No OneTemporary
Actions

Size

1 MB

Subscribers

None

View Options

This file is larger than 256 KB, so syntax highlighting was skipped.

	diff --git a/.github/dependabot.yml b/.github/dependabot.yml
	index d1a7fc2..c4deaa9 100644
	--- a/.github/dependabot.yml
	+++ b/.github/dependabot.yml
	@@ -1,7 +1,15 @@
	version: 2
	updates:
	- package-ecosystem: "gomod" # See documentation for possible values
	directory: "/" # Location of package manifests
	open-pull-requests-limit: 50
	schedule:
	interval: "monthly"
	+ - package-ecosystem: "github-actions"
	+ directory: "/"
	+ schedule:
	+ interval: "daily"
	+ - package-ecosystem: "docker"
	+ directory: "/Dockerfile"
	+ schedule:
	+ interval: "daily"
	diff --git a/.github/workflows/docker-publish.yml b/.github/workflows/docker-publish.yml
	new file mode 100644
	index 0000000..d3bc432
	--- /dev/null
	+++ b/.github/workflows/docker-publish.yml
	@@ -0,0 +1,61 @@
	+name: Build container image, publish as Github-package
	+
	+# This workflow uses actions that are not certified by GitHub.
	+# They are provided by a third-party and are governed by
	+# separate terms of service, privacy policy, and support
	+# documentation.
	+
	+on:
	+ push:
	+ branches: [ main, develop ]
	+ # Publish semver tags as releases.
	+ tags:
	+ - 'v..*'
	+
	+env:
	+ # Use docker.io for Docker Hub if empty
	+ REGISTRY: ghcr.io
	+ # github.repository as <account>/<repo>
	+ IMAGE_NAME: ${{ github.repository }}
	+
	+jobs:
	+ build:
	+
	+ runs-on: ubuntu-latest
	+ permissions:
	+ contents: read
	+ packages: write
	+
	+ steps:
	+ - name: Checkout repository
	+ uses: actions/checkout@v3
	+
	+ # Login against a Docker registry except on PR
	+ # https://github.com/docker/login-action
	+ - name: Log into registry ${{ env.REGISTRY }}
	+ if: github.event_name != 'pull_request'
	+ uses: docker/login-action@v2.1.0
	+ with:
	+ registry: ${{ env.REGISTRY }}
	+ username: ${{ github.actor }}
	+ password: ${{ secrets.GITHUB_TOKEN }}
	+
	+ # Extract metadata (tags, labels) for Docker
	+ # https://github.com/docker/metadata-action
	+ - name: Extract Docker metadata
	+ id: meta
	+ uses: docker/metadata-action@v4.1.1
	+ with:
	+ images: \|
	+ ghcr.io/${{ github.repository }}
	+ flavor: latest=true
	+
	+ # Build and push Docker image with Buildx (don't push on PR)
	+ # https://github.com/docker/build-push-action
	+ - name: Build and push Docker images
	+ uses: docker/build-push-action@v3.2.0
	+ with:
	+ context: .
	+ push: ${{ github.event_name != 'pull_request' }}
	+ tags: ${{ steps.meta.outputs.tags }}
	+ labels: ${{ steps.meta.outputs.labels }}
	diff --git a/.gitignore b/.gitignore
	index f33ebb0..45bf28e 100644
	--- a/.gitignore
	+++ b/.gitignore
	@@ -1,11 +1,12 @@
	node_modules
	*~
	*.swp
	*.swo

	+static/local/custom.css
	build
	tmp
	*.ini
	*.db

	bindata.go
	diff --git a/Dockerfile b/Dockerfile
	index 31a890d..38cd2c7 100644
	--- a/Dockerfile
	+++ b/Dockerfile
	@@ -1,37 +1,36 @@
	# Build image
	FROM golang:1.15-alpine as build

	-RUN apk add --update nodejs nodejs-npm make g++ git
	+RUN apk add --update nodejs npm make g++ git
	RUN npm install -g less less-plugin-clean-css
	-RUN go get -u github.com/go-bindata/go-bindata/...

	RUN mkdir -p /go/src/github.com/writefreely/writefreely
	WORKDIR /go/src/github.com/writefreely/writefreely

	COPY . .

	ENV GO111MODULE=on

	RUN make build \
	&& make ui
	RUN mkdir /stage && \
	cp -R /go/bin \
	/go/src/github.com/writefreely/writefreely/templates \
	/go/src/github.com/writefreely/writefreely/static \
	/go/src/github.com/writefreely/writefreely/pages \
	/go/src/github.com/writefreely/writefreely/keys \
	/go/src/github.com/writefreely/writefreely/cmd \
	/stage

	# Final image
	-FROM alpine:3.12
	+FROM alpine:3

	RUN apk add --no-cache openssl ca-certificates
	COPY --from=build --chown=daemon:daemon /stage /go

	WORKDIR /go
	VOLUME /go/keys
	EXPOSE 8080
	USER daemon

	ENTRYPOINT ["cmd/writefreely/writefreely"]
	diff --git a/Makefile b/Makefile
	index 10d04b2..6f59a18 100644
	--- a/Makefile
	+++ b/Makefile
	@@ -1,171 +1,148 @@
	GITREV=`git describe \| cut -c 2-`
	LDFLAGS=-ldflags="-X 'github.com/writefreely/writefreely.softwareVer=$(GITREV)'"

	GOCMD=go
	GOINSTALL=$(GOCMD) install $(LDFLAGS)
	GOBUILD=$(GOCMD) build $(LDFLAGS)
	GOTEST=$(GOCMD) test $(LDFLAGS)
	GOGET=$(GOCMD) get
	BINARY_NAME=writefreely
	BUILDPATH=build/$(BINARY_NAME)
	DOCKERCMD=docker
	IMAGE_NAME=writeas/writefreely
	TMPBIN=./tmp

	all : build

	-ci: ci-assets deps
	+ci: deps
	cd cmd/writefreely; $(GOBUILD) -v

	-build: assets deps
	+build: deps
	cd cmd/writefreely; $(GOBUILD) -v -tags='sqlite'

	-build-no-sqlite: assets-no-sqlite deps-no-sqlite
	+build-no-sqlite: deps-no-sqlite
	cd cmd/writefreely; $(GOBUILD) -v -o $(BINARY_NAME)

	build-linux: deps
	@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
	$(GOGET) -u src.techknowlogick.com/xgo; \
	fi
	xgo --targets=linux/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely

	build-windows: deps
	@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
	$(GOGET) -u src.techknowlogick.com/xgo; \
	fi
	xgo --targets=windows/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely

	build-darwin: deps
	@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
	$(GOGET) -u src.techknowlogick.com/xgo; \
	fi
	xgo --targets=darwin/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely

	build-arm6: deps
	@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
	$(GOGET) -u src.techknowlogick.com/xgo; \
	fi
	xgo --targets=linux/arm-6, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely

	build-arm7: deps
	@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
	$(GOGET) -u src.techknowlogick.com/xgo; \
	fi
	xgo --targets=linux/arm-7, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely

	build-arm64: deps
	@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
	$(GOGET) -u src.techknowlogick.com/xgo; \
	fi
	xgo --targets=linux/arm64, -dest build/ $(LDFLAGS) -tags='sqlite' -go go-1.15.x -out writefreely ./cmd/writefreely

	build-docker :
	$(DOCKERCMD) build -t $(IMAGE_NAME):latest -t $(IMAGE_NAME):$(GITREV) .

	test:
	$(GOTEST) -v ./...

	-run: dev-assets
	+run:
	$(GOINSTALL) -tags='sqlite' ./...
	$(BINARY_NAME) --debug

	deps :
	$(GOGET) -tags='sqlite' -d -v ./...

	deps-no-sqlite:
	$(GOGET) -d -v ./...

	install : build
	cmd/writefreely/$(BINARY_NAME) --config
	cmd/writefreely/$(BINARY_NAME) --gen-keys
	cmd/writefreely/$(BINARY_NAME) --init-db
	cd less/; $(MAKE) install $(MFLAGS)

	-release : clean ui assets
	+release : clean ui
	mkdir -p $(BUILDPATH)
	cp -r templates $(BUILDPATH)
	cp -r pages $(BUILDPATH)
	cp -r static $(BUILDPATH)
	scripts/invalidate-css.sh $(BUILDPATH)
	mkdir $(BUILDPATH)/keys
	$(MAKE) build-linux
	mv build/$(BINARY_NAME)-linux-amd64 $(BUILDPATH)/$(BINARY_NAME)
	tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME)
	rm $(BUILDPATH)/$(BINARY_NAME)
	$(MAKE) build-arm6
	mv build/$(BINARY_NAME)-linux-arm-6 $(BUILDPATH)/$(BINARY_NAME)
	tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm6.tar.gz -C build $(BINARY_NAME)
	rm $(BUILDPATH)/$(BINARY_NAME)
	$(MAKE) build-arm7
	mv build/$(BINARY_NAME)-linux-arm-7 $(BUILDPATH)/$(BINARY_NAME)
	tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm7.tar.gz -C build $(BINARY_NAME)
	rm $(BUILDPATH)/$(BINARY_NAME)
	$(MAKE) build-arm64
	mv build/$(BINARY_NAME)-linux-arm64 $(BUILDPATH)/$(BINARY_NAME)
	tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm64.tar.gz -C build $(BINARY_NAME)
	rm $(BUILDPATH)/$(BINARY_NAME)
	$(MAKE) build-darwin
	mv build/$(BINARY_NAME)-darwin-10.12-amd64 $(BUILDPATH)/$(BINARY_NAME)
	tar -cvzf $(BINARY_NAME)_$(GITREV)_macos_amd64.tar.gz -C build $(BINARY_NAME)
	rm $(BUILDPATH)/$(BINARY_NAME)
	$(MAKE) build-windows
	mv build/$(BINARY_NAME)-windows-4.0-amd64.exe $(BUILDPATH)/$(BINARY_NAME).exe
	cd build; zip -r ../$(BINARY_NAME)_$(GITREV)_windows_amd64.zip ./$(BINARY_NAME)
	rm $(BUILDPATH)/$(BINARY_NAME).exe
	$(MAKE) build-docker
	$(MAKE) release-docker

	# This assumes you're on linux/amd64
	release-linux : clean ui
	mkdir -p $(BUILDPATH)
	cp -r templates $(BUILDPATH)
	cp -r pages $(BUILDPATH)
	cp -r static $(BUILDPATH)
	mkdir $(BUILDPATH)/keys
	$(MAKE) build-no-sqlite
	mv cmd/writefreely/$(BINARY_NAME) $(BUILDPATH)/$(BINARY_NAME)
	tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME)

	release-docker :
	$(DOCKERCMD) push $(IMAGE_NAME)

	ui : force_look
	cd less/; $(MAKE) $(MFLAGS)
	cd prose/; $(MAKE) $(MFLAGS)

	-assets : generate
	- go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql
	-
	-assets-no-sqlite: generate
	- go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql
	-
	-dev-assets : generate
	- go-bindata -pkg writefreely -ignore=\\.gitignore -debug -tags="!wflib" schema.sql sqlite.sql
	-
	-lib-assets : generate
	- go-bindata -pkg writefreely -ignore=\\.gitignore -o bindata-lib.go -tags="wflib" schema.sql
	-
	-generate :
	- @hash go-bindata > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
	- $(GOGET) -u github.com/jteeuwen/go-bindata/go-bindata; \
	- fi
	-
	$(TMPBIN):
	mkdir -p $(TMPBIN)

	-$(TMPBIN)/go-bindata: deps $(TMPBIN)
	- $(GOBUILD) -o $(TMPBIN)/go-bindata github.com/jteeuwen/go-bindata/go-bindata
	-
	$(TMPBIN)/xgo: deps $(TMPBIN)
	$(GOBUILD) -o $(TMPBIN)/xgo src.techknowlogick.com/xgo

	-ci-assets : $(TMPBIN)/go-bindata
	- $(TMPBIN)/go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql
	-
	clean :
	-rm -rf build
	-rm -rf tmp
	cd less/; $(MAKE) clean $(MFLAGS)

	force_look :
	true
	diff --git a/README.md b/README.md
	index c165820..7831e57 100644
	--- a/README.md
	+++ b/README.md
	@@ -1,89 +1,89 @@

	<p align="center">
	<a href="https://writefreely.org"><img src="https://writefreely.org/img/writefreely.svg" width="350px" alt="WriteFreely" /></a>
	</p>
	<hr />
	<p align="center">
	<a href="https://github.com/writefreely/writefreely/releases/">
	<img src="https://img.shields.io/github/release/writefreely/writefreely.svg" alt="Latest release" />
	</a>
	<a href="https://travis-ci.org/writeas/writefreely">
	<img src="https://travis-ci.org/writefreely/writefreely.svg" alt="Build status" />
	</a>
	<a href="https://github.com/writefreely/writefreely/releases/latest">
	<img src="https://img.shields.io/github/downloads/writefreely/writefreely/total.svg" />
	</a>
	<a href="https://goreportcard.com/report/github.com/writefreely/writefreely">
	<img src="https://goreportcard.com/badge/github.com/writefreely/writefreely" alt="Go Report Card" />
	</a>
	<a href="https://hub.docker.com/r/writeas/writefreely/">
	<img src="https://img.shields.io/docker/pulls/writeas/writefreely.svg" />
	</a>
	</p>


	WriteFreely is a clean, minimalist publishing platform made for writers. Start a blog, share knowledge within your organization, or build a community around the shared act of writing.

	![](https://writefreely.org/img/screens/pencil-reader.png)

	[Try the writing experience](https://write.as/new)

	[Find an instance](https://writefreely.org/instances)

	## Features

	### Made for writing

	Built on a plain, auto-saving editor, WriteFreely gives you a distraction-free writing environment. Once published, your words are front and center, and easy to read.

	### A connected community

	Start writing together, publicly or privately. Connect with other communities, whether running WriteFreely, [Plume](https://joinplu.me/), or other ActivityPub-powered software. And bring members on board from your existing platforms, thanks to our OAuth 2.0 support.

	### Intuitive organization

	Categorize articles [with hashtags](https://writefreely.org/docs/latest/writer/hashtags), and create static pages from normal posts by [_pinning_ them](https://writefreely.org/docs/latest/writer/static) to your blog. Create draft posts and publish to multiple blogs from one account.

	### International

	Blog elements are localized in 20+ languages, and WriteFreely includes first-class support for non-Latin and right-to-left (RTL) script languages.

	### Private by default

	WriteFreely collects minimal data, and never publicizes more than a writer consents to. Writers can seamlessly create multiple blogs from a single account for different pen names or purposes without publicly revealing their association.

	<h2><a href="https://write.as/writefreely"><img src="https://writefreely.org/img/writeas-readme.png" height="32px" alt="Write.as" /></a></h2>

	The quickest way to deploy WriteFreely is with [Write.as](https://write.as/writefreely), a hosted service from the team behind WriteFreely. You'll get fully-managed installation, backup, upgrades, and maintenance — and directly fund our free software work ❤️

	[Learn more on Write.as](https://write.as/writefreely).

	## Quick start

	WriteFreely deploys as a static binary on any platform and architecture that Go supports. Just use our built-in SQLite support, or add a MySQL database, and you'll be up and running!

	For common platforms, start with our [pre-built binaries](https://github.com/writefreely/writefreely/releases/) and head over to our [installation guide](https://writefreely.org/start) to get started.

	### Packages

	You can also find WriteFreely in these package repositories, thanks to our wonderful community!

	* [Arch User Repository](https://aur.archlinux.org/packages/writefreely/)

	## Documentation

	Read our full [documentation on WriteFreely.org](https://writefreely.org/docs) —️ and help us improve by contributing to the [writefreely/documentation](https://github.com/writefreely/documentation) repo.

	## Development

	Start hacking on WriteFreely with our [developer setup guide](https://writefreely.org/docs/latest/developer/setup). For Docker support, see our [Docker guide](https://writefreely.org/docs/latest/admin/docker).

	## Contributing

	We gladly welcome contributions to WriteFreely, whether in the form of [code](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely), [bug reports](https://github.com/writefreely/writefreely/issues/new?template=bug_report.md), [feature requests](https://discuss.write.as/c/feedback/feature-requests), [translations](https://poeditor.com/join/project/TIZ6HFRFdE), or [documentation](https://github.com/writefreely/documentation) improvements.

	Before contributing anything, please read our [Contributing Guide](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely). It describes the correct channels for submitting contributions and any potential requirements.

	## License

	-Copyright © 2018-2021 [A Bunch Tell LLC](https://abunchtell.com) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE).
	+Copyright © 2018-2022 [Musing Studio LLC](https://musing.studio) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE).
	diff --git a/SECURITY.md b/SECURITY.md
	new file mode 100644
	index 0000000..4bf2cfd
	--- /dev/null
	+++ b/SECURITY.md
	@@ -0,0 +1,5 @@
	+# Security Policy
	+
	+## Reporting a Vulnerability
	+
	+To report a vulnerability, send an email to security@writefreely.org.
	diff --git a/account.go b/account.go
	index 5f10fe4..e5c8d34 100644
	--- a/account.go
	+++ b/account.go
	@@ -1,1252 +1,1267 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"encoding/json"
	"fmt"
	"html/template"
	"net/http"
	"regexp"
	"strconv"
	"strings"
	"sync"
	"time"

	"github.com/gorilla/csrf"
	"github.com/gorilla/mux"
	"github.com/gorilla/sessions"
	"github.com/guregu/null/zero"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/auth"
	"github.com/writeas/web-core/data"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/author"
	"github.com/writefreely/writefreely/config"
	"github.com/writefreely/writefreely/page"
	)

	type (
	userSettings struct {
	Username string `schema:"username" json:"username"`
	Email string `schema:"email" json:"email"`
	NewPass string `schema:"new-pass" json:"new_pass"`
	OldPass string `schema:"current-pass" json:"current_pass"`
	IsLogOut bool `schema:"logout" json:"logout"`
	}

	UserPage struct {
	page.StaticPage

	PageTitle string
	Separator template.HTML
	IsAdmin bool
	CanInvite bool
	CollAlias string
	}
	)

	func NewUserPage(app App, r http.Request, u User, title string, flashes []string) UserPage {
	up := &UserPage{
	StaticPage: pageForReq(app, r),
	PageTitle: title,
	}
	up.Username = u.Username
	up.Flashes = flashes
	up.Path = r.URL.Path
	up.IsAdmin = u.IsAdmin()
	up.CanInvite = canUserInvite(app.cfg, up.IsAdmin)
	return up
	}

	func canUserInvite(cfg *config.Config, isAdmin bool) bool {
	return cfg.App.UserInvites != "" &&
	(isAdmin \|\| cfg.App.UserInvites != "admin")
	}

	func (up UserPage) SetMessaging(u User) {
	// up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID)
	}

	const (
	loginAttemptExpiration = 3 * time.Second
	)

	var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead")

	func apiSignup(app App, w http.ResponseWriter, r http.Request) error {
	_, err := signup(app, w, r)
	return err
	}

	func signup(app App, w http.ResponseWriter, r http.Request) (*AuthUser, error) {
	if app.cfg.App.DisablePasswordAuth {
	err := ErrDisabledPasswordAuth
	return nil, err
	}

	reqJSON := IsJSON(r)

	// Get params
	var ur userRegistration
	if reqJSON {
	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&ur)
	if err != nil {
	log.Error("Couldn't parse signup JSON request: %v\n", err)
	return nil, ErrBadJSON
	}
	} else {
	// Check if user is already logged in
	u := getUserSession(app, r)
	if u != nil {
	return &AuthUser{User: u}, nil
	}

	err := r.ParseForm()
	if err != nil {
	log.Error("Couldn't parse signup form request: %v\n", err)
	return nil, ErrBadFormData
	}

	err = app.formDecoder.Decode(&ur, r.PostForm)
	if err != nil {
	log.Error("Couldn't decode signup form request: %v\n", err)
	return nil, ErrBadFormData
	}
	}

	return signupWithRegistration(app, ur, w, r)
	}

	func signupWithRegistration(app App, signup userRegistration, w http.ResponseWriter, r http.Request) (*AuthUser, error) {
	reqJSON := IsJSON(r)

	// Validate required params (alias)
	if signup.Alias == "" {
	return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."}
	}
	if signup.Pass == "" {
	return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."}
	}
	var desiredUsername string
	if signup.Normalize {
	// With this option we simply conform the username to what we expect
	// without complaining. Since they might've done something funny, like
	// enter: write.as/Way Out There, we'll use their raw input for the new
	// collection name and sanitize for the slug / username.
	desiredUsername = signup.Alias
	signup.Alias = getSlug(signup.Alias, "")
	}
	if !author.IsValidUsername(app.cfg, signup.Alias) {
	// Ensure the username is syntactically correct.
	return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."}
	}

	// Handle empty optional params
	hashedPass, err := auth.HashPass([]byte(signup.Pass))
	if err != nil {
	return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
	}

	// Create struct to insert
	u := &User{
	Username: signup.Alias,
	HashedPass: hashedPass,
	HasPass: true,
	Email: prepareUserEmail(signup.Email, app.keys.EmailKey),
	Created: time.Now().Truncate(time.Second).UTC(),
	}

	// Create actual user
	if err := app.db.CreateUser(app.cfg, u, desiredUsername, signup.Description); err != nil {
	return nil, err
	}

	// Log invite if needed
	if signup.InviteCode != "" {
	err = app.db.CreateInvitedUser(signup.InviteCode, u.ID)
	if err != nil {
	return nil, err
	}
	}

	// Add back unencrypted data for response
	if signup.Email != "" {
	u.Email.String = signup.Email
	}

	resUser := &AuthUser{
	User: u,
	}
	title := signup.Alias
	if signup.Normalize {
	title = desiredUsername
	}
	resUser.Collections = &[]Collection{
	{
	Alias: signup.Alias,
	Title: title,
	Description: signup.Description,
	},
	}

	var coll *Collection
	if signup.Monetization != "" {
	if coll == nil {
	coll, err = app.db.GetCollection(signup.Alias)
	if err != nil {
	log.Error("Unable to get new collection '%s' for monetization on signup: %v", signup.Alias, err)
	return nil, err
	}
	}
	err = app.db.SetCollectionAttribute(coll.ID, "monetization_pointer", signup.Monetization)
	if err != nil {
	log.Error("Unable to add monetization on signup: %v", err)
	return nil, err
	}
	coll.Monetization = signup.Monetization
	}

	var token string
	if reqJSON && !signup.Web {
	token, err = app.db.GetAccessToken(u.ID)
	if err != nil {
	return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
	}
	resUser.AccessToken = token
	} else {
	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	// The cookie should still save, even if there's an error.
	// Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144
	log.Error("Session: %v; ignoring", err)
	}
	session.Values[cookieUserVal] = resUser.User.Cookie()
	err = session.Save(r, w)
	if err != nil {
	log.Error("Couldn't save session: %v", err)
	return nil, err
	}
	}
	if reqJSON {
	return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated)
	}

	return resUser, nil
	}

	func viewLogout(app App, w http.ResponseWriter, r http.Request) error {
	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	return ErrInternalCookieSession
	}

	// Ensure user has an email or password set before they go, so they don't
	// lose access to their account.
	val := session.Values[cookieUserVal]
	var u = &User{}
	var ok bool
	if u, ok = val.(*User); !ok {
	log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values)

	err = session.Save(r, w)
	if err != nil {
	log.Error("Couldn't save session on logout: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
	}

	return impart.HTTPError{http.StatusFound, "/"}
	}

	u, err = app.db.GetUserByID(u.ID)
	if err != nil && err != ErrUserNotFound {
	return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."}
	}

	session.Options.MaxAge = -1

	err = session.Save(r, w)
	if err != nil {
	log.Error("Couldn't save session on logout: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
	}

	return impart.HTTPError{http.StatusFound, "/"}
	}

	func handleAPILogout(app App, w http.ResponseWriter, r http.Request) error {
	accessToken := r.Header.Get("Authorization")
	if accessToken == "" {
	return ErrNoAccessToken
	}
	t := auth.GetToken(accessToken)
	if len(t) == 0 {
	return ErrNoAccessToken
	}
	err := app.db.DeleteToken(t)
	if err != nil {
	return err
	}
	return impart.HTTPError{Status: http.StatusNoContent}
	}

	func viewLogin(app App, w http.ResponseWriter, r http.Request) error {
	var earlyError string
	oneTimeToken := r.FormValue("with")
	if oneTimeToken != "" {
	log.Info("Calling login with one-time token.")
	err := login(app, w, r)
	if err != nil {
	log.Info("Received error: %v", err)
	earlyError = fmt.Sprintf("%s", err)
	}
	}

	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	// Ignore this
	log.Error("Unable to get session; ignoring: %v", err)
	}

	p := &struct {
	page.StaticPage
	*OAuthButtons
	To string
	Message template.HTML
	Flashes []template.HTML
	LoginUsername string
	}{
	StaticPage: pageForReq(app, r),
	OAuthButtons: NewOAuthButtons(app.Config()),
	To: r.FormValue("to"),
	Message: template.HTML(""),
	Flashes: []template.HTML{},
	LoginUsername: getTempInfo(app, "login-user", r, w),
	}

	if earlyError != "" {
	p.Flashes = append(p.Flashes, template.HTML(earlyError))
	}

	// Display any error messages
	flashes, _ := getSessionFlashes(app, w, r, session)
	for _, flash := range flashes {
	p.Flashes = append(p.Flashes, template.HTML(flash))
	}
	err = pages["login.tmpl"].ExecuteTemplate(w, "base", p)
	if err != nil {
	log.Error("Unable to render login: %v", err)
	return err
	}
	return nil
	}

	func webLogin(app App, w http.ResponseWriter, r http.Request) error {
	err := login(app, w, r)
	if err != nil {
	username := r.FormValue("alias")
	// Login request was unsuccessful; save the error in the session and redirect them
	if err, ok := err.(impart.HTTPError); ok {
	session, _ := app.sessionStore.Get(r, cookieName)
	if session != nil {
	session.AddFlash(err.Message)
	session.Save(r, w)
	}

	if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 {
	// Retain fixed username recommendation for the login form
	username = m[1]
	}
	}

	// Pass along certain information
	saveTempInfo(app, "login-user", username, r, w)

	// Retain post-login URL if one was given
	redirectTo := "/login"
	postLoginRedirect := r.FormValue("to")
	if postLoginRedirect != "" {
	redirectTo += "?to=" + postLoginRedirect
	}

	log.Error("Unable to login: %v", err)
	return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo}
	}

	return nil
	}

	var loginAttemptUsers = sync.Map{}

	func login(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)
	oneTimeToken := r.FormValue("with")
	verbose := r.FormValue("all") == "true" \|\| r.FormValue("verbose") == "1" \|\| r.FormValue("verbose") == "true" \|\| (reqJSON && oneTimeToken != "")

	redirectTo := r.FormValue("to")
	if redirectTo == "" {
	if app.cfg.App.SingleUser {
	redirectTo = "/me/new"
	} else {
	redirectTo = "/"
	}
	}

	var u *User
	var err error
	var signin userCredentials

	if app.cfg.App.DisablePasswordAuth {
	err := ErrDisabledPasswordAuth
	return err
	}

	// Log in with one-time token if one is given
	if oneTimeToken != "" {
	log.Info("Login: Logging user in via token.")
	userID := app.db.GetUserID(oneTimeToken)
	if userID == -1 {
	log.Error("Login: Got user -1 from token")
	err := ErrBadAccessToken
	err.Message = "Expired or invalid login code."
	return err
	}
	log.Info("Login: Found user %d.", userID)

	u, err = app.db.GetUserByID(userID)
	if err != nil {
	log.Error("Unable to fetch user on one-time token login: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."}
	}
	log.Info("Login: Got user via token")
	} else {
	// Get params
	if reqJSON {
	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&signin)
	if err != nil {
	log.Error("Couldn't parse signin JSON request: %v\n", err)
	return ErrBadJSON
	}
	} else {
	err := r.ParseForm()
	if err != nil {
	log.Error("Couldn't parse signin form request: %v\n", err)
	return ErrBadFormData
	}

	err = app.formDecoder.Decode(&signin, r.PostForm)
	if err != nil {
	log.Error("Couldn't decode signin form request: %v\n", err)
	return ErrBadFormData
	}
	}

	log.Info("Login: Attempting login for '%s'", signin.Alias)

	// Validate required params (all)
	if signin.Alias == "" {
	msg := "Parameter `alias` required."
	if signin.Web {
	msg = "A username is required."
	}
	return impart.HTTPError{http.StatusBadRequest, msg}
	}
	if !signin.EmailLogin && signin.Pass == "" {
	msg := "Parameter `pass` required."
	if signin.Web {
	msg = "A password is required."
	}
	return impart.HTTPError{http.StatusBadRequest, msg}
	}

	// Prevent excessive login attempts on the same account
	// Skip this check in dev environment
	if !app.cfg.Server.Dev {
	now := time.Now()
	attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration))
	if att {
	if attemptExpTime, ok := attemptExp.(time.Time); ok {
	if attemptExpTime.After(now) {
	// This user attempted previously, and the period hasn't expired yet
	return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."}
	} else {
	// This user attempted previously, but the time expired; free up space
	loginAttemptUsers.Delete(signin.Alias)
	}
	} else {
	log.Error("Unable to cast expiration to time")
	}
	}
	}

	// Retrieve password
	u, err = app.db.GetUserForAuth(signin.Alias)
	if err != nil {
	log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err)
	if strings.IndexAny(signin.Alias, "@") > 0 {
	log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message)
	return ErrUserNotFoundEmail
	}
	return err
	}
	// Authenticate
	if u.Email.String == "" {
	// User has no email set, so check if they haven't added a password, either,
	// so we can return a more helpful error message.
	if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass {
	log.Info("Tried logging in to %s, but no password or email.", signin.Alias)
	return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."}
	}
	}
	if len(u.HashedPass) == 0 {
	return impart.HTTPError{http.StatusUnauthorized, "This user never set a password. Perhaps try logging in via OAuth?"}
	}
	if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) {
	return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
	}
	}

	if reqJSON && !signin.Web {
	var token string
	if r.Header.Get("User-Agent") == "" {
	// Get last created token when User-Agent is empty
	token = app.db.FetchLastAccessToken(u.ID)
	if token == "" {
	token, err = app.db.GetAccessToken(u.ID)
	}
	} else {
	token, err = app.db.GetAccessToken(u.ID)
	}
	if err != nil {
	log.Error("Login: Unable to create access token: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
	}
	resUser := getVerboseAuthUser(app, token, u, verbose)
	return impart.WriteSuccess(w, resUser, http.StatusOK)
	}

	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	// The cookie should still save, even if there's an error.
	log.Error("Login: Session: %v; ignoring", err)
	}

	// Remove unwanted data
	session.Values[cookieUserVal] = u.Cookie()
	err = session.Save(r, w)
	if err != nil {
	log.Error("Login: Couldn't save session: %v", err)
	// TODO: return error
	}

	// Send success
	if reqJSON {
	return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK)
	}
	log.Info("Login: Redirecting to %s", redirectTo)
	w.Header().Set("Location", redirectTo)
	w.WriteHeader(http.StatusFound)
	return nil
	}

	func getVerboseAuthUser(app App, token string, u User, verbose bool) *AuthUser {
	resUser := &AuthUser{
	AccessToken: token,
	User: u,
	}

	// Fetch verbose user data if requested
	if verbose {
	posts, err := app.db.GetUserPosts(u)
	if err != nil {
	log.Error("Login: Unable to get user posts: %v", err)
	}
	colls, err := app.db.GetCollections(u, app.cfg.App.Host)
	if err != nil {
	log.Error("Login: Unable to get user collections: %v", err)
	}
	passIsSet, err := app.db.IsUserPassSet(u.ID)
	if err != nil {
	// TODO: correct error meesage
	log.Error("Login: Unable to get user collections: %v", err)
	}

	resUser.Posts = posts
	resUser.Collections = colls
	resUser.User.HasPass = passIsSet
	}
	return resUser
	}

	func viewExportOptions(app App, u User, w http.ResponseWriter, r *http.Request) error {
	// Fetch extra user data
	p := NewUserPage(app, r, u, "Export", nil)

	showUserPage(w, "export", p)
	return nil
	}

	func viewExportPosts(app App, w http.ResponseWriter, r http.Request) ([]byte, string, error) {
	var filename string
	var u = &User{}
	reqJSON := IsJSON(r)
	if reqJSON {
	// Use given Authorization header
	accessToken := r.Header.Get("Authorization")
	if accessToken == "" {
	return nil, filename, ErrNoAccessToken
	}

	userID := app.db.GetUserID(accessToken)
	if userID == -1 {
	return nil, filename, ErrBadAccessToken
	}

	var err error
	u, err = app.db.GetUserByID(userID)
	if err != nil {
	return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."}
	}
	} else {
	// Use user cookie
	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	// The cookie should still save, even if there's an error.
	log.Error("Session: %v; ignoring", err)
	}

	val := session.Values[cookieUserVal]
	var ok bool
	if u, ok = val.(*User); !ok {
	return nil, filename, ErrNotLoggedIn
	}
	}

	filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")

	// Fetch data we're exporting
	var err error
	var data []byte
	posts, err := app.db.GetUserPosts(u)
	if err != nil {
	return data, filename, err
	}

	// Export as CSV
	if strings.HasSuffix(r.URL.Path, ".csv") {
	data = exportPostsCSV(app.cfg.App.Host, u, posts)
	return data, filename, err
	}
	if strings.HasSuffix(r.URL.Path, ".zip") {
	data = exportPostsZip(u, posts)
	return data, filename, err
	}

	if r.FormValue("pretty") == "1" {
	data, err = json.MarshalIndent(posts, "", "\t")
	} else {
	data, err = json.Marshal(posts)
	}
	return data, filename, err
	}

	func viewExportFull(app App, w http.ResponseWriter, r http.Request) ([]byte, string, error) {
	var err error
	filename := ""
	u := getUserSession(app, r)
	if u == nil {
	return nil, filename, ErrNotLoggedIn
	}
	filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")

	exportUser := compileFullExport(app, u)

	var data []byte
	if r.FormValue("pretty") == "1" {
	data, err = json.MarshalIndent(exportUser, "", "\t")
	} else {
	data, err = json.Marshal(exportUser)
	}
	return data, filename, err
	}

	func viewMeAPI(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)
	uObj := struct {
	ID int64 `json:"id,omitempty"`
	Username string `json:"username,omitempty"`
	}{}
	var err error

	if reqJSON {
	_, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization"))
	if err != nil {
	return err
	}
	} else {
	u := getUserSession(app, r)
	if u == nil {
	return impart.WriteSuccess(w, uObj, http.StatusOK)
	}
	uObj.Username = u.Username
	}

	return impart.WriteSuccess(w, uObj, http.StatusOK)
	}

	func viewMyPostsAPI(app App, u User, w http.ResponseWriter, r *http.Request) error {
	reqJSON := IsJSON(r)
	if !reqJSON {
	return ErrBadRequestedType
	}

	isAnonPosts := r.FormValue("anonymous") == "1"
	if isAnonPosts {
	pageStr := r.FormValue("page")
	pg, err := strconv.Atoi(pageStr)
	if err != nil {
	log.Error("Error parsing page parameter '%s': %s", pageStr, err)
	pg = 1
	}

	p, err := app.db.GetAnonymousPosts(u, pg)
	if err != nil {
	return err
	}
	return impart.WriteSuccess(w, p, http.StatusOK)
	}

	var err error
	p := GetPostsCache(u.ID)
	if p == nil {
	userPostsCache.Lock()
	if userPostsCache.users[u.ID].ready == nil {
	userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})}
	userPostsCache.Unlock()

	p, err = app.db.GetUserPosts(u)
	if err != nil {
	return err
	}

	CachePosts(u.ID, p)
	} else {
	userPostsCache.Unlock()

	<-userPostsCache.users[u.ID].ready
	p = GetPostsCache(u.ID)
	}
	}

	return impart.WriteSuccess(w, p, http.StatusOK)
	}

	func viewMyCollectionsAPI(app App, u User, w http.ResponseWriter, r *http.Request) error {
	reqJSON := IsJSON(r)
	if !reqJSON {
	return ErrBadRequestedType
	}

	p, err := app.db.GetCollections(u, app.cfg.App.Host)
	if err != nil {
	return err
	}

	return impart.WriteSuccess(w, p, http.StatusOK)
	}

	func viewArticles(app App, u User, w http.ResponseWriter, r *http.Request) error {
	p, err := app.db.GetAnonymousPosts(u, 1)
	if err != nil {
	log.Error("unable to fetch anon posts: %v", err)
	}
	// nil-out AnonymousPosts slice for easy detection in the template
	if p != nil && len(*p) == 0 {
	p = nil
	}

	f, err := getSessionFlashes(app, w, r, nil)
	if err != nil {
	log.Error("unable to fetch flashes: %v", err)
	}

	c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host)
	if err != nil {
	log.Error("unable to fetch collections: %v", err)
	}

	silenced, err := app.db.IsUserSilenced(u.ID)
	if err != nil {
	+ if err == ErrUserNotFound {
	+ return err
	+ }
	log.Error("view articles: %v", err)
	}
	d := struct {
	*UserPage
	AnonymousPosts *[]PublicPost
	Collections *[]Collection
	Silenced bool
	}{
	UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f),
	AnonymousPosts: p,
	Collections: c,
	Silenced: silenced,
	}
	d.UserPage.SetMessaging(u)
	w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
	w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT")
	showUserPage(w, "articles", d)

	return nil
	}

	func viewCollections(app App, u User, w http.ResponseWriter, r *http.Request) error {
	c, err := app.db.GetCollections(u, app.cfg.App.Host)
	if err != nil {
	log.Error("unable to fetch collections: %v", err)
	return fmt.Errorf("No collections")
	}

	f, _ := getSessionFlashes(app, w, r, nil)

	uc, _ := app.db.GetUserCollectionCount(u.ID)
	// TODO: handle any errors

	silenced, err := app.db.IsUserSilenced(u.ID)
	if err != nil {
	- log.Error("view collections %v", err)
	+ if err == ErrUserNotFound {
	+ return err
	+ }
	+ log.Error("view collections: %v", err)
	return fmt.Errorf("view collections: %v", err)
	}
	d := struct {
	*UserPage
	Collections *[]Collection

	UsedCollections, TotalCollections int

	NewBlogsDisabled bool
	Silenced bool
	}{
	UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f),
	Collections: c,
	UsedCollections: int(uc),
	NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc),
	Silenced: silenced,
	}
	d.UserPage.SetMessaging(u)
	showUserPage(w, "collections", d)

	return nil
	}

	func viewEditCollection(app App, u User, w http.ResponseWriter, r *http.Request) error {
	vars := mux.Vars(r)
	c, err := app.db.GetCollection(vars["collection"])
	if err != nil {
	return err
	}
	if c.OwnerID != u.ID {
	return ErrCollectionNotFound
	}

	// Add collection properties
	c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer")

	silenced, err := app.db.IsUserSilenced(u.ID)
	if err != nil {
	+ if err == ErrUserNotFound {
	+ return err
	+ }
	log.Error("view edit collection %v", err)
	return fmt.Errorf("view edit collection: %v", err)
	}
	flashes, _ := getSessionFlashes(app, w, r, nil)
	obj := struct {
	*UserPage
	*Collection
	Silenced bool

	config.LettersCfg
	LetterReplyTo string
	}{
	UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes),
	Collection: c,
	Silenced: silenced,
	LettersCfg: app.cfg.Letters,
	}
	obj.UserPage.CollAlias = c.Alias
	if obj.LettersCfg.Enabled() {
	obj.LetterReplyTo = app.db.GetCollectionAttribute(c.ID, collAttrLetterReplyTo)
	}

	showUserPage(w, "collection", obj)
	return nil
	}

	func updateSettings(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)

	var s userSettings
	var u *User
	var sess *sessions.Session
	var err error
	if reqJSON {
	accessToken := r.Header.Get("Authorization")
	if accessToken == "" {
	return ErrNoAccessToken
	}

	u, err = app.db.GetAPIUser(accessToken)
	if err != nil {
	return ErrBadAccessToken
	}

	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&s)
	if err != nil {
	log.Error("Couldn't parse settings JSON request: %v\n", err)
	return ErrBadJSON
	}

	// Prevent all username updates
	// TODO: support changing username via JSON API request
	s.Username = ""
	} else {
	u, sess = getUserAndSession(app, r)
	if u == nil {
	return ErrNotLoggedIn
	}

	err := r.ParseForm()
	if err != nil {
	log.Error("Couldn't parse settings form request: %v\n", err)
	return ErrBadFormData
	}

	err = app.formDecoder.Decode(&s, r.PostForm)
	if err != nil {
	log.Error("Couldn't decode settings form request: %v\n", err)
	return ErrBadFormData
	}
	}

	// Do update
	postUpdateReturn := r.FormValue("return")
	redirectTo := "/me/settings"
	if s.IsLogOut {
	redirectTo += "?logout=1"
	} else if postUpdateReturn != "" {
	redirectTo = postUpdateReturn
	}

	// Only do updates on values we need
	if s.Username != "" && s.Username == u.Username {
	// Username hasn't actually changed; blank it out
	s.Username = ""
	}
	err = app.db.ChangeSettings(app, u, &s)
	if err != nil {
	if reqJSON {
	return err
	}

	if err, ok := err.(impart.HTTPError); ok {
	addSessionFlash(app, w, r, err.Message, nil)
	}
	} else {
	// Successful update.
	if reqJSON {
	return impart.WriteSuccess(w, u, http.StatusOK)
	}

	if s.IsLogOut {
	redirectTo = "/me/logout"
	} else {
	sess.Values[cookieUserVal] = u.Cookie()
	addSessionFlash(app, w, r, "Account updated.", nil)
	}
	}

	w.Header().Set("Location", redirectTo)
	w.WriteHeader(http.StatusFound)
	return nil
	}

	func updatePassphrase(app App, w http.ResponseWriter, r http.Request) error {
	accessToken := r.Header.Get("Authorization")
	if accessToken == "" {
	return ErrNoAccessToken
	}

	curPass := r.FormValue("current")
	newPass := r.FormValue("new")
	// Ensure a new password is given (always required)
	if newPass == "" {
	return impart.HTTPError{http.StatusBadRequest, "Provide a new password."}
	}

	userID, sudo := app.db.GetUserIDPrivilege(accessToken)
	if userID == -1 {
	return ErrBadAccessToken
	}

	// Ensure a current password is given if the access token doesn't have sudo
	// privileges.
	if !sudo && curPass == "" {
	return impart.HTTPError{http.StatusBadRequest, "Provide current password."}
	}

	// Hash the new password
	hashedPass, err := auth.HashPass([]byte(newPass))
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
	}

	// Do update
	err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass)
	if err != nil {
	return err
	}

	return impart.WriteSuccess(w, struct{}{}, http.StatusOK)
	}

	func viewStats(app App, u User, w http.ResponseWriter, r *http.Request) error {
	var c *Collection
	var err error
	vars := mux.Vars(r)
	alias := vars["collection"]
	if alias != "" {
	c, err = app.db.GetCollection(alias)
	if err != nil {
	return err
	}
	if c.OwnerID != u.ID {
	return ErrCollectionNotFound
	}
	c.hostName = app.cfg.App.Host
	}

	topPosts, err := app.db.GetTopPosts(u, alias, c.hostName)
	if err != nil {
	log.Error("Unable to get top posts: %v", err)
	return err
	}

	flashes, _ := getSessionFlashes(app, w, r, nil)
	titleStats := ""
	if c != nil {
	titleStats = c.DisplayTitle() + " "
	}

	silenced, err := app.db.IsUserSilenced(u.ID)
	if err != nil {
	+ if err == ErrUserNotFound {
	+ return err
	+ }
	log.Error("view stats: %v", err)
	return err
	}
	obj := struct {
	*UserPage
	VisitsBlog string
	Collection *Collection
	TopPosts *[]PublicPost
	APFollowers int
	Silenced bool
	}{
	UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes),
	VisitsBlog: alias,
	Collection: c,
	TopPosts: topPosts,
	Silenced: silenced,
	}
	obj.UserPage.CollAlias = c.Alias
	if app.cfg.App.Federation {
	folls, err := app.db.GetAPFollowers(c)
	if err != nil {
	return err
	}
	obj.APFollowers = len(*folls)
	}

	showUserPage(w, "stats", obj)
	return nil
	}

	func viewSettings(app App, u User, w http.ResponseWriter, r *http.Request) error {
	fullUser, err := app.db.GetUserByID(u.ID)
	if err != nil {
	+ if err == ErrUserNotFound {
	+ return err
	+ }
	log.Error("Unable to get user for settings: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
	}

	passIsSet, err := app.db.IsUserPassSet(u.ID)
	if err != nil {
	log.Error("Unable to get isUserPassSet for settings: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
	}

	flashes, _ := getSessionFlashes(app, w, r, nil)

	enableOauthSlack := app.Config().SlackOauth.ClientID != ""
	enableOauthWriteAs := app.Config().WriteAsOauth.ClientID != ""
	enableOauthGitLab := app.Config().GitlabOauth.ClientID != ""
	enableOauthGeneric := app.Config().GenericOauth.ClientID != ""
	enableOauthGitea := app.Config().GiteaOauth.ClientID != ""

	oauthAccounts, err := app.db.GetOauthAccounts(r.Context(), u.ID)
	if err != nil {
	log.Error("Unable to get oauth accounts for settings: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
	}
	for idx, oauthAccount := range oauthAccounts {
	switch oauthAccount.Provider {
	case "slack":
	enableOauthSlack = false
	case "write.as":
	enableOauthWriteAs = false
	case "gitlab":
	enableOauthGitLab = false
	case "generic":
	oauthAccounts[idx].DisplayName = app.Config().GenericOauth.DisplayName
	oauthAccounts[idx].AllowDisconnect = app.Config().GenericOauth.AllowDisconnect
	enableOauthGeneric = false
	case "gitea":
	enableOauthGitea = false
	}
	}

	displayOauthSection := enableOauthSlack \|\| enableOauthWriteAs \|\| enableOauthGitLab \|\| enableOauthGeneric \|\| enableOauthGitea \|\| len(oauthAccounts) > 0

	obj := struct {
	*UserPage
	Email string
	HasPass bool
	IsLogOut bool
	Silenced bool
	CSRFField template.HTML
	OauthSection bool
	OauthAccounts []oauthAccountInfo
	OauthSlack bool
	OauthWriteAs bool
	OauthGitLab bool
	GitLabDisplayName string
	OauthGeneric bool
	OauthGenericDisplayName string
	OauthGitea bool
	GiteaDisplayName string
	}{
	UserPage: NewUserPage(app, r, u, "Account Settings", flashes),
	Email: fullUser.EmailClear(app.keys),
	HasPass: passIsSet,
	IsLogOut: r.FormValue("logout") == "1",
	Silenced: fullUser.IsSilenced(),
	CSRFField: csrf.TemplateField(r),
	OauthSection: displayOauthSection,
	OauthAccounts: oauthAccounts,
	OauthSlack: enableOauthSlack,
	OauthWriteAs: enableOauthWriteAs,
	OauthGitLab: enableOauthGitLab,
	GitLabDisplayName: config.OrDefaultString(app.Config().GitlabOauth.DisplayName, gitlabDisplayName),
	OauthGeneric: enableOauthGeneric,
	OauthGenericDisplayName: config.OrDefaultString(app.Config().GenericOauth.DisplayName, genericOauthDisplayName),
	OauthGitea: enableOauthGitea,
	GiteaDisplayName: config.OrDefaultString(app.Config().GiteaOauth.DisplayName, giteaDisplayName),
	}

	showUserPage(w, "settings", obj)
	return nil
	}

	func saveTempInfo(app App, key, val string, r http.Request, w http.ResponseWriter) error {
	session, err := app.sessionStore.Get(r, "t")
	if err != nil {
	return ErrInternalCookieSession
	}

	session.Values[key] = val
	err = session.Save(r, w)
	if err != nil {
	log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err)
	}
	return err
	}

	func getTempInfo(app App, key string, r http.Request, w http.ResponseWriter) string {
	session, err := app.sessionStore.Get(r, "t")
	if err != nil {
	return ""
	}

	// Get the information
	var s = ""
	var ok bool
	if s, ok = session.Values[key].(string); !ok {
	return ""
	}

	// Delete cookie
	session.Options.MaxAge = -1
	err = session.Save(r, w)
	if err != nil {
	log.Error("Couldn't erase temp data for key %s: %v", key, err)
	}

	// Return value
	return s
	}

	func handleUserDelete(app App, u User, w http.ResponseWriter, r *http.Request) error {
	if !app.cfg.App.OpenDeletion {
	return impart.HTTPError{http.StatusForbidden, "Open account deletion is disabled on this instance."}
	}

	confirmUsername := r.PostFormValue("confirm-username")
	if u.Username != confirmUsername {
	return impart.HTTPError{http.StatusBadRequest, "Confirmation username must match your username exactly."}
	}

	// Check for account deletion safeguards in place
	if u.IsAdmin() {
	return impart.HTTPError{http.StatusForbidden, "Cannot delete admin."}
	}

	err := app.db.DeleteAccount(u.ID)
	if err != nil {
	log.Error("user delete account: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not delete account: %v", err)}
	}

	// FIXME: This doesn't ever appear to the user, as (I believe) the value is erased when the session cookie is reset
	_ = addSessionFlash(app, w, r, "Thanks for writing with us! You account was deleted successfully.", nil)
	return impart.HTTPError{http.StatusFound, "/me/logout"}
	}

	func removeOauth(app App, u User, w http.ResponseWriter, r *http.Request) error {
	provider := r.FormValue("provider")
	clientID := r.FormValue("client_id")
	remoteUserID := r.FormValue("remote_user_id")

	err := app.db.RemoveOauth(r.Context(), u.ID, provider, clientID, remoteUserID)
	if err != nil {
	return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()}
	}

	return impart.HTTPError{Status: http.StatusFound, Message: "/me/settings"}
	}

	func prepareUserEmail(input string, emailKey []byte) zero.String {
	email := zero.NewString("", input != "")
	if len(input) > 0 {
	encEmail, err := data.Encrypt(emailKey, input)
	if err != nil {
	log.Error("Unable to encrypt email: %s\n", err)
	} else {
	email.String = string(encEmail)

	}
	}
	return email
	}
	diff --git a/activitypub.go b/activitypub.go
	index 720d5c9..efc34f3 100644
	--- a/activitypub.go
	+++ b/activitypub.go
	@@ -1,874 +1,874 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"bytes"
	"crypto/sha256"
	"database/sql"
	"encoding/base64"
	"encoding/json"
	"fmt"
	"io/ioutil"
	"net/http"
	"net/http/httputil"
	"net/url"
	"path/filepath"
	"strconv"
	"time"

	"github.com/gorilla/mux"
	"github.com/writeas/activity/streams"
	"github.com/writeas/httpsig"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/activitypub"
	"github.com/writeas/web-core/activitystreams"
	"github.com/writeas/web-core/id"
	"github.com/writeas/web-core/log"
	)

	const (
	// TODO: delete. don't use this!
	apCustomHandleDefault = "blog"

	apCacheTime = time.Minute
	)

	var instanceColl *Collection

	func initActivityPub(app *App) {
	ur, _ := url.Parse(app.cfg.App.Host)
	instanceColl = &Collection{
	ID: 0,
	Alias: ur.Host,
	Title: ur.Host,
	db: app.db,
	hostName: app.cfg.App.Host,
	}
	}

	type RemoteUser struct {
	ID int64
	ActorID string
	Inbox string
	SharedInbox string
	Handle string
	}

	func (ru RemoteUser) AsPerson() activitystreams.Person {
	return &activitystreams.Person{
	BaseObject: activitystreams.BaseObject{
	Type: "Person",
	Context: []interface{}{
	activitystreams.Namespace,
	},
	ID: ru.ActorID,
	},
	Inbox: ru.Inbox,
	Endpoints: activitystreams.Endpoints{
	SharedInbox: ru.SharedInbox,
	},
	}
	}

	func activityPubClient() *http.Client {
	return &http.Client{
	Timeout: 15 * time.Second,
	}
	}

	func handleFetchCollectionActivities(app App, w http.ResponseWriter, r http.Request) error {
	w.Header().Set("Server", serverSoftware)

	vars := mux.Vars(r)
	alias := vars["alias"]
	if alias == "" {
	alias = filepath.Base(r.RequestURI)
	}

	// TODO: enforce visibility
	// Get base Collection data
	var c *Collection
	var err error
	if alias == r.Host {
	c = instanceColl
	} else if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	return err
	}
	c.hostName = app.cfg.App.Host

	if !c.IsInstanceColl() {
	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("fetch collection activities: %v", err)
	return ErrInternalGeneral
	}
	if silenced {
	return ErrCollectionNotFound
	}
	}

	p := c.PersonObject()

	setCacheControl(w, apCacheTime)
	return impart.RenderActivityJSON(w, p, http.StatusOK)
	}

	func handleFetchCollectionOutbox(app App, w http.ResponseWriter, r http.Request) error {
	w.Header().Set("Server", serverSoftware)

	vars := mux.Vars(r)
	alias := vars["alias"]

	// TODO: enforce visibility
	// Get base Collection data
	var c *Collection
	var err error
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	return err
	}
	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("fetch collection outbox: %v", err)
	return ErrInternalGeneral
	}
	if silenced {
	return ErrCollectionNotFound
	}
	c.hostName = app.cfg.App.Host

	if app.cfg.App.SingleUser {
	if alias != c.Alias {
	return ErrCollectionNotFound
	}
	}

	res := &CollectionObj{Collection: *c}
	app.db.GetPostsCount(res, false)
	accountRoot := c.FederatedAccount()

	page := r.FormValue("page")
	p, err := strconv.Atoi(page)
	if err != nil \|\| p < 1 {
	// Return outbox
	oc := activitystreams.NewOrderedCollection(accountRoot, "outbox", res.TotalPosts)
	return impart.RenderActivityJSON(w, oc, http.StatusOK)
	}

	// Return outbox page
	ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "outbox", res.TotalPosts, p)
	ocp.OrderedItems = []interface{}{}

	posts, err := app.db.GetPosts(app.cfg, c, p, false, true, false)
	for _, pp := range *posts {
	pp.Collection = res
	o := pp.ActivityObject(app)
	a := activitystreams.NewCreateActivity(o)
	a.Context = nil
	ocp.OrderedItems = append(ocp.OrderedItems, *a)
	}

	setCacheControl(w, apCacheTime)
	return impart.RenderActivityJSON(w, ocp, http.StatusOK)
	}

	func handleFetchCollectionFollowers(app App, w http.ResponseWriter, r http.Request) error {
	w.Header().Set("Server", serverSoftware)

	vars := mux.Vars(r)
	alias := vars["alias"]

	// TODO: enforce visibility
	// Get base Collection data
	var c *Collection
	var err error
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	return err
	}
	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("fetch collection followers: %v", err)
	return ErrInternalGeneral
	}
	if silenced {
	return ErrCollectionNotFound
	}
	c.hostName = app.cfg.App.Host

	accountRoot := c.FederatedAccount()

	folls, err := app.db.GetAPFollowers(c)
	if err != nil {
	return err
	}

	page := r.FormValue("page")
	p, err := strconv.Atoi(page)
	if err != nil \|\| p < 1 {
	// Return outbox
	oc := activitystreams.NewOrderedCollection(accountRoot, "followers", len(*folls))
	return impart.RenderActivityJSON(w, oc, http.StatusOK)
	}

	// Return outbox page
	ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "followers", len(*folls), p)
	ocp.OrderedItems = []interface{}{}
	/*
	for _, f := range *folls {
	ocp.OrderedItems = append(ocp.OrderedItems, f.ActorID)
	}
	*/
	setCacheControl(w, apCacheTime)
	return impart.RenderActivityJSON(w, ocp, http.StatusOK)
	}

	func handleFetchCollectionFollowing(app App, w http.ResponseWriter, r http.Request) error {
	w.Header().Set("Server", serverSoftware)

	vars := mux.Vars(r)
	alias := vars["alias"]

	// TODO: enforce visibility
	// Get base Collection data
	var c *Collection
	var err error
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	return err
	}
	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("fetch collection following: %v", err)
	return ErrInternalGeneral
	}
	if silenced {
	return ErrCollectionNotFound
	}
	c.hostName = app.cfg.App.Host

	accountRoot := c.FederatedAccount()

	page := r.FormValue("page")
	p, err := strconv.Atoi(page)
	if err != nil \|\| p < 1 {
	// Return outbox
	oc := activitystreams.NewOrderedCollection(accountRoot, "following", 0)
	return impart.RenderActivityJSON(w, oc, http.StatusOK)
	}

	// Return outbox page
	ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "following", 0, p)
	ocp.OrderedItems = []interface{}{}
	setCacheControl(w, apCacheTime)
	return impart.RenderActivityJSON(w, ocp, http.StatusOK)
	}

	func handleFetchCollectionInbox(app App, w http.ResponseWriter, r http.Request) error {
	w.Header().Set("Server", serverSoftware)

	vars := mux.Vars(r)
	alias := vars["alias"]
	var c *Collection
	var err error
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	// TODO: return Reject?
	return err
	}
	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("fetch collection inbox: %v", err)
	return ErrInternalGeneral
	}
	if silenced {
	return ErrCollectionNotFound
	}
	c.hostName = app.cfg.App.Host

	if debugging {
	dump, err := httputil.DumpRequest(r, true)
	if err != nil {
	log.Error("Can't dump: %v", err)
	} else {
	log.Info("Rec'd! %q", dump)
	}
	}

	var m map[string]interface{}
	if err := json.NewDecoder(r.Body).Decode(&m); err != nil {
	return err
	}

	a := streams.NewAccept()
	p := c.PersonObject()
	var to *url.URL
	var isFollow, isUnfollow bool
	fullActor := &activitystreams.Person{}
	var remoteUser *RemoteUser

	res := &streams.Resolver{
	FollowCallback: func(f *streams.Follow) error {
	isFollow = true

	// 1) Use the Follow concrete type here
	// 2) Errors are propagated to res.Deserialize call below
	m["@context"] = []string{activitystreams.Namespace}
	b, _ := json.Marshal(m)
	if debugging {
	log.Info("Follow: %s", b)
	}

	_, followID := f.GetId()
	if followID == nil {
	log.Error("Didn't resolve follow ID")
	} else {
	aID := c.FederatedAccount() + "#accept-" + id.GenerateFriendlyRandomString(20)
	acceptID, err := url.Parse(aID)
	if err != nil {
	log.Error("Couldn't parse generated Accept URL '%s': %v", aID, err)
	}
	a.SetId(acceptID)
	}
	a.AppendObject(f.Raw())
	_, to = f.GetActor(0)
	obj := f.Raw().GetObjectIRI(0)
	a.AppendActor(obj)

	// First get actor information
	if to == nil {
	return fmt.Errorf("No valid `to` string")
	}
	fullActor, remoteUser, err = getActor(app, to.String())
	if err != nil {
	return err
	}
	return impart.RenderActivityJSON(w, m, http.StatusOK)
	},
	UndoCallback: func(u *streams.Undo) error {
	isUnfollow = true

	m["@context"] = []string{activitystreams.Namespace}
	b, _ := json.Marshal(m)
	if debugging {
	log.Info("Undo: %s", b)
	}

	a.AppendObject(u.Raw())
	_, to = u.GetActor(0)
	// TODO: get actor from object.object, not object
	obj := u.Raw().GetObjectIRI(0)
	a.AppendActor(obj)
	if to != nil {
	// Populate fullActor from DB?
	remoteUser, err = getRemoteUser(app, to.String())
	if err != nil {
	if iErr, ok := err.(*impart.HTTPError); ok {
	if iErr.Status == http.StatusNotFound {
	log.Error("No remoteuser info for Undo event!")
	}
	}
	return err
	} else {
	fullActor = remoteUser.AsPerson()
	}
	} else {
	log.Error("No to on Undo!")
	}
	return impart.RenderActivityJSON(w, m, http.StatusOK)
	},
	}
	if err := res.Deserialize(m); err != nil {
	// 3) Any errors from #2 can be handled, or the payload is an unknown type.
	log.Error("Unable to resolve Follow: %v", err)
	if debugging {
	log.Error("Map: %s", m)
	}
	return err
	}

	go func() {
	if to == nil {
	if debugging {
	log.Error("No `to` value!")
	}
	return
	}

	time.Sleep(2 * time.Second)
	am, err := a.Serialize()
	if err != nil {
	log.Error("Unable to serialize Accept: %v", err)
	return
	}
	am["@context"] = []string{activitystreams.Namespace}

	err = makeActivityPost(app.cfg.App.Host, p, fullActor.Inbox, am)
	if err != nil {
	log.Error("Unable to make activity POST: %v", err)
	return
	}

	if isFollow {
	t, err := app.db.Begin()
	if err != nil {
	log.Error("Unable to start transaction: %v", err)
	return
	}

	var followerID int64

	if remoteUser != nil {
	followerID = remoteUser.ID
	} else {
	// Add follower locally, since it wasn't found before
	res, err := t.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox) VALUES (?, ?, ?)", fullActor.ID, fullActor.Inbox, fullActor.Endpoints.SharedInbox)
	if err != nil {
	// if duplicate key, res will be nil and panic on
	// res.LastInsertId below
	t.Rollback()
	log.Error("Couldn't add new remoteuser in DB: %v\n", err)
	return
	}

	followerID, err = res.LastInsertId()
	if err != nil {
	t.Rollback()
	log.Error("no lastinsertid for followers, rolling back: %v", err)
	return
	}

	// Add in key
	_, err = t.Exec("INSERT INTO remoteuserkeys (id, remote_user_id, public_key) VALUES (?, ?, ?)", fullActor.PublicKey.ID, followerID, fullActor.PublicKey.PublicKeyPEM)
	if err != nil {
	if !app.db.isDuplicateKeyErr(err) {
	t.Rollback()
	log.Error("Couldn't add follower keys in DB: %v\n", err)
	return
	}
	}
	}

	// Add follow
	_, err = t.Exec("INSERT INTO remotefollows (collection_id, remote_user_id, created) VALUES (?, ?, "+app.db.now()+")", c.ID, followerID)
	if err != nil {
	if !app.db.isDuplicateKeyErr(err) {
	t.Rollback()
	log.Error("Couldn't add follower in DB: %v\n", err)
	return
	}
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	log.Error("Rolling back after Commit(): %v\n", err)
	return
	}
	} else if isUnfollow {
	// Remove follower locally
	_, err = app.db.Exec("DELETE FROM remotefollows WHERE collection_id = ? AND remote_user_id = (SELECT id FROM remoteusers WHERE actor_id = ?)", c.ID, to.String())
	if err != nil {
	log.Error("Couldn't remove follower from DB: %v\n", err)
	}
	}
	}()

	return nil
	}

	func makeActivityPost(hostName string, p *activitystreams.Person, url string, m interface{}) error {
	log.Info("POST %s", url)
	b, err := json.Marshal(m)
	if err != nil {
	return err
	}

	r, _ := http.NewRequest("POST", url, bytes.NewBuffer(b))
	r.Header.Add("Content-Type", "application/activity+json")
	r.Header.Set("User-Agent", ServerUserAgent(hostName))
	h := sha256.New()
	h.Write(b)
	r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil)))

	// Sign using the 'Signature' header
	privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey())
	if err != nil {
	return err
	}
	signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"})
	err = signer.SignSigHeader(r)
	if err != nil {
	log.Error("Can't sign: %v", err)
	}

	if debugging {
	dump, err := httputil.DumpRequestOut(r, true)
	if err != nil {
	log.Error("Can't dump: %v", err)
	} else {
	log.Info("%s", dump)
	}
	}

	resp, err := activityPubClient().Do(r)
	if err != nil {
	return err
	}
	if resp != nil && resp.Body != nil {
	defer resp.Body.Close()
	}

	body, err := ioutil.ReadAll(resp.Body)
	if err != nil {
	return err
	}
	if debugging {
	log.Info("Status : %s", resp.Status)
	log.Info("Response: %s", body)
	}

	return nil
	}

	func resolveIRI(hostName, url string) ([]byte, error) {
	log.Info("GET %s", url)

	r, _ := http.NewRequest("GET", url, nil)
	r.Header.Add("Accept", "application/activity+json")
	r.Header.Set("User-Agent", ServerUserAgent(hostName))

	p := instanceColl.PersonObject()
	h := sha256.New()
	h.Write([]byte{})
	r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil)))

	// Sign using the 'Signature' header
	privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey())
	if err != nil {
	return nil, err
	}
	signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"})
	err = signer.SignSigHeader(r)
	if err != nil {
	log.Error("Can't sign: %v", err)
	}

	if debugging {
	dump, err := httputil.DumpRequestOut(r, true)
	if err != nil {
	log.Error("Can't dump: %v", err)
	} else {
	log.Info("%s", dump)
	}
	}

	resp, err := activityPubClient().Do(r)
	if err != nil {
	return nil, err
	}
	if resp != nil && resp.Body != nil {
	defer resp.Body.Close()
	}

	body, err := ioutil.ReadAll(resp.Body)
	if err != nil {
	return nil, err
	}
	if debugging {
	log.Info("Status : %s", resp.Status)
	log.Info("Response: %s", body)
	}

	return body, nil
	}

	func deleteFederatedPost(app App, p PublicPost, collID int64) error {
	if debugging {
	log.Info("Deleting federated post!")
	}
	p.Collection.hostName = app.cfg.App.Host
	actor := p.Collection.PersonObject(collID)
	na := p.ActivityObject(app)

	// Add followers
	p.Collection.ID = collID
	followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
	if err != nil {
	log.Error("Couldn't delete post (get followers)! %v", err)
	return err
	}

	inboxes := map[string][]string{}
	for _, f := range *followers {
	inbox := f.SharedInbox
	if inbox == "" {
	inbox = f.Inbox
	}
	if _, ok := inboxes[inbox]; ok {
	inboxes[inbox] = append(inboxes[inbox], f.ActorID)
	} else {
	inboxes[inbox] = []string{f.ActorID}
	}
	}

	for si, instFolls := range inboxes {
	na.CC = []string{}
	for _, f := range instFolls {
	na.CC = append(na.CC, f)
	}

	da := activitystreams.NewDeleteActivity(na)
	// Make the ID unique to ensure it works in Pleroma
	// See: https://git.pleroma.social/pleroma/pleroma/issues/1481
	da.ID += "#Delete"

	err = makeActivityPost(app.cfg.App.Host, actor, si, da)
	if err != nil {
	log.Error("Couldn't delete post! %v", err)
	}
	}
	return nil
	}

	func federatePost(app App, p PublicPost, collID int64, isUpdate bool) error {
	// If app is private, do not federate
	if app.cfg.App.Private {
	return nil
	}

	// Do not federate posts from private or protected blogs
	if p.Collection.Visibility == CollPrivate \|\| p.Collection.Visibility == CollProtected {
	return nil
	}

	if debugging {
	if isUpdate {
	log.Info("Federating updated post!")
	} else {
	log.Info("Federating new post!")
	}
	}

	actor := p.Collection.PersonObject(collID)
	na := p.ActivityObject(app)

	// Add followers
	p.Collection.ID = collID
	followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
	if err != nil {
	log.Error("Couldn't post! %v", err)
	return err
	}
	log.Info("Followers for %d: %+v", collID, followers)

	inboxes := map[string][]string{}
	for _, f := range *followers {
	inbox := f.SharedInbox
	if inbox == "" {
	inbox = f.Inbox
	}
	if _, ok := inboxes[inbox]; ok {
	// check if we're already sending to this shared inbox
	inboxes[inbox] = append(inboxes[inbox], f.ActorID)
	} else {
	// add the new shared inbox to the list
	inboxes[inbox] = []string{f.ActorID}
	}
	}

	var activity *activitystreams.Activity
	// for each one of the shared inboxes
	for si, instFolls := range inboxes {
	// add all followers from that instance
	// to the CC field
	na.CC = []string{}
	for _, f := range instFolls {
	na.CC = append(na.CC, f)
	}
	// create a new "Create" activity
	// with our article as object
	if isUpdate {
	activity = activitystreams.NewUpdateActivity(na)
	} else {
	activity = activitystreams.NewCreateActivity(na)
	activity.To = na.To
	activity.CC = na.CC
	}
	// and post it to that sharedInbox
	err = makeActivityPost(app.cfg.App.Host, actor, si, activity)
	if err != nil {
	log.Error("Couldn't post! %v", err)
	}
	}

	// re-create the object so that the CC list gets reset and has
	// the mentioned users. This might seem wasteful but the code is
	// cleaner than adding the mentioned users to CC here instead of
	// in p.ActivityObject()
	na = p.ActivityObject(app)
	for _, tag := range na.Tag {
	if tag.Type == "Mention" {
	activity = activitystreams.NewCreateActivity(na)
	activity.To = na.To
	activity.CC = na.CC
	// This here might be redundant in some cases as we might have already
	// sent this to the sharedInbox of this instance above, but we need too
	// much logic to catch this at the expense of the odd extra request.
	// I don't believe we'd ever have too many mentions in a single post that this
	// could become a burden.
	remoteUser, err := getRemoteUser(app, tag.HRef)
	if err != nil {
	log.Error("Unable to find remote user %s. Skipping: %v", tag.HRef, err)
	continue
	}
	err = makeActivityPost(app.cfg.App.Host, actor, remoteUser.Inbox, activity)
	if err != nil {
	log.Error("Couldn't post! %v", err)
	}
	}
	}

	return nil
	}

	func getRemoteUser(app App, actorID string) (RemoteUser, error) {
	u := RemoteUser{ActorID: actorID}
	var handle sql.NullString
	err := app.db.QueryRow("SELECT id, inbox, shared_inbox, handle FROM remoteusers WHERE actor_id = ?", actorID).Scan(&u.ID, &u.Inbox, &u.SharedInbox, &handle)
	switch {
	case err == sql.ErrNoRows:
	return nil, impart.HTTPError{http.StatusNotFound, "No remote user with that ID."}
	case err != nil:
	log.Error("Couldn't get remote user %s: %v", actorID, err)
	return nil, err
	}

	u.Handle = handle.String

	return &u, nil
	}

	// getRemoteUserFromHandle retrieves the profile page of a remote user
	// from the @user@server.tld handle
	func getRemoteUserFromHandle(app App, handle string) (RemoteUser, error) {
	u := RemoteUser{Handle: handle}
	err := app.db.QueryRow("SELECT id, actor_id, inbox, shared_inbox FROM remoteusers WHERE handle = ?", handle).Scan(&u.ID, &u.ActorID, &u.Inbox, &u.SharedInbox)
	switch {
	case err == sql.ErrNoRows:
	return nil, ErrRemoteUserNotFound
	case err != nil:
	log.Error("Couldn't get remote user %s: %v", handle, err)
	return nil, err
	}
	return &u, nil
	}

	func getActor(app App, actorIRI string) (activitystreams.Person, *RemoteUser, error) {
	log.Info("Fetching actor %s locally", actorIRI)
	actor := &activitystreams.Person{}
	remoteUser, err := getRemoteUser(app, actorIRI)
	if err != nil {
	if iErr, ok := err.(impart.HTTPError); ok {
	if iErr.Status == http.StatusNotFound {
	// Fetch remote actor
	log.Info("Not found; fetching actor %s remotely", actorIRI)
	actorResp, err := resolveIRI(app.cfg.App.Host, actorIRI)
	if err != nil {
	log.Error("Unable to get actor! %v", err)
	return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't fetch actor."}
	}
	if err := unmarshalActor(actorResp, actor); err != nil {
	log.Error("Unable to unmarshal actor! %v", err)
	return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't parse actor."}
	}
	} else {
	return nil, nil, err
	}
	} else {
	return nil, nil, err
	}
	} else {
	actor = remoteUser.AsPerson()
	}
	return actor, remoteUser, nil
	}

	// unmarshal actor normalizes the actor response to conform to
	// the type Person from github.com/writeas/web-core/activitysteams
	//
	// some implementations return different context field types
	// this converts any non-slice contexts into a slice
	func unmarshalActor(actorResp []byte, actor *activitystreams.Person) error {
	// FIXME: Hubzilla has an object for the Actor's url: cannot unmarshal object into Go struct field Person.url of type string

	// flexActor overrides the Context field to allow
	// all valid representations during unmarshal
	flexActor := struct {
	activitystreams.Person
	Context json.RawMessage `json:"@context,omitempty"`
	}{}
	if err := json.Unmarshal(actorResp, &flexActor); err != nil {
	return err
	}

	actor.Endpoints = flexActor.Endpoints
	actor.Followers = flexActor.Followers
	actor.Following = flexActor.Following
	actor.ID = flexActor.ID
	actor.Icon = flexActor.Icon
	actor.Inbox = flexActor.Inbox
	actor.Name = flexActor.Name
	actor.Outbox = flexActor.Outbox
	actor.PreferredUsername = flexActor.PreferredUsername
	actor.PublicKey = flexActor.PublicKey
	actor.Summary = flexActor.Summary
	actor.Type = flexActor.Type
	actor.URL = flexActor.URL

	func(val interface{}) {
	switch val.(type) {
	case []interface{}:
	// already a slice, do nothing
	actor.Context = val.([]interface{})
	default:
	actor.Context = []interface{}{val}
	}
	}(flexActor.Context)

	return nil
	}

	func setCacheControl(w http.ResponseWriter, ttl time.Duration) {
	w.Header().Set("Cache-Control", fmt.Sprintf("public, max-age=%.0f", ttl.Seconds()))
	}
	diff --git a/admin.go b/admin.go
	index 2b757ca..6408cfe 100644
	--- a/admin.go
	+++ b/admin.go
	@@ -1,675 +1,675 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"fmt"
	"net/http"
	"runtime"
	"strconv"
	"strings"
	"time"

	"github.com/gorilla/mux"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/auth"
	"github.com/writeas/web-core/log"
	"github.com/writeas/web-core/passgen"
	"github.com/writefreely/writefreely/appstats"
	"github.com/writefreely/writefreely/config"
	)

	var (
	appStartTime = time.Now()
	sysStatus systemStatus
	)

	const adminUsersPerPage = 30

	type systemStatus struct {
	Uptime string
	NumGoroutine int

	// General statistics.
	MemAllocated string // bytes allocated and still in use
	MemTotal string // bytes allocated (even if freed)
	MemSys string // bytes obtained from system (sum of XxxSys below)
	Lookups uint64 // number of pointer lookups
	MemMallocs uint64 // number of mallocs
	MemFrees uint64 // number of frees

	// Main allocation heap statistics.
	HeapAlloc string // bytes allocated and still in use
	HeapSys string // bytes obtained from system
	HeapIdle string // bytes in idle spans
	HeapInuse string // bytes in non-idle span
	HeapReleased string // bytes released to the OS
	HeapObjects uint64 // total number of allocated objects

	// Low-level fixed-size structure allocator statistics.
	// Inuse is bytes used now.
	// Sys is bytes obtained from system.
	StackInuse string // bootstrap stacks
	StackSys string
	MSpanInuse string // mspan structures
	MSpanSys string
	MCacheInuse string // mcache structures
	MCacheSys string
	BuckHashSys string // profiling bucket hash table
	GCSys string // GC metadata
	OtherSys string // other system allocations

	// Garbage collector statistics.
	NextGC string // next run in HeapAlloc time (bytes)
	LastGC string // last run in absolute time (ns)
	PauseTotalNs string
	PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256]
	NumGC uint32
	}

	type inspectedCollection struct {
	CollectionObj
	Followers int
	LastPost string
	}

	type instanceContent struct {
	ID string
	Type string
	Title sql.NullString
	Content string
	Updated time.Time
	}

	type AdminPage struct {
	UpdateAvailable bool
	}

	func NewAdminPage(app App) AdminPage {
	ap := &AdminPage{}
	if app.updates != nil {
	ap.UpdateAvailable = app.updates.AreAvailableNoCheck()
	}
	return ap
	}

	func (c instanceContent) UpdatedFriendly() string {
	/*
	// TODO: accept a locale in this method and use that for the format
	var loc monday.Locale = monday.LocaleEnUS
	return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc)
	*/
	return c.Updated.Format("January 2, 2006, 3:04 PM")
	}

	func handleViewAdminDash(app App, u User, w http.ResponseWriter, r *http.Request) error {
	p := struct {
	*UserPage
	*AdminPage
	Message string

	UsersCount, CollectionsCount, PostsCount int64
	}{
	UserPage: NewUserPage(app, r, u, "Admin", nil),
	AdminPage: NewAdminPage(app),
	Message: r.FormValue("m"),
	}

	// Get user stats
	p.UsersCount = app.db.GetAllUsersCount()
	var err error
	p.CollectionsCount, err = app.db.GetTotalCollections()
	if err != nil {
	return err
	}
	p.PostsCount, err = app.db.GetTotalPosts()
	if err != nil {
	return err
	}

	showUserPage(w, "admin", p)
	return nil
	}

	func handleViewAdminMonitor(app App, u User, w http.ResponseWriter, r *http.Request) error {
	updateAppStats()
	p := struct {
	*UserPage
	*AdminPage
	SysStatus systemStatus
	Config config.AppCfg

	Message, ConfigMessage string
	}{
	UserPage: NewUserPage(app, r, u, "Admin", nil),
	AdminPage: NewAdminPage(app),
	SysStatus: sysStatus,
	Config: app.cfg.App,

	Message: r.FormValue("m"),
	ConfigMessage: r.FormValue("cm"),
	}

	showUserPage(w, "monitor", p)
	return nil
	}

	func handleViewAdminSettings(app App, u User, w http.ResponseWriter, r *http.Request) error {
	p := struct {
	*UserPage
	*AdminPage
	Config config.AppCfg

	Message, ConfigMessage string
	}{
	UserPage: NewUserPage(app, r, u, "Admin", nil),
	AdminPage: NewAdminPage(app),
	Config: app.cfg.App,

	Message: r.FormValue("m"),
	ConfigMessage: r.FormValue("cm"),
	}

	showUserPage(w, "app-settings", p)
	return nil
	}

	func handleViewAdminUsers(app App, u User, w http.ResponseWriter, r *http.Request) error {
	p := struct {
	*UserPage
	*AdminPage
	Config config.AppCfg
	Message string
	Flashes []string

	Users *[]User
	CurPage int
	TotalUsers int64
	TotalPages []int
	}{
	UserPage: NewUserPage(app, r, u, "Users", nil),
	AdminPage: NewAdminPage(app),
	Config: app.cfg.App,
	Message: r.FormValue("m"),
	}

	p.Flashes, _ = getSessionFlashes(app, w, r, nil)
	p.TotalUsers = app.db.GetAllUsersCount()
	ttlPages := p.TotalUsers / adminUsersPerPage
	p.TotalPages = []int{}
	for i := 1; i <= int(ttlPages); i++ {
	p.TotalPages = append(p.TotalPages, i)
	}

	var err error
	p.CurPage, err = strconv.Atoi(r.FormValue("p"))
	if err != nil \|\| p.CurPage < 1 {
	p.CurPage = 1
	} else if p.CurPage > int(ttlPages) {
	p.CurPage = int(ttlPages)
	}

	p.Users, err = app.db.GetAllUsers(uint(p.CurPage))
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)}
	}

	showUserPage(w, "users", p)
	return nil
	}

	func handleViewAdminUser(app App, u User, w http.ResponseWriter, r *http.Request) error {
	vars := mux.Vars(r)
	username := vars["username"]
	if username == "" {
	return impart.HTTPError{http.StatusFound, "/admin/users"}
	}

	p := struct {
	*UserPage
	*AdminPage
	Config config.AppCfg
	Message string

	User *User
	Colls []inspectedCollection
	LastPost string
	NewPassword string
	TotalPosts int64
	ClearEmail string
	}{
	AdminPage: NewAdminPage(app),
	Config: app.cfg.App,
	Message: r.FormValue("m"),
	Colls: []inspectedCollection{},
	}

	var err error
	p.User, err = app.db.GetUserForAuth(username)
	if err != nil {
	if err == ErrUserNotFound {
	return err
	}
	log.Error("Could not get user: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}

	flashes, _ := getSessionFlashes(app, w, r, nil)
	for _, flash := range flashes {
	if strings.HasPrefix(flash, "SUCCESS: ") {
	p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ")
	p.ClearEmail = p.User.EmailClear(app.keys)
	}
	}
	p.UserPage = NewUserPage(app, r, u, p.User.Username, nil)
	p.TotalPosts = app.db.GetUserPostsCount(p.User.ID)
	lp, err := app.db.GetUserLastPostTime(p.User.ID)
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)}
	}
	if lp != nil {
	p.LastPost = lp.Format("January 2, 2006, 3:04 PM")
	}

	colls, err := app.db.GetCollections(p.User, app.cfg.App.Host)
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)}
	}
	for _, c := range *colls {
	ic := inspectedCollection{
	CollectionObj: CollectionObj{Collection: c},
	}

	if app.cfg.App.Federation {
	folls, err := app.db.GetAPFollowers(&c)
	if err == nil {
	// TODO: handle error here (at least log it)
	ic.Followers = len(*folls)
	}
	}

	app.db.GetPostsCount(&ic.CollectionObj, true)

	lp, err := app.db.GetCollectionLastPostTime(c.ID)
	if err != nil {
	log.Error("Didn't get last post time for collection %d: %v", c.ID, err)
	}
	if lp != nil {
	ic.LastPost = lp.Format("January 2, 2006, 3:04 PM")
	}

	p.Colls = append(p.Colls, ic)
	}

	showUserPage(w, "view-user", p)
	return nil
	}

	func handleAdminDeleteUser(app App, u User, w http.ResponseWriter, r *http.Request) error {
	if !u.IsAdmin() {
	return impart.HTTPError{http.StatusForbidden, "Administrator privileges required for this action"}
	}

	vars := mux.Vars(r)
	username := vars["username"]
	confirmUsername := r.PostFormValue("confirm-username")

	if confirmUsername != username {
	return impart.HTTPError{http.StatusBadRequest, "Username was not confirmed"}
	}

	user, err := app.db.GetUserForAuth(username)
	if err == ErrUserNotFound {
	return impart.HTTPError{http.StatusNotFound, fmt.Sprintf("User '%s' was not found", username)}
	} else if err != nil {
	log.Error("get user for deletion: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user with username '%s': %v", username, err)}
	}

	err = app.db.DeleteAccount(user.ID)
	if err != nil {
	log.Error("delete user %s: %v", user.Username, err)
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not delete user account for '%s': %v", username, err)}
	}

	_ = addSessionFlash(app, w, r, fmt.Sprintf("User \"%s\" was deleted successfully.", username), nil)
	return impart.HTTPError{http.StatusFound, "/admin/users"}
	}

	func handleAdminToggleUserStatus(app App, u User, w http.ResponseWriter, r *http.Request) error {
	vars := mux.Vars(r)
	username := vars["username"]
	if username == "" {
	return impart.HTTPError{http.StatusFound, "/admin/users"}
	}

	user, err := app.db.GetUserForAuth(username)
	if err != nil {
	log.Error("failed to get user: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)}
	}
	if user.IsSilenced() {
	err = app.db.SetUserStatus(user.ID, UserActive)
	} else {
	err = app.db.SetUserStatus(user.ID, UserSilenced)

	// reset the cache to removed silence user posts
	updateTimelineCache(app.timeline, true)
	}
	if err != nil {
	log.Error("toggle user silenced: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)}
	}
	return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)}
	}

	func handleAdminResetUserPass(app App, u User, w http.ResponseWriter, r *http.Request) error {
	vars := mux.Vars(r)
	username := vars["username"]
	if username == "" {
	return impart.HTTPError{http.StatusFound, "/admin/users"}
	}

	// Generate new random password since none supplied
	pass := passgen.NewWordish()
	hashedPass, err := auth.HashPass([]byte(pass))
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
	}

	userIDVal := r.FormValue("user")
	log.Info("ADMIN: Changing user %s password", userIDVal)
	id, err := strconv.Atoi(userIDVal)
	if err != nil {
	return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)}
	}

	err = app.db.ChangePassphrase(int64(id), true, "", hashedPass)
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
	}
	log.Info("ADMIN: Successfully changed.")

	addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil)

	return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)}
	}

	func handleViewAdminPages(app App, u User, w http.ResponseWriter, r *http.Request) error {
	p := struct {
	*UserPage
	*AdminPage
	Config config.AppCfg
	Message string

	Pages []*instanceContent
	}{
	UserPage: NewUserPage(app, r, u, "Pages", nil),
	AdminPage: NewAdminPage(app),
	Config: app.cfg.App,
	Message: r.FormValue("m"),
	}

	var err error
	p.Pages, err = app.db.GetInstancePages()
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)}
	}

	// Add in default pages
	var hasAbout, hasPrivacy bool
	for i, c := range p.Pages {
	if hasAbout && hasPrivacy {
	break
	}
	if c.ID == "about" {
	hasAbout = true
	if !c.Title.Valid {
	p.Pages[i].Title = defaultAboutTitle(app.cfg)
	}
	} else if c.ID == "privacy" {
	hasPrivacy = true
	if !c.Title.Valid {
	p.Pages[i].Title = defaultPrivacyTitle()
	}
	}
	}
	if !hasAbout {
	p.Pages = append(p.Pages, &instanceContent{
	ID: "about",
	Title: defaultAboutTitle(app.cfg),
	Content: defaultAboutPage(app.cfg),
	Updated: defaultPageUpdatedTime,
	})
	}
	if !hasPrivacy {
	p.Pages = append(p.Pages, &instanceContent{
	ID: "privacy",
	Title: defaultPrivacyTitle(),
	Content: defaultPrivacyPolicy(app.cfg),
	Updated: defaultPageUpdatedTime,
	})
	}

	showUserPage(w, "pages", p)
	return nil
	}

	func handleViewAdminPage(app App, u User, w http.ResponseWriter, r *http.Request) error {
	vars := mux.Vars(r)
	slug := vars["slug"]
	if slug == "" {
	return impart.HTTPError{http.StatusFound, "/admin/pages"}
	}

	p := struct {
	*UserPage
	*AdminPage
	Config config.AppCfg
	Message string

	Banner *instanceContent
	Content *instanceContent
	}{
	AdminPage: NewAdminPage(app),
	Config: app.cfg.App,
	Message: r.FormValue("m"),
	}

	var err error
	// Get pre-defined pages, or select slug
	if slug == "about" {
	p.Content, err = getAboutPage(app)
	} else if slug == "privacy" {
	p.Content, err = getPrivacyPage(app)
	} else if slug == "landing" {
	p.Banner, err = getLandingBanner(app)
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
	}
	p.Content, err = getLandingBody(app)
	p.Content.ID = "landing"
	} else if slug == "reader" {
	p.Content, err = getReaderSection(app)
	} else {
	p.Content, err = app.db.GetDynamicContent(slug)
	}
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)}
	}
	title := "New page"
	if p.Content != nil {
	title = "Edit " + p.Content.ID
	} else {
	p.Content = &instanceContent{}
	}
	p.UserPage = NewUserPage(app, r, u, title, nil)

	showUserPage(w, "view-page", p)
	return nil
	}

	func handleAdminUpdateSite(app App, u User, w http.ResponseWriter, r *http.Request) error {
	vars := mux.Vars(r)
	id := vars["page"]

	// Validate
	if id != "about" && id != "privacy" && id != "landing" && id != "reader" {
	return impart.HTTPError{http.StatusNotFound, "No such page."}
	}

	var err error
	m := ""
	if id == "landing" {
	// Handle special landing page
	err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section")
	if err != nil {
	m = "?m=" + err.Error()
	return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
	}
	err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section")
	} else if id == "reader" {
	// Update sections with titles
	err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section")
	} else {
	// Update page
	err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page")
	}
	if err != nil {
	m = "?m=" + err.Error()
	}
	return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
	}

	func handleAdminUpdateConfig(apper Apper, u User, w http.ResponseWriter, r http.Request) error {
	apper.App().cfg.App.SiteName = r.FormValue("site_name")
	apper.App().cfg.App.SiteDesc = r.FormValue("site_desc")
	apper.App().cfg.App.Landing = r.FormValue("landing")
	apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on"
	apper.App().cfg.App.OpenDeletion = r.FormValue("open_deletion") == "on"
	mul, err := strconv.Atoi(r.FormValue("min_username_len"))
	if err == nil {
	apper.App().cfg.App.MinUsernameLen = mul
	}
	mb, err := strconv.Atoi(r.FormValue("max_blogs"))
	if err == nil {
	apper.App().cfg.App.MaxBlogs = mb
	}
	apper.App().cfg.App.Federation = r.FormValue("federation") == "on"
	apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on"
	apper.App().cfg.App.Monetization = r.FormValue("monetization") == "on"
	apper.App().cfg.App.Private = r.FormValue("private") == "on"
	apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on"
	if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil {
	log.Info("Initializing local timeline...")
	initLocalTimeline(apper.App())
	}
	apper.App().cfg.App.UserInvites = r.FormValue("user_invites")
	if apper.App().cfg.App.UserInvites == "none" {
	apper.App().cfg.App.UserInvites = ""
	}
	apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility")

	m := "?cm=Configuration+saved."
	err = apper.SaveConfig(apper.App().cfg)
	if err != nil {
	m = "?cm=" + err.Error()
	}
	return impart.HTTPError{http.StatusFound, "/admin/settings" + m + "#config"}
	}

	func updateAppStats() {
	sysStatus.Uptime = appstats.TimeSincePro(appStartTime)

	m := new(runtime.MemStats)
	runtime.ReadMemStats(m)
	sysStatus.NumGoroutine = runtime.NumGoroutine()

	sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc))
	sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc))
	sysStatus.MemSys = appstats.FileSize(int64(m.Sys))
	sysStatus.Lookups = m.Lookups
	sysStatus.MemMallocs = m.Mallocs
	sysStatus.MemFrees = m.Frees

	sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc))
	sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys))
	sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle))
	sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse))
	sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased))
	sysStatus.HeapObjects = m.HeapObjects

	sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse))
	sysStatus.StackSys = appstats.FileSize(int64(m.StackSys))
	sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse))
	sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys))
	sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse))
	sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys))
	sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys))
	sysStatus.GCSys = appstats.FileSize(int64(m.GCSys))
	sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys))

	sysStatus.NextGC = appstats.FileSize(int64(m.NextGC))
	sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000)
	sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000)
	sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000)
	sysStatus.NumGC = m.NumGC
	}

	func adminResetPassword(app App, u User, newPass string) error {
	hashedPass, err := auth.HashPass([]byte(newPass))
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
	}

	err = app.db.ChangePassphrase(u.ID, true, "", hashedPass)
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
	}
	return nil
	}

	func handleViewAdminUpdates(app App, u User, w http.ResponseWriter, r *http.Request) error {
	check := r.URL.Query().Get("check")

	if check == "now" && app.cfg.App.UpdateChecks {
	app.updates.CheckNow()
	}

	p := struct {
	*UserPage
	*AdminPage
	CurReleaseNotesURL string
	LastChecked string
	LastChecked8601 string
	LatestVersion string
	LatestReleaseURL string
	LatestReleaseNotesURL string
	CheckFailed bool
	}{
	UserPage: NewUserPage(app, r, u, "Updates", nil),
	AdminPage: NewAdminPage(app),
	}
	p.CurReleaseNotesURL = wfReleaseNotesURL(p.Version)
	if app.cfg.App.UpdateChecks {
	p.LastChecked = app.updates.lastCheck.Format("January 2, 2006, 3:04 PM")
	p.LastChecked8601 = app.updates.lastCheck.Format("2006-01-02T15:04:05Z")
	p.LatestVersion = app.updates.LatestVersion()
	p.LatestReleaseURL = app.updates.ReleaseURL()
	p.LatestReleaseNotesURL = app.updates.ReleaseNotesURL()
	p.UpdateAvailable = app.updates.AreAvailable()
	p.CheckFailed = app.updates.checkError != nil
	}

	showUserPage(w, "app-updates", p)
	return nil
	}
	diff --git a/app.go b/app.go
	index 149eb4b..23cdf56 100644
	--- a/app.go
	+++ b/app.go
	@@ -1,945 +1,955 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"crypto/tls"
	"database/sql"
	+ _ "embed"
	"fmt"
	"html/template"
	"io/ioutil"
	"net/http"
	"net/url"
	"os"
	"os/signal"
	"path/filepath"
	"regexp"
	"strings"
	"syscall"
	"time"

	"github.com/gorilla/mux"
	"github.com/gorilla/schema"
	"github.com/gorilla/sessions"
	"github.com/manifoldco/promptui"
	stripmd "github.com/writeas/go-strip-markdown/v2"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/auth"
	"github.com/writeas/web-core/converter"
	"github.com/writeas/web-core/log"
	+ "golang.org/x/crypto/acme/autocert"
	+
	"github.com/writefreely/writefreely/author"
	"github.com/writefreely/writefreely/config"
	"github.com/writefreely/writefreely/key"
	"github.com/writefreely/writefreely/migrations"
	"github.com/writefreely/writefreely/page"
	- "golang.org/x/crypto/acme/autocert"
	)

	const (
	staticDir = "static"
	assumedTitleLen = 80
	postsPerPage = 10

	serverSoftware = "WriteFreely"
	softwareURL = "https://writefreely.org"
	)

	var (
	debugging bool

	// Software version can be set from git env using -ldflags
	- softwareVer = "0.13.1"
	+ softwareVer = "0.13.2"

	// DEPRECATED VARS
	isSingleUser bool
	)

	// App holds data and configuration for an individual WriteFreely instance.
	type App struct {
	router *mux.Router
	shttp *http.ServeMux
	db *datastore
	cfg *config.Config
	cfgFile string
	keys *key.Keychain
	sessionStore sessions.Store
	formDecoder *schema.Decoder
	updates *updatesCache

	timeline *localTimeline
	}

	// DB returns the App's datastore
	func (app App) DB() datastore {
	return app.db
	}

	// Router returns the App's router
	func (app App) Router() mux.Router {
	return app.router
	}

	// Config returns the App's current configuration.
	func (app App) Config() config.Config {
	return app.cfg
	}

	// SetConfig updates the App's Config to the given value.
	func (app App) SetConfig(cfg config.Config) {
	app.cfg = cfg
	}

	// SetKeys updates the App's Keychain to the given value.
	func (app App) SetKeys(k key.Keychain) {
	app.keys = k
	}

	func (app *App) SessionStore() sessions.Store {
	return app.sessionStore
	}

	func (app *App) SetSessionStore(s sessions.Store) {
	app.sessionStore = s
	}

	// Apper is the interface for getting data into and out of a WriteFreely
	// instance (or "App").
	//
	// App returns the App for the current instance.
	//
	// LoadConfig reads an app configuration into the App, returning any error
	// encountered.
	//
	// SaveConfig persists the current App configuration.
	//
	// LoadKeys reads the App's encryption keys and loads them into its
	// key.Keychain.
	type Apper interface {
	App() *App

	LoadConfig() error
	SaveConfig(*config.Config) error

	LoadKeys() error

	ReqLog(r *http.Request, status int, timeSince time.Duration) string
	}

	// App returns the App
	func (app App) App() App {
	return app
	}

	// LoadConfig loads and parses a config file.
	func (app *App) LoadConfig() error {
	log.Info("Loading %s configuration...", app.cfgFile)
	cfg, err := config.Load(app.cfgFile)
	if err != nil {
	log.Error("Unable to load configuration: %v", err)
	os.Exit(1)
	return err
	}
	app.cfg = cfg
	return nil
	}

	// SaveConfig saves the given Config to disk -- namely, to the App's cfgFile.
	func (app App) SaveConfig(c config.Config) error {
	return config.Save(c, app.cfgFile)
	}

	// LoadKeys reads all needed keys from disk into the App. In order to use the
	// configured `Server.KeysParentDir`, you must call initKeyPaths(App) before
	// this.
	func (app *App) LoadKeys() error {
	var err error
	app.keys = &key.Keychain{}

	if debugging {
	log.Info(" %s", emailKeyPath)
	}

	executable, err := os.Executable()
	if err != nil {
	executable = "writefreely"
	} else {
	executable = filepath.Base(executable)
	}

	app.keys.EmailKey, err = ioutil.ReadFile(emailKeyPath)
	if err != nil {
	return err
	}

	if debugging {
	log.Info(" %s", cookieAuthKeyPath)
	}
	app.keys.CookieAuthKey, err = ioutil.ReadFile(cookieAuthKeyPath)
	if err != nil {
	return err
	}

	if debugging {
	log.Info(" %s", cookieKeyPath)
	}
	app.keys.CookieKey, err = ioutil.ReadFile(cookieKeyPath)
	if err != nil {
	return err
	}

	if debugging {
	log.Info(" %s", csrfKeyPath)
	}
	app.keys.CSRFKey, err = ioutil.ReadFile(csrfKeyPath)
	if err != nil {
	if os.IsNotExist(err) {
	log.Error(`Missing key: %s.

