err) return nil, err } c.hostName = wfr.cfg.App.Host if !c.IsInstanceColl() { silenced, err := wfr.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("webfinger find user: check is silenced: %v", err) return nil, err } if silenced { return nil, wfUserNotFoundErr } } if wfr.cfg.App.SingleUser { // Ensure handle matches user-chosen one on single-user blogs if username != c.Alias { log.Info("Username '%s' is not handle '%s'", username, c.Alias) return nil, wfUserNotFoundErr } } // Only return information if site has federation enabled. // TODO: enable two levels of federation? Unlisted or Public on timelines? if !wfr.cfg.App.Federation { return nil, wfUserNotFoundErr } res := webfinger.Resource{ Subject: "acct:" + username + "@" + host, Aliases: []string{ c.CanonicalURL(), c.FederatedAccount(), }, Links: []webfinger.Link{ { HRef: c.CanonicalURL(), Type: "text/html", Rel: "https://webfinger.net/rel/profile-page", }, { HRef: c.FederatedAccount(), Type: "application/activity+json", Rel: "self", }, }, } return &res, nil } func (wfr wfResolver) DummyUser(username string, hostname string, r []webfinger.Rel) (*webfinger.Resource, error) { return nil, wfUserNotFoundErr } func (wfr wfResolver) IsNotFoundError(err error) bool { return err == wfUserNotFoundErr } // RemoteLookup looks up a user by handle at a remote server // and returns the actor URL func RemoteLookup(handle string) string { handle = strings.TrimLeft(handle, "@") // let's take the server part of the handle parts := strings.Split(handle, "@") resp, err := http.Get("https://" + parts[1] + "/.well-known/webfinger?resource=acct:" + handle) if err != nil { log.Error("Error on webfinger request: %v", err) return "" } - body, err := ioutil.ReadAll(resp.Body) + body, err := io.ReadAll(resp.Body) if err != nil { log.Error("Error on webfinger response: %v", err) return "" } var result webfinger.Resource err = json.Unmarshal(body, &result) if err != nil { log.Error("Unable to parse webfinger response: %v", err) return "" } var href string // iterate over webfinger links and find the one with // a self "rel" for _, link := range result.Links { if link.Rel == "self" { href = link.HRef } } // if we didn't find it with the above then // try using aliases if href == "" { // take the last alias because mastodon has the // https://instance.tld/@user first which // doesn't work as an href href = result.Aliases[len(result.Aliases)-1] } return href }