diff --git a/account.go b/account.go index ae8e21c..3adb7f7 100644 --- a/account.go +++ b/account.go @@ -1,1196 +1,1196 @@ /* * Copyright © 2018-2020 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "encoding/json" "fmt" "html/template" "net/http" "regexp" "strings" "sync" "time" "github.com/gorilla/mux" "github.com/gorilla/sessions" "github.com/guregu/null/zero" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/data" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" ) type ( userSettings struct { Username string `schema:"username" json:"username"` Email string `schema:"email" json:"email"` NewPass string `schema:"new-pass" json:"new_pass"` OldPass string `schema:"current-pass" json:"current_pass"` IsLogOut bool `schema:"logout" json:"logout"` } UserPage struct { page.StaticPage PageTitle string Separator template.HTML IsAdmin bool CanInvite bool } ) func NewUserPage(app *App, r *http.Request, u *User, title string, flashes []string) *UserPage { up := &UserPage{ StaticPage: pageForReq(app, r), PageTitle: title, } up.Username = u.Username up.Flashes = flashes up.Path = r.URL.Path up.IsAdmin = u.IsAdmin() up.CanInvite = canUserInvite(app.cfg, up.IsAdmin) return up } func canUserInvite(cfg *config.Config, isAdmin bool) bool { return cfg.App.UserInvites != "" && (isAdmin || cfg.App.UserInvites != "admin") } func (up *UserPage) SetMessaging(u *User) { // up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID) } const ( loginAttemptExpiration = 3 * time.Second ) var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead") func apiSignup(app *App, w http.ResponseWriter, r *http.Request) error { _, err := signup(app, w, r) return err } func signup(app *App, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { if app.cfg.App.DisablePasswordAuth { err := ErrDisabledPasswordAuth return nil, err } reqJSON := IsJSON(r) // Get params var ur userRegistration if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&ur) if err != nil { log.Error("Couldn't parse signup JSON request: %v\n", err) return nil, ErrBadJSON } } else { // Check if user is already logged in u := getUserSession(app, r) if u != nil { return &AuthUser{User: u}, nil } err := r.ParseForm() if err != nil { log.Error("Couldn't parse signup form request: %v\n", err) return nil, ErrBadFormData } err = app.formDecoder.Decode(&ur, r.PostForm) if err != nil { log.Error("Couldn't decode signup form request: %v\n", err) return nil, ErrBadFormData } } return signupWithRegistration(app, ur, w, r) } func signupWithRegistration(app *App, signup userRegistration, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { reqJSON := IsJSON(r) // Validate required params (alias) if signup.Alias == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."} } if signup.Pass == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."} } var desiredUsername string if signup.Normalize { // With this option we simply conform the username to what we expect // without complaining. Since they might've done something funny, like // enter: write.as/Way Out There, we'll use their raw input for the new // collection name and sanitize for the slug / username. desiredUsername = signup.Alias signup.Alias = getSlug(signup.Alias, "") } if !author.IsValidUsername(app.cfg, signup.Alias) { // Ensure the username is syntactically correct. return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."} } // Handle empty optional params // TODO: remove this var createdWithPass := true hashedPass, err := auth.HashPass([]byte(signup.Pass)) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Create struct to insert u := &User{ Username: signup.Alias, HashedPass: hashedPass, HasPass: createdWithPass, Email: prepareUserEmail(signup.Email, app.keys.EmailKey), Created: time.Now().Truncate(time.Second).UTC(), } // Create actual user if err := app.db.CreateUser(app.cfg, u, desiredUsername); err != nil { return nil, err } // Log invite if needed if signup.InviteCode != "" { err = app.db.CreateInvitedUser(signup.InviteCode, u.ID) if err != nil { return nil, err } } // Add back unencrypted data for response if signup.Email != "" { u.Email.String = signup.Email } resUser := &AuthUser{ User: u, } if !createdWithPass { resUser.Password = signup.Pass } title := signup.Alias if signup.Normalize { title = desiredUsername } resUser.Collections = &[]Collection{ { Alias: signup.Alias, Title: title, }, } var token string if reqJSON && !signup.Web { token, err = app.db.GetAccessToken(u.ID) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser.AccessToken = token } else { session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. // Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144 log.Error("Session: %v; ignoring", err) } session.Values[cookieUserVal] = resUser.User.Cookie() err = session.Save(r, w) if err != nil { log.Error("Couldn't save session: %v", err) return nil, err } } if reqJSON { return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated) } return resUser, nil } func viewLogout(app *App, w http.ResponseWriter, r *http.Request) error { session, err := app.sessionStore.Get(r, cookieName) if err != nil { return ErrInternalCookieSession } // Ensure user has an email or password set before they go, so they don't // lose access to their account. val := session.Values[cookieUserVal] var u = &User{} var ok bool if u, ok = val.(*User); !ok { log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values) err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } u, err = app.db.GetUserByID(u.ID) if err != nil && err != ErrUserNotFound { return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."} } session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } func handleAPILogout(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } t := auth.GetToken(accessToken) if len(t) == 0 { return ErrNoAccessToken } err := app.db.DeleteToken(t) if err != nil { return err } return impart.HTTPError{Status: http.StatusNoContent} } func viewLogin(app *App, w http.ResponseWriter, r *http.Request) error { var earlyError string oneTimeToken := r.FormValue("with") if oneTimeToken != "" { log.Info("Calling login with one-time token.") err := login(app, w, r) if err != nil { log.Info("Received error: %v", err) earlyError = fmt.Sprintf("%s", err) } } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session; ignoring: %v", err) } p := &struct { page.StaticPage To string Message template.HTML Flashes []template.HTML LoginUsername string OauthSlack bool OauthWriteAs bool OauthGitlab bool GitlabDisplayName string OauthGeneric bool OauthGenericDisplayName string OauthGitea bool GiteaDisplayName string }{ pageForReq(app, r), r.FormValue("to"), template.HTML(""), []template.HTML{}, getTempInfo(app, "login-user", r, w), app.Config().SlackOauth.ClientID != "", app.Config().WriteAsOauth.ClientID != "", app.Config().GitlabOauth.ClientID != "", config.OrDefaultString(app.Config().GenericOauth.DisplayName, genericOauthDisplayName), app.Config().GenericOauth.ClientID != "", config.OrDefaultString(app.Config().GitlabOauth.DisplayName, gitlabDisplayName), app.Config().GiteaOauth.ClientID != "", config.OrDefaultString(app.Config().GiteaOauth.DisplayName, giteaDisplayName), } if earlyError != "" { p.Flashes = append(p.Flashes, template.HTML(earlyError)) } // Display any error messages flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = pages["login.tmpl"].ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render login: %v", err) return err } return nil } func webLogin(app *App, w http.ResponseWriter, r *http.Request) error { err := login(app, w, r) if err != nil { username := r.FormValue("alias") // Login request was unsuccessful; save the error in the session and redirect them if err, ok := err.(impart.HTTPError); ok { session, _ := app.sessionStore.Get(r, cookieName) if session != nil { session.AddFlash(err.Message) session.Save(r, w) } if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 { // Retain fixed username recommendation for the login form username = m[1] } } // Pass along certain information saveTempInfo(app, "login-user", username, r, w) // Retain post-login URL if one was given redirectTo := "/login" postLoginRedirect := r.FormValue("to") if postLoginRedirect != "" { redirectTo += "?to=" + postLoginRedirect } log.Error("Unable to login: %v", err) return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo} } return nil } var loginAttemptUsers = sync.Map{} func login(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) oneTimeToken := r.FormValue("with") verbose := r.FormValue("all") == "true" || r.FormValue("verbose") == "1" || r.FormValue("verbose") == "true" || (reqJSON && oneTimeToken != "") redirectTo := r.FormValue("to") if redirectTo == "" { if app.cfg.App.SingleUser { redirectTo = "/me/new" } else { redirectTo = "/" } } var u *User var err error var signin userCredentials if app.cfg.App.DisablePasswordAuth { err := ErrDisabledPasswordAuth return err } // Log in with one-time token if one is given if oneTimeToken != "" { log.Info("Login: Logging user in via token.") userID := app.db.GetUserID(oneTimeToken) if userID == -1 { log.Error("Login: Got user -1 from token") err := ErrBadAccessToken err.Message = "Expired or invalid login code." return err } log.Info("Login: Found user %d.", userID) u, err = app.db.GetUserByID(userID) if err != nil { log.Error("Unable to fetch user on one-time token login: %v", err) return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."