	Run this command to generate missing keys:
	%s keys generate

	`, csrfKeyPath, executable)
	}
	return err
	}

	return nil
	}

	func (app App) ReqLog(r http.Request, status int, timeSince time.Duration) string {
	return fmt.Sprintf("\"%s %s\" %d %s \"%s\"", r.Method, r.RequestURI, status, timeSince, r.UserAgent())
	}

	// handleViewHome shows page at root path. It checks the configuration and
	// authentication state to show the correct page.
	func handleViewHome(app App, w http.ResponseWriter, r http.Request) error {
	if app.cfg.App.SingleUser {
	// Render blog index
	return handleViewCollection(app, w, r)
	}

	// Multi-user instance
	forceLanding := r.FormValue("landing") == "1"
	if !forceLanding {
	// Show correct page based on user auth status and configured landing path
	u := getUserSession(app, r)

	if app.cfg.App.Chorus {
	// This instance is focused on reading, so show Reader on home route if not
	// private or a private-instance user is logged in.
	if !app.cfg.App.Private \|\| u != nil {
	return viewLocalTimeline(app, w, r)
	}
	}

	if u != nil {
	// User is logged in, so show the Pad
	return handleViewPad(app, w, r)
	}

	if app.cfg.App.Private {
	return viewLogin(app, w, r)
	}

	if land := app.cfg.App.LandingPath(); land != "/" {
	return impart.HTTPError{http.StatusFound, land}
	}
	}

	return handleViewLanding(app, w, r)
	}

	func handleViewLanding(app App, w http.ResponseWriter, r http.Request) error {
	forceLanding := r.FormValue("landing") == "1"

	p := struct {
	page.StaticPage
	*OAuthButtons
	Flashes []template.HTML
	Banner template.HTML
	Content template.HTML

	ForcedLanding bool
	}{
	StaticPage: pageForReq(app, r),
	OAuthButtons: NewOAuthButtons(app.Config()),
	ForcedLanding: forceLanding,
	}

	banner, err := getLandingBanner(app)
	if err != nil {
	log.Error("unable to get landing banner: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
	}
	p.Banner = template.HTML(applyMarkdown([]byte(banner.Content), "", app.cfg))

	content, err := getLandingBody(app)
	if err != nil {
	log.Error("unable to get landing content: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get content: %v", err)}
	}
	p.Content = template.HTML(applyMarkdown([]byte(content.Content), "", app.cfg))

	// Get error messages
	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	// Ignore this
	log.Error("Unable to get session in handleViewHome; ignoring: %v", err)
	}
	flashes, _ := getSessionFlashes(app, w, r, session)
	for _, flash := range flashes {
	p.Flashes = append(p.Flashes, template.HTML(flash))
	}

	// Show landing page
	return renderPage(w, "landing.tmpl", p)
	}

	func handleTemplatedPage(app App, w http.ResponseWriter, r http.Request, t *template.Template) error {
	p := struct {
	page.StaticPage
	ContentTitle string
	Content template.HTML
	PlainContent string
	Updated string

	AboutStats *InstanceStats
	}{
	StaticPage: pageForReq(app, r),
	}
	if r.URL.Path == "/about" \|\| r.URL.Path == "/privacy" {
	var c *instanceContent
	var err error

	if r.URL.Path == "/about" {
	c, err = getAboutPage(app)

	// Fetch stats
	p.AboutStats = &InstanceStats{}
	p.AboutStats.NumPosts, _ = app.db.GetTotalPosts()
	p.AboutStats.NumBlogs, _ = app.db.GetTotalCollections()
	} else {
	c, err = getPrivacyPage(app)
	}

	if err != nil {
	return err
	}
	p.ContentTitle = c.Title.String
	p.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg))
	p.PlainContent = shortPostDescription(stripmd.Strip(c.Content))
	if !c.Updated.IsZero() {
	p.Updated = c.Updated.Format("January 2, 2006")
	}
	}

	// Serve templated page
	err := t.ExecuteTemplate(w, "base", p)
	if err != nil {
	log.Error("Unable to render page: %v", err)
	}
	return nil
	}

	func pageForReq(app App, r http.Request) page.StaticPage {
	p := page.StaticPage{
	AppCfg: app.cfg.App,
	Path: r.URL.Path,
	Version: "v" + softwareVer,
	}

	+ // Use custom style, if file exists
	+ if _, err := os.Stat(filepath.Join(staticDir, "local", "custom.css")); err == nil {
	+ p.CustomCSS = true
	+ }
	+
	// Add user information, if given
	var u *User
	accessToken := r.FormValue("t")
	if accessToken != "" {
	userID := app.db.GetUserID(accessToken)
	if userID != -1 {
	var err error
	u, err = app.db.GetUserByID(userID)
	if err == nil {
	p.Username = u.Username
	}
	}
	} else {
	u = getUserSession(app, r)
	if u != nil {
	p.Username = u.Username
	p.IsAdmin = u != nil && u.IsAdmin()
	p.CanInvite = canUserInvite(app.cfg, p.IsAdmin)
	}
	}
	p.CanViewReader = !app.cfg.App.Private \|\| u != nil

	return p
	}

	var fileRegex = regexp.MustCompile("/([^/]\\.[^/])$")

	// Initialize loads the app configuration and initializes templates, keys,
	// session, route handlers, and the database connection.
	func Initialize(apper Apper, debug bool) (*App, error) {
	debugging = debug

	apper.LoadConfig()

	// Load templates
	err := InitTemplates(apper.App().Config())
	if err != nil {
	return nil, fmt.Errorf("load templates: %s", err)
	}

	// Load keys and set up session
	initKeyPaths(apper.App()) // TODO: find a better way to do this, since it's unneeded in all Apper implementations
	err = InitKeys(apper)
	if err != nil {
	return nil, fmt.Errorf("init keys: %s", err)
	}
	apper.App().InitUpdates()

	apper.App().InitSession()

	apper.App().InitDecoder()

	err = ConnectToDatabase(apper.App())
	if err != nil {
	return nil, fmt.Errorf("connect to DB: %s", err)
	}

	initActivityPub(apper.App())

	if apper.App().cfg.Letters.Domain != "" \|\| apper.App().cfg.Letters.MailgunPrivate != "" {
	if apper.App().cfg.Letters.Domain == "" {
	log.Error("[FAILED] Starting publish jobs queue: no [letters]domain config value set.")
	} else if apper.App().cfg.Letters.MailgunPrivate == "" {
	log.Error("[FAILED] Starting publish jobs queue: no [letters]mailgun_private config value set.")
	} else {
	log.Info("Starting publish jobs queue...")
	go startPublishJobsQueue(apper.App())
	}
	}

	// Handle local timeline, if enabled
	if apper.App().cfg.App.LocalTimeline {
	log.Info("Initializing local timeline...")
	initLocalTimeline(apper.App())
	}

	return apper.App(), nil
	}

	func Serve(app App, r mux.Router) {
	log.Info("Going to serve...")

	isSingleUser = app.cfg.App.SingleUser
	app.cfg.Server.Dev = debugging

	// Handle shutdown
	c := make(chan os.Signal, 2)
	signal.Notify(c, os.Interrupt, syscall.SIGTERM)
	go func() {
	<-c
	log.Info("Shutting down...")
	shutdown(app)
	log.Info("Done.")
	os.Exit(0)
	}()

	// Start gopher server
	if app.cfg.Server.GopherPort > 0 && !app.cfg.App.Private {
	go initGopher(app)
	}

	// Start web application server
	var bindAddress = app.cfg.Server.Bind
	if bindAddress == "" {
	bindAddress = "localhost"
	}
	var err error
	if app.cfg.IsSecureStandalone() {
	if app.cfg.Server.Autocert {
	m := &autocert.Manager{
	Prompt: autocert.AcceptTOS,
	Cache: autocert.DirCache(app.cfg.Server.TLSCertPath),
	}
	host, err := url.Parse(app.cfg.App.Host)
	if err != nil {
	log.Error("[WARNING] Unable to parse configured host! %s", err)
	log.Error(`[WARNING] ALL hosts are allowed, which can open you to an attack where
	clients connect to a server by IP address and pretend to be asking for an
	incorrect host name, and cause you to reach the CA's rate limit for certificate
	requests. We recommend supplying a valid host name.`)
	log.Info("Using autocert on ANY host")
	} else {
	log.Info("Using autocert on host %s", host.Host)
	m.HostPolicy = autocert.HostWhitelist(host.Host)
	}
	s := &http.Server{
	Addr: ":https",
	Handler: r,
	TLSConfig: &tls.Config{
	GetCertificate: m.GetCertificate,
	},
	}
	s.SetKeepAlivesEnabled(false)

	go func() {
	log.Info("Serving redirects on http://%s:80", bindAddress)
	err = http.ListenAndServe(":80", m.HTTPHandler(nil))
	log.Error("Unable to start redirect server: %v", err)
	}()

	log.Info("Serving on https://%s:443", bindAddress)
	log.Info("---")
	err = s.ListenAndServeTLS("", "")
	} else {
	go func() {
	log.Info("Serving redirects on http://%s:80", bindAddress)
	err = http.ListenAndServe(fmt.Sprintf("%s:80", bindAddress), http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
	http.Redirect(w, r, app.cfg.App.Host, http.StatusMovedPermanently)
	}))
	log.Error("Unable to start redirect server: %v", err)
	}()

	log.Info("Serving on https://%s:443", bindAddress)
	log.Info("Using manual certificates")
	log.Info("---")
	err = http.ListenAndServeTLS(fmt.Sprintf("%s:443", bindAddress), app.cfg.Server.TLSCertPath, app.cfg.Server.TLSKeyPath, r)
	}
	} else {
	log.Info("Serving on http://%s:%d\n", bindAddress, app.cfg.Server.Port)
	log.Info("---")
	err = http.ListenAndServe(fmt.Sprintf("%s:%d", bindAddress, app.cfg.Server.Port), r)
	}
	if err != nil {
	log.Error("Unable to start: %v", err)
	os.Exit(1)
	}
	}

	func (app *App) InitDecoder() {
	// TODO: do this at the package level, instead of the App level
	// Initialize modules
	app.formDecoder = schema.NewDecoder()
	app.formDecoder.RegisterConverter(converter.NullJSONString{}, converter.ConvertJSONNullString)
	app.formDecoder.RegisterConverter(converter.NullJSONBool{}, converter.ConvertJSONNullBool)
	app.formDecoder.RegisterConverter(sql.NullString{}, converter.ConvertSQLNullString)
	app.formDecoder.RegisterConverter(sql.NullBool{}, converter.ConvertSQLNullBool)
	app.formDecoder.RegisterConverter(sql.NullInt64{}, converter.ConvertSQLNullInt64)
	app.formDecoder.RegisterConverter(sql.NullFloat64{}, converter.ConvertSQLNullFloat64)
	}

	// ConnectToDatabase validates and connects to the configured database, then
	// tests the connection.
	func ConnectToDatabase(app *App) error {
	// Check database configuration
	if app.cfg.Database.Type == driverMySQL && (app.cfg.Database.User == "" \|\| app.cfg.Database.Password == "") {
	return fmt.Errorf("Database user or password not set.")
	}
	if app.cfg.Database.Host == "" {
	app.cfg.Database.Host = "localhost"
	}
	if app.cfg.Database.Database == "" {
	app.cfg.Database.Database = "writefreely"
	}

	// TODO: check err
	connectToDatabase(app)

	// Test database connection
	err := app.db.Ping()
	if err != nil {
	return fmt.Errorf("Database ping failed: %s", err)
	}

	return nil
	}

	// FormatVersion constructs the version string for the application
	func FormatVersion() string {
	return serverSoftware + " " + softwareVer
	}

	// OutputVersion prints out the version of the application.
	func OutputVersion() {
	fmt.Println(FormatVersion())
	}

	// NewApp creates a new app instance.
	func NewApp(cfgFile string) *App {
	return &App{
	cfgFile: cfgFile,
	}
	}

	// CreateConfig creates a default configuration and saves it to the app's cfgFile.
	func CreateConfig(app *App) error {
	log.Info("Creating configuration...")
	c := config.New()
	log.Info("Saving configuration %s...", app.cfgFile)
	err := config.Save(c, app.cfgFile)
	if err != nil {
	return fmt.Errorf("Unable to save configuration: %v", err)
	}
	return nil
	}

	// DoConfig runs the interactive configuration process.
	func DoConfig(app *App, configSections string) {
	if configSections == "" {
	configSections = "server db app"
	}
	// let's check there aren't any garbage in the list
	configSectionsArray := strings.Split(configSections, " ")
	for _, element := range configSectionsArray {
	if element != "server" && element != "db" && element != "app" {
	log.Error("Invalid argument to --sections. Valid arguments are only \"server\", \"db\" and \"app\"")
	os.Exit(1)
	}
	}
	d, err := config.Configure(app.cfgFile, configSections)
	if err != nil {
	log.Error("Unable to configure: %v", err)
	os.Exit(1)
	}
	app.cfg = d.Config
	connectToDatabase(app)
	defer shutdown(app)

	if !app.db.DatabaseInitialized() {
	err = adminInitDatabase(app)
	if err != nil {
	log.Error(err.Error())
	os.Exit(1)
	}
	} else {
	log.Info("Database already initialized.")
	}

	if d.User != nil {
	u := &User{
	Username: d.User.Username,
	HashedPass: d.User.HashedPass,
	Created: time.Now().Truncate(time.Second).UTC(),
	}

	// Create blog
	log.Info("Creating user %s...\n", u.Username)
	err = app.db.CreateUser(app.cfg, u, app.cfg.App.SiteName, "")
	if err != nil {
	log.Error("Unable to create user: %s", err)
	os.Exit(1)
	}
	log.Info("Done!")
	}
	os.Exit(0)
	}

	// GenerateKeyFiles creates app encryption keys and saves them into the configured KeysParentDir.
	func GenerateKeyFiles(app *App) error {
	// Read keys path from config
	app.LoadConfig()

	// Create keys dir if it doesn't exist yet
	fullKeysDir := filepath.Join(app.cfg.Server.KeysParentDir, keysDir)
	if _, err := os.Stat(fullKeysDir); os.IsNotExist(err) {
	err = os.Mkdir(fullKeysDir, 0700)
	if err != nil {
	return err
	}
	}

	// Generate keys
	initKeyPaths(app)
	// TODO: use something like https://github.com/hashicorp/go-multierror to return errors
	var keyErrs error
	err := generateKey(emailKeyPath)
	if err != nil {
	keyErrs = err
	}
	err = generateKey(cookieAuthKeyPath)
	if err != nil {
	keyErrs = err
	}
	err = generateKey(cookieKeyPath)
	if err != nil {
	keyErrs = err
	}
	err = generateKey(csrfKeyPath)
	if err != nil {
	keyErrs = err
	}

	return keyErrs
	}

	// CreateSchema creates all database tables needed for the application.
	func CreateSchema(apper Apper) error {
	apper.LoadConfig()
	connectToDatabase(apper.App())
	defer shutdown(apper.App())
	err := adminInitDatabase(apper.App())
	if err != nil {
	return err
	}
	return nil
	}

	// Migrate runs all necessary database migrations.
	func Migrate(apper Apper) error {
	apper.LoadConfig()
	connectToDatabase(apper.App())
	defer shutdown(apper.App())

	err := migrations.Migrate(migrations.NewDatastore(apper.App().db.DB, apper.App().db.driverName))
	if err != nil {
	return fmt.Errorf("migrate: %s", err)
	}
	return nil
	}

	// ResetPassword runs the interactive password reset process.
	func ResetPassword(apper Apper, username string) error {
	// Connect to the database
	apper.LoadConfig()
	connectToDatabase(apper.App())
	defer shutdown(apper.App())

	// Fetch user
	u, err := apper.App().db.GetUserForAuth(username)
	if err != nil {
	log.Error("Get user: %s", err)
	os.Exit(1)
	}

	// Prompt for new password
	prompt := promptui.Prompt{
	Templates: &promptui.PromptTemplates{
	Success: "{{ . \| bold \| faint }}: ",
	},
	Label: "New password",
	Mask: '*',
	}
	newPass, err := prompt.Run()
	if err != nil {
	log.Error("%s", err)
	os.Exit(1)
	}

	// Do the update
	log.Info("Updating...")
	err = adminResetPassword(apper.App(), u, newPass)
	if err != nil {
	log.Error("%s", err)
	os.Exit(1)
	}
	log.Info("Success.")
	return nil
	}

	// DoDeleteAccount runs the confirmation and account delete process.
	func DoDeleteAccount(apper Apper, username string) error {
	// Connect to the database
	apper.LoadConfig()
	connectToDatabase(apper.App())
	defer shutdown(apper.App())

	// check user exists
	u, err := apper.App().db.GetUserForAuth(username)
	if err != nil {
	log.Error("%s", err)
	os.Exit(1)
	}
	userID := u.ID

	// do not delete the admin account
	// TODO: check for other admins and skip?
	if u.IsAdmin() {
	log.Error("Can not delete admin account")
	os.Exit(1)
	}

	// confirm deletion, w/ w/out posts
	prompt := promptui.Prompt{
	Templates: &promptui.PromptTemplates{
	Success: "{{ . \| bold \| faint }}: ",
	},
	Label: fmt.Sprintf("Really delete user : %s", username),
	IsConfirm: true,
	}
	_, err = prompt.Run()
	if err != nil {
	log.Info("Aborted...")
	os.Exit(0)
	}

	log.Info("Deleting...")
	err = apper.App().db.DeleteAccount(userID)
	if err != nil {
	log.Error("%s", err)
	os.Exit(1)
	}
	log.Info("Success.")
	return nil
	}

	func connectToDatabase(app *App) {
	log.Info("Connecting to %s database...", app.cfg.Database.Type)

	var db *sql.DB
	var err error
	if app.cfg.Database.Type == driverMySQL {
	db, err = sql.Open(app.cfg.Database.Type, fmt.Sprintf("%s:%s@tcp(%s:%d)/%s?charset=utf8mb4&parseTime=true&loc=%s&tls=%t", app.cfg.Database.User, app.cfg.Database.Password, app.cfg.Database.Host, app.cfg.Database.Port, app.cfg.Database.Database, url.QueryEscape(time.Local.String()), app.cfg.Database.TLS))
	db.SetMaxOpenConns(50)
	} else if app.cfg.Database.Type == driverSQLite {
	if !SQLiteEnabled {
	log.Error("Invalid database type '%s'. Binary wasn't compiled with SQLite3 support.", app.cfg.Database.Type)
	os.Exit(1)
	}
	if app.cfg.Database.FileName == "" {
	log.Error("SQLite database filename value in config.ini is empty.")
	os.Exit(1)
	}
	db, err = sql.Open("sqlite3_with_regex", app.cfg.Database.FileName+"?parseTime=true&cached=shared")
	db.SetMaxOpenConns(2)
	} else {
	log.Error("Invalid database type '%s'. Only 'mysql' and 'sqlite3' are supported right now.", app.cfg.Database.Type)
	os.Exit(1)
	}
	if err != nil {
	log.Error("%s", err)
	os.Exit(1)
	}
	app.db = &datastore{db, app.cfg.Database.Type}
	}

	func shutdown(app *App) {
	log.Info("Closing database connection...")
	app.db.Close()
	}

	// CreateUser creates a new admin or normal user from the given credentials.
	func CreateUser(apper Apper, username, password string, isAdmin bool) error {
	// Create an admin user with --create-admin
	apper.LoadConfig()
	connectToDatabase(apper.App())
	defer shutdown(apper.App())

	// Ensure an admin / first user doesn't already exist
	firstUser, _ := apper.App().db.GetUserByID(1)
	if isAdmin {
	// Abort if trying to create admin user, but one already exists
	if firstUser != nil {
	return fmt.Errorf("Admin user already exists (%s). Create a regular user with: writefreely --create-user", firstUser.Username)
	}
	} else {
	// Abort if trying to create regular user, but no admin exists yet
	if firstUser == nil {
	return fmt.Errorf("No admin user exists yet. Create an admin first with: writefreely --create-admin")
	}
	}

	// Create the user
	// Normalize and validate username
	desiredUsername := username
	username = getSlug(username, "")

	usernameDesc := username
	if username != desiredUsername {
	usernameDesc += " (originally: " + desiredUsername + ")"
	}

	if !author.IsValidUsername(apper.App().cfg, username) {
	return fmt.Errorf("Username %s is invalid, reserved, or shorter than configured minimum length (%d characters).", usernameDesc, apper.App().cfg.App.MinUsernameLen)
	}

	// Hash the password
	hashedPass, err := auth.HashPass([]byte(password))
	if err != nil {
	return fmt.Errorf("Unable to hash password: %v", err)
	}

	u := &User{
	Username: username,
	HashedPass: hashedPass,
	Created: time.Now().Truncate(time.Second).UTC(),
	}

	userType := "user"
	if isAdmin {
	userType = "admin"
	}
	log.Info("Creating %s %s...", userType, usernameDesc)
	err = apper.App().db.CreateUser(apper.App().Config(), u, desiredUsername, "")
	if err != nil {
	return fmt.Errorf("Unable to create user: %s", err)
	}
	log.Info("Done!")
	return nil
	}

	+//go:embed schema.sql
	+var schemaSql string
	+
	+//go:embed sqlite.sql
	+var sqliteSql string
	+
	func adminInitDatabase(app *App) error {
	- schemaFileName := "schema.sql"
	+ var schema string
	if app.cfg.Database.Type == driverSQLite {
	- schemaFileName = "sqlite.sql"
	- }
	-
	- schema, err := Asset(schemaFileName)
	- if err != nil {
	- return fmt.Errorf("Unable to load schema file: %v", err)
	+ schema = sqliteSql
	+ } else {
	+ schema = schemaSql
	}

	tblReg := regexp.MustCompile("CREATE TABLE (IF NOT EXISTS )?`([a-z_]+)`")

	queries := strings.Split(string(schema), ";\n")
	for _, q := range queries {
	if strings.TrimSpace(q) == "" {
	continue
	}
	parts := tblReg.FindStringSubmatch(q)
	if len(parts) >= 3 {
	log.Info("Creating table %s...", parts[2])
	} else {
	log.Info("Creating table ??? (Weird query) No match in: %v", parts)
	}
	- _, err = app.db.Exec(q)
	+ _, err := app.db.Exec(q)
	if err != nil {
	log.Error("%s", err)
	} else {
	log.Info("Created.")
	}
	}

	// Set up migrations table
	log.Info("Initializing appmigrations table...")
	- err = migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName))
	+ err := migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName))
	if err != nil {
	return fmt.Errorf("Unable to set initial migrations: %v", err)
	}

	log.Info("Running migrations...")
	err = migrations.Migrate(migrations.NewDatastore(app.db.DB, app.db.driverName))
	if err != nil {
	return fmt.Errorf("migrate: %s", err)
	}

	log.Info("Done.")
	return nil
	}

	// ServerUserAgent returns a User-Agent string to use in external requests. The
	// hostName parameter may be left empty.
	func ServerUserAgent(hostName string) string {
	hostUAStr := ""
	if hostName != "" {
	hostUAStr = "; +" + hostName
	}
	return "Go (" + serverSoftware + "/" + softwareVer + hostUAStr + ")"
	}
	diff --git a/auth.go b/auth.go
	index fbee601..e871bdd 100644
	--- a/auth.go
	+++ b/auth.go
	@@ -1,28 +1,28 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	// AuthenticateUser ensures a user with the given accessToken is valid. Call
	// it before any operations that require authentication or optionally associate
	// data with a user account.
	// Returns an error if the given accessToken is invalid. Otherwise the
	// associated user ID is returned.
	func AuthenticateUser(db writestore, accessToken string) (int64, error) {
	if accessToken == "" {
	return 0, ErrNoAccessToken
	}
	userID := db.GetUserID(accessToken)
	if userID == -1 {
	return 0, ErrBadAccessToken
	}

	return userID, nil
	}
	diff --git a/author/author.go b/author/author.go
	index 7431ac5..9c1fec9 100644
	--- a/author/author.go
	+++ b/author/author.go
	@@ -1,128 +1,128 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package author

	import (
	"github.com/writefreely/writefreely/config"
	"os"
	"path/filepath"
	"regexp"
	)

	// Regex pattern for valid usernames
	var validUsernameReg = regexp.MustCompile("^[a-zA-Z0-9][a-zA-Z0-9-]*$")

	// List of reserved usernames
	var reservedUsernames = map[string]bool{
	"a": true,
	"about": true,
	"add": true,
	"admin": true,
	"administrator": true,
	"adminzone": true,
	"api": true,
	"article": true,
	"articles": true,
	"auth": true,
	"authenticate": true,
	"browse": true,
	"c": true,
	"categories": true,
	"category": true,
	"changes": true,
	"community": true,
	"create": true,
	"css": true,
	"data": true,
	"dev": true,
	"developers": true,
	"draft": true,
	"drafts": true,
	"edit": true,
	"edits": true,
	"faq": true,
	"feed": true,
	"feedback": true,
	"guide": true,
	"guides": true,
	"help": true,
	"index": true,
	"invite": true,
	"js": true,
	"login": true,
	"logout": true,
	"me": true,
	"media": true,
	"meta": true,
	"metadata": true,
	"new": true,
	"news": true,
	"oauth": true,
	"post": true,
	"posts": true,
	"privacy": true,
	"publication": true,
	"publications": true,
	"publish": true,
	"random": true,
	"read": true,
	"reader": true,
	"register": true,
	"remove": true,
	"signin": true,
	"signout": true,
	"signup": true,
	"start": true,
	"status": true,
	"summary": true,
	"support": true,
	"tag": true,
	"tags": true,
	"team": true,
	"template": true,
	"templates": true,
	"terms": true,
	"terms-of-service": true,
	"termsofservice": true,
	"theme": true,
	"themes": true,
	"tips": true,
	"tos": true,
	"update": true,
	"updates": true,
	"user": true,
	"users": true,
	"yourname": true,
	}

	// IsValidUsername returns true if a given username is neither reserved nor
	// of the correct format.
	func IsValidUsername(cfg *config.Config, username string) bool {
	// Username has to be above a character limit
	if len(username) < cfg.App.MinUsernameLen {
	return false
	}
	// Username is invalid if page with the same name exists. So traverse
	// available pages, adding them to reservedUsernames map that'll be checked
	// later.
	filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, "pages"), func(path string, i os.FileInfo, err error) error {
	reservedUsernames[i.Name()] = true
	return nil
	})

	// Username is invalid if it is reserved!
	if _, reserved := reservedUsernames[username]; reserved {
	return false
	}

	// TODO: use correct regexp function here
	return len(validUsernameReg.FindStringSubmatch(username)) > 0
	}
	diff --git a/bindata-lib.go b/bindata-lib.go
	deleted file mode 100644
	index 9f4a3fd..0000000
	--- a/bindata-lib.go
	+++ /dev/null
	@@ -1,106 +0,0 @@
	-// +build wflib
	-
	-package writefreely
	-
	-import (
	- "bytes"
	- "compress/gzip"
	- "fmt"
	- "io"
	- "strings"
	-)
	-
	-func bindata_read(data []byte, name string) ([]byte, error) {
	- gz, err := gzip.NewReader(bytes.NewBuffer(data))
	- if err != nil {
	- return nil, fmt.Errorf("Read %q: %v", name, err)
	- }
	-
	- var buf bytes.Buffer
	- _, err = io.Copy(&buf, gz)
	- gz.Close()
	-
	- if err != nil {
	- return nil, fmt.Errorf("Read %q: %v", name, err)
	- }
	-
	- return buf.Bytes(), nil
	-}
	-
	-var _schema_sql = []byte("\x1f\x8b\x08\x00\x00\x00\x00\x00\x00\xff\xd4\x59\x5f\x6f\xa3\x38\x10\x7f\xef\xa7\xf0\xdb\xa6\x52\x23\x6d\x7a\xdd\xaa\xba\xd3\x3e\x64\x53\x76\x2f\xba\x94\xee\x25\x44\xba\x7d\x02\x03\x93\xd4\xaa\xb1\x91\x6d\x92\xe6\xdb\x9f\x8c\x49\x08\x86\x24\xd0\xdb\x3b\x71\x7d\x2a\xcc\x6f\x8c\xfd\x9b\x3f\x9e\x99\x0c\x87\x57\xc3\x21\x7a\xc4\x0a\x87\x58\xc2\xaf\x28\xd8\x0a\xa2\x60\x25\x00\xe8\x2e\xb8\x1a\x0e\xaf\xb4\x78\xf8\xce\x3f\xad\xac\xf5\x3d\x1c\x52\x40\x52\x89\x2c\x52\x99\x00\xb4\xe2\x02\xa9\xfc\x5d\x80\xa3\x08\xa4\x54\xfc\x15\x98\x34\xdf\x9b\xcc\x9d\xb1\xe7\x20\x6f\xfc\x65\xe6\xa0\xe9\x57\xe4\x3e\x7b\xc8\xf9\x6b\xba\xf0\x16\x16\x1a\x0d\xae\x10\x0a\xf2\x87\x00\x85\x84\x61\xb1\x1b\x8c\xee\xaf\x73\x05\x77\x39\x9b\xdd\x68\x71\x26\x41\xf8\x24\x0e\x10\x61\x6a\x60\x0b\x65\x16\xf3\x00\x29\xc2\x76\x5a\x3a\x2a\xa5\xe8\xd1\xf9\x3a\x5e\xce\x3c\xf4\xe1\xe3\x87\x1c\xc9\x19\xf8\x8a\x24\xd0\x0e\x1d\x09\xc0\x0a\xe2\x00\xc5\x58\x81\x56\xab\x43\x27\xcb\xf9\xdc\x71\x3d\xdf\x9b\x3e\x39\x0b\x6f\xfc\xf4\x3d\x57\x84\xb7\x94\x08\x90\x47\x8a\x7b\x7c\xf5\x40\x78\x0d\x4c\x05\x68\x83\x45\xf4\x82\xc5\xe0\xf6\xd3\xa7\xeb\x1a\xf2\xfb\x7c\xfa\x34\x9e\xff\x40\x7f\x38\x3f\xd0\xa0\xa0\xe9\xfa\xea\x1a\x39\xee\xb7\xa9\xeb\x7c\x9e\x32\xc6\x1f\xbf\x94\xfb\xf9\x7d\x3c\x5f\x38\xde\x67\x8a\x15\x61\xa3\xdf\xfe\x75\xb3\xa7\x69\xc4\x99\xd2\xa7\xb8\x6c\xf4\x12\x6b\x4c\xae\xcd\xb9\x3f\xfa\x2f\xb6\x4d\x0f\xd0\x04\x62\x92\x25\x0a\xde\x54\x7e\xb8\xf1\xc4\x73\xe6\x68\xe1\x78\x28\x53\xab\x07\x34\x79\x9e\xcd\xf4\x17\xf5\x83\x1f\x12\x66\x79\x4d\x1a\xbf\xcb\x80\x55\xce\x49\xdc\x2b\xc2\x13\xb2\x16\x58\x11\xde\x18\x68\x16\xc0\x10\xbd\x01\x21\x09\x67\x26\x78\x46\x23\x8b\x69\x03\x6f\x64\x29\x97\x0b\x90\x19\x55\x01\xca\x4d\xb0\x97\xf4\x85\x8f\x88\x53\x0a\x91\x3e\x2c\x56\x4a\x90\x30\x53\xd0\x22\xff\x34\x6a\x19\xae\x4a\xd1\xc9\x74\x73\xd0\x29\xdd\x77\x74\xfb\x60\x81\x36\x98\x66\x60\x85\x76\xdd\x7f\x93\xf0\xae\xe2\xc2\x49\x78\x57\xf3\xe2\xaa\x33\x56\xf7\x77\x73\xb4\x99\xde\xf8\x68\xb9\xc5\x57\xd8\x75\xb2\x46\x8e\x6f\x6d\x87\x34\x0b\x29\x89\xfc\x57\xd8\x05\x28\xa4\x3c\xb4\xa4\x82\x6c\xb0\x82\x13\xe2\x73\xa4\xf6\x90\xc8\x14\x4b\xb9\xe5\x22\xee\xc4\x66\xa9\xd4\x9e\xd2\x42\x25\x40\xb9\xd7\xde\x7f\xbc\xfe\x3f\xb3\x26\x20\x26\x02\x22\xd5\x89\xb5\x52\xc9\xb0\x96\x0a\xd8\xf8\x98\x12\x2c\x8f\xc2\xfd\xa3\x45\x4c\xc0\x60\x7b\x11\x54\x65\xef\x68\xdd\x1e\x52\xd7\x89\x32\x79\x74\xa1\x5b\x5e\x85\xc6\x4b\xef\xd9\x9f\xba\x93\xb9\xf3\xe4\xb8\x9e\xc9\x9f\x0d\x3c\xb5\x4f\x8d\xb5\x4a\x4a\x11\x45\x7f\x4e\xa6\x0d\x62\x90\x91\x20\xa9\xca\x2f\xcb\xc3\xfe\xee\x3b\xed\xaf\x5a\x99\xaa\x1d\x05\x5f\xbe\x00\x14\x17\xa8\x79\x9b\x7f\xa4\xb8\x51\x5b\xaf\x9c\xab\xae\xb8\x48\xf0\x51\xc9\xf8\x50\x2f\x18\x4d\xe6\x8b\x76\x8d\x35\xae\xa9\x82\xb7\xec\x4c\x35\xbd\x21\xb0\xf5\x23\x9e\xe9\xe2\xab\x41\x5e\xaf\x8d\xf4\xdb\xa5\x3b\xfd\x73\xe9\xe4\x2f\xf7\xf6\x1d\x04\x3d\xf3\xee\x94\xcb\x36\xa9\xc0\xc0\x4a\x8f\x2e\x9c\xc0\xee\x39\x68\xb6\xb6\x7c\xb8\x66\x88\x84\xc7\x64\xb5\xf3\x8b\xd6\xc6\xd4\xb9\xb7\x0d\x38\xed\x07\x3e\x4e\x53\xc0\x02\xb3\x08\x0a\xe8\x5d\x53\x67\xc2\xb8\x48\x4c\x73\x42\x31\x5b\x67\x78\xbd\x47\x37\xad\x2b\x14\xad\x38\xc1\x4f\xf0\x94\xda\x12\xcd\x97\x4a\xfd\x4b\x84\x31\x88\xfd\x94\x4b\x62\xa2\xeb\xe8\x8b\x4b\x77\x31\xfd\xe6\x3a\x8f\x0d\x8b\xef\x1b\x30\x5d\x95\x4a\x85\x93\xb4\x6d\x07\x76\xa8\xfc\x3b\x6b\x5e\x70\x7f\x3b\xdd\xfc\x93\xec\x70\xe8\x71\xba\x25\x82\x8e\xe1\x48\x62\xdf\x38\x6b\xbd\x78\xcc\xdf\xd7\x14\x4a\xa3\x0f\xca\xff\x6f\x0e\x6b\xe7\x98\xc2\x73\x0a\xd4\xde\x8f\x6e\x7a\xd5\x2b\x09\x48\xb8\x82\x15\xa7\x94\x6f\x5b\xc4\x7d\x15\x7e\xb2\x64\xaa\xf5\x4f\x46\xcf\xaf\x4c\x28\x6a\xa0\xd3\xa3\x84\xcb\x25\xbe\xf5\x81\x9e\xf1\xab\xb7\xd5\xae\xce\xb7\xf0\xf5\x21\x40\x7e\x75\x77\xe7\xf6\x6c\x1f\x70\x39\x3e\x8c\xc5\x0f\x1e\xdf\x7f\xb6\x3b\x51\x6d\xd7\x66\xc7\xec\x35\x16\x67\x91\xe2\x86\x8a\xd3\x56\x21\x2c\xe4\x6f\xe7\x00\xf2\x05\x0b\x88\xfd\x4b\xb8\xcb\xb6\xb1\xe2\x6f\x50\x6e\xaf\x37\x76\xd1\x24\x77\x99\x3d\x58\x78\x63\x9d\xb3\xe3\xcd\x86\x79\xc3\xfd\xdd\x7f\x34\x6e\xd8\x6f\xac\x97\x83\x06\xbd\x39\xc2\x36\xa4\x99\xf7\x8a\xd8\x2a\xe7\x6c\x8a\xab\x75\x4e\x7d\x44\x86\xdf\x74\x42\x90\x01\x92\x09\xa6\xf4\x64\x2d\x74\x36\xc9\xb7\x99\x0a\x13\x86\x23\x45\x36\xcd\xf3\xe9\x3e\xd1\xde\xd2\xd1\x3b\x76\x86\x5a\x85\xe1\x04\xde\xdd\x1c\x5e\x1a\x66\x54\x57\x32\x7c\x1d\x16\x32\x8f\xf5\x75\x20\xc1\x84\xe6\x5b\x2a\x7e\x9d\x68\x9c\xd3\xbf\xfb\xd7\x82\xcb\x59\xb0\xa4\x65\x50\xfe\xdf\xab\x28\x94\x26\xce\xe2\x53\x61\x78\x90\x17\xee\x90\x3f\xf9\x27\xc3\xf1\xe4\x7d\xdf\xfa\xcc\x7f\x07\x00\x00\xff\xff\xbe\x79\x68\xa8\x10\x1b\x00\x00")
	-
	-func schema_sql() ([]byte, error) {
	- return bindata_read(
	- _schema_sql,
	- "schema.sql",
	- )
	-}
	-
	-// Asset loads and returns the asset for the given name.
	-// It returns an error if the asset could not be found or
	-// could not be loaded.
	-func Asset(name string) ([]byte, error) {
	- cannonicalName := strings.Replace(name, "\\", "/", -1)
	- if f, ok := _bindata[cannonicalName]; ok {
	- return f()
	- }
	- return nil, fmt.Errorf("Asset %s not found", name)
	-}
	-
	-// AssetNames returns the names of the assets.
	-func AssetNames() []string {
	- names := make([]string, 0, len(_bindata))
	- for name := range _bindata {
	- names = append(names, name)
	- }
	- return names
	-}
	-
	-// _bindata is a table, holding each asset generator, mapped to its name.
	-var _bindata = map[string]func() ([]byte, error){
	- "schema.sql": schema_sql,
	-}
	-
	-// AssetDir returns the file names below a certain
	-// directory embedded in the file by go-bindata.
	-// For example if you run go-bindata on data/... and data contains the
	-// following hierarchy:
	-// data/
	-// foo.txt
	-// img/
	-// a.png
	-// b.png
	-// then AssetDir("data") would return []string{"foo.txt", "img"}
	-// AssetDir("data/img") would return []string{"a.png", "b.png"}
	-// AssetDir("foo.txt") and AssetDir("notexist") would return an error
	-// AssetDir("") will return []string{"data"}.
	-func AssetDir(name string) ([]string, error) {
	- node := _bintree
	- if len(name) != 0 {
	- cannonicalName := strings.Replace(name, "\\", "/", -1)
	- pathList := strings.Split(cannonicalName, "/")
	- for _, p := range pathList {
	- node = node.Children[p]
	- if node == nil {
	- return nil, fmt.Errorf("Asset %s not found", name)
	- }
	- }
	- }
	- if node.Func != nil {
	- return nil, fmt.Errorf("Asset %s not found", name)
	- }
	- rv := make([]string, 0, len(node.Children))
	- for name := range node.Children {
	- rv = append(rv, name)
	- }
	- return rv, nil
	-}
	-
	-type _bintree_t struct {
	- Func func() ([]byte, error)
	- Children map[string]*_bintree_t
	-}
	-
	-var _bintree = &_bintree_t{nil, map[string]*_bintree_t{
	- "schema.sql": &_bintree_t{schema_sql, map[string]*_bintree_t{}},
	-}}
	diff --git a/cache.go b/cache.go
	index b1b1be9..47cff3a 100644
	--- a/cache.go
	+++ b/cache.go
	@@ -1,69 +1,69 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"sync"
	"time"
	)

	const (
	postsCacheTime = 4 * time.Second
	)

	type (
	postsCacheItem struct {
	Expire time.Time
	Posts *[]PublicPost
	ready chan struct{}
	}

	AuthCache struct {
	Alias, Pass, Token string
	BadPasses map[string]bool

	expire time.Time
	}
	)

	var (
	userPostsCache = struct {
	sync.RWMutex
	users map[int64]postsCacheItem
	}{
	users: map[int64]postsCacheItem{},
	}
	)

	func CachePosts(userID int64, p *[]PublicPost) {
	close(userPostsCache.users[userID].ready)
	userPostsCache.Lock()
	userPostsCache.users[userID] = postsCacheItem{
	Expire: time.Now().Add(postsCacheTime),
	Posts: p,
	}
	userPostsCache.Unlock()
	}

	func GetPostsCache(userID int64) *[]PublicPost {
	userPostsCache.RLock()
	pci, ok := userPostsCache.users[userID]
	userPostsCache.RUnlock()
	if !ok {
	return nil
	}

	if pci.Expire.Before(time.Now()) {
	// Cache is expired
	return nil
	}
	return pci.Posts
	}
	diff --git a/cmd/writefreely/config.go b/cmd/writefreely/config.go
	index 32e3801..1c3e769 100644
	--- a/cmd/writefreely/config.go
	+++ b/cmd/writefreely/config.go
	@@ -1,60 +1,60 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package main

	import (
	"github.com/urfave/cli/v2"
	"github.com/writefreely/writefreely"
	)

	var (
	cmdConfig cli.Command = cli.Command{
	Name: "config",
	Usage: "config management tools",
	Subcommands: []*cli.Command{
	&cmdConfigGenerate,
	&cmdConfigInteractive,
	},
	}

	cmdConfigGenerate cli.Command = cli.Command{
	Name: "generate",
	Aliases: []string{"gen"},
	Usage: "Generate a basic configuration",
	Action: genConfigAction,
	}

	cmdConfigInteractive cli.Command = cli.Command{
	Name: "start",
	Usage: "Interactive configuration process",
	Action: interactiveConfigAction,
	Flags: []cli.Flag{
	&cli.StringFlag{
	Name: "sections",
	Value: "server db app",
	Usage: "Which sections of the configuration to go through\n" +
	"valid values of sections flag are any combination of 'server', 'db' and 'app' \n" +
	"example: writefreely config start --sections \"db app\"",
	},
	},
	}
	)

	func genConfigAction(c *cli.Context) error {
	app := writefreely.NewApp(c.String("c"))
	return writefreely.CreateConfig(app)
	}

	func interactiveConfigAction(c *cli.Context) error {
	app := writefreely.NewApp(c.String("c"))
	writefreely.DoConfig(app, c.String("sections"))
	return nil
	}
	diff --git a/cmd/writefreely/db.go b/cmd/writefreely/db.go
	index ccae418..908e163 100644
	--- a/cmd/writefreely/db.go
	+++ b/cmd/writefreely/db.go
	@@ -1,49 +1,49 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package main

	import (
	"github.com/urfave/cli/v2"
	"github.com/writefreely/writefreely"
	)

	var (
	cmdDB cli.Command = cli.Command{
	Name: "db",
	Usage: "db management tools",
	Subcommands: []*cli.Command{
	&cmdDBInit,
	&cmdDBMigrate,
	},
	}

	cmdDBInit cli.Command = cli.Command{
	Name: "init",
	Usage: "Initialize Database",
	Action: initDBAction,
	}

	cmdDBMigrate cli.Command = cli.Command{
	Name: "migrate",
	Usage: "Migrate Database",
	Action: migrateDBAction,
	}
	)

	func initDBAction(c *cli.Context) error {
	app := writefreely.NewApp(c.String("c"))
	return writefreely.CreateSchema(app)
	}

	func migrateDBAction(c *cli.Context) error {
	app := writefreely.NewApp(c.String("c"))
	return writefreely.Migrate(app)
	}
	diff --git a/cmd/writefreely/keys.go b/cmd/writefreely/keys.go
	index 680cd4d..2e7cc8e 100644
	--- a/cmd/writefreely/keys.go
	+++ b/cmd/writefreely/keys.go
	@@ -1,38 +1,38 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package main

	import (
	"github.com/urfave/cli/v2"
	"github.com/writefreely/writefreely"
	)

	var (
	cmdKeys cli.Command = cli.Command{
	Name: "keys",
	Usage: "key management tools",
	Subcommands: []*cli.Command{
	&cmdGenerateKeys,
	},
	}

	cmdGenerateKeys cli.Command = cli.Command{
	Name: "generate",
	Aliases: []string{"gen"},
	Usage: "Generate encryption and authentication keys",
	Action: genKeysAction,
	}
	)

	func genKeysAction(c *cli.Context) error {
	app := writefreely.NewApp(c.String("c"))
	return writefreely.GenerateKeyFiles(app)
	}
	diff --git a/cmd/writefreely/main.go b/cmd/writefreely/main.go
	index 992d611..cd7ed69 100644
	--- a/cmd/writefreely/main.go
	+++ b/cmd/writefreely/main.go
	@@ -1,183 +1,183 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package main

	import (
	"fmt"
	"os"
	"strings"

	"github.com/gorilla/mux"
	"github.com/urfave/cli/v2"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely"
	)

	func main() {
	cli.VersionPrinter = func(c *cli.Context) {
	fmt.Printf("%s\n", c.App.Version)
	}
	app := &cli.App{
	Name: "WriteFreely",
	Usage: "A beautifully pared-down blogging platform",
	Version: writefreely.FormatVersion(),
	Action: legacyActions, // legacy due to use of flags for switching actions
	Flags: []cli.Flag{
	&cli.BoolFlag{
	Name: "create-config",
	Value: false,
	Usage: "Generate a basic configuration",
	Hidden: true,
	},
	&cli.BoolFlag{
	Name: "config",
	Value: false,
	Usage: "Interactive configuration process",
	Hidden: true,
	},
	&cli.StringFlag{
	Name: "sections",
	Value: "server db app",
	Usage: "Which sections of the configuration to go through (requires --config)\n" +
	"valid values are any combination of 'server', 'db' and 'app' \n" +
	"example: writefreely --config --sections \"db app\"",
	Hidden: true,
	},
	&cli.BoolFlag{
	Name: "gen-keys",
	Value: false,
	Usage: "Generate encryption and authentication keys",
	Hidden: true,
	},
	&cli.BoolFlag{
	Name: "init-db",
	Value: false,
	Usage: "Initialize app database",
	Hidden: true,
	},
	&cli.BoolFlag{
	Name: "migrate",
	Value: false,
	Usage: "Migrate the database",
	Hidden: true,
	},
	&cli.StringFlag{
	Name: "create-admin",
	Usage: "Create an admin with the given username:password",
	Hidden: true,
	},
	&cli.StringFlag{
	Name: "create-user",
	Usage: "Create a regular user with the given username:password",
	Hidden: true,
	},
	&cli.StringFlag{
	Name: "delete-user",
	Usage: "Delete a user with the given username",
	Hidden: true,
	},
	&cli.StringFlag{
	Name: "reset-pass",
	Usage: "Reset the given user's password",
	Hidden: true,
	},
	}, // legacy flags (set to hidden to eventually switch to bash-complete compatible format)
	}

	defaultFlags := []cli.Flag{
	&cli.StringFlag{
	Name: "c",
	Value: "config.ini",
	Usage: "Load configuration from `FILE`",
	},
	&cli.BoolFlag{
	Name: "debug",
	Value: false,
	Usage: "Enables debug logging",
	},
	}

	app.Flags = append(app.Flags, defaultFlags...)

	app.Commands = []*cli.Command{
	&cmdUser,
	&cmdDB,
	&cmdConfig,
	&cmdKeys,
	&cmdServe,
	}

	err := app.Run(os.Args)
	if err != nil {
	log.Error(err.Error())
	os.Exit(1)
	}
	}

	func legacyActions(c *cli.Context) error {
	app := writefreely.NewApp(c.String("c"))

	switch true {
	case c.IsSet("create-config"):
	return writefreely.CreateConfig(app)
	case c.IsSet("config"):
	writefreely.DoConfig(app, c.String("sections"))
	return nil
	case c.IsSet("gen-keys"):
	return writefreely.GenerateKeyFiles(app)
	case c.IsSet("init-db"):
	return writefreely.CreateSchema(app)
	case c.IsSet("migrate"):
	return writefreely.Migrate(app)
	case c.IsSet("create-admin"):
	username, password, err := parseCredentials(c.String("create-admin"))
	if err != nil {
	return err
	}
	return writefreely.CreateUser(app, username, password, true)
	case c.IsSet("create-user"):
	username, password, err := parseCredentials(c.String("create-user"))
	if err != nil {
	return err
	}
	return writefreely.CreateUser(app, username, password, false)
	case c.IsSet("delete-user"):
	return writefreely.DoDeleteAccount(app, c.String("delete-user"))
	case c.IsSet("reset-pass"):
	return writefreely.ResetPassword(app, c.String("reset-pass"))
	}

	// Initialize the application
	var err error
	log.Info("Starting %s...", writefreely.FormatVersion())
	app, err = writefreely.Initialize(app, c.Bool("debug"))
	if err != nil {
	return err
	}

	// Set app routes
	r := mux.NewRouter()
	writefreely.InitRoutes(app, r)
	app.InitStaticRoutes(r)

	// Serve the application
	writefreely.Serve(app, r)

	return nil
	}

	func parseCredentials(credentialString string) (string, string, error) {
	creds := strings.Split(credentialString, ":")
	if len(creds) != 2 {
	return "", "", fmt.Errorf("invalid format for passed credentials, must be username:password")
	}
	return creds[0], creds[1], nil
	}
	diff --git a/cmd/writefreely/user.go b/cmd/writefreely/user.go
	index 8429513..2efb4b9 100644
	--- a/cmd/writefreely/user.go
	+++ b/cmd/writefreely/user.go
	@@ -1,96 +1,96 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package main

	import (
	"fmt"

	"github.com/urfave/cli/v2"
	"github.com/writefreely/writefreely"
	)

	var (
	cmdUser cli.Command = cli.Command{
	Name: "user",
	Usage: "user management tools",
	Subcommands: []*cli.Command{
	&cmdAddUser,
	&cmdDelUser,
	&cmdResetPass,
	// TODO: possibly add a user list command
	},
	}

	cmdAddUser cli.Command = cli.Command{
	Name: "create",
	Usage: "Add new user",
	Aliases: []string{"a", "add"},
	Flags: []cli.Flag{
	&cli.BoolFlag{
	Name: "admin",
	Value: false,
	Usage: "Create admin user",
	},
	},
	Action: addUserAction,
	}

	cmdDelUser cli.Command = cli.Command{
	Name: "delete",
	Usage: "Delete user",
	Aliases: []string{"del", "d"},
	Action: delUserAction,
	}

	cmdResetPass cli.Command = cli.Command{
	Name: "reset-pass",
	Usage: "Reset user's password",
	Aliases: []string{"resetpass", "reset"},
	Action: resetPassAction,
	}
	)

	func addUserAction(c *cli.Context) error {
	credentials := ""
	if c.NArg() > 0 {
	credentials = c.Args().Get(0)
	} else {
	return fmt.Errorf("No user passed. Example: writefreely user add [USER]:[PASSWORD]")
	}
	username, password, err := parseCredentials(credentials)
	if err != nil {
	return err
	}
	app := writefreely.NewApp(c.String("c"))
	return writefreely.CreateUser(app, username, password, c.Bool("admin"))
	}

	func delUserAction(c *cli.Context) error {
	username := ""
	if c.NArg() > 0 {
	username = c.Args().Get(0)
	} else {
	return fmt.Errorf("No user passed. Example: writefreely user delete [USER]")
	}
	app := writefreely.NewApp(c.String("c"))
	return writefreely.DoDeleteAccount(app, username)
	}

	func resetPassAction(c *cli.Context) error {
	username := ""
	if c.NArg() > 0 {
	username = c.Args().Get(0)
	} else {
	return fmt.Errorf("No user passed. Example: writefreely user reset-pass [USER]")
	}
	app := writefreely.NewApp(c.String("c"))
	return writefreely.ResetPassword(app, username)
	}
	diff --git a/cmd/writefreely/web.go b/cmd/writefreely/web.go
	index 02ae1c9..b91910c 100644
	--- a/cmd/writefreely/web.go
	+++ b/cmd/writefreely/web.go
	@@ -1,48 +1,48 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package main

	import (
	"github.com/gorilla/mux"
	"github.com/urfave/cli/v2"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely"
	)

	var (
	cmdServe cli.Command = cli.Command{
	Name: "serve",
	Aliases: []string{"web"},
	Usage: "Run web application",
	Action: serveAction,
	}
	)

	func serveAction(c *cli.Context) error {
	// Initialize the application
	app := writefreely.NewApp(c.String("c"))
	var err error
	log.Info("Starting %s...", writefreely.FormatVersion())
	app, err = writefreely.Initialize(app, c.Bool("debug"))
	if err != nil {
	return err
	}

	// Set app routes
	r := mux.NewRouter()
	writefreely.InitRoutes(app, r)
	app.InitStaticRoutes(r)

	// Serve the application
	writefreely.Serve(app, r)

	return nil
	}
	diff --git a/collections.go b/collections.go
	index 0840743..48e5f67 100644
	--- a/collections.go
	+++ b/collections.go
	@@ -1,1248 +1,1269 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2022 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"encoding/json"
	"fmt"
	"html/template"
	"math"
	"net/http"
	"net/url"
	"regexp"
	"strconv"
	"strings"
	"unicode"

	"github.com/gorilla/mux"
	+ stripmd "github.com/writeas/go-strip-markdown/v2"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/activitystreams"
	"github.com/writeas/web-core/auth"
	"github.com/writeas/web-core/bots"
	"github.com/writeas/web-core/log"
	- waposts "github.com/writeas/web-core/posts"
	+ "github.com/writeas/web-core/posts"
	"github.com/writefreely/writefreely/author"
	"github.com/writefreely/writefreely/config"
	"github.com/writefreely/writefreely/page"
	"github.com/writefreely/writefreely/spam"
	"golang.org/x/net/idna"
	)

	const collAttrLetterReplyTo = "letter_reply_to"

	type (
	// TODO: add Direction to db
	// TODO: add Language to db
	Collection struct {
	ID int64 `datastore:"id" json:"-"`
	Alias string `datastore:"alias" schema:"alias" json:"alias"`
	Title string `datastore:"title" schema:"title" json:"title"`
	Description string `datastore:"description" schema:"description" json:"description"`
	Direction string `schema:"dir" json:"dir,omitempty"`
	Language string `schema:"lang" json:"lang,omitempty"`
	StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"`
	Script string `datastore:"script" schema:"script" json:"script,omitempty"`
	Signature string `datastore:"post_signature" schema:"signature" json:"-"`
	Public bool `datastore:"public" json:"public"`
	Visibility collVisibility `datastore:"private" json:"-"`
	Format string `datastore:"format" json:"format,omitempty"`
	Views int64 `json:"views"`
	OwnerID int64 `datastore:"owner_id" json:"-"`
	PublicOwner bool `datastore:"public_owner" json:"-"`
	URL string `json:"url,omitempty"`

	Monetization string `json:"monetization_pointer,omitempty"`

	db *datastore
	hostName string
	}
	CollectionObj struct {
	Collection
	TotalPosts int `json:"total_posts"`
	Owner *User `json:"owner,omitempty"`
	Posts *[]PublicPost `json:"posts,omitempty"`
	Format *CollectionFormat
	}
	DisplayCollection struct {
	*CollectionObj
	Prefix string
	IsTopLevel bool
	CurrentPage int
	TotalPages int
	Silenced bool
	}
	SubmittedCollection struct {
	// Data used for updating a given collection
	ID int64
	OwnerID uint64

	// Form helpers
	PreferURL string `schema:"prefer_url" json:"prefer_url"`
	Privacy int `schema:"privacy" json:"privacy"`
	Pass string `schema:"password" json:"password"`
	MathJax bool `schema:"mathjax" json:"mathjax"`
	EmailSubs bool `schema:"email_subs" json:"email_subs"`
	Handle string `schema:"handle" json:"handle"`

	// Actual collection values updated in the DB
	Alias *string `schema:"alias" json:"alias"`
	Title *string `schema:"title" json:"title"`
	Description *string `schema:"description" json:"description"`
	StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"`
	Script *sql.NullString `schema:"script" json:"script"`
	Signature *sql.NullString `schema:"signature" json:"signature"`
	Monetization *string `schema:"monetization_pointer" json:"monetization_pointer"`
	LetterReply *string `schema:"letter_reply" json:"letter_reply"`
	Visibility *int `schema:"visibility" json:"public"`
	Format *sql.NullString `schema:"format" json:"format"`
	}
	CollectionFormat struct {
	Format string
	}

	collectionReq struct {
	// Information about the collection request itself
	prefix, alias, domain string
	isCustomDomain bool

	// User-related fields
	isCollOwner bool

	isAuthorized bool
	}
	)

	func (sc *SubmittedCollection) FediverseHandle() string {
	if sc.Handle == "" {
	return apCustomHandleDefault
	}
	return getSlug(sc.Handle, "")
	}

	// collVisibility represents the visibility level for the collection.
	type collVisibility int

	// Visibility levels. Values are bitmasks, stored in the database as
	// decimal numbers. If adding types, append them to this list. If removing,
	// replace the desired visibility with a new value.
	const CollUnlisted collVisibility = 0
	const (
	CollPublic collVisibility = 1 << iota
	CollPrivate
	CollProtected
	)

	var collVisibilityStrings = map[string]collVisibility{
	"unlisted": CollUnlisted,
	"public": CollPublic,
	"private": CollPrivate,
	"protected": CollProtected,
	}

	func defaultVisibility(cfg *config.Config) collVisibility {
	vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility]
	if !ok {
	vis = CollUnlisted
	}
	return vis
	}

	func (cf *CollectionFormat) Ascending() bool {
	return cf.Format == "novel"
	}
	func (cf *CollectionFormat) ShowDates() bool {
	return cf.Format == "blog"
	}
	func (cf *CollectionFormat) PostsPerPage() int {
	if cf.Format == "novel" {
	return postsPerPage
	}
	return postsPerPage
	}

	// Valid returns whether or not a format value is valid.
	func (cf *CollectionFormat) Valid() bool {
	return cf.Format == "blog" \|\|
	cf.Format == "novel" \|\|
	cf.Format == "notebook"
	}

	// NewFormat creates a new CollectionFormat object from the Collection.
	func (c Collection) NewFormat() CollectionFormat {
	cf := &CollectionFormat{Format: c.Format}

	// Fill in default format
	if cf.Format == "" {
	cf.Format = "blog"
	}

	return cf
	}

	func (c *Collection) IsInstanceColl() bool {
	ur, _ := url.Parse(c.hostName)
	return c.Alias == ur.Host
	}

	func (c *Collection) IsUnlisted() bool {
	return c.Visibility == 0
	}

	func (c *Collection) IsPrivate() bool {
	return c.Visibility&CollPrivate != 0
	}

	func (c *Collection) IsProtected() bool {
	return c.Visibility&CollProtected != 0
	}

	func (c *Collection) IsPublic() bool {
	return c.Visibility&CollPublic != 0
	}

	func (c *Collection) FriendlyVisibility() string {
	if c.IsPrivate() {
	return "Private"
	}
	if c.IsPublic() {
	return "Public"
	}
	if c.IsProtected() {
	return "Password-protected"
	}
	return "Unlisted"
	}

	func (c *Collection) ShowFooterBranding() bool {
	// TODO: implement this setting
	return true
	}

	// CanonicalURL returns a fully-qualified URL to the collection.
	func (c *Collection) CanonicalURL() string {
	return c.RedirectingCanonicalURL(false)
	}

	func (c *Collection) DisplayCanonicalURL() string {
	us := c.CanonicalURL()
	u, err := url.Parse(us)
	if err != nil {
	return us
	}
	p := u.Path
	if p == "/" {
	p = ""
	}
	d := u.Hostname()
	d, _ = idna.ToUnicode(d)
	return d + p
	}

	// RedirectingCanonicalURL returns the fully-qualified canonical URL for the Collection, with a trailing slash. The
	// hostName field needs to be populated for this to work correctly.
	func (c *Collection) RedirectingCanonicalURL(isRedir bool) string {
	if c.hostName == "" {
	// If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail
	log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writefreely/writefreely/issues/new?template=bug_report.md")
	}
	if isSingleUser {
	return c.hostName + "/"
	}

	return fmt.Sprintf("%s/%s/", c.hostName, c.Alias)
	}

	// PrevPageURL provides a full URL for the previous page of collection posts,
	// returning a /page/N result for pages >1
	func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string {
	u := ""
	if n == 2 {
	// Previous page is 1; no need for /page/ prefix
	if prefix == "" {
	u = "/"
	}
	// Else leave off trailing slash
	} else {
	u = fmt.Sprintf("/page/%d", n-1)
	}

	if tl {
	return u
	}
	return "/" + prefix + c.Alias + u
	}

	// NextPageURL provides a full URL for the next page of collection posts
	func (c *Collection) NextPageURL(prefix string, n int, tl bool) string {
	if tl {
	return fmt.Sprintf("/page/%d", n+1)
	}
	return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1)
	}

	func (c *Collection) DisplayTitle() string {
	if c.Title != "" {
	return c.Title
	}
	return c.Alias
	}

	func (c *Collection) StyleSheetDisplay() template.CSS {
	return template.CSS(c.StyleSheet)
	}

	// ForPublic modifies the Collection for public consumption, such as via
	// the API.
	func (c *Collection) ForPublic() {
	c.URL = c.CanonicalURL()
	}

	var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString

	func (c Collection) PersonObject(ids ...int64) activitystreams.Person {
	accountRoot := c.FederatedAccount()
	p := activitystreams.NewPerson(accountRoot)
	p.URL = c.CanonicalURL()
	uname := c.Alias
	p.PreferredUsername = uname
	p.Name = c.DisplayTitle()
	p.Summary = c.Description
	if p.Name != "" {
	if av := c.AvatarURL(); av != "" {
	p.Icon = activitystreams.Image{
	Type: "Image",
	MediaType: "image/png",
	URL: av,
	}
	}
	}

	collID := c.ID
	if len(ids) > 0 {
	collID = ids[0]
	}
	pub, priv := c.db.GetAPActorKeys(collID)
	if pub != nil {
	p.AddPubKey(pub)
	p.SetPrivKey(priv)
	}

	return p
	}

	func (c *Collection) AvatarURL() string {
	fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0]))
	if !isAvatarChar(fl) {
	return ""
	}
	return c.hostName + "/img/avatars/" + fl + ".png"
	}

	func (c *Collection) FederatedAPIBase() string {
	return c.hostName + "/"
	}

	func (c *Collection) FederatedAccount() string {
	accountUser := c.Alias
	return c.FederatedAPIBase() + "api/collections/" + accountUser
	}

	func (c *Collection) RenderMathJax() bool {
	return c.db.CollectionHasAttribute(c.ID, "render_mathjax")
	}

	func (c *Collection) EmailSubsEnabled() bool {
	return c.db.CollectionHasAttribute(c.ID, "email_subs")
	}

	func (c *Collection) MonetizationURL() string {
	if c.Monetization == "" {
	return ""
	}
	return strings.Replace(c.Monetization, "$", "https://", 1)
	}

	+// DisplayDescription returns the description with rendered Markdown and HTML.
	+func (c Collection) DisplayDescription() template.HTML {
	+ if c.Description == "" {
	+ s := template.HTML("")
	+ return &s
	+ }
	+ t := template.HTML(posts.ApplyBasicAccessibleMarkdown([]byte(c.Description)))
	+ return &t
	+}
	+
	+// PlainDescription returns the description with all Markdown and HTML removed.
	+func (c *Collection) PlainDescription() string {
	+ if c.Description == "" {
	+ return ""
	+ }
	+ desc := stripHTMLWithoutEscaping(c.Description)
	+ desc = stripmd.Strip(desc)
	+ return desc
	+}
	+
	func (c CollectionPage) DisplayMonetization() string {
	return displayMonetization(c.Monetization, c.Alias)
	}

	func newCollection(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)
	alias := r.FormValue("alias")
	title := r.FormValue("title")

	var missingParams, accessToken string
	var u *User
	c := struct {
	Alias string `json:"alias" schema:"alias"`
	Title string `json:"title" schema:"title"`
	Web bool `json:"web" schema:"web"`
	}{}
	if reqJSON {
	// Decode JSON request
	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&c)
	if err != nil {
	log.Error("Couldn't parse post update JSON request: %v\n", err)
	return ErrBadJSON
	}
	} else {
	// TODO: move form parsing to formDecoder
	c.Alias = alias
	c.Title = title
	}

	if c.Alias == "" {
	if c.Title != "" {
	// If only a title was given, just use it to generate the alias.
	c.Alias = getSlug(c.Title, "")
	} else {
	missingParams += "`alias` "
	}
	}
	if c.Title == "" {
	missingParams += "`title` "
	}
	if missingParams != "" {
	return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)}
	}

	var userID int64
	var err error
	if reqJSON && !c.Web {
	accessToken = r.Header.Get("Authorization")
	if accessToken == "" {
	return ErrNoAccessToken
	}
	userID = app.db.GetUserID(accessToken)
	if userID == -1 {
	return ErrBadAccessToken
	}
	} else {
	u = getUserSession(app, r)
	if u == nil {
	return ErrNotLoggedIn
	}
	userID = u.ID
	}
	silenced, err := app.db.IsUserSilenced(userID)
	if err != nil {
	log.Error("new collection: %v", err)
	return ErrInternalGeneral
	}
	if silenced {
	return ErrUserSilenced
	}

	if !author.IsValidUsername(app.cfg, c.Alias) {
	return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."}
	}

	coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID)
	if err != nil {
	// TODO: handle this
	return err
	}

	res := &CollectionObj{Collection: *coll}

	if reqJSON {
	return impart.WriteSuccess(w, res, http.StatusCreated)
	}
	redirectTo := "/me/c/"
	// TODO: redirect to pad when necessary
	return impart.HTTPError{http.StatusFound, redirectTo}
	}

	func apiCheckCollectionPermissions(app App, r http.Request, c *Collection) (int64, error) {
	accessToken := r.Header.Get("Authorization")
	var userID int64 = -1
	if accessToken != "" {
	userID = app.db.GetUserID(accessToken)
	}
	isCollOwner := userID == c.OwnerID
	if c.IsPrivate() && !isCollOwner {
	// Collection is private, but user isn't authenticated
	return -1, ErrCollectionNotFound
	}
	if c.IsProtected() {
	// TODO: check access token
	return -1, ErrCollectionUnauthorizedRead
	}

	return userID, nil
	}

	// fetchCollection handles the API endpoint for retrieving collection data.
	func fetchCollection(app App, w http.ResponseWriter, r http.Request) error {
	accept := r.Header.Get("Accept")
	if strings.Contains(accept, "application/activity+json") {
	return handleFetchCollectionActivities(app, w, r)
	}

	vars := mux.Vars(r)
	alias := vars["alias"]

	// TODO: move this logic into a common getCollection function
	// Get base Collection data
	c, err := app.db.GetCollection(alias)
	if err != nil {
	return err
	}
	c.hostName = app.cfg.App.Host

	// Redirect users who aren't requesting JSON
	reqJSON := IsJSON(r)
	if !reqJSON {
	return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
	}

	// Check permissions
	userID, err := apiCheckCollectionPermissions(app, r, c)
	if err != nil {
	return err
	}
	isCollOwner := userID == c.OwnerID

	// Fetch extra data about the Collection
	res := &CollectionObj{Collection: *c}
	if c.PublicOwner {
	u, err := app.db.GetUserByID(res.OwnerID)
	if err != nil {
	// Log the error and just continue
	log.Error("Error getting user for collection: %v", err)
	} else {
	res.Owner = u
	}
	}
	// TODO: check status for silenced
	app.db.GetPostsCount(res, isCollOwner)
	// Strip non-public information
	res.Collection.ForPublic()

	return impart.WriteSuccess(w, res, http.StatusOK)
	}

	// fetchCollectionPosts handles an API endpoint for retrieving a collection's
	// posts.
	func fetchCollectionPosts(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	alias := vars["alias"]

	c, err := app.db.GetCollection(alias)
	if err != nil {
	return err
	}
	c.hostName = app.cfg.App.Host

	// Check permissions
	userID, err := apiCheckCollectionPermissions(app, r, c)
	if err != nil {
	return err
	}
	isCollOwner := userID == c.OwnerID

	// Get page
	page := 1
	if p := r.FormValue("page"); p != "" {
	pInt, _ := strconv.Atoi(p)
	if pInt > 0 {
	page = pInt
	}
	}

	- posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false)
	+ ps, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false)
	if err != nil {
	return err
	}
	- coll := &CollectionObj{Collection: *c, Posts: posts}
	+ coll := &CollectionObj{Collection: *c, Posts: ps}
	app.db.GetPostsCount(coll, isCollOwner)
	// Strip non-public information
	coll.Collection.ForPublic()

	// Transform post bodies if needed
	if r.FormValue("body") == "html" {
	for _, p := range *coll.Posts {
	- p.Content = waposts.ApplyMarkdown([]byte(p.Content))
	+ p.Content = posts.ApplyMarkdown([]byte(p.Content))
	}
	}

	return impart.WriteSuccess(w, coll, http.StatusOK)
	}

	type CollectionPage struct {
	page.StaticPage
	*DisplayCollection
	IsCustomDomain bool
	IsWelcome bool
	IsOwner bool
	IsCollLoggedIn bool
	Honeypot string
	IsSubscriber bool
	CanPin bool
	Username string
	Monetization string
	Flash template.HTML
	Collections *[]Collection
	PinnedPosts *[]PublicPost

	IsAdmin bool
	CanInvite bool

	// Helper field for Chorus mode
	CollAlias string
	}

	func NewCollectionObj(c Collection) CollectionObj {
	return &CollectionObj{
	Collection: *c,
	Format: c.NewFormat(),
	}
	}

	func (c *CollectionObj) ScriptDisplay() template.JS {
	return template.JS(c.Script)
	}

	var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$")

	func (c *CollectionObj) ExternalScripts() []template.URL {
	scripts := []template.URL{}
	if c.Script == "" {
	return scripts
	}

	matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1)
	for _, m := range matches {
	scripts = append(scripts, template.URL(strings.TrimSpace(m[1])))
	}
	return scripts
	}

	func (c *CollectionObj) CanShowScript() bool {
	return false
	}

	func processCollectionRequest(cr collectionReq, vars map[string]string, w http.ResponseWriter, r http.Request) error {
	cr.prefix = vars["prefix"]
	cr.alias = vars["collection"]
	// Normalize the URL, redirecting user to consistent post URL
	if cr.alias != strings.ToLower(cr.alias) {
	return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))}
	}

	return nil
	}

	// processCollectionPermissions checks the permissions for the given
	// collectionReq, returning a Collection if access is granted; otherwise this
	// renders any necessary collection pages, for example, if requesting a custom
	// domain that doesn't yet have a collection associated, or if a collection
	// requires a password. In either case, this will return nil, nil -- thus both
	// values should ALWAYS be checked to determine whether or not to continue.
	func processCollectionPermissions(app App, cr collectionReq, u User, w http.ResponseWriter, r http.Request) (*Collection, error) {
	// Display collection if this is a collection
	var c *Collection
	var err error
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(cr.alias)
	}
	// TODO: verify we don't reveal the existence of a private collection with redirection
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	if err.Status == http.StatusNotFound {
	if cr.isCustomDomain {
	// User is on the site from a custom domain
	//tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r))
	//if tErr != nil {
	//log.Error("Unable to render 404-domain page: %v", err)
	//}
	return nil, nil
	}
	if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen {
	// Alias is within post ID range, so just be sure this isn't a post
	if app.db.PostIDExists(cr.alias) {
	// TODO: use StatusFound for vanity post URLs when we implement them
	return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias}
	}
	}
	// Redirect if necessary
	newAlias := app.db.GetCollectionRedirect(cr.alias)
	if newAlias != "" {
	return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"}
	}
	}
	}
	return nil, err
	}
	c.hostName = app.cfg.App.Host

	// Update CollectionRequest to reflect owner status
	cr.isCollOwner = u != nil && u.ID == c.OwnerID

	// Check permissions
	if !cr.isCollOwner {
	if c.IsPrivate() {
	return nil, ErrCollectionNotFound
	} else if c.IsProtected() {
	uname := ""
	if u != nil {
	uname = u.Username
	}

	// TODO: move this to all permission checks?
	suspended, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("process protected collection permissions: %v", err)
	return nil, err
	}
	if suspended {
	return nil, ErrCollectionNotFound
	}

	// See if we've authorized this collection
	cr.isAuthorized = isAuthorizedForCollection(app, c.Alias, r)

	if !cr.isAuthorized {
	p := struct {
	page.StaticPage
	*CollectionObj
	Username string
	Next string
	Flashes []template.HTML
	}{
	StaticPage: pageForReq(app, r),
	CollectionObj: &CollectionObj{Collection: *c},
	Username: uname,
	Next: r.FormValue("g"),
	Flashes: []template.HTML{},
	}
	// Get owner information
	p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID)
	if err != nil {
	// Log the error and just continue
	log.Error("Error getting user for collection: %v", err)
	}

	flashes, _ := getSessionFlashes(app, w, r, nil)
	for _, flash := range flashes {
	p.Flashes = append(p.Flashes, template.HTML(flash))
	}
	err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p)
	if err != nil {
	log.Error("Unable to render password-collection: %v", err)
	return nil, err
	}
	return nil, nil
	}
	}
	}
	return c, nil
	}

	func checkUserForCollection(app App, cr collectionReq, r http.Request, isPostReq bool) (User, error) {
	u := getUserSession(app, r)
	return u, nil
	}

	func newDisplayCollection(c Collection, cr collectionReq, page int) *DisplayCollection {
	coll := &DisplayCollection{
	CollectionObj: NewCollectionObj(c),
	CurrentPage: page,
	Prefix: cr.prefix,
	IsTopLevel: isSingleUser,
	}
	c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner)
	return coll
	}

	// getCollectionPage returns the collection page as an int. If the parsed page value is not
	// greater than 0 then the default value of 1 is returned.
	func getCollectionPage(vars map[string]string) int {
	if p, _ := strconv.Atoi(vars["page"]); p > 0 {
	return p
	}

	return 1
	}

	// handleViewCollection displays the requested Collection
	func handleViewCollection(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	cr := &collectionReq{}

	err := processCollectionRequest(cr, vars, w, r)
	if err != nil {
	return err
	}

	u, err := checkUserForCollection(app, cr, r, false)
	if err != nil {
	return err
	}

	page := getCollectionPage(vars)

	c, err := processCollectionPermissions(app, cr, u, w, r)
	if c == nil \|\| err != nil {
	return err
	}
	c.hostName = app.cfg.App.Host

	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("view collection: %v", err)
	return ErrInternalGeneral
	}

	// Serve ActivityStreams data now, if requested
	if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
	ac := c.PersonObject()
	ac.Context = []interface{}{activitystreams.Namespace}
	setCacheControl(w, apCacheTime)
	return impart.RenderActivityJSON(w, ac, http.StatusOK)
	}

	// Fetch extra data about the Collection
	// TODO: refactor out this logic, shared in collection.go:fetchCollection()
	coll := newDisplayCollection(c, cr, page)

	coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage())))
	if coll.TotalPages > 0 && page > coll.TotalPages {
	redirURL := fmt.Sprintf("/page/%d", coll.TotalPages)
	if !app.cfg.App.SingleUser {
	redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL)
	}
	return impart.HTTPError{http.StatusFound, redirURL}
	}

	coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false)

	// Serve collection
	displayPage := CollectionPage{
	DisplayCollection: coll,
	IsCollLoggedIn: cr.isAuthorized,
	StaticPage: pageForReq(app, r),
	IsCustomDomain: cr.isCustomDomain,
	IsWelcome: r.FormValue("greeting") != "",
	Honeypot: spam.HoneypotFieldName(),
	CollAlias: c.Alias,
	}
	flashes, _ := getSessionFlashes(app, w, r, nil)
	for _, f := range flashes {
	displayPage.Flash = template.HTML(f)
	}
	displayPage.IsAdmin = u != nil && u.IsAdmin()
	displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin)
	var owner *User
	if u != nil {
	displayPage.Username = u.Username
	displayPage.IsOwner = u.ID == coll.OwnerID
	displayPage.IsSubscriber = u.IsEmailSubscriber(app, coll.ID)
	if displayPage.IsOwner {
	// Add in needed information for users viewing their own collection
	owner = u
	displayPage.CanPin = true

	pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
	if err != nil {
	log.Error("unable to fetch collections: %v", err)
	}
	displayPage.Collections = pubColls
	}
	}
	isOwner := owner != nil
	if !isOwner {
	// Current user doesn't own collection; retrieve owner information
	owner, err = app.db.GetUserByID(coll.OwnerID)
	if err != nil {
	// Log the error and just continue
	log.Error("Error getting user for collection: %v", err)
	}
	}
	if !isOwner && silenced {
	return ErrCollectionNotFound
	}
	displayPage.Silenced = isOwner && silenced
	displayPage.Owner = owner
	coll.Owner = displayPage.Owner

	// Add more data
	// TODO: fix this mess of collections inside collections
	displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
	displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")

	collTmpl := "collection"
	if app.cfg.App.Chorus {
	collTmpl = "chorus-collection"
	}
	err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage)
	if err != nil {
	log.Error("Unable to render collection index: %v", err)
	}

	// Update collection view count
	go func() {
	// Don't update if owner is viewing the collection.
	if u != nil && u.ID == coll.OwnerID {
	return
	}
	// Only update for human views
	if r.Method == "HEAD" \|\| bots.IsBot(r.UserAgent()) {
	return
	}

	_, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID)
	if err != nil {
	log.Error("Unable to update collections count: %v", err)
	}
	}()

	return err
	}

	func handleViewMention(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	handle := vars["handle"]

	remoteUser, err := app.db.GetProfilePageFromHandle(app, handle)
	if err != nil \|\| remoteUser == "" {
	log.Error("Couldn't find user %s: %v", handle, err)
	return ErrRemoteUserNotFound
	}

	return impart.HTTPError{Status: http.StatusFound, Message: remoteUser}
	}

	func handleViewCollectionTag(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	tag := vars["tag"]

	cr := &collectionReq{}
	err := processCollectionRequest(cr, vars, w, r)
	if err != nil {
	return err
	}

	u, err := checkUserForCollection(app, cr, r, false)
	if err != nil {
	return err
	}

	page := getCollectionPage(vars)

	c, err := processCollectionPermissions(app, cr, u, w, r)
	if c == nil \|\| err != nil {
	return err
	}

	coll := newDisplayCollection(c, cr, page)

	coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner)
	if coll.Posts != nil && len(*coll.Posts) == 0 {
	return ErrCollectionPageNotFound
	}

	// Serve collection
	displayPage := struct {
	CollectionPage
	Tag string
	}{
	CollectionPage: CollectionPage{
	DisplayCollection: coll,
	StaticPage: pageForReq(app, r),
	IsCustomDomain: cr.isCustomDomain,
	},
	Tag: tag,
	}
	var owner *User
	if u != nil {
	displayPage.Username = u.Username
	displayPage.IsOwner = u.ID == coll.OwnerID
	if displayPage.IsOwner {
	// Add in needed information for users viewing their own collection
	owner = u
	displayPage.CanPin = true

	pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
	if err != nil {
	log.Error("unable to fetch collections: %v", err)
	}
	displayPage.Collections = pubColls
	}
	}
	isOwner := owner != nil
	if !isOwner {
	// Current user doesn't own collection; retrieve owner information
	owner, err = app.db.GetUserByID(coll.OwnerID)
	if err != nil {
	// Log the error and just continue
	log.Error("Error getting user for collection: %v", err)
	}
	if owner.IsSilenced() {
	return ErrCollectionNotFound
	}
	}
	displayPage.Silenced = owner != nil && owner.IsSilenced()
	displayPage.Owner = owner
	coll.Owner = displayPage.Owner
	// Add more data
	// TODO: fix this mess of collections inside collections
	displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
	displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")

	err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage)
	if err != nil {
	log.Error("Unable to render collection tag page: %v", err)
	}

	return nil
	}

	func handleCollectionPostRedirect(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	slug := vars["slug"]

	cr := &collectionReq{}
	err := processCollectionRequest(cr, vars, w, r)
	if err != nil {
	return err
	}

	// Normalize the URL, redirecting user to consistent post URL
	loc := fmt.Sprintf("/%s", slug)
	if !app.cfg.App.SingleUser {
	loc = fmt.Sprintf("/%s/%s", cr.alias, slug)
	}
	return impart.HTTPError{http.StatusFound, loc}
	}

	func existingCollection(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)
	vars := mux.Vars(r)
	collAlias := vars["alias"]
	isWeb := r.FormValue("web") == "1"

	u := &User{}
	if reqJSON && !isWeb {
	// Ensure an access token was given
	accessToken := r.Header.Get("Authorization")
	u.ID = app.db.GetUserID(accessToken)
	if u.ID == -1 {
	return ErrBadAccessToken
	}
	} else {
	u = getUserSession(app, r)
	if u == nil {
	return ErrNotLoggedIn
	}
	}

	silenced, err := app.db.IsUserSilenced(u.ID)
	if err != nil {
	log.Error("existing collection: %v", err)
	return ErrInternalGeneral
	}

	if silenced {
	return ErrUserSilenced
	}

	if r.Method == "DELETE" {
	err := app.db.DeleteCollection(collAlias, u.ID)
	if err != nil {
	// TODO: if not HTTPError, report error to admin
	log.Error("Unable to delete collection: %s", err)
	return err
	}
	addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil)
	return impart.HTTPError{Status: http.StatusNoContent}
	}

	c := SubmittedCollection{OwnerID: uint64(u.ID)}

	if reqJSON {
	// Decode JSON request
	decoder := json.NewDecoder(r.Body)
	err = decoder.Decode(&c)
	if err != nil {
	log.Error("Couldn't parse collection update JSON request: %v\n", err)
	return ErrBadJSON
	}
	} else {
	err = r.ParseForm()
	if err != nil {
	log.Error("Couldn't parse collection update form request: %v\n", err)
	return ErrBadFormData
	}

	err = app.formDecoder.Decode(&c, r.PostForm)
	if err != nil {
	log.Error("Couldn't decode collection update form request: %v\n", err)
	return ErrBadFormData
	}
	}

	err = app.db.UpdateCollection(&c, collAlias)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	if reqJSON {
	return err
	}
	addSessionFlash(app, w, r, err.Message, nil)
	return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
	} else {
	log.Error("Couldn't update collection: %v\n", err)
	return err
	}
	}

	if reqJSON {
	return impart.WriteSuccess(w, struct {
	}{}, http.StatusOK)
	}

	addSessionFlash(app, w, r, "Blog updated!", nil)
	return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
	}

	// collectionAliasFromReq takes a request and returns the collection alias
	// if it can be ascertained, as well as whether or not the collection uses a
	// custom domain.
	func collectionAliasFromReq(r *http.Request) string {
	vars := mux.Vars(r)
	alias := vars["subdomain"]
	isSubdomain := alias != ""
	if !isSubdomain {
	// Fall back to write.as/{collection} since this isn't a custom domain
	alias = vars["collection"]
	}
	return alias
	}

	func handleWebCollectionUnlock(app App, w http.ResponseWriter, r http.Request) error {
	var readReq struct {
	Alias string `schema:"alias" json:"alias"`
	Pass string `schema:"password" json:"password"`
	Next string `schema:"to" json:"to"`
	}

	// Get params
	if impart.ReqJSON(r) {
	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&readReq)
	if err != nil {
	log.Error("Couldn't parse readReq JSON request: %v\n", err)
	return ErrBadJSON
	}
	} else {
	err := r.ParseForm()
	if err != nil {
	log.Error("Couldn't parse readReq form request: %v\n", err)
	return ErrBadFormData
	}

	err = app.formDecoder.Decode(&readReq, r.PostForm)
	if err != nil {
	log.Error("Couldn't decode readReq form request: %v\n", err)
	return ErrBadFormData
	}
	}

	if readReq.Alias == "" {
	return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."}
	}
	if readReq.Pass == "" {
	return impart.HTTPError{http.StatusBadRequest, "Please supply a password."}
	}

	var collHashedPass []byte
	err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass)
	if err != nil {
	if err == sql.ErrNoRows {
	log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias)
	return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."}
	}
	return err
	}

	if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) {
	return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
	}

	// Success; set cookie
	session, err := app.sessionStore.Get(r, blogPassCookieName)
	if err == nil {
	session.Values[readReq.Alias] = true
	err = session.Save(r, w)
	if err != nil {
	log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err)
	}
	}

	next := "/" + readReq.Next
	if !app.cfg.App.SingleUser {
	next = "/" + readReq.Alias + next
	}
	return impart.HTTPError{http.StatusFound, next}
	}

	func isAuthorizedForCollection(app App, alias string, r http.Request) bool {
	authd := false
	session, err := app.sessionStore.Get(r, blogPassCookieName)
	if err == nil {
	_, authd = session.Values[alias]
	}
	return authd
	}

	func logOutCollection(app App, alias string, w http.ResponseWriter, r http.Request) error {
	session, err := app.sessionStore.Get(r, blogPassCookieName)
	if err != nil {
	return err
	}

	// Remove this from map of blogs logged into
	delete(session.Values, alias)

	// If not auth'd with any blog, delete entire cookie
	if len(session.Values) == 0 {
	session.Options.MaxAge = -1
	}
	return session.Save(r, w)
	}

	func handleLogOutCollection(app App, w http.ResponseWriter, r http.Request) error {
	alias := collectionAliasFromReq(r)
	var c *Collection
	var err error
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	return err
	}
	if !c.IsProtected() {
	// Invalid to log out of this collection
	return ErrCollectionPageNotFound
	}

	err = logOutCollection(app, c.Alias, w, r)
	if err != nil {
	addSessionFlash(app, w, r, "Logging out failed. Try clearing cookies for this site, instead.", nil)
	}
	return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
	}
	diff --git a/config/config.go b/config/config.go
	index 00dd6a5..36bbc82 100644
	--- a/config/config.go
	+++ b/config/config.go
	@@ -1,305 +1,305 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	// Package config holds and assists in the configuration of a writefreely instance.
	package config

	import (
	"net/url"
	"strings"

	+ "github.com/go-ini/ini"
	"github.com/writeas/web-core/log"
	"golang.org/x/net/idna"
	- "gopkg.in/ini.v1"
	)

	const (
	// FileName is the default configuration file name
	FileName = "config.ini"

	UserNormal UserType = "user"
	UserAdmin = "admin"
	)

	type (
	UserType string

	// ServerCfg holds values that affect how the HTTP server runs
	ServerCfg struct {
	HiddenHost string `ini:"hidden_host"`
	Port int `ini:"port"`
	Bind string `ini:"bind"`

	TLSCertPath string `ini:"tls_cert_path"`
	TLSKeyPath string `ini:"tls_key_path"`
	Autocert bool `ini:"autocert"`

	TemplatesParentDir string `ini:"templates_parent_dir"`
	StaticParentDir string `ini:"static_parent_dir"`
	PagesParentDir string `ini:"pages_parent_dir"`
	KeysParentDir string `ini:"keys_parent_dir"`

	HashSeed string `ini:"hash_seed"`

	GopherPort int `ini:"gopher_port"`

	Dev bool `ini:"-"`
	}

	// DatabaseCfg holds values that determine how the application connects to a datastore
	DatabaseCfg struct {
	Type string `ini:"type"`
	FileName string `ini:"filename"`
	User string `ini:"username"`
	Password string `ini:"password"`
	Database string `ini:"database"`
	Host string `ini:"host"`
	Port int `ini:"port"`
	TLS bool `ini:"tls"`
	}

	WriteAsOauthCfg struct {
	ClientID string `ini:"client_id"`
	ClientSecret string `ini:"client_secret"`
	AuthLocation string `ini:"auth_location"`
	TokenLocation string `ini:"token_location"`
	InspectLocation string `ini:"inspect_location"`
	CallbackProxy string `ini:"callback_proxy"`
	CallbackProxyAPI string `ini:"callback_proxy_api"`
	}

	GitlabOauthCfg struct {
	ClientID string `ini:"client_id"`
	ClientSecret string `ini:"client_secret"`
	Host string `ini:"host"`
	DisplayName string `ini:"display_name"`
	CallbackProxy string `ini:"callback_proxy"`
	CallbackProxyAPI string `ini:"callback_proxy_api"`
	}

	GiteaOauthCfg struct {
	ClientID string `ini:"client_id"`
	ClientSecret string `ini:"client_secret"`
	Host string `ini:"host"`
	DisplayName string `ini:"display_name"`
	CallbackProxy string `ini:"callback_proxy"`
	CallbackProxyAPI string `ini:"callback_proxy_api"`
	}

	SlackOauthCfg struct {
	ClientID string `ini:"client_id"`
	ClientSecret string `ini:"client_secret"`
	TeamID string `ini:"team_id"`
	CallbackProxy string `ini:"callback_proxy"`
	CallbackProxyAPI string `ini:"callback_proxy_api"`
	}

	GenericOauthCfg struct {
	ClientID string `ini:"client_id"`
	ClientSecret string `ini:"client_secret"`
	Host string `ini:"host"`
	DisplayName string `ini:"display_name"`
	CallbackProxy string `ini:"callback_proxy"`
	CallbackProxyAPI string `ini:"callback_proxy_api"`
	TokenEndpoint string `ini:"token_endpoint"`
	InspectEndpoint string `ini:"inspect_endpoint"`
	AuthEndpoint string `ini:"auth_endpoint"`
	Scope string `ini:"scope"`
	AllowDisconnect bool `ini:"allow_disconnect"`
	MapUserID string `ini:"map_user_id"`
	MapUsername string `ini:"map_username"`
	MapDisplayName string `ini:"map_display_name"`
	MapEmail string `ini:"map_email"`
	}

	// AppCfg holds values that affect how the application functions
	AppCfg struct {
	SiteName string `ini:"site_name"`
	SiteDesc string `ini:"site_description"`
	Host string `ini:"host"`

	// Site appearance
	Theme string `ini:"theme"`
	Editor string `ini:"editor"`
	JSDisabled bool `ini:"disable_js"`
	WebFonts bool `ini:"webfonts"`
	Landing string `ini:"landing"`
	SimpleNav bool `ini:"simple_nav"`
	WFModesty bool `ini:"wf_modesty"`

	// Site functionality
	Chorus bool `ini:"chorus"`
	Forest bool `ini:"forest"` // The admin cares about the forest, not the trees. Hide unnecessary technical info.
	DisableDrafts bool `ini:"disable_drafts"`

	// Users
	SingleUser bool `ini:"single_user"`
	OpenRegistration bool `ini:"open_registration"`
	OpenDeletion bool `ini:"open_deletion"`
	MinUsernameLen int `ini:"min_username_len"`
	MaxBlogs int `ini:"max_blogs"`

	// Options for public instances
	// Federation
	Federation bool `ini:"federation"`
	PublicStats bool `ini:"public_stats"`
	Monetization bool `ini:"monetization"`
	NotesOnly bool `ini:"notes_only"`

	// Access
	Private bool `ini:"private"`

	// Additional functions
	LocalTimeline bool `ini:"local_timeline"`
	UserInvites string `ini:"user_invites"`

	// Defaults
	DefaultVisibility string `ini:"default_visibility"`

	// Check for Updates
	UpdateChecks bool `ini:"update_checks"`

	// Disable password authentication if use only Oauth
	DisablePasswordAuth bool `ini:"disable_password_auth"`
	}

	LettersCfg struct {
	Domain string `ini:"domain"`
	MailgunPrivate string `ini:"mailgun_private"`
	}

	// Config holds the complete configuration for running a writefreely instance
	Config struct {
	Server ServerCfg `ini:"server"`
	Database DatabaseCfg `ini:"database"`
	App AppCfg `ini:"app"`
	Letters LettersCfg `ini:"letters"`
	SlackOauth SlackOauthCfg `ini:"oauth.slack"`
	WriteAsOauth WriteAsOauthCfg `ini:"oauth.writeas"`
	GitlabOauth GitlabOauthCfg `ini:"oauth.gitlab"`
	GiteaOauth GiteaOauthCfg `ini:"oauth.gitea"`
	GenericOauth GenericOauthCfg `ini:"oauth.generic"`
	}
	)

	// New creates a new Config with sane defaults
	func New() *Config {
	c := &Config{
	Server: ServerCfg{
	Port: 8080,
	Bind: "localhost", /* IPV6 support when not using localhost? */
	},
	App: AppCfg{
	Host: "http://localhost:8080",
	Theme: "write",
	WebFonts: true,
	SingleUser: true,
	MinUsernameLen: 3,
	MaxBlogs: 1,
	Federation: true,
	PublicStats: true,
	},
	}
	c.UseMySQL(true)
	return c
	}

	// UseMySQL resets the Config's Database to use default values for a MySQL setup.
	func (cfg *Config) UseMySQL(fresh bool) {
	cfg.Database.Type = "mysql"
	if fresh {
	cfg.Database.Host = "localhost"
	cfg.Database.Port = 3306
	}
	}

	// UseSQLite resets the Config's Database to use default values for a SQLite setup.
	func (cfg *Config) UseSQLite(fresh bool) {
	cfg.Database.Type = "sqlite3"
	if fresh {
	cfg.Database.FileName = "writefreely.db"
	}
	}

	// IsSecureStandalone returns whether or not the application is running as a
	// standalone server with TLS enabled.
	func (cfg *Config) IsSecureStandalone() bool {
	return cfg.Server.Port == 443 && cfg.Server.TLSCertPath != "" && cfg.Server.TLSKeyPath != ""
	}

	func (ac *AppCfg) LandingPath() string {
	if !strings.HasPrefix(ac.Landing, "/") {
	return "/" + ac.Landing
	}
	return ac.Landing
	}

	func (lc LettersCfg) Enabled() bool {
	return lc.Domain != "" && lc.MailgunPrivate != ""
	}

	func (ac AppCfg) SignupPath() string {
	if !ac.OpenRegistration {
	return ""
	}
	if ac.Chorus \|\| ac.Private \|\| (ac.Landing != "" && ac.Landing != "/") {
	return "/signup"
	}
	return "/"
	}

	// Load reads the given configuration file, then parses and returns it as a Config.
	func Load(fname string) (*Config, error) {
	if fname == "" {
	fname = FileName
	}
	cfg, err := ini.Load(fname)
	if err != nil {
	return nil, err
	}

	// Parse INI file
	uc := &Config{}
	err = cfg.MapTo(uc)
	if err != nil {
	return nil, err
	}

	// Do any transformations
	u, err := url.Parse(uc.App.Host)
	if err != nil {
	return nil, err
	}
	d, err := idna.ToASCII(u.Hostname())
	if err != nil {
	log.Error("idna.ToASCII for %s: %s", u.Hostname(), err)
	return nil, err
	}
	uc.App.Host = u.Scheme + "://" + d
	if u.Port() != "" {
	uc.App.Host += ":" + u.Port()
	}

	return uc, nil
	}

	// Save writes the given Config to the given file.
	func Save(uc *Config, fname string) error {
	cfg := ini.Empty()
	err := ini.ReflectFrom(cfg, uc)
	if err != nil {
	return err
	}

	if fname == "" {
	fname = FileName
	}
	return cfg.SaveTo(fname)
	}
	diff --git a/config/data.go b/config/data.go
	index 1c12fdc..35b61cd 100644
	--- a/config/data.go
	+++ b/config/data.go
	@@ -1,16 +1,16 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package config

	type UserCreation struct {
	Username string
	HashedPass []byte
	}
	diff --git a/config/funcs.go b/config/funcs.go
	index fc8c687..7c6fd4f 100644
	--- a/config/funcs.go
	+++ b/config/funcs.go
	@@ -1,62 +1,62 @@
	/*
	- * Copyright © 2018, 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2018, 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package config

	import (
	"github.com/writeas/web-core/log"
	"golang.org/x/net/idna"
	"net/http"
	"net/url"
	"strings"
	"time"
	)

	// FriendlyHost returns the app's Host sans any schema
	func (ac AppCfg) FriendlyHost() string {
	rawHost := ac.Host[strings.Index(ac.Host, "://")+len("://"):]

	u, err := url.Parse(ac.Host)
	if err != nil {
	log.Error("url.Parse failed on %s: %s", ac.Host, err)
	return rawHost
	}
	d, err := idna.ToUnicode(u.Hostname())
	if err != nil {
	log.Error("idna.ToUnicode failed on %s: %s", ac.Host, err)
	return rawHost
	}

	res := d
	if u.Port() != "" {
	res += ":" + u.Port()
	}
	return res
	}

	func (ac AppCfg) CanCreateBlogs(currentlyUsed uint64) bool {
	if ac.MaxBlogs <= 0 {
	return true
	}
	return int(currentlyUsed) < ac.MaxBlogs
	}

	// OrDefaultString returns input or a default value if input is empty.
	func OrDefaultString(input, defaultValue string) string {
	if len(input) == 0 {
	return defaultValue
	}
	return input
	}

	// DefaultHTTPClient returns a sane default HTTP client.
	func DefaultHTTPClient() *http.Client {
	return &http.Client{Timeout: 10 * time.Second}
	}
	diff --git a/config/setup.go b/config/setup.go
	index 08c479f..9fddd5a 100644
	--- a/config/setup.go
	+++ b/config/setup.go
	@@ -1,382 +1,382 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package config

	import (
	"fmt"
	"github.com/fatih/color"
	"github.com/manifoldco/promptui"
	"github.com/mitchellh/go-wordwrap"
	"github.com/writeas/web-core/auth"
	"strconv"
	"strings"
	)

	type SetupData struct {
	User *UserCreation
	Config *Config
	}

	func Configure(fname string, configSections string) (*SetupData, error) {
	data := &SetupData{}
	var err error
	if fname == "" {
	fname = FileName
	}

	data.Config, err = Load(fname)
	var action string
	isNewCfg := false
	if err != nil {
	fmt.Printf("No %s configuration yet. Creating new.\n", fname)
	data.Config = New()
	action = "generate"
	isNewCfg = true
	} else {
	fmt.Printf("Loaded configuration %s.\n", fname)
	action = "update"
	}
	title := color.New(color.Bold, color.BgGreen).PrintFunc()

	intro := color.New(color.Bold, color.FgWhite).PrintlnFunc()
	fmt.Println()
	intro(" ✍ WriteFreely Configuration ✍")
	fmt.Println()
	fmt.Println(wordwrap.WrapString(" This quick configuration process will "+action+" the application's config file, "+fname+".\n\n It validates your input along the way, so you can be sure any future errors aren't caused by a bad configuration. If you'd rather configure your server manually, instead run: writefreely --create-config and edit that file.", 75))
	fmt.Println()

	tmpls := &promptui.PromptTemplates{
	Success: "{{ . \| bold \| faint }}: ",
	}
	selTmpls := &promptui.SelectTemplates{
	Selected: fmt.Sprintf(`{{.Label}} {{ . \| faint }}`),
	}

	var selPrompt promptui.Select
	var prompt promptui.Prompt

	if strings.Contains(configSections, "server") {
	title(" Server setup ")
	fmt.Println()

	// Environment selection
	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Environment",
	Items: []string{"Development", "Production, standalone", "Production, behind reverse proxy"},
	}
	_, envType, err := selPrompt.Run()
	if err != nil {
	return data, err
	}
	isDevEnv := envType == "Development"
	isStandalone := envType == "Production, standalone"

	data.Config.Server.Dev = isDevEnv

	if isDevEnv \|\| !isStandalone {
	// Running in dev environment or behind reverse proxy; ask for port
	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Local port",
	Validate: validatePort,
	Default: fmt.Sprintf("%d", data.Config.Server.Port),
	}
	port, err := prompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.Server.Port, _ = strconv.Atoi(port) // Ignore error, as we've already validated number
	}

	if isStandalone {
	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Web server mode",
	Items: []string{"Insecure (port 80)", "Secure (port 443), manual certificate", "Secure (port 443), auto certificate"},
	}
	sel, _, err := selPrompt.Run()
	if err != nil {
	return data, err
	}
	if sel == 0 {
	data.Config.Server.Autocert = false
	data.Config.Server.Port = 80
	data.Config.Server.TLSCertPath = ""
	data.Config.Server.TLSKeyPath = ""
	} else if sel == 1 \|\| sel == 2 {
	data.Config.Server.Port = 443
	data.Config.Server.Autocert = sel == 2

	if sel == 1 {
	// Manual certificate configuration
	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Certificate path",
	Validate: validateNonEmpty,
	Default: data.Config.Server.TLSCertPath,
	}
	data.Config.Server.TLSCertPath, err = prompt.Run()
	if err != nil {
	return data, err
	}

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Key path",
	Validate: validateNonEmpty,
	Default: data.Config.Server.TLSKeyPath,
	}
	data.Config.Server.TLSKeyPath, err = prompt.Run()
	if err != nil {
	return data, err
	}
	} else {
	// Automatic certificate
	data.Config.Server.TLSCertPath = "certs"
	data.Config.Server.TLSKeyPath = "certs"
	}
	}
	} else {
	data.Config.Server.TLSCertPath = ""
	data.Config.Server.TLSKeyPath = ""
	}

	fmt.Println()
	}

	if strings.Contains(configSections, "db") {
	title(" Database setup ")
	fmt.Println()

	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Database driver",
	Items: []string{"MySQL", "SQLite"},
	}
	sel, _, err := selPrompt.Run()
	if err != nil {
	return data, err
	}

	if sel == 0 {
	// Configure for MySQL
	data.Config.UseMySQL(isNewCfg)

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Username",
	Validate: validateNonEmpty,
	Default: data.Config.Database.User,
	}
	data.Config.Database.User, err = prompt.Run()
	if err != nil {
	return data, err
	}

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Password",
	Validate: validateNonEmpty,
	Default: data.Config.Database.Password,
	Mask: '*',
	}
	data.Config.Database.Password, err = prompt.Run()
	if err != nil {
	return data, err
	}

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Database name",
	Validate: validateNonEmpty,
	Default: data.Config.Database.Database,
	}
	data.Config.Database.Database, err = prompt.Run()
	if err != nil {
	return data, err
	}

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Host",
	Validate: validateNonEmpty,
	Default: data.Config.Database.Host,
	}
	data.Config.Database.Host, err = prompt.Run()
	if err != nil {
	return data, err
	}

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Port",
	Validate: validatePort,
	Default: fmt.Sprintf("%d", data.Config.Database.Port),
	}
	dbPort, err := prompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.Database.Port, _ = strconv.Atoi(dbPort) // Ignore error, as we've already validated number
	} else if sel == 1 {
	// Configure for SQLite
	data.Config.UseSQLite(isNewCfg)

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Filename",
	Validate: validateNonEmpty,
	Default: data.Config.Database.FileName,
	}
	data.Config.Database.FileName, err = prompt.Run()
	if err != nil {
	return data, err
	}
	}

	fmt.Println()
	}

	if strings.Contains(configSections, "app") {
	title(" App setup ")
	fmt.Println()

	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Site type",
	Items: []string{"Single user blog", "Multi-user instance"},
	}
	_, usersType, err := selPrompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.App.SingleUser = usersType == "Single user blog"

	if data.Config.App.SingleUser {
	data.User = &UserCreation{}

	// prompt for username
	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Admin username",
	Validate: validateNonEmpty,
	}
	data.User.Username, err = prompt.Run()
	if err != nil {
	return data, err
	}

	// prompt for password
	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Admin password",
	Validate: validateNonEmpty,
	}
	newUserPass, err := prompt.Run()
	if err != nil {
	return data, err
	}

	data.User.HashedPass, err = auth.HashPass([]byte(newUserPass))
	if err != nil {
	return data, err
	}
	}

	siteNameLabel := "Instance name"
	if data.Config.App.SingleUser {
	siteNameLabel = "Blog name"
	}
	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: siteNameLabel,
	Validate: validateNonEmpty,
	Default: data.Config.App.SiteName,
	}
	data.Config.App.SiteName, err = prompt.Run()
	if err != nil {
	return data, err
	}

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Public URL",
	Validate: validateDomain,
	Default: data.Config.App.Host,
	}
	data.Config.App.Host, err = prompt.Run()
	if err != nil {
	return data, err
	}

	if !data.Config.App.SingleUser {
	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Registration",
	Items: []string{"Open", "Closed"},
	}
	_, regType, err := selPrompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.App.OpenRegistration = regType == "Open"

	prompt = promptui.Prompt{
	Templates: tmpls,
	Label: "Max blogs per user",
	Default: fmt.Sprintf("%d", data.Config.App.MaxBlogs),
	}
	maxBlogs, err := prompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.App.MaxBlogs, _ = strconv.Atoi(maxBlogs) // Ignore error, as we've already validated number
	}

	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Federation",
	Items: []string{"Enabled", "Disabled"},
	}
	_, fedType, err := selPrompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.App.Federation = fedType == "Enabled"

	if data.Config.App.Federation {
	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Usage stats (active users, posts)",
	Items: []string{"Public", "Private"},
	}
	_, fedStatsType, err := selPrompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.App.PublicStats = fedStatsType == "Public"

	selPrompt = promptui.Select{
	Templates: selTmpls,
	Label: "Instance metadata privacy",
	Items: []string{"Public", "Private"},
	}
	_, fedStatsType, err = selPrompt.Run()
	if err != nil {
	return data, err
	}
	data.Config.App.Private = fedStatsType == "Private"
	}
	}

	return data, Save(data.Config, fname)
	}
	diff --git a/config/validation.go b/config/validation.go
	index 598c9fe..f6b8a14 100644
	--- a/config/validation.go
	+++ b/config/validation.go
	@@ -1,51 +1,51 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package config

	import (
	"fmt"
	"regexp"
	"strconv"
	)

	var (
	domainReg = regexp.MustCompile("^https?://")
	)

	const (
	minPort = 80
	maxPort = 1<<16 - 1
	)

	func validateDomain(i string) error {
	if !domainReg.MatchString(i) {
	return fmt.Errorf("Domain must start with http:// or https://")
	}
	return nil
	}

	func validatePort(i string) error {
	p, err := strconv.Atoi(i)
	if err != nil {
	return err
	}
	if p < minPort \|\| p > maxPort {
	return fmt.Errorf("Port must be a number %d - %d", minPort, maxPort)
	}
	return nil
	}

	func validateNonEmpty(i string) error {
	if i == "" {
	return fmt.Errorf("Must not be empty")
	}
	return nil
	}
	diff --git a/database-lib.go b/database-lib.go
	index 8b28577..87a9dee 100644
	--- a/database-lib.go
	+++ b/database-lib.go
	@@ -1,28 +1,29 @@
	+//go:build wflib
	// +build wflib

	/*
	- * Copyright © 2019-2020 A Bunch Tell LLC.
	+ * Copyright © 2019-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	// This file contains dummy database funcs for when writefreely is used as a
	// library.

	package writefreely

	func (db *datastore) isDuplicateKeyErr(err error) bool {
	return false
	}

	func (db *datastore) isIgnorableError(err error) bool {
	return false
	}

	func (db *datastore) isHighLoadError(err error) bool {
	return false
	}
	diff --git a/database-no-sqlite.go b/database-no-sqlite.go
	index f2c7ffc..ef5104e 100644
	--- a/database-no-sqlite.go
	+++ b/database-no-sqlite.go
	@@ -1,52 +1,53 @@
	+//go:build !sqlite && !wflib
	// +build !sqlite,!wflib

	/*
	- * Copyright © 2019-2020 A Bunch Tell LLC.
	+ * Copyright © 2019-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"github.com/go-sql-driver/mysql"
	"github.com/writeas/web-core/log"
	)

	func (db *datastore) isDuplicateKeyErr(err error) bool {
	if db.driverName == driverMySQL {
	if mysqlErr, ok := err.(*mysql.MySQLError); ok {
	return mysqlErr.Number == mySQLErrDuplicateKey
	}
	} else {
	log.Error("isDuplicateKeyErr: failed check for unrecognized driver '%s'", db.driverName)
	}

	return false
	}

	func (db *datastore) isIgnorableError(err error) bool {
	if db.driverName == driverMySQL {
	if mysqlErr, ok := err.(*mysql.MySQLError); ok {
	return mysqlErr.Number == mySQLErrCollationMix
	}
	} else {
	log.Error("isIgnorableError: failed check for unrecognized driver '%s'", db.driverName)
	}

	return false
	}

	func (db *datastore) isHighLoadError(err error) bool {
	if db.driverName == driverMySQL {
	if mysqlErr, ok := err.(*mysql.MySQLError); ok {
	return mysqlErr.Number == mySQLErrMaxUserConns \|\| mysqlErr.Number == mySQLErrTooManyConns
	}
	}

	return false
	}
	diff --git a/database-sqlite.go b/database-sqlite.go
	index 10e701e..7d33315 100644
	--- a/database-sqlite.go
	+++ b/database-sqlite.go
	@@ -1,72 +1,73 @@
	+//go:build sqlite && !wflib
	// +build sqlite,!wflib

	/*
	- * Copyright © 2019-2020 A Bunch Tell LLC.
	+ * Copyright © 2019-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"github.com/go-sql-driver/mysql"
	"github.com/mattn/go-sqlite3"
	"github.com/writeas/web-core/log"
	"regexp"
	)

	func init() {
	SQLiteEnabled = true

	regex := func(re, s string) (bool, error) {
	return regexp.MatchString(re, s)
	}
	sql.Register("sqlite3_with_regex", &sqlite3.SQLiteDriver{
	ConnectHook: func(conn *sqlite3.SQLiteConn) error {
	return conn.RegisterFunc("regexp", regex, true)
	},
	})
	}

	func (db *datastore) isDuplicateKeyErr(err error) bool {
	if db.driverName == driverSQLite {
	if err, ok := err.(sqlite3.Error); ok {
	return err.Code == sqlite3.ErrConstraint
	}
	} else if db.driverName == driverMySQL {
	if mysqlErr, ok := err.(*mysql.MySQLError); ok {
	return mysqlErr.Number == mySQLErrDuplicateKey
	}
	} else {
	log.Error("isDuplicateKeyErr: failed check for unrecognized driver '%s'", db.driverName)
	}

	return false
	}

	func (db *datastore) isIgnorableError(err error) bool {
	if db.driverName == driverMySQL {
	if mysqlErr, ok := err.(*mysql.MySQLError); ok {
	return mysqlErr.Number == mySQLErrCollationMix
	}
	} else {
	log.Error("isIgnorableError: failed check for unrecognized driver '%s'", db.driverName)
	}

	return false
	}

	func (db *datastore) isHighLoadError(err error) bool {
	if db.driverName == driverMySQL {
	if mysqlErr, ok := err.(*mysql.MySQLError); ok {
	return mysqlErr.Number == mySQLErrMaxUserConns \|\| mysqlErr.Number == mySQLErrTooManyConns
	}
	}

	return false
	}
	diff --git a/database.go b/database.go
	index 07bc109..425066f 100644
	--- a/database.go
	+++ b/database.go
	@@ -1,3091 +1,3091 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"context"
	"database/sql"
	"fmt"
	"github.com/go-sql-driver/mysql"
	"github.com/writeas/web-core/silobridge"
	wf_db "github.com/writefreely/writefreely/db"
	"net/http"
	"strings"
	"time"

	"github.com/guregu/null"
	"github.com/guregu/null/zero"
	uuid "github.com/nu7hatch/gouuid"
	"github.com/writeas/activityserve"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/activitypub"
	"github.com/writeas/web-core/auth"
	"github.com/writeas/web-core/data"
	"github.com/writeas/web-core/id"
	"github.com/writeas/web-core/log"
	"github.com/writeas/web-core/query"
	"github.com/writefreely/writefreely/author"
	"github.com/writefreely/writefreely/config"
	"github.com/writefreely/writefreely/key"
	)

	const (
	mySQLErrDuplicateKey = 1062
	mySQLErrCollationMix = 1267
	mySQLErrTooManyConns = 1040
	mySQLErrMaxUserConns = 1203

	driverMySQL = "mysql"
	driverSQLite = "sqlite3"
	)

	var (
	SQLiteEnabled bool
	)

	type writestore interface {
	CreateUser(config.Config, User, string, string) error
	UpdateUserEmail(keys *key.Keychain, userID int64, email string) error
	UpdateEncryptedUserEmail(int64, []byte) error
	GetUserByID(int64) (*User, error)
	GetUserForAuth(string) (*User, error)
	GetUserForAuthByID(int64) (*User, error)
	GetUserNameFromToken(string) (string, error)
	GetUserDataFromToken(string) (int64, string, error)
	GetAPIUser(header string) (*User, error)
	GetUserID(accessToken string) int64
	GetUserIDPrivilege(accessToken string) (userID int64, sudo bool)
	DeleteToken(accessToken []byte) error
	FetchLastAccessToken(userID int64) string
	GetAccessToken(userID int64) (string, error)
	GetTemporaryAccessToken(userID int64, validSecs int) (string, error)
	GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error)
	DeleteAccount(userID int64) error
	ChangeSettings(app App, u User, s *userSettings) error
	ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error

	GetCollections(u User, hostName string) ([]Collection, error)
	GetPublishableCollections(u User, hostName string) ([]Collection, error)
	GetMeStats(u *User) userMeStats
	GetTotalCollections() (int64, error)
	GetTotalPosts() (int64, error)
	GetTopPosts(u User, alias string, hostName string) ([]PublicPost, error)
	GetAnonymousPosts(u User, page int) ([]PublicPost, error)
	GetUserPosts(u User) ([]PublicPost, error)

	CreateOwnedPost(post SubmittedPost, accessToken, collAlias, hostName string) (PublicPost, error)
	CreatePost(userID, collID int64, post SubmittedPost) (Post, error)
	UpdateOwnedPost(post *AuthenticatedPost, userID int64) error
	GetEditablePost(id, editToken string) (*PublicPost, error)
	PostIDExists(id string) bool
	GetPost(id string, collectionID int64) (*PublicPost, error)
	GetOwnedPost(id string, ownerID int64) (*PublicPost, error)
	GetPostProperty(id string, collectionID int64, property string) (interface{}, error)

	CreateCollectionFromToken(config.Config, string, string, string) (Collection, error)
	CreateCollection(config.Config, string, string, int64) (Collection, error)
	GetCollectionBy(condition string, value interface{}) (*Collection, error)
	GetCollection(alias string) (*Collection, error)
	GetCollectionForPad(alias string) (*Collection, error)
	GetCollectionByID(id int64) (*Collection, error)
	UpdateCollection(c *SubmittedCollection, alias string) error
	DeleteCollection(alias string, userID int64) error

	UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error
	GetLastPinnedPostPos(collID int64) int64
	GetPinnedPosts(coll CollectionObj, includeFuture bool) ([]PublicPost, error)
	RemoveCollectionRedirect(t *sql.Tx, alias string) error
	GetCollectionRedirect(alias string) (new string)
	IsCollectionAttributeOn(id int64, attr string) bool
	CollectionHasAttribute(id int64, attr string) bool

	CanCollect(cpr *ClaimPostRequest, userID int64) bool
	AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error)
	DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error)
	ClaimPosts(cfg config.Config, userID int64, collAlias string, posts []ClaimPostRequest) (*[]ClaimPostResult, error)

	GetPostsCount(c *CollectionObj, includeFuture bool)
	GetPosts(cfg config.Config, c Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error)
	GetPostsTagged(cfg config.Config, c Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error)

	GetAPFollowers(c Collection) ([]RemoteUser, error)
	GetAPActorKeys(collectionID int64) ([]byte, []byte)
	CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error
	GetUserInvites(userID int64) (*[]Invite, error)
	GetUserInvite(id string) (*Invite, error)
	GetUsersInvitedCount(id string) int64
	CreateInvitedUser(inviteID string, userID int64) error

	GetDynamicContent(id string) (*instanceContent, error)
	UpdateDynamicContent(id, title, content, contentType string) error
	GetAllUsers(page uint) (*[]User, error)
	GetAllUsersCount() int64
	GetUserLastPostTime(id int64) (*time.Time, error)
	GetCollectionLastPostTime(id int64) (*time.Time, error)

	GetIDForRemoteUser(context.Context, string, string, string) (int64, error)
	RecordRemoteUserID(context.Context, int64, string, string, string, string) error
	ValidateOAuthState(context.Context, string) (string, string, int64, string, error)
	GenerateOAuthState(context.Context, string, string, int64, string) (string, error)
	GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error)
	RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error

	DatabaseInitialized() bool
	}

	type datastore struct {
	*sql.DB
	driverName string
	}

	var _ writestore = &datastore{}

	func (db *datastore) now() string {
	if db.driverName == driverSQLite {
	return "strftime('%Y-%m-%d %H:%M:%S','now')"
	}
	return "NOW()"
	}

	func (db *datastore) clip(field string, l int) string {
	if db.driverName == driverSQLite {
	return fmt.Sprintf("SUBSTR(%s, 0, %d)", field, l)
	}
	return fmt.Sprintf("LEFT(%s, %d)", field, l)
	}

	func (db *datastore) upsert(indexedCols ...string) string {
	if db.driverName == driverSQLite {
	// NOTE: SQLite UPSERT syntax only works in v3.24.0 (2018-06-04) or later
	// Leaving this for whenever we can upgrade and include it in our binary
	cc := strings.Join(indexedCols, ", ")
	return "ON CONFLICT(" + cc + ") DO UPDATE SET"
	}
	return "ON DUPLICATE KEY UPDATE"
	}

	func (db *datastore) dateSub(l int, unit string) string {
	if db.driverName == driverSQLite {
	return fmt.Sprintf("DATETIME('now', '-%d %s')", l, unit)
	}
	return fmt.Sprintf("DATE_SUB(NOW(), INTERVAL %d %s)", l, unit)
	}

	// CreateUser creates a new user in the database from the given User, UPDATING it in the process with the user's ID.
	func (db datastore) CreateUser(cfg config.Config, u *User, collectionTitle string, collectionDesc string) error {
	if db.PostIDExists(u.Username) {
	return impart.HTTPError{http.StatusConflict, "Invalid collection name."}
	}

	// New users get a `users` and `collections` row.
	t, err := db.Begin()
	if err != nil {
	return err
	}

	// 1. Add to `users` table
	// NOTE: Assumes User's Password is already hashed!
	res, err := t.Exec("INSERT INTO users (username, password, email) VALUES (?, ?, ?)", u.Username, u.HashedPass, u.Email)
	if err != nil {
	t.Rollback()
	if db.isDuplicateKeyErr(err) {
	return impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}

	log.Error("Rolling back users INSERT: %v\n", err)
	return err
	}
	u.ID, err = res.LastInsertId()
	if err != nil {
	t.Rollback()
	log.Error("Rolling back after LastInsertId: %v\n", err)
	return err
	}

	// 2. Create user's Collection
	if collectionTitle == "" {
	collectionTitle = u.Username
	}
	res, err = t.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", u.Username, collectionTitle, collectionDesc, defaultVisibility(cfg), u.ID, 0)
	if err != nil {
	t.Rollback()
	if db.isDuplicateKeyErr(err) {
	return impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}
	log.Error("Rolling back collections INSERT: %v\n", err)
	return err
	}

	db.RemoveCollectionRedirect(t, u.Username)

	err = t.Commit()
	if err != nil {
	t.Rollback()
	log.Error("Rolling back after Commit(): %v\n", err)
	return err
	}

	return nil
	}

	// FIXME: We're returning errors inconsistently in this file. Do we use Errorf
	// for returned value, or impart?
	func (db datastore) UpdateUserEmail(keys key.Keychain, userID int64, email string) error {
	encEmail, err := data.Encrypt(keys.EmailKey, email)
	if err != nil {
	return fmt.Errorf("Couldn't encrypt email %s: %s\n", email, err)
	}

	return db.UpdateEncryptedUserEmail(userID, encEmail)
	}

	func (db *datastore) UpdateEncryptedUserEmail(userID int64, encEmail []byte) error {
	_, err := db.Exec("UPDATE users SET email = ? WHERE id = ?", encEmail, userID)
	if err != nil {
	return fmt.Errorf("Unable to update user email: %s", err)
	}

	return nil
	}

	func (db datastore) CreateCollectionFromToken(cfg config.Config, alias, title, accessToken string) (*Collection, error) {
	userID := db.GetUserID(accessToken)
	if userID == -1 {
	return nil, ErrBadAccessToken
	}

	return db.CreateCollection(cfg, alias, title, userID)
	}

	func (db *datastore) GetUserCollectionCount(userID int64) (uint64, error) {
	var collCount uint64
	err := db.QueryRow("SELECT COUNT(*) FROM collections WHERE owner_id = ?", userID).Scan(&collCount)
	switch {
	case err == sql.ErrNoRows:
	return 0, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user from database."}
	case err != nil:
	log.Error("Couldn't get collections count for user %d: %v", userID, err)
	return 0, err
	}

	return collCount, nil
	}

	func (db datastore) CreateCollection(cfg config.Config, alias, title string, userID int64) (*Collection, error) {
	if db.PostIDExists(alias) {
	return nil, impart.HTTPError{http.StatusConflict, "Invalid collection name."}
	}

	// All good, so create new collection
	res, err := db.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", alias, title, "", defaultVisibility(cfg), userID, 0)
	if err != nil {
	if db.isDuplicateKeyErr(err) {
	return nil, impart.HTTPError{http.StatusConflict, "Collection already exists."}
	}
	log.Error("Couldn't add to collections: %v\n", err)
	return nil, err
	}

	c := &Collection{
	Alias: alias,
	Title: title,
	OwnerID: userID,
	PublicOwner: false,
	Public: defaultVisibility(cfg) == CollPublic,
	}

	c.ID, err = res.LastInsertId()
	if err != nil {
	log.Error("Couldn't get collection LastInsertId: %v\n", err)
	}

	return c, nil
	}

	func (db datastore) GetUserByID(id int64) (User, error) {
	u := &User{ID: id}

	err := db.QueryRow("SELECT username, password, email, created, status FROM users WHERE id = ?", id).Scan(&u.Username, &u.HashedPass, &u.Email, &u.Created, &u.Status)
	switch {
	case err == sql.ErrNoRows:
	return nil, ErrUserNotFound
	case err != nil:
	log.Error("Couldn't SELECT user password: %v", err)
	return nil, err
	}

	return u, nil
	}

	// IsUserSilenced returns true if the user account associated with id is
	// currently silenced.
	func (db *datastore) IsUserSilenced(id int64) (bool, error) {
	u := &User{ID: id}

	err := db.QueryRow("SELECT status FROM users WHERE id = ?", id).Scan(&u.Status)
	switch {
	case err == sql.ErrNoRows:
	- return false, fmt.Errorf("is user silenced: %v", ErrUserNotFound)
	+ return false, ErrUserNotFound
	case err != nil:
	log.Error("Couldn't SELECT user status: %v", err)
	return false, fmt.Errorf("is user silenced: %v", err)
	}

	return u.IsSilenced(), nil
	}

	// DoesUserNeedAuth returns true if the user hasn't provided any methods for
	// authenticating with the account, such a passphrase or email address.
	// Any errors are reported to admin and silently quashed, returning false as the
	// result.
	func (db *datastore) DoesUserNeedAuth(id int64) bool {
	var pass, email []byte

	// Find out if user has an email set first
	err := db.QueryRow("SELECT password, email FROM users WHERE id = ?", id).Scan(&pass, &email)
	switch {
	case err == sql.ErrNoRows:
	// ERROR. Don't give false positives on needing auth methods
	return false
	case err != nil:
	// ERROR. Don't give false positives on needing auth methods
	log.Error("Couldn't SELECT user %d from users: %v", id, err)
	return false
	}
	// User doesn't need auth if there's an email
	return len(email) == 0 && len(pass) == 0
	}

	func (db *datastore) IsUserPassSet(id int64) (bool, error) {
	var pass []byte
	err := db.QueryRow("SELECT password FROM users WHERE id = ?", id).Scan(&pass)
	switch {
	case err == sql.ErrNoRows:
	return false, nil
	case err != nil:
	log.Error("Couldn't SELECT user %d from users: %v", id, err)
	return false, err
	}

	return len(pass) > 0, nil
	}

	func (db datastore) GetUserForAuth(username string) (User, error) {
	u := &User{Username: username}

	err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE username = ?", username).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
	switch {
	case err == sql.ErrNoRows:
	// Check if they've entered the wrong, unnormalized username
	username = getSlug(username, "")
	if username != u.Username {
	err = db.QueryRow("SELECT id FROM users WHERE username = ? LIMIT 1", username).Scan(&u.ID)
	if err == nil {
	return db.GetUserForAuth(username)
	}
	}
	return nil, ErrUserNotFound
	case err != nil:
	log.Error("Couldn't SELECT user password: %v", err)
	return nil, err
	}

	return u, nil
	}

	func (db datastore) GetUserForAuthByID(userID int64) (User, error) {
	u := &User{ID: userID}

	err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE id = ?", u.ID).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
	switch {
	case err == sql.ErrNoRows:
	return nil, ErrUserNotFound
	case err != nil:
	log.Error("Couldn't SELECT userForAuthByID: %v", err)
	return nil, err
	}

	return u, nil
	}

	func (db *datastore) GetUserNameFromToken(accessToken string) (string, error) {
	t := auth.GetToken(accessToken)
	if len(t) == 0 {
	return "", ErrNoAccessToken
	}

	var oneTime bool
	var username string
	err := db.QueryRow("SELECT username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&username, &oneTime)
	switch {
	case err == sql.ErrNoRows:
	return "", ErrBadAccessToken
	case err != nil:
	return "", ErrInternalGeneral
	}

	// Delete token if it was one-time
	if oneTime {
	db.DeleteToken(t[:])
	}

	return username, nil
	}

	func (db *datastore) GetUserDataFromToken(accessToken string) (int64, string, error) {
	t := auth.GetToken(accessToken)
	if len(t) == 0 {
	return 0, "", ErrNoAccessToken
	}

	var userID int64
	var oneTime bool
	var username string
	err := db.QueryRow("SELECT user_id, username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &username, &oneTime)
	switch {
	case err == sql.ErrNoRows:
	return 0, "", ErrBadAccessToken
	case err != nil:
	return 0, "", ErrInternalGeneral
	}

	// Delete token if it was one-time
	if oneTime {
	db.DeleteToken(t[:])
	}

	return userID, username, nil
	}

	func (db datastore) GetAPIUser(header string) (User, error) {
	uID := db.GetUserID(header)
	if uID == -1 {
	return nil, fmt.Errorf(ErrUserNotFound.Error())
	}
	return db.GetUserByID(uID)
	}

	// GetUserID takes a hexadecimal accessToken, parses it into its binary
	// representation, and gets any user ID associated with the token. If no user
	// is associated, -1 is returned.
	func (db *datastore) GetUserID(accessToken string) int64 {
	i, _ := db.GetUserIDPrivilege(accessToken)
	return i
	}

	func (db *datastore) GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) {
	t := auth.GetToken(accessToken)
	if len(t) == 0 {
	return -1, false
	}

	var oneTime bool
	err := db.QueryRow("SELECT user_id, sudo, one_time FROM accesstokens WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &sudo, &oneTime)
	switch {
	case err == sql.ErrNoRows:
	return -1, false
	case err != nil:
	return -1, false
	}

	// Delete token if it was one-time
	if oneTime {
	db.DeleteToken(t[:])
	}

	return
	}

	func (db *datastore) DeleteToken(accessToken []byte) error {
	res, err := db.Exec("DELETE FROM accesstokens WHERE token LIKE ?", accessToken)
	if err != nil {
	return err
	}
	rowsAffected, _ := res.RowsAffected()
	if rowsAffected == 0 {
	return impart.HTTPError{http.StatusNotFound, "Token is invalid or doesn't exist"}
	}
	return nil
	}

	// FetchLastAccessToken creates a new non-expiring, valid access token for the given
	// userID.
	func (db *datastore) FetchLastAccessToken(userID int64) string {
	var t []byte
	err := db.QueryRow("SELECT token FROM accesstokens WHERE user_id = ? AND (expires IS NULL OR expires > "+db.now()+") ORDER BY created DESC LIMIT 1", userID).Scan(&t)
	switch {
	case err == sql.ErrNoRows:
	return ""
	case err != nil:
	log.Error("Failed selecting from accesstoken: %v", err)
	return ""
	}

	u, err := uuid.Parse(t)
	if err != nil {
	return ""
	}
	return u.String()
	}

	// GetAccessToken creates a new non-expiring, valid access token for the given
	// userID.
	func (db *datastore) GetAccessToken(userID int64) (string, error) {
	return db.GetTemporaryOneTimeAccessToken(userID, 0, false)
	}

	// GetTemporaryAccessToken creates a new valid access token for the given
	// userID that remains valid for the given time in seconds. If validSecs is 0,
	// the access token doesn't automatically expire.
	func (db *datastore) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) {
	return db.GetTemporaryOneTimeAccessToken(userID, validSecs, false)
	}

	// GetTemporaryOneTimeAccessToken creates a new valid access token for the given
	// userID that remains valid for the given time in seconds and can only be used
	// once if oneTime is true. If validSecs is 0, the access token doesn't
	// automatically expire.
	func (db *datastore) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) {
	u, err := uuid.NewV4()
	if err != nil {
	log.Error("Unable to generate token: %v", err)
	return "", err
	}

	// Insert UUID to `accesstokens`
	binTok := u[:]

	expirationVal := "NULL"
	if validSecs > 0 {
	expirationVal = fmt.Sprintf("DATE_ADD("+db.now()+", INTERVAL %d SECOND)", validSecs)
	}

	_, err = db.Exec("INSERT INTO accesstokens (token, user_id, one_time, expires) VALUES (?, ?, ?, "+expirationVal+")", string(binTok), userID, oneTime)
	if err != nil {
	log.Error("Couldn't INSERT accesstoken: %v", err)
	return "", err
	}

	return u.String(), nil
	}

	func (db datastore) CreateOwnedPost(post SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) {
	var userID, collID int64 = -1, -1
	var coll *Collection
	var err error
	if accessToken != "" {
	userID = db.GetUserID(accessToken)
	if userID == -1 {
	return nil, ErrBadAccessToken
	}
	if collAlias != "" {
	coll, err = db.GetCollection(collAlias)
	if err != nil {
	return nil, err
	}
	coll.hostName = hostName
	if coll.OwnerID != userID {
	return nil, ErrForbiddenCollection
	}
	collID = coll.ID
	}
	}

	rp := &PublicPost{}
	rp.Post, err = db.CreatePost(userID, collID, post)
	if err != nil {
	return rp, err
	}
	if coll != nil {
	coll.ForPublic()
	rp.Collection = &CollectionObj{Collection: *coll}
	}
	return rp, nil
	}

	func (db datastore) CreatePost(userID, collID int64, post SubmittedPost) (*Post, error) {
	idLen := postIDLen
	friendlyID := id.GenerateFriendlyRandomString(idLen)

	// Handle appearance / font face
	appearance := post.Font
	if !post.isFontValid() {
	appearance = "norm"
	}

	var err error
	ownerID := sql.NullInt64{
	Valid: false,
	}
	ownerCollID := sql.NullInt64{
	Valid: false,
	}
	slug := sql.NullString{"", false}

	// If an alias was supplied, we'll add this to the collection as well.
	if userID > 0 {
	ownerID.Int64 = userID
	ownerID.Valid = true
	if collID > 0 {
	ownerCollID.Int64 = collID
	ownerCollID.Valid = true
	var slugVal string
	if post.Slug != nil && *post.Slug != "" {
	slugVal = *post.Slug
	} else {
	if post.Title != nil && *post.Title != "" {
	slugVal = getSlug(*post.Title, post.Language.String)
	if slugVal == "" {
	slugVal = getSlug(*post.Content, post.Language.String)
	}
	} else {
	slugVal = getSlug(*post.Content, post.Language.String)
	}
	}
	if slugVal == "" {
	slugVal = friendlyID
	}
	slug = sql.NullString{slugVal, true}
	}
	}

	created := time.Now()
	if db.driverName == driverSQLite {
	// SQLite stores datetimes in UTC, so convert time.Now() to it here
	created = created.UTC()
	}
	- if post.Created != nil {
	+ if post.Created != nil && *post.Created != "" {
	created, err = time.Parse("2006-01-02T15:04:05Z", *post.Created)
	if err != nil {
	log.Error("Unable to parse Created time '%s': %v", *post.Created, err)
	created = time.Now()
	if db.driverName == driverSQLite {
	// SQLite stores datetimes in UTC, so convert time.Now() to it here
	created = created.UTC()
	}
	}
	}

	stmt, err := db.Prepare("INSERT INTO posts (id, slug, title, content, text_appearance, language, rtl, privacy, owner_id, collection_id, created, updated, view_count) VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?, ?, " + db.now() + ", ?)")
	if err != nil {
	return nil, err
	}
	defer stmt.Close()
	_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
	if err != nil {
	if db.isDuplicateKeyErr(err) {
	// Duplicate entry error; try a new slug
	// TODO: make this a little more robust
	slug = sql.NullString{id.GenSafeUniqueSlug(slug.String), true}
	_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
	if err != nil {
	return nil, handleFailedPostInsert(fmt.Errorf("Retried slug generation, still failed: %v", err))
	}
	} else {
	return nil, handleFailedPostInsert(err)
	}
	}

	// TODO: return Created field in proper format
	return &Post{
	ID: friendlyID,
	Slug: null.NewString(slug.String, slug.Valid),
	Font: appearance,
	Language: zero.NewString(post.Language.String, post.Language.Valid),
	RTL: zero.NewBool(post.IsRTL.Bool, post.IsRTL.Valid),
	OwnerID: null.NewInt(userID, true),
	CollectionID: null.NewInt(userID, true),
	Created: created.Truncate(time.Second).UTC(),
	Updated: time.Now().Truncate(time.Second).UTC(),
	Title: zero.NewString(*(post.Title), true),
	Content: *(post.Content),
	}, nil
	}

	// UpdateOwnedPost updates an existing post with only the given fields in the
	// supplied AuthenticatedPost.
	func (db datastore) UpdateOwnedPost(post AuthenticatedPost, userID int64) error {
	params := []interface{}{}
	var queryUpdates, sep, authCondition string
	if post.Slug != nil && *post.Slug != "" {
	queryUpdates += sep + "slug = ?"
	sep = ", "
	params = append(params, getSlug(*post.Slug, ""))
	}
	if post.Content != nil {
	queryUpdates += sep + "content = ?"
	sep = ", "
	params = append(params, post.Content)
	}
	if post.Title != nil {
	queryUpdates += sep + "title = ?"
	sep = ", "
	params = append(params, post.Title)
	}
	if post.Language.Valid {
	queryUpdates += sep + "language = ?"
	sep = ", "
	params = append(params, post.Language.String)
	}
	if post.IsRTL.Valid {
	queryUpdates += sep + "rtl = ?"
	sep = ", "
	params = append(params, post.IsRTL.Bool)
	}
	if post.Font != "" {
	queryUpdates += sep + "text_appearance = ?"
	sep = ", "
	params = append(params, post.Font)
	}
	if post.Created != nil {
	createTime, err := time.Parse(postMetaDateFormat, *post.Created)
	if err != nil {
	log.Error("Unable to parse Created date: %v", err)
	return fmt.Errorf("That's the incorrect format for Created date.")
	}
	queryUpdates += sep + "created = ?"
	sep = ", "
	params = append(params, createTime)
	}

	// WHERE parameters...
	// id = ?
	params = append(params, post.ID)
	// AND owner_id = ?
	authCondition = "(owner_id = ?)"
	params = append(params, userID)

	if queryUpdates == "" {
	return ErrPostNoUpdatableVals
	}

	queryUpdates += sep + "updated = " + db.now()

	res, err := db.Exec("UPDATE posts SET "+queryUpdates+" WHERE id = ? AND "+authCondition, params...)
	if err != nil {
	log.Error("Unable to update owned post: %v", err)
	return err
	}

	rowsAffected, _ := res.RowsAffected()
	if rowsAffected == 0 {
	// Show the correct error message if nothing was updated
	var dummy int
	err := db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND "+authCondition, post.ID, params[len(params)-1]).Scan(&dummy)
	switch {
	case err == sql.ErrNoRows:
	return ErrUnauthorizedEditPost
	case err != nil:
	log.Error("Failed selecting from posts: %v", err)
	}
	return nil
	}

	return nil
	}

	func (db datastore) GetCollectionBy(condition string, value interface{}) (Collection, error) {
	c := &Collection{}

	// FIXME: change Collection to reflect database values. Add helper functions to get actual values
	var styleSheet, script, signature, format zero.String
	row := db.QueryRow("SELECT id, alias, title, description, style_sheet, script, post_signature, format, owner_id, privacy, view_count FROM collections WHERE "+condition, value)

	err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &styleSheet, &script, &signature, &format, &c.OwnerID, &c.Visibility, &c.Views)
	switch {
	case err == sql.ErrNoRows:
	return nil, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
	case db.isHighLoadError(err):
	return nil, ErrUnavailable
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	return nil, err
	}
	c.StyleSheet = styleSheet.String
	c.Script = script.String
	c.Signature = signature.String
	c.Format = format.String
	c.Public = c.IsPublic()
	c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")

	c.db = db

	return c, nil
	}

	func (db datastore) GetCollection(alias string) (Collection, error) {
	return db.GetCollectionBy("alias = ?", alias)
	}

	func (db datastore) GetCollectionForPad(alias string) (Collection, error) {
	c := &Collection{Alias: alias}

	row := db.QueryRow("SELECT id, alias, title, description, privacy FROM collections WHERE alias = ?", alias)

	err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility)
	switch {
	case err == sql.ErrNoRows:
	return c, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	return c, ErrInternalGeneral
	}
	c.Public = c.IsPublic()

	return c, nil
	}

	func (db datastore) GetCollectionByID(id int64) (Collection, error) {
	return db.GetCollectionBy("id = ?", id)
	}

	func (db datastore) GetCollectionFromDomain(host string) (Collection, error) {
	return db.GetCollectionBy("host = ?", host)
	}

	func (db datastore) UpdateCollection(c SubmittedCollection, alias string) error {
	q := query.NewUpdate().
	SetStringPtr(c.Title, "title").
	SetStringPtr(c.Description, "description").
	SetNullString(c.StyleSheet, "style_sheet").
	SetNullString(c.Script, "script").
	SetNullString(c.Signature, "post_signature")

	if c.Format != nil {
	cf := &CollectionFormat{Format: c.Format.String}
	if cf.Valid() {
	q.SetNullString(c.Format, "format")
	}
	}

	var updatePass bool
	if c.Visibility != nil && (collVisibility(*c.Visibility)&CollProtected == 0 \|\| c.Pass != "") {
	q.SetIntPtr(c.Visibility, "privacy")
	if c.Pass != "" {
	updatePass = true
	}
	}

	// WHERE values
	q.Where("alias = ? AND owner_id = ?", alias, c.OwnerID)

	if q.Updates == "" && c.Monetization == nil {
	return ErrPostNoUpdatableVals
	}

	// Find any current domain
	var collID int64
	var rowsAffected int64
	var changed bool
	var res sql.Result
	err := db.QueryRow("SELECT id FROM collections WHERE alias = ?", alias).Scan(&collID)
	if err != nil {
	log.Error("Failed selecting from collections: %v. Some things won't work.", err)
	}

	// Update MathJax value
	if c.MathJax {
	if db.driverName == driverSQLite {
	_, err = db.Exec("INSERT OR REPLACE INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", collID, "render_mathjax", "1")
	} else {
	_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "render_mathjax", "1", "1")
	}
	if err != nil {
	log.Error("Unable to insert render_mathjax value: %v", err)
	return err
	}
	} else {
	_, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "render_mathjax")
	if err != nil {
	log.Error("Unable to delete render_mathjax value: %v", err)
	return err
	}
	}

	// Update Monetization value
	if c.Monetization != nil {
	skipUpdate := false
	if *c.Monetization != "" {
	// Strip away any excess spaces
	trimmed := strings.TrimSpace(*c.Monetization)
	// Only update value when it starts with "$", per spec: https://paymentpointers.org
	if strings.HasPrefix(trimmed, "$") {
	c.Monetization = &trimmed
	} else {
	// Value appears invalid, so don't update
	skipUpdate = true
	}
	}
	if !skipUpdate {
	- _, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) ON DUPLICATE KEY UPDATE value = ?", collID, "monetization_pointer", c.Monetization, c.Monetization)
	+ _, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "monetization_pointer", c.Monetization, c.Monetization)
	if err != nil {
	log.Error("Unable to insert monetization_pointer value: %v", err)
	return err
	}
	}
	}

	// Update EmailSub value
	if c.EmailSubs {
	// TODO: ensure these work with SQLite
	_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) ON DUPLICATE KEY UPDATE value = ?", collID, "email_subs", "1", "1")
	if err != nil {
	log.Error("Unable to insert email_subs value: %v", err)
	return err
	}
	skipUpdate := false
	if c.LetterReply != nil {
	// Strip away any excess spaces
	trimmed := strings.TrimSpace(*c.LetterReply)
	// Only update value when it contains "@"
	if strings.IndexRune(trimmed, '@') > 0 {
	c.LetterReply = &trimmed
	} else {
	// Value appears invalid, so don't update
	skipUpdate = true
	}
	if !skipUpdate {
	_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) ON DUPLICATE KEY UPDATE value = ?", collID, collAttrLetterReplyTo, c.LetterReply, c.LetterReply)
	if err != nil {
	log.Error("Unable to insert %s value: %v", collAttrLetterReplyTo, err)
	return err
	}
	}
	}
	} else {
	_, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "email_subs")
	if err != nil {
	log.Error("Unable to delete email_subs value: %v", err)
	return err
	}
	}

	// Update rest of the collection data
	if q.Updates != "" {
	res, err = db.Exec("UPDATE collections SET "+q.Updates+" WHERE "+q.Conditions, q.Params...)
	if err != nil {
	log.Error("Unable to update collection: %v", err)
	return err
	}
	}

	rowsAffected, _ = res.RowsAffected()
	if !changed \|\| rowsAffected == 0 {
	// Show the correct error message if nothing was updated
	var dummy int
	err := db.QueryRow("SELECT 1 FROM collections WHERE alias = ? AND owner_id = ?", alias, c.OwnerID).Scan(&dummy)
	switch {
	case err == sql.ErrNoRows:
	return ErrUnauthorizedEditPost
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	}
	if !updatePass {
	return nil
	}
	}

	if updatePass {
	hashedPass, err := auth.HashPass([]byte(c.Pass))
	if err != nil {
	log.Error("Unable to create hash: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
	}
	if db.driverName == driverSQLite {
	_, err = db.Exec("INSERT OR REPLACE INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?)", alias, hashedPass)
	} else {
	_, err = db.Exec("INSERT INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?) "+db.upsert("collection_id")+" password = ?", alias, hashedPass, hashedPass)
	}
	if err != nil {
	return err
	}
	}

	return nil
	}

	const postCols = "id, slug, text_appearance, language, rtl, privacy, owner_id, collection_id, pinned_position, created, updated, view_count, title, content"

	// getEditablePost returns a PublicPost with the given ID only if the given
	// edit token is valid for the post.
	func (db datastore) GetEditablePost(id, editToken string) (PublicPost, error) {
	// FIXME: code duplicated from getPost()
	// TODO: add slight logic difference to getPost / one func
	var ownerName sql.NullString
	p := &Post{}

	row := db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE id = ? LIMIT 1", id)
	err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
	switch {
	case err == sql.ErrNoRows:
	return nil, ErrPostNotFound
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	return nil, err
	}

	if p.Content == "" && p.Title.String == "" {
	return nil, ErrPostUnpublished
	}

	res := p.processPost()
	if ownerName.Valid {
	res.Owner = &PublicUser{Username: ownerName.String}
	}

	return &res, nil
	}

	func (db *datastore) PostIDExists(id string) bool {
	var dummy bool
	err := db.QueryRow("SELECT 1 FROM posts WHERE id = ?", id).Scan(&dummy)
	return err == nil && dummy
	}

	// GetPost gets a public-facing post object from the database. If collectionID
	// is > 0, the post will be retrieved by slug and collection ID, rather than
	// post ID.
	// TODO: break this into two functions:
	// - GetPost(id string)
	// - GetCollectionPost(slug string, collectionID int64)
	func (db datastore) GetPost(id string, collectionID int64) (PublicPost, error) {
	var ownerName sql.NullString
	p := &Post{}

	var row *sql.Row
	var where string
	params := []interface{}{id}
	if collectionID > 0 {
	where = "slug = ? AND collection_id = ?"
	params = append(params, collectionID)
	} else {
	where = "id = ?"
	}
	row = db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE "+where+" LIMIT 1", params...)
	err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
	switch {
	case err == sql.ErrNoRows:
	if collectionID > 0 {
	return nil, ErrCollectionPageNotFound
	}
	return nil, ErrPostNotFound
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	return nil, err
	}

	if p.Content == "" && p.Title.String == "" {
	return nil, ErrPostUnpublished
	}

	res := p.processPost()
	if ownerName.Valid {
	res.Owner = &PublicUser{Username: ownerName.String}
	}

	return &res, nil
	}

	// TODO: don't duplicate getPost() functionality
	func (db datastore) GetOwnedPost(id string, ownerID int64) (PublicPost, error) {
	p := &Post{}

	var row *sql.Row
	where := "id = ? AND owner_id = ?"
	params := []interface{}{id, ownerID}
	row = db.QueryRow("SELECT "+postCols+" FROM posts WHERE "+where+" LIMIT 1", params...)
	err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
	switch {
	case err == sql.ErrNoRows:
	return nil, ErrPostNotFound
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	return nil, err
	}

	if p.Content == "" && p.Title.String == "" {
	return nil, ErrPostUnpublished
	}

	res := p.processPost()

	return &res, nil
	}

	func (db *datastore) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) {
	propSelects := map[string]string{
	"views": "view_count AS views",
	}
	selectQuery, ok := propSelects[property]
	if !ok {
	return nil, impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid property: %s.", property)}
	}

	var res interface{}
	var row *sql.Row
	if collectionID != 0 {
	row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE slug = ? AND collection_id = ? LIMIT 1", id, collectionID)
	} else {
	row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE id = ? LIMIT 1", id)
	}
	err := row.Scan(&res)
	switch {
	case err == sql.ErrNoRows:
	return nil, impart.HTTPError{http.StatusNotFound, "Post not found."}
	case err != nil:
	log.Error("Failed selecting post: %v", err)
	return nil, err
	}

	return res, nil
	}

	// GetPostsCount modifies the CollectionObj to include the correct number of
	// standard (non-pinned) posts. It will return future posts if `includeFuture`
	// is true.
	func (db datastore) GetPostsCount(c CollectionObj, includeFuture bool) {
	var count int64
	timeCondition := ""
	if !includeFuture {
	timeCondition = "AND created <= " + db.now()
	}
	err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND pinned_position IS NULL "+timeCondition, c.ID).Scan(&count)
	switch {
	case err == sql.ErrNoRows:
	c.TotalPosts = 0
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	c.TotalPosts = 0
	}

	c.TotalPosts = int(count)
	}

	// GetPosts retrieves all posts for the given Collection.
	// It will return future posts if `includeFuture` is true.
	// It will include only standard (non-pinned) posts unless `includePinned` is true.
	// TODO: change includeFuture to isOwner, since that's how it's used
	func (db datastore) GetPosts(cfg config.Config, c Collection, page int, includeFuture, forceRecentFirst, includePinned bool) ([]PublicPost, error) {
	collID := c.ID

	cf := c.NewFormat()
	order := "DESC"
	if cf.Ascending() && !forceRecentFirst {
	order = "ASC"
	}

	pagePosts := cf.PostsPerPage()
	start := page*pagePosts - pagePosts
	if page == 0 {
	start = 0
	pagePosts = 1000
	}

	limitStr := ""
	if page > 0 {
	limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
	}
	timeCondition := ""
	if !includeFuture {
	timeCondition = "AND created <= " + db.now()
	}
	pinnedCondition := ""
	if !includePinned {
	pinnedCondition = "AND pinned_position IS NULL"
	}
	rows, err := db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? "+pinnedCondition+" "+timeCondition+" ORDER BY created "+order+limitStr, collID)
	if err != nil {
	log.Error("Failed selecting from posts: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
	}
	defer rows.Close()

	// TODO: extract this common row scanning logic for queries using `postCols`
	posts := []PublicPost{}
	for rows.Next() {
	p := &Post{}
	err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
	if err != nil {
	log.Error("Failed scanning row: %v", err)
	break
	}
	p.extractData()
	p.augmentContent(c)
	p.formatContent(cfg, c, includeFuture, false)

	posts = append(posts, p.processPost())
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	return &posts, nil
	}

	// GetPostsTagged retrieves all posts on the given Collection that contain the
	// given tag.
	// It will return future posts if `includeFuture` is true.
	// TODO: change includeFuture to isOwner, since that's how it's used
	func (db datastore) GetPostsTagged(cfg config.Config, c Collection, tag string, page int, includeFuture bool) ([]PublicPost, error) {
	collID := c.ID

	cf := c.NewFormat()
	order := "DESC"
	if cf.Ascending() {
	order = "ASC"
	}

	pagePosts := cf.PostsPerPage()
	start := page*pagePosts - pagePosts
	if page == 0 {
	start = 0
	pagePosts = 1000
	}

	limitStr := ""
	if page > 0 {
	limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
	}
	timeCondition := ""
	if !includeFuture {
	timeCondition = "AND created <= " + db.now()
	}

	var rows *sql.Rows
	var err error
	if db.driverName == driverSQLite {
	rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, `.#`+strings.ToLower(tag)+`\b.`)
	} else {
	rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, "#"+strings.ToLower(tag)+"[[:>:]]")
	}
	if err != nil {
	log.Error("Failed selecting from posts: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
	}
	defer rows.Close()

	// TODO: extract this common row scanning logic for queries using `postCols`
	posts := []PublicPost{}
	for rows.Next() {
	p := &Post{}
	err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
	if err != nil {
	log.Error("Failed scanning row: %v", err)
	break
	}
	p.extractData()
	p.augmentContent(c)
	p.formatContent(cfg, c, includeFuture, false)

	posts = append(posts, p.processPost())
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	return &posts, nil
	}

	func (db datastore) GetAPFollowers(c Collection) (*[]RemoteUser, error) {
	rows, err := db.Query("SELECT actor_id, inbox, shared_inbox FROM remotefollows f INNER JOIN remoteusers u ON f.remote_user_id = u.id WHERE collection_id = ?", c.ID)
	if err != nil {
	log.Error("Failed selecting from followers: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve followers."}
	}
	defer rows.Close()

	followers := []RemoteUser{}
	for rows.Next() {
	f := RemoteUser{}
	err = rows.Scan(&f.ActorID, &f.Inbox, &f.SharedInbox)
	followers = append(followers, f)
	}
	return &followers, nil
	}

	// CanCollect returns whether or not the given user can add the given post to a
	// collection. This is true when a post is already owned by the user.
	// NOTE: this is currently only used to potentially add owned posts to a
	// collection. This has the SIDE EFFECT of also generating a slug for the post.
	// FIXME: make this side effect more explicit (or extract it)
	func (db datastore) CanCollect(cpr ClaimPostRequest, userID int64) bool {
	var title, content string
	var lang sql.NullString
	err := db.QueryRow("SELECT title, content, language FROM posts WHERE id = ? AND owner_id = ?", cpr.ID, userID).Scan(&title, &content, &lang)
	switch {
	case err == sql.ErrNoRows:
	return false
	case err != nil:
	log.Error("Failed on post CanCollect(%s, %d): %v", cpr.ID, userID, err)
	return false
	}

	// Since we have the post content and the post is collectable, generate the
	// post's slug now.
	cpr.Slug = getSlugFromPost(title, content, lang.String)

	return true
	}

	func (db datastore) AttemptClaim(p ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) {
	qRes, err := db.Exec(query, params...)
	if err != nil {
	if db.isDuplicateKeyErr(err) && slugIdx > -1 {
	s := id.GenSafeUniqueSlug(p.Slug)
	if s == p.Slug {
	// Sanity check to prevent infinite recursion
	return qRes, fmt.Errorf("GenSafeUniqueSlug generated nothing unique: %s", s)
	}
	p.Slug = s
	params[slugIdx] = p.Slug
	return db.AttemptClaim(p, query, params, slugIdx)
	}
	return qRes, fmt.Errorf("attemptClaim: %s", err)
	}
	return qRes, nil
	}

	func (db datastore) DispersePosts(userID int64, postIDs []string) ([]ClaimPostResult, error) {
	postClaimReqs := map[string]bool{}
	res := []ClaimPostResult{}
	for i := range postIDs {
	postID := postIDs[i]

	r := ClaimPostResult{Code: 0, ErrorMessage: ""}

	// Perform post validation
	if postID == "" {
	r.ErrorMessage = "Missing post ID. "
	}
	if _, ok := postClaimReqs[postID]; ok {
	r.Code = 429
	r.ErrorMessage = "You've already tried anonymizing this post."
	r.ID = postID
	res = append(res, r)
	continue
	}
	postClaimReqs[postID] = true

	var err error
	// Get full post information to return
	var fullPost *PublicPost
	fullPost, err = db.GetPost(postID, 0)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	r.Code = err.Status
	r.ErrorMessage = err.Message
	r.ID = postID
	res = append(res, r)
	continue
	} else {
	log.Error("Error getting post in dispersePosts: %v", err)
	}
	}
	if fullPost.OwnerID.Int64 != userID {
	r.Code = http.StatusConflict
	r.ErrorMessage = "Post is already owned by someone else."
	r.ID = postID
	res = append(res, r)
	continue
	}

	var qRes sql.Result
	var query string
	var params []interface{}
	// Do AND owner_id = ? for sanity.
	// This should've been caught and returned with a good error message
	// just above.
	query = "UPDATE posts SET collection_id = NULL WHERE id = ? AND owner_id = ?"
	params = []interface{}{postID, userID}
	qRes, err = db.Exec(query, params...)
	if err != nil {
	r.Code = http.StatusInternalServerError
	r.ErrorMessage = "A glitch happened on our end."
	r.ID = postID
	res = append(res, r)
	log.Error("dispersePosts (post %s): %v", postID, err)
	continue
	}

	// Post was successfully dispersed
	r.Code = http.StatusOK
	r.Post = fullPost

	rowsAffected, _ := qRes.RowsAffected()
	if rowsAffected == 0 {
	// This was already claimed, but return 200
	r.Code = http.StatusOK
	}
	res = append(res, r)
	}

	return &res, nil
	}

	func (db datastore) ClaimPosts(cfg config.Config, userID int64, collAlias string, posts []ClaimPostRequest) ([]ClaimPostResult, error) {
	postClaimReqs := map[string]bool{}
	res := []ClaimPostResult{}
	postCollAlias := collAlias
	for i := range *posts {
	p := (*posts)[i]
	if &p == nil {
	continue
	}

	r := ClaimPostResult{Code: 0, ErrorMessage: ""}

	// Perform post validation
	if p.ID == "" {
	r.ErrorMessage = "Missing post ID `id`. "
	}
	if _, ok := postClaimReqs[p.ID]; ok {
	r.Code = 429
	r.ErrorMessage = "You've already tried claiming this post."
	r.ID = p.ID
	res = append(res, r)
	continue
	}
	postClaimReqs[p.ID] = true

	canCollect := db.CanCollect(&p, userID)
	if !canCollect && p.Token == "" {
	// TODO: ensure post isn't owned by anyone else when a valid modify
	// token is given.
	r.ErrorMessage += "Missing post Edit Token `token`."
	}
	if r.ErrorMessage != "" {
	// Post validate failed
	r.Code = http.StatusBadRequest
	r.ID = p.ID
	res = append(res, r)
	continue
	}

	var err error
	var qRes sql.Result
	var query string
	var params []interface{}
	var slugIdx int = -1
	var coll *Collection
	if collAlias == "" {
	// Posts are being claimed at /posts/claim, not
	// /collections/{alias}/collect, so use given individual collection
	// to associate post with.
	postCollAlias = p.CollectionAlias
	}
	if postCollAlias != "" {
	// Associate this post with a collection
	if p.CreateCollection {
	// This is a new collection
	// TODO: consider removing this. This seriously complicates this
	// method and adds another (unnecessary?) logic path.
	coll, err = db.CreateCollection(cfg, postCollAlias, "", userID)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	r.Code = err.Status
	r.ErrorMessage = err.Message
	} else {
	r.Code = http.StatusInternalServerError
	r.ErrorMessage = "Unknown error occurred creating collection"
	}
	r.ID = p.ID
	res = append(res, r)
	continue
	}
	} else {
	// Attempt to add to existing collection
	coll, err = db.GetCollection(postCollAlias)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	if err.Status == http.StatusNotFound {
	// Show obfuscated "forbidden" response, as if attempting to add to an
	// unowned blog.
	r.Code = ErrForbiddenCollection.Status
	r.ErrorMessage = ErrForbiddenCollection.Message
	} else {
	r.Code = err.Status
	r.ErrorMessage = err.Message
	}
	} else {
	r.Code = http.StatusInternalServerError
	r.ErrorMessage = "Unknown error occurred claiming post with collection"
	}
	r.ID = p.ID
	res = append(res, r)
	continue
	}
	if coll.OwnerID != userID {
	r.Code = ErrForbiddenCollection.Status
	r.ErrorMessage = ErrForbiddenCollection.Message
	r.ID = p.ID
	res = append(res, r)
	continue
	}
	}
	if p.Slug == "" {
	p.Slug = p.ID
	}
	if canCollect {
	// User already owns this post, so just add it to the given
	// collection.
	query = "UPDATE posts SET collection_id = ?, slug = ? WHERE id = ? AND owner_id = ?"
	params = []interface{}{coll.ID, p.Slug, p.ID, userID}
	slugIdx = 1
	} else {
	query = "UPDATE posts SET owner_id = ?, collection_id = ?, slug = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
	params = []interface{}{userID, coll.ID, p.Slug, p.ID, p.Token}
	slugIdx = 2
	}
	} else {
	query = "UPDATE posts SET owner_id = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
	params = []interface{}{userID, p.ID, p.Token}
	}
	qRes, err = db.AttemptClaim(&p, query, params, slugIdx)
	if err != nil {
	r.Code = http.StatusInternalServerError
	r.ErrorMessage = "An unknown error occurred."
	r.ID = p.ID
	res = append(res, r)
	log.Error("claimPosts (post %s): %v", p.ID, err)
	continue
	}

	// Get full post information to return
	var fullPost *PublicPost
	if p.Token != "" {
	fullPost, err = db.GetEditablePost(p.ID, p.Token)
	} else {
	fullPost, err = db.GetPost(p.ID, 0)
	}
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	r.Code = err.Status
	r.ErrorMessage = err.Message
	r.ID = p.ID
	res = append(res, r)
	continue
	}
	}
	if fullPost.OwnerID.Int64 != userID {
	r.Code = http.StatusConflict
	r.ErrorMessage = "Post is already owned by someone else."
	r.ID = p.ID
	res = append(res, r)
	continue
	}

	// Post was successfully claimed
	r.Code = http.StatusOK
	r.Post = fullPost
	if coll != nil {
	r.Post.Collection = &CollectionObj{Collection: *coll}
	}

	rowsAffected, _ := qRes.RowsAffected()
	if rowsAffected == 0 {
	// This was already claimed, but return 200
	r.Code = http.StatusOK
	}
	res = append(res, r)
	}

	return &res, nil
	}

	func (db *datastore) UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error {
	if pos <= 0 \|\| pos > 20 {
	pos = db.GetLastPinnedPostPos(collID) + 1
	if pos == -1 {
	pos = 1
	}
	}
	var err error
	if pinned {
	_, err = db.Exec("UPDATE posts SET pinned_position = ? WHERE id = ?", pos, postID)
	} else {
	_, err = db.Exec("UPDATE posts SET pinned_position = NULL WHERE id = ?", postID)
	}
	if err != nil {
	log.Error("Unable to update pinned post: %v", err)
	return err
	}
	return nil
	}

	func (db *datastore) GetLastPinnedPostPos(collID int64) int64 {
	var lastPos sql.NullInt64
	err := db.QueryRow("SELECT MAX(pinned_position) FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL", collID).Scan(&lastPos)
	switch {
	case err == sql.ErrNoRows:
	return -1
	case err != nil:
	log.Error("Failed selecting from posts: %v", err)
	return -1
	}
	if !lastPos.Valid {
	return -1
	}
	return lastPos.Int64
	}

	func (db datastore) GetPinnedPosts(coll CollectionObj, includeFuture bool) (*[]PublicPost, error) {
	// FIXME: sqlite-backed instances don't include ellipsis on truncated titles
	timeCondition := ""
	if !includeFuture {
	timeCondition = "AND created <= " + db.now()
	}
	rows, err := db.Query("SELECT id, slug, title, "+db.clip("content", 80)+", pinned_position FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL "+timeCondition+" ORDER BY pinned_position ASC", coll.ID)
	if err != nil {
	log.Error("Failed selecting pinned posts: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve pinned posts."}
	}
	defer rows.Close()

	posts := []PublicPost{}
	for rows.Next() {
	p := &Post{}
	err = rows.Scan(&p.ID, &p.Slug, &p.Title, &p.Content, &p.PinnedPosition)
	if err != nil {
	log.Error("Failed scanning row: %v", err)
	break
	}
	p.extractData()
	p.augmentContent(&coll.Collection)

	pp := p.processPost()
	pp.Collection = coll
	posts = append(posts, pp)
	}
	return &posts, nil
	}

	func (db datastore) GetCollections(u User, hostName string) (*[]Collection, error) {
	rows, err := db.Query("SELECT id, alias, title, description, privacy, view_count FROM collections WHERE owner_id = ? ORDER BY id ASC", u.ID)
	if err != nil {
	log.Error("Failed selecting from collections: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user collections."}
	}
	defer rows.Close()

	colls := []Collection{}
	for rows.Next() {
	c := Collection{}
	err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views)
	if err != nil {
	log.Error("Failed scanning row: %v", err)
	break
	}
	c.hostName = hostName
	c.URL = c.CanonicalURL()
	c.Public = c.IsPublic()

	/*
	// NOTE: future functionality
	if visibility != nil { // TODO: && visibility == CollPublic {
	// Add Monetization info when retrieving all public collections
	c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")
	}
	*/

	colls = append(colls, c)
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	return &colls, nil
	}

	func (db datastore) GetPublishableCollections(u User, hostName string) (*[]Collection, error) {
	c, err := db.GetCollections(u, hostName)
	if err != nil {
	return nil, err
	}

	if len(*c) == 0 {
	return nil, impart.HTTPError{http.StatusInternalServerError, "You don't seem to have any blogs; they might've moved to another account. Try logging out and logging into your other account."}
	}
	return c, nil
	}

	func (db datastore) GetPublicCollections(hostName string) ([]Collection, error) {
	rows, err := db.Query(`SELECT c.id, alias, title, description, privacy, view_count
	FROM collections c
	LEFT JOIN users u ON u.id = c.owner_id
	WHERE c.privacy = 1 AND u.status = 0
	- ORDER BY id ASC`)
	+ ORDER BY title ASC`)
	if err != nil {
	log.Error("Failed selecting public collections: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve public collections."}
	}
	defer rows.Close()

	colls := []Collection{}
	for rows.Next() {
	c := Collection{}
	err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views)
	if err != nil {
	log.Error("Failed scanning row: %v", err)
	break
	}
	c.hostName = hostName
	c.URL = c.CanonicalURL()
	c.Public = c.IsPublic()

	// Add Monetization information
	c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")

	colls = append(colls, c)
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	return &colls, nil
	}

	func (db datastore) GetMeStats(u User) userMeStats {
	s := userMeStats{}

	// User counts
	colls, _ := db.GetUserCollectionCount(u.ID)
	s.TotalCollections = colls

	var articles, collPosts uint64
	err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NULL", u.ID).Scan(&articles)
	if err != nil && err != sql.ErrNoRows {
	log.Error("Couldn't get articles count for user %d: %v", u.ID, err)
	}
	s.TotalArticles = articles

	err = db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NOT NULL", u.ID).Scan(&collPosts)
	if err != nil && err != sql.ErrNoRows {
	log.Error("Couldn't get coll posts count for user %d: %v", u.ID, err)
	}
	s.CollectionPosts = collPosts

	return s
	}

	func (db *datastore) GetTotalCollections() (collCount int64, err error) {
	err = db.QueryRow(`
	SELECT COUNT(*)
	FROM collections c
	LEFT JOIN users u ON u.id = c.owner_id
	WHERE u.status = 0`).Scan(&collCount)
	if err != nil {
	log.Error("Unable to fetch collections count: %v", err)
	}
	return
	}

	func (db *datastore) GetTotalPosts() (postCount int64, err error) {
	err = db.QueryRow(`
	SELECT COUNT(*)
	FROM posts p
	LEFT JOIN users u ON u.id = p.owner_id
	WHERE u.status = 0`).Scan(&postCount)
	if err != nil {
	log.Error("Unable to fetch posts count: %v", err)
	}
	return
	}

	func (db datastore) GetTopPosts(u User, alias string, hostName string) (*[]PublicPost, error) {
	params := []interface{}{u.ID}
	where := ""
	if alias != "" {
	where = " AND alias = ?"
	params = append(params, alias)
	}
	- rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...)
	+ rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.content, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...)
	if err != nil {
	log.Error("Failed selecting from posts: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user top posts."}
	}
	defer rows.Close()

	posts := []PublicPost{}
	var gotErr bool
	for rows.Next() {
	p := Post{}
	c := Collection{}
	var alias, title, description sql.NullString
	var views sql.NullInt64
	- err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &alias, &title, &description, &views)
	+ err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Content, &alias, &title, &description, &views)
	if err != nil {
	log.Error("Failed scanning User.getPosts() row: %v", err)
	gotErr = true
	break
	}
	p.extractData()
	pubPost := p.processPost()

	if alias.Valid && alias.String != "" {
	c.Alias = alias.String
	c.Title = title.String
	c.Description = description.String
	c.Views = views.Int64
	c.hostName = hostName
	pubPost.Collection = &CollectionObj{Collection: c}
	}

	posts = append(posts, pubPost)
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	if gotErr && len(posts) == 0 {
	// There were a lot of errors
	return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
	}

	return &posts, nil
	}

	func (db datastore) GetAnonymousPosts(u User, page int) (*[]PublicPost, error) {
	pagePosts := 10
	start := page*pagePosts - pagePosts
	if page == 0 {
	start = 0
	pagePosts = 1000
	}

	limitStr := ""
	if page > 0 {
	limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
	}
	- rows, err := db.Query("SELECT id, view_count, title, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC"+limitStr, u.ID)
	+ rows, err := db.Query("SELECT id, view_count, title, language, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC"+limitStr, u.ID)
	if err != nil {
	log.Error("Failed selecting from posts: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user anonymous posts."}
	}
	defer rows.Close()

	posts := []PublicPost{}
	for rows.Next() {
	p := Post{}
	- err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content)
	+ err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Language, &p.Created, &p.Updated, &p.Content)
	if err != nil {
	log.Error("Failed scanning row: %v", err)
	break
	}
	p.extractData()

	posts = append(posts, p.processPost())
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	return &posts, nil
	}

	func (db datastore) GetUserPosts(u User) (*[]PublicPost, error) {
	rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.created, p.updated, p.content, p.text_appearance, p.language, p.rtl, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON collection_id = c.id WHERE p.owner_id = ? ORDER BY created ASC", u.ID)
	if err != nil {
	log.Error("Failed selecting from posts: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."}
	}
	defer rows.Close()

	posts := []PublicPost{}
	var gotErr bool
	for rows.Next() {
	p := Post{}
	c := Collection{}
	var alias, title, description sql.NullString
	var views sql.NullInt64
	err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content, &p.Font, &p.Language, &p.RTL, &alias, &title, &description, &views)
	if err != nil {
	log.Error("Failed scanning User.getPosts() row: %v", err)
	gotErr = true
	break
	}
	p.extractData()
	pubPost := p.processPost()

	if alias.Valid && alias.String != "" {
	c.Alias = alias.String
	c.Title = title.String
	c.Description = description.String
	c.Views = views.Int64
	pubPost.Collection = &CollectionObj{Collection: c}
	}

	posts = append(posts, pubPost)
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	if gotErr && len(posts) == 0 {
	// There were a lot of errors
	return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
	}

	return &posts, nil
	}

	func (db *datastore) GetUserPostsCount(userID int64) int64 {
	var count int64
	err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ?", userID).Scan(&count)
	switch {
	case err == sql.ErrNoRows:
	return 0
	case err != nil:
	log.Error("Failed selecting posts count for user %d: %v", userID, err)
	return 0
	}

	return count
	}

	// ChangeSettings takes a User and applies the changes in the given
	// userSettings, MODIFYING THE USER with successful changes.
	func (db datastore) ChangeSettings(app App, u User, s userSettings) error {
	var errPass error
	q := query.NewUpdate()