} } log.Info("Login: Got user via token") } else { // Get params if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&signin) if err != nil { log.Error("Couldn't parse signin JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse signin form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&signin, r.PostForm) if err != nil { log.Error("Couldn't decode signin form request: %v\n", err) return ErrBadFormData } } log.Info("Login: Attempting login for '%s'", signin.Alias) // Validate required params (all) if signin.Alias == "" { msg := "Parameter `alias` required." if signin.Web { msg = "A username is required." } return impart.HTTPError{http.StatusBadRequest, msg} } if !signin.EmailLogin && signin.Pass == "" { msg := "Parameter `pass` required." if signin.Web { msg = "A password is required." } return impart.HTTPError{http.StatusBadRequest, msg} } // Prevent excessive login attempts on the same account // Skip this check in dev environment if !app.cfg.Server.Dev { now := time.Now() attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration)) if att { if attemptExpTime, ok := attemptExp.(time.Time); ok { if attemptExpTime.After(now) { // This user attempted previously, and the period hasn't expired yet return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."} } else { // This user attempted previously, but the time expired; free up space loginAttemptUsers.Delete(signin.Alias) } } else { log.Error("Unable to cast expiration to time") } } } // Retrieve password u, err = app.db.GetUserForAuth(signin.Alias) if err != nil { log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err) if strings.IndexAny(signin.Alias, "@") > 0 { log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message) return ErrUserNotFoundEmail } return err } // Authenticate if u.Email.String == "" { // User has no email set, so check if they haven't added a password, either, // so we can return a more helpful error message. if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass { log.Info("Tried logging in to %s, but no password or email.", signin.Alias) return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."} } } if len(u.HashedPass) == 0 { return impart.HTTPError{http.StatusUnauthorized, "This user never set a password. Perhaps try logging in via OAuth?"} } if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } } if reqJSON && !signin.Web { var token string if r.Header.Get("User-Agent") == "" { // Get last created token when User-Agent is empty token = app.db.FetchLastAccessToken(u.ID) if token == "" { token, err = app.db.GetAccessToken(u.ID) } } else { token, err = app.db.GetAccessToken(u.ID) } if err != nil { log.Error("Login: Unable to create access token: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser := getVerboseAuthUser(app, token, u, verbose) return impart.WriteSuccess(w, resUser, http.StatusOK) } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Login: Session: %v; ignoring", err) } // Remove unwanted data session.Values[cookieUserVal] = u.Cookie() err = session.Save(r, w) if err != nil { log.Error("Login: Couldn't save session: %v", err) // TODO: return error } // Send success if reqJSON { return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK) } log.Info("Login: Redirecting to %s", redirectTo) w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func getVerboseAuthUser(app *App, token string, u *User, verbose bool) *AuthUser { resUser := &AuthUser{ AccessToken: token, User: u, } // Fetch verbose user data if requested if verbose { posts, err := app.db.GetUserPosts(u) if err != nil { log.Error("Login: Unable to get user posts: %v", err) } colls, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("Login: Unable to get user collections: %v", err) } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { // TODO: correct error meesage log.Error("Login: Unable to get user collections: %v", err) } resUser.Posts = posts resUser.Collections = colls resUser.User.HasPass = passIsSet } return resUser } func viewExportOptions(app *App, u *User, w http.ResponseWriter, r *http.Request) error { // Fetch extra user data p := NewUserPage(app, r, u, "Export", nil) showUserPage(w, "export", p) return nil } func viewExportPosts(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var filename string var u = &User{} reqJSON := IsJSON(r) if reqJSON { // Use given Authorization header accessToken := r.Header.Get("Authorization") if accessToken == "" { return nil, filename, ErrNoAccessToken } userID := app.db.GetUserID(accessToken) if userID == -1 { return nil, filename, ErrBadAccessToken } var err error u, err = app.db.GetUserByID(userID) if err != nil { return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."} } } else { // Use user cookie session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Session: %v; ignoring", err) } val := session.Values[cookieUserVal] var ok bool if u, ok = val.(*User); !ok { return nil, filename, ErrNotLoggedIn } } filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") // Fetch data we're exporting var err error var data []byte posts, err := app.db.GetUserPosts(u) if err != nil { return data, filename, err } // Export as CSV if strings.HasSuffix(r.URL.Path, ".csv") { data = exportPostsCSV(app.cfg.App.Host, u, posts) return data, filename, err } if strings.HasSuffix(r.URL.Path, ".zip") { data = exportPostsZip(u, posts) return data, filename, err } if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(posts, "", "\t") } else { data, err = json.Marshal(posts) } return data, filename, err } func viewExportFull(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var err error filename := "" u := getUserSession(app, r) if u == nil { return nil, filename, ErrNotLoggedIn } filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") exportUser := compileFullExport(app, u) var data []byte if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(exportUser, "", "\t") } else { data, err = json.Marshal(exportUser) } return data, filename, err } func viewMeAPI(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) uObj := struct { ID int64 `json:"id,omitempty"` Username string `json:"username,omitempty"` }{} var err error if reqJSON { _, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization")) if err != nil { return err } } else { u := getUserSession(app, r) if u == nil { return impart.WriteSuccess(w, uObj, http.StatusOK) } uObj.Username = u.Username } return impart.WriteSuccess(w, uObj, http.StatusOK) } func viewMyPostsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) if !reqJSON { return ErrBadRequestedType } var err error p := GetPostsCache(u.ID) if p == nil { userPostsCache.Lock() if userPostsCache.users[u.ID].ready == nil { userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})} userPostsCache.Unlock() p, err = app.db.GetUserPosts(u) if err != nil { return err } CachePosts(u.ID, p) } else { userPostsCache.Unlock() <-userPostsCache.users[u.ID].ready p = GetPostsCache(u.ID) } } return impart.WriteSuccess(w, p, http.StatusOK) } func viewMyCollectionsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) if !reqJSON { return ErrBadRequestedType } p, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { return err } return impart.WriteSuccess(w, p, http.StatusOK) } func viewArticles(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p, err := app.db.GetAnonymousPosts(u) if err != nil { log.Error("unable to fetch anon posts: %v", err) } // nil-out AnonymousPosts slice for easy detection in the template if p != nil && len(*p) == 0 { p = nil } f, err := getSessionFlashes(app, w, r, nil) if err != nil { log.Error("unable to fetch flashes: %v", err) } c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { log.Error("view articles: %v", err) } d := struct { *UserPage AnonymousPosts *[]PublicPost Collections *[]Collection Silenced bool }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f), AnonymousPosts: p, Collections: c, Silenced: silenced, } d.UserPage.SetMessaging(u) w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT") showUserPage(w, "articles", d) return nil } func viewCollections(app *App, u *User, w http.ResponseWriter, r *http.Request) error { c, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) return fmt.Errorf("No collections") } f, _ := getSessionFlashes(app, w, r, nil) uc, _ := app.db.GetUserCollectionCount(u.ID) // TODO: handle any errors silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { log.Error("view collections %v", err) return fmt.Errorf("view collections: %v", err) } d := struct { *UserPage Collections *[]Collection UsedCollections, TotalCollections int NewBlogsDisabled bool Silenced bool }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f), Collections: c, UsedCollections: int(uc), NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc), Silenced: silenced, } d.UserPage.SetMessaging(u) showUserPage(w, "collections", d) return nil } func viewEditCollection(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) c, err := app.db.GetCollection(vars["collection"]) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } // Add collection properties - c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer") + c.MonetizationPointer = app.db.GetCollectionAttribute(c.ID, "monetization_pointer") silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { log.Error("view edit collection %v", err) return fmt.Errorf("view edit collection: %v", err) } flashes, _ := getSessionFlashes(app, w, r, nil) obj := struct { *UserPage *Collection Silenced bool }{ UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes), Collection: c, Silenced: silenced, } showUserPage(w, "collection", obj) return nil } func updateSettings(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) var s userSettings var u *User var sess *sessions.Session var err error if reqJSON { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } u, err = app.db.GetAPIUser(accessToken) if err != nil { return ErrBadAccessToken } decoder := json.NewDecoder(r.Body) err := decoder.Decode(&s) if err != nil { log.Error("Couldn't parse settings JSON request: %v\n", err) return ErrBadJSON } // Prevent all username updates // TODO: support changing username via JSON API request s.Username = "" } else { u, sess = getUserAndSession(app, r) if u == nil { return ErrNotLoggedIn } err := r.ParseForm() if err != nil { log.Error("Couldn't parse settings form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&s, r.PostForm) if err != nil { log.Error("Couldn't decode settings form request: %v\n", err) return ErrBadFormData } } // Do update postUpdateReturn := r.FormValue("return") redirectTo := "/me/settings" if s.IsLogOut { redirectTo += "?logout=1" } else if postUpdateReturn != "" { redirectTo = postUpdateReturn } // Only do updates on values we need if s.Username != "" && s.Username == u.Username { // Username hasn't actually changed; blank it out s.Username = "" } err = app.db.ChangeSettings(app, u, &s) if err != nil { if reqJSON { return err } if err, ok := err.(impart.HTTPError); ok { addSessionFlash(app, w, r, err.Message, nil) } } else { // Successful update. if reqJSON { return impart.WriteSuccess(w, u, http.StatusOK) } if s.IsLogOut { redirectTo = "/me/logout" } else { sess.Values[cookieUserVal] = u.Cookie() addSessionFlash(app, w, r, "Account updated.", nil) } } w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func updatePassphrase(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } curPass := r.FormValue("current") newPass := r.FormValue("new") // Ensure a new password is given (always required) if newPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide a new password."} } userID, sudo := app.db.GetUserIDPrivilege(accessToken) if userID == -1 { return ErrBadAccessToken } // Ensure a current password is given if the access token doesn't have sudo // privileges. if !sudo && curPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide current password."} } // Hash the new password hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Do update err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass) if err != nil { return err } return impart.WriteSuccess(w, struct{}{}, http.StatusOK) } func viewStats(app *App, u *User, w http.ResponseWriter, r *http.Request) error { var c *Collection var err error vars := mux.Vars(r) alias := vars["collection"] if alias != "" { c, err = app.db.GetCollection(alias) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } } topPosts, err := app.db.GetTopPosts(u, alias) if err != nil { log.Error("Unable to get top posts: %v", err) return err } flashes, _ := getSessionFlashes(app, w, r, nil) titleStats := "" if c != nil { titleStats = c.DisplayTitle() + " " } silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { log.Error("view stats: %v", err) return err } obj := struct { *UserPage VisitsBlog string Collection *Collection TopPosts *[]PublicPost APFollowers int Silenced bool }{ UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes), VisitsBlog: alias, Collection: c, TopPosts: topPosts, Silenced: silenced, } if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(c) if err != nil { return err } obj.APFollowers = len(*folls) } showUserPage(w, "stats", obj) return nil } func viewSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error { fullUser, err := app.db.GetUserByID(u.ID) if err != nil { log.Error("Unable to get user for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { log.Error("Unable to get isUserPassSet for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } flashes, _ := getSessionFlashes(app, w, r, nil) enableOauthSlack := app.Config().SlackOauth.ClientID != "" enableOauthWriteAs := app.Config().WriteAsOauth.ClientID != "" enableOauthGitLab := app.Config().GitlabOauth.ClientID != "" enableOauthGeneric := app.Config().GenericOauth.ClientID != "" enableOauthGitea := app.Config().GiteaOauth.ClientID != "" oauthAccounts, err := app.db.GetOauthAccounts(r.Context(), u.ID) if err != nil { log.Error("Unable to get oauth accounts for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } for idx, oauthAccount := range oauthAccounts { switch oauthAccount.Provider { case "slack": enableOauthSlack = false case "write.as": enableOauthWriteAs = false case "gitlab": enableOauthGitLab = false case "generic": oauthAccounts[idx].DisplayName = app.Config().GenericOauth.DisplayName oauthAccounts[idx].AllowDisconnect = app.Config().GenericOauth.AllowDisconnect enableOauthGeneric = false case "gitea": enableOauthGitea = false } } displayOauthSection := enableOauthSlack || enableOauthWriteAs || enableOauthGitLab || enableOauthGeneric || enableOauthGitea || len(oauthAccounts) > 0 obj := struct { *UserPage Email string HasPass bool IsLogOut bool Silenced bool OauthSection bool OauthAccounts []oauthAccountInfo OauthSlack bool OauthWriteAs bool OauthGitLab bool GitLabDisplayName string OauthGeneric bool OauthGenericDisplayName string OauthGitea bool GiteaDisplayName string }{ UserPage: NewUserPage(app, r, u, "Account Settings", flashes), Email: fullUser.EmailClear(app.keys), HasPass: passIsSet, IsLogOut: r.FormValue("logout") == "1", Silenced: fullUser.IsSilenced(), OauthSection: displayOauthSection, OauthAccounts: oauthAccounts, OauthSlack: enableOauthSlack, OauthWriteAs: enableOauthWriteAs, OauthGitLab: enableOauthGitLab, GitLabDisplayName: config.OrDefaultString(app.Config().GitlabOauth.DisplayName, gitlabDisplayName), OauthGeneric: enableOauthGeneric, OauthGenericDisplayName: config.OrDefaultString(app.Config().GenericOauth.DisplayName, genericOauthDisplayName), OauthGitea: enableOauthGitea, GiteaDisplayName: config.OrDefaultString(app.Config().GiteaOauth.DisplayName, giteaDisplayName), } showUserPage(w, "settings", obj) return nil } func saveTempInfo(app *App, key, val string, r *http.Request, w http.ResponseWriter) error { session, err := app.sessionStore.Get(r, "t") if err != nil { return ErrInternalCookieSession } session.Values[key] = val err = session.Save(r, w) if err != nil { log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err) } return err } func getTempInfo(app *App, key string, r *http.Request, w http.ResponseWriter) string { session, err := app.sessionStore.Get(r, "t") if err != nil { return "" } // Get the information var s = "" var ok bool if s, ok = session.Values[key].(string); !ok { return "" } // Delete cookie session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't erase temp data for key %s: %v", key, err) } // Return value return s } func removeOauth(app *App, u *User, w http.ResponseWriter, r *http.Request) error { provider := r.FormValue("provider") clientID := r.FormValue("client_id") remoteUserID := r.FormValue("remote_user_id") err := app.db.RemoveOauth(r.Context(), u.ID, provider, clientID, remoteUserID) if err != nil { return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()} } return impart.HTTPError{Status: http.StatusFound, Message: "/me/settings"} } func prepareUserEmail(input string, emailKey []byte) zero.String { email := zero.NewString("", input != "") if len(input) > 0 { encEmail, err := data.Encrypt(emailKey, input) if err != nil { log.Error("Unable to encrypt email: %s\n", err) } else { email.String = string(encEmail) } } return email } diff --git a/admin.go b/admin.go index 457b384..a0d10eb 100644 --- a/admin.go +++ b/admin.go @@ -1,637 +1,638 @@ /* * Copyright © 2018-2020 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "fmt" "net/http" "runtime" "strconv" "strings" "time" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/log" "github.com/writeas/web-core/passgen" "github.com/writeas/writefreely/appstats" "github.com/writeas/writefreely/config" ) var ( appStartTime = time.Now() sysStatus systemStatus ) const adminUsersPerPage = 30 type systemStatus struct { Uptime string NumGoroutine int // General statistics. MemAllocated string // bytes allocated and still in use MemTotal string // bytes allocated (even if freed) MemSys string // bytes obtained from system (sum of XxxSys below) Lookups uint64 // number of pointer lookups MemMallocs uint64 // number of mallocs MemFrees uint64 // number of frees // Main allocation heap statistics. HeapAlloc string // bytes allocated and still in use HeapSys string // bytes obtained from system HeapIdle string // bytes in idle spans HeapInuse string // bytes in non-idle span HeapReleased string // bytes released to the OS HeapObjects uint64 // total number of allocated objects // Low-level fixed-size structure allocator statistics. // Inuse is bytes used now. // Sys is bytes obtained from system. StackInuse string // bootstrap stacks StackSys string MSpanInuse string // mspan structures MSpanSys string MCacheInuse string // mcache structures MCacheSys string BuckHashSys string // profiling bucket hash table GCSys string // GC metadata OtherSys string // other system allocations // Garbage collector statistics. NextGC string // next run in HeapAlloc time (bytes) LastGC string // last run in absolute time (ns) PauseTotalNs string PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256] NumGC uint32 } type inspectedCollection struct { CollectionObj Followers int LastPost string } type instanceContent struct { ID string Type string Title sql.NullString Content string Updated time.Time } type AdminPage struct { UpdateAvailable bool } func NewAdminPage(app *App) *AdminPage { ap := &AdminPage{} if app.updates != nil { ap.UpdateAvailable = app.updates.AreAvailableNoCheck() } return ap } func (c instanceContent) UpdatedFriendly() string { /* // TODO: accept a locale in this method and use that for the format var loc monday.Locale = monday.LocaleEnUS return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc) */ return c.Updated.Format("January 2, 2006, 3:04 PM") } func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Message string UsersCount, CollectionsCount, PostsCount int64 }{ UserPage: NewUserPage(app, r, u, "Admin", nil), AdminPage: NewAdminPage(app), Message: r.FormValue("m"), } // Get user stats p.UsersCount = app.db.GetAllUsersCount() var err error p.CollectionsCount, err = app.db.GetTotalCollections() if err != nil { return err } p.PostsCount, err = app.db.GetTotalPosts() if err != nil { return err } showUserPage(w, "admin", p) return nil } func handleViewAdminMonitor(app *App, u *User, w http.ResponseWriter, r *http.Request) error { updateAppStats() p := struct { *UserPage *AdminPage SysStatus systemStatus Config config.AppCfg Message, ConfigMessage string }{ UserPage: NewUserPage(app, r, u, "Admin", nil), AdminPage: NewAdminPage(app), SysStatus: sysStatus, Config: app.cfg.App, Message: r.FormValue("m"), ConfigMessage: r.FormValue("cm"), } showUserPage(w, "monitor", p) return nil } func handleViewAdminSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Config config.AppCfg Message, ConfigMessage string }{ UserPage: NewUserPage(app, r, u, "Admin", nil), AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), ConfigMessage: r.FormValue("cm"), } showUserPage(w, "app-settings", p) return nil } func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Config config.AppCfg Message string Users *[]User CurPage int TotalUsers int64 TotalPages []int }{ UserPage: NewUserPage(app, r, u, "Users", nil), AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), } p.TotalUsers = app.db.GetAllUsersCount() ttlPages := p.TotalUsers / adminUsersPerPage p.TotalPages = []int{} for i := 1; i <= int(ttlPages); i++ { p.TotalPages = append(p.TotalPages, i) } var err error p.CurPage, err = strconv.Atoi(r.FormValue("p")) if err != nil || p.CurPage < 1 { p.CurPage = 1 } else if p.CurPage > int(ttlPages) { p.CurPage = int(ttlPages) } p.Users, err = app.db.GetAllUsers(uint(p.CurPage)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)} } showUserPage(w, "users", p) return nil } func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } p := struct { *UserPage *AdminPage Config config.AppCfg Message string User *User Colls []inspectedCollection LastPost string NewPassword string TotalPosts int64 ClearEmail string }{ AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), Colls: []inspectedCollection{}, } var err error p.User, err = app.db.GetUserForAuth(username) if err != nil { if err == ErrUserNotFound { return err } log.Error("Could not get user: %v", err) return impart.HTTPError{http.StatusInternalServerError, err.Error()} } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { if strings.HasPrefix(flash, "SUCCESS: ") { p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ") p.ClearEmail = p.User.EmailClear(app.keys) } } p.UserPage = NewUserPage(app, r, u, p.User.Username, nil) p.TotalPosts = app.db.GetUserPostsCount(p.User.ID) lp, err := app.db.GetUserLastPostTime(p.User.ID) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)} } if lp != nil { p.LastPost = lp.Format("January 2, 2006, 3:04 PM") } colls, err := app.db.GetCollections(p.User, app.cfg.App.Host) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)} } for _, c := range *colls { ic := inspectedCollection{ CollectionObj: CollectionObj{Collection: c}, } if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(&c) if err == nil { // TODO: handle error here (at least log it) ic.Followers = len(*folls) } } app.db.GetPostsCount(&ic.CollectionObj, true) lp, err := app.db.GetCollectionLastPostTime(c.ID) if err != nil { log.Error("Didn't get last post time for collection %d: %v", c.ID, err) } if lp != nil { ic.LastPost = lp.Format("January 2, 2006, 3:04 PM") } p.Colls = append(p.Colls, ic) } showUserPage(w, "view-user", p) return nil } func handleAdminToggleUserStatus(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } user, err := app.db.GetUserForAuth(username) if err != nil { log.Error("failed to get user: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)} } if user.IsSilenced() { err = app.db.SetUserStatus(user.ID, UserActive) } else { err = app.db.SetUserStatus(user.ID, UserSilenced) } if err != nil { log.Error("toggle user silenced: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)} } return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)} } func handleAdminResetUserPass(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } // Generate new random password since none supplied pass := passgen.NewWordish() hashedPass, err := auth.HashPass([]byte(pass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)} } userIDVal := r.FormValue("user") log.Info("ADMIN: Changing user %s password", userIDVal) id, err := strconv.Atoi(userIDVal) if err != nil { return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)} } err = app.db.ChangePassphrase(int64(id), true, "", hashedPass) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)} } log.Info("ADMIN: Successfully changed.") addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil) return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)} } func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage *AdminPage Config config.AppCfg Message string Pages []*instanceContent }{ UserPage: NewUserPage(app, r, u, "Pages", nil), AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), } var err error p.Pages, err = app.db.GetInstancePages() if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)} } // Add in default pages var hasAbout, hasPrivacy bool for i, c := range p.Pages { if hasAbout && hasPrivacy { break } if c.ID == "about" { hasAbout = true if !c.Title.Valid { p.Pages[i].Title = defaultAboutTitle(app.cfg) } } else if c.ID == "privacy" { hasPrivacy = true if !c.Title.Valid { p.Pages[i].Title = defaultPrivacyTitle() } } } if !hasAbout { p.Pages = append(p.Pages, &instanceContent{ ID: "about", Title: defaultAboutTitle(app.cfg), Content: defaultAboutPage(app.cfg), Updated: defaultPageUpdatedTime, }) } if !hasPrivacy { p.Pages = append(p.Pages, &instanceContent{ ID: "privacy", Title: defaultPrivacyTitle(), Content: defaultPrivacyPolicy(app.cfg), Updated: defaultPageUpdatedTime, }) } showUserPage(w, "pages", p) return nil } func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] if slug == "" { return impart.HTTPError{http.StatusFound, "/admin/pages"} } p := struct { *UserPage *AdminPage Config config.AppCfg Message string Banner *instanceContent Content *instanceContent }{ AdminPage: NewAdminPage(app), Config: app.cfg.App, Message: r.FormValue("m"), } var err error // Get pre-defined pages, or select slug if slug == "about" { p.Content, err = getAboutPage(app) } else if slug == "privacy" { p.Content, err = getPrivacyPage(app) } else if slug == "landing" { p.Banner, err = getLandingBanner(app) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)} } p.Content, err = getLandingBody(app) p.Content.ID = "landing" } else if slug == "reader" { p.Content, err = getReaderSection(app) } else { p.Content, err = app.db.GetDynamicContent(slug) } if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)} } title := "New page" if p.Content != nil { title = "Edit " + p.Content.ID } else { p.Content = &instanceContent{} } p.UserPage = NewUserPage(app, r, u, title, nil) showUserPage(w, "view-page", p) return nil } func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) id := vars["page"] // Validate if id != "about" && id != "privacy" && id != "landing" && id != "reader" { return impart.HTTPError{http.StatusNotFound, "No such page."