	// Update email if given
	if s.Email != "" {
	encEmail, err := data.Encrypt(app.keys.EmailKey, s.Email)
	if err != nil {
	log.Error("Couldn't encrypt email %s: %s\n", s.Email, err)
	return impart.HTTPError{http.StatusInternalServerError, "Unable to encrypt email address."}
	}
	q.SetBytes(encEmail, "email")

	// Update the email if something goes awry updating the password
	defer func() {
	if errPass != nil {
	db.UpdateEncryptedUserEmail(u.ID, encEmail)
	}
	}()
	u.Email = zero.StringFrom(s.Email)
	}

	// Update username if given
	var newUsername string
	if s.Username != "" {
	var ie *impart.HTTPError
	newUsername, ie = getValidUsername(app, s.Username, u.Username)
	if ie != nil {
	// Username is invalid
	return *ie
	}
	if !author.IsValidUsername(app.cfg, newUsername) {
	// Ensure the username is syntactically correct.
	return impart.HTTPError{http.StatusPreconditionFailed, "Username isn't valid."}
	}

	t, err := db.Begin()
	if err != nil {
	log.Error("Couldn't start username change transaction: %v", err)
	return err
	}

	_, err = t.Exec("UPDATE users SET username = ? WHERE id = ?", newUsername, u.ID)
	if err != nil {
	t.Rollback()
	if db.isDuplicateKeyErr(err) {
	return impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}
	log.Error("Unable to update users table: %v", err)
	return ErrInternalGeneral
	}

	_, err = t.Exec("UPDATE collections SET alias = ? WHERE alias = ? AND owner_id = ?", newUsername, u.Username, u.ID)
	if err != nil {
	t.Rollback()
	if db.isDuplicateKeyErr(err) {
	return impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}
	log.Error("Unable to update collection: %v", err)
	return ErrInternalGeneral
	}

	// Keep track of name changes for redirection
	db.RemoveCollectionRedirect(t, newUsername)
	_, err = t.Exec("UPDATE collectionredirects SET new_alias = ? WHERE new_alias = ?", newUsername, u.Username)
	if err != nil {
	log.Error("Unable to update collectionredirects: %v", err)
	}
	_, err = t.Exec("INSERT INTO collectionredirects (prev_alias, new_alias) VALUES (?, ?)", u.Username, newUsername)
	if err != nil {
	log.Error("Unable to add new collectionredirect: %v", err)
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	log.Error("Rolling back after Commit(): %v\n", err)
	return err
	}

	u.Username = newUsername
	}

	// Update passphrase if given
	if s.NewPass != "" {
	// Check if user has already set a password
	var err error
	u.HasPass, err = db.IsUserPassSet(u.ID)
	if err != nil {
	errPass = impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data."}
	return errPass
	}

	if u.HasPass {
	// Check if currently-set password is correct
	hashedPass := u.HashedPass
	if len(hashedPass) == 0 {
	authUser, err := db.GetUserForAuthByID(u.ID)
	if err != nil {
	errPass = err
	return errPass
	}
	hashedPass = authUser.HashedPass
	}
	if !auth.Authenticated(hashedPass, []byte(s.OldPass)) {
	errPass = impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
	return errPass
	}
	}
	hashedPass, err := auth.HashPass([]byte(s.NewPass))
	if err != nil {
	errPass = impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
	return errPass
	}
	q.SetBytes(hashedPass, "password")
	}

	// WHERE values
	q.Append(u.ID)

	if q.Updates == "" {
	if s.Username == "" {
	return ErrPostNoUpdatableVals
	}

	// Nothing to update except username. That was successful, so return now.
	return nil
	}

	res, err := db.Exec("UPDATE users SET "+q.Updates+" WHERE id = ?", q.Params...)
	if err != nil {
	log.Error("Unable to update collection: %v", err)
	return err
	}

	rowsAffected, _ := res.RowsAffected()
	if rowsAffected == 0 {
	// Show the correct error message if nothing was updated
	var dummy int
	err := db.QueryRow("SELECT 1 FROM users WHERE id = ?", u.ID).Scan(&dummy)
	switch {
	case err == sql.ErrNoRows:
	return ErrUnauthorizedGeneral
	case err != nil:
	log.Error("Failed selecting from users: %v", err)
	}
	return nil
	}

	if s.NewPass != "" && !u.HasPass {
	u.HasPass = true
	}

	return nil
	}

	func (db *datastore) ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error {
	var dbPass []byte
	err := db.QueryRow("SELECT password FROM users WHERE id = ?", userID).Scan(&dbPass)
	switch {
	case err == sql.ErrNoRows:
	return ErrUserNotFound
	case err != nil:
	log.Error("Couldn't SELECT user password for change: %v", err)
	return err
	}

	if !sudo && !auth.Authenticated(dbPass, []byte(curPass)) {
	return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
	}

	_, err = db.Exec("UPDATE users SET password = ? WHERE id = ?", hashedPass, userID)
	if err != nil {
	log.Error("Could not update passphrase: %v", err)
	return err
	}

	return nil
	}

	func (db datastore) RemoveCollectionRedirect(t sql.Tx, alias string) error {
	_, err := t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ?", alias)
	if err != nil {
	log.Error("Unable to delete from collectionredirects: %v", err)
	return err
	}
	return nil
	}

	func (db *datastore) GetCollectionRedirect(alias string) (new string) {
	row := db.QueryRow("SELECT new_alias FROM collectionredirects WHERE prev_alias = ?", alias)
	err := row.Scan(&new)
	if err != nil && err != sql.ErrNoRows && !db.isIgnorableError(err) {
	log.Error("Failed selecting from collectionredirects: %v", err)
	}
	return
	}

	func (db *datastore) DeleteCollection(alias string, userID int64) error {
	c := &Collection{Alias: alias}
	var username string

	row := db.QueryRow("SELECT username FROM users WHERE id = ?", userID)
	err := row.Scan(&username)
	if err != nil {
	return err
	}

	// Ensure user isn't deleting their main blog
	if alias == username {
	return impart.HTTPError{http.StatusForbidden, "You cannot currently delete your primary blog."}
	}

	row = db.QueryRow("SELECT id FROM collections WHERE alias = ? AND owner_id = ?", alias, userID)
	err = row.Scan(&c.ID)
	switch {
	case err == sql.ErrNoRows:
	return impart.HTTPError{http.StatusNotFound, "Collection doesn't exist or you're not allowed to delete it."}
	case err != nil:
	log.Error("Failed selecting from collections: %v", err)
	return ErrInternalGeneral
	}

	t, err := db.Begin()
	if err != nil {
	return err
	}

	// Float all collection's posts
	_, err = t.Exec("UPDATE posts SET collection_id = NULL WHERE collection_id = ? AND owner_id = ?", c.ID, userID)
	if err != nil {
	t.Rollback()
	return err
	}

	// Remove redirects to or from this collection
	_, err = t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ? OR new_alias = ?", alias, alias)
	if err != nil {
	t.Rollback()
	return err
	}

	// Remove any optional collection password
	_, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
	if err != nil {
	t.Rollback()
	return err
	}

	// Finally, delete collection itself
	_, err = t.Exec("DELETE FROM collections WHERE id = ?", c.ID)
	if err != nil {
	t.Rollback()
	return err
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	return err
	}

	return nil
	}

	func (db *datastore) IsCollectionAttributeOn(id int64, attr string) bool {
	var v string
	err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v)
	switch {
	case err == sql.ErrNoRows:
	return false
	case err != nil:
	log.Error("Couldn't SELECT value in isCollectionAttributeOn for attribute '%s': %v", attr, err)
	return false
	}
	return v == "1"
	}

	func (db *datastore) CollectionHasAttribute(id int64, attr string) bool {
	var dummy string
	err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&dummy)
	switch {
	case err == sql.ErrNoRows:
	return false
	case err != nil:
	log.Error("Couldn't SELECT value in collectionHasAttribute for attribute '%s': %v", attr, err)
	return false
	}
	return true
	}

	func (db *datastore) GetCollectionAttribute(id int64, attr string) string {
	var v string
	err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v)
	switch {
	case err == sql.ErrNoRows:
	return ""
	case err != nil:
	log.Error("Couldn't SELECT value in getCollectionAttribute for attribute '%s': %v", attr, err)
	return ""
	}
	return v
	}

	func (db *datastore) SetCollectionAttribute(id int64, attr, v string) error {
	_, err := db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", id, attr, v)
	if err != nil {
	log.Error("Unable to INSERT into collectionattributes: %v", err)
	return err
	}
	return nil
	}

	// DeleteAccount will delete the entire account for userID
	func (db *datastore) DeleteAccount(userID int64) error {
	// Get all collections
	rows, err := db.Query("SELECT id, alias FROM collections WHERE owner_id = ?", userID)
	if err != nil {
	log.Error("Unable to get collections: %v", err)
	return err
	}
	defer rows.Close()
	colls := []Collection{}
	var c Collection
	for rows.Next() {
	err = rows.Scan(&c.ID, &c.Alias)
	if err != nil {
	log.Error("Unable to scan collection cols: %v", err)
	return err
	}
	colls = append(colls, c)
	}

	// Start transaction
	t, err := db.Begin()
	if err != nil {
	log.Error("Unable to begin: %v", err)
	return err
	}

	// Clean up all collection related information
	var res sql.Result
	for _, c := range colls {
	// Delete tokens
	res, err = t.Exec("DELETE FROM collectionattributes WHERE collection_id = ?", c.ID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete attributes on %s: %v", c.Alias, err)
	return err
	}
	rs, _ := res.RowsAffected()
	log.Info("Deleted %d for %s from collectionattributes", rs, c.Alias)

	// Remove any optional collection password
	res, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete passwords on %s: %v", c.Alias, err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d for %s from collectionpasswords", rs, c.Alias)

	// Remove redirects to this collection
	res, err = t.Exec("DELETE FROM collectionredirects WHERE new_alias = ?", c.Alias)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete redirects on %s: %v", c.Alias, err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d for %s from collectionredirects", rs, c.Alias)

	// Remove any collection keys
	res, err = t.Exec("DELETE FROM collectionkeys WHERE collection_id = ?", c.ID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete keys on %s: %v", c.Alias, err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d for %s from collectionkeys", rs, c.Alias)

	// TODO: federate delete collection

	// Remove remote follows
	res, err = t.Exec("DELETE FROM remotefollows WHERE collection_id = ?", c.ID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete remote follows on %s: %v", c.Alias, err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d for %s from remotefollows", rs, c.Alias)
	}

	// Delete collections
	res, err = t.Exec("DELETE FROM collections WHERE owner_id = ?", userID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete collections: %v", err)
	return err
	}
	rs, _ := res.RowsAffected()
	log.Info("Deleted %d from collections", rs)

	// Delete tokens
	res, err = t.Exec("DELETE FROM accesstokens WHERE user_id = ?", userID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete access tokens: %v", err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d from accesstokens", rs)

	// Delete user attributes
	res, err = t.Exec("DELETE FROM oauth_users WHERE user_id = ?", userID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete oauth_users: %v", err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d from oauth_users", rs)

	// Delete posts
	// TODO: should maybe get each row so we can federate a delete
	// if so needs to be outside of transaction like collections
	res, err = t.Exec("DELETE FROM posts WHERE owner_id = ?", userID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete posts: %v", err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d from posts", rs)

	// Delete user attributes
	res, err = t.Exec("DELETE FROM userattributes WHERE user_id = ?", userID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete attributes: %v", err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d from userattributes", rs)

	// Delete user invites
	res, err = t.Exec("DELETE FROM userinvites WHERE owner_id = ?", userID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete invites: %v", err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d from userinvites", rs)

	// Delete the user
	res, err = t.Exec("DELETE FROM users WHERE id = ?", userID)
	if err != nil {
	t.Rollback()
	log.Error("Unable to delete user: %v", err)
	return err
	}
	rs, _ = res.RowsAffected()
	log.Info("Deleted %d from users", rs)

	// Commit all changes to the database
	err = t.Commit()
	if err != nil {
	t.Rollback()
	log.Error("Unable to commit: %v", err)
	return err
	}

	// TODO: federate delete actor

	return nil
	}

	func (db *datastore) GetAPActorKeys(collectionID int64) ([]byte, []byte) {
	var pub, priv []byte
	err := db.QueryRow("SELECT public_key, private_key FROM collectionkeys WHERE collection_id = ?", collectionID).Scan(&pub, &priv)
	switch {
	case err == sql.ErrNoRows:
	// Generate keys
	pub, priv = activitypub.GenerateKeys()
	_, err = db.Exec("INSERT INTO collectionkeys (collection_id, public_key, private_key) VALUES (?, ?, ?)", collectionID, pub, priv)
	if err != nil {
	log.Error("Unable to INSERT new activitypub keypair: %v", err)
	return nil, nil
	}
	case err != nil:
	log.Error("Couldn't SELECT collectionkeys: %v", err)
	return nil, nil
	}

	return pub, priv
	}

	func (db datastore) CreateUserInvite(id string, userID int64, maxUses int, expires time.Time) error {
	_, err := db.Exec("INSERT INTO userinvites (id, owner_id, max_uses, created, expires, inactive) VALUES (?, ?, ?, "+db.now()+", ?, 0)", id, userID, maxUses, expires)
	return err
	}

	func (db datastore) GetUserInvites(userID int64) ([]Invite, error) {
	rows, err := db.Query("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE owner_id = ? ORDER BY created DESC", userID)
	if err != nil {
	log.Error("Failed selecting from userinvites: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user invites."}
	}
	defer rows.Close()

	is := []Invite{}
	for rows.Next() {
	i := Invite{}
	err = rows.Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
	is = append(is, i)
	}
	return &is, nil
	}

	func (db datastore) GetUserInvite(id string) (Invite, error) {
	var i Invite
	err := db.QueryRow("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE id = ?", id).Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
	switch {
	case err == sql.ErrNoRows, db.isIgnorableError(err):
	return nil, impart.HTTPError{http.StatusNotFound, "Invite doesn't exist."}
	case err != nil:
	log.Error("Failed selecting invite: %v", err)
	return nil, err
	}

	return &i, nil
	}

	// IsUsersInvite returns true if the user with ID created the invite with code
	// and an error other than sql no rows, if any. Will return false in the event
	// of an error.
	func (db *datastore) IsUsersInvite(code string, userID int64) (bool, error) {
	var id string
	err := db.QueryRow("SELECT id FROM userinvites WHERE id = ? AND owner_id = ?", code, userID).Scan(&id)
	if err != nil && err != sql.ErrNoRows {
	log.Error("Failed selecting invite: %v", err)
	return false, err
	}
	return id != "", nil
	}

	func (db *datastore) GetUsersInvitedCount(id string) int64 {
	var count int64
	err := db.QueryRow("SELECT COUNT(*) FROM usersinvited WHERE invite_id = ?", id).Scan(&count)
	switch {
	case err == sql.ErrNoRows:
	return 0
	case err != nil:
	log.Error("Failed selecting users invited count: %v", err)
	return 0
	}

	return count
	}

	func (db *datastore) CreateInvitedUser(inviteID string, userID int64) error {
	_, err := db.Exec("INSERT INTO usersinvited (invite_id, user_id) VALUES (?, ?)", inviteID, userID)
	return err
	}

	func (db datastore) GetInstancePages() ([]instanceContent, error) {
	return db.GetAllDynamicContent("page")
	}

	func (db datastore) GetAllDynamicContent(t string) ([]instanceContent, error) {
	where := ""
	params := []interface{}{}
	if t != "" {
	where = " WHERE content_type = ?"
	params = append(params, t)
	}
	rows, err := db.Query("SELECT id, title, content, updated, content_type FROM appcontent"+where, params...)
	if err != nil {
	log.Error("Failed selecting from appcontent: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve instance pages."}
	}
	defer rows.Close()

	pages := []*instanceContent{}
	for rows.Next() {
	c := &instanceContent{}
	err = rows.Scan(&c.ID, &c.Title, &c.Content, &c.Updated, &c.Type)
	if err != nil {
	log.Error("Failed scanning row: %v", err)
	break
	}
	pages = append(pages, c)
	}
	err = rows.Err()
	if err != nil {
	log.Error("Error after Next() on rows: %v", err)
	}

	return pages, nil
	}

	func (db datastore) GetDynamicContent(id string) (instanceContent, error) {
	c := &instanceContent{
	ID: id,
	}
	err := db.QueryRow("SELECT title, content, updated, content_type FROM appcontent WHERE id = ?", id).Scan(&c.Title, &c.Content, &c.Updated, &c.Type)
	switch {
	case err == sql.ErrNoRows:
	return nil, nil
	case err != nil:
	log.Error("Couldn't SELECT FROM appcontent for id '%s': %v", id, err)
	return nil, err
	}
	return c, nil
	}

	func (db *datastore) UpdateDynamicContent(id, title, content, contentType string) error {
	var err error
	if db.driverName == driverSQLite {
	_, err = db.Exec("INSERT OR REPLACE INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?)", id, title, content, contentType)
	} else {
	_, err = db.Exec("INSERT INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?) "+db.upsert("id")+" title = ?, content = ?, updated = "+db.now(), id, title, content, contentType, title, content)
	}
	if err != nil {
	log.Error("Unable to INSERT appcontent for '%s': %v", id, err)
	}
	return err
	}

	func (db datastore) GetAllUsers(page uint) ([]User, error) {
	limitStr := fmt.Sprintf("0, %d", adminUsersPerPage)
	if page > 1 {
	limitStr = fmt.Sprintf("%d, %d", (page-1)*adminUsersPerPage, adminUsersPerPage)
	}

	rows, err := db.Query("SELECT id, username, created, status FROM users ORDER BY created DESC LIMIT " + limitStr)
	if err != nil {
	log.Error("Failed selecting from users: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve all users."}
	}
	defer rows.Close()

	users := []User{}
	for rows.Next() {
	u := User{}
	err = rows.Scan(&u.ID, &u.Username, &u.Created, &u.Status)
	if err != nil {
	log.Error("Failed scanning GetAllUsers() row: %v", err)
	break
	}
	users = append(users, u)
	}
	return &users, nil
	}

	func (db *datastore) GetAllUsersCount() int64 {
	var count int64
	err := db.QueryRow("SELECT COUNT(*) FROM users").Scan(&count)
	switch {
	case err == sql.ErrNoRows:
	return 0
	case err != nil:
	log.Error("Failed selecting all users count: %v", err)
	return 0
	}

	return count
	}

	func (db datastore) GetUserLastPostTime(id int64) (time.Time, error) {
	var t time.Time
	err := db.QueryRow("SELECT created FROM posts WHERE owner_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
	switch {
	case err == sql.ErrNoRows:
	return nil, nil
	case err != nil:
	log.Error("Failed selecting last post time from posts: %v", err)
	return nil, err
	}
	return &t, nil
	}

	// SetUserStatus changes a user's status in the database. see Users.UserStatus
	func (db *datastore) SetUserStatus(id int64, status UserStatus) error {
	_, err := db.Exec("UPDATE users SET status = ? WHERE id = ?", status, id)
	if err != nil {
	return fmt.Errorf("failed to update user status: %v", err)
	}
	return nil
	}

	func (db datastore) GetCollectionLastPostTime(id int64) (time.Time, error) {
	var t time.Time
	err := db.QueryRow("SELECT created FROM posts WHERE collection_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
	switch {
	case err == sql.ErrNoRows:
	return nil, nil
	case err != nil:
	log.Error("Failed selecting last post time from posts: %v", err)
	return nil, err
	}
	return &t, nil
	}

	func (db *datastore) GenerateOAuthState(ctx context.Context, provider string, clientID string, attachUser int64, inviteCode string) (string, error) {
	state := id.Generate62RandomString(24)
	attachUserVal := sql.NullInt64{Valid: attachUser > 0, Int64: attachUser}
	inviteCodeVal := sql.NullString{Valid: inviteCode != "", String: inviteCode}
	_, err := db.ExecContext(ctx, "INSERT INTO oauth_client_states (state, provider, client_id, used, created_at, attach_user_id, invite_code) VALUES (?, ?, ?, FALSE, "+db.now()+", ?, ?)", state, provider, clientID, attachUserVal, inviteCodeVal)
	if err != nil {
	return "", fmt.Errorf("unable to record oauth client state: %w", err)
	}
	return state, nil
	}

	func (db *datastore) ValidateOAuthState(ctx context.Context, state string) (string, string, int64, string, error) {
	var provider string
	var clientID string
	var attachUserID sql.NullInt64
	var inviteCode sql.NullString
	err := wf_db.RunTransactionWithOptions(ctx, db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
	err := tx.
	QueryRowContext(ctx, "SELECT provider, client_id, attach_user_id, invite_code FROM oauth_client_states WHERE state = ? AND used = FALSE", state).
	Scan(&provider, &clientID, &attachUserID, &inviteCode)
	if err != nil {
	return err
	}

	res, err := tx.ExecContext(ctx, "UPDATE oauth_client_states SET used = TRUE WHERE state = ?", state)
	if err != nil {
	return err
	}
	rowsAffected, err := res.RowsAffected()
	if err != nil {
	return err
	}
	if rowsAffected != 1 {
	return fmt.Errorf("state not found")
	}
	return nil
	})
	if err != nil {
	return "", "", 0, "", nil
	}
	return provider, clientID, attachUserID.Int64, inviteCode.String, nil
	}

	func (db *datastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error {
	var err error
	if db.driverName == driverSQLite {
	_, err = db.ExecContext(ctx, "INSERT OR REPLACE INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?)", localUserID, remoteUserID, provider, clientID, accessToken)
	} else {
	_, err = db.ExecContext(ctx, "INSERT INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?) "+db.upsert("user")+" access_token = ?", localUserID, remoteUserID, provider, clientID, accessToken, accessToken)
	}
	if err != nil {
	log.Error("Unable to INSERT oauth_users for '%d': %v", localUserID, err)
	}
	return err
	}

	// GetIDForRemoteUser returns a user ID associated with a remote user ID.
	func (db *datastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) {
	var userID int64 = -1
	err := db.
	QueryRowContext(ctx, "SELECT user_id FROM oauth_users WHERE remote_user_id = ? AND provider = ? AND client_id = ?", remoteUserID, provider, clientID).
	Scan(&userID)
	// Not finding a record is OK.
	if err != nil && err != sql.ErrNoRows {
	return -1, err
	}
	return userID, nil
	}

	type oauthAccountInfo struct {
	Provider string
	ClientID string
	RemoteUserID string
	DisplayName string
	AllowDisconnect bool
	}

	func (db *datastore) GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error) {
	rows, err := db.QueryContext(ctx, "SELECT provider, client_id, remote_user_id FROM oauth_users WHERE user_id = ? ", userID)
	if err != nil {
	log.Error("Failed selecting from oauth_users: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user oauth accounts."}
	}
	defer rows.Close()

	var records []oauthAccountInfo
	for rows.Next() {
	info := oauthAccountInfo{}
	err = rows.Scan(&info.Provider, &info.ClientID, &info.RemoteUserID)
	if err != nil {
	log.Error("Failed scanning GetAllUsers() row: %v", err)
	break
	}
	records = append(records, info)
	}
	return records, nil
	}

	// DatabaseInitialized returns whether or not the current datastore has been
	// initialized with the correct schema.
	// Currently, it checks to see if the `users` table exists.
	func (db *datastore) DatabaseInitialized() bool {
	var dummy string
	var err error
	if db.driverName == driverSQLite {
	err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = 'users'").Scan(&dummy)
	} else {
	err = db.QueryRow("SHOW TABLES LIKE 'users'").Scan(&dummy)
	}
	switch {
	case err == sql.ErrNoRows:
	return false
	case err != nil:
	log.Error("Couldn't SHOW TABLES: %v", err)
	return false
	}

	return true
	}

	func (db *datastore) RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error {
	_, err := db.ExecContext(ctx, `DELETE FROM oauth_users WHERE user_id = ? AND provider = ? AND client_id = ? AND remote_user_id = ?`, userID, provider, clientID, remoteUserID)
	return err
	}

	func stringLogln(log *string, s string, v ...interface{}) {
	*log += fmt.Sprintf(s+"\n", v...)
	}

	func handleFailedPostInsert(err error) error {
	log.Error("Couldn't insert into posts: %v", err)
	return err
	}

	func (db datastore) GetProfilePageFromHandle(app App, handle string) (string, error) {
	handle = strings.TrimLeft(handle, "@")
	actorIRI := ""
	parts := strings.Split(handle, "@")
	if len(parts) != 2 {
	return "", fmt.Errorf("invalid handle format")
	}
	domain := parts[1]

	// Check non-AP instances
	if siloProfileURL := silobridge.Profile(parts[0], domain); siloProfileURL != "" {
	return siloProfileURL, nil
	}

	remoteUser, err := getRemoteUserFromHandle(app, handle)
	if err != nil {
	// can't find using handle in the table but the table may already have this user without
	// handle from a previous version
	// TODO: Make this determination. We should know whether a user exists without a handle, or doesn't exist at all
	actorIRI = RemoteLookup(handle)
	_, errRemoteUser := getRemoteUser(app, actorIRI)
	// if it exists then we need to update the handle
	if errRemoteUser == nil {
	_, err := app.db.Exec("UPDATE remoteusers SET handle = ? WHERE actor_id = ?", handle, actorIRI)
	if err != nil {
	log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI)
	}
	} else {
	// this probably means we don't have the user in the table so let's try to insert it
	// here we need to ask the server for the inboxes
	remoteActor, err := activityserve.NewRemoteActor(actorIRI)
	if err != nil {
	log.Error("Couldn't fetch remote actor: %v", err)
	}
	if debugging {
	log.Info("%s %s %s %s", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
	}
	_, err = app.db.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, handle) VALUES(?, ?, ?, ?)", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
	if err != nil {
	log.Error("Couldn't insert remote user: %v", err)
	return "", err
	}
	}
	} else {
	actorIRI = remoteUser.ActorID
	}
	return actorIRI, nil
	}

	func (db datastore) AddEmailSubscription(collID, userID int64, email string, confirmed bool) (EmailSubscriber, error) {
	friendlyChars := "0123456789BCDFGHJKLMNPQRSTVWXYZbcdfghjklmnpqrstvwxyz"
	subID := id.GenerateRandomString(friendlyChars, 8)
	token := id.GenerateRandomString(friendlyChars, 16)
	emailVal := sql.NullString{
	String: email,
	Valid: email != "",
	}
	userIDVal := sql.NullInt64{
	Int64: userID,
	Valid: userID > 0,
	}

	_, err := db.Exec("INSERT INTO emailsubscribers (id, collection_id, user_id, email, subscribed, token, confirmed) VALUES (?, ?, ?, ?, NOW(), ?, ?)", subID, collID, userIDVal, emailVal, token, confirmed)
	if err != nil {
	if mysqlErr, ok := err.(*mysql.MySQLError); ok {
	if mysqlErr.Number == mySQLErrDuplicateKey {
	// Duplicate, so just return existing subscriber information
	log.Info("Duplicate subscriber for email %s, user %d; returning existing subscriber", email, userID)
	return db.FetchEmailSubscriber(email, userID, collID)
	}
	}
	return nil, err
	}

	return &EmailSubscriber{
	ID: subID,
	CollID: collID,
	UserID: userIDVal,
	Email: emailVal,
	Token: token,
	}, nil
	}

	func (db *datastore) IsEmailSubscriber(email string, userID, collID int64) bool {
	var dummy int
	var err error
	if email != "" {
	err = db.QueryRow("SELECT 1 FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID).Scan(&dummy)
	} else {
	err = db.QueryRow("SELECT 1 FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID).Scan(&dummy)
	}
	switch {
	case err == sql.ErrNoRows:
	return false
	case err != nil:
	return false
	}
	return true
	}

	func (db datastore) GetEmailSubscribers(collID int64, reqConfirmed bool) ([]EmailSubscriber, error) {
	cond := ""
	if reqConfirmed {
	cond = " AND confirmed = 1"
	}
	rows, err := db.Query(`SELECT s.id, collection_id, user_id, s.email, u.email, subscribed, token, confirmed, allow_export
	FROM emailsubscribers s
	LEFT JOIN users u
	ON u.id = user_id
	WHERE collection_id = ?`+cond+`
	ORDER BY subscribed DESC`, collID)
	if err != nil {
	log.Error("Failed selecting email subscribers for collection %d: %v", collID, err)
	return nil, err
	}
	defer rows.Close()

	var subs []*EmailSubscriber
	for rows.Next() {
	s := &EmailSubscriber{}
	err = rows.Scan(&s.ID, &s.CollID, &s.UserID, &s.Email, &s.acctEmail, &s.Subscribed, &s.Token, &s.Confirmed, &s.AllowExport)
	if err != nil {
	log.Error("Failed scanning row from email subscribers: %v", err)
	continue
	}
	subs = append(subs, s)
	}
	return subs, nil
	}

	func (db *datastore) FetchEmailSubscriberEmail(subID, token string) (string, error) {
	var email sql.NullString
	// TODO: return user email if there's a user_id ?
	err := db.QueryRow("SELECT email FROM emailsubscribers WHERE id = ? AND token = ?", subID, token).Scan(&email)
	switch {
	case err == sql.ErrNoRows:
	return "", fmt.Errorf("Subscriber doesn't exist or token is invalid.")
	case err != nil:
	log.Error("Couldn't SELECT email from emailsubscribers: %v", err)
	return "", fmt.Errorf("Something went very wrong.")
	}

	return email.String, nil
	}

	func (db datastore) FetchEmailSubscriber(email string, userID, collID int64) (EmailSubscriber, error) {
	const emailSubCols = "id, collection_id, user_id, email, subscribed, token, confirmed, allow_export"

	s := &EmailSubscriber{}
	var row *sql.Row
	if email != "" {
	row = db.QueryRow("SELECT "+emailSubCols+" FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID)
	} else {
	row = db.QueryRow("SELECT "+emailSubCols+" FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID)
	}
	err := row.Scan(&s.ID, &s.CollID, &s.UserID, &s.Email, &s.Subscribed, &s.Token, &s.Confirmed, &s.AllowExport)
	switch {
	case err == sql.ErrNoRows:
	return nil, nil
	case err != nil:
	return nil, err
	}
	return s, nil
	}

	func (db *datastore) DeleteEmailSubscriber(subID, token string) error {
	res, err := db.Exec("DELETE FROM emailsubscribers WHERE id = ? AND token = ?", subID, token)
	if err != nil {
	return err
	}

	rowsAffected, _ := res.RowsAffected()
	if rowsAffected == 0 {
	return impart.HTTPError{http.StatusNotFound, "Invalid token, or subscriber doesn't exist"}
	}
	return nil
	}

	func (db *datastore) DeleteEmailSubscriberByUser(email string, userID, collID int64) error {
	var res sql.Result
	var err error
	if email != "" {
	res, err = db.Exec("DELETE FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID)
	} else {
	res, err = db.Exec("DELETE FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID)
	}
	if err != nil {
	return err
	}

	rowsAffected, _ := res.RowsAffected()
	if rowsAffected == 0 {
	return impart.HTTPError{http.StatusNotFound, "Subscriber doesn't exist"}
	}
	return nil
	}

	func (db *datastore) UpdateSubscriberConfirmed(subID, token string) error {
	email, err := db.FetchEmailSubscriberEmail(subID, token)
	if err != nil {
	log.Error("Didn't fetch email subscriber: %v", err)
	return err
	}

	// TODO: ensure all addresses with original name are also confirmed, e.g. matt+fake@write.as and matt@write.as are now confirmed
	_, err = db.Exec("UPDATE emailsubscribers SET confirmed = 1 WHERE email = ?", email)
	if err != nil {
	log.Error("Could not update email subscriber confirmation status: %v", err)
	return err
	}
	return nil
	}

	func (db *datastore) IsSubscriberConfirmed(email string) bool {
	var dummy int64
	err := db.QueryRow("SELECT 1 FROM emailsubscribers WHERE email = ? AND confirmed = 1", email).Scan(&dummy)
	switch {
	case err == sql.ErrNoRows:
	return false
	case err != nil:
	log.Error("Couldn't SELECT in isSubscriberConfirmed: %v", err)
	return false
	}

	return true
	}

	func (db datastore) InsertJob(j PostJob) error {
	res, err := db.Exec("INSERT INTO publishjobs (post_id, action, delay) VALUES (?, ?, ?)", j.PostID, j.Action, j.Delay)
	if err != nil {
	return err
	}
	jobID, err := res.LastInsertId()
	if err != nil {
	log.Error("[jobs] Couldn't get last insert ID! %s", err)
	}
	log.Info("[jobs] Queued %s job #%d for post %s, delayed %d minutes", j.Action, jobID, j.PostID, j.Delay)
	return nil
	}

	func (db *datastore) UpdateJobForPost(postID string, delay int64) error {
	_, err := db.Exec("UPDATE publishjobs SET delay = ? WHERE post_id = ?", delay, postID)
	if err != nil {
	return fmt.Errorf("Unable to update publish job: %s", err)
	}
	log.Info("Updated job for post %s: delay %d", postID, delay)
	return nil
	}

	func (db *datastore) DeleteJob(id int64) error {
	_, err := db.Exec("DELETE FROM publishjobs WHERE id = ?", id)
	if err != nil {
	return err
	}
	log.Info("[job #%d] Deleted.", id)
	return nil
	}

	func (db *datastore) DeleteJobByPost(postID string) error {
	_, err := db.Exec("DELETE FROM publishjobs WHERE post_id = ?", postID)
	if err != nil {
	return err
	}
	log.Info("[job] Deleted job for post %s", postID)
	return nil
	}

	func (db datastore) GetJobsToRun(action string) ([]PostJob, error) {
	rows, err := db.Query(`SELECT pj.id, post_id, action, delay
	FROM publishjobs pj
	INNER JOIN posts p
	ON post_id = p.id
	WHERE action = ? AND created < DATE_SUB(NOW(), INTERVAL delay MINUTE) AND created > DATE_SUB(NOW(), INTERVAL delay + 5 MINUTE)
	ORDER BY created ASC`, action)
	if err != nil {
	log.Error("Failed selecting from publishjobs: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve publish jobs."}
	}
	defer rows.Close()

	jobs := []*PostJob{}
	for rows.Next() {
	j := &PostJob{}
	err = rows.Scan(&j.ID, &j.PostID, &j.Action, &j.Delay)
	jobs = append(jobs, j)
	}
	return jobs, nil
	}
	diff --git a/db/create.go b/db/create.go
	index 648f93a..8728d5d 100644
	--- a/db/create.go
	+++ b/db/create.go
	@@ -1,266 +1,266 @@
	/*
	- * Copyright © 2019-2020 A Bunch Tell LLC.
	+ * Copyright © 2019-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package db

	import (
	"fmt"
	"strings"
	)

	type ColumnType int

	type OptionalInt struct {
	Set bool
	Value int
	}

	type OptionalString struct {
	Set bool
	Value string
	}

	type SQLBuilder interface {
	ToSQL() (string, error)
	}

	type Column struct {
	Dialect DialectType
	Name string
	Nullable bool
	Default OptionalString
	Type ColumnType
	Size OptionalInt
	PrimaryKey bool
	}

	type CreateTableSqlBuilder struct {
	Dialect DialectType
	Name string
	IfNotExists bool
	ColumnOrder []string
	Columns map[string]*Column
	Constraints []string
	}

	const (
	ColumnTypeBool ColumnType = iota
	ColumnTypeSmallInt ColumnType = iota
	ColumnTypeInteger ColumnType = iota
	ColumnTypeChar ColumnType = iota
	ColumnTypeVarChar ColumnType = iota
	ColumnTypeText ColumnType = iota
	ColumnTypeDateTime ColumnType = iota
	)

	var _ SQLBuilder = &CreateTableSqlBuilder{}

	var UnsetSize OptionalInt = OptionalInt{Set: false, Value: 0}
	var UnsetDefault OptionalString = OptionalString{Set: false, Value: ""}

	func (d ColumnType) Format(dialect DialectType, size OptionalInt) (string, error) {
	if dialect != DialectMySQL && dialect != DialectSQLite {
	return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size)
	}
	switch d {
	case ColumnTypeSmallInt:
	{
	if dialect == DialectSQLite {
	return "INTEGER", nil
	}
	mod := ""
	if size.Set {
	mod = fmt.Sprintf("(%d)", size.Value)
	}
	return "SMALLINT" + mod, nil
	}
	case ColumnTypeInteger:
	{
	if dialect == DialectSQLite {
	return "INTEGER", nil
	}
	mod := ""
	if size.Set {
	mod = fmt.Sprintf("(%d)", size.Value)
	}
	return "INT" + mod, nil
	}
	case ColumnTypeChar:
	{
	if dialect == DialectSQLite {
	return "TEXT", nil
	}
	mod := ""
	if size.Set {
	mod = fmt.Sprintf("(%d)", size.Value)
	}
	return "CHAR" + mod, nil
	}
	case ColumnTypeVarChar:
	{
	if dialect == DialectSQLite {
	return "TEXT", nil
	}
	mod := ""
	if size.Set {
	mod = fmt.Sprintf("(%d)", size.Value)
	}
	return "VARCHAR" + mod, nil
	}
	case ColumnTypeBool:
	{
	if dialect == DialectSQLite {
	return "INTEGER", nil
	}
	return "TINYINT(1)", nil
	}
	case ColumnTypeDateTime:
	return "DATETIME", nil
	case ColumnTypeText:
	return "TEXT", nil
	}
	return "", fmt.Errorf("unsupported column type %d for dialect %d and size %v", d, dialect, size)
	}

	func (c Column) SetName(name string) Column {
	c.Name = name
	return c
	}

	func (c Column) SetNullable(nullable bool) Column {
	c.Nullable = nullable
	return c
	}

	func (c Column) SetPrimaryKey(pk bool) Column {
	c.PrimaryKey = pk
	return c
	}

	func (c Column) SetDefault(value string) Column {
	c.Default = OptionalString{Set: true, Value: value}
	return c
	}

	func (c Column) SetDefaultCurrentTimestamp() Column {
	def := "NOW()"
	if c.Dialect == DialectSQLite {
	def = "CURRENT_TIMESTAMP"
	}
	c.Default = OptionalString{Set: true, Value: def}
	return c
	}

	func (c Column) SetType(t ColumnType) Column {
	c.Type = t
	return c
	}

	func (c Column) SetSize(size int) Column {
	c.Size = OptionalInt{Set: true, Value: size}
	return c
	}

	func (c *Column) String() (string, error) {
	var str strings.Builder

	str.WriteString(c.Name)

	str.WriteString(" ")
	typeStr, err := c.Type.Format(c.Dialect, c.Size)
	if err != nil {
	return "", err
	}

	str.WriteString(typeStr)

	if !c.Nullable {
	str.WriteString(" NOT NULL")
	}

	if c.Default.Set {
	str.WriteString(" DEFAULT ")
	val := c.Default.Value
	if val == "" {
	val = "''"
	}
	str.WriteString(val)
	}

	if c.PrimaryKey {
	str.WriteString(" PRIMARY KEY")
	}

	return str.String(), nil
	}

	func (b CreateTableSqlBuilder) Column(column Column) *CreateTableSqlBuilder {
	if b.Columns == nil {
	b.Columns = make(map[string]*Column)
	}
	b.Columns[column.Name] = column
	b.ColumnOrder = append(b.ColumnOrder, column.Name)
	return b
	}

	func (b CreateTableSqlBuilder) UniqueConstraint(columns ...string) CreateTableSqlBuilder {
	for _, column := range columns {
	if _, ok := b.Columns[column]; !ok {
	// This fails silently.
	return b
	}
	}
	b.Constraints = append(b.Constraints, fmt.Sprintf("UNIQUE(%s)", strings.Join(columns, ",")))
	return b
	}

	func (b CreateTableSqlBuilder) SetIfNotExists(ine bool) CreateTableSqlBuilder {
	b.IfNotExists = ine
	return b
	}

	func (b *CreateTableSqlBuilder) ToSQL() (string, error) {
	var str strings.Builder

	str.WriteString("CREATE TABLE ")
	if b.IfNotExists {
	str.WriteString("IF NOT EXISTS ")
	}
	str.WriteString(b.Name)

	var things []string
	for _, columnName := range b.ColumnOrder {
	column, ok := b.Columns[columnName]
	if !ok {
	return "", fmt.Errorf("column not found: %s", columnName)
	}
	columnStr, err := column.String()
	if err != nil {
	return "", err
	}
	things = append(things, columnStr)
	}
	for _, constraint := range b.Constraints {
	things = append(things, constraint)
	}

	if thingLen := len(things); thingLen > 0 {
	str.WriteString(" ( ")
	for i, thing := range things {
	str.WriteString(thing)
	if i < thingLen-1 {
	str.WriteString(", ")
	}
	}
	str.WriteString(" )")
	}

	return str.String(), nil
	}
	diff --git a/errors.go b/errors.go
	index cf52df1..f0d3099 100644
	--- a/errors.go
	+++ b/errors.go
	@@ -1,62 +1,62 @@
	/*
	- * Copyright © 2018-2020 A Bunch Tell LLC.
	+ * Copyright © 2018-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"net/http"

	"github.com/writeas/impart"
	)

	// Commonly returned HTTP errors
	var (
	ErrBadFormData = impart.HTTPError{http.StatusBadRequest, "Expected valid form data."}
	ErrBadJSON = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON object."}
	ErrBadJSONArray = impart.HTTPError{http.StatusBadRequest, "Expected valid JSON array."}
	ErrBadAccessToken = impart.HTTPError{http.StatusUnauthorized, "Invalid access token."}
	ErrNoAccessToken = impart.HTTPError{http.StatusBadRequest, "Authorization token required."}
	ErrNotLoggedIn = impart.HTTPError{http.StatusUnauthorized, "Not logged in."}

	ErrForbiddenCollection = impart.HTTPError{http.StatusForbidden, "You don't have permission to add to this collection."}
	ErrForbiddenEditPost = impart.HTTPError{http.StatusForbidden, "You don't have permission to update this post."}
	ErrUnauthorizedEditPost = impart.HTTPError{http.StatusUnauthorized, "Invalid editing credentials."}
	ErrUnauthorizedGeneral = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to do that."}
	ErrBadRequestedType = impart.HTTPError{http.StatusNotAcceptable, "Bad requested Content-Type."}
	ErrCollectionUnauthorizedRead = impart.HTTPError{http.StatusUnauthorized, "You don't have permission to access this collection."}

	ErrNoPublishableContent = impart.HTTPError{http.StatusBadRequest, "Supply something to publish."}

	ErrInternalGeneral = impart.HTTPError{http.StatusInternalServerError, "The humans messed something up. They've been notified."}
	ErrInternalCookieSession = impart.HTTPError{http.StatusInternalServerError, "Could not get cookie session."}

	ErrUnavailable = impart.HTTPError{http.StatusServiceUnavailable, "Service temporarily unavailable due to high load."}

	ErrCollectionNotFound = impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
	ErrCollectionGone = impart.HTTPError{http.StatusGone, "This blog was unpublished."}
	ErrCollectionPageNotFound = impart.HTTPError{http.StatusNotFound, "Collection page doesn't exist."}
	ErrPostNotFound = impart.HTTPError{Status: http.StatusNotFound, Message: "Post not found."}
	ErrPostBanned = impart.HTTPError{Status: http.StatusGone, Message: "Post removed."}
	ErrPostUnpublished = impart.HTTPError{Status: http.StatusGone, Message: "Post unpublished by author."}
	ErrPostFetchError = impart.HTTPError{Status: http.StatusInternalServerError, Message: "We encountered an error getting the post. The humans have been alerted."}

	ErrUserNotFound = impart.HTTPError{http.StatusNotFound, "User doesn't exist."}
	ErrRemoteUserNotFound = impart.HTTPError{http.StatusNotFound, "Remote user not found."}
	ErrUserNotFoundEmail = impart.HTTPError{http.StatusNotFound, "Please enter your username instead of your email address."}

	ErrUserSilenced = impart.HTTPError{http.StatusForbidden, "Account is silenced."}

	ErrDisabledPasswordAuth = impart.HTTPError{http.StatusForbidden, "Password authentication is disabled."}
	)

	// Post operation errors
	var (
	ErrPostNoUpdatableVals = impart.HTTPError{http.StatusBadRequest, "Supply some properties to update."}
	)
	diff --git a/export.go b/export.go
	index bdfd7c4..e6a09c1 100644
	--- a/export.go
	+++ b/export.go
	@@ -1,132 +1,132 @@
	/*
	- * Copyright © 2018-2019 A Bunch Tell LLC.
	+ * Copyright © 2018-2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"archive/zip"
	"bytes"
	"encoding/csv"
	"strings"
	"time"

	"github.com/writeas/web-core/log"
	)

	func exportPostsCSV(hostName string, u User, posts []PublicPost) []byte {
	var b bytes.Buffer

	r := [][]string{
	{"id", "slug", "blog", "url", "created", "title", "body"},
	}
	for _, p := range *posts {
	var blog string
	if p.Collection != nil {
	blog = p.Collection.Alias
	p.Collection.hostName = hostName
	}
	f := []string{p.ID, p.Slug.String, blog, p.CanonicalURL(hostName), p.Created8601(), p.Title.String, strings.Replace(p.Content, "\n", "\\n", -1)}
	r = append(r, f)
	}

	w := csv.NewWriter(&b)
	w.WriteAll(r) // calls Flush internally
	if err := w.Error(); err != nil {
	log.Info("error writing csv: %v", err)
	}

	return b.Bytes()
	}

	type exportedTxt struct {
	Name, Title, Body string

	Mod time.Time
	}

	func exportPostsZip(u User, posts []PublicPost) []byte {
	// Create a buffer to write our archive to.
	b := new(bytes.Buffer)

	// Create a new zip archive.
	w := zip.NewWriter(b)

	// Add some files to the archive.
	var filename string
	files := []exportedTxt{}
	for _, p := range *posts {
	filename = ""
	if p.Collection != nil {
	filename += p.Collection.Alias + "/"
	}
	if p.Slug.String != "" {
	filename += p.Slug.String + "_"
	}
	filename += p.ID + ".txt"
	files = append(files, exportedTxt{filename, p.Title.String, p.Content, p.Created})
	}

	for _, file := range files {
	head := &zip.FileHeader{Name: file.Name}
	head.SetModTime(file.Mod)
	f, err := w.CreateHeader(head)
	if err != nil {
	log.Error("export zip header: %v", err)
	}
	var fullPost string
	if file.Title != "" {
	fullPost = "# " + file.Title + "\n\n"
	}
	fullPost += file.Body
	_, err = f.Write([]byte(fullPost))
	if err != nil {
	log.Error("export zip write: %v", err)
	}
	}

	// Make sure to check the error on Close.
	err := w.Close()
	if err != nil {
	log.Error("export zip close: %v", err)
	}

	return b.Bytes()
	}

	func compileFullExport(app App, u User) *ExportUser {
	exportUser := &ExportUser{
	User: u,
	}

	colls, err := app.db.GetCollections(u, app.cfg.App.Host)
	if err != nil {
	log.Error("unable to fetch collections: %v", err)
	}

	posts, err := app.db.GetAnonymousPosts(u, 0)
	if err != nil {
	log.Error("unable to fetch anon posts: %v", err)
	}
	exportUser.AnonymousPosts = *posts

	var collObjs []CollectionObj
	for _, c := range *colls {
	co := &CollectionObj{Collection: c}
	co.Posts, err = app.db.GetPosts(app.cfg, &c, 0, true, false, true)
	if err != nil {
	log.Error("unable to get collection posts: %v", err)
	}
	app.db.GetPostsCount(co, true)
	collObjs = append(collObjs, *co)
	}
	exportUser.Collections = &collObjs

	return exportUser
	}
	diff --git a/feed.go b/feed.go
	index d85baf8..68dd2c0 100644
	--- a/feed.go
	+++ b/feed.go
	@@ -1,125 +1,125 @@
	/*
	- * Copyright © 2018-2020 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"fmt"
	"net/http"
	"time"

	- . "github.com/gorilla/feeds"
	+ "github.com/gorilla/feeds"
	"github.com/gorilla/mux"
	stripmd "github.com/writeas/go-strip-markdown/v2"
	"github.com/writeas/web-core/log"
	)

	func ViewFeed(app App, w http.ResponseWriter, req http.Request) error {
	alias := collectionAliasFromReq(req)

	// Display collection if this is a collection
	var c *Collection
	var err error
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	return nil
	}

	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("view feed: get user: %v", err)
	return ErrInternalGeneral
	}
	if silenced {
	return ErrCollectionNotFound
	}
	c.hostName = app.cfg.App.Host

	if c.IsPrivate() \|\| c.IsProtected() {
	return ErrCollectionNotFound
	}

	// Fetch extra data about the Collection
	// TODO: refactor out this logic, shared in collection.go:fetchCollection()
	coll := &DisplayCollection{CollectionObj: &CollectionObj{Collection: *c}}
	if c.PublicOwner {
	u, err := app.db.GetUserByID(coll.OwnerID)
	if err != nil {
	// Log the error and just continue
	log.Error("Error getting user for collection: %v", err)
	} else {
	coll.Owner = u
	}
	}

	tag := mux.Vars(req)["tag"]
	if tag != "" {
	coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, 1, false)
	} else {
	coll.Posts, _ = app.db.GetPosts(app.cfg, c, 1, false, true, false)
	}

	author := ""
	if coll.Owner != nil {
	author = coll.Owner.Username
	}

	collectionTitle := coll.DisplayTitle()
	if tag != "" {
	collectionTitle = tag + " — " + collectionTitle
	}

	baseUrl := coll.CanonicalURL()
	basePermalinkUrl := baseUrl
	siteURL := baseUrl
	if tag != "" {
	siteURL += "tag:" + tag
	}

	- feed := &Feed{
	+ feed := &feeds.Feed{
	Title: collectionTitle,
	- Link: &Link{Href: siteURL},
	+ Link: &feeds.Link{Href: siteURL},
	Description: coll.Description,
	- Author: &Author{author, ""},
	+ Author: &feeds.Author{author, ""},
	Created: time.Now(),
	}

	var title, permalink string
	for _, p := range *coll.Posts {
	// Add necessary path back to the web browser for Web Monetization if needed
	p.Collection = coll.CollectionObj // augmentReadingDestination requires a populated Collection field
	p.augmentReadingDestination()
	// Create the item for the feed
	title = p.PlainDisplayTitle()
	permalink = fmt.Sprintf("%s%s", baseUrl, p.Slug.String)
	- feed.Items = append(feed.Items, &Item{
	+ feed.Items = append(feed.Items, &feeds.Item{
	Id: fmt.Sprintf("%s%s", basePermalinkUrl, p.Slug.String),
	Title: title,
	- Link: &Link{Href: permalink},
	+ Link: &feeds.Link{Href: permalink},
	Description: "<![CDATA[" + stripmd.Strip(p.Content) + "]]>",
	Content: string(p.HTMLContent),
	- Author: &Author{author, ""},
	+ Author: &feeds.Author{author, ""},
	Created: p.Created,
	Updated: p.Updated,
	})
	}

	rss, err := feed.ToRss()
	if err != nil {
	return err
	}

	fmt.Fprint(w, rss)
	return nil
	}
	diff --git a/go.mod b/go.mod
	index 72c74da..3bae217 100644
	--- a/go.mod
	+++ b/go.mod
	@@ -1,58 +1,93 @@
	module github.com/writefreely/writefreely

	require (
	- git.mills.io/prologic/go-gopher v0.0.0-20210712135410-b7ebb55feece
	github.com/PuerkitoBio/goquery v1.7.0 // indirect
	github.com/aymerick/douceur v0.2.0
	github.com/clbanning/mxj v1.8.4 // indirect
	github.com/dustin/go-humanize v1.0.0
	github.com/facebookgo/ensure v0.0.0-20200202191622-63f1cf65ac4c // indirect
	github.com/facebookgo/stack v0.0.0-20160209184415-751773369052 // indirect
	github.com/facebookgo/subset v0.0.0-20200203212716-c811ad88dec4 // indirect
	- github.com/fatih/color v1.10.0
	+ github.com/fatih/color v1.13.0
	+ github.com/go-ini/ini v1.67.0
	github.com/go-sql-driver/mysql v1.6.0
	github.com/go-test/deep v1.0.1 // indirect
	github.com/gobuffalo/envy v1.9.0 // indirect
	github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e // indirect
	- github.com/gorilla/csrf v1.7.0
	+ github.com/gorilla/csrf v1.7.1
	github.com/gorilla/feeds v1.1.1
	github.com/gorilla/mux v1.8.0
	github.com/gorilla/schema v1.2.0
	- github.com/gorilla/sessions v1.2.0
	+ github.com/gorilla/sessions v1.2.1
	github.com/guregu/null v3.5.0+incompatible
	github.com/hashicorp/go-multierror v1.1.1
	github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2
	- github.com/jtolds/gls v4.2.1+incompatible // indirect
	github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec
	- github.com/lunixbochs/vtclean v1.0.0 // indirect
	github.com/mailgun/mailgun-go v2.0.0+incompatible
	- github.com/manifoldco/promptui v0.8.0
	- github.com/mattn/go-sqlite3 v1.14.6
	- github.com/microcosm-cc/bluemonday v1.0.5
	+ github.com/manifoldco/promptui v0.9.0
	+ github.com/mattn/go-sqlite3 v1.14.16
	+ github.com/microcosm-cc/bluemonday v1.0.21
	github.com/mitchellh/go-wordwrap v1.0.1
	github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d
	github.com/onsi/ginkgo v1.16.4 // indirect
	github.com/onsi/gomega v1.13.0 // indirect
	github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be // indirect
	github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304 // indirect
	github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c // indirect
	- github.com/stretchr/testify v1.7.0
	- github.com/urfave/cli/v2 v2.3.0
	+ github.com/stretchr/testify v1.8.1
	+ github.com/urfave/cli/v2 v2.23.5
	github.com/writeas/activity v0.1.2
	github.com/writeas/activityserve v0.0.0-20200409150223-d7ab3eaa4481
	github.com/writeas/go-strip-markdown/v2 v2.1.1
	github.com/writeas/go-webfinger v1.1.0
	github.com/writeas/httpsig v1.0.0
	github.com/writeas/impart v1.1.1
	github.com/writeas/import v0.2.1
	github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219
	github.com/writeas/saturday v1.7.2-0.20200427193424-392b95a03320
	github.com/writeas/slug v1.2.0
	- github.com/writeas/web-core v1.3.1-0.20210330164422-95a3a717ed8f
	+ github.com/writeas/web-core v1.4.1-0.20220118212728-0da0bcaf018e
	+ github.com/writefreely/go-gopher v0.0.0-20220429181814-40127126f83b
	github.com/writefreely/go-nodeinfo v1.2.0
	golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9
	- golang.org/x/net v0.0.0-20210428140749-89ef3d95e781
	- gopkg.in/ini.v1 v1.62.0
	+ golang.org/x/net v0.0.0-20221002022538-bcab6841153b
	+)
	+
	+require (
	+ code.as/core/socks v1.0.0 // indirect
	+ github.com/andybalholm/cascadia v1.1.0 // indirect
	+ github.com/beevik/etree v1.1.0 // indirect
	+ github.com/captncraig/cors v0.0.0-20190703115713-e80254a89df1 // indirect
	+ github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e // indirect
	+ github.com/cpuguy83/go-md2man/v2 v2.0.2 // indirect
	+ github.com/davecgh/go-spew v1.1.1 // indirect
	+ github.com/dchest/uniuri v0.0.0-20200228104902-7aecb25e1fe5 // indirect
	+ github.com/fatih/structs v1.1.0 // indirect
	+ github.com/go-fed/httpsig v0.1.1-0.20200204213531-0ef28562fabe // indirect
	+ github.com/gofrs/uuid v3.3.0+incompatible // indirect
	+ github.com/gologme/log v1.2.0 // indirect
	+ github.com/gorilla/css v1.0.0 // indirect
	+ github.com/gorilla/securecookie v1.1.1 // indirect
	+ github.com/hashicorp/errwrap v1.0.0 // indirect
	+ github.com/joho/godotenv v1.3.0 // indirect
	+ github.com/jtolds/gls v4.2.1+incompatible // indirect
	+ github.com/mattn/go-colorable v0.1.9 // indirect
	+ github.com/mattn/go-isatty v0.0.14 // indirect
	+ github.com/petermattis/goid v0.0.0-20180202154549-b0b1615b78e5 // indirect
	+ github.com/pkg/errors v0.9.1 // indirect
	+ github.com/pmezard/go-difflib v1.0.0 // indirect
	+ github.com/rogpeppe/go-internal v1.3.2 // indirect
	+ github.com/russross/blackfriday/v2 v2.1.0 // indirect
	+ github.com/sasha-s/go-deadlock v0.3.1 // indirect
	+ github.com/shurcooL/sanitized_anchor_name v1.0.0 // indirect
	+ github.com/writeas/go-strip-markdown v2.0.1+incompatible // indirect
	+ github.com/writeas/go-writeas/v2 v2.0.2 // indirect
	+ github.com/writeas/openssl-go v1.0.0 // indirect
	+ github.com/xrash/smetrics v0.0.0-20201216005158-039620a65673 // indirect
	+ golang.org/x/sys v0.0.0-20220728004956-3c1f35247d10 // indirect
	+ golang.org/x/text v0.3.7 // indirect
	+ gopkg.in/ini.v1 v1.62.0 // indirect
	+ gopkg.in/yaml.v3 v3.0.1 // indirect
	)

	-go 1.15
	+go 1.19
	diff --git a/go.sum b/go.sum
	index 106e978..2477252 100644
	--- a/go.sum
	+++ b/go.sum
	@@ -1,287 +1,293 @@
	code.as/core/socks v1.0.0 h1:SPQXNp4SbEwjOAP9VzUahLHak8SDqy5n+9cm9tpjZOs=
	code.as/core/socks v1.0.0/go.mod h1:BAXBy5O9s2gmw6UxLqNJcVbWY7C/UPs+801CcSsfWOY=
	-git.mills.io/prologic/go-gopher v0.0.0-20210712135410-b7ebb55feece h1:0esmnntqeuM1iBgHH0HOeSynsLA1l28p2K3h/WZuIfQ=
	-git.mills.io/prologic/go-gopher v0.0.0-20210712135410-b7ebb55feece/go.mod h1:EMXlYOIbYJQhPTtIltgaaHtCYDawV/HL0dYf8ShzAck=
	-github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
	github.com/PuerkitoBio/goquery v1.7.0 h1:O5SP3b9JWqMSVMG69zMfj577zwkSNpxrFf7ybS74eiw=
	github.com/PuerkitoBio/goquery v1.7.0/go.mod h1:GsLWisAFVj4WgDibEWF4pvYnkVQBpKBKeU+7zCJoLcc=
	github.com/andybalholm/cascadia v1.1.0 h1:BuuO6sSfQNFRu1LppgbD25Hr2vLYW25JvxHs5zzsLTo=
	github.com/andybalholm/cascadia v1.1.0/go.mod h1:GsXiBklL0woXo1j/WYWtSYYC4ouU9PqHO0sqidkEA4Y=
	github.com/aymerick/douceur v0.2.0 h1:Mv+mAeH1Q+n9Fr+oyamOlAkUNPWPlA8PPGR0QAaYuPk=
	github.com/aymerick/douceur v0.2.0/go.mod h1:wlT5vV2O3h55X9m7iVYN0TBM0NH/MmbLnd30/FjWUq4=
	github.com/beevik/etree v1.1.0 h1:T0xke/WvNtMoCqgzPhkX2r4rjY3GDZFi+FjpRZY2Jbs=
	github.com/beevik/etree v1.1.0/go.mod h1:r8Aw8JqVegEf0w2fDnATrX9VpkMcyFeM0FhwO62wh+A=
	github.com/captncraig/cors v0.0.0-20190703115713-e80254a89df1 h1:AFSJaASPGYNbkUa5c8ZybrcW9pP3Cy7+z5dnpcc/qG8=
	github.com/captncraig/cors v0.0.0-20190703115713-e80254a89df1/go.mod h1:EIlIeMufZ8nqdUhnesledB15xLRl4wIJUppwDLPrdrQ=
	-github.com/chris-ramon/douceur v0.2.0 h1:IDMEdxlEUUBYBKE4z/mJnFyVXox+MjuEVDJNN27glkU=
	github.com/chris-ramon/douceur v0.2.0/go.mod h1:wDW5xjJdeoMm1mRt4sD4c/LbF/mWdEpRXQKjTR8nIBE=
	github.com/chzyer/logex v1.1.10 h1:Swpa1K6QvQznwJRcfTfQJmTE72DqScAa40E+fbHEXEE=
	github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI=
	github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e h1:fY5BOSpyZCqRo5OhCuC+XN+r/bBCmeuuJtjz+bCNIf8=
	github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI=
	github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1 h1:q763qf9huN11kDQavWsoZXJNW3xEE4JJyHa5Q25/sd8=
	github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU=
	github.com/clbanning/mxj v1.8.3/go.mod h1:BVjHeAH+rl9rs6f+QIpeRl0tfu10SXn1pUSa5PVGJng=
	github.com/clbanning/mxj v1.8.4 h1:HuhwZtbyvyOw+3Z1AowPkU87JkJUSv751ELWaiTpj8I=
	github.com/clbanning/mxj v1.8.4/go.mod h1:BVjHeAH+rl9rs6f+QIpeRl0tfu10SXn1pUSa5PVGJng=
	-github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d h1:U+s90UTSYgptZMwQh2aRr3LuazLJIa+Pg3Kc1ylSYVY=
	-github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU=
	+github.com/cpuguy83/go-md2man/v2 v2.0.2 h1:p1EgwI/C7NhT0JmVkwCD2ZBK8j4aeHQX2pMHHBfMQ6w=
	+github.com/cpuguy83/go-md2man/v2 v2.0.2/go.mod h1:tgQtvFlXSQOSOSIRvRPT7W67SCa46tRHOmNcaadrF8o=
	github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
	github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
	github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
	github.com/dchest/uniuri v0.0.0-20200228104902-7aecb25e1fe5 h1:RAV05c0xOkJ3dZGS0JFybxFKZ2WMLabgx3uXnd7rpGs=
	github.com/dchest/uniuri v0.0.0-20200228104902-7aecb25e1fe5/go.mod h1:GgB8SF9nRG+GqaDtLcwJZsQFhcogVCJ79j4EdT0c2V4=
	github.com/dustin/go-humanize v1.0.0 h1:VSnTsYCnlFHaM2/igO1h6X3HA71jcobQuxemgkq4zYo=
	github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk=
	github.com/facebookgo/ensure v0.0.0-20200202191622-63f1cf65ac4c h1:8ISkoahWXwZR41ois5lSJBSVw4D0OV19Ht/JSTzvSv0=
	github.com/facebookgo/ensure v0.0.0-20200202191622-63f1cf65ac4c/go.mod h1:Yg+htXGokKKdzcwhuNDwVvN+uBxDGXJ7G/VN1d8fa64=
	github.com/facebookgo/stack v0.0.0-20160209184415-751773369052 h1:JWuenKqqX8nojtoVVWjGfOF9635RETekkoH6Cc9SX0A=
	github.com/facebookgo/stack v0.0.0-20160209184415-751773369052/go.mod h1:UbMTZqLaRiH3MsBH8va0n7s1pQYcu3uTb8G4tygF4Zg=
	github.com/facebookgo/subset v0.0.0-20200203212716-c811ad88dec4 h1:7HZCaLC5+BZpmbhCOZJ293Lz68O7PYrF2EzeiFMwCLk=
	github.com/facebookgo/subset v0.0.0-20200203212716-c811ad88dec4/go.mod h1:5tD+neXqOorC30/tWg0LCSkrqj/AR6gu8yY8/fpw1q0=
	-github.com/fatih/color v1.10.0 h1:s36xzo75JdqLaaWoiEHk767eHiwo0598uUxyfiPkDsg=
	-github.com/fatih/color v1.10.0/go.mod h1:ELkj/draVOlAH/xkhN6mQ50Qd0MPOk5AAr3maGEBuJM=
	+github.com/fatih/color v1.13.0 h1:8LOYc1KYPPmyKMuN8QV2DNRWNbLo6LZ0iLs8+mlH53w=
	+github.com/fatih/color v1.13.0/go.mod h1:kLAiJbzzSOZDVNGyDpeOxJ47H46qBXwg5ILebYFFOfk=
	github.com/fatih/structs v1.1.0 h1:Q7juDM0QtcnhCpeyLGQKyg4TOIghuNXrkL32pHAUMxo=
	github.com/fatih/structs v1.1.0/go.mod h1:9NiDSp5zOcgEDl+j00MP/WkGVPOlPRLejGD8Ga6PJ7M=
	github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
	github.com/fsnotify/fsnotify v1.4.9 h1:hsms1Qyu0jgnwNXIxa+/V/PDsU6CfLf6CNO8H7IWoS4=
	github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ=
	github.com/go-fed/httpsig v0.1.0/go.mod h1:T56HUNYZUQ1AGUzhAYPugZfp36sKApVnGBgKlIY+aIE=
	github.com/go-fed/httpsig v0.1.1-0.20200204213531-0ef28562fabe h1:U71giCx5NjRn4Lb71UuprPHqhjxGv3Jqonb9fgcaJH8=
	github.com/go-fed/httpsig v0.1.1-0.20200204213531-0ef28562fabe/go.mod h1:T56HUNYZUQ1AGUzhAYPugZfp36sKApVnGBgKlIY+aIE=
	+github.com/go-ini/ini v1.67.0 h1:z6ZrTEZqSWOTyH2FlglNbNgARyHG8oLW9gMELqKr06A=
	+github.com/go-ini/ini v1.67.0/go.mod h1:ByCAeIL28uOIIG0E3PJtZPDL8WnHpFKFOtgjp+3Ies8=
	github.com/go-sql-driver/mysql v1.6.0 h1:BCTh4TKNUYmOmMUcQ3IipzF5prigylS7XXjEkfCHuOE=
	github.com/go-sql-driver/mysql v1.6.0/go.mod h1:DCzpHaOWr8IXmIStZouvnhqoel9Qv2LBy8hT2VhHyBg=
	github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0/go.mod h1:fyg7847qk6SyHyPtNmDHnmrv/HOrqktSC+C9fM+CJOE=
	github.com/go-test/deep v1.0.1 h1:UQhStjbkDClarlmv0am7OXXO4/GaPdCGiUiMTvi28sg=
	github.com/go-test/deep v1.0.1/go.mod h1:wGDj63lr65AM2AQyKZd/NYHGb0R+1RLqB8NKt3aSFNA=
	github.com/gobuffalo/envy v1.9.0 h1:eZR0DuEgVLfeIb1zIKt3bT4YovIMf9O9LXQeCZLXpqE=
	github.com/gobuffalo/envy v1.9.0/go.mod h1:FurDp9+EDPE4aIUS3ZLyD+7/9fpx7YRt/ukY6jIHf0w=
	github.com/gofrs/uuid v3.3.0+incompatible h1:8K4tyRfvU1CYPgJsveYFQMhpFd/wXNM7iK6rR7UHz84=
	github.com/gofrs/uuid v3.3.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM=
	github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
	github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
	github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
	github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
	github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
	github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
	github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
	github.com/golang/protobuf v1.5.0/go.mod h1:FsONVRAS9T7sI+LIUmWTfcYkHO4aIWwzhcaSAoJOfIk=
	-github.com/golang/protobuf v1.5.2 h1:ROPKBNFfQgOUMifHyP+KYbvpjbdoFNs+aK7DXlji0Tw=
	github.com/golang/protobuf v1.5.2/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY=
	github.com/gologme/log v1.2.0 h1:Ya5Ip/KD6FX7uH0S31QO87nCCSucKtF44TLbTtO7V4c=
	github.com/gologme/log v1.2.0/go.mod h1:gq31gQ8wEHkR+WekdWsqDuf8pXTUZA9BnnzTuPz1Y9U=
	github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
	github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
	github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
	-github.com/google/go-cmp v0.5.5 h1:Khx7svrCpmxxtHBq5j2mp/xVjsi8hQMfNLvJFAlrGgU=
	github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
	github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e h1:JKmoR8x90Iww1ks85zJ1lfDGgIiMDuIptTOhJq+zKyg=
	github.com/gopherjs/gopherjs v0.0.0-20181103185306-d547d1d9531e/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY=
	-github.com/gorilla/csrf v1.7.0 h1:mMPjV5/3Zd460xCavIkppUdvnl5fPXMpv2uz2Zyg7/Y=
	-github.com/gorilla/csrf v1.7.0/go.mod h1:+a/4tCmqhG6/w4oafeAZ9pEa3/NZOWYVbD9fV0FwIQA=
	+github.com/gorilla/csrf v1.7.1 h1:Ir3o2c1/Uzj6FBxMlAUB6SivgVMy1ONXwYgXn+/aHPE=
	+github.com/gorilla/csrf v1.7.1/go.mod h1:+a/4tCmqhG6/w4oafeAZ9pEa3/NZOWYVbD9fV0FwIQA=
	github.com/gorilla/css v1.0.0 h1:BQqNyPTi50JCFMTw/b67hByjMVXZRwGha6wxVGkeihY=
	github.com/gorilla/css v1.0.0/go.mod h1:Dn721qIggHpt4+EFCcTLTU/vk5ySda2ReITrtgBl60c=
	github.com/gorilla/feeds v1.1.1 h1:HwKXxqzcRNg9to+BbvJog4+f3s/xzvtZXICcQGutYfY=
	github.com/gorilla/feeds v1.1.1/go.mod h1:Nk0jZrvPFZX1OBe5NPiddPw7CfwF6Q9eqzaBbaightA=
	github.com/gorilla/mux v1.7.4/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So=
	github.com/gorilla/mux v1.8.0 h1:i40aqfkR1h2SlN9hojwV5ZA91wcXFOvkdNIeFDP5koI=
	github.com/gorilla/mux v1.8.0/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So=
	github.com/gorilla/schema v1.2.0 h1:YufUaxZYCKGFuAq3c96BOhjgd5nmXiOY9NGzF247Tsc=
	github.com/gorilla/schema v1.2.0/go.mod h1:kgLaKoK1FELgZqMAVxx/5cbj0kT+57qxUrAlIO2eleU=
	github.com/gorilla/securecookie v1.1.1 h1:miw7JPhV+b/lAHSXz4qd/nN9jRiAFV5FwjeKyCS8BvQ=
	github.com/gorilla/securecookie v1.1.1/go.mod h1:ra0sb63/xPlUeL+yeDciTfxMRAA+MP+HVt/4epWDjd4=
	-github.com/gorilla/sessions v1.2.0 h1:S7P+1Hm5V/AT9cjEcUD5uDaQSX0OE577aCXgoaKpYbQ=
	-github.com/gorilla/sessions v1.2.0/go.mod h1:dk2InVEVJ0sfLlnXv9EAgkf6ecYs/i80K/zI+bUmuGM=
	+github.com/gorilla/sessions v1.2.1 h1:DHd3rPN5lE3Ts3D8rKkQ8x/0kqfeNmBAaiSi+o7FsgI=
	+github.com/gorilla/sessions v1.2.1/go.mod h1:dk2InVEVJ0sfLlnXv9EAgkf6ecYs/i80K/zI+bUmuGM=
	github.com/guregu/null v3.5.0+incompatible h1:fSdvRTQtmBA4B4YDZXhLtxTIJZYuUxBFTTHS4B9djG4=
	github.com/guregu/null v3.5.0+incompatible/go.mod h1:ePGpQaN9cw0tj45IR5E5ehMvsFlLlQZAkkOXZurJ3NM=
	github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA=
	github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
	github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
	github.com/hashicorp/go-multierror v1.1.1 h1:H5DkEtf6CXdFp0N0Em5UCwQpXMWke8IA0+lD48awMYo=
	github.com/hashicorp/go-multierror v1.1.1/go.mod h1:iw975J/qwKPdAO1clOe2L8331t/9/fmwbPZ6JB6eMoM=
	github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
	github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2 h1:wIdDEle9HEy7vBPjC6oKz6ejs3Ut+jmsYvuOoAW2pSM=
	github.com/ikeikeikeike/go-sitemap-generator/v2 v2.0.2/go.mod h1:WtaVKD9TeruTED9ydiaOJU08qGoEPP/LyzTKiD3jEsw=
	github.com/joho/godotenv v1.3.0 h1:Zjp+RcGpHhGlrMbJzXTrZZPrWj+1vfm90La1wgB6Bhc=
	github.com/joho/godotenv v1.3.0/go.mod h1:7hK45KPybAkOC6peb+G5yklZfMxEjkZhHbwpqxOKXbg=
	github.com/jtolds/gls v4.2.1+incompatible h1:fSuqC+Gmlu6l/ZYAoZzx2pyucC8Xza35fpRVWLVmUEE=
	github.com/jtolds/gls v4.2.1+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU=
	-github.com/juju/ansiterm v0.0.0-20180109212912-720a0952cc2a h1:FaWFmfWdAUKbSCtOU2QjDaorUexogfaMgbipgYATUMU=
	-github.com/juju/ansiterm v0.0.0-20180109212912-720a0952cc2a/go.mod h1:UJSiEoRfvx3hP73CvoARgeLjaIOjybY9vj8PUPPFGeU=
	-github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
	github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
	+github.com/kr/pretty v0.2.1 h1:Fmg33tUaq4/8ym9TJN1x7sLJnHVwhP33CNkpYV/7rwI=
	+github.com/kr/pretty v0.2.1/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI=
	github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
	github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
	github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
	github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec h1:ZXWuspqypleMuJy4bzYEqlMhJnGAYpLrWe5p7W3CdvI=
	github.com/kylemcc/twitter-text-go v0.0.0-20180726194232-7f582f6736ec/go.mod h1:voECJzdraJmolzPBgL9Z7ANwXf4oMXaTCsIkdiPpR/g=
	-github.com/lunixbochs/vtclean v0.0.0-20180621232353-2d01aacdc34a/go.mod h1:pHhQNgMf3btfWnGBVipUOjRYhoOsdGqdm/+2c2E2WMI=
	-github.com/lunixbochs/vtclean v1.0.0 h1:xu2sLAri4lGiovBDQKxl5mrXyESr3gUr5m5SM5+LVb8=
	-github.com/lunixbochs/vtclean v1.0.0/go.mod h1:pHhQNgMf3btfWnGBVipUOjRYhoOsdGqdm/+2c2E2WMI=
	github.com/mailgun/mailgun-go v2.0.0+incompatible h1:0FoRHWwMUctnd8KIR3vtZbqdfjpIMxOZgcSa51s8F8o=
	github.com/mailgun/mailgun-go v2.0.0+incompatible/go.mod h1:NWTyU+O4aczg/nsGhQnvHL6v2n5Gy6Sv5tNDVvC6FbU=
	-github.com/manifoldco/promptui v0.8.0 h1:R95mMF+McvXZQ7j1g8ucVZE1gLP3Sv6j9vlF9kyRqQo=
	-github.com/manifoldco/promptui v0.8.0/go.mod h1:n4zTdgP0vr0S3w7/O/g98U+e0gwLScEXGwov2nIKuGQ=
	-github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU=
	-github.com/mattn/go-colorable v0.1.8 h1:c1ghPdyEDarC70ftn0y+A/Ee++9zz8ljHG1b13eJ0s8=
	-github.com/mattn/go-colorable v0.1.8/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc=
	-github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
	-github.com/mattn/go-isatty v0.0.12 h1:wuysRhFDzyxgEmMf5xjvJ2M9dZoWAXNNr5LSBS7uHXY=
	+github.com/manifoldco/promptui v0.9.0 h1:3V4HzJk1TtXW1MTZMP7mdlwbBpIinw3HztaIlYthEiA=
	+github.com/manifoldco/promptui v0.9.0/go.mod h1:ka04sppxSGFAtxX0qhlYQjISsg9mR4GWtQEhdbn6Pgg=
	+github.com/mattn/go-colorable v0.1.9 h1:sqDoxXbdeALODt0DAeJCVp38ps9ZogZEAXjus69YV3U=
	+github.com/mattn/go-colorable v0.1.9/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc=
	github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU=
	-github.com/mattn/go-sqlite3 v1.14.6 h1:dNPt6NO46WmLVt2DLNpwczCmdV5boIZ6g/tlDrlRUbg=
	-github.com/mattn/go-sqlite3 v1.14.6/go.mod h1:NyWgC/yNuGj7Q9rpYnZvas74GogHl5/Z4A/KQRfk6bU=
	-github.com/microcosm-cc/bluemonday v1.0.2/go.mod h1:iVP4YcDBq+n/5fb23BhYFvIMq/leAFZyRl6bYmGDlGc=
	-github.com/microcosm-cc/bluemonday v1.0.5 h1:cF59UCKMmmUgqN1baLvqU/B1ZsMori+duLVTLpgiG3w=
	+github.com/mattn/go-isatty v0.0.14 h1:yVuAays6BHfxijgZPzw+3Zlu5yQgKGP2/hcQbHb7S9Y=
	+github.com/mattn/go-isatty v0.0.14/go.mod h1:7GGIvUiUoEMVVmxf/4nioHXj79iQHKdU27kJ6hsGG94=
	+github.com/mattn/go-sqlite3 v1.14.16 h1:yOQRA0RpS5PFz/oikGwBEqvAWhWg5ufRz4ETLjwpU1Y=
	+github.com/mattn/go-sqlite3 v1.14.16/go.mod h1:2eHXhiwb8IkHr+BDWZGa96P6+rkvnG63S2DGjv9HUNg=
	github.com/microcosm-cc/bluemonday v1.0.5/go.mod h1:8iwZnFn2CDDNZ0r6UXhF4xawGvzaqzCRa1n3/lO3W2w=
	+github.com/microcosm-cc/bluemonday v1.0.21 h1:dNH3e4PSyE4vNX+KlRGHT5KrSvjeUkoNPwEORjffHJg=
	+github.com/microcosm-cc/bluemonday v1.0.21/go.mod h1:ytNkv4RrDrLJ2pqlsSI46O6IVXmZOBBD4SaJyDwwTkM=
	github.com/mitchellh/go-wordwrap v1.0.1 h1:TLuKupo69TCn6TQSyGxwI1EblZZEsQ0vMlAFQflz0v0=
	github.com/mitchellh/go-wordwrap v1.0.1/go.mod h1:R62XHJLzvMFRBbcrT7m7WgmE1eOyTSsCt+hzestvNj0=
	github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
	github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
	github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A=
	github.com/nxadm/tail v1.4.8 h1:nPr65rt6Y5JFSKQO7qToXr7pePgD6Gwiw05lkbyAQTE=
	github.com/nxadm/tail v1.4.8/go.mod h1:+ncqLTQzXmGhMZNUePPaPqPvBxHAIsmXswZKocGu+AU=
	github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE=
	github.com/onsi/ginkgo v1.12.1/go.mod h1:zj2OWP4+oCPe1qIXoGWkgMRwljMUYCdkwsT2108oapk=
	github.com/onsi/ginkgo v1.16.2/go.mod h1:CObGmKUOKaSC0RjmoAK7tKyn4Azo5P2IWuoMnvwxz1E=
	github.com/onsi/ginkgo v1.16.4 h1:29JGrr5oVBm5ulCWet69zQkzWipVXIol6ygQUe/EzNc=
	github.com/onsi/ginkgo v1.16.4/go.mod h1:dX+/inL/fNMqNlz0e9LfyB9TswhZpCVdJM/Z6Vvnwo0=
	github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY=
	github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo=
	github.com/onsi/gomega v1.13.0 h1:7lLHu94wT9Ij0o6EWWclhu0aOh32VxhkwEJvzuWPeak=
	github.com/onsi/gomega v1.13.0/go.mod h1:lRk9szgn8TxENtWd0Tp4c3wjlRfMTMH27I+3Je41yGY=
	+github.com/petermattis/goid v0.0.0-20180202154549-b0b1615b78e5 h1:q2e307iGHPdTGp0hoxKjt1H5pDo6utceo3dQVK3I5XQ=
	+github.com/petermattis/goid v0.0.0-20180202154549-b0b1615b78e5/go.mod h1:jvVRKCrJTQWu0XVbaOlby/2lO20uSCHEMzzplHXte1o=
	github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4=
	github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
	github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
	github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
	github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be h1:ta7tUOvsPHVHGom5hKW5VXNc2xZIkfCKP8iaqOyYtUQ=
	github.com/rainycape/unidecode v0.0.0-20150907023854-cb7f23ec59be/go.mod h1:MIDFMn7db1kT65GmV94GzpX9Qdi7N/pQlwb+AN8wh+Q=
	github.com/rogpeppe/go-internal v1.3.2 h1:XU784Pr0wdahMY2bYcyK6N1KuaRAdLtqD4qd8D18Bfs=
	github.com/rogpeppe/go-internal v1.3.2/go.mod h1:xXDCJY+GAPziupqXw64V24skbSoqbTEfhy4qGm1nDQc=
	-github.com/russross/blackfriday/v2 v2.0.1 h1:lPqVAte+HuHNfhJ/0LC98ESWRz8afy9tM/0RK8m9o+Q=
	-github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
	+github.com/russross/blackfriday/v2 v2.1.0 h1:JIOH55/0cWyOuilr9/qlrm0BSXldqnqwMsf35Ld67mk=
	+github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
	+github.com/sasha-s/go-deadlock v0.3.1 h1:sqv7fDNShgjcaxkO0JNcOAlr8B9+cV5Ey/OB71efZx0=
	+github.com/sasha-s/go-deadlock v0.3.1/go.mod h1:F73l+cr82YSh10GxyRI6qZiCgK64VaZjwesgfQ1/iLM=
	github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo=
	github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
	github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304 h1:Jpy1PXuP99tXNrhbq2BaPz9B+jNAvH1JPQQpG/9GCXY=
	github.com/smartystreets/assertions v0.0.0-20190116191733-b6c0e53d7304/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc=
	github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c h1:Ho+uVpkel/udgjbwB5Lktg9BtvJSh2DT0Hi6LPSyI2w=
	github.com/smartystreets/goconvey v0.0.0-20181108003508-044398e4856c/go.mod h1:XDJAKZRPZ1CvBcN2aX5YOUTYGHki24fSF0Iv48Ibg0s=
	github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
	+github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw=
	+github.com/stretchr/objx v0.5.0/go.mod h1:Yh+to48EsGEfYuaHDzXPcE3xhTkx73EhmCGUpEOglKo=
	github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
	github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA=
	-github.com/stretchr/testify v1.7.0 h1:nwc3DEeHmmLAfoZucVR881uASk0Mfjw8xYJ99tb5CcY=
	github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
	-github.com/urfave/cli/v2 v2.3.0 h1:qph92Y649prgesehzOrQjdWyxFOp/QVM+6imKHad91M=
	-github.com/urfave/cli/v2 v2.3.0/go.mod h1:LJmUH05zAU44vOAcrfzZQKsZbVcdbOG8rtL3/XcUArI=
	+github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
	+github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU=
	+github.com/stretchr/testify v1.8.1 h1:w7B6lhMri9wdJUVmEZPGGhZzrYTPvgJArz7wNPgYKsk=
	+github.com/stretchr/testify v1.8.1/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4=
	+github.com/urfave/cli/v2 v2.23.5 h1:xbrU7tAYviSpqeR3X4nEFWUdB/uDZ6DE+HxmRU7Xtyw=
	+github.com/urfave/cli/v2 v2.23.5/go.mod h1:GHupkWPMM0M/sj1a2b4wUrWBPzazNrIjouW6fmdJLxc=
	github.com/writeas/activity v0.1.2 h1:Y12B5lIrabfqKE7e7HFCWiXrlfXljr9tlkFm2mp7DgY=
	github.com/writeas/activity v0.1.2/go.mod h1:mYYgiewmEM+8tlifirK/vl6tmB2EbjYaxwb+ndUw5T0=
	github.com/writeas/activityserve v0.0.0-20200409150223-d7ab3eaa4481 h1:BiSivIxLQFcKoUorpNN3rNwwFG5bITPnqUSyIccfdh0=
	github.com/writeas/activityserve v0.0.0-20200409150223-d7ab3eaa4481/go.mod h1:4akDJSl+sSp+QhrQKMqzAqdV1gJ1pPx6XPI77zgMM8o=
	+github.com/writeas/go-strip-markdown v2.0.1+incompatible h1:IIqxTM5Jr7RzhigcL6FkrCNfXkvbR+Nbu1ls48pXYcw=
	+github.com/writeas/go-strip-markdown v2.0.1+incompatible/go.mod h1:Rsyu10ZhbEK9pXdk8V6MVnZmTzRG0alMNLMwa0J01fE=
	github.com/writeas/go-strip-markdown/v2 v2.1.1 h1:hAxUM21Uhznf/FnbVGiJciqzska6iLei22Ijc3q2e28=
	github.com/writeas/go-strip-markdown/v2 v2.1.1/go.mod h1:UvvgPJgn1vvN8nWuE5e7v/+qmDu3BSVnKAB6Gl7hFzA=
	github.com/writeas/go-webfinger v1.1.0 h1:MzNyt0ry/GMsRmJGftn2o9mPwqK1Q5MLdh4VuJCfb1Q=
	github.com/writeas/go-webfinger v1.1.0/go.mod h1:w2VxyRO/J5vfNjJHYVubsjUGHd3RLDoVciz0DE3ApOc=
	-github.com/writeas/go-writeas v1.1.0 h1:WHGm6wriBkxYAOGbvriXH8DlMUGOi6jhSZLUZKQ+4mQ=
	github.com/writeas/go-writeas v1.1.0/go.mod h1:oh9U1rWaiE0p3kzdKwwvOpNXgp0P0IELI7OLOwV4fkA=
	github.com/writeas/go-writeas/v2 v2.0.2 h1:akvdMg89U5oBJiCkBwOXljVLTqP354uN6qnG2oOMrbk=
	github.com/writeas/go-writeas/v2 v2.0.2/go.mod h1:9sjczQJKmru925fLzg0usrU1R1tE4vBmQtGnItUMR0M=
	github.com/writeas/httpsig v1.0.0 h1:peIAoIA3DmlP8IG8tMNZqI4YD1uEnWBmkcC9OFPjt3A=
	github.com/writeas/httpsig v1.0.0/go.mod h1:7ClMGSrSVXJbmiLa17bZ1LrG1oibGZmUMlh3402flPY=
	github.com/writeas/impart v1.1.0/go.mod h1:g0MpxdnTOHHrl+Ca/2oMXUHJ0PcRAEWtkCzYCJUXC9Y=
	github.com/writeas/impart v1.1.1 h1:RyA9+CqbdbDuz53k+nXCWUY+NlEkdyw6+nWanxSBl5o=
	github.com/writeas/impart v1.1.1/go.mod h1:g0MpxdnTOHHrl+Ca/2oMXUHJ0PcRAEWtkCzYCJUXC9Y=
	github.com/writeas/import v0.2.1 h1:3k+bDNCyqaWdZinyUZtEO4je3mR6fr/nE4ozTh9/9Wg=
	github.com/writeas/import v0.2.1/go.mod h1:gFe0Pl7ZWYiXbI0TJxeMMyylPGZmhVvCfQxhMEc8CxM=
	github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219 h1:baEp0631C8sT2r/hqwypIw2snCFZa6h7U6TojoLHu/c=
	github.com/writeas/monday v0.0.0-20181024183321-54a7dd579219/go.mod h1:NyM35ayknT7lzO6O/1JpfgGyv+0W9Z9q7aE0J8bXxfQ=
	github.com/writeas/openssl-go v1.0.0 h1:YXM1tDXeYOlTyJjoMlYLQH1xOloUimSR1WMF8kjFc5o=
	github.com/writeas/openssl-go v1.0.0/go.mod h1:WsKeK5jYl0B5y8ggOmtVjbmb+3rEGqSD25TppjJnETA=
	-github.com/writeas/saturday v1.6.0/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ=
	+github.com/writeas/saturday v1.7.1/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ=
	github.com/writeas/saturday v1.7.2-0.20200427193424-392b95a03320 h1:PozPZ29CQ/xt6ym/+FvIz+KvKEObSSc5ye+95zbTjVU=
	github.com/writeas/saturday v1.7.2-0.20200427193424-392b95a03320/go.mod h1:ETE1EK6ogxptJpAgUbcJD0prAtX48bSloie80+tvnzQ=
	github.com/writeas/slug v1.2.0 h1:EMQ+cwLiOcA6EtFwUgyw3Ge18x9uflUnOnR6bp/J+/g=
	github.com/writeas/slug v1.2.0/go.mod h1:RE8shOqQP3YhsfsQe0L3RnuejfQ4Mk+JjY5YJQFubfQ=
	-github.com/writeas/web-core v1.3.1-0.20210330164422-95a3a717ed8f h1:ItBZYzdIbBmmqn8BZGWww00MBFgcUKy5ei0gJrzRDFk=
	-github.com/writeas/web-core v1.3.1-0.20210330164422-95a3a717ed8f/go.mod h1:DzNxa0YLV/wNeeWeHFPNa/nHmyJBFIIzXN/m9PpDm5c=
	+github.com/writeas/web-core v1.4.1-0.20220118212728-0da0bcaf018e h1:/SiS+iQb5YbE/QtKlfJKHSO2c8KwamtTkg0Ojg1uFEI=
	+github.com/writeas/web-core v1.4.1-0.20220118212728-0da0bcaf018e/go.mod h1:MTWDZWikeG063S9IrI6ekvu3N2tJEVRpZuU4kAWg1DY=
	+github.com/writefreely/go-gopher v0.0.0-20220429181814-40127126f83b h1:h3NzB8OZ50NNi5k9yrFeyFszt3LyqyVK4+xUHFYY8B0=
	+github.com/writefreely/go-gopher v0.0.0-20220429181814-40127126f83b/go.mod h1:T2UVVzt+R5KSSZe2xRSytnwc2M9AoDegi7foeIsik+M=
	github.com/writefreely/go-nodeinfo v1.2.0 h1:La+YbTCvmpTwFhBSlebWDDL81N88Qf/SCAvRLR7F8ss=
	github.com/writefreely/go-nodeinfo v1.2.0/go.mod h1:UTvE78KpcjYOlRHupZIiSEFcXHioTXuacCbHU+CAcPg=
	+github.com/xrash/smetrics v0.0.0-20201216005158-039620a65673 h1:bAn7/zixMGCfxrRTfdpNzjtPYqr8smhKouy9mxVdGPU=
	+github.com/xrash/smetrics v0.0.0-20201216005158-039620a65673/go.mod h1:N3UwUGtsrSj3ccvlPHLoLsHnpR27oXr4ZE984MbSER8=
	github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
	golang.org/x/crypto v0.0.0-20180527072434-ab813273cd59/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
	-golang.org/x/crypto v0.0.0-20190131182504-b8fe1690c613/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
	golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
	golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
	+golang.org/x/crypto v0.0.0-20200109152110-61a87790db17/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
	golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9 h1:psW17arqaxU48Z5kZ0CQnkZWQJsqcURM6tKiBApRjXI=
	golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
	golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
	golang.org/x/net v0.0.0-20180218175443-cbe0f9307d01/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
	golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
	golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
	golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
	golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
	golang.org/x/net v0.0.0-20200202094626-16171245cfb2/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
	golang.org/x/net v0.0.0-20200520004742-59133d7f0dd7/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
	golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
	-golang.org/x/net v0.0.0-20210428140749-89ef3d95e781 h1:DzZ89McO9/gWPsQXS/FVKAlG02ZjaQ6AlZRBimEYOd0=
	golang.org/x/net v0.0.0-20210428140749-89ef3d95e781/go.mod h1:OJAsFXCWl8Ukc7SiCT/9KSuxbyM7479/AVlXFRxuMCk=
	+golang.org/x/net v0.0.0-20221002022538-bcab6841153b h1:6e93nYa3hNqAvLr0pD4PN1fFS+gKzp2zAXqrnTCstqU=
	+golang.org/x/net v0.0.0-20221002022538-bcab6841153b/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk=
	golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
	golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
	golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
	golang.org/x/sys v0.0.0-20180525142821-c11f84a56e43/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
	golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
	golang.org/x/sys v0.0.0-20181122145206-62eef0e2fa9b/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
	golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
	golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	-golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd h1:xhmwyvizuTgC2qz7ZlMluP20uW+C3Rm0FD/WLDX8884=
	golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	golang.org/x/sys v0.0.0-20210112080510-489259a85091/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	-golang.org/x/sys v0.0.0-20210423082822-04245dca01da h1:b3NXsE2LusjYGGjL5bxEVZZORm/YEFFrWFjR8eFrw/c=
	golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
	+golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
	+golang.org/x/sys v0.0.0-20220728004956-3c1f35247d10 h1:WIoqL4EROvwiPdUtaip4VcDdpZ4kha7wBWZrbVKCIZg=
	+golang.org/x/sys v0.0.0-20220728004956-3c1f35247d10/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
	golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
	-golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
	golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
	golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
	-golang.org/x/text v0.3.6 h1:aRYxNxv6iGQlyVaZmk6ZgYEDa+Jg18DxebPSrd6bg1M=
	golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
	+golang.org/x/text v0.3.7 h1:olpwvP2KacW1ZWvsR7uQhoyTYvKAupfQrRGBFM352Gk=
	+golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ=
	golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
	golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
	golang.org/x/tools v0.0.0-20201224043029-2b0845dc783e/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
	golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
	golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
	golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
	-golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1 h1:go1bK/D/BFZV2I8cIQd1NKEZ+0owSTG1fDTci4IqFcE=
	golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
	google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
	google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
	google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
	google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
	google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
	google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
	google.golang.org/protobuf v1.26.0-rc.1/go.mod h1:jlhhOSvTdKEhbULTjvd4ARK9grFBp09yW+WbY/TyQbw=
	-google.golang.org/protobuf v1.26.0 h1:bxAC2xTBsZGibn2RTntX0oH50xLsqy1OxA9tTL3p/lk=
	google.golang.org/protobuf v1.26.0/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc=
	gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
	-gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY=
	gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
	+gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk=
	+gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q=
	gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI=
	gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys=
	gopkg.in/ini.v1 v1.55.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k=
	gopkg.in/ini.v1 v1.62.0 h1:duBzk771uxoUuOlyRLkHsygud9+5lrlGjdFBb4mSKDU=
	gopkg.in/ini.v1 v1.62.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k=
	gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ=
	gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw=
	gopkg.in/yaml.v1 v1.0.0-20140924161607-9f9df34309c0 h1:POO/ycCATvegFmVuPpQzZFJ+pGZeX22Ufu6fibxDVjU=
	gopkg.in/yaml.v1 v1.0.0-20140924161607-9f9df34309c0/go.mod h1:WDnlLJ4WF5VGsH/HVa3CI79GS0ol3YnhVnKP89i0kNg=
	gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
	-gopkg.in/yaml.v2 v2.2.3/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
	gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
	gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
	gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY=
	gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
	-gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c h1:dUUwHk2QECo/6vqA44rthZ8ie2QXMNeKRTHCNY2nXvo=
	gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
	+gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
	+gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
	diff --git a/gopher.go b/gopher.go
	index 7d86632..2ac1590 100644
	--- a/gopher.go
	+++ b/gopher.go
	@@ -1,167 +1,167 @@
	/*
	- * Copyright © 2020 A Bunch Tell LLC.
	+ * Copyright © 2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"bytes"
	"fmt"
	"io"
	"net/url"
	"regexp"
	"strings"

	- "git.mills.io/prologic/go-gopher"
	"github.com/writeas/web-core/log"
	+ "github.com/writefreely/go-gopher"
	)

	func initGopher(apper Apper) {
	handler := NewWFHandler(apper)

	gopher.HandleFunc("/", handler.Gopher(handleGopher))
	log.Info("Serving on gopher://localhost:%d", apper.App().Config().Server.GopherPort)
	gopher.ListenAndServe(fmt.Sprintf(":%d", apper.App().Config().Server.GopherPort), nil)
	}

	// Utility function to strip the URL from the hostname provided by app.cfg.App.Host
	func stripHostProtocol(app *App) string {
	u, err := url.Parse(app.cfg.App.Host)
	if err != nil {
	// Fall back to host, with scheme stripped
	return string(regexp.MustCompile("^.*://").ReplaceAll([]byte(app.cfg.App.Host), []byte("")))
	}
	return u.Hostname()
	}

	func handleGopher(app App, w gopher.ResponseWriter, r gopher.Request) error {
	parts := strings.Split(r.Selector, "/")
	if app.cfg.App.SingleUser {
	if parts[1] != "" {
	return handleGopherCollectionPost(app, w, r)
	}
	return handleGopherCollection(app, w, r)
	}

	// Show all public collections (a gopher Reader view, essentially)
	if len(parts) == 3 {
	return handleGopherCollection(app, w, r)
	}

	w.WriteInfo(fmt.Sprintf("Welcome to %s", app.cfg.App.SiteName))

	colls, err := app.db.GetPublicCollections(app.cfg.App.Host)
	if err != nil {
	return err
	}

	for _, c := range *colls {
	w.WriteItem(&gopher.Item{
	Host: stripHostProtocol(app),
	Port: app.cfg.Server.GopherPort,
	Type: gopher.DIRECTORY,
	Description: c.DisplayTitle(),
	Selector: "/" + c.Alias + "/",
	})
	}
	return w.End()
	}

	func handleGopherCollection(app App, w gopher.ResponseWriter, r gopher.Request) error {
	var collAlias, slug string
	var c *Collection
	var err error
	var baseSel = "/"

	parts := strings.Split(r.Selector, "/")
	if app.cfg.App.SingleUser {
	// sanity check
	slug = parts[1]
	if slug != "" {
	return handleGopherCollectionPost(app, w, r)
	}

	c, err = app.db.GetCollectionByID(1)
	if err != nil {
	return err
	}
	} else {
	collAlias = parts[1]
	slug = parts[2]
	if slug != "" {
	return handleGopherCollectionPost(app, w, r)
	}

	c, err = app.db.GetCollection(collAlias)
	if err != nil {
	return err
	}
	baseSel = "/" + c.Alias + "/"
	}
	c.hostName = app.cfg.App.Host

	w.WriteInfo(c.DisplayTitle())
	if c.Description != "" {
	w.WriteInfo(c.Description)
	}

	posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false)
	if err != nil {
	return err
	}

	for _, p := range *posts {
	w.WriteItem(&gopher.Item{
	Port: app.cfg.Server.GopherPort,
	Host: stripHostProtocol(app),
	Type: gopher.FILE,
	Description: p.CreatedDate() + " - " + p.DisplayTitle(),
	Selector: baseSel + p.Slug.String,
	})
	}
	return w.End()
	}

	func handleGopherCollectionPost(app App, w gopher.ResponseWriter, r gopher.Request) error {
	var collAlias, slug string
	var c *Collection
	var err error

	parts := strings.Split(r.Selector, "/")
	if app.cfg.App.SingleUser {
	slug = parts[1]
	c, err = app.db.GetCollectionByID(1)
	if err != nil {
	return err
	}
	} else {
	collAlias = parts[1]
	slug = parts[2]
	c, err = app.db.GetCollection(collAlias)
	if err != nil {
	return err
	}
	}
	c.hostName = app.cfg.App.Host

	p, err := app.db.GetPost(slug, c.ID)
	if err != nil {
	return err
	}

	b := bytes.Buffer{}
	if p.Title.String != "" {
	b.WriteString(p.Title.String + "\n")
	}
	b.WriteString(p.DisplayDate + "\n\n")
	b.WriteString(p.Content)
	io.Copy(w, &b)

	return w.End()
	}
	diff --git a/handle.go b/handle.go
	index d746feb..e0600bb 100644
	--- a/handle.go
	+++ b/handle.go
	@@ -1,1007 +1,1013 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"fmt"
	"html/template"
	"net/http"
	"net/url"
	"runtime/debug"
	"strconv"
	"strings"
	"time"

	- "git.mills.io/prologic/go-gopher"
	"github.com/gorilla/sessions"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/log"
	+ "github.com/writefreely/go-gopher"
	"github.com/writefreely/writefreely/config"
	"github.com/writefreely/writefreely/page"
	)

	// UserLevel represents the required user level for accessing an endpoint
	type UserLevel int

	const (
	UserLevelNoneType UserLevel = iota // user or not -- ignored
	UserLevelOptionalType // user or not -- object fetched if user
	UserLevelNoneRequiredType // non-user (required)
	UserLevelUserType // user (required)
	)

	func UserLevelNone(cfg *config.Config) UserLevel {
	return UserLevelNoneType
	}

	func UserLevelOptional(cfg *config.Config) UserLevel {
	return UserLevelOptionalType
	}

	func UserLevelNoneRequired(cfg *config.Config) UserLevel {
	return UserLevelNoneRequiredType
	}

	func UserLevelUser(cfg *config.Config) UserLevel {
	return UserLevelUserType
	}

	// UserLevelReader returns the permission level required for any route where
	// users can read published content.
	func UserLevelReader(cfg *config.Config) UserLevel {
	if cfg.App.Private {
	return UserLevelUserType
	}
	return UserLevelOptionalType
	}

	type (
	handlerFunc func(app App, w http.ResponseWriter, r http.Request) error
	gopherFunc func(app App, w gopher.ResponseWriter, r gopher.Request) error
	userHandlerFunc func(app App, u User, w http.ResponseWriter, r *http.Request) error
	userApperHandlerFunc func(apper Apper, u User, w http.ResponseWriter, r http.Request) error
	dataHandlerFunc func(app App, w http.ResponseWriter, r http.Request) ([]byte, string, error)
	authFunc func(app App, r http.Request) (*User, error)
	UserLevelFunc func(cfg *config.Config) UserLevel
	)

	type Handler struct {
	errors *ErrorPages
	sessionStore sessions.Store
	app Apper
	}

	// ErrorPages hold template HTML error pages for displaying errors to the user.
	// In each, there should be a defined template named "base".
	type ErrorPages struct {
	NotFound *template.Template
	Gone *template.Template
	InternalServerError *template.Template
	UnavailableError *template.Template
	Blank *template.Template
	}

	// NewHandler returns a new Handler instance, using the given StaticPage data,
	// and saving alias to the application's CookieStore.
	func NewHandler(apper Apper) *Handler {
	h := &Handler{
	errors: &ErrorPages{
	NotFound: template.Must(template.New("").Parse("{{define \"base\"}}<html><head><title>404</title></head><body><p>Not found.</p></body></html>{{end}}")),
	Gone: template.Must(template.New("").Parse("{{define \"base\"}}<html><head><title>410</title></head><body><p>Gone.</p></body></html>{{end}}")),
	InternalServerError: template.Must(template.New("").Parse("{{define \"base\"}}<html><head><title>500</title></head><body><p>Internal server error.</p></body></html>{{end}}")),
	UnavailableError: template.Must(template.New("").Parse("{{define \"base\"}}<html><head><title>503</title></head><body><p>Service is temporarily unavailable.</p></body></html>{{end}}")),
	Blank: template.Must(template.New("").Parse("{{define \"base\"}}<html><head><title>{{.Title}}</title></head><body><p>{{.Content}}</p></body></html>{{end}}")),
	},
	sessionStore: apper.App().SessionStore(),
	app: apper,
	}

	return h
	}

	// NewWFHandler returns a new Handler instance, using WriteFreely template files.
	// You MUST call writefreely.InitTemplates() before this.
	func NewWFHandler(apper Apper) *Handler {
	h := NewHandler(apper)
	h.SetErrorPages(&ErrorPages{
	NotFound: pages["404-general.tmpl"],
	Gone: pages["410.tmpl"],
	InternalServerError: pages["500.tmpl"],
	UnavailableError: pages["503.tmpl"],
	Blank: pages["blank.tmpl"],
	})
	return h
	}

	// SetErrorPages sets the given set of ErrorPages as templates for any errors
	// that come up.
	func (h Handler) SetErrorPages(e ErrorPages) {
	h.errors = e
	}

	// User handles requests made in the web application by the authenticated user.
	// This provides user-friendly HTML pages and actions that work in the browser.
	func (h *Handler) User(f userHandlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleHTTPError(w, r, func() error {
	var status int
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s: %s", e, debug.Stack())
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = http.StatusInternalServerError
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	u := getUserSession(h.app.App(), r)
	if u == nil {
	err := ErrNotLoggedIn
	status = err.Status
	return err
	}

	err := f(h.app.App(), u, w, r)
	if err == nil {
	status = http.StatusOK
	- } else if err, ok := err.(impart.HTTPError); ok {
	- status = err.Status
	+ } else if impErr, ok := err.(impart.HTTPError); ok {
	+ status = impErr.Status
	+ if impErr == ErrUserNotFound {
	+ log.Info("Logged-in user not found. Logging out.")
	+ sendRedirect(w, http.StatusFound, "/me/logout?to="+h.app.App().cfg.App.LandingPath())
	+ // Reset err so handleHTTPError does nothing
	+ err = nil
	+ }
	} else {
	status = http.StatusInternalServerError
	}

	return err
	}())
	}
	}

	// Admin handles requests on /admin routes
	func (h *Handler) Admin(f userHandlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleHTTPError(w, r, func() error {
	var status int
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s: %s", e, debug.Stack())
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = http.StatusInternalServerError
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	u := getUserSession(h.app.App(), r)
	if u == nil \|\| !u.IsAdmin() {
	err := impart.HTTPError{http.StatusNotFound, ""}
	status = err.Status
	return err
	}

	err := f(h.app.App(), u, w, r)
	if err == nil {
	status = http.StatusOK
	} else if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = http.StatusInternalServerError
	}

	return err
	}())
	}
	}

	// AdminApper handles requests on /admin routes that require an Apper.
	func (h *Handler) AdminApper(f userApperHandlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleHTTPError(w, r, func() error {
	var status int
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s: %s", e, debug.Stack())
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = http.StatusInternalServerError
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	u := getUserSession(h.app.App(), r)
	if u == nil \|\| !u.IsAdmin() {
	err := impart.HTTPError{http.StatusNotFound, ""}
	status = err.Status
	return err
	}

	err := f(h.app, u, w, r)
	if err == nil {
	status = http.StatusOK
	} else if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = http.StatusInternalServerError
	}

	return err
	}())
	}
	}

	func apiAuth(app App, r http.Request) (*User, error) {
	// Authorize user from Authorization header
	t := r.Header.Get("Authorization")
	if t == "" {
	return nil, ErrNoAccessToken
	}
	u := &User{ID: app.db.GetUserID(t)}
	if u.ID == -1 {
	return nil, ErrBadAccessToken
	}

	return u, nil
	}

	// optionaAPIAuth is used for endpoints that accept authenticated requests via
	// Authorization header or cookie, unlike apiAuth. It returns a different err
	// in the case where no Authorization header is present.
	func optionalAPIAuth(app App, r http.Request) (*User, error) {
	// Authorize user from Authorization header
	t := r.Header.Get("Authorization")
	if t == "" {
	return nil, ErrNotLoggedIn
	}
	u := &User{ID: app.db.GetUserID(t)}
	if u.ID == -1 {
	return nil, ErrBadAccessToken
	}

	return u, nil
	}

	func webAuth(app App, r http.Request) (*User, error) {
	u := getUserSession(app, r)
	if u == nil {
	return nil, ErrNotLoggedIn
	}
	return u, nil
	}

	// UserAPI handles requests made in the API by the authenticated user.
	// This provides user-friendly HTML pages and actions that work in the browser.
	func (h *Handler) UserAPI(f userHandlerFunc) http.HandlerFunc {
	return h.UserAll(false, f, apiAuth)
	}

	// UserWebAPI handles endpoints that accept a user authorized either via the web (cookies) or an Authorization header.
	func (h *Handler) UserWebAPI(f userHandlerFunc) http.HandlerFunc {
	return h.UserAll(false, f, func(app App, r http.Request) (*User, error) {
	// Authorize user via cookies
	u := getUserSession(app, r)
	if u != nil {
	return u, nil
	}

	// Fall back to access token, since user isn't logged in via web
	var err error
	u, err = apiAuth(app, r)
	if err != nil {
	return nil, err
	}

	return u, nil
	})
	}

	func (h *Handler) UserAll(web bool, f userHandlerFunc, a authFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	handleFunc := func() error {
	var status int
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s: %s", e, debug.Stack())
	impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
	status = 500
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	u, err := a(h.app.App(), r)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}
	return err
	}

	err = f(h.app.App(), u, w, r)
	if err == nil {
	status = 200
	} else if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}

	return err
	}

	if web {
	h.handleHTTPError(w, r, handleFunc())
	} else {
	h.handleError(w, r, handleFunc())
	}
	}
	}

	func (h *Handler) RedirectOnErr(f handlerFunc, loc string) handlerFunc {
	return func(app App, w http.ResponseWriter, r http.Request) error {
	err := f(app, w, r)
	if err != nil {
	if ie, ok := err.(impart.HTTPError); ok {
	// Override default redirect with returned error's, if it's a
	// redirect error.
	if ie.Status == http.StatusFound {
	return ie
	}
	}
	return impart.HTTPError{http.StatusFound, loc}
	}
	return nil
	}
	}

	func (h *Handler) Page(n string) http.HandlerFunc {
	return h.Web(func(app App, w http.ResponseWriter, r http.Request) error {
	t, ok := pages[n]
	if !ok {
	return impart.HTTPError{http.StatusNotFound, "Page not found."}
	}

	sp := pageForReq(app, r)

	err := t.ExecuteTemplate(w, "base", sp)
	if err != nil {
	log.Error("Unable to render page: %v", err)
	}
	return err
	}, UserLevelOptional)
	}

	func (h *Handler) WebErrors(f handlerFunc, ul UserLevelFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	// TODO: factor out this logic shared with Web()
	h.handleHTTPError(w, r, func() error {
	var status int
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	u := getUserSession(h.app.App(), r)
	username := "None"
	if u != nil {
	username = u.Username
	}
	log.Error("User: %s\n\n%s: %s", username, e, debug.Stack())
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = 500
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	var session *sessions.Session
	var err error
	if ul(h.app.App().cfg) != UserLevelNoneType {
	session, err = h.sessionStore.Get(r, cookieName)
	if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType \|\| ul(h.app.App().cfg) == UserLevelUserType) {
	// Cookie is required, but we can ignore this error
	log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err)
	}

	_, gotUser := session.Values[cookieUserVal].(*User)
	if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser {
	to := correctPageFromLoginAttempt(r)
	log.Info("Handler: Required NO user, but got one. Redirecting to %s", to)
	err := impart.HTTPError{http.StatusFound, to}
	status = err.Status
	return err
	} else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser {
	log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.")
	err := ErrNotLoggedIn
	status = err.Status
	return err
	}
	}

	// TODO: pass User object to function
	err = f(h.app.App(), w, r)
	if err == nil {
	status = 200
	} else if httpErr, ok := err.(impart.HTTPError); ok {
	status = httpErr.Status
	if status < 300 \|\| status > 399 {
	addSessionFlash(h.app.App(), w, r, httpErr.Message, session)
	return impart.HTTPError{http.StatusFound, r.Referer()}
	}
	} else {
	e := fmt.Sprintf("[Web handler] 500: %v", err)
	if !strings.HasSuffix(e, "write: broken pipe") {
	log.Error(e)
	} else {
	log.Error(e)
	}
	log.Info("Web handler internal error render")
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = 500
	}

	return err
	}())
	}
	}

	func (h Handler) CollectionPostOrStatic(w http.ResponseWriter, r http.Request) {
	if strings.Contains(r.URL.Path, ".") && !isRaw(r) {
	start := time.Now()
	status := 200
	defer func() {
	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	// Serve static file
	h.app.App().shttp.ServeHTTP(w, r)
	return
	}

	h.Web(viewCollectionPost, UserLevelReader)(w, r)
	}

	// Web handles requests made in the web application. This provides user-
	// friendly HTML pages and actions that work in the browser.
	func (h *Handler) Web(f handlerFunc, ul UserLevelFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleHTTPError(w, r, func() error {
	var status int
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	u := getUserSession(h.app.App(), r)
	username := "None"
	if u != nil {
	username = u.Username
	}
	log.Error("User: %s\n\n%s: %s", username, e, debug.Stack())
	log.Info("Web deferred internal error render")
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = 500
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	if ul(h.app.App().cfg) != UserLevelNoneType {
	session, err := h.sessionStore.Get(r, cookieName)
	if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType \|\| ul(h.app.App().cfg) == UserLevelUserType) {
	// Cookie is required, but we can ignore this error
	log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err)
	}

	_, gotUser := session.Values[cookieUserVal].(*User)
	if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser {
	to := correctPageFromLoginAttempt(r)
	log.Info("Handler: Required NO user, but got one. Redirecting to %s", to)
	err := impart.HTTPError{http.StatusFound, to}
	status = err.Status
	return err
	} else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser {
	log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.")
	err := ErrNotLoggedIn
	status = err.Status
	return err
	}
	}

	// TODO: pass User object to function
	err := f(h.app.App(), w, r)
	if err == nil {
	status = 200
	} else if httpErr, ok := err.(impart.HTTPError); ok {
	status = httpErr.Status
	} else {
	e := fmt.Sprintf("[Web handler] 500: %v", err)
	log.Error(e)
	log.Info("Web internal error render")
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = 500
	}

	return err
	}())
	}
	}

	func (h *Handler) All(f handlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleError(w, r, func() error {
	// TODO: return correct "success" status
	status := 200
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s:\n%s", e, debug.Stack())
	impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
	status = 500
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	// TODO: do any needed authentication

	err := f(h.app.App(), w, r)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}
	}

	return err
	}())
	}
	}

	func (h *Handler) PlainTextAPI(f handlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleTextError(w, r, func() error {
	// TODO: return correct "success" status
	status := 200
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s:\n%s", e, debug.Stack())
	status = http.StatusInternalServerError
	w.WriteHeader(status)
	fmt.Fprintf(w, "Something didn't work quite right. The robots have alerted the humans.")
	}

	log.Info(fmt.Sprintf("\"%s %s\" %d %s \"%s\" \"%s\"", r.Method, r.RequestURI, status, time.Since(start), r.UserAgent(), r.Host))
	}()

	err := f(h.app.App(), w, r)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = http.StatusInternalServerError
	}
	}

	return err
	}())
	}
	}

	func (h *Handler) OAuth(f handlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleOAuthError(w, r, func() error {
	// TODO: return correct "success" status
	status := 200
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s:\n%s", e, debug.Stack())
	impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
	status = 500
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	err := f(h.app.App(), w, r)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}
	}

	return err
	}())
	}
	}

	func (h *Handler) AllReader(f handlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleError(w, r, func() error {
	status := 200
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("%s:\n%s", e, debug.Stack())
	impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "Something didn't work quite right."})
	status = 500
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	// Allow any origin, as public endpoints are handled in here
	w.Header().Set("Access-Control-Allow-Origin", "*")

	if h.app.App().cfg.App.Private {
	// This instance is private, so ensure it's being accessed by a valid user
	// Check if authenticated with an access token
	_, apiErr := optionalAPIAuth(h.app.App(), r)
	if apiErr != nil {
	if err, ok := apiErr.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}

	if apiErr == ErrNotLoggedIn {
	// Fall back to web auth since there was no access token given
	_, err := webAuth(h.app.App(), r)
	if err != nil {
	if err, ok := apiErr.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}
	return err
	}
	} else {
	return apiErr
	}
	}
	}

	err := f(h.app.App(), w, r)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}
	}

	return err
	}())
	}
	}

	func (h *Handler) Download(f dataHandlerFunc, ul UserLevelFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleHTTPError(w, r, func() error {
	var status int
	start := time.Now()
	defer func() {
	if e := recover(); e != nil {
	log.Error("%s: %s", e, debug.Stack())
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = 500
	}

	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	data, filename, err := f(h.app.App(), w, r)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}
	return err
	}

	ext := ".json"
	ct := "application/json"
	if strings.HasSuffix(r.URL.Path, ".csv") {
	ext = ".csv"
	ct = "text/csv"
	} else if strings.HasSuffix(r.URL.Path, ".zip") {
	ext = ".zip"
	ct = "application/zip"
	}
	w.Header().Set("Content-Disposition", fmt.Sprintf("attachment; filename=%s%s", filename, ext))
	w.Header().Set("Content-Type", ct)
	w.Header().Set("Content-Length", strconv.Itoa(len(data)))
	fmt.Fprint(w, string(data))

	status = 200
	return nil
	}())
	}
	}

	func (h *Handler) Redirect(url string, ul UserLevelFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleHTTPError(w, r, func() error {
	start := time.Now()

	var status int
	if ul(h.app.App().cfg) != UserLevelNoneType {
	session, err := h.sessionStore.Get(r, cookieName)
	if err != nil && (ul(h.app.App().cfg) == UserLevelNoneRequiredType \|\| ul(h.app.App().cfg) == UserLevelUserType) {
	// Cookie is required, but we can ignore this error
	log.Error("Handler: Unable to get session (for user permission %d); ignoring: %v", ul(h.app.App().cfg), err)
	}

	_, gotUser := session.Values[cookieUserVal].(*User)
	if ul(h.app.App().cfg) == UserLevelNoneRequiredType && gotUser {
	to := correctPageFromLoginAttempt(r)
	log.Info("Handler: Required NO user, but got one. Redirecting to %s", to)
	err := impart.HTTPError{http.StatusFound, to}
	status = err.Status
	return err
	} else if ul(h.app.App().cfg) == UserLevelUserType && !gotUser {
	log.Info("Handler: Required a user, but DIDN'T get one. Sending not logged in.")
	err := ErrNotLoggedIn
	status = err.Status
	return err
	}
	}

	status = sendRedirect(w, http.StatusFound, url)

	log.Info(h.app.ReqLog(r, status, time.Since(start)))

	return nil
	}())
	}
	}

	func (h Handler) handleHTTPError(w http.ResponseWriter, r http.Request, err error) {
	if err == nil {
	return
	}

	if err, ok := err.(impart.HTTPError); ok {
	if err.Status >= 300 && err.Status < 400 {
	sendRedirect(w, err.Status, err.Message)
	return
	} else if err.Status == http.StatusUnauthorized {
	q := ""
	if r.URL.RawQuery != "" {
	q = url.QueryEscape("?" + r.URL.RawQuery)
	}
	sendRedirect(w, http.StatusFound, "/login?to="+r.URL.Path+q)
	return
	} else if err.Status == http.StatusGone {
	w.WriteHeader(err.Status)
	p := &struct {
	page.StaticPage
	Content *template.HTML
	}{
	StaticPage: pageForReq(h.app.App(), r),
	}
	if err.Message != "" {
	co := template.HTML(err.Message)
	p.Content = &co
	}
	h.errors.Gone.ExecuteTemplate(w, "base", p)
	return
	} else if err.Status == http.StatusNotFound {
	w.WriteHeader(err.Status)
	if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
	// This is a fediverse request; simply return the header
	return
	}
	h.errors.NotFound.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	return
	} else if err.Status == http.StatusInternalServerError {
	w.WriteHeader(err.Status)
	log.Info("handleHTTPErorr internal error render")
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	return
	} else if err.Status == http.StatusServiceUnavailable {
	w.WriteHeader(err.Status)
	h.errors.UnavailableError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	return
	} else if err.Status == http.StatusAccepted {
	impart.WriteSuccess(w, "", err.Status)
	return
	} else {
	p := &struct {
	page.StaticPage
	Title string
	Content template.HTML
	}{
	pageForReq(h.app.App(), r),
	fmt.Sprintf("Uh oh (%d)", err.Status),
	template.HTML(fmt.Sprintf("<p style=\"text-align: center\" class=\"introduction\">%s</p>", err.Message)),
	}
	h.errors.Blank.ExecuteTemplate(w, "base", p)
	return
	}
	impart.WriteError(w, err)
	return
	}

	impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."})
	}

	func (h Handler) handleError(w http.ResponseWriter, r http.Request, err error) {
	if err == nil {
	return
	}

	if err, ok := err.(impart.HTTPError); ok {
	if err.Status >= 300 && err.Status < 400 {
	sendRedirect(w, err.Status, err.Message)
	return
	}

	// if strings.Contains(r.Header.Get("Accept"), "text/html") {
	impart.WriteError(w, err)
	// }
	return
	}

	if IsJSON(r) {
	impart.WriteError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."})
	return
	}
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	}

	func (h Handler) handleTextError(w http.ResponseWriter, r http.Request, err error) {
	if err == nil {
	return
	}

	if err, ok := err.(impart.HTTPError); ok {
	if err.Status >= 300 && err.Status < 400 {
	sendRedirect(w, err.Status, err.Message)
	return
	}

	w.WriteHeader(err.Status)
	fmt.Fprintf(w, http.StatusText(err.Status))
	return
	}

	w.WriteHeader(http.StatusInternalServerError)
	fmt.Fprintf(w, "This is an unhelpful error message for a miscellaneous internal error.")
	}

	func (h Handler) handleOAuthError(w http.ResponseWriter, r http.Request, err error) {
	if err == nil {
	return
	}

	if err, ok := err.(impart.HTTPError); ok {
	if err.Status >= 300 && err.Status < 400 {
	sendRedirect(w, err.Status, err.Message)
	return
	}

	impart.WriteOAuthError(w, err)
	return
	}

	impart.WriteOAuthError(w, impart.HTTPError{http.StatusInternalServerError, "This is an unhelpful error message for a miscellaneous internal error."})
	return
	}

	func correctPageFromLoginAttempt(r *http.Request) string {
	to := r.FormValue("to")
	if to == "" {
	to = "/"
	} else if !strings.HasPrefix(to, "/") {
	to = "/" + to
	}
	return to
	}

	func (h *Handler) LogHandlerFunc(f http.HandlerFunc) http.HandlerFunc {
	return func(w http.ResponseWriter, r *http.Request) {
	h.handleHTTPError(w, r, func() error {
	status := 200
	start := time.Now()

	defer func() {
	if e := recover(); e != nil {
	log.Error("Handler.LogHandlerFunc\n\n%s: %s", e, debug.Stack())
	h.errors.InternalServerError.ExecuteTemplate(w, "base", pageForReq(h.app.App(), r))
	status = 500
	}

	// TODO: log actual status code returned
	log.Info(h.app.ReqLog(r, status, time.Since(start)))
	}()

	if h.app.App().cfg.App.Private {
	// This instance is private, so ensure it's being accessed by a valid user
	// Check if authenticated with an access token
	_, apiErr := optionalAPIAuth(h.app.App(), r)
	if apiErr != nil {
	if err, ok := apiErr.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}

	if apiErr == ErrNotLoggedIn {
	// Fall back to web auth since there was no access token given
	_, err := webAuth(h.app.App(), r)
	if err != nil {
	if err, ok := apiErr.(impart.HTTPError); ok {
	status = err.Status
	} else {
	status = 500
	}
	return err
	}
	} else {
	return apiErr
	}
	}
	}

	f(w, r)

	return nil
	}())
	}
	}

	func (h *Handler) Gopher(f gopherFunc) gopher.HandlerFunc {
	return func(w gopher.ResponseWriter, r *gopher.Request) {
	defer func() {
	if e := recover(); e != nil {
	log.Error("%s: %s", e, debug.Stack())
	w.WriteError("An internal error occurred")
	}
	log.Info("gopher: %s", r.Selector)
	}()

	err := f(h.app.App(), w, r)
	if err != nil {
	log.Error("failed: %s", err)
	w.WriteError("the page failed for some reason (see logs)")
	}
	}
	}

	func sendRedirect(w http.ResponseWriter, code int, location string) int {
	w.Header().Set("Location", location)
	w.WriteHeader(code)
	return code
	}

	func cacheControl(next http.Handler) http.Handler {
	return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
	w.Header().Set("Cache-Control", "public, max-age=604800, immutable")
	next.ServeHTTP(w, r)
	})
	}
	diff --git a/hostmeta.go b/hostmeta.go
	index 4f452c3..9152bec 100644
	--- a/hostmeta.go
	+++ b/hostmeta.go
	@@ -1,29 +1,29 @@
	/*
	- * Copyright © 2018-2019 A Bunch Tell LLC.
	+ * Copyright © 2018-2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"fmt"
	"net/http"
	)

	func handleViewHostMeta(app App, w http.ResponseWriter, r http.Request) error {
	w.Header().Set("Server", serverSoftware)
	w.Header().Set("Content-Type", "application/xrd+xml; charset=utf-8")

	meta := `<?xml version="1.0" encoding="UTF-8"?>
	<XRD xmlns="http://docs.oasis-open.org/ns/xri/xrd-1.0">
	<Link rel="lrdd" type="application/xrd+xml" template="https://` + r.Host + `/.well-known/webfinger?resource={uri}"/>
	</XRD>`
	fmt.Fprintf(w, meta)

	return nil
	}
	diff --git a/instance.go b/instance.go
	index 6805a6e..bc6e063 100644
	--- a/instance.go
	+++ b/instance.go
	@@ -1,16 +1,16 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	type InstanceStats struct {
	NumPosts int64
	NumBlogs int64
	}
	diff --git a/invites.go b/invites.go
	index 4024634..72f4890 100644
	--- a/invites.go
	+++ b/invites.go
	@@ -1,203 +1,206 @@
	/*
	- * Copyright © 2019-2021 A Bunch Tell LLC.
	+ * Copyright © 2019-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"html/template"
	"net/http"
	"strconv"
	"time"

	"github.com/gorilla/mux"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/id"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/page"
	)

	type Invite struct {
	ID string
	MaxUses sql.NullInt64
	Created time.Time
	Expires *time.Time
	Inactive bool

	uses int64
	}

	func (i Invite) Uses() int64 {
	return i.uses
	}

	func (i Invite) Expired() bool {
	return i.Expires != nil && i.Expires.Before(time.Now())
	}

	func (i Invite) Active(db *datastore) bool {
	if i.Expired() {
	return false
	}
	if i.MaxUses.Valid && i.MaxUses.Int64 > 0 {
	if c := db.GetUsersInvitedCount(i.ID); c >= i.MaxUses.Int64 {
	return false
	}
	}
	return true
	}

	func (i Invite) ExpiresFriendly() string {
	return i.Expires.Format("January 2, 2006, 3:04 PM")
	}

	func handleViewUserInvites(app App, u User, w http.ResponseWriter, r *http.Request) error {
	// Don't show page if instance doesn't allow it
	if !(app.cfg.App.UserInvites != "" && (u.IsAdmin() \|\| app.cfg.App.UserInvites != "admin")) {
	return impart.HTTPError{http.StatusNotFound, ""}
	}

	f, _ := getSessionFlashes(app, w, r, nil)

	p := struct {
	*UserPage
	Invites *[]Invite
	Silenced bool
	}{
	UserPage: NewUserPage(app, r, u, "Invite People", f),
	}

	var err error

	p.Silenced, err = app.db.IsUserSilenced(u.ID)
	if err != nil {
	+ if err == ErrUserNotFound {
	+ return err
	+ }
	log.Error("view invites: %v", err)
	}

	p.Invites, err = app.db.GetUserInvites(u.ID)
	if err != nil {
	return err
	}
	for i := range *p.Invites {
	(p.Invites)[i].uses = app.db.GetUsersInvitedCount((p.Invites)[i].ID)
	}

	showUserPage(w, "invite", p)
	return nil
	}

	func handleCreateUserInvite(app App, u User, w http.ResponseWriter, r *http.Request) error {
	muVal := r.FormValue("uses")
	expVal := r.FormValue("expires")

	if u.IsSilenced() {
	return ErrUserSilenced
	}

	var err error
	var maxUses int
	if muVal != "0" {
	maxUses, err = strconv.Atoi(muVal)
	if err != nil {
	return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'max_uses'"}
	}
	}

	var expDate *time.Time
	var expires int
	if expVal != "0" {
	expires, err = strconv.Atoi(expVal)
	if err != nil {
	return impart.HTTPError{http.StatusBadRequest, "Invalid value for 'expires'"}
	}
	ed := time.Now().Add(time.Duration(expires) * time.Minute)
	expDate = &ed
	}

	inviteID := id.GenerateRandomString("0123456789BCDFGHJKLMNPQRSTVWXYZbcdfghjklmnpqrstvwxyz", 6)
	err = app.db.CreateUserInvite(inviteID, u.ID, maxUses, expDate)
	if err != nil {
	return err
	}

	return impart.HTTPError{http.StatusFound, "/me/invites"}
	}

	func handleViewInvite(app App, w http.ResponseWriter, r http.Request) error {
	inviteCode := mux.Vars(r)["code"]

	i, err := app.db.GetUserInvite(inviteCode)
	if err != nil {
	return err
	}

	expired := i.Expired()
	if !expired && i.MaxUses.Valid && i.MaxUses.Int64 > 0 {
	// Invite has a max-use number, so check if we're past that limit
	i.uses = app.db.GetUsersInvitedCount(inviteCode)
	expired = i.uses >= i.MaxUses.Int64
	}

	if u := getUserSession(app, r); u != nil {
	// check if invite belongs to another user
	// error can be ignored as not important in this case
	if ownInvite, _ := app.db.IsUsersInvite(inviteCode, u.ID); !ownInvite {
	addSessionFlash(app, w, r, "You're already registered and logged in.", nil)
	// show homepage
	return impart.HTTPError{http.StatusFound, "/me/settings"}
	}

	// show invite instructions
	p := struct {
	*UserPage
	Invite *Invite
	Expired bool
	}{
	UserPage: NewUserPage(app, r, u, "Invite to "+app.cfg.App.SiteName, nil),
	Invite: i,
	Expired: expired,
	}
	showUserPage(w, "invite-help", p)
	return nil
	}

	p := struct {
	page.StaticPage
	*OAuthButtons
	Error string
	Flashes []template.HTML
	Invite string
	}{
	StaticPage: pageForReq(app, r),
	OAuthButtons: NewOAuthButtons(app.cfg),
	Invite: inviteCode,
	}

	if expired {
	p.Error = "This invite link has expired."
	}

	// Tell search engines not to index invite links
	w.Header().Set("X-Robots-Tag", "noindex")

	// Get error messages
	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	// Ignore this
	log.Error("Unable to get session in handleViewInvite; ignoring: %v", err)
	}
	flashes, _ := getSessionFlashes(app, w, r, session)
	for _, flash := range flashes {
	p.Flashes = append(p.Flashes, template.HTML(flash))
	}

	// Show landing page
	return renderPage(w, "signup.tmpl", p)
	}
	diff --git a/key/key.go b/key/key.go
	index 25490ca..1fa5625 100644
	--- a/key/key.go
	+++ b/key/key.go
	@@ -1,69 +1,69 @@
	/*
	- * Copyright © 2019, 2021 A Bunch Tell LLC.
	+ * Copyright © 2019, 2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	// Package key holds application keys and utilities around generating them.
	package key

	import (
	"crypto/rand"
	)

	const (
	EncKeysBytes = 32
	)

	type Keychain struct {
	EmailKey, CookieAuthKey, CookieKey, CSRFKey []byte
	}

	// GenerateKeys generates necessary keys for the app on the given Keychain,
	// skipping any that already exist.
	func (keys *Keychain) GenerateKeys() error {
	// Generate keys only if they don't already exist
	// TODO: use something like https://github.com/hashicorp/go-multierror to return errors
	var err, keyErrs error
	if len(keys.EmailKey) == 0 {
	keys.EmailKey, err = GenerateBytes(EncKeysBytes)
	if err != nil {
	keyErrs = err
	}
	}
	if len(keys.CookieAuthKey) == 0 {
	keys.CookieAuthKey, err = GenerateBytes(EncKeysBytes)
	if err != nil {
	keyErrs = err
	}
	}
	if len(keys.CookieKey) == 0 {
	keys.CookieKey, err = GenerateBytes(EncKeysBytes)
	if err != nil {
	keyErrs = err
	}
	}
	if len(keys.CSRFKey) == 0 {
	keys.CSRFKey, err = GenerateBytes(EncKeysBytes)
	if err != nil {
	keyErrs = err
	}
	}

	return keyErrs
	}

	// GenerateBytes returns securely generated random bytes.
	func GenerateBytes(n int) ([]byte, error) {
	b := make([]byte, n)
	_, err := rand.Read(b)
	if err != nil {
	return nil, err
	}

	return b, nil
	}
	diff --git a/keys.go b/keys.go
	index 1b43d0b..98ff13f 100644
	--- a/keys.go
	+++ b/keys.go
	@@ -1,75 +1,75 @@
	/*
	- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/key"
	"io/ioutil"
	"os"
	"path/filepath"
	)

	const (
	keysDir = "keys"
	)

	var (
	emailKeyPath = filepath.Join(keysDir, "email.aes256")
	cookieAuthKeyPath = filepath.Join(keysDir, "cookies_auth.aes256")
	cookieKeyPath = filepath.Join(keysDir, "cookies_enc.aes256")
	csrfKeyPath = filepath.Join(keysDir, "csrf.aes256")
	)

	// InitKeys loads encryption keys into memory via the given Apper interface
	func InitKeys(apper Apper) error {
	log.Info("Loading encryption keys...")
	err := apper.LoadKeys()
	if err != nil {
	return err
	}
	return nil
	}

	func initKeyPaths(app *App) {
	emailKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, emailKeyPath)
	cookieAuthKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, cookieAuthKeyPath)
	cookieKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, cookieKeyPath)
	csrfKeyPath = filepath.Join(app.cfg.Server.KeysParentDir, csrfKeyPath)
	}

	// generateKey generates a key at the given path used for the encryption of
	// certain user data. Because user data becomes unrecoverable without these
	// keys, this won't overwrite any existing key, and instead outputs a message.
	func generateKey(path string) error {
	// Check if key file exists
	if _, err := os.Stat(path); err == nil {
	log.Info("%s already exists. rm the file if you understand the consquences.", path)
	return nil
	} else if !os.IsNotExist(err) {
	log.Error("%s", err)
	return err
	}

	log.Info("Generating %s.", path)
	b, err := key.GenerateBytes(key.EncKeysBytes)
	if err != nil {
	log.Error("FAILED. %s. Run writefreely --gen-keys again.", err)
	return err
	}
	err = ioutil.WriteFile(path, b, 0600)
	if err != nil {
	log.Error("FAILED writing file: %s", err)
	return err
	}
	log.Info("Success.")
	return nil
	}
	diff --git a/less/core.less b/less/core.less
	index 30ecaf1..1b418ba 100644
	--- a/less/core.less
	+++ b/less/core.less
	@@ -1,1636 +1,1637 @@
	body {
	font-family: @serifFont;
	font-size-adjust: 0.5;
	-webkit-font-smoothing: antialiased;
	-moz-osx-font-smoothing: grayscale;
	background-color: white;
	color: #111;

	h1, header h2 {
	a {
	color: @headerTextColor;
	.transition-duration(0.2s);
	&:hover {
	color: #303030;
	text-decoration: none;
	}
	}
	}
	h1, h2, h3 {
	line-height: 1.2;
	}

	&#post article, &#collection article p, &#subpage article p {
	display: block;
	unicode-bidi: embed;
	white-space: pre;
	}

	&#post {
	#wrapper, pre {
	max-width: 40em;
	margin: 0 auto;
	a:hover {
	text-decoration: underline;
	}
	}

	blockquote {
	p + p {
	margin: -2em 0 0.5em;
	}
	}
	article {
	margin-bottom: 2em !important;

	h1, h2, h3, h4, h5, h6, p, ul, ol, code {
	display: inline;
	margin: 0;
	}
	hr + p, ol, ul {
	display: block;
	margin-top: -1rem;
	margin-bottom: -1rem;
	}
	ol, ul {
	margin: 2rem 0 -1rem;
	ol, ul {
	margin: 1.25rem 0 -0.5rem;
	}
	}
	li {
	margin-top: -0.5rem;
	margin-bottom: -0.5rem;
	}
	h2#title {
	.article-title;
	}
	h1 {
	font-size: 1.5em;
	}
	h2 {
	font-size: 1.4em;
	}
	}

	header {
	nav {
	span, a {
	&.pinned {
	&.selected {
	font-weight: bold;
	}
	&+.views {
	margin-left: 2em;
	}
	}
	}
	}
	}
	.owner-visible {
	display: none;
	}
	}

	&#post, &#collection, &#subpage {
	code {
	.article-code;
	}
	img, video, audio {
	max-width: 100%;
	}
	audio {
	width: 100%;
	white-space: initial;
	}
	pre {
	.code-block;

	code {
	background: transparent;
	border: 0;
	padding: 0;
	font-size: 1em;
	white-space: pre-wrap; /* CSS 3 */
	white-space: -moz-pre-wrap; /* Mozilla, since 1999 */
	white-space: -pre-wrap; /* Opera 4-6 */
	white-space: -o-pre-wrap; /* Opera 7 */
	word-wrap: break-word; /* Internet Explorer 5.5+ */
	}
	}
	blockquote {
	.article-blockquote;
	}
	article {
	hr {
	margin-top: 0;
	margin-bottom: 0;
	}
	p.badge {
	background-color: #aaa;
	display: inline-block;
	padding: 0.25em 0.5em;
	margin: 0;
	float: right;
	color: white;
	.rounded(.25em);
	}
	}
	header {
	nav {
	span, a {
	&.pinned {
	&+.pinned {
	margin-left: 1.5em;
	}
	}
	}
	}
	}
	footer {
	nav {
	a {
	margin-top: 0;
	}
	}
	}
	}
	&#collection {
	#welcome, .access {
	margin: 0 auto;
	max-width: 35em;
	h2 {
	font-weight: normal;
	margin-bottom: 1em;
	}
	p {
	font-size: 1.2em;
	line-height: 1.6;
	}
	}
	.access {
	margin: 8em auto;
	text-align: center;
	h2, ul.errors {
	font-size: 1.2em;
	margin-bottom: 1.5em !important;
	}
	}
	header {
	padding: 0 1em;
	text-align: center;
	max-width: 50em;
	margin: 3em auto 4em;

	.writeas-prefix {
	a {
	color: #aaa;
	}
	display: block;
	margin-bottom: 0.5em;
	}
	nav {
	display: block;
	margin: 1em 0;
	a:first-child {
	margin: 0;
	}
	}
	}
	nav#manage {
	position: absolute;
	top: 1em;
	left: 1.5em;
	li a.write {
	font-family: @serifFont;
	padding-top: 0.2em;
	padding-bottom: 0.2em;
	}
	}
	pre {
	line-height: 1.5;
	}
	.flash {
	text-align: center;
	margin-bottom: 4em;
	}
	}
	&#subpage {
	#wrapper {
	h1 {
	font-size: 2.5em;
	letter-spacing: -2px;
	padding: 0 2rem 2rem;
	}
	}
	}
	&#post {
	pre {
	font-size: 0.75em;
	}
	}

	&#collection, &#subpage {
	#wrapper {
	margin-left: auto;
	margin-right: auto;

	article {
	margin-bottom: 4em;

	&:hover {
	.hidden {
	.opacity(1);
	}
	}
	}
	h2 {
	margin-top: 0em;
	margin-bottom: 0.25em;
	&+time {
	display: block;
	margin-top: 0.25em;
	margin-bottom: 0.25em;
	}
	}
	time {
	font-size: 1.1em;

	&+p {
	margin-top: 0.25em;
	}
	}
	footer {
	text-align: left;
	padding: 0;
	}
	}
	#paging {
	overflow: visible;
	padding: 1em 6em 0;
	}
	a.read-more {
	color: #666;
	}
	}

	&#me #official-writing {
	h2 {
	font-weight: normal;
	a {
	font-size: 0.6em;
	margin-left: 1em;
	}
	a[name] {
	margin-left: 0;
	}
	a:link, a:visited {
	color: @textLinkColor;
	}
	a:hover {
	text-decoration: underline;
	}
	}
	}
	&#promo {
	div.heading {
	margin: 8em 0;
	}
	div.heading, div.attention-form {
	h1 {
	font-size: 3.5em;
	}
	input {
	padding-left: 0.75em;
	padding-right: 0.75em;
	&[type=email] {
	max-width: 16em;
	}
	&[type=submit] {
	padding-left: 1.5em;
	padding-right: 1.5em;
	}
	}
	}
	h2 {
	margin-bottom: 0;
	font-size: 1.8em;
	font-weight: normal;
	span.write-as {
	color: black;
	}
	&.soon {
	color: lighten(@subheaders, 50%);
	span {
	&.write-as {
	color: lighten(#000, 50%);
	}
	&.note {
	color: lighten(#333, 50%);
	font-variant: small-caps;
	margin-left: 0.5em;
	}
	}
	}
	}
	.half-col a {
	margin-left: 1em;
	margin-right: 1em;
	}
	}
	nav#top-nav {
	display: inline;
	position: absolute;
	top: 1.5em;
	right: 1.5em;
	font-size: 0.95rem;
	font-family: @sansFont;
	text-transform: uppercase;
	a {
	color: #777;
	}
	a + a {
	margin-left: 1em;
	}
	}

	footer {
	nav, ul {
	a {
	display: inline-block;
	margin-top: 0.8em;
	.transition-duration(0.1s);
	text-decoration: none;
	+ a {
	margin-left: 0.8em;
	}
	&:link, &:visited {
	color: #999;
	}
	&:hover {
	color: #666;
	text-decoration: none;
	}
	}
	}
	a.home {
	&:link, &:visited {
	color: #333;
	}
	font-weight: bold;
	text-decoration: none;
	&:hover {
	color: #000;
	}
	}
	ul {
	list-style: none;
	text-align: left;
	padding-left: 0 !important;
	margin-left: 0 !important;
	.icons img {
	height: 16px;
	width: 16px;
	fill: #999;
	}
	}
	}
	}

	img {
	&.paid {
	height: 0.86em;
	vertical-align: middle;
	margin-bottom: 0.1em;
	}
	}

	nav#full-nav {
	margin: 0;

	.left-side {
	display: inline-block;

	a:first-child {
	margin-left: 0;
	}
	}

	.right-side {
	float: right;
	}
	}

	nav#full-nav a.simple-btn, .tool button {
	font-family: @sansFont;
	border: 1px solid #ccc !important;
	padding: .5rem 1rem;
	margin: 0;
	.rounded(.25em);
	text-decoration: none;
	}

	.post-title {
	a {
	&:link {
	color: #333;
	}
	&:visited {
	color: #444;
	}
	}
	time, time a:link, time a:visited, &+.time {
	color: #999;
	}
	}

	.hidden {
	-moz-transition-property: opacity;
	-webkit-transition-property: opacity;
	-o-transition-property: opacity;
	transition-property: opacity;
	.transition-duration(0.4s);
	.opacity(0);
	}

	a {
	text-decoration: none;
	&:hover {
	text-decoration: underline;
	}
	&.subdued {
	color: #999;
	&:hover {
	border-bottom: 1px solid #999;
	text-decoration: none;
	}
	}
	&.danger {
	color: @dangerCol;
	font-size: 0.86em;
	}
	&.simple-cta {
	text-decoration: none;
	border-bottom: 1px solid #ccc;
	color: #333;
	padding-bottom: 2px;
	&:hover {
	text-decoration: none;
	}
	}
	&.action-btn {
	font-family: @sansFont;
	text-transform: uppercase;
	.rounded(.25em);
	background-color: red;
	color: white;
	font-weight: bold;
	padding: 0.5em 0.75em;
	&:hover {
	background-color: lighten(#f00, 5%);
	text-decoration: none;
	}
	}
	&.hashtag:hover {
	text-decoration: none;
	span + span {
	text-decoration: underline;
	}
	}
	&.hashtag {
	span:first-child {
	color: #999;
	margin-right: 0.1em;
	font-size: 0.86em;
	text-decoration: none;
	}
	}
	}

	abbr {
	border-bottom: 1px dotted #999;
	text-decoration: none;
	cursor: help;
	}

	body#collection article p, body#subpage article p {
	.article-p;
	}
	pre, body#post article, #post .alert, #subpage .alert, body#collection article, body#subpage article, body#subpage #wrapper h1 {
	max-width: 40rem;
	margin: 0 auto;
	}
	#collection header .alert, #post .alert, #subpage .alert {
	margin-bottom: 1em;
	p {
	text-align: left;
	line-height: 1.5;
	}
	}
	textarea, input#title, pre, body#post article, body#collection article p {
	&.norm, &.sans, &.wrap {
	line-height: 1.5;
	white-space: pre-wrap; /* CSS 3 */
	white-space: -moz-pre-wrap; /* Mozilla, since 1999 */
	white-space: -pre-wrap; /* Opera 4-6 */
	white-space: -o-pre-wrap; /* Opera 7 */
	word-wrap: break-word; /* Internet Explorer 5.5+ */
	}
	}
	textarea, input#title, pre, body#post article, body#collection article, body#subpage article, span, .font {
	&.norm {
	font-family: @serifFont;
	}
	&.sans {
	font-family: @sansFont;
	}
	&.mono, &.wrap, &.code {
	font-family: @monoFont;
	}
	&.mono, &.code {
	max-width: none !important;
	}
	}
	textarea {
	&.section {
	border: 1px solid #ccc;
	padding: 0.65em 0.75em;
	.rounded(.25em);
	&.codable {
	height: 12em;
	resize: vertical;
	}
	}
	}
	.ace_editor {
	height: 12em;
	border: 1px solid #333;
	max-width: initial;
	width: 100%;
	font-size: 0.86em !important;
	border: 1px solid #ccc;
	padding: 0.65em 0.75em;
	margin: 0;
	.rounded(.25em);
	}

	p {
	-webkit-font-smoothing: antialiased;
	-moz-osx-font-smoothing: grayscale;
	&.intro {
	font-size: 1.25em;
	text-align: center;
	}
	&.upgrade-prompt {
	font-size: 0.9em;
	color: #444;
	}
	&.text-cta {
	font-size: 1.2em;
	text-align: center;
	margin-bottom: 0.5em;
	&+ p {
	text-align: center;
	font-size: 0.7em;
	margin-top: 0;
	color: #666;
	}
	}
	&.error {
	font-style: italic;
	color: @errUrgentCol;
	}
	&.headeresque {
	font-size: 2em;
	}
	}

	table.classy {
	width: 95%;
	border-collapse: collapse;
	margin-bottom: 2em;

	tr + tr {
	border-top: 1px solid #ccc;
	}
	th {
	text-transform: uppercase;
	font-weight: normal;
	font-size: 95%;
	font-family: @sansFont;
	padding: 1rem 0.75rem;
	text-align: center;
	}
	td {
	height: 3.5rem;
	}
	p {
	margin-top: 0 !important;
	margin-bottom: 0 !important;
	}

	&.export {
	.disabled {
	color: #999;
	}
	.disabled, a {
	text-transform: lowercase;
	}
	}
	}

	article table {
	border-spacing: 0;
	border-collapse: collapse;
	width: 100%;
	th {
	border-width: 1px 1px 2px 1px;
	border-style: solid;
	border-color: #ccc;
	}
	td {
	border-width: 0 1px 1px 1px;
	border-style: solid;
	border-color: #ccc;
	padding: .25rem .5rem;
	}
	}

	body#collection article, body#subpage article {
	padding-top: 0;
	padding-bottom: 0;
	.book {
	h2 {
	font-size: 1.4em;
	}
	a.hidden.action {
	color: #666;
	float: right;
	font-size: 1em;
	margin-left: 1em;
	margin-bottom: 1em;
	}
	}
	}
	body#post article {
	p.badge {
	font-size: 0.9em;
	}
	}

	article {
	h2.post-title a[rel=nofollow]::after {
	content: '\a0 \2934';
	}
	}


	table.downloads {
	width: 100%;
	td {
	text-align: center;
	}
	img.os {
	width: 48px;
	vertical-align: middle;
	margin-bottom: 6px;
	}
	}

	select.inputform, textarea.inputform {
	border: 1px solid #999;
	+ background: white;
	}

	input, button, select.inputform, textarea.inputform, a.btn {
	padding: 0.5em;
	font-family: @serifFont;
	font-size: 100%;
	.rounded(.25em);
	&[type=submit], &.submit, &.cta {
	border: 1px solid @primary;
	background: @primary;
	color: white;
	.transition(0.2s);
	&:hover {
	background-color: lighten(@primary, 3%);
	text-decoration: none;
	}
	&:disabled {
	cursor: default;
	background-color: desaturate(@primary, 100%) !important;
	border-color: desaturate(@primary, 100%) !important;
	}
	}
	&.error[type=text], textarea.error {
	-webkit-transition: all 0.30s ease-in-out;
	-moz-transition: all 0.30s ease-in-out;
	-ms-transition: all 0.30s ease-in-out;
	-o-transition: all 0.30s ease-in-out;
	outline: none;
	}
	&.danger {
	border: 1px solid @dangerCol;
	background: @dangerCol;
	color: white;
	&:hover {
	background-color: lighten(@dangerCol, 3%);
	}
	}

	&.error[type=text]:focus, textarea.error:focus {
	box-shadow: 0 0 5px @errUrgentCol;
	border: 1px solid @errUrgentCol;
	}
	}

	.btn.pager {
	border: 1px solid @lightNavBorder;
	font-size: .86em;
	padding: .5em 1em;
	white-space: nowrap;
	font-family: @sansFont;
	&:hover {
	text-decoration: none;
	background: @lightNavBorder;
	}
	}

	.btn.cta.secondary, input[type=submit].secondary {
	background: transparent;
	color: @primary;
	&:hover {
	background-color: #f9f9f9;
	}
	}

	.btn.cta.disabled {
	background-color: desaturate(@primary, 100%) !important;
	border-color: desaturate(@primary, 100%) !important;
	}

	div.flat-select {
	display: inline-block;
	position: relative;
	select {
	border: 0;
	background: 0;
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
	position: absolute;
	top: 0;
	left: 0;
	right: 0;
	bottom: 0;
	width: 100%;
	height: 100%;
	opacity: 0;
	}

	&.action {
	&:hover {
	label {
	text-decoration: underline;
	}
	}
	label, select {
	cursor: pointer;
	}
	}
	}

	input {
	&.underline{
	border: none;
	border-bottom: 1px solid #ccc;
	padding: 0 .2em .2em;
	font-size: 0.9em;
	color: #333;
	}
	&.inline {
	padding: 0.2rem 0.2rem;
	margin-left: 0;
	font-size: 1em;
	border: 0 !important;
	border-bottom: 1px solid #999 !important;
	width: 7em;
	.rounded(0);
	}

	&[type=tel], &[type=text], &[type=email], &[type=password] {
	border: 1px solid #999;
	}
	&.boxy {
	border: 1px solid #999 !important;
	}
	}

	#beta, .content-container {
	max-width: 50em;
	margin: 0 auto 3em;
	font-size: 1.2em;

	&.tight {
	max-width: 30em;
	}
	&.snug {
	max-width: 40em;
	}
	.app {
	+ .app {
	margin-top: 1.5em;
	}
	h2 {
	margin-bottom: 0.25em;
	}
	p {
	margin-top: 0.25em;
	}
	}

	h2.intro {
	font-weight: normal;
	}
	p {
	line-height: 1.5;
	}
	li {
	margin: 0.3em 0;
	}
	h2 {
	&.light {
	font-weight: normal;
	}
	a {
	.transition-duration(0.2s);
	-moz-transition-property: color;
	-webkit-transition-property: color;
	-o-transition-property: color;
	transition-property: color;

	&:link, &:visited, &:hover {
	color: @subheaders;
	}
	&:hover {
	color: lighten(@subheaders, 10%);
	text-decoration: none;
	}
	}
	}
	}
	.content-container {
	&#pricing {
	button {
	cursor: pointer;
	color: white;
	margin-top: 1em;
	margin-bottom: 1em;
	padding-left: 1.5em;
	padding-right: 1.5em;
	border: 0;
	background: @primary;
	.rounded(.25em);
	.transition(0.2s);

	&:hover {
	background-color: lighten(@primary, 5%);
	}
	&.unselected {
	cursor: pointer;
	}
	}
	h2 span {
	font-weight: normal;
	}
	.half {
	margin: 0 0 1em 0;
	text-align: center;
	}
	}
	div.blurbs {
	>h2 {
	text-align: center;
	color: #333;
	font-weight: normal;
	}
	p.price {
	font-size: 1.2em;
	margin-bottom: 0;
	color: #333;
	margin-top: 0.5em;
	&+p {
	margin-top: 0;
	font-size: 0.8em;
	}
	}
	p.text-cta {
	font-size: 1em;
	}
	}
	}
	footer div.blurbs {
	display: flex;
	flex-flow: row;
	flex-wrap: wrap;
	}
	div.blurbs {
	.half, .third, .fourth {
	font-size: 0.86em;
	h3 {
	font-weight: normal;
	}
	p, ul {
	color: #595959;
	}
	hr {
	margin: 1em 0;
	}
	}
	.half {
	padding: 0 1em 0 0;
	width: ~"calc(50% - 1em)";
	&+.half {
	padding: 0 0 0 1em;
	}
	}
	.third {
	padding: 0;
	width: ~"calc(33% - 1em)";
	&+.third {
	padding: 0 0 0 1em;
	}
	}
	.fourth {
	flex: 1 1 25%;
	-webkit-flex: 1 1 25%;
	h3 {
	margin-bottom: 0.5em;
	}
	ul {
	margin-top: 0.5em;
	}
	}
	}
	.contain-me {
	text-align: left;
	margin: 0 auto 4em;
	max-width: 50em;
	h2 + p, h2 + p + p, p.describe-me {
	margin-left: 1.5em;
	margin-right: 1.5em;
	color: #333;
	}
	}
	footer.contain-me {
	font-size: 1.1em;
	}
	#official-writing, #wrapper {
	h2, h3, h4 {
	color: @subheaders;
	}
	ul {
	&.collections {
	padding-left: 0;
	margin-left: 0;
	h3 {
	margin-top: 0;
	font-weight: normal;
	}
	li {
	&.collection {
	a.title {
	&:link, &:visited {
	color: @headerTextColor;
	}
	}
	}
	a.create {
	color: #444;
	}
	}
	& + p {
	margin-top: 2em;
	margin-left: 1em;
	}
	}
	}
	}

	#official-writing, #wrapper {
	h2 {
	&.major {
	color: #222;
	}
	&.bugfix {
	color: #666;
	}

	+.android-version {
	a {
	color: #999;
	&:hover {
	text-decoration: underline;
	}
	}
	}
	}
	}

	li {
	line-height: 1.5;

	.item-desc, .prog-lang {
	font-size: 0.6em;
	font-family: 'Open Sans', sans-serif;
	font-weight: bold;
	margin-left: 0.5em;
	margin-right: 0.5em;
	text-transform: uppercase;
	color: #999;
	}
	}

	.success {
	color: darken(@proSelectedCol, 20%);
	}

	.alert {
	padding: 1em;
	margin-bottom: 1.25em;
	border: 1px solid transparent;
	.rounded(.25em);
	&.info {
	color: #31708f;
	background-color: #d9edf7;
	border-color: #bce8f1;
	}
	&.success {
	color: #3c763d;
	background-color: #dff0d8;
	border-color: #d6e9c6;
	}
	&.danger {
	border-color: #856404;
	background-color: white;
	h3 {
	margin: 0 0 0.5em 0;
	font-size: 1em;
	font-weight: bold;
	color: black !important;
	}
	h3 + p, button {
	font-size: 0.86em;
	}
	}

	p {
	margin: 0;
	&+p {
	margin-top: 0.5em;
	}
	}
	p.dismiss {
	font-family: @sansFont;
	text-align: right;
	font-size: 0.86em;
	text-transform: uppercase;
	}
	}

	ul.errors {
	padding: 0;
	text-indent: 0;
	li.urgent {
	list-style: none;
	font-style: italic;
	text-align: center;
	color: @errUrgentCol;
	a:link, a:visited {
	color: purple;
	}
	}
	li.info {
	list-style: none;
	font-size: 1.1em;
	text-align: center;
	}
	}

	body#pad #target a.upgrade-prompt {
	padding-left: 1em;
	padding-right: 1em;
	text-align: center;
	font-style: italic;
	color: @primary;
	}

	body#pad-sub #posts, .atoms {
	margin-top: 1.5em;

	h3 {
	margin-bottom: 0.25em;
	&+ h4 {
	margin-top: 0.25em;
	margin-bottom: 0.5em;
	&+ p {
	margin-top: 0.5em;
	}
	}
	.electron {
	font-weight: normal;
	font-size: 0.86em;
	margin-left: 0.75rem;
	}
	}
	h3, h4 {
	a {
	.transition-duration(0.2s);
	-moz-transition-property: color;
	-webkit-transition-property: color;
	-o-transition-property: color;
	transition-property: color;
	}
	}
	h4 {
	font-size: 0.9em;
	font-weight: normal;
	}
	date, .electron {
	margin-right: 0.5em;
	}
	.action {
	font-size: 1em;
	}
	#more-posts p {
	text-align: center;
	font-size: 1.1em;
	}
	p {
	font-size: 0.86em;
	}
	.error {
	display: inline-block;
	font-size: 0.8em;
	font-style: italic;
	color: @errUrgentCol;

	strong {
	font-style: normal;
	}
	}
	.error + nav {
	display: inline-block;
	font-size: 0.8em;
	margin-left: 1em;

	a + a {
	margin-left: 0.75em;
	}
	}
	}

	h2 {
	a, time {
	&+.action {
	margin-left: 0.5em;
	}
	}
	}
	.action {
	font-size: 0.7em;
	font-weight: normal;
	font-family: @serifFont;

	&+ .action {
	margin-left: 0.5em;
	}
	&.new-post {
	font-weight: bold;
	}
	}
	article.moved {
	p {
	font-size: 1.2em;
	color: #999;
	}
	}
	span.as {
	.opacity(0.2);
	font-weight: normal;
	}
	span.ras {
	.opacity(0.6);
	font-weight: normal;
	}

	header {
	nav {
	.username {
	font-size: 2em;
	font-weight: normal;
	color: #555;
	}
	&#user-nav {
	margin-left: 0;
	& > a, .tabs > a {
	&.selected {
	cursor: default;
	font-weight: bold;
	&:hover {
	text-decoration: none;
	}
	}
	& + a {
	margin-left: 2em;
	}
	}
	a {
	font-size: 1.2em;
	font-family: @sansFont;
	span {
	font-size: 0.7em;
	color: #999;
	text-transform: uppercase;
	margin-left: 0.5em;
	margin-right: 0.5em;
	}
	&.title {
	font-size: 1.6em;
	font-family: @serifFont;
	font-weight: bold;
	}
	}
	nav > ul > li:first-child {
	&> a {
	display: inline-block;
	}
	img {
	position: relative;
	top: -0.5em;
	right: 0.3em;
	}
	}
	ul ul {
	font-size: 0.8em;
	a {
	padding-top: 0.25em;
	padding-bottom: 0.25em;
	}
	}
	li {
	line-height: 1.5;
	}
	}
	&.tabs {
	margin: 0 0 0 1em;
	}
	&+ nav.tabs {
	margin: 0;
	}
	}
	&.singleuser {
	margin: 0.5em 1em 0.5em 0.25em;
	nav#user-nav {
	nav > ul > li:first-child {
	img {
	top: -0.75em;
	}
	}
	}
	.right-side {
	padding-top: 0.5em;
	}
	}
	.dash-nav {
	font-weight: bold;
	}
	}

	li#create-collection {
	display: none;
	h4 {
	margin-top: 0px;
	margin-bottom: 0px;
	}
	input[type=submit] {
	margin-left: 0.5em;
	}
	}

	#collection-options {
	.option {
	textarea {
	font-size: 0.86em;
	font-family: @monoFont;
	}
	.section > p.explain {
	font-size: 0.8em;
	}
	}
	}

	.img-placeholder {
	text-align: center;
	img {
	max-width: 100%;
	}
	}

	dl {
	&.admin-dl-horizontal {
	dt {
	font-weight: bolder;
	width: 360px;
	}
	dd {
	line-height: 1.5;
	}
	}
	}
	dt {
	float: left;
	clear: left;
	overflow: hidden;
	text-overflow: ellipsis;
	white-space: nowrap;
	}
	form {
	dt, dd {
	padding: 0.5rem 0;
	}
	dt {
	line-height: 1.8;
	}
	dd {
	font-size: 0.86em;
	line-height: 2;
	}

	&.prominent {
	margin: 1em 0;

	label {
	font-weight: bold;
	}
	input, select {
	width: 100%;
	}
	select {
	font-size: 1em;
	padding: 0.5rem;
	display: block;
	border-radius: 0.25rem;
	margin: 0.5rem 0;
	}
	}
	}
	div.row {
	display: flex;
	align-items: center;
	> div {
	flex: 1;
	}
	}

	.check, .blip {
	font-size: 1.125em;
	color: #71D571;
	}

	.ex.failure {
	font-weight: bold;
	color: @dangerCol;
	}

	@media all and (max-width: 450px) {
	body#post {
	header {
	nav {
	.xtra-feature {
	display: none;
	}
	}
	}
	}
	}
	@media all and (min-width: 1280px) {
	body#promo {
	div.heading {
	margin: 10em 0;
	}
	}
	}

	@media all and (min-width: 1600px) {
	body#promo {
	div.heading {
	margin: 14em 0;
	}
	}
	}

	@media all and (max-width: 900px) {
	.half.big {
	padding: 0 !important;
	width: 100% !important;
	}
	.third {
	padding: 0 !important;
	float: none;
	width: 100% !important;
	p.introduction {
	font-size: 0.86em;
	}
	}
	div.blurbs {
	.fourth {
	flex: 1 1 15em;
	-webkit-flex: 1 1 15em;
	}
	}
	.blurbs .third, .blurbs .half {
	p, ul {
	text-align: left;
	}
	}
	.half-col, .big {
	float: none;
	text-align: center;

	&+.half-col, &+.big {
	margin-top: 4em !important;
	margin-left: 0;
	}
	}
	#beta, .content-container {
	font-size: 1.15em;
	}
	}

	@media all and (max-width: 600px) {
	div.row:not(.admin-actions) {
	flex-direction: column;
	}
	.half {
	padding: 0 !important;
	width: 100% !important;
	}
	.third {
	width: 100% !important;
	float: none;
	}
	body#promo {
	div.heading {
	margin: 6em 0;
	}
	h2 {
	font-size: 1.6em;
	}
	.half-col a + a {
	margin-left: 1em;
	}
	.half-col a.channel {
	margin-left: auto !important;
	margin-right: auto !important;
	}
	}
	ul.add-integrations {
	li {
	display: list-item;
	&+ li {
	margin-left: 0;
	}
	}
	}
	}

	@media all and (max-height: 500px) {
	body#promo {
	div.heading {
	margin: 5em 0;
	}
	}
	}

	@media all and (max-height: 400px) {
	body#promo {
	div.heading {
	margin: 0em 0;
	}
	}
	}

	/* Smartphones (portrait and landscape) ----------- */
	@media only screen and (min-device-width : 320px) and (max-device-width : 480px) {
	header {
	.opacity(1);
	}
	}

	/* Smartphones (portrait) ----------- */
	@media only screen and (max-width : 320px) {
	.content-container#pricing {
	.half {
	float: none;
	width: 100%;
	}
	}
	header {
	.opacity(1);
	}
	}

	/* iPads (portrait and landscape) ----------- */
	@media only screen and (min-device-width : 768px) and (max-device-width : 1024px) {
	header {
	.opacity(1);
	}
	}

	@media (pointer: coarse) {
	body footer nav a:not(.pubd) {
	padding: 0.8em 1em;
	margin-left: 0;
	margin-top: 0;
	}
	article {
	.hidden {
	.opacity(1);
	}
	}
	}

	@media print {
	h1 {
	page-break-before: always;
	}

	h1, h2, h3, h4, h5, h6 {
	page-break-after: avoid;
	}

	table, figure {
	page-break-inside: avoid;
	}

	header, footer {
	display: none;
	}
	article#post-body {
	margin-top: 2em;
	margin-left: 0;
	margin-right: 0;
	}
	hr {
	border: 1px solid #ccc;
	}
	}

	.code-block {
	padding: 0;
	max-width: 100%;
	margin: 0;
	background: #f8f8f8;
	border: 1px solid #ccc;
	padding: 0.375em 0.625em;
	font-size: 0.86em;
	.rounded(.25em);
	}
	pre.code-block {
	overflow-x: auto;
	}

	#emailsub {
	text-align: center;
	}
	p#emailsub {
	display: inline-block !important;
	width: 100%;
	font-style: italic;
	}
	#subscribe-btn {
	margin-left: 0.5em;
	}

	#org-nav {
	font-family: @sansFont;
	font-size: 1.1em;
	color: #888;

	em, strong {
	color: #000;
	}
	&+h1 {
	margin-top: 0.5em;
	}
	a:link, a:visited, a:hover {
	color: @accent;
	}
	a:first-child {
	margin-right: 0.25em;
	}
	a.coll-name {
	font-weight: bold;
	margin-left: 0.25em;
	}
	}
	\ No newline at end of file
	diff --git a/less/login.less b/less/login.less
	index fefeb12..df6f246 100644
	--- a/less/login.less
	+++ b/less/login.less
	@@ -1,91 +1,91 @@
	/*
	- * Copyright © 2020 A Bunch Tell LLC.
	+ * Copyright © 2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	.row.signinbtns {
	justify-content: center;
	font-size: 1em;
	margin-top: 2em;
	margin-bottom: 1em;
	flex-wrap: wrap;

	.loginbtn {
	height: 40px;
	margin: 0.5em;

	&.btn {
	box-sizing: border-box;
	font-size: 17px;
	white-space: nowrap;

	img {
	height: 1.5em;
	vertical-align: middle;
	}
	}

	&#writeas-login, &#slack-login {
	img {
	margin-top: -0.2em;
	}
	}

	&#gitlab-login {
	background-color: #fc6d26;
	border-color: #fc6d26;
	&:hover {
	background-color: darken(#fc6d26, 5%);
	border-color: darken(#fc6d26, 5%);
	}
	}

	&#gitea-login {
	background-color: #2ecc71;
	border-color: #2ecc71;
	&:hover {
	background-color: #2cc26b;
	border-color: #2cc26b;
	}
	}

	&#slack-login, &#gitlab-login, &#gitea-login, &#generic-oauth-login {
	font-size: 0.86em;
	font-family: @sansFont;
	}

	&#slack-login, &#generic-oauth-login {
	color: @lightTextColor;
	background-color: @lightNavBG;
	border-color: @lightNavBorder;
	&:hover {
	background-color: @lightNavHoverBG;
	}
	}
	}
	}

	.or {
	text-align: center;
	margin-bottom: 3.5em;

	p {
	display: inline-block;
	background-color: white;
	padding: 0 1em;
	}

	hr {
	margin-top: -1.6em;
	margin-bottom: 0;
	}

	hr.short {
	max-width: 30rem;
	}
	}
	\ No newline at end of file
	diff --git a/migrations/drivers.go b/migrations/drivers.go
	index b4a95bd..f19b6c9 100644
	--- a/migrations/drivers.go
	+++ b/migrations/drivers.go
	@@ -1,94 +1,94 @@
	/*
	- * Copyright © 2019 A Bunch Tell LLC.
	+ * Copyright © 2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	import (
	"fmt"
	)

	// TODO: use now() from writefreely pkg
	func (db *datastore) now() string {
	if db.driverName == driverSQLite {
	return "strftime('%Y-%m-%d %H:%M:%S','now')"
	}
	return "NOW()"
	}

	func (db *datastore) typeInt() string {
	if db.driverName == driverSQLite {
	return "INTEGER"
	}
	return "INT"
	}

	func (db *datastore) typeSmallInt() string {
	if db.driverName == driverSQLite {
	return "INTEGER"
	}
	return "SMALLINT"
	}

	func (db *datastore) typeTinyInt() string {
	if db.driverName == driverSQLite {
	return "INTEGER"
	}
	return "TINYINT"
	}

	func (db *datastore) typeText() string {
	return "TEXT"
	}

	func (db *datastore) typeChar(l int) string {
	if db.driverName == driverSQLite {
	return "TEXT"
	}
	return fmt.Sprintf("CHAR(%d)", l)
	}

	func (db *datastore) typeVarChar(l int) string {
	if db.driverName == driverSQLite {
	return "TEXT"
	}
	return fmt.Sprintf("VARCHAR(%d)", l)
	}

	func (db *datastore) typeBool() string {
	if db.driverName == driverSQLite {
	return "INTEGER"
	}
	return "TINYINT(1)"
	}

	func (db *datastore) typeDateTime() string {
	return "DATETIME"
	}

	func (db *datastore) collateMultiByte() string {
	if db.driverName == driverSQLite {
	return ""
	}
	return " COLLATE utf8_bin"
	}

	func (db *datastore) engine() string {
	if db.driverName == driverSQLite {
	return ""
	}
	return " ENGINE = InnoDB"
	}

	func (db *datastore) after(colName string) string {
	if db.driverName == driverSQLite {
	return ""
	}
	return " AFTER " + colName
	}
	diff --git a/migrations/migrations.go b/migrations/migrations.go
	index 4fe7162..5a88379 100644
	--- a/migrations/migrations.go
	+++ b/migrations/migrations.go
	@@ -1,146 +1,146 @@
	/*
	- * Copyright © 2019 A Bunch Tell LLC.
	+ * Copyright © 2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	// Package migrations contains database migrations for WriteFreely
	package migrations

	import (
	"database/sql"

	"github.com/writeas/web-core/log"
	)

	// TODO: refactor to use the datastore struct from writefreely pkg
	type datastore struct {
	*sql.DB
	driverName string
	}

	func NewDatastore(db sql.DB, dn string) datastore {
	return &datastore{db, dn}
	}

	// TODO: use these consts from writefreely pkg
	const (
	driverMySQL = "mysql"
	driverSQLite = "sqlite3"
	)

	type Migration interface {
	Description() string
	Migrate(db *datastore) error
	}

	type migration struct {
	description string
	migrate func(db *datastore) error
	}

	func New(d string, fn func(db *datastore) error) Migration {
	return &migration{d, fn}
	}

	func (m *migration) Description() string {
	return m.description
	}

	func (m migration) Migrate(db datastore) error {
	return m.migrate(db)
	}

	var migrations = []Migration{
	New("support user invites", supportUserInvites), // -> V1 (v0.8.0)
	New("support dynamic instance pages", supportInstancePages), // V1 -> V2 (v0.9.0)
	New("support users suspension", supportUserStatus), // V2 -> V3 (v0.11.0)
	New("support oauth", oauth), // V3 -> V4
	New("support slack oauth", oauthSlack), // V4 -> v5
	New("support ActivityPub mentions", supportActivityPubMentions), // V5 -> V6
	New("support oauth attach", oauthAttach), // V6 -> V7
	New("support oauth via invite", oauthInvites), // V7 -> V8 (v0.12.0)
	New("optimize drafts retrieval", optimizeDrafts), // V8 -> V9
	New("support post signatures", supportPostSignatures), // V9 -> V10 (v0.13.0)
	New("support newsletters", supportLetters), // V10 -> V11
	}

	// CurrentVer returns the current migration version the application is on
	func CurrentVer() int {
	return len(migrations)
	}

	func SetInitialMigrations(db *datastore) error {
	// Included schema files represent changes up to V1, so note that in the database
	_, err := db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", 1, "")
	if err != nil {
	return err
	}
	return nil
	}

	func Migrate(db *datastore) error {
	var version int
	var err error
	if db.tableExists("appmigrations") {
	err = db.QueryRow("SELECT MAX(version) FROM appmigrations").Scan(&version)
	if err != nil {
	return err
	}
	} else {
	log.Info("Initializing appmigrations table...")
	version = 0
	_, err = db.Exec(`CREATE TABLE appmigrations (
	version ` + db.typeInt() + ` NOT NULL,
	migrated ` + db.typeDateTime() + ` NOT NULL,
	result ` + db.typeText() + ` NOT NULL
	) ` + db.engine() + `;`)
	if err != nil {
	return err
	}
	}

	if len(migrations[version:]) > 0 {
	for i, m := range migrations[version:] {
	curVer := version + i + 1
	log.Info("Migrating to V%d: %s", curVer, m.Description())
	err = m.Migrate(db)
	if err != nil {
	return err
	}

	// Update migrations table
	_, err = db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", curVer, "")
	if err != nil {
	return err
	}
	}
	} else {
	log.Info("Database up-to-date. No migrations to run.")
	}

	return nil
	}

	func (db *datastore) tableExists(t string) bool {
	var dummy string
	var err error
	if db.driverName == driverSQLite {
	err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = ?", t).Scan(&dummy)
	} else {
	err = db.QueryRow("SHOW TABLES LIKE '" + t + "'").Scan(&dummy)
	}
	switch {
	case err == sql.ErrNoRows:
	return false
	case err != nil:
	log.Error("Couldn't SHOW TABLES: %v", err)
	return false
	}

	return true
	}
	diff --git a/migrations/v1.go b/migrations/v1.go
	index ef3a579..dcc956d 100644
	--- a/migrations/v1.go
	+++ b/migrations/v1.go
	@@ -1,49 +1,49 @@
	/*
	- * Copyright © 2019 A Bunch Tell LLC.
	+ * Copyright © 2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	func supportUserInvites(db *datastore) error {
	t, err := db.Begin()
	if err != nil {
	return err
	}
	_, err = t.Exec(`CREATE TABLE userinvites (
	id ` + db.typeChar(6) + ` NOT NULL ,
	owner_id ` + db.typeInt() + ` NOT NULL ,
	max_uses ` + db.typeSmallInt() + ` NULL ,
	created ` + db.typeDateTime() + ` NOT NULL ,
	expires ` + db.typeDateTime() + ` NULL ,
	inactive ` + db.typeBool() + ` NOT NULL ,
	PRIMARY KEY (id)
	) ` + db.engine() + `;`)
	if err != nil {
	t.Rollback()
	return err
	}

	_, err = t.Exec(`CREATE TABLE usersinvited (
	invite_id ` + db.typeChar(6) + ` NOT NULL ,
	user_id ` + db.typeInt() + ` NOT NULL ,
	PRIMARY KEY (invite_id, user_id)
	) ` + db.engine() + `;`)
	if err != nil {
	t.Rollback()
	return err
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	return err
	}

	return nil
	}
	diff --git a/migrations/v10.go b/migrations/v10.go
	index 9c84a01..25a4a28 100644
	--- a/migrations/v10.go
	+++ b/migrations/v10.go
	@@ -1,33 +1,33 @@
	/*
	- * Copyright © 2020 A Bunch Tell LLC.
	+ * Copyright © 2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	func supportPostSignatures(db *datastore) error {
	t, err := db.Begin()
	if err != nil {
	t.Rollback()
	return err
	}

	_, err = t.Exec(`ALTER TABLE collections ADD COLUMN post_signature ` + db.typeText() + db.collateMultiByte() + ` NULL` + db.after("script"))
	if err != nil {
	t.Rollback()
	return err
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	return err
	}

	return nil
	}
	diff --git a/migrations/v2.go b/migrations/v2.go
	index d282ec7..fb742b5 100644
	--- a/migrations/v2.go
	+++ b/migrations/v2.go
	@@ -1,38 +1,38 @@
	/*
	- * Copyright © 2019 A Bunch Tell LLC.
	+ * Copyright © 2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	func supportInstancePages(db *datastore) error {
	t, err := db.Begin()
	if err != nil {
	return err
	}

	_, err = t.Exec(`ALTER TABLE appcontent ADD COLUMN title ` + db.typeVarChar(255) + db.collateMultiByte() + ` NULL`)
	if err != nil {
	t.Rollback()
	return err
	}

	_, err = t.Exec(`ALTER TABLE appcontent ADD COLUMN content_type ` + db.typeVarChar(36) + ` DEFAULT 'page' NOT NULL`)
	if err != nil {
	t.Rollback()
	return err
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	return err
	}

	return nil
	}
	diff --git a/migrations/v3.go b/migrations/v3.go
	index e36b9d0..6236ae3 100644
	--- a/migrations/v3.go
	+++ b/migrations/v3.go
	@@ -1,32 +1,32 @@
	/*
	- * Copyright © 2019 A Bunch Tell LLC.
	+ * Copyright © 2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	func supportUserStatus(db *datastore) error {
	t, err := db.Begin()
	if err != nil {
	return err
	}