} } var err error m := "" if id == "landing" { // Handle special landing page err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section") if err != nil { m = "?m=" + err.Error() return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section") } else if id == "reader" { // Update sections with titles err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section") } else { // Update page err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page") } if err != nil { m = "?m=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error { apper.App().cfg.App.SiteName = r.FormValue("site_name") apper.App().cfg.App.SiteDesc = r.FormValue("site_desc") apper.App().cfg.App.Landing = r.FormValue("landing") apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on" mul, err := strconv.Atoi(r.FormValue("min_username_len")) if err == nil { apper.App().cfg.App.MinUsernameLen = mul } mb, err := strconv.Atoi(r.FormValue("max_blogs")) if err == nil { apper.App().cfg.App.MaxBlogs = mb } apper.App().cfg.App.Federation = r.FormValue("federation") == "on" apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on" + apper.App().cfg.App.Monetization = r.FormValue("monetization") == "on" apper.App().cfg.App.Private = r.FormValue("private") == "on" apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on" if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil { log.Info("Initializing local timeline...") initLocalTimeline(apper.App()) } apper.App().cfg.App.UserInvites = r.FormValue("user_invites") if apper.App().cfg.App.UserInvites == "none" { apper.App().cfg.App.UserInvites = "" } apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility") m := "?cm=Configuration+saved." err = apper.SaveConfig(apper.App().cfg) if err != nil { m = "?cm=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin/settings" + m + "#config"} } func updateAppStats() { sysStatus.Uptime = appstats.TimeSincePro(appStartTime) m := new(runtime.MemStats) runtime.ReadMemStats(m) sysStatus.NumGoroutine = runtime.NumGoroutine() sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc)) sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc)) sysStatus.MemSys = appstats.FileSize(int64(m.Sys)) sysStatus.Lookups = m.Lookups sysStatus.MemMallocs = m.Mallocs sysStatus.MemFrees = m.Frees sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc)) sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys)) sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle)) sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse)) sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased)) sysStatus.HeapObjects = m.HeapObjects sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse)) sysStatus.StackSys = appstats.FileSize(int64(m.StackSys)) sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse)) sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys)) sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse)) sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys)) sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys)) sysStatus.GCSys = appstats.FileSize(int64(m.GCSys)) sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys)) sysStatus.NextGC = appstats.FileSize(int64(m.NextGC)) sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000) sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000) sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000) sysStatus.NumGC = m.NumGC } func adminResetPassword(app *App, u *User, newPass string) error { hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)} } err = app.db.ChangePassphrase(u.ID, true, "", hashedPass) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)} } return nil } func handleViewAdminUpdates(app *App, u *User, w http.ResponseWriter, r *http.Request) error { check := r.URL.Query().Get("check") if check == "now" && app.cfg.App.UpdateChecks { app.updates.CheckNow() } p := struct { *UserPage *AdminPage CurReleaseNotesURL string LastChecked string LastChecked8601 string LatestVersion string LatestReleaseURL string LatestReleaseNotesURL string CheckFailed bool }{ UserPage: NewUserPage(app, r, u, "Updates", nil), AdminPage: NewAdminPage(app), } p.CurReleaseNotesURL = wfReleaseNotesURL(p.Version) if app.cfg.App.UpdateChecks { p.LastChecked = app.updates.lastCheck.Format("January 2, 2006, 3:04 PM") p.LastChecked8601 = app.updates.lastCheck.Format("2006-01-02T15:04:05Z") p.LatestVersion = app.updates.LatestVersion() p.LatestReleaseURL = app.updates.ReleaseURL() p.LatestReleaseNotesURL = app.updates.ReleaseNotesURL() p.UpdateAvailable = app.updates.AreAvailable() p.CheckFailed = app.updates.checkError != nil } showUserPage(w, "app-updates", p) return nil } diff --git a/collections.go b/collections.go index ad9cd87..f2958fd 100644 --- a/collections.go +++ b/collections.go @@ -1,1160 +1,1160 @@ /* * Copyright © 2018-2020 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "encoding/json" "fmt" "html/template" "math" "net/http" "net/url" "regexp" "strconv" "strings" "unicode" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/activitystreams" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/bots" "github.com/writeas/web-core/log" waposts "github.com/writeas/web-core/posts" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" ) type ( // TODO: add Direction to db // TODO: add Language to db Collection struct { ID int64 `datastore:"id" json:"-"` Alias string `datastore:"alias" schema:"alias" json:"alias"` Title string `datastore:"title" schema:"title" json:"title"` Description string `datastore:"description" schema:"description" json:"description"` Direction string `schema:"dir" json:"dir,omitempty"` Language string `schema:"lang" json:"lang,omitempty"` StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"` Script string `datastore:"script" schema:"script" json:"script,omitempty"` Signature string `datastore:"post_signature" schema:"signature" json:"-"` Public bool `datastore:"public" json:"public"` Visibility collVisibility `datastore:"private" json:"-"` Format string `datastore:"format" json:"format,omitempty"` Views int64 `json:"views"` OwnerID int64 `datastore:"owner_id" json:"-"` PublicOwner bool `datastore:"public_owner" json:"-"` URL string `json:"url,omitempty"` - Monetization string `json:"monetization_pointer,omitempty"` + MonetizationPointer string `json:"monetization_pointer,omitempty"` db *datastore hostName string } CollectionObj struct { Collection TotalPosts int `json:"total_posts"` Owner *User `json:"owner,omitempty"` Posts *[]PublicPost `json:"posts,omitempty"` Format *CollectionFormat } DisplayCollection struct { *CollectionObj Prefix string IsTopLevel bool CurrentPage int TotalPages int Silenced bool } SubmittedCollection struct { // Data used for updating a given collection ID int64 OwnerID uint64 // Form helpers PreferURL string `schema:"prefer_url" json:"prefer_url"` Privacy int `schema:"privacy" json:"privacy"` Pass string `schema:"password" json:"password"` MathJax bool `schema:"mathjax" json:"mathjax"` Handle string `schema:"handle" json:"handle"` // Actual collection values updated in the DB Alias *string `schema:"alias" json:"alias"` Title *string `schema:"title" json:"title"` Description *string `schema:"description" json:"description"` StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"` Script *sql.NullString `schema:"script" json:"script"` Signature *sql.NullString `schema:"signature" json:"signature"` Monetization *string `schema:"monetization_pointer" json:"monetization_pointer"` Visibility *int `schema:"visibility" json:"public"` Format *sql.NullString `schema:"format" json:"format"` } CollectionFormat struct { Format string } collectionReq struct { // Information about the collection request itself prefix, alias, domain string isCustomDomain bool // User-related fields isCollOwner bool } ) func (sc *SubmittedCollection) FediverseHandle() string { if sc.Handle == "" { return apCustomHandleDefault } return getSlug(sc.Handle, "") } // collVisibility represents the visibility level for the collection. type collVisibility int // Visibility levels. Values are bitmasks, stored in the database as // decimal numbers. If adding types, append them to this list. If removing, // replace the desired visibility with a new value. const CollUnlisted collVisibility = 0 const ( CollPublic collVisibility = 1 << iota CollPrivate CollProtected ) var collVisibilityStrings = map[string]collVisibility{ "unlisted": CollUnlisted, "public": CollPublic, "private": CollPrivate, "protected": CollProtected, } func defaultVisibility(cfg *config.Config) collVisibility { vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility] if !ok { vis = CollUnlisted } return vis } func (cf *CollectionFormat) Ascending() bool { return cf.Format == "novel" } func (cf *CollectionFormat) ShowDates() bool { return cf.Format == "blog" } func (cf *CollectionFormat) PostsPerPage() int { if cf.Format == "novel" { return postsPerPage } return postsPerPage } // Valid returns whether or not a format value is valid. func (cf *CollectionFormat) Valid() bool { return cf.Format == "blog" || cf.Format == "novel" || cf.Format == "notebook" } // NewFormat creates a new CollectionFormat object from the Collection. func (c *Collection) NewFormat() *CollectionFormat { cf := &CollectionFormat{Format: c.Format} // Fill in default format if cf.Format == "" { cf.Format = "blog" } return cf } func (c *Collection) IsUnlisted() bool { return c.Visibility == 0 } func (c *Collection) IsPrivate() bool { return c.Visibility&CollPrivate != 0 } func (c *Collection) IsProtected() bool { return c.Visibility&CollProtected != 0 } func (c *Collection) IsPublic() bool { return c.Visibility&CollPublic != 0 } func (c *Collection) FriendlyVisibility() string { if c.IsPrivate() { return "Private" } if c.IsPublic() { return "Public" } if c.IsProtected() { return "Password-protected" } return "Unlisted" } func (c *Collection) ShowFooterBranding() bool { // TODO: implement this setting return true } // CanonicalURL returns a fully-qualified URL to the collection. func (c *Collection) CanonicalURL() string { return c.RedirectingCanonicalURL(false) } func (c *Collection) DisplayCanonicalURL() string { us := c.CanonicalURL() u, err := url.Parse(us) if err != nil { return us } p := u.Path if p == "/" { p = "" } return u.Hostname() + p } func (c *Collection) RedirectingCanonicalURL(isRedir bool) string { if c.hostName == "" { // If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writeas/writefreely/issues/new?template=bug_report.md") } if isSingleUser { return c.hostName + "/" } return fmt.Sprintf("%s/%s/", c.hostName, c.Alias) } // PrevPageURL provides a full URL for the previous page of collection posts, // returning a /page/N result for pages >1 func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string { u := "" if n == 2 { // Previous page is 1; no need for /page/ prefix if prefix == "" { u = "/" } // Else leave off trailing slash } else { u = fmt.Sprintf("/page/%d", n-1) } if tl { return u } return "/" + prefix + c.Alias + u } // NextPageURL provides a full URL for the next page of collection posts func (c *Collection) NextPageURL(prefix string, n int, tl bool) string { if tl { return fmt.Sprintf("/page/%d", n+1) } return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1) } func (c *Collection) DisplayTitle() string { if c.Title != "" { return c.Title } return c.Alias } func (c *Collection) StyleSheetDisplay() template.CSS { return template.CSS(c.StyleSheet) } // ForPublic modifies the Collection for public consumption, such as via // the API. func (c *Collection) ForPublic() { c.URL = c.CanonicalURL() } var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person { accountRoot := c.FederatedAccount() p := activitystreams.NewPerson(accountRoot) p.URL = c.CanonicalURL() uname := c.Alias p.PreferredUsername = uname p.Name = c.DisplayTitle() p.Summary = c.Description if p.Name != "" { if av := c.AvatarURL(); av != "" { p.Icon = activitystreams.Image{ Type: "Image", MediaType: "image/png", URL: av, } } } collID := c.ID if len(ids) > 0 { collID = ids[0] } pub, priv := c.db.GetAPActorKeys(collID) if pub != nil { p.AddPubKey(pub) p.SetPrivKey(priv) } return p } func (c *Collection) AvatarURL() string { fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0])) if !isAvatarChar(fl) { return "" } return c.hostName + "/img/avatars/" + fl + ".png" } func (c *Collection) FederatedAPIBase() string { return c.hostName + "/" } func (c *Collection) FederatedAccount() string { accountUser := c.Alias return c.FederatedAPIBase() + "api/collections/" + accountUser } func (c *Collection) RenderMathJax() bool { return c.db.CollectionHasAttribute(c.ID, "render_mathjax") } func newCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) alias := r.FormValue("alias") title := r.FormValue("title") var missingParams, accessToken string var u *User c := struct { Alias string `json:"alias" schema:"alias"` Title string `json:"title" schema:"title"` Web bool `json:"web" schema:"web"` }{} if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err := decoder.Decode(&c) if err != nil { log.Error("Couldn't parse post update JSON request: %v\n", err) return ErrBadJSON } } else { // TODO: move form parsing to formDecoder c.Alias = alias c.Title = title } if c.Alias == "" { if c.Title != "" { // If only a title was given, just use it to generate the alias. c.Alias = getSlug(c.Title, "") } else { missingParams += "`alias` " } } if c.Title == "" { missingParams += "`title` " } if missingParams != "" { return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)} } var userID int64 var err error if reqJSON && !c.Web { accessToken = r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } userID = app.db.GetUserID(accessToken) if userID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } userID = u.ID } silenced, err := app.db.IsUserSilenced(userID) if err != nil { log.Error("new collection: %v", err) return ErrInternalGeneral } if silenced { return ErrUserSilenced } if !author.IsValidUsername(app.cfg, c.Alias) { return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."} } coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID) if err != nil { // TODO: handle this return err } res := &CollectionObj{Collection: *coll} if reqJSON { return impart.WriteSuccess(w, res, http.StatusCreated) } redirectTo := "/me/c/" // TODO: redirect to pad when necessary return impart.HTTPError{http.StatusFound, redirectTo} } func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) { accessToken := r.Header.Get("Authorization") var userID int64 = -1 if accessToken != "" { userID = app.db.GetUserID(accessToken) } isCollOwner := userID == c.OwnerID if c.IsPrivate() && !isCollOwner { // Collection is private, but user isn't authenticated return -1, ErrCollectionNotFound } if c.IsProtected() { // TODO: check access token return -1, ErrCollectionUnauthorizedRead } return userID, nil } // fetchCollection handles the API endpoint for retrieving collection data. func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error { accept := r.Header.Get("Accept") if strings.Contains(accept, "application/activity+json") { return handleFetchCollectionActivities(app, w, r) } vars := mux.Vars(r) alias := vars["alias"] // TODO: move this logic into a common getCollection function // Get base Collection data c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Redirect users who aren't requesting JSON reqJSON := IsJSON(r) if !reqJSON { return impart.HTTPError{http.StatusFound, c.CanonicalURL()} } // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Fetch extra data about the Collection res := &CollectionObj{Collection: *c} if c.PublicOwner { u, err := app.db.GetUserByID(res.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } else { res.Owner = u } } // TODO: check status for silenced app.db.GetPostsCount(res, isCollOwner) // Strip non-public information res.Collection.ForPublic() return impart.WriteSuccess(w, res, http.StatusOK) } // fetchCollectionPosts handles an API endpoint for retrieving a collection's // posts. func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) alias := vars["alias"] c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Get page page := 1 if p := r.FormValue("page"); p != "" { pInt, _ := strconv.Atoi(p) if pInt > 0 { page = pInt } } posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false) if err != nil { return err } coll := &CollectionObj{Collection: *c, Posts: posts} app.db.GetPostsCount(coll, isCollOwner) // Strip non-public information coll.Collection.ForPublic() // Transform post bodies if needed if r.FormValue("body") == "html" { for _, p := range *coll.Posts { p.Content = waposts.ApplyMarkdown([]byte(p.Content)) } } return impart.WriteSuccess(w, coll, http.StatusOK) } type CollectionPage struct { page.StaticPage *DisplayCollection IsCustomDomain bool IsWelcome bool IsOwner bool CanPin bool Username string Monetization string Collections *[]Collection PinnedPosts *[]PublicPost IsAdmin bool CanInvite bool } func NewCollectionObj(c *Collection) *CollectionObj { return &CollectionObj{ Collection: *c, Format: c.NewFormat(), } } func (c *CollectionObj) ScriptDisplay() template.JS { return template.JS(c.Script) } var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$") func (c *CollectionObj) ExternalScripts() []template.URL { scripts := []template.URL{} if c.Script == "" { return scripts } matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1) for _, m := range matches { scripts = append(scripts, template.URL(strings.TrimSpace(m[1]))) } return scripts } func (c *CollectionObj) CanShowScript() bool { return false } func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error { cr.prefix = vars["prefix"] cr.alias = vars["collection"] // Normalize the URL, redirecting user to consistent post URL if cr.alias != strings.ToLower(cr.alias) { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))} } return nil } // processCollectionPermissions checks the permissions for the given // collectionReq, returning a Collection if access is granted; otherwise this // renders any necessary collection pages, for example, if requesting a custom // domain that doesn't yet have a collection associated, or if a collection // requires a password. In either case, this will return nil, nil -- thus both // values should ALWAYS be checked to determine whether or not to continue. func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) { // Display collection if this is a collection var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(cr.alias) } // TODO: verify we don't reveal the existence of a private collection with redirection if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { if cr.isCustomDomain { // User is on the site from a custom domain //tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r)) //if tErr != nil { //log.Error("Unable to render 404-domain page: %v", err) //} return nil, nil } if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen { // Alias is within post ID range, so just be sure this isn't a post if app.db.PostIDExists(cr.alias) { // TODO: use StatusFound for vanity post URLs when we implement them return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias} } } // Redirect if necessary newAlias := app.db.GetCollectionRedirect(cr.alias) if newAlias != "" { return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"} } } } return nil, err } c.hostName = app.cfg.App.Host // Update CollectionRequest to reflect owner status cr.isCollOwner = u != nil && u.ID == c.OwnerID // Check permissions if !cr.isCollOwner { if c.IsPrivate() { return nil, ErrCollectionNotFound } else if c.IsProtected() { uname := "" if u != nil { uname = u.Username } // TODO: move this to all permission checks? suspended, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("process protected collection permissions: %v", err) return nil, err } if suspended { return nil, ErrCollectionNotFound } // See if we've authorized this collection authd := isAuthorizedForCollection(app, c.Alias, r) if !authd { p := struct { page.StaticPage *CollectionObj Username string Next string Flashes []template.HTML }{ StaticPage: pageForReq(app, r), CollectionObj: &CollectionObj{Collection: *c}, Username: uname, Next: r.FormValue("g"), Flashes: []template.HTML{}, } // Get owner information p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p) if err != nil { log.Error("Unable to render password-collection: %v", err) return nil, err } return nil, nil } } } return c, nil } func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) { u := getUserSession(app, r) return u, nil } func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection { coll := &DisplayCollection{ CollectionObj: NewCollectionObj(c), CurrentPage: page, Prefix: cr.prefix, IsTopLevel: isSingleUser, } c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner) return coll } func getCollectionPage(vars map[string]string) int { page := 1 var p int p, _ = strconv.Atoi(vars["page"]) if p > 0 { page = p } return page } // handleViewCollection displays the requested Collection func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } c.hostName = app.cfg.App.Host silenced, err := app.db.IsUserSilenced(c.OwnerID) if err != nil { log.Error("view collection: %v", err) return ErrInternalGeneral } // Serve ActivityStreams data now, if requested if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { ac := c.PersonObject() ac.Context = []interface{}{activitystreams.Namespace} setCacheControl(w, apCacheTime) return impart.RenderActivityJSON(w, ac, http.StatusOK) } // Fetch extra data about the Collection // TODO: refactor out this logic, shared in collection.go:fetchCollection() coll := newDisplayCollection(c, cr, page) coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage()))) if coll.TotalPages > 0 && page > coll.TotalPages { redirURL := fmt.Sprintf("/page/%d", coll.TotalPages) if !app.cfg.App.SingleUser { redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL) } return impart.HTTPError{http.StatusFound, redirURL} } coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false) // Serve collection displayPage := CollectionPage{ DisplayCollection: coll, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, IsWelcome: r.FormValue("greeting") != "", } displayPage.IsAdmin = u != nil && u.IsAdmin() displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin) var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } isOwner := owner != nil if !isOwner { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } } if !isOwner && silenced { return ErrCollectionNotFound } displayPage.Silenced = isOwner && silenced displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner) displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer") collTmpl := "collection" if app.cfg.App.Chorus { collTmpl = "chorus-collection" } err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage) if err != nil { log.Error("Unable to render collection index: %v", err) } // Update collection view count go func() { // Don't update if owner is viewing the collection. if u != nil && u.ID == coll.OwnerID { return } // Only update for human views if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) { return } _, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID) if err != nil { log.Error("Unable to update collections count: %v", err) } }() return err } func handleViewMention(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) handle := vars["handle"] remoteUser, err := app.db.GetProfilePageFromHandle(app, handle) if err != nil || remoteUser == "" { log.Error("Couldn't find user %s: %v", handle, err) return ErrRemoteUserNotFound } return impart.HTTPError{Status: http.StatusFound, Message: remoteUser} } func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) tag := vars["tag"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } coll := newDisplayCollection(c, cr, page) coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner) if coll.Posts != nil && len(*coll.Posts) == 0 { return ErrCollectionPageNotFound } // Serve collection displayPage := struct { CollectionPage Tag string }{ CollectionPage: CollectionPage{ DisplayCollection: coll, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, }, Tag: tag, } var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } isOwner := owner != nil if !isOwner { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } if owner.IsSilenced() { return ErrCollectionNotFound } } displayPage.Silenced = owner != nil && owner.IsSilenced() displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner) displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer") err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage) if err != nil { log.Error("Unable to render collection tag page: %v", err) } return nil } func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } // Normalize the URL, redirecting user to consistent post URL loc := fmt.Sprintf("/%s", slug) if !app.cfg.App.SingleUser { loc = fmt.Sprintf("/%s/%s", cr.alias, slug) } return impart.HTTPError{http.StatusFound, loc} } func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r) vars := mux.Vars(r) collAlias := vars["alias"] isWeb := r.FormValue("web") == "1" u := &User{} if reqJSON && !isWeb { // Ensure an access token was given accessToken := r.Header.Get("Authorization") u.ID = app.db.GetUserID(accessToken) if u.ID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } } silenced, err := app.db.IsUserSilenced(u.ID) if err != nil { log.Error("existing collection: %v", err) return ErrInternalGeneral } if silenced { return ErrUserSilenced } if r.Method == "DELETE" { err := app.db.DeleteCollection(collAlias, u.ID) if err != nil { // TODO: if not HTTPError, report error to admin log.Error("Unable to delete collection: %s", err) return err } addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil) return impart.HTTPError{Status: http.StatusNoContent} } c := SubmittedCollection{OwnerID: uint64(u.ID)} if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err = decoder.Decode(&c) if err != nil { log.Error("Couldn't parse collection update JSON request: %v\n", err) return ErrBadJSON } } else { err = r.ParseForm() if err != nil { log.Error("Couldn't parse collection update form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&c, r.PostForm) if err != nil { log.Error("Couldn't decode collection update form request: %v\n", err) return ErrBadFormData } } err = app.db.UpdateCollection(&c, collAlias) if err != nil { if err, ok := err.