	_, err = t.Exec(`ALTER TABLE users ADD COLUMN status ` + db.typeInt() + ` DEFAULT '0' NOT NULL`)
	if err != nil {
	t.Rollback()
	return err
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	return err
	}

	return nil
	}
	diff --git a/migrations/v4.go b/migrations/v4.go
	index c69dce1..4ae267d 100644
	--- a/migrations/v4.go
	+++ b/migrations/v4.go
	@@ -1,54 +1,54 @@
	/*
	- * Copyright © 2019-2021 A Bunch Tell LLC.
	+ * Copyright © 2019-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	import (
	"context"
	"database/sql"

	wf_db "github.com/writefreely/writefreely/db"
	)

	func oauth(db *datastore) error {
	dialect := wf_db.DialectMySQL
	if db.driverName == driverSQLite {
	dialect = wf_db.DialectSQLite
	}
	return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
	createTableUsersOauth, err := dialect.
	Table("oauth_users").
	SetIfNotExists(false).
	Column(dialect.Column("user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)).
	Column(dialect.Column("remote_user_id", wf_db.ColumnTypeInteger, wf_db.UnsetSize)).
	ToSQL()
	if err != nil {
	return err
	}
	createTableOauthClientState, err := dialect.
	Table("oauth_client_states").
	SetIfNotExists(false).
	Column(dialect.Column("state", wf_db.ColumnTypeVarChar, wf_db.OptionalInt{Set: true, Value: 255})).
	Column(dialect.Column("used", wf_db.ColumnTypeBool, wf_db.UnsetSize)).
	Column(dialect.Column("created_at", wf_db.ColumnTypeDateTime, wf_db.UnsetSize).SetDefaultCurrentTimestamp()).
	UniqueConstraint("state").
	ToSQL()
	if err != nil {
	return err
	}

	for _, table := range []string{createTableUsersOauth, createTableOauthClientState} {
	if _, err := tx.ExecContext(ctx, table); err != nil {
	return err
	}
	}
	return nil
	})
	}
	diff --git a/migrations/v5.go b/migrations/v5.go
	index 1fe3e30..db18fa1 100644
	--- a/migrations/v5.go
	+++ b/migrations/v5.go
	@@ -1,88 +1,88 @@
	/*
	- * Copyright © 2019-2021 A Bunch Tell LLC.
	+ * Copyright © 2019-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	import (
	"context"
	"database/sql"

	wf_db "github.com/writefreely/writefreely/db"
	)

	func oauthSlack(db *datastore) error {
	dialect := wf_db.DialectMySQL
	if db.driverName == driverSQLite {
	dialect = wf_db.DialectSQLite
	}
	return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
	builders := []wf_db.SQLBuilder{
	dialect.
	AlterTable("oauth_client_states").
	AddColumn(dialect.
	Column(
	"provider",
	wf_db.ColumnTypeVarChar,
	wf_db.OptionalInt{Set: true, Value: 24}).SetDefault("")),
	dialect.
	AlterTable("oauth_client_states").
	AddColumn(dialect.
	Column(
	"client_id",
	wf_db.ColumnTypeVarChar,
	wf_db.OptionalInt{Set: true, Value: 128}).SetDefault("")),
	dialect.
	AlterTable("oauth_users").
	AddColumn(dialect.
	Column(
	"provider",
	wf_db.ColumnTypeVarChar,
	wf_db.OptionalInt{Set: true, Value: 24}).SetDefault("")),
	dialect.
	AlterTable("oauth_users").
	AddColumn(dialect.
	Column(
	"client_id",
	wf_db.ColumnTypeVarChar,
	wf_db.OptionalInt{Set: true, Value: 128}).SetDefault("")),
	dialect.
	AlterTable("oauth_users").
	AddColumn(dialect.
	Column(
	"access_token",
	wf_db.ColumnTypeVarChar,
	wf_db.OptionalInt{Set: true, Value: 512}).SetDefault("")),
	dialect.CreateUniqueIndex("oauth_users_uk", "oauth_users", "user_id", "provider", "client_id"),
	}

	if dialect != wf_db.DialectSQLite {
	// This updates the length of the `remote_user_id` column. It isn't needed for SQLite databases.
	builders = append(builders, dialect.
	AlterTable("oauth_users").
	ChangeColumn("remote_user_id",
	dialect.
	Column(
	"remote_user_id",
	wf_db.ColumnTypeVarChar,
	wf_db.OptionalInt{Set: true, Value: 128})))
	}

	for _, builder := range builders {
	query, err := builder.ToSQL()
	if err != nil {
	return err
	}
	if _, err := tx.ExecContext(ctx, query); err != nil {
	return err
	}
	}
	return nil
	})
	}
	diff --git a/migrations/v6.go b/migrations/v6.go
	index 074f446..885d445 100644
	--- a/migrations/v6.go
	+++ b/migrations/v6.go
	@@ -1,32 +1,32 @@
	/*
	- * Copyright © 2019-2020 A Bunch Tell LLC.
	+ * Copyright © 2019-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	func supportActivityPubMentions(db *datastore) error {
	t, err := db.Begin()
	if err != nil {
	return err
	}

	_, err = t.Exec(`ALTER TABLE remoteusers ADD COLUMN handle ` + db.typeVarChar(255) + ` NULL`)
	if err != nil {
	t.Rollback()
	return err
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	return err
	}

	return nil
	}
	diff --git a/migrations/v7.go b/migrations/v7.go
	index 5737b21..2056aa0 100644
	--- a/migrations/v7.go
	+++ b/migrations/v7.go
	@@ -1,46 +1,46 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	import (
	"context"
	"database/sql"

	wf_db "github.com/writefreely/writefreely/db"
	)

	func oauthAttach(db *datastore) error {
	dialect := wf_db.DialectMySQL
	if db.driverName == driverSQLite {
	dialect = wf_db.DialectSQLite
	}
	return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
	builders := []wf_db.SQLBuilder{
	dialect.
	AlterTable("oauth_client_states").
	AddColumn(dialect.
	Column(
	"attach_user_id",
	wf_db.ColumnTypeInteger,
	wf_db.OptionalInt{Set: true, Value: 24}).SetNullable(true)),
	}
	for _, builder := range builders {
	query, err := builder.ToSQL()
	if err != nil {
	return err
	}
	if _, err := tx.ExecContext(ctx, query); err != nil {
	return err
	}
	}
	return nil
	})
	}
	diff --git a/migrations/v8.go b/migrations/v8.go
	index 28af523..36001af 100644
	--- a/migrations/v8.go
	+++ b/migrations/v8.go
	@@ -1,45 +1,45 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	import (
	"context"
	"database/sql"

	wf_db "github.com/writefreely/writefreely/db"
	)

	func oauthInvites(db *datastore) error {
	dialect := wf_db.DialectMySQL
	if db.driverName == driverSQLite {
	dialect = wf_db.DialectSQLite
	}
	return wf_db.RunTransactionWithOptions(context.Background(), db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
	builders := []wf_db.SQLBuilder{
	dialect.
	AlterTable("oauth_client_states").
	AddColumn(dialect.Column("invite_code", wf_db.ColumnTypeChar, wf_db.OptionalInt{
	Set: true,
	Value: 6,
	}).SetNullable(true)),
	}
	for _, builder := range builders {
	query, err := builder.ToSQL()
	if err != nil {
	return err
	}
	if _, err := tx.ExecContext(ctx, query); err != nil {
	return err
	}
	}
	return nil
	})
	}
	diff --git a/migrations/v9.go b/migrations/v9.go
	index c6b832e..f542189 100644
	--- a/migrations/v9.go
	+++ b/migrations/v9.go
	@@ -1,37 +1,37 @@
	/*
	- * Copyright © 2020 A Bunch Tell LLC.
	+ * Copyright © 2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package migrations

	func optimizeDrafts(db *datastore) error {
	t, err := db.Begin()
	if err != nil {
	t.Rollback()
	return err
	}

	if db.driverName == driverSQLite {
	_, err = t.Exec(`CREATE INDEX key_owner_post_id ON posts (owner_id, id)`)
	} else {
	_, err = t.Exec(`ALTER TABLE posts ADD INDEX(owner_id, id)`)
	}
	if err != nil {
	t.Rollback()
	return err
	}

	err = t.Commit()
	if err != nil {
	t.Rollback()
	return err
	}

	return nil
	}
	diff --git a/monetization.go b/monetization.go
	index 92375c2..3bb4fcf 100644
	--- a/monetization.go
	+++ b/monetization.go
	@@ -1,160 +1,160 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"bytes"
	"fmt"
	"github.com/gorilla/mux"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/log"
	"io/ioutil"
	"net/http"
	"net/url"
	"os"
	"strings"
	)

	func displayMonetization(monetization, alias string) string {
	if monetization == "" {
	return ""
	}

	ptrURL, err := url.Parse(strings.Replace(monetization, "$", "https://", 1))
	if err == nil {
	if strings.HasSuffix(ptrURL.Host, ".xrptipbot.com") {
	// xrp tip bot doesn't support stream receipts, so return plain pointer
	return monetization
	}
	}

	u := os.Getenv("PAYMENT_HOST")
	if u == "" {
	return "$webmonetization.org/api/receipts/" + url.PathEscape(monetization)
	}
	u += "/" + alias
	return u
	}

	func handleSPSPEndpoint(app App, w http.ResponseWriter, r http.Request) error {
	idStr := r.FormValue("id")
	id, err := url.QueryUnescape(idStr)
	if err != nil {
	log.Error("Unable to unescape: %s", err)
	return err
	}

	var c *Collection
	if strings.IndexRune(id, '.') > 0 && app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(id)
	}
	if err != nil {
	return err
	}

	pointer := c.Monetization
	if pointer == "" {
	err := impart.HTTPError{http.StatusNotFound, "No monetization pointer."}
	return err
	}

	fmt.Fprintf(w, pointer)
	return nil
	}

	func handleGetSplitContent(app App, w http.ResponseWriter, r http.Request) error {
	var collID int64
	var collLookupID string
	var coll *Collection
	var err error
	vars := mux.Vars(r)
	if collAlias := vars["alias"]; collAlias != "" {
	// Fetch collection information, since an alias is provided
	coll, err = app.db.GetCollection(collAlias)
	if err != nil {
	return err
	}
	collID = coll.ID
	collLookupID = coll.Alias
	}

	p, err := app.db.GetPost(vars["post"], collID)
	if err != nil {
	return err
	}

	receipt := r.FormValue("receipt")
	if receipt == "" {
	return impart.HTTPError{http.StatusBadRequest, "No `receipt` given."}
	}
	err = verifyReceipt(receipt, collLookupID)
	if err != nil {
	return err
	}

	d := struct {
	Content string `json:"body"`
	HTMLContent string `json:"html_body"`
	}{}

	if exc := strings.Index(p.Content, shortCodePaid); exc > -1 {
	baseURL := ""
	if coll != nil {
	baseURL = coll.CanonicalURL()
	}

	d.Content = p.Content[exc+len(shortCodePaid):]
	d.HTMLContent = applyMarkdown([]byte(d.Content), baseURL, app.cfg)
	}

	return impart.WriteSuccess(w, d, http.StatusOK)
	}

	func verifyReceipt(receipt, id string) error {
	receiptsHost := os.Getenv("RECEIPTS_HOST")
	if receiptsHost == "" {
	receiptsHost = "https://webmonetization.org/api/receipts/verify?id=" + id
	} else {
	receiptsHost = fmt.Sprintf("%s/receipts?id=%s", receiptsHost, id)
	}

	log.Info("Verifying receipt %s at %s", receipt, receiptsHost)
	r, err := http.NewRequest("POST", receiptsHost, bytes.NewBufferString(receipt))
	if err != nil {
	log.Error("Unable to create new request to %s: %s", receiptsHost, err)
	return err
	}

	resp, err := http.DefaultClient.Do(r)
	if err != nil {
	log.Error("Unable to Do() request to %s: %s", receiptsHost, err)
	return err
	}
	if resp != nil && resp.Body != nil {
	defer resp.Body.Close()
	}

	body, err := ioutil.ReadAll(resp.Body)
	if err != nil {
	log.Error("Unable to read %s response body: %s", receiptsHost, err)
	return err
	}
	log.Info("Status : %s", resp.Status)
	log.Info("Response: %s", body)

	if resp.StatusCode != http.StatusOK {
	log.Error("Bad response from %s:\nStatus: %d\n%s", receiptsHost, resp.StatusCode, string(body))
	return impart.HTTPError{resp.StatusCode, string(body)}
	}
	return nil
	}
	diff --git a/nodeinfo.go b/nodeinfo.go
	index f0c0b5e..4902c42 100644
	--- a/nodeinfo.go
	+++ b/nodeinfo.go
	@@ -1,115 +1,115 @@
	/*
	- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"github.com/writeas/web-core/log"
	"github.com/writefreely/go-nodeinfo"
	"github.com/writefreely/writefreely/config"
	"strings"
	)

	type nodeInfoResolver struct {
	cfg *config.Config
	db *datastore
	}

	func nodeInfoConfig(db datastore, cfg config.Config) *nodeinfo.Config {
	name := cfg.App.SiteName
	desc := cfg.App.SiteDesc
	if desc == "" {
	desc = "Minimal, federated blogging platform."
	}
	if cfg.App.SingleUser {
	// Fetch blog information, instead
	coll, err := db.GetCollectionByID(1)
	if err == nil {
	desc = coll.Description
	}
	}
	return &nodeinfo.Config{
	BaseURL: cfg.App.Host,
	InfoURL: "/api/nodeinfo",

	Metadata: nodeinfo.Metadata{
	NodeName: name,
	NodeDescription: desc,
	Private: cfg.App.Private,
	Software: nodeinfo.SoftwareMeta{
	HomePage: softwareURL,
	GitHub: "https://github.com/writefreely/writefreely",
	Follow: "https://writing.exchange/@write_as",
	},
	MaxBlogs: cfg.App.MaxBlogs,
	PublicReader: cfg.App.LocalTimeline,
	Invites: cfg.App.UserInvites != "",
	},
	Protocols: []nodeinfo.NodeProtocol{
	nodeinfo.ProtocolActivityPub,
	},
	Services: nodeinfo.Services{
	Inbound: []nodeinfo.NodeService{},
	Outbound: []nodeinfo.NodeService{
	nodeinfo.ServiceRSS,
	},
	},
	Software: nodeinfo.SoftwareInfo{
	Name: strings.ToLower(serverSoftware),
	Version: softwareVer,
	},
	}
	}

	func (r nodeInfoResolver) IsOpenRegistration() (bool, error) {
	return r.cfg.App.OpenRegistration, nil
	}

	func (r nodeInfoResolver) Usage() (nodeinfo.Usage, error) {
	var collCount, postCount int64
	var activeHalfYear, activeMonth int
	var err error
	collCount, err = r.db.GetTotalCollections()
	if err != nil {
	collCount = 0
	}
	postCount, err = r.db.GetTotalPosts()
	if err != nil {
	log.Error("Unable to fetch post counts: %v", err)
	}

	if r.cfg.App.PublicStats {
	// Display bi-yearly / monthly stats
	err = r.db.QueryRow(`SELECT COUNT(*) FROM (
	SELECT DISTINCT collection_id
	FROM posts
	INNER JOIN collections c
	ON collection_id = c.id
	WHERE collection_id IS NOT NULL
	AND updated > DATE_SUB(NOW(), INTERVAL 6 MONTH)) co`).Scan(&activeHalfYear)

	err = r.db.QueryRow(`SELECT COUNT(*) FROM (
	SELECT DISTINCT collection_id
	FROM posts
	INNER JOIN FROM collections c
	ON collection_id = c.id
	WHERE collection_id IS NOT NULL
	AND updated > DATE_SUB(NOW(), INTERVAL 1 MONTH)) co`).Scan(&activeMonth)
	}

	return nodeinfo.Usage{
	Users: nodeinfo.UsageUsers{
	Total: int(collCount),
	ActiveHalfYear: activeHalfYear,
	ActiveMonth: activeMonth,
	},
	LocalPosts: int(postCount),
	}, nil
	}
	diff --git a/oauth.go b/oauth.go
	index 2958721..ee08740 100644
	--- a/oauth.go
	+++ b/oauth.go
	@@ -1,467 +1,473 @@
	/*
	- * Copyright © 2019-2021 A Bunch Tell LLC.
	+ * Copyright © 2019-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"context"
	"encoding/json"
	"fmt"
	"io"
	"io/ioutil"
	"net/http"
	"net/url"
	"strings"
	"time"

	"github.com/gorilla/mux"
	"github.com/gorilla/sessions"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/config"
	)

	// OAuthButtons holds display information for different OAuth providers we support.
	type OAuthButtons struct {
	SlackEnabled bool
	WriteAsEnabled bool
	GitLabEnabled bool
	GitLabDisplayName string
	GiteaEnabled bool
	GiteaDisplayName string
	GenericEnabled bool
	GenericDisplayName string
	}

	// NewOAuthButtons creates a new OAuthButtons struct based on our app configuration.
	func NewOAuthButtons(cfg config.Config) OAuthButtons {
	return &OAuthButtons{
	SlackEnabled: cfg.SlackOauth.ClientID != "",
	WriteAsEnabled: cfg.WriteAsOauth.ClientID != "",
	GitLabEnabled: cfg.GitlabOauth.ClientID != "",
	GitLabDisplayName: config.OrDefaultString(cfg.GitlabOauth.DisplayName, gitlabDisplayName),
	GiteaEnabled: cfg.GiteaOauth.ClientID != "",
	GiteaDisplayName: config.OrDefaultString(cfg.GiteaOauth.DisplayName, giteaDisplayName),
	GenericEnabled: cfg.GenericOauth.ClientID != "",
	GenericDisplayName: config.OrDefaultString(cfg.GenericOauth.DisplayName, genericOauthDisplayName),
	}
	}

	// TokenResponse contains data returned when a token is created either
	// through a code exchange or using a refresh token.
	type TokenResponse struct {
	AccessToken string `json:"access_token"`
	ExpiresIn int `json:"expires_in"`
	RefreshToken string `json:"refresh_token"`
	TokenType string `json:"token_type"`
	Error string `json:"error"`
	}

	// InspectResponse contains data returned when an access token is inspected.
	type InspectResponse struct {
	ClientID string `json:"client_id"`
	UserID string `json:"user_id"`
	ExpiresAt time.Time `json:"expires_at"`
	Username string `json:"username"`
	DisplayName string `json:"-"`
	Email string `json:"email"`
	Error string `json:"error"`
	}

	// tokenRequestMaxLen is the most bytes that we'll read from the /oauth/token
	// endpoint. One megabyte is plenty.
	const tokenRequestMaxLen = 1000000

	// infoRequestMaxLen is the most bytes that we'll read from the
	// /oauth/inspect endpoint.
	const infoRequestMaxLen = 1000000

	// OAuthDatastoreProvider provides a minimal interface of data store, config,
	// and session store for use with the oauth handlers.
	type OAuthDatastoreProvider interface {
	DB() OAuthDatastore
	Config() *config.Config
	SessionStore() sessions.Store
	}

	// OAuthDatastore provides a minimal interface of data store methods used in
	// oauth functionality.
	type OAuthDatastore interface {
	GetIDForRemoteUser(context.Context, string, string, string) (int64, error)
	RecordRemoteUserID(context.Context, int64, string, string, string, string) error
	ValidateOAuthState(context.Context, string) (string, string, int64, string, error)
	GenerateOAuthState(context.Context, string, string, int64, string) (string, error)

	CreateUser(config.Config, User, string, string) error
	GetUserByID(int64) (*User, error)
	}

	type HttpClient interface {
	Do(req http.Request) (http.Response, error)
	}

	type oauthClient interface {
	GetProvider() string
	GetClientID() string
	GetCallbackLocation() string
	buildLoginURL(state string) (string, error)
	exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error)
	inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error)
	}

	type callbackProxyClient struct {
	server string
	callbackLocation string
	httpClient HttpClient
	}

	type oauthHandler struct {
	Config *config.Config
	DB OAuthDatastore
	Store sessions.Store
	EmailKey []byte
	oauthClient oauthClient
	callbackProxy *callbackProxyClient
	}

	func (h oauthHandler) viewOauthInit(app App, w http.ResponseWriter, r http.Request) error {
	ctx := r.Context()

	var attachUser int64
	if attach := r.URL.Query().Get("attach"); attach == "t" {
	user, _ := getUserAndSession(app, r)
	if user == nil {
	return impart.HTTPError{http.StatusInternalServerError, "cannot attach auth to user: user not found in session"}
	}
	attachUser = user.ID
	}

	state, err := h.DB.GenerateOAuthState(ctx, h.oauthClient.GetProvider(), h.oauthClient.GetClientID(), attachUser, r.FormValue("invite_code"))
	if err != nil {
	log.Error("viewOauthInit error: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"}
	}

	if h.callbackProxy != nil {
	if err := h.callbackProxy.register(ctx, state); err != nil {
	log.Error("viewOauthInit error: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, "could not register state server"}
	}
	}

	location, err := h.oauthClient.buildLoginURL(state)
	if err != nil {
	log.Error("viewOauthInit error: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, "could not prepare oauth redirect url"}
	}
	return impart.HTTPError{http.StatusTemporaryRedirect, location}
	}

	func configureSlackOauth(parentHandler Handler, r mux.Router, app *App) {
	if app.Config().SlackOauth.ClientID != "" {
	callbackLocation := app.Config().App.Host + "/oauth/callback/slack"

	var stateRegisterClient *callbackProxyClient = nil
	if app.Config().SlackOauth.CallbackProxyAPI != "" {
	stateRegisterClient = &callbackProxyClient{
	server: app.Config().SlackOauth.CallbackProxyAPI,
	callbackLocation: app.Config().App.Host + "/oauth/callback/slack",
	httpClient: config.DefaultHTTPClient(),
	}
	callbackLocation = app.Config().SlackOauth.CallbackProxy
	}
	oauthClient := slackOauthClient{
	ClientID: app.Config().SlackOauth.ClientID,
	ClientSecret: app.Config().SlackOauth.ClientSecret,
	TeamID: app.Config().SlackOauth.TeamID,
	HttpClient: config.DefaultHTTPClient(),
	CallbackLocation: callbackLocation,
	}
	configureOauthRoutes(parentHandler, r, app, oauthClient, stateRegisterClient)
	}
	}

	func configureWriteAsOauth(parentHandler Handler, r mux.Router, app *App) {
	if app.Config().WriteAsOauth.ClientID != "" {
	callbackLocation := app.Config().App.Host + "/oauth/callback/write.as"

	var callbackProxy *callbackProxyClient = nil
	if app.Config().WriteAsOauth.CallbackProxy != "" {
	callbackProxy = &callbackProxyClient{
	server: app.Config().WriteAsOauth.CallbackProxyAPI,
	callbackLocation: app.Config().App.Host + "/oauth/callback/write.as",
	httpClient: config.DefaultHTTPClient(),
	}
	callbackLocation = app.Config().WriteAsOauth.CallbackProxy
	}

	oauthClient := writeAsOauthClient{
	ClientID: app.Config().WriteAsOauth.ClientID,
	ClientSecret: app.Config().WriteAsOauth.ClientSecret,
	ExchangeLocation: config.OrDefaultString(app.Config().WriteAsOauth.TokenLocation, writeAsExchangeLocation),
	InspectLocation: config.OrDefaultString(app.Config().WriteAsOauth.InspectLocation, writeAsIdentityLocation),
	AuthLocation: config.OrDefaultString(app.Config().WriteAsOauth.AuthLocation, writeAsAuthLocation),
	HttpClient: config.DefaultHTTPClient(),
	CallbackLocation: callbackLocation,
	}
	configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
	}
	}

	func configureGitlabOauth(parentHandler Handler, r mux.Router, app *App) {
	if app.Config().GitlabOauth.ClientID != "" {
	callbackLocation := app.Config().App.Host + "/oauth/callback/gitlab"

	var callbackProxy *callbackProxyClient = nil
	if app.Config().GitlabOauth.CallbackProxy != "" {
	callbackProxy = &callbackProxyClient{
	server: app.Config().GitlabOauth.CallbackProxyAPI,
	callbackLocation: app.Config().App.Host + "/oauth/callback/gitlab",
	httpClient: config.DefaultHTTPClient(),
	}
	callbackLocation = app.Config().GitlabOauth.CallbackProxy
	}

	address := config.OrDefaultString(app.Config().GitlabOauth.Host, gitlabHost)
	oauthClient := gitlabOauthClient{
	ClientID: app.Config().GitlabOauth.ClientID,
	ClientSecret: app.Config().GitlabOauth.ClientSecret,
	ExchangeLocation: address + "/oauth/token",
	InspectLocation: address + "/api/v4/user",
	AuthLocation: address + "/oauth/authorize",
	HttpClient: config.DefaultHTTPClient(),
	CallbackLocation: callbackLocation,
	}
	configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
	}
	}

	func configureGenericOauth(parentHandler Handler, r mux.Router, app *App) {
	if app.Config().GenericOauth.ClientID != "" {
	callbackLocation := app.Config().App.Host + "/oauth/callback/generic"

	var callbackProxy *callbackProxyClient = nil
	if app.Config().GenericOauth.CallbackProxy != "" {
	callbackProxy = &callbackProxyClient{
	server: app.Config().GenericOauth.CallbackProxyAPI,
	callbackLocation: app.Config().App.Host + "/oauth/callback/generic",
	httpClient: config.DefaultHTTPClient(),
	}
	callbackLocation = app.Config().GenericOauth.CallbackProxy
	}

	oauthClient := genericOauthClient{
	ClientID: app.Config().GenericOauth.ClientID,
	ClientSecret: app.Config().GenericOauth.ClientSecret,
	ExchangeLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.TokenEndpoint,
	InspectLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.InspectEndpoint,
	AuthLocation: app.Config().GenericOauth.Host + app.Config().GenericOauth.AuthEndpoint,
	HttpClient: config.DefaultHTTPClient(),
	CallbackLocation: callbackLocation,
	Scope: config.OrDefaultString(app.Config().GenericOauth.Scope, "read_user"),
	MapUserID: config.OrDefaultString(app.Config().GenericOauth.MapUserID, "user_id"),
	MapUsername: config.OrDefaultString(app.Config().GenericOauth.MapUsername, "username"),
	MapDisplayName: config.OrDefaultString(app.Config().GenericOauth.MapDisplayName, "-"),
	MapEmail: config.OrDefaultString(app.Config().GenericOauth.MapEmail, "email"),
	}
	configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
	}
	}

	func configureGiteaOauth(parentHandler Handler, r mux.Router, app *App) {
	if app.Config().GiteaOauth.ClientID != "" {
	callbackLocation := app.Config().App.Host + "/oauth/callback/gitea"

	var callbackProxy *callbackProxyClient = nil
	if app.Config().GiteaOauth.CallbackProxy != "" {
	callbackProxy = &callbackProxyClient{
	server: app.Config().GiteaOauth.CallbackProxyAPI,
	callbackLocation: app.Config().App.Host + "/oauth/callback/gitea",
	httpClient: config.DefaultHTTPClient(),
	}
	callbackLocation = app.Config().GiteaOauth.CallbackProxy
	}

	oauthClient := giteaOauthClient{
	ClientID: app.Config().GiteaOauth.ClientID,
	ClientSecret: app.Config().GiteaOauth.ClientSecret,
	ExchangeLocation: app.Config().GiteaOauth.Host + "/login/oauth/access_token",
	- InspectLocation: app.Config().GiteaOauth.Host + "/api/v1/user",
	+ InspectLocation: app.Config().GiteaOauth.Host + "/login/oauth/userinfo",
	AuthLocation: app.Config().GiteaOauth.Host + "/login/oauth/authorize",
	HttpClient: config.DefaultHTTPClient(),
	CallbackLocation: callbackLocation,
	+ Scope: "openid profile email",
	+ MapUserID: "sub",
	+ MapUsername: "login",
	+ MapDisplayName: "full_name",
	+ MapEmail: "email",
	}
	configureOauthRoutes(parentHandler, r, app, oauthClient, callbackProxy)
	}
	}

	func configureOauthRoutes(parentHandler Handler, r mux.Router, app App, oauthClient oauthClient, callbackProxy callbackProxyClient) {
	handler := &oauthHandler{
	Config: app.Config(),
	DB: app.DB(),
	Store: app.SessionStore(),
	oauthClient: oauthClient,
	EmailKey: app.keys.EmailKey,
	callbackProxy: callbackProxy,
	}
	r.HandleFunc("/oauth/"+oauthClient.GetProvider(), parentHandler.OAuth(handler.viewOauthInit)).Methods("GET")
	r.HandleFunc("/oauth/callback/"+oauthClient.GetProvider(), parentHandler.OAuth(handler.viewOauthCallback)).Methods("GET")
	r.HandleFunc("/oauth/signup", parentHandler.OAuth(handler.viewOauthSignup)).Methods("POST")
	}

	func (h oauthHandler) viewOauthCallback(app App, w http.ResponseWriter, r http.Request) error {
	ctx := r.Context()

	code := r.FormValue("code")
	state := r.FormValue("state")

	provider, clientID, attachUserID, inviteCode, err := h.DB.ValidateOAuthState(ctx, state)
	if err != nil {
	log.Error("Unable to ValidateOAuthState: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}

	tokenResponse, err := h.oauthClient.exchangeOauthCode(ctx, code)
	if err != nil {
	log.Error("Unable to exchangeOauthCode: %s", err)
	// TODO: show user friendly message if needed
	// TODO: show NO message for cases like user pressing "Cancel" on authorize step
	addSessionFlash(app, w, r, err.Error(), nil)
	if attachUserID > 0 {
	return impart.HTTPError{http.StatusFound, "/me/settings"}
	}
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}

	// Now that we have the access token, let's use it real quick to make sure
	// it really really works.
	tokenInfo, err := h.oauthClient.inspectOauthAccessToken(ctx, tokenResponse.AccessToken)
	if err != nil {
	log.Error("Unable to inspectOauthAccessToken: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}

	localUserID, err := h.DB.GetIDForRemoteUser(ctx, tokenInfo.UserID, provider, clientID)
	if err != nil {
	log.Error("Unable to GetIDForRemoteUser: %s", err)
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}

	if localUserID != -1 && attachUserID > 0 {
	- if err = addSessionFlash(app, w, r, "This Slack account is already attached to another user.", nil); err != nil {
	+ if err = addSessionFlash(app, w, r, "This OAuth account is already attached to another user.", nil); err != nil {
	return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()}
	}
	return impart.HTTPError{http.StatusFound, "/me/settings"}
	}

	if localUserID != -1 {
	// Existing user, so log in now
	user, err := h.DB.GetUserByID(localUserID)
	if err != nil {
	log.Error("Unable to GetUserByID %d: %s", localUserID, err)
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}
	if err = loginOrFail(h.Store, w, r, user); err != nil {
	log.Error("Unable to loginOrFail %d: %s", localUserID, err)
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}
	return nil
	}
	if attachUserID > 0 {
	log.Info("attaching to user %d", attachUserID)
	+ log.Info("OAuth userid: %s", tokenInfo.UserID)
	err = h.DB.RecordRemoteUserID(r.Context(), attachUserID, tokenInfo.UserID, provider, clientID, tokenResponse.AccessToken)
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}
	return impart.HTTPError{http.StatusFound, "/me/settings"}
	}

	// New user registration below.
	// First, verify that user is allowed to register
	if inviteCode != "" {
	// Verify invite code is valid
	i, err := app.db.GetUserInvite(inviteCode)
	if err != nil {
	return impart.HTTPError{http.StatusInternalServerError, err.Error()}
	}
	if !i.Active(app.db) {
	return impart.HTTPError{http.StatusNotFound, "Invite link has expired."}
	}
	} else if !app.cfg.App.OpenRegistration {
	addSessionFlash(app, w, r, ErrUserNotFound.Error(), nil)
	return impart.HTTPError{http.StatusFound, "/login"}
	}

	displayName := tokenInfo.DisplayName
	if len(displayName) == 0 {
	displayName = tokenInfo.Username
	}

	tp := &oauthSignupPageParams{
	AccessToken: tokenResponse.AccessToken,
	TokenUsername: tokenInfo.Username,
	TokenAlias: tokenInfo.DisplayName,
	TokenEmail: tokenInfo.Email,
	TokenRemoteUser: tokenInfo.UserID,
	Provider: provider,
	ClientID: clientID,
	InviteCode: inviteCode,
	}
	tp.TokenHash = tp.HashTokenParams(h.Config.Server.HashSeed)

	return h.showOauthSignupPage(app, w, r, tp, nil)
	}

	func (r *callbackProxyClient) register(ctx context.Context, state string) error {
	form := url.Values{}
	form.Add("state", state)
	form.Add("location", r.callbackLocation)
	req, err := http.NewRequestWithContext(ctx, "POST", r.server, strings.NewReader(form.Encode()))
	if err != nil {
	return err
	}
	req.Header.Set("User-Agent", ServerUserAgent(""))
	req.Header.Set("Accept", "application/json")
	req.Header.Set("Content-Type", "application/x-www-form-urlencoded")

	resp, err := r.httpClient.Do(req)
	if err != nil {
	return err
	}
	if resp.StatusCode != http.StatusCreated {
	return fmt.Errorf("unable register state location: %d", resp.StatusCode)
	}

	return nil
	}

	func limitedJsonUnmarshal(body io.ReadCloser, n int, thing interface{}) error {
	lr := io.LimitReader(body, int64(n+1))
	data, err := ioutil.ReadAll(lr)
	if err != nil {
	return err
	}
	if len(data) == n+1 {
	return fmt.Errorf("content larger than max read allowance: %d", n)
	}
	return json.Unmarshal(data, thing)
	}

	func loginOrFail(store sessions.Store, w http.ResponseWriter, r http.Request, user User) error {
	// An error may be returned, but a valid session should always be returned.
	session, _ := store.Get(r, cookieName)
	session.Values[cookieUserVal] = user.Cookie()
	if err := session.Save(r, w); err != nil {
	fmt.Println("error saving session", err)
	return err
	}
	http.Redirect(w, r, "/", http.StatusTemporaryRedirect)
	return nil
	}
	diff --git a/oauth_generic.go b/oauth_generic.go
	index ccf6a0f..25c162b 100644
	--- a/oauth_generic.go
	+++ b/oauth_generic.go
	@@ -1,142 +1,142 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC and respective authors.
	+ * Copyright © 2020-2021 Musing Studio LLC and respective authors.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"context"
	"errors"
	"fmt"
	"github.com/writeas/web-core/log"
	"net/http"
	"net/url"
	"strings"
	)

	type genericOauthClient struct {
	ClientID string
	ClientSecret string
	AuthLocation string
	ExchangeLocation string
	InspectLocation string
	CallbackLocation string
	Scope string
	MapUserID string
	MapUsername string
	MapDisplayName string
	MapEmail string
	HttpClient HttpClient
	}

	var _ oauthClient = genericOauthClient{}

	const (
	genericOauthDisplayName = "OAuth"
	)

	func (c genericOauthClient) GetProvider() string {
	return "generic"
	}

	func (c genericOauthClient) GetClientID() string {
	return c.ClientID
	}

	func (c genericOauthClient) GetCallbackLocation() string {
	return c.CallbackLocation
	}

	func (c genericOauthClient) buildLoginURL(state string) (string, error) {
	u, err := url.Parse(c.AuthLocation)
	if err != nil {
	return "", err
	}
	q := u.Query()
	q.Set("client_id", c.ClientID)
	q.Set("redirect_uri", c.CallbackLocation)
	q.Set("response_type", "code")
	q.Set("state", state)
	q.Set("scope", c.Scope)
	u.RawQuery = q.Encode()
	return u.String(), nil
	}

	func (c genericOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) {
	form := url.Values{}
	form.Add("grant_type", "authorization_code")
	form.Add("redirect_uri", c.CallbackLocation)
	form.Add("scope", c.Scope)
	form.Add("code", code)
	req, err := http.NewRequest("POST", c.ExchangeLocation, strings.NewReader(form.Encode()))
	if err != nil {
	return nil, err
	}
	req.WithContext(ctx)
	req.Header.Set("User-Agent", ServerUserAgent(""))
	req.Header.Set("Accept", "application/json")
	req.Header.Set("Content-Type", "application/x-www-form-urlencoded")
	req.SetBasicAuth(c.ClientID, c.ClientSecret)

	resp, err := c.HttpClient.Do(req)
	if err != nil {
	return nil, err
	}
	if resp.StatusCode != http.StatusOK {
	return nil, errors.New("unable to exchange code for access token")
	}

	var tokenResponse TokenResponse
	if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil {
	return nil, err
	}
	if tokenResponse.Error != "" {
	return nil, errors.New(tokenResponse.Error)
	}
	return &tokenResponse, nil
	}

	func (c genericOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) {
	req, err := http.NewRequest("GET", c.InspectLocation, nil)
	if err != nil {
	return nil, err
	}
	req.WithContext(ctx)
	req.Header.Set("User-Agent", ServerUserAgent(""))
	req.Header.Set("Accept", "application/json")
	req.Header.Set("Authorization", "Bearer "+accessToken)

	resp, err := c.HttpClient.Do(req)
	if err != nil {
	return nil, err
	}
	if resp.StatusCode != http.StatusOK {
	return nil, errors.New("unable to inspect access token")
	}

	// since we don't know what the JSON from the server will look like, we create a
	// generic interface and then map manually to values set in the config
	var genericInterface map[string]interface{}
	if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &genericInterface); err != nil {
	return nil, err
	}

	// map each relevant field in inspectResponse to the mapped field from the config
	var inspectResponse InspectResponse
	inspectResponse.UserID, _ = genericInterface[c.MapUserID].(string)
	if inspectResponse.UserID == "" {
	log.Error("[CONFIGURATION ERROR] Generic OAuth provider returned empty UserID value (`%s`).\n Do you need to configure a different `map_user_id` value for this provider?", c.MapUserID)
	return nil, fmt.Errorf("no UserID (`%s`) value returned", c.MapUserID)
	}
	inspectResponse.Username, _ = genericInterface[c.MapUsername].(string)
	inspectResponse.DisplayName, _ = genericInterface[c.MapDisplayName].(string)
	inspectResponse.Email, _ = genericInterface[c.MapEmail].(string)

	return &inspectResponse, nil
	}
	diff --git a/oauth_gitea.go b/oauth_gitea.go
	index a9b7741..3ecd4a7 100644
	--- a/oauth_gitea.go
	+++ b/oauth_gitea.go
	@@ -1,114 +1,133 @@
	package writefreely

	import (
	"context"
	"errors"
	+ "fmt"
	+ "github.com/writeas/web-core/log"
	"net/http"
	"net/url"
	"strings"
	)

	type giteaOauthClient struct {
	ClientID string
	ClientSecret string
	AuthLocation string
	ExchangeLocation string
	InspectLocation string
	CallbackLocation string
	+ Scope string
	+ MapUserID string
	+ MapUsername string
	+ MapDisplayName string
	+ MapEmail string
	HttpClient HttpClient
	}

	var _ oauthClient = giteaOauthClient{}

	const (
	giteaDisplayName = "Gitea"
	)

	func (c giteaOauthClient) GetProvider() string {
	return "gitea"
	}

	func (c giteaOauthClient) GetClientID() string {
	return c.ClientID
	}

	func (c giteaOauthClient) GetCallbackLocation() string {
	return c.CallbackLocation
	}

	func (c giteaOauthClient) buildLoginURL(state string) (string, error) {
	u, err := url.Parse(c.AuthLocation)
	if err != nil {
	return "", err
	}
	q := u.Query()
	q.Set("client_id", c.ClientID)
	q.Set("redirect_uri", c.CallbackLocation)
	q.Set("response_type", "code")
	q.Set("state", state)
	- // q.Set("scope", "read_user")
	+ q.Set("scope", c.Scope)
	u.RawQuery = q.Encode()
	return u.String(), nil
	}

	func (c giteaOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) {
	form := url.Values{}
	form.Add("grant_type", "authorization_code")
	form.Add("redirect_uri", c.CallbackLocation)
	- // form.Add("scope", "read_user")
	+ form.Add("scope", c.Scope)
	form.Add("code", code)
	req, err := http.NewRequest("POST", c.ExchangeLocation, strings.NewReader(form.Encode()))
	if err != nil {
	return nil, err
	}
	req.WithContext(ctx)
	req.Header.Set("User-Agent", ServerUserAgent(""))
	req.Header.Set("Accept", "application/json")
	req.Header.Set("Content-Type", "application/x-www-form-urlencoded")
	req.SetBasicAuth(c.ClientID, c.ClientSecret)

	resp, err := c.HttpClient.Do(req)
	if err != nil {
	return nil, err
	}
	if resp.StatusCode != http.StatusOK {
	return nil, errors.New("unable to exchange code for access token")
	}

	var tokenResponse TokenResponse
	if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil {
	return nil, err
	}
	if tokenResponse.Error != "" {
	return nil, errors.New(tokenResponse.Error)
	}
	return &tokenResponse, nil
	}

	func (c giteaOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) {
	req, err := http.NewRequest("GET", c.InspectLocation, nil)
	if err != nil {
	return nil, err
	}
	req.WithContext(ctx)
	req.Header.Set("User-Agent", ServerUserAgent(""))
	req.Header.Set("Accept", "application/json")
	req.Header.Set("Authorization", "Bearer "+accessToken)

	resp, err := c.HttpClient.Do(req)
	if err != nil {
	return nil, err
	}
	if resp.StatusCode != http.StatusOK {
	return nil, errors.New("unable to inspect access token")
	}

	- var inspectResponse InspectResponse
	- if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &inspectResponse); err != nil {
	+ // since we don't know what the JSON from the server will look like, we create a
	+ // generic interface and then map manually to values set in the config
	+ var genericInterface map[string]interface{}
	+ if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &genericInterface); err != nil {
	return nil, err
	}
	- if inspectResponse.Error != "" {
	- return nil, errors.New(inspectResponse.Error)
	+
	+ // map each relevant field in inspectResponse to the mapped field from the config
	+ var inspectResponse InspectResponse
	+ inspectResponse.UserID, _ = genericInterface[c.MapUserID].(string)
	+ // log.Info("Userid from Gitea: %s", inspectResponse.UserID)
	+ if inspectResponse.UserID == "" {
	+ log.Error("[CONFIGURATION ERROR] Gitea OAuth provider returned empty UserID value (`%s`).\n Do you need to configure a different `map_user_id` value for this provider?", c.MapUserID)
	+ return nil, fmt.Errorf("no UserID (`%s`) value returned", c.MapUserID)
	}
	+ inspectResponse.Username, _ = genericInterface[c.MapUsername].(string)
	+ inspectResponse.DisplayName, _ = genericInterface[c.MapDisplayName].(string)
	+ inspectResponse.Email, _ = genericInterface[c.MapEmail].(string)
	+
	return &inspectResponse, nil
	}
	diff --git a/oauth_signup.go b/oauth_signup.go
	index 8dff416..b9b52c5 100644
	--- a/oauth_signup.go
	+++ b/oauth_signup.go
	@@ -1,231 +1,231 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"crypto/sha256"
	"encoding/hex"
	"fmt"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/auth"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/page"
	"html/template"
	"net/http"
	"strings"
	"time"
	)

	type viewOauthSignupVars struct {
	page.StaticPage
	To string
	Message template.HTML
	Flashes []template.HTML

	AccessToken string
	TokenUsername string
	TokenAlias string // TODO: rename this to match the data it represents: the collection title
	TokenEmail string
	TokenRemoteUser string
	Provider string
	ClientID string
	TokenHash string
	InviteCode string

	LoginUsername string
	Alias string // TODO: rename this to match the data it represents: the collection title
	Email string
	}

	const (
	oauthParamAccessToken = "access_token"
	oauthParamTokenUsername = "token_username"
	oauthParamTokenAlias = "token_alias"
	oauthParamTokenEmail = "token_email"
	oauthParamTokenRemoteUserID = "token_remote_user"
	oauthParamClientID = "client_id"
	oauthParamProvider = "provider"
	oauthParamHash = "signature"
	oauthParamUsername = "username"
	oauthParamAlias = "alias"
	oauthParamEmail = "email"
	oauthParamPassword = "password"
	oauthParamInviteCode = "invite_code"
	)

	type oauthSignupPageParams struct {
	AccessToken string
	TokenUsername string
	TokenAlias string // TODO: rename this to match the data it represents: the collection title
	TokenEmail string
	TokenRemoteUser string
	ClientID string
	Provider string
	TokenHash string
	InviteCode string
	}

	func (p oauthSignupPageParams) HashTokenParams(key string) string {
	hasher := sha256.New()
	hasher.Write([]byte(key))
	hasher.Write([]byte(p.AccessToken))
	hasher.Write([]byte(p.TokenUsername))
	hasher.Write([]byte(p.TokenAlias))
	hasher.Write([]byte(p.TokenEmail))
	hasher.Write([]byte(p.TokenRemoteUser))
	hasher.Write([]byte(p.ClientID))
	hasher.Write([]byte(p.Provider))
	return hex.EncodeToString(hasher.Sum(nil))
	}

	func (h oauthHandler) viewOauthSignup(app App, w http.ResponseWriter, r http.Request) error {
	tp := &oauthSignupPageParams{
	AccessToken: r.FormValue(oauthParamAccessToken),
	TokenUsername: r.FormValue(oauthParamTokenUsername),
	TokenAlias: r.FormValue(oauthParamTokenAlias),
	TokenEmail: r.FormValue(oauthParamTokenEmail),
	TokenRemoteUser: r.FormValue(oauthParamTokenRemoteUserID),
	ClientID: r.FormValue(oauthParamClientID),
	Provider: r.FormValue(oauthParamProvider),
	InviteCode: r.FormValue(oauthParamInviteCode),
	}
	if tp.HashTokenParams(h.Config.Server.HashSeed) != r.FormValue(oauthParamHash) {
	return impart.HTTPError{Status: http.StatusBadRequest, Message: "Request has been tampered with."}
	}
	tp.TokenHash = tp.HashTokenParams(h.Config.Server.HashSeed)
	if err := h.validateOauthSignup(r); err != nil {
	return h.showOauthSignupPage(app, w, r, tp, err)
	}

	var err error
	hashedPass := []byte{}
	clearPass := r.FormValue(oauthParamPassword)
	hasPass := clearPass != ""
	if hasPass {
	hashedPass, err = auth.HashPass([]byte(clearPass))
	if err != nil {
	return h.showOauthSignupPage(app, w, r, tp, fmt.Errorf("unable to hash password"))
	}
	}
	newUser := &User{
	Username: r.FormValue(oauthParamUsername),
	HashedPass: hashedPass,
	HasPass: hasPass,
	Email: prepareUserEmail(r.FormValue(oauthParamEmail), h.EmailKey),
	Created: time.Now().Truncate(time.Second).UTC(),
	}
	displayName := r.FormValue(oauthParamAlias)
	if len(displayName) == 0 {
	displayName = r.FormValue(oauthParamUsername)
	}

	err = h.DB.CreateUser(h.Config, newUser, displayName, "")
	if err != nil {
	return h.showOauthSignupPage(app, w, r, tp, err)
	}

	// Log invite if needed
	if tp.InviteCode != "" {
	err = app.db.CreateInvitedUser(tp.InviteCode, newUser.ID)
	if err != nil {
	return err
	}
	}

	err = h.DB.RecordRemoteUserID(r.Context(), newUser.ID, r.FormValue(oauthParamTokenRemoteUserID), r.FormValue(oauthParamProvider), r.FormValue(oauthParamClientID), r.FormValue(oauthParamAccessToken))
	if err != nil {
	return h.showOauthSignupPage(app, w, r, tp, err)
	}

	if err := loginOrFail(h.Store, w, r, newUser); err != nil {
	return h.showOauthSignupPage(app, w, r, tp, err)
	}
	return nil
	}

	func (h oauthHandler) validateOauthSignup(r *http.Request) error {
	username := r.FormValue(oauthParamUsername)
	if len(username) < h.Config.App.MinUsernameLen {
	return impart.HTTPError{Status: http.StatusBadRequest, Message: "Username is too short."}
	}
	if len(username) > 100 {
	return impart.HTTPError{Status: http.StatusBadRequest, Message: "Username is too long."}
	}
	collTitle := r.FormValue(oauthParamAlias)
	if len(collTitle) == 0 {
	collTitle = username
	}
	email := r.FormValue(oauthParamEmail)
	if len(email) > 0 {
	parts := strings.Split(email, "@")
	if len(parts) != 2 \|\| (len(parts[0]) < 1 \|\| len(parts[1]) < 1) {
	return impart.HTTPError{Status: http.StatusBadRequest, Message: "Invalid email address"}
	}
	}
	return nil
	}

	func (h oauthHandler) showOauthSignupPage(app App, w http.ResponseWriter, r http.Request, tp *oauthSignupPageParams, errMsg error) error {
	username := tp.TokenUsername
	collTitle := tp.TokenAlias
	email := tp.TokenEmail

	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	// Ignore this
	log.Error("Unable to get session; ignoring: %v", err)
	}

	if tmpValue := r.FormValue(oauthParamUsername); len(tmpValue) > 0 {
	username = tmpValue
	}
	if tmpValue := r.FormValue(oauthParamAlias); len(tmpValue) > 0 {
	collTitle = tmpValue
	}
	if tmpValue := r.FormValue(oauthParamEmail); len(tmpValue) > 0 {
	email = tmpValue
	}

	p := &viewOauthSignupVars{
	StaticPage: pageForReq(app, r),
	To: r.FormValue("to"),
	Flashes: []template.HTML{},

	AccessToken: tp.AccessToken,
	TokenUsername: tp.TokenUsername,
	TokenAlias: tp.TokenAlias,
	TokenEmail: tp.TokenEmail,
	TokenRemoteUser: tp.TokenRemoteUser,
	Provider: tp.Provider,
	ClientID: tp.ClientID,
	TokenHash: tp.TokenHash,
	InviteCode: tp.InviteCode,

	LoginUsername: username,
	Alias: collTitle,
	Email: email,
	}

	// Display any error messages
	flashes, _ := getSessionFlashes(app, w, r, session)
	for _, flash := range flashes {
	p.Flashes = append(p.Flashes, template.HTML(flash))
	}
	if errMsg != nil {
	p.Flashes = append(p.Flashes, template.HTML(errMsg.Error()))
	}
	err = pages["signup-oauth.tmpl"].ExecuteTemplate(w, "base", p)
	if err != nil {
	log.Error("Unable to render signup-oauth: %v", err)
	return err
	}
	return nil
	}
	diff --git a/oauth_slack.go b/oauth_slack.go
	index bad3775..a2752db 100644
	--- a/oauth_slack.go
	+++ b/oauth_slack.go
	@@ -1,178 +1,178 @@
	/*
	- * Copyright © 2019-2020 A Bunch Tell LLC.
	+ * Copyright © 2019-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"context"
	"errors"
	"github.com/writeas/slug"
	"net/http"
	"net/url"
	"strings"
	)

	type slackOauthClient struct {
	ClientID string
	ClientSecret string
	TeamID string
	CallbackLocation string
	HttpClient HttpClient
	}

	type slackExchangeResponse struct {
	OK bool `json:"ok"`
	AccessToken string `json:"access_token"`
	Scope string `json:"scope"`
	TeamName string `json:"team_name"`
	TeamID string `json:"team_id"`
	Error string `json:"error"`
	}

	type slackIdentity struct {
	Name string `json:"name"`
	ID string `json:"id"`
	Email string `json:"email"`
	}

	type slackTeam struct {
	Name string `json:"name"`
	ID string `json:"id"`
	}

	type slackUserIdentityResponse struct {
	OK bool `json:"ok"`
	User slackIdentity `json:"user"`
	Team slackTeam `json:"team"`
	Error string `json:"error"`
	}

	const (
	slackAuthLocation = "https://slack.com/oauth/authorize"
	slackExchangeLocation = "https://slack.com/api/oauth.access"
	slackIdentityLocation = "https://slack.com/api/users.identity"
	)

	var _ oauthClient = slackOauthClient{}

	func (c slackOauthClient) GetProvider() string {
	return "slack"
	}

	func (c slackOauthClient) GetClientID() string {
	return c.ClientID
	}

	func (c slackOauthClient) GetCallbackLocation() string {
	return c.CallbackLocation
	}

	func (c slackOauthClient) buildLoginURL(state string) (string, error) {
	u, err := url.Parse(slackAuthLocation)
	if err != nil {
	return "", err
	}
	q := u.Query()
	q.Set("client_id", c.ClientID)
	q.Set("scope", "identity.basic identity.email identity.team")
	q.Set("redirect_uri", c.CallbackLocation)
	q.Set("state", state)

	// If this param is not set, the user can select which team they
	// authenticate through and then we'd have to match the configured team
	// against the profile get. That is extra work in the post-auth phase
	// that we don't want to do.
	q.Set("team", c.TeamID)

	// The Slack OAuth docs don't explicitly list this one, but it is part of
	// the spec, so we include it anyway.
	q.Set("response_type", "code")
	u.RawQuery = q.Encode()
	return u.String(), nil
	}

	func (c slackOauthClient) exchangeOauthCode(ctx context.Context, code string) (*TokenResponse, error) {
	form := url.Values{}
	// The oauth.access documentation doesn't explicitly mention this
	// parameter, but it is part of the spec, so we include it anyway.
	// https://api.slack.com/methods/oauth.access
	form.Add("grant_type", "authorization_code")
	form.Add("redirect_uri", c.CallbackLocation)
	form.Add("code", code)
	req, err := http.NewRequest("POST", slackExchangeLocation, strings.NewReader(form.Encode()))
	if err != nil {
	return nil, err
	}
	req.WithContext(ctx)
	req.Header.Set("User-Agent", ServerUserAgent(""))
	req.Header.Set("Accept", "application/json")
	req.Header.Set("Content-Type", "application/x-www-form-urlencoded")
	req.SetBasicAuth(c.ClientID, c.ClientSecret)

	resp, err := c.HttpClient.Do(req)
	if err != nil {
	return nil, err
	}
	if resp.StatusCode != http.StatusOK {
	return nil, errors.New("unable to exchange code for access token")
	}

	var tokenResponse slackExchangeResponse
	if err := limitedJsonUnmarshal(resp.Body, tokenRequestMaxLen, &tokenResponse); err != nil {
	return nil, err
	}
	if !tokenResponse.OK {
	return nil, errors.New(tokenResponse.Error)
	}
	return tokenResponse.TokenResponse(), nil
	}

	func (c slackOauthClient) inspectOauthAccessToken(ctx context.Context, accessToken string) (*InspectResponse, error) {
	req, err := http.NewRequest("GET", slackIdentityLocation, nil)
	if err != nil {
	return nil, err
	}
	req.WithContext(ctx)
	req.Header.Set("User-Agent", ServerUserAgent(""))
	req.Header.Set("Accept", "application/json")
	req.Header.Set("Authorization", "Bearer "+accessToken)

	resp, err := c.HttpClient.Do(req)
	if err != nil {
	return nil, err
	}
	if resp.StatusCode != http.StatusOK {
	return nil, errors.New("unable to inspect access token")
	}

	var inspectResponse slackUserIdentityResponse
	if err := limitedJsonUnmarshal(resp.Body, infoRequestMaxLen, &inspectResponse); err != nil {
	return nil, err
	}
	if !inspectResponse.OK {
	return nil, errors.New(inspectResponse.Error)
	}
	return inspectResponse.InspectResponse(), nil
	}

	func (resp slackUserIdentityResponse) InspectResponse() *InspectResponse {
	return &InspectResponse{
	UserID: resp.User.ID,
	Username: slug.Make(resp.User.Name),
	DisplayName: resp.User.Name,
	Email: resp.User.Email,
	}
	}

	func (resp slackExchangeResponse) TokenResponse() *TokenResponse {
	return &TokenResponse{
	AccessToken: resp.AccessToken,
	}
	}
	diff --git a/oauth_test.go b/oauth_test.go
	index 553c1cb..1bd0bfc 100644
	--- a/oauth_test.go
	+++ b/oauth_test.go
	@@ -1,261 +1,261 @@
	/*
	- * Copyright © 2019-2021 A Bunch Tell LLC.
	+ * Copyright © 2019-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"context"
	"fmt"
	"github.com/gorilla/sessions"
	"github.com/stretchr/testify/assert"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/id"
	"github.com/writefreely/writefreely/config"
	"net/http"
	"net/http/httptest"
	"net/url"
	"strings"
	"testing"
	)

	type MockOAuthDatastoreProvider struct {
	DoDB func() OAuthDatastore
	DoConfig func() *config.Config
	DoSessionStore func() sessions.Store
	}

	type MockOAuthDatastore struct {
	DoGenerateOAuthState func(context.Context, string, string, int64, string) (string, error)
	DoValidateOAuthState func(context.Context, string) (string, string, int64, string, error)
	DoGetIDForRemoteUser func(context.Context, string, string, string) (int64, error)
	DoCreateUser func(config.Config, User, string) error
	DoRecordRemoteUserID func(context.Context, int64, string, string, string, string) error
	DoGetUserByID func(int64) (*User, error)
	}

	var _ OAuthDatastore = &MockOAuthDatastore{}

	type StringReadCloser struct {
	*strings.Reader
	}

	func (src *StringReadCloser) Close() error {
	return nil
	}

	type MockHTTPClient struct {
	DoDo func(req http.Request) (http.Response, error)
	}

	func (m MockHTTPClient) Do(req http.Request) (*http.Response, error) {
	if m.DoDo != nil {
	return m.DoDo(req)
	}
	return &http.Response{}, nil
	}

	func (m *MockOAuthDatastoreProvider) SessionStore() sessions.Store {
	if m.DoSessionStore != nil {
	return m.DoSessionStore()
	}
	return sessions.NewCookieStore([]byte("secret-key"))
	}

	func (m *MockOAuthDatastoreProvider) DB() OAuthDatastore {
	if m.DoDB != nil {
	return m.DoDB()
	}
	return &MockOAuthDatastore{}
	}

	func (m MockOAuthDatastoreProvider) Config() config.Config {
	if m.DoConfig != nil {
	return m.DoConfig()
	}
	cfg := config.New()
	cfg.UseSQLite(true)
	cfg.WriteAsOauth = config.WriteAsOauthCfg{
	ClientID: "development",
	ClientSecret: "development",
	AuthLocation: "https://write.as/oauth/login",
	TokenLocation: "https://write.as/oauth/token",
	InspectLocation: "https://write.as/oauth/inspect",
	}
	cfg.SlackOauth = config.SlackOauthCfg{
	ClientID: "development",
	ClientSecret: "development",
	TeamID: "development",
	}
	return cfg
	}

	func (m *MockOAuthDatastore) ValidateOAuthState(ctx context.Context, state string) (string, string, int64, string, error) {
	if m.DoValidateOAuthState != nil {
	return m.DoValidateOAuthState(ctx, state)
	}
	return "", "", 0, "", nil
	}

	func (m *MockOAuthDatastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) {
	if m.DoGetIDForRemoteUser != nil {
	return m.DoGetIDForRemoteUser(ctx, remoteUserID, provider, clientID)
	}
	return -1, nil
	}

	func (m MockOAuthDatastore) CreateUser(cfg config.Config, u *User, username, description string) error {
	if m.DoCreateUser != nil {
	return m.DoCreateUser(cfg, u, username)
	}
	u.ID = 1
	return nil
	}

	func (m *MockOAuthDatastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error {
	if m.DoRecordRemoteUserID != nil {
	return m.DoRecordRemoteUserID(ctx, localUserID, remoteUserID, provider, clientID, accessToken)
	}
	return nil
	}

	func (m MockOAuthDatastore) GetUserByID(userID int64) (User, error) {
	if m.DoGetUserByID != nil {
	return m.DoGetUserByID(userID)
	}
	user := &User{}
	return user, nil
	}

	func (m *MockOAuthDatastore) GenerateOAuthState(ctx context.Context, provider string, clientID string, attachUserID int64, inviteCode string) (string, error) {
	if m.DoGenerateOAuthState != nil {
	return m.DoGenerateOAuthState(ctx, provider, clientID, attachUserID, inviteCode)
	}
	return id.Generate62RandomString(14), nil
	}

	func TestViewOauthInit(t *testing.T) {

	t.Run("success", func(t *testing.T) {
	app := &MockOAuthDatastoreProvider{}
	h := oauthHandler{
	Config: app.Config(),
	DB: app.DB(),
	Store: app.SessionStore(),
	EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd},
	oauthClient: writeAsOauthClient{
	ClientID: app.Config().WriteAsOauth.ClientID,
	ClientSecret: app.Config().WriteAsOauth.ClientSecret,
	ExchangeLocation: app.Config().WriteAsOauth.TokenLocation,
	InspectLocation: app.Config().WriteAsOauth.InspectLocation,
	AuthLocation: app.Config().WriteAsOauth.AuthLocation,
	CallbackLocation: "http://localhost/oauth/callback",
	HttpClient: nil,
	},
	}
	req, err := http.NewRequest("GET", "/oauth/client", nil)
	assert.NoError(t, err)
	rr := httptest.NewRecorder()
	err = h.viewOauthInit(nil, rr, req)
	assert.NotNil(t, err)
	httpErr, ok := err.(impart.HTTPError)
	assert.True(t, ok)
	assert.Equal(t, http.StatusTemporaryRedirect, httpErr.Status)
	assert.NotEmpty(t, httpErr.Message)
	locURI, err := url.Parse(httpErr.Message)
	assert.NoError(t, err)
	assert.Equal(t, "/oauth/login", locURI.Path)
	assert.Equal(t, "development", locURI.Query().Get("client_id"))
	assert.Equal(t, "http://localhost/oauth/callback", locURI.Query().Get("redirect_uri"))
	assert.Equal(t, "code", locURI.Query().Get("response_type"))
	assert.NotEmpty(t, locURI.Query().Get("state"))
	})

	t.Run("state failure", func(t *testing.T) {
	app := &MockOAuthDatastoreProvider{
	DoDB: func() OAuthDatastore {
	return &MockOAuthDatastore{
	DoGenerateOAuthState: func(ctx context.Context, provider, clientID string, attachUserID int64, inviteCode string) (string, error) {
	return "", fmt.Errorf("pretend unable to write state error")
	},
	}
	},
	}
	h := oauthHandler{
	Config: app.Config(),
	DB: app.DB(),
	Store: app.SessionStore(),
	EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd},
	oauthClient: writeAsOauthClient{
	ClientID: app.Config().WriteAsOauth.ClientID,
	ClientSecret: app.Config().WriteAsOauth.ClientSecret,
	ExchangeLocation: app.Config().WriteAsOauth.TokenLocation,
	InspectLocation: app.Config().WriteAsOauth.InspectLocation,
	AuthLocation: app.Config().WriteAsOauth.AuthLocation,
	CallbackLocation: "http://localhost/oauth/callback",
	HttpClient: nil,
	},
	}
	req, err := http.NewRequest("GET", "/oauth/client", nil)
	assert.NoError(t, err)
	rr := httptest.NewRecorder()
	err = h.viewOauthInit(nil, rr, req)
	httpErr, ok := err.(impart.HTTPError)
	assert.True(t, ok)
	assert.NotEmpty(t, httpErr.Message)
	assert.Equal(t, http.StatusInternalServerError, httpErr.Status)
	assert.Equal(t, "could not prepare oauth redirect url", httpErr.Message)
	})
	}

	func TestViewOauthCallback(t *testing.T) {
	t.Run("success", func(t *testing.T) {
	app := &MockOAuthDatastoreProvider{}
	h := oauthHandler{
	Config: app.Config(),
	DB: app.DB(),
	Store: app.SessionStore(),
	EmailKey: []byte{0xd, 0xe, 0xc, 0xa, 0xf, 0xf, 0xb, 0xa, 0xd},
	oauthClient: writeAsOauthClient{
	ClientID: app.Config().WriteAsOauth.ClientID,
	ClientSecret: app.Config().WriteAsOauth.ClientSecret,
	ExchangeLocation: app.Config().WriteAsOauth.TokenLocation,
	InspectLocation: app.Config().WriteAsOauth.InspectLocation,
	AuthLocation: app.Config().WriteAsOauth.AuthLocation,
	CallbackLocation: "http://localhost/oauth/callback",
	HttpClient: &MockHTTPClient{
	DoDo: func(req http.Request) (http.Response, error) {
	switch req.URL.String() {
	case "https://write.as/oauth/token":
	return &http.Response{
	StatusCode: 200,
	Body: &StringReadCloser{strings.NewReader(`{"access_token": "access_token", "expires_in": 1000, "refresh_token": "refresh_token", "token_type": "access"}`)},
	}, nil
	case "https://write.as/oauth/inspect":
	return &http.Response{
	StatusCode: 200,
	Body: &StringReadCloser{strings.NewReader(`{"client_id": "development", "user_id": "1", "expires_at": "2019-12-19T11:42:01Z", "username": "nick", "email": "nick@testing.write.as"}`)},
	}, nil
	}

	return &http.Response{
	StatusCode: http.StatusNotFound,
	}, nil
	},
	},
	},
	}
	req, err := http.NewRequest("GET", "/oauth/callback", nil)
	assert.NoError(t, err)
	rr := httptest.NewRecorder()
	err = h.viewOauthCallback(&App{cfg: app.Config(), sessionStore: app.SessionStore()}, rr, req)
	assert.NoError(t, err)
	assert.Equal(t, http.StatusTemporaryRedirect, rr.Code)
	})
	}
	diff --git a/pad.go b/pad.go
	index d150334..55dde70 100644
	--- a/pad.go
	+++ b/pad.go
	@@ -1,190 +1,193 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"net/http"
	"strings"

	"github.com/gorilla/mux"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/page"
	)

	func handleViewPad(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	action := vars["action"]
	slug := vars["slug"]
	collAlias := vars["collection"]
	if app.cfg.App.SingleUser {
	// TODO: refactor all of this, especially for single-user blogs
	c, err := app.db.GetCollectionByID(1)
	if err != nil {
	return err
	}
	collAlias = c.Alias
	}
	appData := &struct {
	page.StaticPage
	Post *RawPost
	User *User
	Blogs *[]Collection
	Silenced bool

	Editing bool // True if we're modifying an existing post
	EditCollection *Collection // Collection of the post we're editing, if any
	}{
	StaticPage: pageForReq(app, r),
	Post: &RawPost{Font: "norm"},
	User: getUserSession(app, r),
	}
	var err error
	if appData.User != nil {
	appData.Blogs, err = app.db.GetPublishableCollections(appData.User, app.cfg.App.Host)
	if err != nil {
	log.Error("Unable to get user's blogs for Pad: %v", err)
	}
	appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID)
	if err != nil {
	+ if err == ErrUserNotFound {
	+ return err
	+ }
	log.Error("Unable to get user status for Pad: %v", err)
	}
	}

	padTmpl := app.cfg.App.Editor
	if templates[padTmpl] == nil {
	if padTmpl != "" {
	log.Info("No template '%s' found. Falling back to default 'pad' template.", padTmpl)
	}
	padTmpl = "pad"
	}

	if action == "" && slug == "" {
	// Not editing any post; simply render the Pad
	if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil {
	log.Error("Unable to execute template: %v", err)
	}

	return nil
	}

	// Retrieve post information for editing
	appData.Editing = true
	// Make sure this isn't cached, so user doesn't accidentally lose data
	w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
	w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT")
	if slug != "" {
	// TODO: refactor all of this, especially for single-user blogs
	appData.Post = getRawCollectionPost(app, slug, collAlias)
	if appData.Post.OwnerID != appData.User.ID {
	// TODO: add ErrForbiddenEditPost message to flashes
	return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/edit")]}
	}
	appData.EditCollection, err = app.db.GetCollectionForPad(collAlias)
	if err != nil {
	log.Error("Unable to GetCollectionForPad: %s", err)
	return err
	}
	appData.EditCollection.hostName = app.cfg.App.Host
	} else {
	// Editing a floating article
	appData.Post = getRawPost(app, action)
	appData.Post.Id = action
	}

	if appData.Post.Gone {
	return ErrPostUnpublished
	} else if appData.Post.Found && (appData.Post.Title != "" \|\| appData.Post.Content != "") {
	// Got the post
	} else if appData.Post.Found {
	log.Error("Found post, but other conditions failed.")
	return ErrPostFetchError
	} else {
	return ErrPostNotFound
	}

	if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil {
	log.Error("Unable to execute template: %v", err)
	}
	return nil
	}

	func handleViewMeta(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	action := vars["action"]
	slug := vars["slug"]
	collAlias := vars["collection"]
	appData := &struct {
	page.StaticPage
	Post *RawPost
	User *User
	EditCollection *Collection // Collection of the post we're editing, if any
	Flashes []string
	NeedsToken bool
	Silenced bool
	}{
	StaticPage: pageForReq(app, r),
	Post: &RawPost{Font: "norm"},
	User: getUserSession(app, r),
	}
	var err error
	appData.Silenced, err = app.db.IsUserSilenced(appData.User.ID)
	if err != nil {
	log.Error("view meta: get user status: %v", err)
	return ErrInternalGeneral
	}

	if action == "" && slug == "" {
	return ErrPostNotFound
	}

	// Make sure this isn't cached, so user doesn't accidentally lose data
	w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
	w.Header().Set("Expires", "Thu, 28 Jul 1989 12:00:00 GMT")
	if slug != "" {
	appData.Post = getRawCollectionPost(app, slug, collAlias)
	if appData.Post.OwnerID != appData.User.ID {
	// TODO: add ErrForbiddenEditPost message to flashes
	return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/meta")]}
	}
	if app.cfg.App.SingleUser {
	// TODO: optimize this query just like we do in GetCollectionForPad (?)
	appData.EditCollection, err = app.db.GetCollectionByID(1)
	} else {
	appData.EditCollection, err = app.db.GetCollectionForPad(collAlias)
	}
	if err != nil {
	return err
	}
	appData.EditCollection.hostName = app.cfg.App.Host
	} else {
	// Editing a floating article
	appData.Post = getRawPost(app, action)
	appData.Post.Id = action
	}
	appData.NeedsToken = appData.User == nil \|\| appData.User.ID != appData.Post.OwnerID

	if appData.Post.Gone {
	return ErrPostUnpublished
	} else if appData.Post.Found && appData.Post.Content != "" {
	// Got the post
	} else if appData.Post.Found {
	return ErrPostFetchError
	} else {
	return ErrPostNotFound
	}
	appData.Flashes, _ = getSessionFlashes(app, w, r, nil)

	if err = templates["edit-meta"].ExecuteTemplate(w, "edit-meta", appData); err != nil {
	log.Error("Unable to execute template: %v", err)
	}
	return nil
	}
	diff --git a/page/page.go b/page/page.go
	index 2cfb6cc..5ab7750 100644
	--- a/page/page.go
	+++ b/page/page.go
	@@ -1,47 +1,48 @@
	/*
	- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	// package page provides mechanisms and data for generating a WriteFreely page.
	package page

	import (
	"github.com/writefreely/writefreely/config"
	"strings"
	)

	type StaticPage struct {
	// App configuration
	config.AppCfg
	Version string
	HeaderNav bool
	+ CustomCSS bool

	// Request values
	Path string
	Username string
	Values map[string]string
	Flashes []string
	CanViewReader bool
	IsAdmin bool
	CanInvite bool
	}

	// SanitizeHost alters the StaticPage to contain a real hostname. This is
	// especially important for the Tor hidden service, as it can be served over
	// proxies, messing up the apparent hostname.
	func (sp StaticPage) SanitizeHost(cfg config.Config) {
	if cfg.Server.HiddenHost != "" && strings.HasPrefix(sp.Host, cfg.Server.HiddenHost) {
	sp.Host = cfg.Server.HiddenHost
	}
	}

	func (sp StaticPage) OfficialVersion() string {
	p := strings.Split(sp.Version, "-")
	return p[0]
	}
	diff --git a/pages.go b/pages.go
	index f871882..8b3a987 100644
	--- a/pages.go
	+++ b/pages.go
	@@ -1,164 +1,164 @@
	/*
	- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"github.com/writefreely/writefreely/config"
	"time"
	)

	var defaultPageUpdatedTime = time.Date(2018, 11, 8, 12, 0, 0, 0, time.Local)

	func getAboutPage(app App) (instanceContent, error) {
	c, err := app.db.GetDynamicContent("about")
	if err != nil {
	return nil, err
	}
	if c == nil {
	c = &instanceContent{
	ID: "about",
	Type: "page",
	Content: defaultAboutPage(app.cfg),
	}
	}
	if !c.Title.Valid {
	c.Title = defaultAboutTitle(app.cfg)
	}
	return c, nil
	}

	func defaultAboutTitle(cfg *config.Config) sql.NullString {
	return sql.NullString{String: "About " + cfg.App.SiteName, Valid: true}
	}

	func getPrivacyPage(app App) (instanceContent, error) {
	c, err := app.db.GetDynamicContent("privacy")
	if err != nil {
	return nil, err
	}
	if c == nil {
	c = &instanceContent{
	ID: "privacy",
	Type: "page",
	Content: defaultPrivacyPolicy(app.cfg),
	Updated: defaultPageUpdatedTime,
	}
	}
	if !c.Title.Valid {
	c.Title = defaultPrivacyTitle()
	}
	return c, nil
	}

	func defaultPrivacyTitle() sql.NullString {
	return sql.NullString{String: "Privacy Policy", Valid: true}
	}

	func defaultAboutPage(cfg *config.Config) string {
	if cfg.App.Federation {
	return `_` + cfg.App.SiteName + `_ is an interconnected place for you to write and publish, powered by [WriteFreely](https://writefreely.org) and ActivityPub.`
	}
	return `_` + cfg.App.SiteName + `_ is a place for you to write and publish, powered by [WriteFreely](https://writefreely.org).`
	}

	func defaultPrivacyPolicy(cfg *config.Config) string {
	return `[WriteFreely](https://writefreely.org), the software that powers this site, is built to enforce your right to privacy by default.

	It retains as little data about you as possible, not even requiring an email address to sign up. However, if you _do_ give us your email address, it is stored encrypted in our database. We salt and hash your account's password.

	We store log files, or data about what happens on our servers. We also use cookies to keep you logged in to your account.

	Beyond this, it's important that you trust whoever runs ` + cfg.App.SiteName + `. Software can only do so much to protect you -- your level of privacy protections will ultimately fall on the humans that run this particular service.`
	}

	func getLandingBanner(app App) (instanceContent, error) {
	c, err := app.db.GetDynamicContent("landing-banner")
	if err != nil {
	return nil, err
	}
	if c == nil {
	c = &instanceContent{
	ID: "landing-banner",
	Type: "section",
	Content: defaultLandingBanner(app.cfg),
	Updated: defaultPageUpdatedTime,
	}
	}
	return c, nil
	}

	func getLandingBody(app App) (instanceContent, error) {
	c, err := app.db.GetDynamicContent("landing-body")
	if err != nil {
	return nil, err
	}
	if c == nil {
	c = &instanceContent{
	ID: "landing-body",
	Type: "section",
	Content: defaultLandingBody(app.cfg),
	Updated: defaultPageUpdatedTime,
	}
	}
	return c, nil
	}

	func defaultLandingBanner(cfg *config.Config) string {
	if cfg.App.Federation {
	return "# Start your blog in the fediverse"
	}
	return "# Start your blog"
	}

	func defaultLandingBody(cfg *config.Config) string {
	if cfg.App.Federation {
	return `## Join the Fediverse

	The fediverse is a large network of platforms that all speak a common language. Imagine if you could reply to Instagram posts from Twitter, or interact with your favorite Medium blogs from Facebook -- federated alternatives like [PixelFed](https://pixelfed.org), [Mastodon](https://joinmastodon.org), and WriteFreely enable you to do these types of things.

	<div style="text-align:center">
	<iframe style="width: 560px; height: 315px; max-width: 100%;" sandbox="allow-same-origin allow-scripts" src="https://video.writeas.org/videos/embed/cc55e615-d204-417c-9575-7b57674cc6f3" frameborder="0" allowfullscreen></iframe>
	</div>

	## Write More Socially

	WriteFreely can communicate with other federated platforms like Mastodon, so people can follow your blogs, bookmark their favorite posts, and boost them to their followers. Sign up above to create a blog and join the fediverse.`
	}
	return ""
	}

	func getReaderSection(app App) (instanceContent, error) {
	c, err := app.db.GetDynamicContent("reader")
	if err != nil {
	return nil, err
	}
	if c == nil {
	c = &instanceContent{
	ID: "reader",
	Type: "section",
	Content: defaultReaderBanner(app.cfg),
	Updated: defaultPageUpdatedTime,
	}
	}
	if !c.Title.Valid {
	c.Title = defaultReaderTitle(app.cfg)
	}
	return c, nil
	}

	func defaultReaderTitle(cfg *config.Config) sql.NullString {
	return sql.NullString{String: "Reader", Valid: true}
	}

	func defaultReaderBanner(cfg *config.Config) string {
	return "Read the latest posts from " + cfg.App.SiteName + "."
	}
	diff --git a/parse/posts.go b/parse/posts.go
	index f660e08..6a9a910 100644
	--- a/parse/posts.go
	+++ b/parse/posts.go
	@@ -1,82 +1,82 @@
	/*
	- * Copyright © 2018-2020 A Bunch Tell LLC.
	+ * Copyright © 2018-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	// Package parse assists in the parsing of plain text posts
	package parse

	import (
	"github.com/writeas/web-core/stringmanip"
	"regexp"
	"strings"
	)

	var (
	titleElementReg = regexp.MustCompile("</?p>")
	urlReg = regexp.MustCompile("https?://")
	imgReg = regexp.MustCompile(`!\[([^]]+)\]$[^)]+$`)
	)

	// PostLede attempts to extract the first thought of the given post, generally
	// contained within the first line or sentence of text.
	func PostLede(t string, includePunc bool) string {
	// Adjust where we truncate if we want to include punctuation
	iAdj := 0
	if includePunc {
	iAdj = 1
	}

	// Find lede within first line of text
	nl := strings.IndexRune(t, '\n')
	if nl > -1 {
	t = t[:nl]
	}

	// Strip certain HTML tags
	t = titleElementReg.ReplaceAllString(t, "")

	// Strip URL protocols
	t = urlReg.ReplaceAllString(t, "")

	// Strip image URL, leaving only alt text
	t = imgReg.ReplaceAllString(t, " $1 ")

	// Find lede within first sentence
	punc := strings.Index(t, ". ")
	if punc > -1 {
	t = t[:punc+iAdj]
	}
	punc = stringmanip.IndexRune(t, '。')
	if punc > -1 {
	c := []rune(t)
	t = string(c[:punc+iAdj])
	}
	punc = stringmanip.IndexRune(t, '?')
	if punc > -1 {
	c := []rune(t)
	t = string(c[:punc+iAdj])
	}

	return t
	}

	// TruncToWord truncates the given text to the provided limit.
	func TruncToWord(s string, l int) (string, bool) {
	truncated := false
	c := []rune(s)
	if len(c) > l {
	truncated = true
	s = string(c[:l])
	spaceIdx := strings.LastIndexByte(s, ' ')
	if spaceIdx > -1 {
	s = s[:spaceIdx]
	}
	}
	return s, truncated
	}
	diff --git a/parse/posts_test.go b/parse/posts_test.go
	index 8f0d8b3..c377f57 100644
	--- a/parse/posts_test.go
	+++ b/parse/posts_test.go
	@@ -1,55 +1,55 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package parse

	import "testing"

	func TestPostLede(t *testing.T) {
	text := map[string]string{
	"早安。跨出舒適圈，才能前往": "早安。",
	"早安。This is my post. It is great.": "早安。",
	"Hello. 早安。": "Hello.",
	"Sup? Everyone says punctuation is punctuation.": "Sup?",
	"Humans are humans, and society is full of good and bad actors. Technology, at the most fundamental level, is a neutral tool that can be used by either to meet any ends. ": "Humans are humans, and society is full of good and bad actors.",
	`Online Domino Is Must For Everyone

	Do you want to understand how to play poker online?`: "Online Domino Is Must For Everyone",
	`おはようございます

	私は日本から帰ったばかりです。`: "おはようございます",
	"Hello, we say, おはよう. We say \"good morning\"": "Hello, we say, おはよう.",
	}

	c := 1
	for i, o := range text {
	if s := PostLede(i, true); s != o {
	t.Errorf("#%d: Got '%s' from '%s'; expected '%s'", c, s, i, o)
	}
	c++
	}
	}

	func TestTruncToWord(t *testing.T) {
	text := map[string]string{
	"Можливо, ми можемо використовувати інтернет-інструменти, щоб виготовити якийсь текст, який би міг бути і на, і в кінцевому підсумку, буде скорочено, тому що це тривало так довго.": "Можливо, ми можемо використовувати інтернет-інструменти, щоб виготовити якийсь",
	"早安。This is my post. It is great. It is a long post that is great that is a post that is great.": "早安。This is my post. It is great. It is a long post that is great that is a post",
	"Sup? Everyone says punctuation is punctuation.": "Sup? Everyone says punctuation is punctuation.",
	"I arrived in Japan six days ago. Tired from a 10-hour flight after a night-long layover in Calgary, I wandered wide-eyed around Narita airport looking for an ATM.": "I arrived in Japan six days ago. Tired from a 10-hour flight after a night-long",
	}

	c := 1
	for i, o := range text {
	if s, _ := TruncToWord(i, 80); s != o {
	t.Errorf("#%d: Got '%s' from '%s'; expected '%s'", c, s, i, o)
	}
	c++
	}
	}
	diff --git a/postrender.go b/postrender.go
	index 13bf02e..5be8d0c 100644
	--- a/postrender.go
	+++ b/postrender.go
	@@ -1,358 +1,361 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"bytes"
	"encoding/json"
	"fmt"
	"html"
	"html/template"
	"net/http"
	"net/url"
	"regexp"
	"strings"
	"unicode"
	"unicode/utf8"

	"github.com/microcosm-cc/bluemonday"
	stripmd "github.com/writeas/go-strip-markdown/v2"
	"github.com/writeas/impart"
	blackfriday "github.com/writeas/saturday"
	"github.com/writeas/web-core/log"
	"github.com/writeas/web-core/stringmanip"
	"github.com/writefreely/writefreely/config"
	"github.com/writefreely/writefreely/parse"
	)

	var (
	blockReg = regexp.MustCompile("<(ul\|ol\|blockquote)>\n")
	endBlockReg = regexp.MustCompile("</([a-z]+)>\n</(ul\|ol\|blockquote)>")
	youtubeReg = regexp.MustCompile("(https?://www.youtube.com/embed/[a-zA-Z0-9\\-_]+)(\\?[^\t\n\f\r \"']+)?")
	titleElementReg = regexp.MustCompile("</?h[1-6]>")
	hashtagReg = regexp.MustCompile(`{{\[\[\\|\\|([^\|]+)\\|\\|\]\]}}`)
	markeddownReg = regexp.MustCompile("<p>(.+)</p>")
	mentionReg = regexp.MustCompile(`@([A-Za-z0-9._%+-]+)(@[A-Za-z0-9.-]+\.[A-Za-z]+)\b`)
	)

	func (p Post) handlePremiumContent(c Collection, isOwner, postPage bool, cfg *config.Config) {
	if c.Monetization != "" {
	// User has Web Monetization enabled, so split content if it exists
	spl := strings.Index(p.Content, shortCodePaid)
	p.IsPaid = spl > -1
	if postPage {
	// We're viewing the individual post
	if isOwner {
	p.Content = strings.Replace(p.Content, shortCodePaid, "\n\n"+`<p class="split">Your subscriber content begins here.</p>`+"\n\n", 1)
	} else {
	if spl > -1 {
	p.Content = p.Content[:spl+len(shortCodePaid)]
	p.Content = strings.Replace(p.Content, shortCodePaid, "\n\n"+`<p class="split">Continue reading with a <strong>Coil</strong> membership.</p>`+"\n\n", 1)
	}
	}
	} else {
	// We've viewing the post on the collection landing
	if spl > -1 {
	baseURL := c.CanonicalURL()
	if isOwner {
	baseURL = "/" + c.Alias + "/"
	}

	p.Content = p.Content[:spl+len(shortCodePaid)]
	p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:spl]), baseURL, cfg))
	}
	}
	}
	}

	func (p Post) formatContent(cfg config.Config, c *Collection, isOwner bool, isPostPage bool) {
	baseURL := c.CanonicalURL()
	// TODO: redundant
	if !isSingleUser {
	baseURL = "/" + c.Alias + "/"
	}

	p.handlePremiumContent(c, isOwner, isPostPage, cfg)
	p.Content = strings.Replace(p.Content, "<!--paid-->", "<!--paid-->", 1)

	p.HTMLTitle = template.HTML(applyBasicMarkdown([]byte(p.Title.String)))
	p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), baseURL, cfg))
	if exc := strings.Index(string(p.Content), "<!--more-->"); exc > -1 {
	p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:exc]), baseURL, cfg))
	}
	}

	func (p PublicPost) formatContent(cfg config.Config, isOwner bool, isPostPage bool) {
	p.Post.formatContent(cfg, &p.Collection.Collection, isOwner, isPostPage)
	}

	func (p Post) augmentContent(c Collection) {
	if p.PinnedPosition.Valid {
	// Don't augment posts that are pinned
	return
	}
	if strings.Index(p.Content, "<!--nosig-->") > -1 {
	// Don't augment posts with the special "nosig" shortcode
	return
	}
	// Add post signatures
	if c.Signature != "" {
	p.Content += "\n\n" + c.Signature
	}
	}

	func (p *PublicPost) augmentContent() {
	p.Post.augmentContent(&p.Collection.Collection)
	}

	func (p *PublicPost) augmentReadingDestination() {
	if p.IsPaid {
	p.HTMLContent += template.HTML("\n\n" + `<p><a class="read-more" href="` + p.Collection.CanonicalURL() + p.Slug.String + `">` + localStr("Read more...", p.Language.String) + `</a> ($)</p>`)
	}
	}

	func applyMarkdown(data []byte, baseURL string, cfg *config.Config) string {
	return applyMarkdownSpecial(data, false, baseURL, cfg)
	}

	func disableYoutubeAutoplay(outHTML string) string {
	for _, match := range youtubeReg.FindAllString(outHTML, -1) {
	u, err := url.Parse(match)
	if err != nil {
	continue
	}
	u.RawQuery = html.UnescapeString(u.RawQuery)
	q := u.Query()
	// Set Youtube autoplay url parameter, if any, to 0
	if len(q["autoplay"]) == 1 {
	q.Set("autoplay", "0")
	}
	u.RawQuery = q.Encode()
	cleanURL := u.String()
	outHTML = strings.Replace(outHTML, match, cleanURL, 1)
	}
	return outHTML
	}

	func applyMarkdownSpecial(data []byte, skipNoFollow bool, baseURL string, cfg *config.Config) string {
	mdExtensions := 0 \|
	blackfriday.EXTENSION_TABLES \|
	blackfriday.EXTENSION_FENCED_CODE \|
	blackfriday.EXTENSION_AUTOLINK \|
	blackfriday.EXTENSION_STRIKETHROUGH \|
	blackfriday.EXTENSION_SPACE_HEADERS \|
	blackfriday.EXTENSION_AUTO_HEADER_IDS
	htmlFlags := 0 \|
	blackfriday.HTML_USE_SMARTYPANTS \|
	blackfriday.HTML_SMARTYPANTS_DASHES

	if baseURL != "" {
	htmlFlags \|= blackfriday.HTML_HASHTAGS
	}

	// Generate Markdown
	md := blackfriday.Markdown([]byte(data), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions)
	if baseURL != "" {
	// Replace special text generated by Markdown parser
	tagPrefix := baseURL + "tag:"
	if cfg.App.Chorus {
	tagPrefix = "/read/t/"
	}
	md = []byte(hashtagReg.ReplaceAll(md, []byte("<a href=\""+tagPrefix+"$1\" class=\"hashtag\"><span>#</span><span class=\"p-category\">$1</span></a>")))
	handlePrefix := cfg.App.Host + "/@/"
	md = []byte(mentionReg.ReplaceAll(md, []byte("<a href=\""+handlePrefix+"$1$2\" class=\"u-url mention\">@<span>$1$2</span></a>")))
	}
	// Strip out bad HTML
	policy := getSanitizationPolicy()
	policy.RequireNoFollowOnLinks(!skipNoFollow)
	outHTML := string(policy.SanitizeBytes(md))
	// Strip newlines on certain block elements that render with them
	outHTML = blockReg.ReplaceAllString(outHTML, "<$1>")
	outHTML = endBlockReg.ReplaceAllString(outHTML, "</$1></$2>")
	outHTML = disableYoutubeAutoplay(outHTML)
	return outHTML
	}

	func applyBasicMarkdown(data []byte) string {
	if len(bytes.TrimSpace(data)) == 0 {
	return ""
	}

	mdExtensions := 0 \|
	blackfriday.EXTENSION_STRIKETHROUGH \|
	blackfriday.EXTENSION_SPACE_HEADERS \|
	blackfriday.EXTENSION_HEADER_IDS
	htmlFlags := 0 \|
	blackfriday.HTML_SKIP_HTML \|
	blackfriday.HTML_USE_SMARTYPANTS \|
	blackfriday.HTML_SMARTYPANTS_DASHES

	// Generate Markdown
	// This passes the supplied title into blackfriday.Markdown() as an H1 header, so we only render HTML that
	// belongs in an H1.
	md := blackfriday.Markdown(append([]byte("# "), data...), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions)
	// Remove H1 markup
	md = bytes.TrimSpace(md) // blackfriday.Markdown adds a newline at the end of the <h1>
	+ if len(md) == 0 {
	+ return ""
	+ }
	md = md[len("<h1>") : len(md)-len("</h1>")]
	// Strip out bad HTML
	policy := bluemonday.UGCPolicy()
	policy.AllowAttrs("class", "id").Globally()
	outHTML := string(policy.SanitizeBytes(md))
	outHTML = markeddownReg.ReplaceAllString(outHTML, "$1")
	outHTML = strings.TrimRightFunc(outHTML, unicode.IsSpace)

	return outHTML
	}

	func postTitle(content, friendlyId string) string {
	const maxTitleLen = 80

	content = stripHTMLWithoutEscaping(content)

	content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace)
	eol := strings.IndexRune(content, '\n')
	blankLine := strings.Index(content, "\n\n")
	if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen {
	return strings.TrimSpace(content[:blankLine])
	} else if utf8.RuneCountInString(content) <= maxTitleLen {
	return content
	}
	return friendlyId
	}