(impart.HTTPError); ok { if reqJSON { return err } addSessionFlash(app, w, r, err.Message, nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } else { log.Error("Couldn't update collection: %v\n", err) return err } } if reqJSON { return impart.WriteSuccess(w, struct { }{}, http.StatusOK) } addSessionFlash(app, w, r, "Blog updated!", nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } // collectionAliasFromReq takes a request and returns the collection alias // if it can be ascertained, as well as whether or not the collection uses a // custom domain. func collectionAliasFromReq(r *http.Request) string { vars := mux.Vars(r) alias := vars["subdomain"] isSubdomain := alias != "" if !isSubdomain { // Fall back to write.as/{collection} since this isn't a custom domain alias = vars["collection"] } return alias } func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error { var readReq struct { Alias string `schema:"alias" json:"alias"` Pass string `schema:"password" json:"password"` Next string `schema:"to" json:"to"` } // Get params if impart.ReqJSON(r) { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&readReq) if err != nil { log.Error("Couldn't parse readReq JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse readReq form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&readReq, r.PostForm) if err != nil { log.Error("Couldn't decode readReq form request: %v\n", err) return ErrBadFormData } } if readReq.Alias == "" { return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."} } if readReq.Pass == "" { return impart.HTTPError{http.StatusBadRequest, "Please supply a password."} } var collHashedPass []byte err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass) if err != nil { if err == sql.ErrNoRows { log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias) return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."} } return err } if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } // Success; set cookie session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { session.Values[readReq.Alias] = true err = session.Save(r, w) if err != nil { log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err) } } next := "/" + readReq.Next if !app.cfg.App.SingleUser { next = "/" + readReq.Alias + next } return impart.HTTPError{http.StatusFound, next} } func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool { authd := false session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { _, authd = session.Values[alias] } return authd } diff --git a/config/config.go b/config/config.go index 9ff13f8..39e461b 100644 --- a/config/config.go +++ b/config/config.go @@ -1,266 +1,268 @@ /* - * Copyright © 2018-2019 A Bunch Tell LLC. + * Copyright © 2018-2020 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ // Package config holds and assists in the configuration of a writefreely instance. package config import ( "strings" "gopkg.in/ini.v1" ) const ( // FileName is the default configuration file name FileName = "config.ini" UserNormal UserType = "user" UserAdmin = "admin" ) type ( UserType string // ServerCfg holds values that affect how the HTTP server runs ServerCfg struct { HiddenHost string `ini:"hidden_host"` Port int `ini:"port"` Bind string `ini:"bind"` TLSCertPath string `ini:"tls_cert_path"` TLSKeyPath string `ini:"tls_key_path"` Autocert bool `ini:"autocert"` TemplatesParentDir string `ini:"templates_parent_dir"` StaticParentDir string `ini:"static_parent_dir"` PagesParentDir string `ini:"pages_parent_dir"` KeysParentDir string `ini:"keys_parent_dir"` HashSeed string `ini:"hash_seed"` GopherPort int `ini:"gopher_port"` Dev bool `ini:"-"` } // DatabaseCfg holds values that determine how the application connects to a datastore DatabaseCfg struct { Type string `ini:"type"` FileName string `ini:"filename"` User string `ini:"username"` Password string `ini:"password"` Database string `ini:"database"` Host string `ini:"host"` Port int `ini:"port"` TLS bool `ini:"tls"` } WriteAsOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` AuthLocation string `ini:"auth_location"` TokenLocation string `ini:"token_location"` InspectLocation string `ini:"inspect_location"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } GitlabOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` Host string `ini:"host"` DisplayName string `ini:"display_name"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } SlackOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` TeamID string `ini:"team_id"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } GenericOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` Host string `ini:"host"` DisplayName string `ini:"display_name"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` TokenEndpoint string `ini:"token_endpoint"` InspectEndpoint string `ini:"inspect_endpoint"` AuthEndpoint string `ini:"auth_endpoint"` AllowDisconnect bool `ini:"allow_disconnect"` } GiteaOauthCfg struct { ClientID string `ini:"client_id"` ClientSecret string `ini:"client_secret"` Host string `ini:"host"` DisplayName string `ini:"display_name"` CallbackProxy string `ini:"callback_proxy"` CallbackProxyAPI string `ini:"callback_proxy_api"` } // AppCfg holds values that affect how the application functions AppCfg struct { SiteName string `ini:"site_name"` SiteDesc string `ini:"site_description"` Host string `ini:"host"` // Site appearance Theme string `ini:"theme"` Editor string `ini:"editor"` JSDisabled bool `ini:"disable_js"` WebFonts bool `ini:"webfonts"` Landing string `ini:"landing"` SimpleNav bool `ini:"simple_nav"` WFModesty bool `ini:"wf_modesty"` // Site functionality Chorus bool `ini:"chorus"` Forest bool `ini:"forest"` // The admin cares about the forest, not the trees. Hide unnecessary technical info. DisableDrafts bool `ini:"disable_drafts"` // Users SingleUser bool `ini:"single_user"` OpenRegistration bool `ini:"open_registration"` MinUsernameLen int `ini:"min_username_len"` MaxBlogs int `ini:"max_blogs"` + // Options for public instances // Federation - Federation bool `ini:"federation"` - PublicStats bool `ini:"public_stats"` + Federation bool `ini:"federation"` + PublicStats bool `ini:"public_stats"` + Monetization bool `ini:"monetization"` // Access Private bool `ini:"private"` // Additional functions LocalTimeline bool `ini:"local_timeline"` UserInvites string `ini:"user_invites"` // Defaults DefaultVisibility string `ini:"default_visibility"` // Check for Updates UpdateChecks bool `ini:"update_checks"` // Disable password authentication if use only Oauth DisablePasswordAuth bool `ini:"disable_password_auth"` } // Config holds the complete configuration for running a writefreely instance Config struct { Server ServerCfg `ini:"server"` Database DatabaseCfg `ini:"database"` App AppCfg `ini:"app"` SlackOauth SlackOauthCfg `ini:"oauth.slack"` WriteAsOauth WriteAsOauthCfg `ini:"oauth.writeas"` GitlabOauth GitlabOauthCfg `ini:"oauth.gitlab"` GenericOauth GenericOauthCfg `ini:"oauth.generic"` GiteaOauth GiteaOauthCfg `ini:"oauth.gitea"` } ) // New creates a new Config with sane defaults func New() *Config { c := &Config{ Server: ServerCfg{ Port: 8080, Bind: "localhost", /* IPV6 support when not using localhost? */ }, App: AppCfg{ Host: "http://localhost:8080", Theme: "write", WebFonts: true, SingleUser: true, MinUsernameLen: 3, MaxBlogs: 1, Federation: true, PublicStats: true, }, } c.UseMySQL(true) return c } // UseMySQL resets the Config's Database to use default values for a MySQL setup. func (cfg *Config) UseMySQL(fresh bool) { cfg.Database.Type = "mysql" if fresh { cfg.Database.Host = "localhost" cfg.Database.Port = 3306 } } // UseSQLite resets the Config's Database to use default values for a SQLite setup. func (cfg *Config) UseSQLite(fresh bool) { cfg.Database.Type = "sqlite3" if fresh { cfg.Database.FileName = "writefreely.db" } } // IsSecureStandalone returns whether or not the application is running as a // standalone server with TLS enabled. func (cfg *Config) IsSecureStandalone() bool { return cfg.Server.Port == 443 && cfg.Server.TLSCertPath != "" && cfg.Server.TLSKeyPath != "" } func (ac *AppCfg) LandingPath() string { if !strings.HasPrefix(ac.Landing, "/") { return "/" + ac.Landing } return ac.Landing } func (ac AppCfg) SignupPath() string { if !ac.OpenRegistration { return "" } if ac.Chorus || ac.Private || (ac.Landing != "" && ac.Landing != "/") { return "/signup" } return "/" } // Load reads the given configuration file, then parses and returns it as a Config. func Load(fname string) (*Config, error) { if fname == "" { fname = FileName } cfg, err := ini.Load(fname) if err != nil { return nil, err } // Parse INI file uc := &Config{} err = cfg.MapTo(uc) if err != nil { return nil, err } return uc, nil } // Save writes the given Config to the given file. func Save(uc *Config, fname string) error { cfg := ini.Empty() err := ini.ReflectFrom(cfg, uc) if err != nil { return err } if fname == "" { fname = FileName } return cfg.SaveTo(fname) } diff --git a/templates/user/admin/app-settings.tmpl b/templates/user/admin/app-settings.tmpl index 4bd87da..9142dcc 100644 --- a/templates/user/admin/app-settings.tmpl +++ b/templates/user/admin/app-settings.tmpl @@ -1,161 +1,168 @@ {{define "app-settings"}} {{template "header" .}}
{{.ConfigMessage}}
{{end}}Still have questions? Read more details in the configuration docs.
Upgrade for $40 / year to edit.
{{end}} {{define "collection"}} {{template "header" .}}