	// TODO: fix duplicated code from postTitle. postTitle is a widely used func we
	// don't have time to investigate right now.
	func friendlyPostTitle(content, friendlyId string) string {
	const maxTitleLen = 80

	content = stripHTMLWithoutEscaping(content)

	content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace)
	eol := strings.IndexRune(content, '\n')
	blankLine := strings.Index(content, "\n\n")
	if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen {
	return strings.TrimSpace(content[:blankLine])
	} else if eol == -1 && utf8.RuneCountInString(content) <= maxTitleLen {
	return content
	}
	title, truncd := parse.TruncToWord(parse.PostLede(content, true), maxTitleLen)
	if truncd {
	title += "..."
	}
	return title
	}

	// Strip HTML tags with bluemonday's StrictPolicy, then unescape the HTML
	// entities added in by sanitizing the content.
	func stripHTMLWithoutEscaping(content string) string {
	return html.UnescapeString(bluemonday.StrictPolicy().Sanitize(content))
	}

	func getSanitizationPolicy() *bluemonday.Policy {
	policy := bluemonday.UGCPolicy()
	policy.AllowAttrs("src", "style").OnElements("iframe", "video", "audio")
	policy.AllowAttrs("src", "type").OnElements("source")
	policy.AllowAttrs("frameborder", "width", "height").Matching(bluemonday.Integer).OnElements("iframe")
	policy.AllowAttrs("allowfullscreen").OnElements("iframe")
	policy.AllowAttrs("controls", "loop", "muted", "autoplay").OnElements("video")
	policy.AllowAttrs("controls", "loop", "muted", "autoplay", "preload").OnElements("audio")
	policy.AllowAttrs("target").OnElements("a")
	policy.AllowAttrs("title").OnElements("abbr")
	policy.AllowAttrs("style", "class", "id").Globally()
	policy.AllowElements("header", "footer")
	policy.AllowURLSchemes("http", "https", "mailto", "xmpp")
	return policy
	}

	func sanitizePost(content string) string {
	return strings.Replace(content, "<", "<", -1)
	}

	// postDescription generates a description based on the given post content,
	// title, and post ID. This doesn't consider a V2 post field, `title` when
	// choosing what to generate. In case a post has a title, this function will
	// fail, and logic should instead be implemented to skip this when there's no
	// title, like so:
	// var desc string
	// if title == "" {
	// desc = postDescription(content, title, friendlyId)
	// } else {
	// desc = shortPostDescription(content)
	// }
	func postDescription(content, title, friendlyId string) string {
	maxLen := 140

	if content == "" {
	content = "WriteFreely is a painless, simple, federated blogging platform."
	} else {
	fmtStr := "%s"
	truncation := 0
	if utf8.RuneCountInString(content) > maxLen {
	// Post is longer than the max description, so let's show a better description
	fmtStr = "%s..."
	truncation = 3
	}

	if title == friendlyId {
	// No specific title was found; simply truncate the post, starting at the beginning
	content = fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1))
	} else {
	// There was a title, so return a real description
	blankLine := strings.Index(content, "\n\n")
	if blankLine < 0 {
	blankLine = 0
	}
	truncd := stringmanip.Substring(content, blankLine, blankLine+maxLen-truncation)
	contentNoNL := strings.Replace(truncd, "\n", " ", -1)
	content = strings.TrimSpace(fmt.Sprintf(fmtStr, contentNoNL))
	}
	}

	return content
	}

	func shortPostDescription(content string) string {
	maxLen := 140
	fmtStr := "%s"
	truncation := 0
	if utf8.RuneCountInString(content) > maxLen {
	// Post is longer than the max description, so let's show a better description
	fmtStr = "%s..."
	truncation = 3
	}
	return strings.TrimSpace(fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1)))
	}

	func handleRenderMarkdown(app App, w http.ResponseWriter, r http.Request) error {
	if !IsJSON(r) {
	return impart.HTTPError{Status: http.StatusUnsupportedMediaType, Message: "Markdown API only supports JSON requests"}
	}

	in := struct {
	CollectionURL string `json:"collection_url"`
	RawBody string `json:"raw_body"`
	}{}

	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&in)
	if err != nil {
	log.Error("Couldn't parse markdown JSON request: %v", err)
	return ErrBadJSON
	}

	out := struct {
	Body string `json:"body"`
	}{
	Body: applyMarkdown([]byte(in.RawBody), in.CollectionURL, app.cfg),
	}

	return impart.WriteSuccess(w, out, http.StatusOK)
	}
	diff --git a/postrender_test.go b/postrender_test.go
	index 531c0f1..ec6bbdd 100644
	--- a/postrender_test.go
	+++ b/postrender_test.go
	@@ -1,43 +1,43 @@
	/*
	- * Copyright © 2021 A Bunch Tell LLC.
	+ * Copyright © 2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import "testing"

	func TestApplyBasicMarkdown(t *testing.T) {
	tests := []struct {
	name string
	in string
	result string
	}{
	{"empty", "", ""},
	{"empty spaces", " ", ""},
	{"empty tabs", "\t", ""},
	{"empty newline", "\n", ""},
	{"nums", "123", "123"},
	{"dot", ".", "."},
	{"dash", "-", "-"},
	{"plain", "Hello, World!", "Hello, World!"},
	{"multibyte", "こんにちは", `こんにちは`},
	{"bold", "안녕하세요", `<strong>안녕하세요</strong>`},
	{"link", "[WriteFreely](https://writefreely.org)", `<a href="https://writefreely.org" rel="nofollow">WriteFreely</a>`},
	{"date", "12. April", `12. April`},
	{"table", "\| Hi \| There \|", `\| Hi \| There \|`},
	}
	for _, test := range tests {
	t.Run(test.name, func(t *testing.T) {
	res := applyBasicMarkdown([]byte(test.in))
	if res != test.result {
	t.Errorf("%s: wanted %s, got %s", test.name, test.result, res)
	}
	})
	}
	}
	diff --git a/posts.go b/posts.go
	index ef460ef..306f38c 100644
	--- a/posts.go
	+++ b/posts.go
	@@ -1,1682 +1,1684 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"encoding/json"
	"fmt"
	"github.com/writefreely/writefreely/spam"
	"html/template"
	"net/http"
	"net/url"
	"regexp"
	"strings"
	"time"

	"github.com/gorilla/mux"
	"github.com/guregu/null"
	"github.com/guregu/null/zero"
	"github.com/kylemcc/twitter-text-go/extract"
	"github.com/microcosm-cc/bluemonday"
	stripmd "github.com/writeas/go-strip-markdown/v2"
	"github.com/writeas/impart"
	"github.com/writeas/monday"
	"github.com/writeas/slug"
	"github.com/writeas/web-core/activitystreams"
	"github.com/writeas/web-core/bots"
	"github.com/writeas/web-core/converter"
	"github.com/writeas/web-core/i18n"
	"github.com/writeas/web-core/log"
	"github.com/writeas/web-core/tags"
	"github.com/writefreely/writefreely/page"
	"github.com/writefreely/writefreely/parse"
	)

	const (
	// Post ID length bounds
	minIDLen = 10
	maxIDLen = 10
	userPostIDLen = 10
	postIDLen = 10

	postMetaDateFormat = "2006-01-02 15:04:05"

	shortCodePaid = "<!--paid-->"
	)

	type (
	AnonymousPost struct {
	ID string
	Content string
	HTMLContent template.HTML
	Font string
	Language string
	Direction string
	Title string
	GenTitle string
	Description string
	Author string
	Views int64
	Images []string
	IsPlainText bool
	IsCode bool
	IsLinkable bool
	}

	AuthenticatedPost struct {
	ID string `json:"id" schema:"id"`
	Web bool `json:"web" schema:"web"`
	*SubmittedPost
	}

	// SubmittedPost represents a post supplied by a client for publishing or
	// updating. Since Title and Content can be updated to "", they are
	// pointers that can be easily tested to detect changes.
	SubmittedPost struct {
	Slug *string `json:"slug" schema:"slug"`
	Title *string `json:"title" schema:"title"`
	Content *string `json:"body" schema:"body"`
	Font string `json:"font" schema:"font"`
	IsRTL converter.NullJSONBool `json:"rtl" schema:"rtl"`
	Language converter.NullJSONString `json:"lang" schema:"lang"`
	Created *string `json:"created" schema:"created"`
	}

	// Post represents a post as found in the database.
	Post struct {
	ID string `db:"id" json:"id"`
	Slug null.String `db:"slug" json:"slug,omitempty"`
	Font string `db:"text_appearance" json:"appearance"`
	Language zero.String `db:"language" json:"language"`
	RTL zero.Bool `db:"rtl" json:"rtl"`
	Privacy int64 `db:"privacy" json:"-"`
	OwnerID null.Int `db:"owner_id" json:"-"`
	CollectionID null.Int `db:"collection_id" json:"-"`
	PinnedPosition null.Int `db:"pinned_position" json:"-"`
	Created time.Time `db:"created" json:"created"`
	Updated time.Time `db:"updated" json:"updated"`
	ViewCount int64 `db:"view_count" json:"-"`
	Title zero.String `db:"title" json:"title"`
	HTMLTitle template.HTML `db:"title" json:"-"`
	Content string `db:"content" json:"body"`
	HTMLContent template.HTML `db:"content" json:"-"`
	HTMLExcerpt template.HTML `db:"content" json:"-"`
	Tags []string `json:"tags"`
	Images []string `json:"images,omitempty"`
	IsPaid bool `json:"paid"`

	OwnerName string `json:"owner,omitempty"`
	}

	// PublicPost holds properties for a publicly returned post, i.e. a post in
	// a context where the viewer may not be the owner. As such, sensitive
	// metadata for the post is hidden and properties supporting the display of
	// the post are added.
	PublicPost struct {
	*Post
	IsSubdomain bool `json:"-"`
	IsTopLevel bool `json:"-"`
	DisplayDate string `json:"-"`
	Views int64 `json:"views"`
	Owner *PublicUser `json:"-"`
	IsOwner bool `json:"-"`
	URL string `json:"url,omitempty"`
	Collection *CollectionObj `json:"collection,omitempty"`
	}

	CollectionPostPage struct {
	*PublicPost
	page.StaticPage
	IsOwner bool
	IsPinned bool
	IsCustomDomain bool
	Monetization string
	PinnedPosts *[]PublicPost
	IsFound bool
	IsAdmin bool
	CanInvite bool
	Silenced bool

	// Helper field for Chorus mode
	CollAlias string
	}

	RawPost struct {
	Id, Slug string
	Title string
	Content string
	Views int64
	Font string
	Created time.Time
	Updated time.Time
	IsRTL sql.NullBool
	Language sql.NullString
	OwnerID int64
	CollectionID sql.NullInt64

	Found bool
	Gone bool
	}

	AnonymousAuthPost struct {
	ID string `json:"id"`
	Token string `json:"token"`
	}
	ClaimPostRequest struct {
	*AnonymousAuthPost
	CollectionAlias string `json:"collection"`
	CreateCollection bool `json:"create_collection"`

	// Generated properties
	Slug string `json:"-"`
	}
	ClaimPostResult struct {
	ID string `json:"id,omitempty"`
	Code int `json:"code,omitempty"`
	ErrorMessage string `json:"error_msg,omitempty"`
	Post *PublicPost `json:"post,omitempty"`
	}
	)

	func (p *Post) Direction() string {
	if p.RTL.Valid {
	if p.RTL.Bool {
	return "rtl"
	}
	return "ltr"
	}
	return "auto"
	}

	// DisplayTitle dynamically generates a title from the Post's contents if it
	// doesn't already have an explicit title.
	func (p *Post) DisplayTitle() string {
	if p.Title.String != "" {
	return p.Title.String
	}
	t := friendlyPostTitle(p.Content, p.ID)
	return t
	}

	// PlainDisplayTitle dynamically generates a title from the Post's contents if it
	// doesn't already have an explicit title.
	func (p *Post) PlainDisplayTitle() string {
	if t := stripmd.Strip(p.DisplayTitle()); t != "" {
	return t
	}
	return p.ID
	}

	// FormattedDisplayTitle dynamically generates a title from the Post's contents if it
	// doesn't already have an explicit title.
	func (p *Post) FormattedDisplayTitle() template.HTML {
	if p.HTMLTitle != "" {
	return p.HTMLTitle
	}
	return template.HTML(p.DisplayTitle())
	}

	// Summary gives a shortened summary of the post based on the post's title,
	// especially for display in a longer list of posts. It extracts a summary for
	// posts in the Title\n\nBody format, returning nothing if the entire was short
	// enough that the extracted title == extracted summary.
	func (p Post) Summary() string {
	if p.Content == "" {
	return ""
	}
	p.Content = stripHTMLWithoutEscaping(p.Content)
	// and Markdown
	p.Content = stripmd.StripOptions(p.Content, stripmd.Options{SkipImages: true})

	title := p.Title.String
	var desc string
	if title == "" {
	// No title, so generate one
	title = friendlyPostTitle(p.Content, p.ID)
	desc = postDescription(p.Content, title, p.ID)
	if desc == title {
	return ""
	}
	return desc
	}

	return shortPostDescription(p.Content)
	}

	func (p Post) SummaryHTML() template.HTML {
	return template.HTML(p.Summary())
	}

	// Excerpt shows any text that comes before a (more) tag.
	// TODO: use HTMLExcerpt in templates instead of this method
	func (p *Post) Excerpt() template.HTML {
	return p.HTMLExcerpt
	}

	func (p *Post) CreatedDate() string {
	return p.Created.Format("2006-01-02")
	}

	func (p *Post) Created8601() string {
	return p.Created.Format("2006-01-02T15:04:05Z")
	}

	func (p *Post) IsScheduled() bool {
	return p.Created.After(time.Now())
	}

	func (p *Post) HasTag(tag string) bool {
	// Regexp looks for tag and has a non-capturing group at the end looking
	// for the end of the word.
	// Assisted by: https://stackoverflow.com/a/35192941/1549194
	hasTag, _ := regexp.MatchString("#"+tag+`(?:[[:punct:]]\|\s\|\z)`, p.Content)
	return hasTag
	}

	func (p *Post) HasTitleLink() bool {
	if p.Title.String == "" {
	return false
	}
	hasLink, _ := regexp.MatchString(`([^!]+\|^)\[.+\]$.+$`, p.Title.String)
	return hasLink
	}

	func (c CollectionPostPage) DisplayMonetization() string {
	if c.Collection == nil {
	log.Info("CollectionPostPage.DisplayMonetization: c.Collection is nil")
	return ""
	}
	return displayMonetization(c.Monetization, c.Collection.Alias)
	}

	func handleViewPost(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	friendlyID := vars["post"]

	// NOTE: until this is done better, be sure to keep this in parity with
	// isRaw() and viewCollectionPost()
	isJSON := strings.HasSuffix(friendlyID, ".json")
	isXML := strings.HasSuffix(friendlyID, ".xml")
	isCSS := strings.HasSuffix(friendlyID, ".css")
	isMarkdown := strings.HasSuffix(friendlyID, ".md")
	isRaw := strings.HasSuffix(friendlyID, ".txt") \|\| isJSON \|\| isXML \|\| isCSS \|\| isMarkdown

	// Display reserved page if that is requested resource
	if t, ok := pages[r.URL.Path[1:]+".tmpl"]; ok {
	return handleTemplatedPage(app, w, r, t)
	} else if (strings.Contains(r.URL.Path, ".") && !isRaw && !isMarkdown) \|\| r.URL.Path == "/robots.txt" \|\| r.URL.Path == "/manifest.json" {
	// Serve static file
	app.shttp.ServeHTTP(w, r)
	return nil
	}

	// Display collection if this is a collection
	c, _ := app.db.GetCollection(friendlyID)
	if c != nil {
	return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", friendlyID)}
	}

	// Normalize the URL, redirecting user to consistent post URL
	if friendlyID != strings.ToLower(friendlyID) {
	return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s", strings.ToLower(friendlyID))}
	}

	ext := ""
	if isRaw {
	parts := strings.Split(friendlyID, ".")
	friendlyID = parts[0]
	if len(parts) > 1 {
	ext = "." + parts[1]
	}
	}

	var ownerID sql.NullInt64
	var title string
	var content string
	var font string
	var language []byte
	var rtl []byte
	var views int64
	var post *AnonymousPost
	var found bool
	var gone bool

	fixedID := slug.Make(friendlyID)
	if fixedID != friendlyID {
	return impart.HTTPError{http.StatusFound, fmt.Sprintf("/%s%s", fixedID, ext)}
	}

	err := app.db.QueryRow(fmt.Sprintf("SELECT owner_id, title, content, text_appearance, view_count, language, rtl FROM posts WHERE id = ?"), friendlyID).Scan(&ownerID, &title, &content, &font, &views, &language, &rtl)
	switch {
	case err == sql.ErrNoRows:
	found = false

	// Output the error in the correct format
	if isJSON {
	content = "{\"error\": \"Post not found.\"}"
	} else if isRaw {
	content = "Post not found."
	} else {
	return ErrPostNotFound
	}
	case err != nil:
	found = false

	log.Error("Post loading err: %s\n", err)
	return ErrInternalGeneral
	default:
	found = true

	var d string
	if len(rtl) == 0 {
	d = "auto"
	} else if rtl[0] == 49 {
	// TODO: find a cleaner way to get this (possibly NULL) value
	d = "rtl"
	} else {
	d = "ltr"
	}
	generatedTitle := friendlyPostTitle(content, friendlyID)
	sanitizedContent := content
	if font != "code" {
	sanitizedContent = template.HTMLEscapeString(content)
	}
	var desc string
	if title == "" {
	desc = postDescription(content, title, friendlyID)
	} else {
	desc = shortPostDescription(content)
	}
	post = &AnonymousPost{
	ID: friendlyID,
	Content: sanitizedContent,
	Title: title,
	GenTitle: generatedTitle,
	Description: desc,
	Author: "",
	Font: font,
	IsPlainText: isRaw,
	IsCode: font == "code",
	IsLinkable: font != "code",
	Views: views,
	Language: string(language),
	Direction: d,
	}
	if !isRaw {
	post.HTMLContent = template.HTML(applyMarkdown([]byte(content), "", app.cfg))
	post.Images = extractImages(post.Content)
	}
	}

	var silenced bool
	if found {
	silenced, err = app.db.IsUserSilenced(ownerID.Int64)
	if err != nil {
	log.Error("view post: %v", err)
	}
	}

	// Check if post has been unpublished
	if title == "" && content == "" {
	gone = true

	if isJSON {
	content = "{\"error\": \"Post was unpublished.\"}"
	} else if isCSS {
	content = ""
	} else if isRaw {
	content = "Post was unpublished."
	} else {
	return ErrPostUnpublished
	}
	}

	var u = &User{}
	if isRaw {
	contentType := "text/plain"
	if isJSON {
	contentType = "application/json"
	} else if isCSS {
	contentType = "text/css"
	} else if isXML {
	contentType = "application/xml"
	} else if isMarkdown {
	contentType = "text/markdown"
	}
	w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
	if isMarkdown && post.Title != "" {
	fmt.Fprintf(w, "%s\n", post.Title)
	for i := 1; i <= len(post.Title); i++ {
	fmt.Fprintf(w, "=")
	}
	fmt.Fprintf(w, "\n\n")
	}
	fmt.Fprint(w, content)

	if !found {
	return ErrPostNotFound
	} else if gone {
	return ErrPostUnpublished
	}
	} else {
	var err error
	page := struct {
	*AnonymousPost
	page.StaticPage
	Username string
	IsOwner bool
	SiteURL string
	Silenced bool
	}{
	AnonymousPost: post,
	StaticPage: pageForReq(app, r),
	SiteURL: app.cfg.App.Host,
	}
	if u = getUserSession(app, r); u != nil {
	page.Username = u.Username
	page.IsOwner = ownerID.Valid && ownerID.Int64 == u.ID
	}

	if !page.IsOwner && silenced {
	return ErrPostNotFound
	}
	page.Silenced = silenced
	err = templates["post"].ExecuteTemplate(w, "post", page)
	if err != nil {
	log.Error("Post template execute error: %v", err)
	}
	}

	go func() {
	if u != nil && ownerID.Valid && ownerID.Int64 == u.ID {
	// Post is owned by someone; skip view increment since that person is viewing this post.
	return
	}
	// Update stats for non-raw post views
	if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
	_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE id = ?", friendlyID)
	if err != nil {
	log.Error("Unable to update posts count: %v", err)
	}
	}
	}()

	return nil
	}

	// API v2 funcs
	// newPost creates a new post with or without an owning Collection.
	//
	// Endpoints:
	// /posts
	// /posts?collection={alias}
	// ? /collections/{alias}/posts
	func newPost(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)
	vars := mux.Vars(r)
	collAlias := vars["alias"]
	if collAlias == "" {
	collAlias = r.FormValue("collection")
	}
	accessToken := r.Header.Get("Authorization")
	if accessToken == "" {
	// TODO: remove this
	accessToken = r.FormValue("access_token")
	}

	// FIXME: determine web submission with Content-Type header
	var u *User
	var userID int64 = -1
	var username string
	if accessToken == "" {
	u = getUserSession(app, r)
	if u != nil {
	userID = u.ID
	username = u.Username
	}
	} else {
	userID = app.db.GetUserID(accessToken)
	}
	silenced, err := app.db.IsUserSilenced(userID)
	if err != nil {
	log.Error("new post: %v", err)
	}
	if silenced {
	return ErrUserSilenced
	}

	if userID == -1 {
	return ErrNotLoggedIn
	}

	if accessToken == "" && u == nil && collAlias != "" {
	return impart.HTTPError{http.StatusBadRequest, "Parameter `access_token` required."}
	}

	// Get post data
	var p *SubmittedPost
	if reqJSON {
	decoder := json.NewDecoder(r.Body)
	err = decoder.Decode(&p)
	if err != nil {
	log.Error("Couldn't parse new post JSON request: %v\n", err)
	return ErrBadJSON
	}
	if p.Title == nil {
	t := ""
	p.Title = &t
	}
	if strings.TrimSpace((p.Title)) == "" && (p.Content == nil \|\| strings.TrimSpace((p.Content)) == "") {
	return ErrNoPublishableContent
	}
	if p.Content == nil {
	c := ""
	p.Content = &c
	}

	} else {
	post := r.FormValue("body")
	appearance := r.FormValue("font")
	title := r.FormValue("title")
	rtlValue := r.FormValue("rtl")
	langValue := r.FormValue("lang")
	if strings.TrimSpace(post) == "" {
	return ErrNoPublishableContent
	}

	var isRTL, rtlValid bool
	if rtlValue == "auto" && langValue != "" {
	isRTL = i18n.LangIsRTL(langValue)
	rtlValid = true
	} else {
	isRTL = rtlValue == "true"
	rtlValid = rtlValue != "" && langValue != ""
	}

	// Create a new post
	p = &SubmittedPost{
	Title: &title,
	Content: &post,
	Font: appearance,
	IsRTL: converter.NullJSONBool{sql.NullBool{Bool: isRTL, Valid: rtlValid}},
	Language: converter.NullJSONString{sql.NullString{String: langValue, Valid: langValue != ""}},
	}
	}
	if !p.isFontValid() {
	p.Font = "norm"
	}

	var newPost *PublicPost = &PublicPost{}
	var coll *Collection
	if accessToken != "" {
	newPost, err = app.db.CreateOwnedPost(p, accessToken, collAlias, app.cfg.App.Host)
	} else {
	//return ErrNotLoggedIn
	// TODO: verify user is logged in
	var collID int64
	if collAlias != "" {
	coll, err = app.db.GetCollection(collAlias)
	if err != nil {
	return err
	}
	coll.hostName = app.cfg.App.Host
	if coll.OwnerID != u.ID {
	return ErrForbiddenCollection
	}
	collID = coll.ID
	}
	// TODO: return PublicPost from createPost
	newPost.Post, err = app.db.CreatePost(userID, collID, p)
	}
	if err != nil {
	return err
	}
	if coll != nil {
	coll.ForPublic()
	newPost.Collection = &CollectionObj{Collection: *coll}
	}

	newPost.extractData()
	newPost.OwnerName = username
	newPost.URL = newPost.CanonicalURL(app.cfg.App.Host)

	// Write success now
	response := impart.WriteSuccess(w, newPost, http.StatusCreated)

	if newPost.Collection != nil {
	if !app.cfg.App.Private && app.cfg.App.Federation && !newPost.Created.After(time.Now()) {
	go federatePost(app, newPost, newPost.Collection.ID, false)
	}
	if app.cfg.Letters.Enabled() && newPost.Collection.EmailSubsEnabled() {
	go app.db.InsertJob(&PostJob{
	PostID: newPost.ID,
	Action: "email",
	Delay: emailSendDelay,
	})
	}
	}

	return response
	}

	func existingPost(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)
	vars := mux.Vars(r)
	postID := vars["post"]

	p := AuthenticatedPost{ID: postID}
	var err error

	if reqJSON {
	// Decode JSON request
	decoder := json.NewDecoder(r.Body)
	err = decoder.Decode(&p)
	if err != nil {
	log.Error("Couldn't parse post update JSON request: %v\n", err)
	return ErrBadJSON
	}
	} else {
	err = r.ParseForm()
	if err != nil {
	log.Error("Couldn't parse post update form request: %v\n", err)
	return ErrBadFormData
	}

	// Can't decode to a nil SubmittedPost property, so create instance now
	p.SubmittedPost = &SubmittedPost{}
	err = app.formDecoder.Decode(&p, r.PostForm)
	if err != nil {
	log.Error("Couldn't decode post update form request: %v\n", err)
	return ErrBadFormData
	}
	}

	if p.Web {
	p.IsRTL.Valid = true
	}

	if p.SubmittedPost == nil {
	return ErrPostNoUpdatableVals
	}

	// Ensure an access token was given
	accessToken := r.Header.Get("Authorization")
	// Get user's cookie session if there's no token
	var u *User
	//var username string
	if accessToken == "" {
	u = getUserSession(app, r)
	if u != nil {
	//username = u.Username
	}
	}
	if u == nil && accessToken == "" {
	return ErrNoAccessToken
	}

	// Get user ID from current session or given access token, if one was given.
	var userID int64
	if u != nil {
	userID = u.ID
	} else if accessToken != "" {
	userID, err = AuthenticateUser(app.db, accessToken)
	if err != nil {
	return err
	}
	}

	silenced, err := app.db.IsUserSilenced(userID)
	if err != nil {
	log.Error("existing post: %v", err)
	}
	if silenced {
	return ErrUserSilenced
	}

	// Modify post struct
	p.ID = postID

	err = app.db.UpdateOwnedPost(&p, userID)
	if err != nil {
	if reqJSON {
	return err
	}

	if err, ok := err.(impart.HTTPError); ok {
	addSessionFlash(app, w, r, err.Message, nil)
	} else {
	addSessionFlash(app, w, r, err.Error(), nil)
	}
	}

	var pRes *PublicPost
	pRes, err = app.db.GetPost(p.ID, 0)
	if reqJSON {
	if err != nil {
	return err
	}
	pRes.extractData()
	}

	if pRes.CollectionID.Valid {
	coll, err := app.db.GetCollectionBy("id = ?", pRes.CollectionID.Int64)
	if err == nil && !app.cfg.App.Private && app.cfg.App.Federation {
	coll.hostName = app.cfg.App.Host
	pRes.Collection = &CollectionObj{Collection: *coll}
	go federatePost(app, pRes, pRes.Collection.ID, true)
	}
	}

	// Write success now
	if reqJSON {
	return impart.WriteSuccess(w, pRes, http.StatusOK)
	}

	addSessionFlash(app, w, r, "Changes saved.", nil)
	collectionAlias := vars["alias"]
	redirect := "/" + postID + "/meta"
	if collectionAlias != "" {
	collPre := "/" + collectionAlias
	if app.cfg.App.SingleUser {
	collPre = ""
	}
	redirect = collPre + "/" + pRes.Slug.String + "/edit/meta"
	} else {
	if app.cfg.App.SingleUser {
	redirect = "/d" + redirect
	}
	}
	w.Header().Set("Location", redirect)
	w.WriteHeader(http.StatusFound)

	return nil
	}

	func deletePost(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	friendlyID := vars["post"]
	editToken := r.FormValue("token")

	var ownerID int64
	var u *User
	accessToken := r.Header.Get("Authorization")
	if accessToken == "" && editToken == "" {
	u = getUserSession(app, r)
	if u == nil {
	return ErrNoAccessToken
	}
	}

	var res sql.Result
	var t *sql.Tx
	var err error
	var collID sql.NullInt64
	var coll *Collection
	var pp *PublicPost
	if editToken != "" {
	// TODO: SELECT owner_id, as well, and return appropriate error if NULL instead of running two queries
	var dummy int64
	err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ?", friendlyID).Scan(&dummy)
	switch {
	case err == sql.ErrNoRows:
	return impart.HTTPError{http.StatusNotFound, "Post not found."}
	}
	err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND owner_id IS NULL", friendlyID).Scan(&dummy)
	switch {
	case err == sql.ErrNoRows:
	// Post already has an owner. This could provide a bad experience
	// for the user, but it's more important to ensure data isn't lost
	// unexpectedly. So prevent deletion via token.
	return impart.HTTPError{http.StatusConflict, "This post belongs to some user (hopefully yours). Please log in and delete it from that user's account."}
	}
	res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND modify_token = ? AND owner_id IS NULL", friendlyID, editToken)
	} else if accessToken != "" \|\| u != nil {
	// Caller provided some way to authenticate; assume caller expects the
	// post to be deleted based on a specific post owner, thus we should
	// return corresponding errors.
	if accessToken != "" {
	ownerID = app.db.GetUserID(accessToken)
	if ownerID == -1 {
	return ErrBadAccessToken
	}
	} else {
	ownerID = u.ID
	}

	// TODO: don't make two queries
	var realOwnerID sql.NullInt64
	err = app.db.QueryRow("SELECT collection_id, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&collID, &realOwnerID)
	if err != nil {
	return err
	}
	if !collID.Valid {
	// There's no collection; simply delete the post
	res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
	} else {
	// Post belongs to a collection; do any additional clean up
	coll, err = app.db.GetCollectionBy("id = ?", collID.Int64)
	if err != nil {
	log.Error("Unable to get collection: %v", err)
	return err
	}
	if app.cfg.App.Federation {
	// First fetch full post for federation
	pp, err = app.db.GetOwnedPost(friendlyID, ownerID)
	if err != nil {
	log.Error("Unable to get owned post: %v", err)
	return err
	}
	collObj := &CollectionObj{Collection: *coll}
	pp.Collection = collObj
	}

	t, err = app.db.Begin()
	if err != nil {
	log.Error("No begin: %v", err)
	return err
	}
	res, err = t.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
	}
	} else {
	return impart.HTTPError{http.StatusBadRequest, "No authenticated user or post token given."}
	}
	if err != nil {
	return err
	}

	affected, err := res.RowsAffected()
	if err != nil {
	if t != nil {
	t.Rollback()
	log.Error("Rows affected err! Rolling back")
	}
	return err
	} else if affected == 0 {
	if t != nil {
	t.Rollback()
	log.Error("No rows affected! Rolling back")
	}
	return impart.HTTPError{http.StatusForbidden, "Post not found, or you're not the owner."}
	}
	if t != nil {
	t.Commit()
	}
	if coll != nil && !app.cfg.App.Private && app.cfg.App.Federation {
	go deleteFederatedPost(app, pp, collID.Int64)
	}

	return impart.HTTPError{Status: http.StatusNoContent}
	}

	// addPost associates a post with the authenticated user.
	func addPost(app App, w http.ResponseWriter, r http.Request) error {
	var ownerID int64

	// Authenticate user
	at := r.Header.Get("Authorization")
	if at != "" {
	ownerID = app.db.GetUserID(at)
	if ownerID == -1 {
	return ErrBadAccessToken
	}
	} else {
	u := getUserSession(app, r)
	if u == nil {
	return ErrNotLoggedIn
	}
	ownerID = u.ID
	}

	silenced, err := app.db.IsUserSilenced(ownerID)
	if err != nil {
	log.Error("add post: %v", err)
	}
	if silenced {
	return ErrUserSilenced
	}

	// Parse claimed posts in format:
	// [{"id": "...", "token": "..."}]
	var claims *[]ClaimPostRequest
	decoder := json.NewDecoder(r.Body)
	err = decoder.Decode(&claims)
	if err != nil {
	return ErrBadJSONArray
	}

	vars := mux.Vars(r)
	collAlias := vars["alias"]

	// Update all given posts
	res, err := app.db.ClaimPosts(app.cfg, ownerID, collAlias, claims)
	if err != nil {
	return err
	}

	for _, pRes := range *res {
	if pRes.Code != http.StatusOK {
	continue
	}
	if !app.cfg.App.Private && app.cfg.App.Federation {
	if !pRes.Post.Created.After(time.Now()) {
	pRes.Post.Collection.hostName = app.cfg.App.Host
	go federatePost(app, pRes.Post, pRes.Post.Collection.ID, false)
	}
	}
	if app.cfg.Letters.Enabled() && pRes.Post.Collection.EmailSubsEnabled() {
	go app.db.InsertJob(&PostJob{
	PostID: pRes.Post.ID,
	Action: "email",
	Delay: emailSendDelay,
	})
	}
	}
	return impart.WriteSuccess(w, res, http.StatusOK)
	}

	func dispersePost(app App, w http.ResponseWriter, r http.Request) error {
	var ownerID int64

	// Authenticate user
	at := r.Header.Get("Authorization")
	if at != "" {
	ownerID = app.db.GetUserID(at)
	if ownerID == -1 {
	return ErrBadAccessToken
	}
	} else {
	u := getUserSession(app, r)
	if u == nil {
	return ErrNotLoggedIn
	}
	ownerID = u.ID
	}

	// Parse posts in format:
	// ["..."]
	var postIDs []string
	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&postIDs)
	if err != nil {
	return ErrBadJSONArray
	}

	// Update all given posts
	res, err := app.db.DispersePosts(ownerID, postIDs)
	if err != nil {
	return err
	}
	return impart.WriteSuccess(w, res, http.StatusOK)
	}

	type (
	PinPostResult struct {
	ID string `json:"id,omitempty"`
	Code int `json:"code,omitempty"`
	ErrorMessage string `json:"error_msg,omitempty"`
	}
	)

	// pinPost pins a post to a blog
	func pinPost(app App, w http.ResponseWriter, r http.Request) error {
	var userID int64

	// Authenticate user
	at := r.Header.Get("Authorization")
	if at != "" {
	userID = app.db.GetUserID(at)
	if userID == -1 {
	return ErrBadAccessToken
	}
	} else {
	u := getUserSession(app, r)
	if u == nil {
	return ErrNotLoggedIn
	}
	userID = u.ID
	}

	silenced, err := app.db.IsUserSilenced(userID)
	if err != nil {
	log.Error("pin post: %v", err)
	}
	if silenced {
	return ErrUserSilenced
	}

	// Parse request
	var posts []struct {
	ID string `json:"id"`
	Position int64 `json:"position"`
	}
	decoder := json.NewDecoder(r.Body)
	err = decoder.Decode(&posts)
	if err != nil {
	return ErrBadJSONArray
	}

	// Validate data
	vars := mux.Vars(r)
	collAlias := vars["alias"]

	coll, err := app.db.GetCollection(collAlias)
	if err != nil {
	return err
	}
	if coll.OwnerID != userID {
	return ErrForbiddenCollection
	}

	// Do (un)pinning
	isPinning := r.URL.Path[strings.LastIndex(r.URL.Path, "/"):] == "/pin"
	res := []PinPostResult{}
	for _, p := range posts {
	err = app.db.UpdatePostPinState(isPinning, p.ID, coll.ID, userID, p.Position)
	ppr := PinPostResult{ID: p.ID}
	if err != nil {
	ppr.Code = http.StatusInternalServerError
	// TODO: set error messsage
	} else {
	ppr.Code = http.StatusOK
	}
	res = append(res, ppr)
	}
	return impart.WriteSuccess(w, res, http.StatusOK)
	}

	func fetchPost(app App, w http.ResponseWriter, r http.Request) error {
	var collID int64
	var coll *Collection
	var err error
	vars := mux.Vars(r)
	if collAlias := vars["alias"]; collAlias != "" {
	// Fetch collection information, since an alias is provided
	coll, err = app.db.GetCollection(collAlias)
	if err != nil {
	return err
	}
	collID = coll.ID
	}

	p, err := app.db.GetPost(vars["post"], collID)
	if err != nil {
	return err
	}
	if coll == nil && p.CollectionID.Valid {
	// Collection post is getting fetched by post ID, not coll alias + post slug, so get coll info now.
	coll, err = app.db.GetCollectionByID(p.CollectionID.Int64)
	if err != nil {
	return err
	}
	}
	if coll != nil {
	coll.hostName = app.cfg.App.Host
	_, err = apiCheckCollectionPermissions(app, r, coll)
	if err != nil {
	return err
	}
	}

	silenced, err := app.db.IsUserSilenced(p.OwnerID.Int64)
	if err != nil {
	log.Error("fetch post: %v", err)
	}
	if silenced {
	return ErrPostNotFound
	}

	p.extractData()

	accept := r.Header.Get("Accept")
	if strings.Contains(accept, "application/activity+json") {
	if coll == nil {
	// This is a draft post; 404 for now
	// TODO: return ActivityObject
	return impart.HTTPError{http.StatusNotFound, ""}
	}

	p.Collection = &CollectionObj{Collection: *coll}
	po := p.ActivityObject(app)
	po.Context = []interface{}{activitystreams.Namespace}
	setCacheControl(w, apCacheTime)
	return impart.RenderActivityJSON(w, po, http.StatusOK)
	}

	return impart.WriteSuccess(w, p, http.StatusOK)
	}

	func fetchPostProperty(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	p, err := app.db.GetPostProperty(vars["post"], 0, vars["property"])
	if err != nil {
	return err
	}

	return impart.WriteSuccess(w, p, http.StatusOK)
	}

	func (p *Post) processPost() PublicPost {
	res := &PublicPost{Post: p, Views: 0}
	res.Views = p.ViewCount
	// TODO: move to own function
	loc := monday.FuzzyLocale(p.Language.String)
	res.DisplayDate = monday.Format(p.Created, monday.LongFormatsByLocale[loc], loc)

	return *res
	}

	func (p *PublicPost) CanonicalURL(hostName string) string {
	if p.Collection == nil \|\| p.Collection.Alias == "" {
	return hostName + "/" + p.ID + ".md"
	}
	return p.Collection.CanonicalURL() + p.Slug.String
	}

	func (pp *PublicPost) DisplayCanonicalURL() string {
	us := pp.CanonicalURL(pp.Collection.hostName)
	u, err := url.Parse(us)
	if err != nil {
	return us
	}
	return u.Hostname() + u.Path
	}

	func (p PublicPost) ActivityObject(app App) *activitystreams.Object {
	cfg := app.cfg
	var o *activitystreams.Object
	if cfg.App.NotesOnly \|\| strings.Index(p.Content, "\n\n") == -1 {
	o = activitystreams.NewNoteObject()
	} else {
	o = activitystreams.NewArticleObject()
	}
	o.ID = p.Collection.FederatedAPIBase() + "api/posts/" + p.ID
	o.Published = p.Created
	o.URL = p.CanonicalURL(cfg.App.Host)
	o.AttributedTo = p.Collection.FederatedAccount()
	o.CC = []string{
	p.Collection.FederatedAccount() + "/followers",
	}
	o.Name = p.DisplayTitle()
	p.augmentContent()
	if p.HTMLContent == template.HTML("") {
	p.formatContent(cfg, false, false)
	p.augmentReadingDestination()
	}
	o.Content = string(p.HTMLContent)
	if p.Language.Valid {
	o.ContentMap = map[string]string{
	p.Language.String: string(p.HTMLContent),
	}
	}
	if len(p.Tags) == 0 {
	o.Tag = []activitystreams.Tag{}
	} else {
	var tagBaseURL string
	if isSingleUser {
	tagBaseURL = p.Collection.CanonicalURL() + "tag:"
	} else {
	if cfg.App.Chorus {
	tagBaseURL = fmt.Sprintf("%s/read/t/", p.Collection.hostName)
	} else {
	tagBaseURL = fmt.Sprintf("%s/%s/tag:", p.Collection.hostName, p.Collection.Alias)
	}
	}
	for _, t := range p.Tags {
	o.Tag = append(o.Tag, activitystreams.Tag{
	Type: activitystreams.TagHashtag,
	HRef: tagBaseURL + t,
	Name: "#" + t,
	})
	}
	}
	if len(p.Images) > 0 {
	for _, i := range p.Images {
	o.Attachment = append(o.Attachment, activitystreams.NewImageAttachment(i))
	}
	}
	// Find mentioned users
	mentionedUsers := make(map[string]string)

	stripper := bluemonday.StrictPolicy()
	content := stripper.Sanitize(p.Content)
	mentions := mentionReg.FindAllString(content, -1)

	for _, handle := range mentions {
	actorIRI, err := app.db.GetProfilePageFromHandle(app, handle)
	if err != nil {
	log.Info("Couldn't find user '%s' locally or remotely", handle)
	continue
	}
	mentionedUsers[handle] = actorIRI
	}

	for handle, iri := range mentionedUsers {
	o.CC = append(o.CC, iri)
	o.Tag = append(o.Tag, activitystreams.Tag{Type: "Mention", HRef: iri, Name: handle})
	}
	return o
	}

	// TODO: merge this into getSlugFromPost or phase it out
	func getSlug(title, lang string) string {
	return getSlugFromPost("", title, lang)
	}

	func getSlugFromPost(title, body, lang string) string {
	if title == "" {
	+ // Remove Markdown, so e.g. link URLs and image alt text don't make it into the slug
	+ body = strings.TrimSpace(stripmd.StripOptions(body, stripmd.Options{SkipImages: true}))
	title = postTitle(body, body)
	}
	title = parse.PostLede(title, false)
	// Truncate lede if needed
	title, _ = parse.TruncToWord(title, 80)
	var s string
	if lang != "" && len(lang) == 2 {
	s = slug.MakeLang(title, lang)
	} else {
	s = slug.Make(title)
	}

	// Transliteration may cause the slug to expand past the limit, so truncate again
	s, _ = parse.TruncToWord(s, 80)
	return strings.TrimFunc(s, func(r rune) bool {
	// TruncToWord doesn't respect words in a slug, since spaces are replaced
	// with hyphens. So remove any trailing hyphens.
	return r == '-'
	})
	}

	// isFontValid returns whether or not the submitted post's appearance is valid.
	func (p *SubmittedPost) isFontValid() bool {
	validFonts := map[string]bool{
	"norm": true,
	"sans": true,
	"mono": true,
	"wrap": true,
	"code": true,
	}

	_, valid := validFonts[p.Font]
	return valid
	}

	func getRawPost(app App, friendlyID string) RawPost {
	var content, font, title string
	var isRTL sql.NullBool
	var lang sql.NullString
	var ownerID sql.NullInt64
	var created, updated time.Time

	err := app.db.QueryRow("SELECT title, content, text_appearance, language, rtl, created, updated, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&title, &content, &font, &lang, &isRTL, &created, &updated, &ownerID)
	switch {
	case err == sql.ErrNoRows:
	return &RawPost{Content: "", Found: false, Gone: false}
	case err != nil:
	log.Error("Unable to fetch getRawPost: %s", err)
	return &RawPost{Content: "", Found: true, Gone: false}
	}

	return &RawPost{
	Title: title,
	Content: content,
	Font: font,
	Created: created,
	Updated: updated,
	IsRTL: isRTL,
	Language: lang,
	OwnerID: ownerID.Int64,
	Found: true,
	Gone: content == "" && title == "",
	}

	}

	// TODO; return a Post!
	func getRawCollectionPost(app App, slug, collAlias string) RawPost {
	var id, title, content, font string
	var isRTL sql.NullBool
	var lang sql.NullString
	var created, updated time.Time
	var ownerID null.Int
	var views int64
	var err error

	if app.cfg.App.SingleUser {
	err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = 1", slug).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID)
	} else {
	err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = (SELECT id FROM collections WHERE alias = ?)", slug, collAlias).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID)
	}
	switch {
	case err == sql.ErrNoRows:
	return &RawPost{Content: "", Found: false, Gone: false}
	case err != nil:
	log.Error("Unable to fetch getRawCollectionPost: %s", err)
	return &RawPost{Content: "", Found: true, Gone: false}
	}

	return &RawPost{
	Id: id,
	Slug: slug,
	Title: title,
	Content: content,
	Font: font,
	Created: created,
	Updated: updated,
	IsRTL: isRTL,
	Language: lang,
	OwnerID: ownerID.Int64,
	Found: true,
	Gone: content == "" && title == "",
	Views: views,
	}
	}

	func isRaw(r *http.Request) bool {
	vars := mux.Vars(r)
	slug := vars["slug"]

	// NOTE: until this is done better, be sure to keep this in parity with
	// isRaw in viewCollectionPost() and handleViewPost()
	isJSON := strings.HasSuffix(slug, ".json")
	isXML := strings.HasSuffix(slug, ".xml")
	isMarkdown := strings.HasSuffix(slug, ".md")
	return strings.HasSuffix(slug, ".txt") \|\| isJSON \|\| isXML \|\| isMarkdown
	}

	func viewCollectionPost(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	slug := vars["slug"]

	// NOTE: until this is done better, be sure to keep this in parity with
	// isRaw() and handleViewPost()
	isJSON := strings.HasSuffix(slug, ".json")
	isXML := strings.HasSuffix(slug, ".xml")
	isMarkdown := strings.HasSuffix(slug, ".md")
	isRaw := strings.HasSuffix(slug, ".txt") \|\| isJSON \|\| isXML \|\| isMarkdown

	cr := &collectionReq{}
	err := processCollectionRequest(cr, vars, w, r)
	if err != nil {
	return err
	}

	// Check for hellbanned users
	u, err := checkUserForCollection(app, cr, r, true)
	if err != nil {
	return err
	}

	// Normalize the URL, redirecting user to consistent post URL
	if slug != strings.ToLower(slug) {
	loc := fmt.Sprintf("/%s", strings.ToLower(slug))
	if !app.cfg.App.SingleUser {
	loc = "/" + cr.alias + loc
	}
	return impart.HTTPError{http.StatusMovedPermanently, loc}
	}

	// Display collection if this is a collection
	var c *Collection
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(cr.alias)
	}
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	if err.Status == http.StatusNotFound {
	// Redirect if necessary
	newAlias := app.db.GetCollectionRedirect(cr.alias)
	if newAlias != "" {
	return impart.HTTPError{http.StatusFound, "/" + newAlias + "/" + slug}
	}
	}
	}
	return err
	}
	c.hostName = app.cfg.App.Host

	silenced, err := app.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("view collection post: %v", err)
	}

	// Check collection permissions
	if c.IsPrivate() && (u == nil \|\| u.ID != c.OwnerID) {
	return ErrPostNotFound
	}
	if c.IsProtected() && (u == nil \|\| u.ID != c.OwnerID) {
	if silenced {
	return ErrPostNotFound
	} else if !isAuthorizedForCollection(app, c.Alias, r) {
	return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/?g=" + slug}
	}
	}

	cr.isCollOwner = u != nil && c.OwnerID == u.ID

	if isRaw {
	slug = strings.Split(slug, ".")[0]
	}

	// Fetch extra data about the Collection
	// TODO: refactor out this logic, shared in collection.go:fetchCollection()
	coll := NewCollectionObj(c)
	owner, err := app.db.GetUserByID(coll.OwnerID)
	if err != nil {
	// Log the error and just continue
	log.Error("Error getting user for collection: %v", err)
	} else {
	coll.Owner = owner
	}

	postFound := true
	p, err := app.db.GetPost(slug, coll.ID)
	if err != nil {
	if err == ErrCollectionPageNotFound {
	postFound = false

	if slug == "feed" {
	// User tried to access blog feed without a trailing slash, and
	// there's no post with a slug "feed"
	return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "feed/"}
	}

	po := &Post{
	Slug: null.NewString(slug, true),
	Font: "norm",
	Language: zero.NewString("en", true),
	RTL: zero.NewBool(false, true),
	Content: `<p class="msg">This page is missing.</p>

	Are you sure it was ever here?`,
	}
	pp := po.processPost()
	p = &pp
	} else {
	return err
	}
	}

	// Check if the authenticated user is the post owner
	p.IsOwner = u != nil && u.ID == p.OwnerID.Int64
	p.Collection = coll
	p.IsTopLevel = app.cfg.App.SingleUser

	// Only allow a post owner or admin to view a post for silenced collections
	if silenced && !p.IsOwner && (u == nil \|\| !u.IsAdmin()) {
	return ErrPostNotFound
	}

	// Check if post has been unpublished
	if p.Content == "" && p.Title.String == "" {
	return impart.HTTPError{http.StatusGone, "Post was unpublished."}
	}

	p.augmentContent()

	// Serve collection post
	if isRaw {
	contentType := "text/plain"
	if isJSON {
	contentType = "application/json"
	} else if isXML {
	contentType = "application/xml"
	} else if isMarkdown {
	contentType = "text/markdown"
	}
	w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
	if !postFound {
	w.WriteHeader(http.StatusNotFound)
	fmt.Fprintf(w, "Post not found.")
	// TODO: return error instead, so status is correctly reflected in logs
	return nil
	}
	if isMarkdown && p.Title.String != "" {
	fmt.Fprintf(w, "# %s\n\n", p.Title.String)
	}
	fmt.Fprint(w, p.Content)
	} else if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
	if !postFound {
	return ErrCollectionPageNotFound
	}
	p.extractData()
	ap := p.ActivityObject(app)
	ap.Context = []interface{}{activitystreams.Namespace}
	setCacheControl(w, apCacheTime)
	return impart.RenderActivityJSON(w, ap, http.StatusOK)
	} else {
	p.extractData()
	p.Content = strings.Replace(p.Content, "<!--more-->", "", 1)
	if app.cfg.Letters.Enabled() && c.EmailSubsEnabled() {
	// TODO: indicate plan is inactive or subs disabled when OWNER is viewing their own post.
	if u != nil && u.IsEmailSubscriber(app, c.ID) {
	p.Content = strings.Replace(p.Content, "<!--emailsub-->", `<p id="emailsub">You're subscribed to email updates. <a href="/api/collections/`+c.Alias+`/email/unsubscribe?slug=`+p.Slug.String+`">Unsubscribe</a>.</p>`, -1)
	} else {
	p.Content = strings.Replace(p.Content, "<!--emailsub-->", `<form method="post" id="emailsub" action="/api/collections/`+c.Alias+`/email/subscribe"><input type="hidden" name="slug" value="`+p.Slug.String+`" /><input type="hidden" name="web" value="1" /><div style="position: absolute; left: -5000px;" aria-hidden="true"><input type="email" name="`+spam.HoneypotFieldName()+`" tabindex="-1" value="" /><input type="password" name="fake_password" tabindex="-1" placeholder="password" autocomplete="new-password" /></div><input type="email" name="email" placeholder="me@example.com" /><input type="submit" id="subscribe-btn" value="Subscribe" /></form>`, -1)
	}
	}
	p.Content = strings.Replace(p.Content, "<!--emailsub-->", "<!--emailsub-->", 1)
	// TODO: move this to function
	p.formatContent(app.cfg, cr.isCollOwner, true)
	tp := CollectionPostPage{
	PublicPost: p,
	StaticPage: pageForReq(app, r),
	IsOwner: cr.isCollOwner,
	IsCustomDomain: cr.isCustomDomain,
	IsFound: postFound,
	Silenced: silenced,
	CollAlias: c.Alias,
	}
	tp.IsAdmin = u != nil && u.IsAdmin()
	tp.CanInvite = canUserInvite(app.cfg, tp.IsAdmin)
	tp.PinnedPosts, _ = app.db.GetPinnedPosts(coll, p.IsOwner)
	tp.IsPinned = len(*tp.PinnedPosts) > 0 && PostsContains(tp.PinnedPosts, p)
	tp.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")

	if !postFound {
	w.WriteHeader(http.StatusNotFound)
	}
	postTmpl := "collection-post"
	if app.cfg.App.Chorus {
	postTmpl = "chorus-collection-post"
	}
	if err := templates[postTmpl].ExecuteTemplate(w, "post", tp); err != nil {
	log.Error("Error in %s template: %v", postTmpl, err)
	}
	}

	go func() {
	if p.OwnerID.Valid {
	// Post is owned by someone. Don't update stats if owner is viewing the post.
	if u != nil && p.OwnerID.Int64 == u.ID {
	return
	}
	}
	// Update stats for non-raw post views
	if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
	_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE slug = ? AND collection_id = ?", slug, coll.ID)
	if err != nil {
	log.Error("Unable to update posts count: %v", err)
	}
	}
	}()

	return nil
	}

	// TODO: move this to utils after making it more generic
	func PostsContains(sl []PublicPost, s PublicPost) bool {
	for _, e := range *sl {
	if e.ID == s.ID {
	return true
	}
	}
	return false
	}

	func (p *Post) extractData() {
	p.Tags = tags.Extract(p.Content)
	p.extractImages()
	}

	func (p *Post) IsSans() bool {
	return p.Font == "sans"
	}

	func (p *Post) IsMonospace() bool {
	return p.Font == "mono"
	}

	func (rp *RawPost) UserFacingCreated() string {
	return rp.Created.Format(postMetaDateFormat)
	}

	func (rp *RawPost) Created8601() string {
	return rp.Created.Format("2006-01-02T15:04:05Z")
	}

	func (rp *RawPost) Updated8601() string {
	if rp.Updated.IsZero() {
	return ""
	}
	return rp.Updated.Format("2006-01-02T15:04:05Z")
	}

	var imageURLRegex = regexp.MustCompile(`(?i)[^ ]+\.(gif\|png\|jpg\|jpeg\|image)$`)

	func (p *Post) extractImages() {
	p.Images = extractImages(p.Content)
	}

	func extractImages(content string) []string {
	matches := extract.ExtractUrls(content)
	urls := map[string]bool{}
	for i := range matches {
	uRaw := matches[i].Text
	// Parse the extracted text so we can examine the path
	u, err := url.Parse(uRaw)
	if err != nil {
	continue
	}
	// Ensure the path looks like it leads to an image file
	if !imageURLRegex.MatchString(u.Path) {
	continue
	}
	urls[uRaw] = true
	}

	resURLs := make([]string, 0)
	for k := range urls {
	resURLs = append(resURLs, k)
	}
	return resURLs
	}
	diff --git a/posts_test.go b/posts_test.go
	index 0c9bc95..612c178 100644
	--- a/posts_test.go
	+++ b/posts_test.go
	@@ -1,45 +1,45 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely_test

	import (
	"testing"

	"github.com/guregu/null/zero"
	"github.com/stretchr/testify/assert"
	"github.com/writefreely/writefreely"
	)

	func TestPostSummary(t *testing.T) {
	testCases := map[string]struct {
	given writefreely.Post
	expected string
	}{
	"no special chars": {givenPost("Content."), "Content."},
	"HTML content": {givenPost("Content <p>with a</p> paragraph."), "Content with a paragraph."},
	"content with escaped char": {givenPost("Content's all OK."), "Content's all OK."},
	"multiline content": {givenPost(`Content
	in
	multiple
	lines.`), "Content in multiple lines."},
	}

	for name, test := range testCases {
	t.Run(name, func(t *testing.T) {
	actual := test.given.Summary()
	assert.Equal(t, test.expected, actual)
	})
	}
	}

	func givenPost(content string) writefreely.Post {
	return writefreely.Post{Title: zero.StringFrom("Title"), Content: content}
	}
	diff --git a/prose/markdownSerializer.js b/prose/markdownSerializer.js
	index 6ccf6bc..685703c 100644
	--- a/prose/markdownSerializer.js
	+++ b/prose/markdownSerializer.js
	@@ -1,128 +1,128 @@
	import { MarkdownSerializer } from "prosemirror-markdown";

	function backticksFor(node, side) {
	const ticks = /`+/g;
	let m;
	let len = 0;
	if (node.isText)
	while ((m = ticks.exec(node.text))) len = Math.max(len, m[0].length);
	let result = len > 0 && side > 0 ? " `" : "`";
	for (let i = 0; i < len; i++) result += "`";
	if (len > 0 && side < 0) result += " ";
	return result;
	}

	function isPlainURL(link, parent, index, side) {
	if (link.attrs.title \|\| !/^\w+:/.test(link.attrs.href)) return false;
	const content = parent.child(index + (side < 0 ? -1 : 0));
	if (
	!content.isText \|\|
	content.text != link.attrs.href \|\|
	content.marks[content.marks.length - 1] != link
	)
	return false;
	if (index == (side < 0 ? 1 : parent.childCount - 1)) return true;
	const next = parent.child(index + (side < 0 ? -2 : 1));
	return !link.isInSet(next.marks);
	}

	export const writeFreelyMarkdownSerializer = new MarkdownSerializer(
	{
	readmore(state, node) {
	state.write("<!--more-->\n");
	state.closeBlock(node);
	},
	blockquote(state, node) {
	state.wrapBlock("> ", null, node, () => state.renderContent(node));
	},
	code_block(state, node) {
	state.write(`\`\`\`${node.attrs.params \|\| ""}\n`);
	state.text(node.textContent, false);
	state.ensureNewLine();
	state.write("```");
	state.closeBlock(node);
	},
	heading(state, node) {
	state.write(`${state.repeat("#", node.attrs.level)} `);
	state.renderInline(node);
	state.closeBlock(node);
	},
	horizontal_rule: function horizontal_rule(state, node) {
	state.write(node.attrs.markup \|\| "---");
	state.closeBlock(node);
	},
	bullet_list(state, node) {
	node.attrs.tight = true;
	state.renderList(node, " ", () => `${node.attrs.bullet \|\| "*"} `);
	},
	ordered_list(state, node) {
	const start = node.attrs.order \|\| 1;
	const maxW = String(start + node.childCount - 1).length;
	const space = state.repeat(" ", maxW + 2);
	state.renderList(node, space, (i) => {
	const nStr = String(start + i);
	return `${state.repeat(" ", maxW - nStr.length) + nStr}. `;
	});
	},
	list_item(state, node) {
	state.renderContent(node);
	},
	paragraph(state, node) {
	state.renderInline(node);
	state.closeBlock(node);
	},

	image(state, node) {
	state.write(
	`![${state.esc(node.attrs.alt \|\| "")}](${state.esc(node.attrs.src)}${
	node.attrs.title ? ` ${state.quote(node.attrs.title)}` : ""
	})`
	);
	},
	hard_break(state, node, parent, index) {
	for (let i = index + 1; i < parent.childCount; i += 1)
	if (parent.child(i).type !== node.type) {
	state.write("\\\n");
	return;
	}
	},
	text(state, node) {
	state.text(node.text \|\| "");
	},
	},
	{
	em: {
	- open: "*",
	- close: "*",
	+ open: "_",
	+ close: "_",
	mixable: true,
	expelEnclosingWhitespace: true,
	},
	strong: {
	open: "**",
	close: "**",
	mixable: true,
	expelEnclosingWhitespace: true,
	},
	link: {
	open(_state, mark, parent, index) {
	return isPlainURL(mark, parent, index, 1) ? "<" : "[";
	},
	close(state, mark, parent, index) {
	return isPlainURL(mark, parent, index, -1)
	? ">"
	: `](${state.esc(mark.attrs.href)}${
	mark.attrs.title ? ` ${state.quote(mark.attrs.title)}` : ""
	})`;
	},
	},
	code: {
	open(_state, _mark, parent, index) {
	return backticksFor(parent.child(index), -1);
	},
	close(_state, _mark, parent, index) {
	return backticksFor(parent.child(index - 1), 1);
	},
	escape: false,
	},
	}
	);
	diff --git a/prose/package-lock.json b/prose/package-lock.json
	index adcd161..e82ddc6 100644
	--- a/prose/package-lock.json
	+++ b/prose/package-lock.json
	@@ -1,16278 +1,16280 @@
	{
	"name": "prose",
	"version": "1.0.0",
	"lockfileVersion": 2,
	"requires": true,
	"packages": {
	"": {
	+ "name": "prose",
	"version": "1.0.0",
	"license": "ISC",
	"dependencies": {
	"babel-core": "^6.26.3",
	"babel-preset-es2015": "^6.24.1",
	"markdown-it": "^12.0.4",
	- "prosemirror-example-setup": "^1.1.2",
	+ "prosemirror-example-setup": "github:writefreely/prosemirror-example-setup",
	"prosemirror-keymap": "^1.1.4",
	- "prosemirror-markdown": "github:VV-EE/prosemirror-markdown",
	+ "prosemirror-markdown": "github:writefreely/prosemirror-markdown",
	"prosemirror-model": "^1.9.1",
	"prosemirror-state": "^1.3.2",
	"prosemirror-view": "^1.14.2",
	"webpack": "^4.42.0",
	"webpack-cli": "^3.3.11"
	},
	"devDependencies": {
	"@babel/core": "^7.8.7",
	"@babel/preset-env": "^7.9.0",
	"babel-loader": "^8.0.6",
	"prettier": "^2.2.1"
	}
	},
	"node_modules/@babel/code-frame": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz",
	"integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.8.3"
	}
	},
	"node_modules/@babel/compat-data": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.11.0.tgz",
	"integrity": "sha512-TPSvJfv73ng0pfnEOh17bYMPQbI95+nGWc71Ss4vZdRBHTDqmM9Z8ZV4rYz8Ks7sfzc95n30k6ODIq5UGnXcYQ==",
	"dev": true,
	"dependencies": {
	"browserslist": "^4.12.0",
	"invariant": "^2.2.4",
	"semver": "^5.5.0"
	}
	},
	"node_modules/@babel/core": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/core/-/core-7.8.7.tgz",
	"integrity": "sha512-rBlqF3Yko9cynC5CCFy6+K/w2N+Sq/ff2BPy+Krp7rHlABIr5epbA7OxVeKoMHB39LZOp1UY5SuLjy6uWi35yA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.8.3",
	"@babel/generator": "^7.8.7",
	"@babel/helpers": "^7.8.4",
	"@babel/parser": "^7.8.7",
	"@babel/template": "^7.8.6",
	"@babel/traverse": "^7.8.6",
	"@babel/types": "^7.8.7",
	"convert-source-map": "^1.7.0",
	"debug": "^4.1.0",
	"gensync": "^1.0.0-beta.1",
	"json5": "^2.1.0",
	"lodash": "^4.17.13",
	"resolve": "^1.3.2",
	"semver": "^5.4.1",
	"source-map": "^0.5.0"
	},
	"engines": {
	"node": ">=6.9.0"
	}
	},
	"node_modules/@babel/core/node_modules/debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"dependencies": {
	"ms": "^2.1.1"
	}
	},
	"node_modules/@babel/core/node_modules/json5": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/json5/-/json5-2.1.1.tgz",
	"integrity": "sha512-l+3HXD0GEI3huGq1njuqtzYK8OYJyXMkOLtQ53pjWh89tvWS2h6l+1zMkYWqlb57+SiQodKZyvMEFb2X+KrFhQ==",
	"dev": true,
	"dependencies": {
	"minimist": "^1.2.0"
	},
	"bin": {
	"json5": "lib/cli.js"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/@babel/core/node_modules/ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	},
	"node_modules/@babel/generator": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.8.7.tgz",
	"integrity": "sha512-DQwjiKJqH4C3qGiyQCAExJHoZssn49JTMJgZ8SANGgVFdkupcUhLOdkAeoC6kmHZCPfoDG5M0b6cFlSN5wW7Ew==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.8.7",
	"jsesc": "^2.5.1",
	"lodash": "^4.17.13",
	"source-map": "^0.5.0"
	}
	},
	"node_modules/@babel/generator/node_modules/jsesc": {
	"version": "2.5.2",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz",
	"integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==",
	"dev": true,
	"bin": {
	"jsesc": "bin/jsesc"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-annotate-as-pure": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.10.4.tgz",
	"integrity": "sha512-XQlqKQP4vXFB7BN8fEEerrmYvHp3fK/rBkRFz9jaJbzK0B1DSfej9Kc7ZzE8Z/OnId1jpJdNAZ3BFQjWG68rcA==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-annotate-as-pure/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-annotate-as-pure/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-annotate-as-pure/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-builder-binary-assignment-operator-visitor": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.10.4.tgz",
	"integrity": "sha512-L0zGlFrGWZK4PbT8AszSfLTM5sDU1+Az/En9VrdT8/LmEiJt4zXt+Jve9DCAnQcbqDhCI+29y/L93mrDzddCcg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-explode-assignable-expression": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-builder-binary-assignment-operator-visitor/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-builder-binary-assignment-operator-visitor/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-builder-binary-assignment-operator-visitor/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-compilation-targets": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.10.4.tgz",
	"integrity": "sha512-a3rYhlsGV0UHNDvrtOXBg8/OpfV0OKTkxKPzIplS1zpx7CygDcWWxckxZeDd3gzPzC4kUT0A4nVFDK0wGMh4MQ==",
	"dev": true,
	"dependencies": {
	"@babel/compat-data": "^7.10.4",
	"browserslist": "^4.12.0",
	"invariant": "^2.2.4",
	"levenary": "^1.1.1",
	"semver": "^5.5.0"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/helper-create-class-features-plugin/-/helper-create-class-features-plugin-7.10.5.tgz",
	"integrity": "sha512-0nkdeijB7VlZoLT3r/mY3bUkw3T8WG/hNw+FATs/6+pG2039IJWjTYL0VTISqsNHMUTEnwbVnc89WIJX9Qed0A==",
	"dev": true,
	"dependencies": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-member-expression-to-functions": "^7.10.5",
	"@babel/helper-optimise-call-expression": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.0"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-create-class-features-plugin/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-create-regexp-features-plugin": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-create-regexp-features-plugin/-/helper-create-regexp-features-plugin-7.10.4.tgz",
	"integrity": "sha512-2/hu58IEPKeoLF45DBwx3XFqsbCXmkdAay4spVr2x0jYgRxrSNp+ePwvSsy9g6YSaNDcKIQVPXk1Ov8S2edk2g==",
	"dev": true,
	"dependencies": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-regex": "^7.10.4",
	"regexpu-core": "^4.7.0"
	}
	},
	"node_modules/@babel/helper-create-regexp-features-plugin/node_modules/jsesc": {
	"version": "0.5.0",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz",
	"integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=",
	"dev": true,
	"bin": {
	"jsesc": "bin/jsesc"
	}
	},
	"node_modules/@babel/helper-create-regexp-features-plugin/node_modules/regexpu-core": {
	"version": "4.7.0",
	"resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-4.7.0.tgz",
	"integrity": "sha512-TQ4KXRnIn6tz6tjnrXEkD/sshygKH/j5KzK86X8MkeHyZ8qst/LZ89j3X4/8HEIfHANTFIP/AbXakeRhWIl5YQ==",
	"dev": true,
	"dependencies": {
	"regenerate": "^1.4.0",
	"regenerate-unicode-properties": "^8.2.0",
	"regjsgen": "^0.5.1",
	"regjsparser": "^0.6.4",
	"unicode-match-property-ecmascript": "^1.0.4",
	"unicode-match-property-value-ecmascript": "^1.2.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-create-regexp-features-plugin/node_modules/regjsgen": {
	"version": "0.5.2",
	"resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.5.2.tgz",
	"integrity": "sha512-OFFT3MfrH90xIW8OOSyUrk6QHD5E9JOTeGodiJeBS3J6IwlgzJMNE/1bZklWz5oTg+9dCMyEetclvCVXOPoN3A==",
	"dev": true
	},
	"node_modules/@babel/helper-create-regexp-features-plugin/node_modules/regjsparser": {
	"version": "0.6.4",
	"resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.6.4.tgz",
	"integrity": "sha512-64O87/dPDgfk8/RQqC4gkZoGyyWFIEUTTh80CU6CWuK5vkCGyekIx+oKcEIYtP/RAxSQltCZHCNu/mdd7fqlJw==",
	"dev": true,
	"dependencies": {
	"jsesc": "~0.5.0"
	},
	"bin": {
	"regjsparser": "bin/parser"
	}
	},
	"node_modules/@babel/helper-define-map": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/helper-define-map/-/helper-define-map-7.10.5.tgz",
	"integrity": "sha512-fMw4kgFB720aQFXSVaXr79pjjcW5puTCM16+rECJ/plGS+zByelE8l9nCpV1GibxTnFVmUuYG9U8wYfQHdzOEQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/types": "^7.10.5",
	"lodash": "^4.17.19"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/helper-define-map/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-define-map/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-define-map/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-explode-assignable-expression": {
	"version": "7.11.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-explode-assignable-expression/-/helper-explode-assignable-expression-7.11.4.tgz",
	"integrity": "sha512-ux9hm3zR4WV1Y3xXxXkdG/0gxF9nvI0YVmKVhvK9AfMoaQkemL3sJpXw+Xbz65azo8qJiEz2XVDUpK3KYhH3ZQ==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-explode-assignable-expression/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-explode-assignable-expression/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-explode-assignable-expression/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-function-name": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.8.3.tgz",
	"integrity": "sha512-BCxgX1BC2hD/oBlIFUgOCQDOPV8nSINxCwM3o93xP4P9Fq6aV5sgv2cOOITDMtCfQ+3PvHp3l689XZvAM9QyOA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.8.3",
	"@babel/template": "^7.8.3",
	"@babel/types": "^7.8.3"
	}
	},
	"node_modules/@babel/helper-get-function-arity": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.8.3.tgz",
	"integrity": "sha512-FVDR+Gd9iLjUMY1fzE2SR0IuaJToR4RkCDARVfsBBPSP53GEqSFjD8gNyxg246VUyc/ALRxFaAK8rVG7UT7xRA==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.8.3"
	}
	},
	"node_modules/@babel/helper-hoist-variables": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.10.4.tgz",
	"integrity": "sha512-wljroF5PgCk2juF69kanHVs6vrLwIPNp6DLD+Lrl3hoQ3PpPPikaDRNFA+0t81NOoMt2DL6WW/mdU8k4k6ZzuA==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-hoist-variables/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-hoist-variables/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-hoist-variables/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-member-expression-to-functions": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.11.0.tgz",
	"integrity": "sha512-JbFlKHFntRV5qKw3YC0CvQnDZ4XMwgzzBbld7Ly4Mj4cbFy3KywcR8NtNctRToMWJOVvLINJv525Gd6wwVEx/Q==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.0"
	}
	},
	"node_modules/@babel/helper-member-expression-to-functions/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-member-expression-to-functions/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-member-expression-to-functions/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-module-imports": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.10.4.tgz",
	"integrity": "sha512-nEQJHqYavI217oD9+s5MUBzk6x1IlvoS9WTPfgG43CbMEeStE0v+r+TucWdx8KFGowPGvyOkDT9+7DHedIDnVw==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-module-imports/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-module-imports/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-module-imports/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-module-transforms": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.11.0.tgz",
	"integrity": "sha512-02EVu8COMuTRO1TAzdMtpBPbe6aQ1w/8fePD2YgQmxZU4gpNWaL9gK3Jp7dxlkUlUCJOTaSeA+Hrm1BRQwqIhg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-module-imports": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4",
	"@babel/helper-simple-access": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.11.0",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.11.0",
	"lodash": "^4.17.19"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.0"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/helper-module-transforms/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-module-transforms/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-module-transforms/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-optimise-call-expression": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.10.4.tgz",
	"integrity": "sha512-n3UGKY4VXwXThEiKrgRAoVPBMqeoPgHVqiHZOanAJCG9nQUL2pLRQirUzl0ioKclHGpGqRgIOkgcIJaIWLpygg==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-optimise-call-expression/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-optimise-call-expression/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-optimise-call-expression/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-plugin-utils": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.10.4.tgz",
	"integrity": "sha512-O4KCvQA6lLiMU9l2eawBPMf1xPP8xPfB3iEQw150hOVTqj/rfXz0ThTb4HEzqQfs2Bmo5Ay8BzxfzVtBrr9dVg==",
	"dev": true
	},
	"node_modules/@babel/helper-regex": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/helper-regex/-/helper-regex-7.10.5.tgz",
	"integrity": "sha512-68kdUAzDrljqBrio7DYAEgCoJHxppJOERHOgOrDN7WjOzP0ZQ1LsSDRXcemzVZaLvjaJsJEESb6qt+znNuENDg==",
	"dev": true,
	"dependencies": {
	"lodash": "^4.17.19"
	}
	},
	"node_modules/@babel/helper-regex/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-remap-async-to-generator": {
	"version": "7.11.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-remap-async-to-generator/-/helper-remap-async-to-generator-7.11.4.tgz",
	"integrity": "sha512-tR5vJ/vBa9wFy3m5LLv2faapJLnDFxNWff2SAYkSE4rLUdbp7CdObYFgI7wK4T/Mj4UzpjPwzR8Pzmr5m7MHGA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-wrap-function": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-remap-async-to-generator/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-replace-supers": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.10.4.tgz",
	"integrity": "sha512-sPxZfFXocEymYTdVK1UNmFPBN+Hv5mJkLPsYWwGBxZAxaWfFu+xqp7b6qWD0yjNuNL2VKc6L5M18tOXUP7NU0A==",
	"dev": true,
	"dependencies": {
	"@babel/helper-member-expression-to-functions": "^7.10.4",
	"@babel/helper-optimise-call-expression": "^7.10.4",
	"@babel/traverse": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/generator": {
	"version": "7.11.6",
	"resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz",
	"integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.5",
	"jsesc": "^2.5.1",
	"source-map": "^0.5.0"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.0"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/traverse": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz",
	"integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/generator": "^7.11.5",
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.11.0",
	"@babel/parser": "^7.11.5",
	"@babel/types": "^7.11.5",
	"debug": "^4.1.0",
	"globals": "^11.1.0",
	"lodash": "^4.17.19"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"dependencies": {
	"ms": "^2.1.1"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/helper-replace-supers/node_modules/jsesc": {
	"version": "2.5.2",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz",
	"integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==",
	"dev": true,
	"bin": {
	"jsesc": "bin/jsesc"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-replace-supers/node_modules/ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	},
	"node_modules/@babel/helper-replace-supers/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-replace-supers/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-simple-access": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.10.4.tgz",
	"integrity": "sha512-0fMy72ej/VEvF8ULmX6yb5MtHG4uH4Dbd6I/aHDb/JVg0bbivwt9Wg+h3uMvX+QSFtwr5MeItvazbrc4jtRAXw==",
	"dev": true,
	"dependencies": {
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/helper-simple-access/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-simple-access/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-simple-access/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-skip-transparent-expression-wrappers": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.11.0.tgz",
	"integrity": "sha512-0XIdiQln4Elglgjbwo9wuJpL/K7AGCY26kmEt0+pRP0TAj4jjyNq1MjoRvikrTVqKcx4Gysxt4cXvVFXP/JO2Q==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.0"
	}
	},
	"node_modules/@babel/helper-skip-transparent-expression-wrappers/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-skip-transparent-expression-wrappers/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-skip-transparent-expression-wrappers/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-split-export-declaration": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.8.3.tgz",
	"integrity": "sha512-3x3yOeyBhW851hroze7ElzdkeRXQYQbFIb7gLK1WQYsw2GWDay5gAJNw1sWJ0VFP6z5J1whqeXH/WCdCjZv6dA==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.8.3"
	}
	},
	"node_modules/@babel/helper-validator-identifier": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz",
	"integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==",
	"dev": true
	},
	"node_modules/@babel/helper-wrap-function": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-wrap-function/-/helper-wrap-function-7.10.4.tgz",
	"integrity": "sha512-6py45WvEF0MhiLrdxtRjKjufwLL1/ob2qDJgg5JgNdojBAZSAKnAjkyOCNug6n+OBl4VW76XjvgSFTdaMcW0Ug==",
	"dev": true,
	"dependencies": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/traverse": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/generator": {
	"version": "7.11.6",
	"resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz",
	"integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.5",
	"jsesc": "^2.5.1",
	"source-map": "^0.5.0"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.0"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/traverse": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz",
	"integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/generator": "^7.11.5",
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.11.0",
	"@babel/parser": "^7.11.5",
	"@babel/types": "^7.11.5",
	"debug": "^4.1.0",
	"globals": "^11.1.0",
	"lodash": "^4.17.19"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"dependencies": {
	"ms": "^2.1.1"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/helper-wrap-function/node_modules/jsesc": {
	"version": "2.5.2",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz",
	"integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==",
	"dev": true,
	"bin": {
	"jsesc": "bin/jsesc"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/helper-wrap-function/node_modules/ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	},
	"node_modules/@babel/helper-wrap-function/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helper-wrap-function/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/helpers": {
	"version": "7.8.4",
	"resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.8.4.tgz",
	"integrity": "sha512-VPbe7wcQ4chu4TDQjimHv/5tj73qz88o12EPkO2ValS2QiQS/1F2SsjyIGNnAD0vF/nZS6Cf9i+vW6HIlnaR8w==",
	"dev": true,
	"dependencies": {
	"@babel/template": "^7.8.3",
	"@babel/traverse": "^7.8.4",
	"@babel/types": "^7.8.3"
	}
	},
	"node_modules/@babel/highlight": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.8.3.tgz",
	"integrity": "sha512-PX4y5xQUvy0fnEVHrYOarRPXVWafSjTW9T0Hab8gVIawpl2Sj0ORyrygANq+KjcNlSSTw0YCLSNA8OyZ1I4yEg==",
	"dev": true,
	"dependencies": {
	"chalk": "^2.0.0",
	"esutils": "^2.0.2",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/highlight/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/highlight/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/highlight/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/highlight/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/parser": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.8.7.tgz",
	"integrity": "sha512-9JWls8WilDXFGxs0phaXAZgpxTZhSk/yOYH2hTHC0X1yC7Z78IJfvR1vJ+rmJKq3I35td2XzXzN6ZLYlna+r/A==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/plugin-proposal-async-generator-functions": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-async-generator-functions/-/plugin-proposal-async-generator-functions-7.10.5.tgz",
	"integrity": "sha512-cNMCVezQbrRGvXJwm9fu/1sJj9bHdGAgKodZdLqOQIpfoH3raqmRPBM17+lh7CzhiKRRBrGtZL9WcjxSoGYUSg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-remap-async-to-generator": "^7.10.4",
	"@babel/plugin-syntax-async-generators": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-proposal-class-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-class-properties/-/plugin-proposal-class-properties-7.10.4.tgz",
	"integrity": "sha512-vhwkEROxzcHGNu2mzUC0OFFNXdZ4M23ib8aRRcJSsW8BZK9pQMD7QB7csl97NBbgGZO7ZyHUyKDnxzOaP4IrCg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-create-class-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-proposal-dynamic-import": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-dynamic-import/-/plugin-proposal-dynamic-import-7.10.4.tgz",
	"integrity": "sha512-up6oID1LeidOOASNXgv/CFbgBqTuKJ0cJjz6An5tWD+NVBNlp3VNSBxv2ZdU7SYl3NxJC7agAQDApZusV6uFwQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-dynamic-import": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-proposal-export-namespace-from": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-export-namespace-from/-/plugin-proposal-export-namespace-from-7.10.4.tgz",
	"integrity": "sha512-aNdf0LY6/3WXkhh0Fdb6Zk9j1NMD8ovj3F6r0+3j837Pn1S1PdNtcwJ5EG9WkVPNHPxyJDaxMaAOVq4eki0qbg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-export-namespace-from": "^7.8.3"
	}
	},
	"node_modules/@babel/plugin-proposal-json-strings": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-json-strings/-/plugin-proposal-json-strings-7.10.4.tgz",
	"integrity": "sha512-fCL7QF0Jo83uy1K0P2YXrfX11tj3lkpN7l4dMv9Y9VkowkhkQDwFHFd8IiwyK5MZjE8UpbgokkgtcReH88Abaw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-json-strings": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-proposal-logical-assignment-operators": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-logical-assignment-operators/-/plugin-proposal-logical-assignment-operators-7.11.0.tgz",
	"integrity": "sha512-/f8p4z+Auz0Uaf+i8Ekf1iM7wUNLcViFUGiPxKeXvxTSl63B875YPiVdUDdem7hREcI0E0kSpEhS8tF5RphK7Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-logical-assignment-operators": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-proposal-nullish-coalescing-operator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-nullish-coalescing-operator/-/plugin-proposal-nullish-coalescing-operator-7.10.4.tgz",
	"integrity": "sha512-wq5n1M3ZUlHl9sqT2ok1T2/MTt6AXE0e1Lz4WzWBr95LsAZ5qDXe4KnFuauYyEyLiohvXFMdbsOTMyLZs91Zlw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-proposal-numeric-separator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-numeric-separator/-/plugin-proposal-numeric-separator-7.10.4.tgz",
	"integrity": "sha512-73/G7QoRoeNkLZFxsoCCvlg4ezE4eM+57PnOqgaPOozd5myfj7p0muD1mRVJvbUWbOzD+q3No2bWbaKy+DJ8DA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-numeric-separator": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-proposal-object-rest-spread": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-object-rest-spread/-/plugin-proposal-object-rest-spread-7.11.0.tgz",
	"integrity": "sha512-wzch41N4yztwoRw0ak+37wxwJM2oiIiy6huGCoqkvSTA9acYWcPfn9Y4aJqmFFJ70KTJUu29f3DQ43uJ9HXzEA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-object-rest-spread": "^7.8.0",
	"@babel/plugin-transform-parameters": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-proposal-optional-catch-binding": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-catch-binding/-/plugin-proposal-optional-catch-binding-7.10.4.tgz",
	"integrity": "sha512-LflT6nPh+GK2MnFiKDyLiqSqVHkQnVf7hdoAvyTnnKj9xB3docGRsdPuxp6qqqW19ifK3xgc9U5/FwrSaCNX5g==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-optional-catch-binding": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-proposal-optional-chaining": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-chaining/-/plugin-proposal-optional-chaining-7.11.0.tgz",
	"integrity": "sha512-v9fZIu3Y8562RRwhm1BbMRxtqZNFmFA2EG+pT2diuU8PT3H6T/KXoZ54KgYisfOFZHV6PfvAiBIZ9Rcz+/JCxA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-skip-transparent-expression-wrappers": "^7.11.0",
	"@babel/plugin-syntax-optional-chaining": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-proposal-private-methods": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-private-methods/-/plugin-proposal-private-methods-7.10.4.tgz",
	"integrity": "sha512-wh5GJleuI8k3emgTg5KkJK6kHNsGEr0uBTDBuQUBJwckk9xs1ez79ioheEVVxMLyPscB0LfkbVHslQqIzWV6Bw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-create-class-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-proposal-unicode-property-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-unicode-property-regex/-/plugin-proposal-unicode-property-regex-7.10.4.tgz",
	"integrity": "sha512-H+3fOgPnEXFL9zGYtKQe4IDOPKYlZdF1kqFDQRRb8PK4B8af1vAGK04tF5iQAAsui+mHNBQSAtd2/ndEDe9wuA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-syntax-async-generators": {
	"version": "7.8.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.8.4.tgz",
	"integrity": "sha512-tycmZxkGfZaxhMRbXlPXuVFpdWlXpir2W4AMhSJgRKzk/eDlIXOhb2LHWoLpDF7TEHylV5zNhykX6KAgHJmTNw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-syntax-class-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-class-properties/-/plugin-syntax-class-properties-7.10.4.tgz",
	"integrity": "sha512-GCSBF7iUle6rNugfURwNmCGG3Z/2+opxAMLs1nND4bhEG5PuxTIggDBoeYYSujAlLtsupzOHYJQgPS3pivwXIA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-syntax-dynamic-import": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-dynamic-import/-/plugin-syntax-dynamic-import-7.8.3.tgz",
	"integrity": "sha512-5gdGbFon+PszYzqs83S3E5mpi7/y/8M9eC90MRTZfduQOYW76ig6SOSPNe41IG5LoP3FGBn2N0RjVDSQiS94kQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-syntax-export-namespace-from": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-export-namespace-from/-/plugin-syntax-export-namespace-from-7.8.3.tgz",
	"integrity": "sha512-MXf5laXo6c1IbEbegDmzGPwGNTsHZmEy6QGznu5Sh2UCWvueywb2ee+CCE4zQiZstxU9BMoQO9i6zUFSY0Kj0Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.3"
	}
	},
	"node_modules/@babel/plugin-syntax-json-strings": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.8.3.tgz",
	"integrity": "sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-syntax-logical-assignment-operators": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-logical-assignment-operators/-/plugin-syntax-logical-assignment-operators-7.10.4.tgz",
	"integrity": "sha512-d8waShlpFDinQ5MtvGU9xDAOzKH47+FFoney2baFIoMr952hKOLp1HR7VszoZvOsV/4+RRszNY7D17ba0te0ig==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-syntax-nullish-coalescing-operator": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-nullish-coalescing-operator/-/plugin-syntax-nullish-coalescing-operator-7.8.3.tgz",
	"integrity": "sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-syntax-numeric-separator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-numeric-separator/-/plugin-syntax-numeric-separator-7.10.4.tgz",
	"integrity": "sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-syntax-object-rest-spread": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.8.3.tgz",
	"integrity": "sha512-XoqMijGZb9y3y2XskN+P1wUGiVwWZ5JmoDRwx5+3GmEplNyVM2s2Dg8ILFQm8rWM48orGy5YpI5Bl8U1y7ydlA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-syntax-optional-catch-binding": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.8.3.tgz",
	"integrity": "sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-syntax-optional-chaining": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-chaining/-/plugin-syntax-optional-chaining-7.8.3.tgz",
	"integrity": "sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"node_modules/@babel/plugin-syntax-top-level-await": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-top-level-await/-/plugin-syntax-top-level-await-7.10.4.tgz",
	"integrity": "sha512-ni1brg4lXEmWyafKr0ccFWkJG0CeMt4WV1oyeBW6EFObF4oOHclbkj5cARxAPQyAQ2UTuplJyK4nfkXIMMFvsQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-arrow-functions": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-arrow-functions/-/plugin-transform-arrow-functions-7.10.4.tgz",
	"integrity": "sha512-9J/oD1jV0ZCBcgnoFWFq1vJd4msoKb/TCpGNFyyLt0zABdcvgK3aYikZ8HjzB14c26bc7E3Q1yugpwGy2aTPNA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-async-to-generator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-async-to-generator/-/plugin-transform-async-to-generator-7.10.4.tgz",
	"integrity": "sha512-F6nREOan7J5UXTLsDsZG3DXmZSVofr2tGNwfdrVwkDWHfQckbQXnXSPfD7iO+c/2HGqycwyLST3DnZ16n+cBJQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-module-imports": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-remap-async-to-generator": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-block-scoped-functions": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoped-functions/-/plugin-transform-block-scoped-functions-7.10.4.tgz",
	"integrity": "sha512-WzXDarQXYYfjaV1szJvN3AD7rZgZzC1JtjJZ8dMHUyiK8mxPRahynp14zzNjU3VkPqPsO38CzxiWO1c9ARZ8JA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-block-scoping": {
	"version": "7.11.1",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoping/-/plugin-transform-block-scoping-7.11.1.tgz",
	"integrity": "sha512-00dYeDE0EVEHuuM+26+0w/SCL0BH2Qy7LwHuI4Hi4MH5gkC8/AqMN5uWFJIsoXZrAphiMm1iXzBw6L2T+eA0ew==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-classes": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-classes/-/plugin-transform-classes-7.10.4.tgz",
	"integrity": "sha512-2oZ9qLjt161dn1ZE0Ms66xBncQH4In8Sqw1YWgBUZuGVJJS5c0OFZXL6dP2MRHrkU/eKhWg8CzFJhRQl50rQxA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-define-map": "^7.10.4",
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-optimise-call-expression": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.10.4",
	"globals": "^11.1.0"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.11.0"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-classes/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-computed-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-computed-properties/-/plugin-transform-computed-properties-7.10.4.tgz",
	"integrity": "sha512-JFwVDXcP/hM/TbyzGq3l/XWGut7p46Z3QvqFMXTfk6/09m7xZHJUN9xHfsv7vqqD4YnfI5ueYdSJtXqqBLyjBw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-destructuring": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-destructuring/-/plugin-transform-destructuring-7.10.4.tgz",
	"integrity": "sha512-+WmfvyfsyF603iPa6825mq6Qrb7uLjTOsa3XOFzlYcYDHSS4QmpOWOL0NNBY5qMbvrcf3tq0Cw+v4lxswOBpgA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-dotall-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-dotall-regex/-/plugin-transform-dotall-regex-7.10.4.tgz",
	"integrity": "sha512-ZEAVvUTCMlMFAbASYSVQoxIbHm2OkG2MseW6bV2JjIygOjdVv8tuxrCTzj1+Rynh7ODb8GivUy7dzEXzEhuPaA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-duplicate-keys": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-duplicate-keys/-/plugin-transform-duplicate-keys-7.10.4.tgz",
	"integrity": "sha512-GL0/fJnmgMclHiBTTWXNlYjYsA7rDrtsazHG6mglaGSTh0KsrW04qml+Bbz9FL0LcJIRwBWL5ZqlNHKTkU3xAA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-exponentiation-operator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-exponentiation-operator/-/plugin-transform-exponentiation-operator-7.10.4.tgz",
	"integrity": "sha512-S5HgLVgkBcRdyQAHbKj+7KyuWx8C6t5oETmUuwz1pt3WTWJhsUV0WIIXuVvfXMxl/QQyHKlSCNNtaIamG8fysw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-builder-binary-assignment-operator-visitor": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-for-of": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-for-of/-/plugin-transform-for-of-7.10.4.tgz",
	"integrity": "sha512-ItdQfAzu9AlEqmusA/65TqJ79eRcgGmpPPFvBnGILXZH975G0LNjP1yjHvGgfuCxqrPPueXOPe+FsvxmxKiHHQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-function-name/-/plugin-transform-function-name-7.10.4.tgz",
	"integrity": "sha512-OcDCq2y5+E0dVD5MagT5X+yTRbcvFjDI2ZVAottGH6tzqjx/LKpgkUepu3hp/u4tZBzxxpNGwLsAvGBvQ2mJzg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"dependencies": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true,
	"bin": {
	"parser": "bin/babel-parser.js"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-function-name/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-literals": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-literals/-/plugin-transform-literals-7.10.4.tgz",
	"integrity": "sha512-Xd/dFSTEVuUWnyZiMu76/InZxLTYilOSr1UlHV+p115Z/Le2Fi1KXkJUYz0b42DfndostYlPub3m8ZTQlMaiqQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-member-expression-literals": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-member-expression-literals/-/plugin-transform-member-expression-literals-7.10.4.tgz",
	"integrity": "sha512-0bFOvPyAoTBhtcJLr9VcwZqKmSjFml1iVxvPL0ReomGU53CX53HsM4h2SzckNdkQcHox1bpAqzxBI1Y09LlBSw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-modules-amd": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-amd/-/plugin-transform-modules-amd-7.10.5.tgz",
	"integrity": "sha512-elm5uruNio7CTLFItVC/rIzKLfQ17+fX7EVz5W0TMgIHFo1zY0Ozzx+lgwhL4plzl8OzVn6Qasx5DeEFyoNiRw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-module-transforms": "^7.10.5",
	"@babel/helper-plugin-utils": "^7.10.4",
	"babel-plugin-dynamic-import-node": "^2.3.3"
	}
	},
	"node_modules/@babel/plugin-transform-modules-commonjs": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.10.4.tgz",
	"integrity": "sha512-Xj7Uq5o80HDLlW64rVfDBhao6OX89HKUmb+9vWYaLXBZOma4gA6tw4Ni1O5qVDoZWUV0fxMYA0aYzOawz0l+1w==",
	"dev": true,
	"dependencies": {
	"@babel/helper-module-transforms": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-simple-access": "^7.10.4",
	"babel-plugin-dynamic-import-node": "^2.3.3"
	}
	},
	"node_modules/@babel/plugin-transform-modules-systemjs": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.10.5.tgz",
	"integrity": "sha512-f4RLO/OL14/FP1AEbcsWMzpbUz6tssRaeQg11RH1BP/XnPpRoVwgeYViMFacnkaw4k4wjRSjn3ip1Uw9TaXuMw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-hoist-variables": "^7.10.4",
	"@babel/helper-module-transforms": "^7.10.5",
	"@babel/helper-plugin-utils": "^7.10.4",
	"babel-plugin-dynamic-import-node": "^2.3.3"
	}
	},
	"node_modules/@babel/plugin-transform-modules-umd": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-umd/-/plugin-transform-modules-umd-7.10.4.tgz",
	"integrity": "sha512-mohW5q3uAEt8T45YT7Qc5ws6mWgJAaL/8BfWD9Dodo1A3RKWli8wTS+WiQ/knF+tXlPirW/1/MqzzGfCExKECA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-module-transforms": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-named-capturing-groups-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-named-capturing-groups-regex/-/plugin-transform-named-capturing-groups-regex-7.10.4.tgz",
	"integrity": "sha512-V6LuOnD31kTkxQPhKiVYzYC/Jgdq53irJC/xBSmqcNcqFGV+PER4l6rU5SH2Vl7bH9mLDHcc0+l9HUOe4RNGKA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-new-target": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-new-target/-/plugin-transform-new-target-7.10.4.tgz",
	"integrity": "sha512-YXwWUDAH/J6dlfwqlWsztI2Puz1NtUAubXhOPLQ5gjR/qmQ5U96DY4FQO8At33JN4XPBhrjB8I4eMmLROjjLjw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-object-super": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-object-super/-/plugin-transform-object-super-7.10.4.tgz",
	"integrity": "sha512-5iTw0JkdRdJvr7sY0vHqTpnruUpTea32JHmq/atIWqsnNussbRzjEDyWep8UNztt1B5IusBYg8Irb0bLbiEBCQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-parameters": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-parameters/-/plugin-transform-parameters-7.10.5.tgz",
	"integrity": "sha512-xPHwUj5RdFV8l1wuYiu5S9fqWGM2DrYc24TMvUiRrPVm+SM3XeqU9BcokQX/kEUe+p2RBwy+yoiR1w/Blq6ubw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-parameters/node_modules/@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"dependencies": {
	"@babel/types": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-parameters/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/plugin-transform-parameters/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/plugin-transform-parameters/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/plugin-transform-property-literals": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-property-literals/-/plugin-transform-property-literals-7.10.4.tgz",
	"integrity": "sha512-ofsAcKiUxQ8TY4sScgsGeR2vJIsfrzqvFb9GvJ5UdXDzl+MyYCaBj/FGzXuv7qE0aJcjWMILny1epqelnFlz8g==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-regenerator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-regenerator/-/plugin-transform-regenerator-7.10.4.tgz",
	"integrity": "sha512-3thAHwtor39A7C04XucbMg17RcZ3Qppfxr22wYzZNcVIkPHfpM9J0SO8zuCV6SZa265kxBJSrfKTvDCYqBFXGw==",
	"dev": true,
	"dependencies": {
	"regenerator-transform": "^0.14.2"
	}
	},
	"node_modules/@babel/plugin-transform-regenerator/node_modules/regenerator-transform": {
	"version": "0.14.5",
	"resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.14.5.tgz",
	"integrity": "sha512-eOf6vka5IO151Jfsw2NO9WpGX58W6wWmefK3I1zEGr0lOD0u8rwPaNqQL1aRxUaxLeKO3ArNh3VYg1KbaD+FFw==",
	"dev": true,
	"dependencies": {
	"@babel/runtime": "^7.8.4"
	}
	},
	"node_modules/@babel/plugin-transform-reserved-words": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-reserved-words/-/plugin-transform-reserved-words-7.10.4.tgz",
	"integrity": "sha512-hGsw1O6Rew1fkFbDImZIEqA8GoidwTAilwCyWqLBM9f+e/u/sQMQu7uX6dyokfOayRuuVfKOW4O7HvaBWM+JlQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-shorthand-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-shorthand-properties/-/plugin-transform-shorthand-properties-7.10.4.tgz",
	"integrity": "sha512-AC2K/t7o07KeTIxMoHneyX90v3zkm5cjHJEokrPEAGEy3UCp8sLKfnfOIGdZ194fyN4wfX/zZUWT9trJZ0qc+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-spread": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-spread/-/plugin-transform-spread-7.11.0.tgz",
	"integrity": "sha512-UwQYGOqIdQJe4aWNyS7noqAnN2VbaczPLiEtln+zPowRNlD+79w3oi2TWfYe0eZgd+gjZCbsydN7lzWysDt+gw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-skip-transparent-expression-wrappers": "^7.11.0"
	}
	},
	"node_modules/@babel/plugin-transform-sticky-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-sticky-regex/-/plugin-transform-sticky-regex-7.10.4.tgz",
	"integrity": "sha512-Ddy3QZfIbEV0VYcVtFDCjeE4xwVTJWTmUtorAJkn6u/92Z/nWJNV+mILyqHKrUxXYKA2EoCilgoPePymKL4DvQ==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-regex": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-template-literals": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-template-literals/-/plugin-transform-template-literals-7.10.5.tgz",
	"integrity": "sha512-V/lnPGIb+KT12OQikDvgSuesRX14ck5FfJXt6+tXhdkJ+Vsd0lDCVtF6jcB4rNClYFzaB2jusZ+lNISDk2mMMw==",
	"dev": true,
	"dependencies": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-typeof-symbol": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-typeof-symbol/-/plugin-transform-typeof-symbol-7.10.4.tgz",
	"integrity": "sha512-QqNgYwuuW0y0H+kUE/GWSR45t/ccRhe14Fs/4ZRouNNQsyd4o3PG4OtHiIrepbM2WKUBDAXKCAK/Lk4VhzTaGA==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-unicode-escapes": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-escapes/-/plugin-transform-unicode-escapes-7.10.4.tgz",
	"integrity": "sha512-y5XJ9waMti2J+e7ij20e+aH+fho7Wb7W8rNuu72aKRwCHFqQdhkdU2lo3uZ9tQuboEJcUFayXdARhcxLQ3+6Fg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/plugin-transform-unicode-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-regex/-/plugin-transform-unicode-regex-7.10.4.tgz",
	"integrity": "sha512-wNfsc4s8N2qnIwpO/WP2ZiSyjfpTamT2C9V9FDH/Ljub9zw6P3SjkXcFmc0RQUt96k2fmIvtla2MMjgTwIAC+A==",
	"dev": true,
	"dependencies": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"node_modules/@babel/preset-env": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/preset-env/-/preset-env-7.11.5.tgz",
	"integrity": "sha512-kXqmW1jVcnB2cdueV+fyBM8estd5mlNfaQi6lwLgRwCby4edpavgbFhiBNjmWA3JpB/yZGSISa7Srf+TwxDQoA==",
	"dev": true,
	"dependencies": {
	"@babel/compat-data": "^7.11.0",
	"@babel/helper-compilation-targets": "^7.10.4",
	"@babel/helper-module-imports": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-proposal-async-generator-functions": "^7.10.4",
	"@babel/plugin-proposal-class-properties": "^7.10.4",
	"@babel/plugin-proposal-dynamic-import": "^7.10.4",
	"@babel/plugin-proposal-export-namespace-from": "^7.10.4",
	"@babel/plugin-proposal-json-strings": "^7.10.4",
	"@babel/plugin-proposal-logical-assignment-operators": "^7.11.0",
	"@babel/plugin-proposal-nullish-coalescing-operator": "^7.10.4",
	"@babel/plugin-proposal-numeric-separator": "^7.10.4",
	"@babel/plugin-proposal-object-rest-spread": "^7.11.0",
	"@babel/plugin-proposal-optional-catch-binding": "^7.10.4",
	"@babel/plugin-proposal-optional-chaining": "^7.11.0",
	"@babel/plugin-proposal-private-methods": "^7.10.4",
	"@babel/plugin-proposal-unicode-property-regex": "^7.10.4",
	"@babel/plugin-syntax-async-generators": "^7.8.0",
	"@babel/plugin-syntax-class-properties": "^7.10.4",
	"@babel/plugin-syntax-dynamic-import": "^7.8.0",
	"@babel/plugin-syntax-export-namespace-from": "^7.8.3",
	"@babel/plugin-syntax-json-strings": "^7.8.0",
	"@babel/plugin-syntax-logical-assignment-operators": "^7.10.4",
	"@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0",
	"@babel/plugin-syntax-numeric-separator": "^7.10.4",
	"@babel/plugin-syntax-object-rest-spread": "^7.8.0",
	"@babel/plugin-syntax-optional-catch-binding": "^7.8.0",
	"@babel/plugin-syntax-optional-chaining": "^7.8.0",
	"@babel/plugin-syntax-top-level-await": "^7.10.4",
	"@babel/plugin-transform-arrow-functions": "^7.10.4",
	"@babel/plugin-transform-async-to-generator": "^7.10.4",
	"@babel/plugin-transform-block-scoped-functions": "^7.10.4",
	"@babel/plugin-transform-block-scoping": "^7.10.4",
	"@babel/plugin-transform-classes": "^7.10.4",
	"@babel/plugin-transform-computed-properties": "^7.10.4",
	"@babel/plugin-transform-destructuring": "^7.10.4",
	"@babel/plugin-transform-dotall-regex": "^7.10.4",
	"@babel/plugin-transform-duplicate-keys": "^7.10.4",
	"@babel/plugin-transform-exponentiation-operator": "^7.10.4",
	"@babel/plugin-transform-for-of": "^7.10.4",
	"@babel/plugin-transform-function-name": "^7.10.4",
	"@babel/plugin-transform-literals": "^7.10.4",
	"@babel/plugin-transform-member-expression-literals": "^7.10.4",
	"@babel/plugin-transform-modules-amd": "^7.10.4",
	"@babel/plugin-transform-modules-commonjs": "^7.10.4",
	"@babel/plugin-transform-modules-systemjs": "^7.10.4",
	"@babel/plugin-transform-modules-umd": "^7.10.4",
	"@babel/plugin-transform-named-capturing-groups-regex": "^7.10.4",
	"@babel/plugin-transform-new-target": "^7.10.4",
	"@babel/plugin-transform-object-super": "^7.10.4",
	"@babel/plugin-transform-parameters": "^7.10.4",
	"@babel/plugin-transform-property-literals": "^7.10.4",
	"@babel/plugin-transform-regenerator": "^7.10.4",
	"@babel/plugin-transform-reserved-words": "^7.10.4",
	"@babel/plugin-transform-shorthand-properties": "^7.10.4",
	"@babel/plugin-transform-spread": "^7.11.0",
	"@babel/plugin-transform-sticky-regex": "^7.10.4",
	"@babel/plugin-transform-template-literals": "^7.10.4",
	"@babel/plugin-transform-typeof-symbol": "^7.10.4",
	"@babel/plugin-transform-unicode-escapes": "^7.10.4",
	"@babel/plugin-transform-unicode-regex": "^7.10.4",
	"@babel/preset-modules": "^0.1.3",
	"@babel/types": "^7.11.5",
	"browserslist": "^4.12.0",
	"core-js-compat": "^3.6.2",
	"invariant": "^2.2.2",
	"levenary": "^1.1.1",
	"semver": "^5.5.0"
	}
	},
	"node_modules/@babel/preset-env/node_modules/@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"dependencies": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/preset-env/node_modules/lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"node_modules/@babel/preset-env/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/preset-modules": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/@babel/preset-modules/-/preset-modules-0.1.4.tgz",
	"integrity": "sha512-J36NhwnfdzpmH41M1DrnkkgAqhZaqr/NBdPfQ677mLzlaXo+oDiv1deyCDtgAhz8p328otdob0Du7+xgHGZbKg==",
	"dev": true,
	"dependencies": {
	"@babel/helper-plugin-utils": "^7.0.0",
	"@babel/plugin-proposal-unicode-property-regex": "^7.4.4",
	"@babel/plugin-transform-dotall-regex": "^7.4.4",
	"@babel/types": "^7.4.4",
	"esutils": "^2.0.2"
	}
	},
	"node_modules/@babel/runtime": {
	"version": "7.11.2",
	"resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.11.2.tgz",
	"integrity": "sha512-TeWkU52so0mPtDcaCTxNBI/IHiz0pZgr8VEFqXFtZWpYD08ZB6FaSwVAS8MKRQAP3bYKiVjwysOJgMFY28o6Tw==",
	"dev": true,
	"dependencies": {
	"regenerator-runtime": "^0.13.4"
	}
	},
	"node_modules/@babel/runtime/node_modules/regenerator-runtime": {
	"version": "0.13.7",
	"resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.7.tgz",
	"integrity": "sha512-a54FxoJDIr27pgf7IgeQGxmqUNYrcV338lf/6gH456HZ/PhX+5BcwHXG9ajESmwe6WRO0tAzRUrRmNONWgkrew==",
	"dev": true
	},
	"node_modules/@babel/template": {
	"version": "7.8.6",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.8.6.tgz",
	"integrity": "sha512-zbMsPMy/v0PWFZEhQJ66bqjhH+z0JgMoBWuikXybgG3Gkd/3t5oQ1Rw2WQhnSrsOmsKXnZOx15tkC4qON/+JPg==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.8.3",
	"@babel/parser": "^7.8.6",
	"@babel/types": "^7.8.6"
	}
	},
	"node_modules/@babel/traverse": {
	"version": "7.8.6",
	"resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.8.6.tgz",
	"integrity": "sha512-2B8l0db/DPi8iinITKuo7cbPznLCEk0kCxDoB9/N6gGNg/gxOXiR/IcymAFPiBwk5w6TtQ27w4wpElgp9btR9A==",
	"dev": true,
	"dependencies": {
	"@babel/code-frame": "^7.8.3",
	"@babel/generator": "^7.8.6",
	"@babel/helper-function-name": "^7.8.3",
	"@babel/helper-split-export-declaration": "^7.8.3",
	"@babel/parser": "^7.8.6",
	"@babel/types": "^7.8.6",
	"debug": "^4.1.0",
	"globals": "^11.1.0",
	"lodash": "^4.17.13"
	}
	},
	"node_modules/@babel/traverse/node_modules/debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"dependencies": {
	"ms": "^2.1.1"
	}
	},
	"node_modules/@babel/traverse/node_modules/globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@babel/traverse/node_modules/ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	},
	"node_modules/@babel/types": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.8.7.tgz",
	"integrity": "sha512-k2TreEHxFA4CjGkL+GYjRyx35W0Mr7DP5+9q6WMkyKXB+904bYmG40syjMFV0oLlhhFCwWl0vA0DyzTDkwAiJw==",
	"dev": true,
	"dependencies": {
	"esutils": "^2.0.2",
	"lodash": "^4.17.13",
	"to-fast-properties": "^2.0.0"
	}
	},
	"node_modules/@babel/types/node_modules/to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/@webassemblyjs/ast": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.8.5.tgz",
	"integrity": "sha512-aJMfngIZ65+t71C3y2nBBg5FFG0Okt9m0XEgWZ7Ywgn1oMAT8cNwx00Uv1cQyHtidq0Xn94R4TAywO+LCQ+ZAQ==",
	"dependencies": {
	"@webassemblyjs/helper-module-context": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/wast-parser": "1.8.5"
	}
	},
	"node_modules/@webassemblyjs/floating-point-hex-parser": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.8.5.tgz",
	"integrity": "sha512-9p+79WHru1oqBh9ewP9zW95E3XAo+90oth7S5Re3eQnECGq59ly1Ri5tsIipKGpiStHsUYmY3zMLqtk3gTcOtQ=="
	},
	"node_modules/@webassemblyjs/helper-api-error": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.8.5.tgz",
	"integrity": "sha512-Za/tnzsvnqdaSPOUXHyKJ2XI7PDX64kWtURyGiJJZKVEdFOsdKUCPTNEVFZq3zJ2R0G5wc2PZ5gvdTRFgm81zA=="
	},
	"node_modules/@webassemblyjs/helper-buffer": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.8.5.tgz",
	"integrity": "sha512-Ri2R8nOS0U6G49Q86goFIPNgjyl6+oE1abW1pS84BuhP1Qcr5JqMwRFT3Ah3ADDDYGEgGs1iyb1DGX+kAi/c/Q=="
	},
	"node_modules/@webassemblyjs/helper-code-frame": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.8.5.tgz",
	"integrity": "sha512-VQAadSubZIhNpH46IR3yWO4kZZjMxN1opDrzePLdVKAZ+DFjkGD/rf4v1jap744uPVU6yjL/smZbRIIJTOUnKQ==",
	"dependencies": {
	"@webassemblyjs/wast-printer": "1.8.5"
	}
	},
	"node_modules/@webassemblyjs/helper-fsm": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.8.5.tgz",
	"integrity": "sha512-kRuX/saORcg8se/ft6Q2UbRpZwP4y7YrWsLXPbbmtepKr22i8Z4O3V5QE9DbZK908dh5Xya4Un57SDIKwB9eow=="
	},
	"node_modules/@webassemblyjs/helper-module-context": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.8.5.tgz",
	"integrity": "sha512-/O1B236mN7UNEU4t9X7Pj38i4VoU8CcMHyy3l2cV/kIF4U5KoHXDVqcDuOs1ltkac90IM4vZdHc52t1x8Yfs3g==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"mamacro": "^0.0.3"
	}
	},
	"node_modules/@webassemblyjs/helper-wasm-bytecode": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.8.5.tgz",
	"integrity": "sha512-Cu4YMYG3Ddl72CbmpjU/wbP6SACcOPVbHN1dI4VJNJVgFwaKf1ppeFJrwydOG3NDHxVGuCfPlLZNyEdIYlQ6QQ=="
	},
	"node_modules/@webassemblyjs/helper-wasm-section": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.8.5.tgz",
	"integrity": "sha512-VV083zwR+VTrIWWtgIUpqfvVdK4ff38loRmrdDBgBT8ADXYsEZ5mPQ4Nde90N3UYatHdYoDIFb7oHzMncI02tA==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-buffer": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/wasm-gen": "1.8.5"
	}
	},
	"node_modules/@webassemblyjs/ieee754": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.8.5.tgz",
	"integrity": "sha512-aaCvQYrvKbY/n6wKHb/ylAJr27GglahUO89CcGXMItrOBqRarUMxWLJgxm9PJNuKULwN5n1csT9bYoMeZOGF3g==",
	"dependencies": {
	"@xtuc/ieee754": "^1.2.0"
	}
	},
	"node_modules/@webassemblyjs/leb128": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.8.5.tgz",
	"integrity": "sha512-plYUuUwleLIziknvlP8VpTgO4kqNaH57Y3JnNa6DLpu/sGcP6hbVdfdX5aHAV716pQBKrfuU26BJK29qY37J7A==",
	"dependencies": {
	"@xtuc/long": "4.2.2"
	}
	},
	"node_modules/@webassemblyjs/utf8": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.8.5.tgz",
	"integrity": "sha512-U7zgftmQriw37tfD934UNInokz6yTmn29inT2cAetAsaU9YeVCveWEwhKL1Mg4yS7q//NGdzy79nlXh3bT8Kjw=="
	},
	"node_modules/@webassemblyjs/wasm-edit": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.8.5.tgz",
	"integrity": "sha512-A41EMy8MWw5yvqj7MQzkDjU29K7UJq1VrX2vWLzfpRHt3ISftOXqrtojn7nlPsZ9Ijhp5NwuODuycSvfAO/26Q==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-buffer": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/helper-wasm-section": "1.8.5",
	"@webassemblyjs/wasm-gen": "1.8.5",
	"@webassemblyjs/wasm-opt": "1.8.5",
	"@webassemblyjs/wasm-parser": "1.8.5",
	"@webassemblyjs/wast-printer": "1.8.5"
	}
	},
	"node_modules/@webassemblyjs/wasm-gen": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.8.5.tgz",
	"integrity": "sha512-BCZBT0LURC0CXDzj5FXSc2FPTsxwp3nWcqXQdOZE4U7h7i8FqtFK5Egia6f9raQLpEKT1VL7zr4r3+QX6zArWg==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/ieee754": "1.8.5",
	"@webassemblyjs/leb128": "1.8.5",
	"@webassemblyjs/utf8": "1.8.5"
	}
	},
	"node_modules/@webassemblyjs/wasm-opt": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.8.5.tgz",
	"integrity": "sha512-HKo2mO/Uh9A6ojzu7cjslGaHaUU14LdLbGEKqTR7PBKwT6LdPtLLh9fPY33rmr5wcOMrsWDbbdCHq4hQUdd37Q==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-buffer": "1.8.5",
	"@webassemblyjs/wasm-gen": "1.8.5",
	"@webassemblyjs/wasm-parser": "1.8.5"
	}
	},
	"node_modules/@webassemblyjs/wasm-parser": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.8.5.tgz",
	"integrity": "sha512-pi0SYE9T6tfcMkthwcgCpL0cM9nRYr6/6fjgDtL6q/ZqKHdMWvxitRi5JcZ7RI4SNJJYnYNaWy5UUrHQy998lw==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-api-error": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/ieee754": "1.8.5",
	"@webassemblyjs/leb128": "1.8.5",
	"@webassemblyjs/utf8": "1.8.5"
	}
	},
	"node_modules/@webassemblyjs/wast-parser": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.8.5.tgz",
	"integrity": "sha512-daXC1FyKWHF1i11obK086QRlsMsY4+tIOKgBqI1lxAnkp9xe9YMcgOxm9kLe+ttjs5aWV2KKE1TWJCN57/Btsg==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/floating-point-hex-parser": "1.8.5",
	"@webassemblyjs/helper-api-error": "1.8.5",
	"@webassemblyjs/helper-code-frame": "1.8.5",
	"@webassemblyjs/helper-fsm": "1.8.5",
	"@xtuc/long": "4.2.2"
	}
	},
	"node_modules/@webassemblyjs/wast-printer": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.8.5.tgz",
	"integrity": "sha512-w0U0pD4EhlnvRyeJzBqaVSJAo9w/ce7/WPogeXLzGkO6hzhr4GnQIZ4W4uUt5b9ooAaXPtnXlj0gzsXEOUNYMg==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/wast-parser": "1.8.5",
	"@xtuc/long": "4.2.2"
	}
	},
	"node_modules/@xtuc/ieee754": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/@xtuc/ieee754/-/ieee754-1.2.0.tgz",
	"integrity": "sha512-DX8nKgqcGwsc0eJSqYt5lwP4DH5FlHnmuWWBRy7X0NcaGR0ZtuyeESgMwTYVEtxmsNGY+qit4QYT/MIYTOTPeA=="
	},
	"node_modules/@xtuc/long": {
	"version": "4.2.2",
	"resolved": "https://registry.npmjs.org/@xtuc/long/-/long-4.2.2.tgz",
	"integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ=="
	},
	"node_modules/acorn": {
	"version": "6.4.1",
	"resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.1.tgz",
	"integrity": "sha512-ZVA9k326Nwrj3Cj9jlh3wGFutC2ZornPNARZwsNYqQYgN0EsV2d53w5RN/co65Ohn4sUAUtb1rSUAOD6XN9idA==",
	"bin": {
	"acorn": "bin/acorn"
	},
	"engines": {
	"node": ">=0.4.0"
	}
	},
	"node_modules/ajv": {
	"version": "6.12.0",
	"resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.0.tgz",
	"integrity": "sha512-D6gFiFA0RRLyUbvijN74DWAjXSFxWKaWP7mldxkVhyhAV3+SWA9HEJPHQ2c9soIeTFJqcSdFDGFgdqs1iUU2Hw==",
	"dependencies": {
	"fast-deep-equal": "^3.1.1",
	"fast-json-stable-stringify": "^2.0.0",
	"json-schema-traverse": "^0.4.1",
	"uri-js": "^4.2.2"
	}
	},
	"node_modules/ajv-errors": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.1.tgz",
	"integrity": "sha512-DCRfO/4nQ+89p/RK43i8Ezd41EqdGIU4ld7nGF8OQ14oc/we5rEntLCUa7+jrn3nn83BosfwZA0wb4pon2o8iQ=="
	},
	"node_modules/ajv-keywords": {
	"version": "3.4.1",
	"resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.4.1.tgz",
	"integrity": "sha512-RO1ibKvd27e6FEShVFfPALuHI3WjSVNeK5FIsmme/LYRNxjKuNj+Dt7bucLa6NdSv3JcVTyMlm9kGR84z1XpaQ=="
	},
	"node_modules/ansi-regex": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz",
	"integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/ansi-styles": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
	"integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/anymatch": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz",
	"integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==",
	"dependencies": {
	"micromatch": "^3.1.4",
	"normalize-path": "^2.1.1"
	}
	},
	"node_modules/anymatch/node_modules/normalize-path": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz",
	"integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=",
	"dependencies": {
	"remove-trailing-separator": "^1.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/aproba": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz",
	"integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw=="
	},
	"node_modules/argparse": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz",
	"integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q=="
	},
	"node_modules/arr-diff": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz",
	"integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/arr-flatten": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz",
	"integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/arr-union": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz",
	"integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/array-unique": {
	"version": "0.3.2",
	"resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz",
	"integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/asn1.js": {
	"version": "4.10.1",
	"resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-4.10.1.tgz",
	"integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==",
	"dependencies": {
	"bn.js": "^4.0.0",
	"inherits": "^2.0.1",
	"minimalistic-assert": "^1.0.0"
	}
	},
	"node_modules/assert": {
	"version": "1.5.0",
	"resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz",
	"integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==",
	"dependencies": {
	"object-assign": "^4.1.1",
	"util": "0.10.3"
	}
	},
	"node_modules/assert/node_modules/inherits": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz",
	"integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE="
	},
	"node_modules/assert/node_modules/util": {
	"version": "0.10.3",
	"resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz",
	"integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=",
	"dependencies": {
	"inherits": "2.0.1"
	}
	},
	"node_modules/assign-symbols": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz",
	"integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/async-each": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.3.tgz",
	"integrity": "sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ=="
	},
	"node_modules/atob": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz",
	"integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==",
	"bin": {
	"atob": "bin/atob.js"
	},
	"engines": {
	"node": ">= 4.5.0"
	}
	},
	"node_modules/babel-code-frame": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-code-frame/-/babel-code-frame-6.26.0.tgz",
	"integrity": "sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=",
	"dependencies": {
	"chalk": "^1.1.3",
	"esutils": "^2.0.2",
	"js-tokens": "^3.0.2"
	}
	},
	"node_modules/babel-core": {
	"version": "6.26.3",
	"resolved": "https://registry.npmjs.org/babel-core/-/babel-core-6.26.3.tgz",
	"integrity": "sha512-6jyFLuDmeidKmUEb3NM+/yawG0M2bDZ9Z1qbZP59cyHLz8kYGKYwpJP0UwUKKUiTRNvxfLesJnTedqczP7cTDA==",
	"dependencies": {
	"babel-code-frame": "^6.26.0",
	"babel-generator": "^6.26.0",
	"babel-helpers": "^6.24.1",
	"babel-messages": "^6.23.0",
	"babel-register": "^6.26.0",
	"babel-runtime": "^6.26.0",
	"babel-template": "^6.26.0",
	"babel-traverse": "^6.26.0",
	"babel-types": "^6.26.0",
	"babylon": "^6.18.0",
	"convert-source-map": "^1.5.1",
	"debug": "^2.6.9",
	"json5": "^0.5.1",
	"lodash": "^4.17.4",
	"minimatch": "^3.0.4",
	"path-is-absolute": "^1.0.1",
	"private": "^0.1.8",
	"slash": "^1.0.0",
	"source-map": "^0.5.7"
	}
	},
	"node_modules/babel-core/node_modules/json5": {
	"version": "0.5.1",
	"resolved": "https://registry.npmjs.org/json5/-/json5-0.5.1.tgz",
	"integrity": "sha1-Hq3nrMASA0rYTiOWdn6tn6VJWCE=",
	"bin": {
	"json5": "lib/cli.js"
	}
	},
	"node_modules/babel-generator": {
	"version": "6.26.1",
	"resolved": "https://registry.npmjs.org/babel-generator/-/babel-generator-6.26.1.tgz",
	"integrity": "sha512-HyfwY6ApZj7BYTcJURpM5tznulaBvyio7/0d4zFOeMPUmfxkCjHocCuoLa2SAGzBI8AREcH3eP3758F672DppA==",
	"dependencies": {
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"detect-indent": "^4.0.0",
	"jsesc": "^1.3.0",
	"lodash": "^4.17.4",
	"source-map": "^0.5.7",
	"trim-right": "^1.0.1"
	}
	},
	"node_modules/babel-helper-call-delegate": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz",
	"integrity": "sha1-7Oaqzdx25Bw0YfiL/Fdb0Nqi340=",
	"dependencies": {
	"babel-helper-hoist-variables": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-helper-define-map": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-helper-define-map/-/babel-helper-define-map-6.26.0.tgz",
	"integrity": "sha1-pfVtq0GiX5fstJjH66ypgZ+Vvl8=",
	"dependencies": {
	"babel-helper-function-name": "^6.24.1",
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"lodash": "^4.17.4"
	}
	},
	"node_modules/babel-helper-function-name": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz",
	"integrity": "sha1-00dbjAPtmCQqJbSDUasYOZ01gKk=",
	"dependencies": {
	"babel-helper-get-function-arity": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-helper-get-function-arity": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz",
	"integrity": "sha1-j3eCqpNAfEHTqlCQj4mwMbG2hT0=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-helper-hoist-variables": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz",
	"integrity": "sha1-HssnaJydJVE+rbyZFKc/VAi+enY=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-helper-optimise-call-expression": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-optimise-call-expression/-/babel-helper-optimise-call-expression-6.24.1.tgz",
	"integrity": "sha1-96E0J7qfc/j0+pk8VKl4gtEkQlc=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-helper-regex": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz",
	"integrity": "sha1-MlxZ+QL4LyS3T6zu0DY5VPZJXnI=",
	"dependencies": {
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"lodash": "^4.17.4"
	}
	},
	"node_modules/babel-helper-replace-supers": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-replace-supers/-/babel-helper-replace-supers-6.24.1.tgz",
	"integrity": "sha1-v22/5Dk40XNpohPKiov3S2qQqxo=",
	"dependencies": {
	"babel-helper-optimise-call-expression": "^6.24.1",
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-helpers": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helpers/-/babel-helpers-6.24.1.tgz",
	"integrity": "sha1-NHHenK7DiOXIUOWX5Yom3fN2ArI=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"node_modules/babel-loader": {
	"version": "8.0.6",
	"resolved": "https://registry.npmjs.org/babel-loader/-/babel-loader-8.0.6.tgz",
	"integrity": "sha512-4BmWKtBOBm13uoUwd08UwjZlaw3O9GWf456R9j+5YykFZ6LUIjIKLc0zEZf+hauxPOJs96C8k6FvYD09vWzhYw==",
	"dev": true,
	"dependencies": {
	"find-cache-dir": "^2.0.0",
	"loader-utils": "^1.0.2",
	"mkdirp": "^0.5.1",
	"pify": "^4.0.1"
	},
	"engines": {
	"node": ">= 6.9"
	}
	},
	"node_modules/babel-messages": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-messages/-/babel-messages-6.23.0.tgz",
	"integrity": "sha1-8830cDhYA1sqKVHG7F7fbGLyYw4=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-check-es2015-constants": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz",
	"integrity": "sha1-NRV7EBQm/S/9PaP3XH0ekYNbv4o=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-dynamic-import-node": {
	"version": "2.3.3",
	"resolved": "https://registry.npmjs.org/babel-plugin-dynamic-import-node/-/babel-plugin-dynamic-import-node-2.3.3.tgz",
	"integrity": "sha512-jZVI+s9Zg3IqA/kdi0i6UDCybUI3aSBLnglhYbSSjKlV7yF1F/5LWv8MakQmvYpnbJDS6fcBL2KzHSxNCMtWSQ==",
	"dev": true,
	"dependencies": {
	"object.assign": "^4.1.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-arrow-functions": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-arrow-functions/-/babel-plugin-transform-es2015-arrow-functions-6.22.0.tgz",
	"integrity": "sha1-RSaSy3EdX3ncf4XkQM5BufJE0iE=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-block-scoped-functions": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoped-functions/-/babel-plugin-transform-es2015-block-scoped-functions-6.22.0.tgz",
	"integrity": "sha1-u8UbSflk1wy42OC5ToICRs46YUE=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-block-scoping": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoping/-/babel-plugin-transform-es2015-block-scoping-6.26.0.tgz",
	"integrity": "sha1-1w9SmcEwjQXBL0Y4E7CgnnOxiV8=",
	"dependencies": {
	"babel-runtime": "^6.26.0",
	"babel-template": "^6.26.0",
	"babel-traverse": "^6.26.0",
	"babel-types": "^6.26.0",
	"lodash": "^4.17.4"
	}
	},
	"node_modules/babel-plugin-transform-es2015-classes": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-classes/-/babel-plugin-transform-es2015-classes-6.24.1.tgz",
	"integrity": "sha1-WkxYpQyclGHlZLSyo7+ryXolhNs=",
	"dependencies": {
	"babel-helper-define-map": "^6.24.1",
	"babel-helper-function-name": "^6.24.1",
	"babel-helper-optimise-call-expression": "^6.24.1",
	"babel-helper-replace-supers": "^6.24.1",
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-computed-properties": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-computed-properties/-/babel-plugin-transform-es2015-computed-properties-6.24.1.tgz",
	"integrity": "sha1-b+Ko0WiV1WNPTNmZttNICjCBWbM=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-destructuring": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz",
	"integrity": "sha1-mXux8auWf2gtKwh2/jWNYOdlxW0=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-duplicate-keys": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-duplicate-keys/-/babel-plugin-transform-es2015-duplicate-keys-6.24.1.tgz",
	"integrity": "sha1-c+s9MQypaePvnskcU3QabxV2Qj4=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-for-of": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-for-of/-/babel-plugin-transform-es2015-for-of-6.23.0.tgz",
	"integrity": "sha1-9HyVsrYT3x0+zC/bdXNiPHUkhpE=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-function-name": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz",
	"integrity": "sha1-g0yJhTvDaxrw86TF26qU/Y6sqos=",
	"dependencies": {
	"babel-helper-function-name": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-literals": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-literals/-/babel-plugin-transform-es2015-literals-6.22.0.tgz",
	"integrity": "sha1-T1SgLWzWbPkVKAAZox0xklN3yi4=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-modules-amd": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-amd/-/babel-plugin-transform-es2015-modules-amd-6.24.1.tgz",
	"integrity": "sha1-Oz5UAXI5hC1tGcMBHEvS8AoA0VQ=",
	"dependencies": {
	"babel-plugin-transform-es2015-modules-commonjs": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-modules-commonjs": {
	"version": "6.26.2",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.2.tgz",
	"integrity": "sha512-CV9ROOHEdrjcwhIaJNBGMBCodN+1cfkwtM1SbUHmvyy35KGT7fohbpOxkE2uLz1o6odKK2Ck/tz47z+VqQfi9Q==",
	"dependencies": {
	"babel-plugin-transform-strict-mode": "^6.24.1",
	"babel-runtime": "^6.26.0",
	"babel-template": "^6.26.0",
	"babel-types": "^6.26.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-modules-systemjs": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-systemjs/-/babel-plugin-transform-es2015-modules-systemjs-6.24.1.tgz",
	"integrity": "sha1-/4mhQrkRmpBhlfXxBuzzBdlAfSM=",
	"dependencies": {
	"babel-helper-hoist-variables": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-modules-umd": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-umd/-/babel-plugin-transform-es2015-modules-umd-6.24.1.tgz",
	"integrity": "sha1-rJl+YoXNGO1hdq22B9YCNErThGg=",
	"dependencies": {
	"babel-plugin-transform-es2015-modules-amd": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-object-super": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-object-super/-/babel-plugin-transform-es2015-object-super-6.24.1.tgz",
	"integrity": "sha1-JM72muIcuDp/hgPa0CH1cusnj40=",
	"dependencies": {
	"babel-helper-replace-supers": "^6.24.1",
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-parameters": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz",
	"integrity": "sha1-V6w1GrScrxSpfNE7CfZv3wpiXys=",
	"dependencies": {
	"babel-helper-call-delegate": "^6.24.1",
	"babel-helper-get-function-arity": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-shorthand-properties": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-shorthand-properties/-/babel-plugin-transform-es2015-shorthand-properties-6.24.1.tgz",
	"integrity": "sha1-JPh11nIch2YbvZmkYi5R8U3jiqA=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-spread": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz",
	"integrity": "sha1-1taKmfia7cRTbIGlQujdnxdG+NE=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-sticky-regex": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz",
	"integrity": "sha1-AMHNsaynERLN8M9hJsLta0V8zbw=",
	"dependencies": {
	"babel-helper-regex": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-plugin-transform-es2015-template-literals": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-template-literals/-/babel-plugin-transform-es2015-template-literals-6.22.0.tgz",
	"integrity": "sha1-qEs0UPfp+PH2g51taH2oS7EjbY0=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-typeof-symbol": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-typeof-symbol/-/babel-plugin-transform-es2015-typeof-symbol-6.23.0.tgz",
	"integrity": "sha1-3sCfHN3/lLUqxz1QXITfWdzOs3I=",
	"dependencies": {
	"babel-runtime": "^6.22.0"
	}
	},
	"node_modules/babel-plugin-transform-es2015-unicode-regex": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz",
	"integrity": "sha1-04sS9C6nMj9yk4fxinxa4frrNek=",
	"dependencies": {
	"babel-helper-regex": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"regexpu-core": "^2.0.0"
	}
	},
	"node_modules/babel-plugin-transform-regenerator": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.26.0.tgz",
	"integrity": "sha1-4HA2lvveJ/Cj78rPi03KL3s6jy8=",
	"dependencies": {
	"regenerator-transform": "^0.10.0"
	}
	},
	"node_modules/babel-plugin-transform-strict-mode": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz",
	"integrity": "sha1-1fr3qleKZbvlkc9e2uBKDGcCB1g=",
	"dependencies": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"node_modules/babel-preset-es2015": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-preset-es2015/-/babel-preset-es2015-6.24.1.tgz",
	"integrity": "sha1-1EBQ1rwsn+6nAqrzjXJ6AhBTiTk=",
	"dependencies": {
	"babel-plugin-check-es2015-constants": "^6.22.0",
	"babel-plugin-transform-es2015-arrow-functions": "^6.22.0",
	"babel-plugin-transform-es2015-block-scoped-functions": "^6.22.0",
	"babel-plugin-transform-es2015-block-scoping": "^6.24.1",
	"babel-plugin-transform-es2015-classes": "^6.24.1",
	"babel-plugin-transform-es2015-computed-properties": "^6.24.1",
	"babel-plugin-transform-es2015-destructuring": "^6.22.0",
	"babel-plugin-transform-es2015-duplicate-keys": "^6.24.1",
	"babel-plugin-transform-es2015-for-of": "^6.22.0",
	"babel-plugin-transform-es2015-function-name": "^6.24.1",
	"babel-plugin-transform-es2015-literals": "^6.22.0",
	"babel-plugin-transform-es2015-modules-amd": "^6.24.1",
	"babel-plugin-transform-es2015-modules-commonjs": "^6.24.1",
	"babel-plugin-transform-es2015-modules-systemjs": "^6.24.1",
	"babel-plugin-transform-es2015-modules-umd": "^6.24.1",
	"babel-plugin-transform-es2015-object-super": "^6.24.1",
	"babel-plugin-transform-es2015-parameters": "^6.24.1",
	"babel-plugin-transform-es2015-shorthand-properties": "^6.24.1",
	"babel-plugin-transform-es2015-spread": "^6.22.0",
	"babel-plugin-transform-es2015-sticky-regex": "^6.24.1",
	"babel-plugin-transform-es2015-template-literals": "^6.22.0",
	"babel-plugin-transform-es2015-typeof-symbol": "^6.22.0",
	"babel-plugin-transform-es2015-unicode-regex": "^6.24.1",
	"babel-plugin-transform-regenerator": "^6.24.1"
	}
	},
	"node_modules/babel-register": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-register/-/babel-register-6.26.0.tgz",
	"integrity": "sha1-btAhFz4vy0htestFxgCahW9kcHE=",
	"dependencies": {
	"babel-core": "^6.26.0",
	"babel-runtime": "^6.26.0",
	"core-js": "^2.5.0",
	"home-or-tmp": "^2.0.0",
	"lodash": "^4.17.4",
	"mkdirp": "^0.5.1",
	"source-map-support": "^0.4.15"
	}
	},
	"node_modules/babel-register/node_modules/source-map-support": {
	"version": "0.4.18",
	"resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.4.18.tgz",
	"integrity": "sha512-try0/JqxPLF9nOjvSta7tVondkP5dwgyLDjVoyMDlmjugT2lRZ1OfsrYTkCd2hkDnJTKRbO/Rl3orm8vlsUzbA==",
	"dependencies": {
	"source-map": "^0.5.6"
	}
	},
	"node_modules/babel-runtime": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-runtime/-/babel-runtime-6.26.0.tgz",
	"integrity": "sha1-llxwWGaOgrVde/4E/yM3vItWR/4=",
	"dependencies": {
	"core-js": "^2.4.0",
	"regenerator-runtime": "^0.11.0"
	}
	},
	"node_modules/babel-template": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-template/-/babel-template-6.26.0.tgz",
	"integrity": "sha1-3gPi0WOWsGn0bdn/+FIfsaDjXgI=",
	"dependencies": {
	"babel-runtime": "^6.26.0",
	"babel-traverse": "^6.26.0",
	"babel-types": "^6.26.0",
	"babylon": "^6.18.0",
	"lodash": "^4.17.4"
	}
	},
	"node_modules/babel-traverse": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-traverse/-/babel-traverse-6.26.0.tgz",
	"integrity": "sha1-RqnL1+3MYsjlwGTi0tjQ9ANXZu4=",
	"dependencies": {
	"babel-code-frame": "^6.26.0",
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"babylon": "^6.18.0",
	"debug": "^2.6.8",
	"globals": "^9.18.0",
	"invariant": "^2.2.2",
	"lodash": "^4.17.4"
	}
	},
	"node_modules/babel-types": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-types/-/babel-types-6.26.0.tgz",
	"integrity": "sha1-o7Bz+Uq0nrb6Vc1lInozQ4BjJJc=",
	"dependencies": {
	"babel-runtime": "^6.26.0",
	"esutils": "^2.0.2",
	"lodash": "^4.17.4",
	"to-fast-properties": "^1.0.3"
	}
	},
	"node_modules/babylon": {
	"version": "6.18.0",
	"resolved": "https://registry.npmjs.org/babylon/-/babylon-6.18.0.tgz",
	"integrity": "sha512-q/UEjfGJ2Cm3oKV71DJz9d25TPnq5rhBVL2Q4fA5wcC3jcrdn7+SssEybFIxwAvvP+YCsCYNKughoF33GxgycQ==",
	"bin": {
	"babylon": "bin/babylon.js"
	}
	},
	"node_modules/balanced-match": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz",
	"integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c="
	},
	"node_modules/base": {
	"version": "0.11.2",
	"resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz",
	"integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==",
	"dependencies": {
	"cache-base": "^1.0.1",
	"class-utils": "^0.3.5",
	"component-emitter": "^1.2.1",
	"define-property": "^1.0.0",
	"isobject": "^3.0.1",
	"mixin-deep": "^1.2.0",
	"pascalcase": "^0.1.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/base/node_modules/define-property": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
	"integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
	"dependencies": {
	"is-descriptor": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/base/node_modules/is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/base/node_modules/is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/base/node_modules/is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"dependencies": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/base64-js": {
	"version": "1.3.1",
	"resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.1.tgz",
	"integrity": "sha512-mLQ4i2QO1ytvGWFWmcngKO//JXAQueZvwEKtjgQFM4jIK0kU+ytMfplL8j+n5mspOfjHwoAg+9yhb7BwAHm36g=="
	},
	"node_modules/big.js": {
	"version": "5.2.2",
	"resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz",
	"integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ==",
	"engines": {
	"node": "*"
	}
	},
	"node_modules/binary-extensions": {
	"version": "1.13.1",
	"resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz",
	"integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/bindings": {
	"version": "1.5.0",
	"resolved": "https://registry.npmjs.org/bindings/-/bindings-1.5.0.tgz",
	"integrity": "sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==",
	"optional": true,
	"dependencies": {
	"file-uri-to-path": "1.0.0"
	}
	},
	"node_modules/bluebird": {
	"version": "3.7.2",
	"resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.7.2.tgz",
	"integrity": "sha512-XpNj6GDQzdfW+r2Wnn7xiSAd7TM3jzkxGXBGTtWKuSXv1xUV+azxAm8jdWZN06QTQk+2N2XB9jRDkvbmQmcRtg=="
	},
	"node_modules/bn.js": {
	"version": "4.11.8",
	"resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.8.tgz",
	"integrity": "sha512-ItfYfPLkWHUjckQCk8xC+LwxgK8NYcXywGigJgSwOP8Y2iyWT4f2vsZnoOXTTbo+o5yXmIUJ4gn5538SO5S3gA=="
	},
	"node_modules/brace-expansion": {
	"version": "1.1.11",
	"resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
	"integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
	"dependencies": {
	"balanced-match": "^1.0.0",
	"concat-map": "0.0.1"
	}
	},
	"node_modules/braces": {
	"version": "2.3.2",
	"resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz",
	"integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==",
	"dependencies": {
	"arr-flatten": "^1.1.0",
	"array-unique": "^0.3.2",
	"extend-shallow": "^2.0.1",
	"fill-range": "^4.0.0",
	"isobject": "^3.0.1",
	"repeat-element": "^1.1.2",
	"snapdragon": "^0.8.1",
	"snapdragon-node": "^2.0.1",
	"split-string": "^3.0.2",
	"to-regex": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/braces/node_modules/extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"dependencies": {
	"is-extendable": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/brorand": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz",
	"integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8="
	},
	"node_modules/browserify-aes": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz",
	"integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==",
	"dependencies": {
	"buffer-xor": "^1.0.3",
	"cipher-base": "^1.0.0",
	"create-hash": "^1.1.0",
	"evp_bytestokey": "^1.0.3",
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	}
	},
	"node_modules/browserify-cipher": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz",
	"integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==",
	"dependencies": {
	"browserify-aes": "^1.0.4",
	"browserify-des": "^1.0.0",
	"evp_bytestokey": "^1.0.0"
	}
	},
	"node_modules/browserify-des": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz",
	"integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==",
	"dependencies": {
	"cipher-base": "^1.0.1",
	"des.js": "^1.0.0",
	"inherits": "^2.0.1",
	"safe-buffer": "^5.1.2"
	}
	},
	"node_modules/browserify-rsa": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz",
	"integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=",
	"dependencies": {
	"bn.js": "^4.1.0",
	"randombytes": "^2.0.1"
	}
	},
	"node_modules/browserify-sign": {
	"version": "4.0.4",
	"resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.0.4.tgz",
	"integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=",
	"dependencies": {
	"bn.js": "^4.1.1",
	"browserify-rsa": "^4.0.0",
	"create-hash": "^1.1.0",
	"create-hmac": "^1.1.2",
	"elliptic": "^6.0.0",
	"inherits": "^2.0.1",
	"parse-asn1": "^5.0.0"
	}
	},
	"node_modules/browserify-zlib": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz",
	"integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==",
	"dependencies": {
	"pako": "~1.0.5"
	}
	},
	"node_modules/browserslist": {
	"version": "4.14.1",
	"resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.14.1.tgz",
	"integrity": "sha512-zyBTIHydW37pnb63c7fHFXUG6EcqWOqoMdDx6cdyaDFriZ20EoVxcE95S54N+heRqY8m8IUgB5zYta/gCwSaaA==",
	"dev": true,
	"dependencies": {
	"caniuse-lite": "^1.0.30001124",
	"electron-to-chromium": "^1.3.562",
	"escalade": "^3.0.2",
	"node-releases": "^1.1.60"
	},
	"bin": {
	"browserslist": "cli.js"
	},
	"engines": {
	"node": "^6 \|\| ^7 \|\| ^8 \|\| ^9 \|\| ^10 \|\| ^11 \|\| ^12 \|\| >=13.7"
	}
	},
	"node_modules/buffer": {
	"version": "4.9.2",
	"resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz",
	"integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==",
	"dependencies": {
	"base64-js": "^1.0.2",
	"ieee754": "^1.1.4",
	"isarray": "^1.0.0"
	}
	},
	"node_modules/buffer-from": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz",
	"integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A=="
	},
	"node_modules/buffer-xor": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz",
	"integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk="
	},
	"node_modules/builtin-status-codes": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz",
	"integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug="
	},
	"node_modules/cacache": {
	"version": "12.0.3",
	"resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.3.tgz",
	"integrity": "sha512-kqdmfXEGFepesTuROHMs3MpFLWrPkSSpRqOw80RCflZXy/khxaArvFrQ7uJxSUduzAufc6G0g1VUCOZXxWavPw==",
	"dependencies": {
	"bluebird": "^3.5.5",
	"chownr": "^1.1.1",
	"figgy-pudding": "^3.5.1",
	"glob": "^7.1.4",
	"graceful-fs": "^4.1.15",
	"infer-owner": "^1.0.3",
	"lru-cache": "^5.1.1",
	"mississippi": "^3.0.0",
	"mkdirp": "^0.5.1",
	"move-concurrently": "^1.0.1",
	"promise-inflight": "^1.0.1",
	"rimraf": "^2.6.3",
	"ssri": "^6.0.1",
	"unique-filename": "^1.1.1",
	"y18n": "^4.0.0"
	}
	},
	"node_modules/cache-base": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz",
	"integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==",
	"dependencies": {
	"collection-visit": "^1.0.0",
	"component-emitter": "^1.2.1",
	"get-value": "^2.0.6",
	"has-value": "^1.0.0",
	"isobject": "^3.0.1",
	"set-value": "^2.0.0",
	"to-object-path": "^0.3.0",
	"union-value": "^1.0.0",
	"unset-value": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/camelcase": {
	"version": "5.3.1",
	"resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz",
	"integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/caniuse-lite": {
	"version": "1.0.30001125",
	"resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001125.tgz",
	"integrity": "sha512-9f+r7BW8Qli917mU3j0fUaTweT3f3vnX/Lcs+1C73V+RADmFme+Ih0Br8vONQi3X0lseOe6ZHfsZLCA8MSjxUA==",
	"dev": true
	},
	"node_modules/chalk": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
	"integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
	"dependencies": {
	"ansi-styles": "^2.2.1",
	"escape-string-regexp": "^1.0.2",
	"has-ansi": "^2.0.0",
	"strip-ansi": "^3.0.0",
	"supports-color": "^2.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/chokidar": {
	"version": "2.1.8",
	"resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz",
	"integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==",
	"dependencies": {
	"anymatch": "^2.0.0",
	"async-each": "^1.0.1",
	"braces": "^2.3.2",
	"glob-parent": "^3.1.0",
	"inherits": "^2.0.3",
	"is-binary-path": "^1.0.0",
	"is-glob": "^4.0.0",
	"normalize-path": "^3.0.0",
	"path-is-absolute": "^1.0.0",
	"readdirp": "^2.2.1",
	"upath": "^1.1.1"
	},
	"optionalDependencies": {
	"fsevents": "^1.2.7"
	}
	},
	"node_modules/chownr": {
	"version": "1.1.4",
	"resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.4.tgz",
	"integrity": "sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg=="
	},
	"node_modules/chrome-trace-event": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-1.0.2.tgz",
	"integrity": "sha512-9e/zx1jw7B4CO+c/RXoCsfg/x1AfUBioy4owYH0bJprEYAx5hRFLRhWBqHAG57D0ZM4H7vxbP7bPe0VwhQRYDQ==",
	"dependencies": {
	"tslib": "^1.9.0"
	},
	"engines": {
	"node": ">=6.0"
	}
	},
	"node_modules/cipher-base": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz",
	"integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==",
	"dependencies": {
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	}
	},
	"node_modules/class-utils": {
	"version": "0.3.6",
	"resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz",
	"integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==",
	"dependencies": {
	"arr-union": "^3.1.0",
	"define-property": "^0.2.5",
	"isobject": "^3.0.0",
	"static-extend": "^0.1.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/class-utils/node_modules/define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"dependencies": {
	"is-descriptor": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/cliui": {
	"version": "5.0.0",
	"resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz",
	"integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==",
	"dependencies": {
	"string-width": "^3.1.0",
	"strip-ansi": "^5.2.0",
	"wrap-ansi": "^5.1.0"
	}
	},
	"node_modules/cliui/node_modules/ansi-regex": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz",
	"integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/cliui/node_modules/strip-ansi": {
	"version": "5.2.0",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz",
	"integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==",
	"dependencies": {
	"ansi-regex": "^4.1.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/collection-visit": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz",
	"integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=",
	"dependencies": {
	"map-visit": "^1.0.0",
	"object-visit": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/color-convert": {
	"version": "1.9.3",
	"resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz",
	"integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==",
	"dependencies": {
	"color-name": "1.1.3"
	}
	},
	"node_modules/color-name": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz",
	"integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU="
	},
	"node_modules/commander": {
	"version": "2.20.3",
	"resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz",
	"integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ=="
	},
	"node_modules/commondir": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz",
	"integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs="
	},
	"node_modules/component-emitter": {
	"version": "1.3.0",
	"resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz",
	"integrity": "sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg=="
	},
	"node_modules/concat-map": {
	"version": "0.0.1",
	"resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
	"integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s="
	},
	"node_modules/concat-stream": {
	"version": "1.6.2",
	"resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz",
	"integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==",
	"engines": [
	"node >= 0.8"
	],
	"dependencies": {
	"buffer-from": "^1.0.0",
	"inherits": "^2.0.3",
	"readable-stream": "^2.2.2",
	"typedarray": "^0.0.6"
	}
	},
	"node_modules/console-browserify": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz",
	"integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA=="
	},
	"node_modules/constants-browserify": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz",
	"integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U="
	},
	"node_modules/convert-source-map": {
	"version": "1.7.0",
	"resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz",
	"integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==",
	"dependencies": {
	"safe-buffer": "~5.1.1"
	}
	},
	"node_modules/copy-concurrently": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz",
	"integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==",
	"dependencies": {
	"aproba": "^1.1.1",
	"fs-write-stream-atomic": "^1.0.8",
	"iferr": "^0.1.5",
	"mkdirp": "^0.5.1",
	"rimraf": "^2.5.4",
	"run-queue": "^1.0.0"
	}
	},
	"node_modules/copy-descriptor": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz",
	"integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/core-js": {
	"version": "2.6.11",
	"resolved": "https://registry.npmjs.org/core-js/-/core-js-2.6.11.tgz",
	"integrity": "sha512-5wjnpaT/3dV+XB4borEsnAYQchn00XSgTAWKDkEqv+K8KevjbzmofK6hfJ9TZIlpj2N0xQpazy7PiRQiWHqzWg==",
	"hasInstallScript": true
	},
	"node_modules/core-js-compat": {
	"version": "3.6.5",
	"resolved": "https://registry.npmjs.org/core-js-compat/-/core-js-compat-3.6.5.tgz",
	"integrity": "sha512-7ItTKOhOZbznhXAQ2g/slGg1PJV5zDO/WdkTwi7UEOJmkvsE32PWvx6mKtDjiMpjnR2CNf6BAD6sSxIlv7ptng==",
	"dev": true,
	"dependencies": {
	"browserslist": "^4.8.5",
	"semver": "7.0.0"
	}
	},
	"node_modules/core-js-compat/node_modules/semver": {
	"version": "7.0.0",
	"resolved": "https://registry.npmjs.org/semver/-/semver-7.0.0.tgz",
	"integrity": "sha512-+GB6zVA9LWh6zovYQLALHwv5rb2PHGlJi3lfiqIHxR0uuwCgefcOJc59v9fv1w8GbStwxuuqqAjI9NMAOOgq1A==",
	"dev": true,
	"bin": {
	"semver": "bin/semver.js"
	}
	},
	"node_modules/core-util-is": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
	"integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac="
	},
	"node_modules/create-ecdh": {
	"version": "4.0.3",
	"resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.3.tgz",
	"integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==",
	"dependencies": {
	"bn.js": "^4.1.0",
	"elliptic": "^6.0.0"
	}
	},
	"node_modules/create-hash": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz",
	"integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==",
	"dependencies": {
	"cipher-base": "^1.0.1",
	"inherits": "^2.0.1",
	"md5.js": "^1.3.4",
	"ripemd160": "^2.0.1",
	"sha.js": "^2.4.0"
	}
	},
	"node_modules/create-hmac": {
	"version": "1.1.7",
	"resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz",
	"integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==",
	"dependencies": {
	"cipher-base": "^1.0.3",
	"create-hash": "^1.1.0",
	"inherits": "^2.0.1",
	"ripemd160": "^2.0.0",
	"safe-buffer": "^5.0.1",
	"sha.js": "^2.4.8"
	}
	},
	"node_modules/crel": {
	"version": "4.2.0",
	"resolved": "https://registry.npmjs.org/crel/-/crel-4.2.0.tgz",
	"integrity": "sha512-ZBVhTmtapdjEn8rTcTR/ePE0JSNfHzZfDkD3eAnsQEBmkQW9r14mzq6tK5Hkw6r26l7XxlU2Ox1nfHsmGIj0zQ=="
	},
	"node_modules/cross-spawn": {
	"version": "6.0.5",
	"resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz",
	"integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==",
	"dependencies": {
	"nice-try": "^1.0.4",
	"path-key": "^2.0.1",
	"semver": "^5.5.0",
	"shebang-command": "^1.2.0",
	"which": "^1.2.9"
	},
	"engines": {
	"node": ">=4.8"
	}
	},
	"node_modules/crypto-browserify": {
	"version": "3.12.0",
	"resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz",
	"integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==",
	"dependencies": {
	"browserify-cipher": "^1.0.0",
	"browserify-sign": "^4.0.0",
	"create-ecdh": "^4.0.0",
	"create-hash": "^1.1.0",
	"create-hmac": "^1.1.0",
	"diffie-hellman": "^5.0.0",
	"inherits": "^2.0.1",
	"pbkdf2": "^3.0.3",
	"public-encrypt": "^4.0.0",
	"randombytes": "^2.0.0",
	"randomfill": "^1.0.3"
	},
	"engines": {
	"node": "*"
	}
	},
	"node_modules/cyclist": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz",
	"integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk="
	},
	"node_modules/debug": {
	"version": "2.6.9",
	"resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
	"integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
	"dependencies": {
	"ms": "2.0.0"
	}
	},
	"node_modules/decamelize": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz",
	"integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/decode-uri-component": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz",
	"integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=",
	"engines": {
	"node": ">=0.10"
	}
	},
	"node_modules/define-properties": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz",
	"integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==",
	"dev": true,
	"dependencies": {
	"object-keys": "^1.0.12"
	},
	"engines": {
	"node": ">= 0.4"
	}
	},
	"node_modules/define-property": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz",
	"integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==",
	"dependencies": {
	"is-descriptor": "^1.0.2",
	"isobject": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/define-property/node_modules/is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/define-property/node_modules/is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/define-property/node_modules/is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"dependencies": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/des.js": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz",
	"integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==",
	"dependencies": {
	"inherits": "^2.0.1",
	"minimalistic-assert": "^1.0.0"
	}
	},
	"node_modules/detect-file": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/detect-file/-/detect-file-1.0.0.tgz",
	"integrity": "sha1-8NZtA2cqglyxtzvbP+YjEMjlUrc=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/detect-indent": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/detect-indent/-/detect-indent-4.0.0.tgz",
	"integrity": "sha1-920GQ1LN9Docts5hnE7jqUdd4gg=",
	"dependencies": {
	"repeating": "^2.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/diffie-hellman": {
	"version": "5.0.3",
	"resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz",
	"integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==",
	"dependencies": {
	"bn.js": "^4.1.0",
	"miller-rabin": "^4.0.0",
	"randombytes": "^2.0.0"
	}
	},
	"node_modules/domain-browser": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz",
	"integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==",
	"engines": {
	"node": ">=0.4",
	"npm": ">=1.2"
	}
	},
	"node_modules/duplexify": {
	"version": "3.7.1",
	"resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz",
	"integrity": "sha512-07z8uv2wMyS51kKhD1KsdXJg5WQ6t93RneqRxUHnskXVtlYYkLqM0gqStQZ3pj073g687jPCHrqNfCzawLYh5g==",
	"dependencies": {
	"end-of-stream": "^1.0.0",
	"inherits": "^2.0.1",
	"readable-stream": "^2.0.0",
	"stream-shift": "^1.0.0"
	}
	},
	"node_modules/electron-to-chromium": {
	"version": "1.3.564",
	"resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.564.tgz",
	"integrity": "sha512-fNaYN3EtKQWLQsrKXui8mzcryJXuA0LbCLoizeX6oayG2emBaS5MauKjCPAvc29NEY4FpLHIUWiP+Y0Bfrs5dg==",
	"dev": true
	},
	"node_modules/elliptic": {
	"version": "6.5.2",
	"resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.2.tgz",
	"integrity": "sha512-f4x70okzZbIQl/NSRLkI/+tteV/9WqL98zx+SQ69KbXxmVrmjwsNUPn/gYJJ0sHvEak24cZgHIPegRePAtA/xw==",
	"dependencies": {
	"bn.js": "^4.4.0",
	"brorand": "^1.0.1",
	"hash.js": "^1.0.0",
	"hmac-drbg": "^1.0.0",
	"inherits": "^2.0.1",
	"minimalistic-assert": "^1.0.0",
	"minimalistic-crypto-utils": "^1.0.0"
	}
	},
	"node_modules/emoji-regex": {
	"version": "7.0.3",
	"resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz",
	"integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA=="
	},
	"node_modules/emojis-list": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-3.0.0.tgz",
	"integrity": "sha512-/kyM18EfinwXZbno9FyUGeFh87KC8HRQBQGildHZbEuRyWFOmv1U10o9BBp8XVZDVNNuQKyIGIu5ZYAAXJ0V2Q==",
	"engines": {
	"node": ">= 4"
	}
	},
	"node_modules/end-of-stream": {
	"version": "1.4.4",
	"resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz",
	"integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==",
	"dependencies": {
	"once": "^1.4.0"
	}
	},
	"node_modules/enhanced-resolve": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.1.tgz",
	"integrity": "sha512-98p2zE+rL7/g/DzMHMTF4zZlCgeVdJ7yr6xzEpJRYwFYrGi9ANdn5DnJURg6RpBkyk60XYDnWIv51VfIhfNGuA==",
	"dependencies": {
	"graceful-fs": "^4.1.2",
	"memory-fs": "^0.5.0",
	"tapable": "^1.0.0"
	},
	"engines": {
	"node": ">=6.9.0"
	}
	},
	"node_modules/enhanced-resolve/node_modules/memory-fs": {
	"version": "0.5.0",
	"resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.5.0.tgz",
	"integrity": "sha512-jA0rdU5KoQMC0e6ppoNRtpp6vjFq6+NY7r8hywnC7V+1Xj/MtHwGIbB1QaK/dunyjWteJzmkpd7ooeWg10T7GA==",
	"dependencies": {
	"errno": "^0.1.3",
	"readable-stream": "^2.0.1"
	},
	"engines": {
	"node": ">=4.3.0 <5.0.0 \|\| >=5.10"
	}
	},
	"node_modules/entities": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/entities/-/entities-2.1.0.tgz",
	"integrity": "sha512-hCx1oky9PFrJ611mf0ifBLBRW8lUUVRlFolb5gWRfIELabBlbp9xZvrqZLZAs+NxFnbfQoeGd8wDkygjg7U85w=="
	},
	"node_modules/errno": {
	"version": "0.1.7",
	"resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz",
	"integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==",
	"dependencies": {
	"prr": "~1.0.1"
	},
	"bin": {
	"errno": "cli.js"
	}
	},
	"node_modules/escalade": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/escalade/-/escalade-3.0.2.tgz",
	"integrity": "sha512-gPYAU37hYCUhW5euPeR+Y74F7BL+IBsV93j5cvGriSaD1aG6MGsqsV1yamRdrWrb2j3aiZvb0X+UBOWpx3JWtQ==",
	"dev": true,
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/escape-string-regexp": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz",
	"integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=",
	"engines": {
	"node": ">=0.8.0"
	}
	},
	"node_modules/eslint-scope": {
	"version": "4.0.3",
	"resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-4.0.3.tgz",
	"integrity": "sha512-p7VutNr1O/QrxysMo3E45FjYDTeXBy0iTltPFNSqKAIfjDSXC+4dj+qfyuD8bfAXrW/y6lW3O76VaYNPKfpKrg==",
	"dependencies": {
	"esrecurse": "^4.1.0",
	"estraverse": "^4.1.1"
	},
	"engines": {
	"node": ">=4.0.0"
	}
	},
	"node_modules/esrecurse": {
	"version": "4.2.1",
	"resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.2.1.tgz",
	"integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==",
	"dependencies": {
	"estraverse": "^4.1.0"
	},
	"engines": {
	"node": ">=4.0"
	}
	},
	"node_modules/estraverse": {
	"version": "4.3.0",
	"resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.3.0.tgz",
	"integrity": "sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==",
	"engines": {
	"node": ">=4.0"
	}
	},
	"node_modules/esutils": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz",
	"integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/events": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/events/-/events-3.1.0.tgz",
	"integrity": "sha512-Rv+u8MLHNOdMjTAFeT3nCjHn2aGlx435FP/sDHNaRhDEMwyI/aB22Kj2qIN8R0cw3z28psEQLYwxVKLsKrMgWg==",
	"engines": {
	"node": ">=0.8.x"
	}
	},
	"node_modules/evp_bytestokey": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz",
	"integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==",
	"dependencies": {
	"md5.js": "^1.3.4",
	"safe-buffer": "^5.1.1"
	}
	},
	"node_modules/execa": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/execa/-/execa-1.0.0.tgz",
	"integrity": "sha512-adbxcyWV46qiHyvSp50TKt05tB4tK3HcmF7/nxfAdhnox83seTDbwnaqKO4sXRy7roHAIFqJP/Rw/AuEbX61LA==",
	"dependencies": {
	"cross-spawn": "^6.0.0",
	"get-stream": "^4.0.0",
	"is-stream": "^1.1.0",
	"npm-run-path": "^2.0.0",
	"p-finally": "^1.0.0",
	"signal-exit": "^3.0.0",
	"strip-eof": "^1.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/expand-brackets": {
	"version": "2.1.4",
	"resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz",
	"integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=",
	"dependencies": {
	"debug": "^2.3.3",
	"define-property": "^0.2.5",
	"extend-shallow": "^2.0.1",
	"posix-character-classes": "^0.1.0",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/expand-brackets/node_modules/define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"dependencies": {
	"is-descriptor": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/expand-brackets/node_modules/extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"dependencies": {
	"is-extendable": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/expand-tilde": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/expand-tilde/-/expand-tilde-2.0.2.tgz",
	"integrity": "sha1-l+gBqgUt8CRU3kawK/YhZCzchQI=",
	"dependencies": {
	"homedir-polyfill": "^1.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extend-shallow": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz",
	"integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=",
	"dependencies": {
	"assign-symbols": "^1.0.0",
	"is-extendable": "^1.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extend-shallow/node_modules/is-extendable": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
	"integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
	"dependencies": {
	"is-plain-object": "^2.0.4"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extglob": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz",
	"integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==",
	"dependencies": {
	"array-unique": "^0.3.2",
	"define-property": "^1.0.0",
	"expand-brackets": "^2.1.4",
	"extend-shallow": "^2.0.1",
	"fragment-cache": "^0.2.1",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extglob/node_modules/define-property": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
	"integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
	"dependencies": {
	"is-descriptor": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extglob/node_modules/extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"dependencies": {
	"is-extendable": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extglob/node_modules/is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extglob/node_modules/is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/extglob/node_modules/is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"dependencies": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fast-deep-equal": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.1.tgz",
	"integrity": "sha512-8UEa58QDLauDNfpbrX55Q9jrGHThw2ZMdOky5Gl1CDtVeJDPVrG4Jxx1N8jw2gkWaff5UUuX1KJd+9zGe2B+ZA=="
	},
	"node_modules/fast-json-stable-stringify": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz",
	"integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw=="
	},
	"node_modules/figgy-pudding": {
	"version": "3.5.1",
	"resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.1.tgz",
	"integrity": "sha512-vNKxJHTEKNThjfrdJwHc7brvM6eVevuO5nTj6ez8ZQ1qbXTvGthucRF7S4vf2cr71QVnT70V34v0S1DyQsti0w=="
	},
	"node_modules/file-uri-to-path": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz",
	"integrity": "sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==",
	"optional": true
	},
	"node_modules/fill-range": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz",
	"integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=",
	"dependencies": {
	"extend-shallow": "^2.0.1",
	"is-number": "^3.0.0",
	"repeat-string": "^1.6.1",
	"to-regex-range": "^2.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fill-range/node_modules/extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"dependencies": {
	"is-extendable": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/find-cache-dir": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz",
	"integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==",
	"dependencies": {
	"commondir": "^1.0.1",
	"make-dir": "^2.0.0",
	"pkg-dir": "^3.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/find-up": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz",
	"integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==",
	"dependencies": {
	"locate-path": "^3.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/findup-sync": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/findup-sync/-/findup-sync-3.0.0.tgz",
	"integrity": "sha512-YbffarhcicEhOrm4CtrwdKBdCuz576RLdhJDsIfvNtxUuhdRet1qZcsMjqbePtAseKdAnDyM/IyXbu7PRPRLYg==",
	"dependencies": {
	"detect-file": "^1.0.0",
	"is-glob": "^4.0.0",
	"micromatch": "^3.0.4",
	"resolve-dir": "^1.0.1"
	},
	"engines": {
	"node": ">= 0.10"
	}
	},
	"node_modules/flush-write-stream": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.1.1.tgz",
	"integrity": "sha512-3Z4XhFZ3992uIq0XOqb9AreonueSYphE6oYbpt5+3u06JWklbsPkNv3ZKkP9Bz/r+1MWCaMoSQ28P85+1Yc77w==",
	"dependencies": {
	"inherits": "^2.0.3",
	"readable-stream": "^2.3.6"
	}
	},
	"node_modules/for-in": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz",
	"integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fragment-cache": {
	"version": "0.2.1",
	"resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz",
	"integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=",
	"dependencies": {
	"map-cache": "^0.2.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/from2": {
	"version": "2.3.0",
	"resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz",
	"integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=",
	"dependencies": {
	"inherits": "^2.0.1",
	"readable-stream": "^2.0.0"
	}
	},
	"node_modules/fs-write-stream-atomic": {
	"version": "1.0.10",
	"resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz",
	"integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=",
	"dependencies": {
	"graceful-fs": "^4.1.2",
	"iferr": "^0.1.5",
	"imurmurhash": "^0.1.4",
	"readable-stream": "1 \|\| 2"
	}
	},
	"node_modules/fs.realpath": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
	"integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8="
	},
	"node_modules/fsevents": {
	"version": "1.2.11",
	"resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.11.tgz",
	"integrity": "sha512-+ux3lx6peh0BpvY0JebGyZoiR4D+oYzdPZMKJwkZ+sFkNJzpL7tXc/wehS49gUAxg3tmMHPHZkA8JU2rhhgDHw==",
	"bundleDependencies": [
	"abbrev",
	"ansi-regex",
	"aproba",
	"are-we-there-yet",
	"balanced-match",
	"brace-expansion",
	"chownr",
	"code-point-at",
	"concat-map",
	"console-control-strings",
	"core-util-is",
	"debug",
	"deep-extend",
	"delegates",
	"detect-libc",
	"fs-minipass",
	"fs.realpath",
	"gauge",
	"glob",
	"has-unicode",
	"iconv-lite",
	"ignore-walk",
	"inflight",
	"inherits",
	"ini",
	"is-fullwidth-code-point",
	"isarray",
	"minimatch",
	"minimist",
	"minipass",
	"minizlib",
	"mkdirp",
	"ms",
	"needle",
	"node-pre-gyp",
	"nopt",
	"npm-bundled",
	"npm-normalize-package-bin",
	"npm-packlist",
	"npmlog",
	"number-is-nan",
	"object-assign",
	"once",
	"os-homedir",
	"os-tmpdir",
	"osenv",
	"path-is-absolute",
	"process-nextick-args",
	"rc",
	"readable-stream",
	"rimraf",
	"safe-buffer",
	"safer-buffer",
	"sax",
	"semver",
	"set-blocking",
	"signal-exit",
	"string-width",
	"string_decoder",
	"strip-ansi",
	"strip-json-comments",
	"tar",
	"util-deprecate",
	"wide-align",
	"wrappy",
	"yallist"
	],
	"hasInstallScript": true,
	"optional": true,
	"os": [
	"darwin"
	],
	"dependencies": {
	"bindings": "^1.5.0",
	"nan": "^2.12.1",
	"node-pre-gyp": "*"
	},
	"engines": {
	"node": ">=4.0"
	}
	},
	"node_modules/fsevents/node_modules/abbrev": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz",
	"integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/ansi-regex": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz",
	"integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/aproba": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz",
	"integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/are-we-there-yet": {
	"version": "1.1.5",
	"resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz",
	"integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"delegates": "^1.0.0",
	"readable-stream": "^2.0.6"
	}
	},
	"node_modules/fsevents/node_modules/balanced-match": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz",
	"integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/brace-expansion": {
	"version": "1.1.11",
	"resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
	"integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"balanced-match": "^1.0.0",
	"concat-map": "0.0.1"
	}
	},
	"node_modules/fsevents/node_modules/chownr": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.3.tgz",
	"integrity": "sha512-i70fVHhmV3DtTl6nqvZOnIjbY0Pe4kAUjwHj8z0zAdgBtYrJyYwLKCCuRBQ5ppkyL0AkN7HKRnETdmdp1zqNXw==",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/code-point-at": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz",
	"integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/concat-map": {
	"version": "0.0.1",
	"resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
	"integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/console-control-strings": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz",
	"integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/core-util-is": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
	"integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/debug": {
	"version": "3.2.6",
	"resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz",
	"integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"ms": "^2.1.1"
	}
	},
	"node_modules/fsevents/node_modules/deep-extend": {
	"version": "0.6.0",
	"resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz",
	"integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=4.0.0"
	}
	},
	"node_modules/fsevents/node_modules/delegates": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz",
	"integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/detect-libc": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-1.0.3.tgz",
	"integrity": "sha1-+hN8S9aY7fVc1c0CrFWfkaTEups=",
	"inBundle": true,
	"license": "Apache-2.0",
	"optional": true,
	"bin": {
	"detect-libc": "bin/detect-libc.js"
	},
	"engines": {
	"node": ">=0.10"
	}
	},
	"node_modules/fsevents/node_modules/fs-minipass": {
	"version": "1.2.7",
	"resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-1.2.7.tgz",
	"integrity": "sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"minipass": "^2.6.0"
	}
	},
	"node_modules/fsevents/node_modules/fs.realpath": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
	"integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/gauge": {
	"version": "2.7.4",
	"resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz",
	"integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"aproba": "^1.0.3",
	"console-control-strings": "^1.0.0",
	"has-unicode": "^2.0.0",
	"object-assign": "^4.1.0",
	"signal-exit": "^3.0.0",
	"string-width": "^1.0.1",
	"strip-ansi": "^3.0.1",
	"wide-align": "^1.1.0"
	}
	},
	"node_modules/fsevents/node_modules/glob": {
	"version": "7.1.6",
	"resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz",
	"integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"fs.realpath": "^1.0.0",
	"inflight": "^1.0.4",
	"inherits": "2",
	"minimatch": "^3.0.4",
	"once": "^1.3.0",
	"path-is-absolute": "^1.0.0"
	},
	"engines": {
	"node": "*"
	},
	"funding": {
	"url": "https://github.com/sponsors/isaacs"
	}
	},
	"node_modules/fsevents/node_modules/has-unicode": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz",
	"integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/iconv-lite": {
	"version": "0.4.24",
	"resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz",
	"integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"safer-buffer": ">= 2.1.2 < 3"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/ignore-walk": {
	"version": "3.0.3",
	"resolved": "https://registry.npmjs.org/ignore-walk/-/ignore-walk-3.0.3.tgz",
	"integrity": "sha512-m7o6xuOaT1aqheYHKf8W6J5pYH85ZI9w077erOzLje3JsB1gkafkAhHHY19dqjulgIZHFm32Cp5uNZgcQqdJKw==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"minimatch": "^3.0.4"
	}
	},
	"node_modules/fsevents/node_modules/inflight": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
	"integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"once": "^1.3.0",
	"wrappy": "1"
	}
	},
	"node_modules/fsevents/node_modules/inherits": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
	"integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/ini": {
	"version": "1.3.5",
	"resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz",
	"integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"engines": {
	"node": "*"
	}
	},
	"node_modules/fsevents/node_modules/is-fullwidth-code-point": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz",
	"integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"number-is-nan": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/isarray": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
	"integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/minimatch": {
	"version": "3.0.4",
	"resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
	"integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"brace-expansion": "^1.1.7"
	},
	"engines": {
	"node": "*"
	}
	},
	"node_modules/fsevents/node_modules/minimist": {
	"version": "0.0.8",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
	"integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/minipass": {
	"version": "2.9.0",
	"resolved": "https://registry.npmjs.org/minipass/-/minipass-2.9.0.tgz",
	"integrity": "sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"safe-buffer": "^5.1.2",
	"yallist": "^3.0.0"
	}
	},
	"node_modules/fsevents/node_modules/minizlib": {
	"version": "1.3.3",
	"resolved": "https://registry.npmjs.org/minizlib/-/minizlib-1.3.3.tgz",
	"integrity": "sha512-6ZYMOEnmVsdCeTJVE0W9ZD+pVnE8h9Hma/iOwwRDsdQoePpoX56/8B6z3P9VNwppJuBKNRuFDRNRqRWexT9G9Q==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"minipass": "^2.9.0"
	}
	},
	"node_modules/fsevents/node_modules/mkdirp": {
	"version": "0.5.1",
	"resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
	"integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"minimist": "0.0.8"
	},
	"bin": {
	"mkdirp": "bin/cmd.js"
	}
	},
	"node_modules/fsevents/node_modules/ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/needle": {
	"version": "2.4.0",
	"resolved": "https://registry.npmjs.org/needle/-/needle-2.4.0.tgz",
	"integrity": "sha512-4Hnwzr3mi5L97hMYeNl8wRW/Onhy4nUKR/lVemJ8gJedxxUyBLm9kkrDColJvoSfwi0jCNhD+xCdOtiGDQiRZg==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"debug": "^3.2.6",
	"iconv-lite": "^0.4.4",
	"sax": "^1.2.4"
	},
	"bin": {
	"needle": "bin/needle"
	},
	"engines": {
	"node": ">= 4.4.x"
	}
	},
	"node_modules/fsevents/node_modules/node-pre-gyp": {
	"version": "0.14.0",
	"resolved": "https://registry.npmjs.org/node-pre-gyp/-/node-pre-gyp-0.14.0.tgz",
	"integrity": "sha512-+CvDC7ZttU/sSt9rFjix/P05iS43qHCOOGzcr3Ry99bXG7VX953+vFyEuph/tfqoYu8dttBkE86JSKBO2OzcxA==",
	"inBundle": true,
	"license": "BSD-3-Clause",
	"optional": true,
	"dependencies": {
	"detect-libc": "^1.0.2",
	"mkdirp": "^0.5.1",
	"needle": "^2.2.1",
	"nopt": "^4.0.1",
	"npm-packlist": "^1.1.6",
	"npmlog": "^4.0.2",
	"rc": "^1.2.7",
	"rimraf": "^2.6.1",
	"semver": "^5.3.0",
	"tar": "^4.4.2"
	},
	"bin": {
	"node-pre-gyp": "bin/node-pre-gyp"
	}
	},
	"node_modules/fsevents/node_modules/nopt": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/nopt/-/nopt-4.0.1.tgz",
	"integrity": "sha1-0NRoWv1UFRk8jHUFYC0NF81kR00=",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"abbrev": "1",
	"osenv": "^0.1.4"
	},
	"bin": {
	"nopt": "bin/nopt.js"
	}
	},
	"node_modules/fsevents/node_modules/npm-bundled": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/npm-bundled/-/npm-bundled-1.1.1.tgz",
	"integrity": "sha512-gqkfgGePhTpAEgUsGEgcq1rqPXA+tv/aVBlgEzfXwA1yiUJF7xtEt3CtVwOjNYQOVknDk0F20w58Fnm3EtG0fA==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"npm-normalize-package-bin": "^1.0.1"
	}
	},
	"node_modules/fsevents/node_modules/npm-normalize-package-bin": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/npm-normalize-package-bin/-/npm-normalize-package-bin-1.0.1.tgz",
	"integrity": "sha512-EPfafl6JL5/rU+ot6P3gRSCpPDW5VmIzX959Ob1+ySFUuuYHWHekXpwdUZcKP5C+DS4GEtdJluwBjnsNDl+fSA==",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/npm-packlist": {
	"version": "1.4.7",
	"resolved": "https://registry.npmjs.org/npm-packlist/-/npm-packlist-1.4.7.tgz",
	"integrity": "sha512-vAj7dIkp5NhieaGZxBJB8fF4R0078rqsmhJcAfXZ6O7JJhjhPK96n5Ry1oZcfLXgfun0GWTZPOxaEyqv8GBykQ==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"ignore-walk": "^3.0.1",
	"npm-bundled": "^1.0.1"
	}
	},
	"node_modules/fsevents/node_modules/npmlog": {
	"version": "4.1.2",
	"resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz",
	"integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"are-we-there-yet": "~1.1.2",
	"console-control-strings": "~1.1.0",
	"gauge": "~2.7.3",
	"set-blocking": "~2.0.0"
	}
	},
	"node_modules/fsevents/node_modules/number-is-nan": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz",
	"integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/object-assign": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
	"integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/once": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
	"integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"wrappy": "1"
	}
	},
	"node_modules/fsevents/node_modules/os-homedir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz",
	"integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/os-tmpdir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz",
	"integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/osenv": {
	"version": "0.1.5",
	"resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz",
	"integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"os-homedir": "^1.0.0",
	"os-tmpdir": "^1.0.0"
	}
	},
	"node_modules/fsevents/node_modules/path-is-absolute": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
	"integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/process-nextick-args": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz",
	"integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/rc": {
	"version": "1.2.8",
	"resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz",
	"integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==",
	"inBundle": true,
	"license": "(BSD-2-Clause OR MIT OR Apache-2.0)",
	"optional": true,
	"dependencies": {
	"deep-extend": "^0.6.0",
	"ini": "~1.3.0",
	"minimist": "^1.2.0",
	"strip-json-comments": "~2.0.1"
	},
	"bin": {
	"rc": "cli.js"
	}
	},
	"node_modules/fsevents/node_modules/rc/node_modules/minimist": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
	"integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/readable-stream": {
	"version": "2.3.6",
	"resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz",
	"integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"core-util-is": "~1.0.0",
	"inherits": "~2.0.3",
	"isarray": "~1.0.0",
	"process-nextick-args": "~2.0.0",
	"safe-buffer": "~5.1.1",
	"string_decoder": "~1.1.1",
	"util-deprecate": "~1.0.1"
	}
	},
	"node_modules/fsevents/node_modules/rimraf": {
	"version": "2.7.1",
	"resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz",
	"integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"glob": "^7.1.3"
	},
	"bin": {
	"rimraf": "bin.js"
	}
	},
	"node_modules/fsevents/node_modules/safe-buffer": {
	"version": "5.1.2",
	"resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
	"integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/safer-buffer": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
	"integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/sax": {
	"version": "1.2.4",
	"resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz",
	"integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/semver": {
	"version": "5.7.1",
	"resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz",
	"integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"bin": {
	"semver": "bin/semver"
	}
	},
	"node_modules/fsevents/node_modules/set-blocking": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz",
	"integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/signal-exit": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz",
	"integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/string_decoder": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
	"integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"safe-buffer": "~5.1.0"
	}
	},
	"node_modules/fsevents/node_modules/string-width": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz",
	"integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"code-point-at": "^1.0.0",
	"is-fullwidth-code-point": "^1.0.0",
	"strip-ansi": "^3.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/strip-ansi": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz",
	"integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"dependencies": {
	"ansi-regex": "^2.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/strip-json-comments": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz",
	"integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=",
	"inBundle": true,
	"license": "MIT",
	"optional": true,
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/fsevents/node_modules/tar": {
	"version": "4.4.13",
	"resolved": "https://registry.npmjs.org/tar/-/tar-4.4.13.tgz",
	"integrity": "sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"chownr": "^1.1.1",
	"fs-minipass": "^1.2.5",
	"minipass": "^2.8.6",
	"minizlib": "^1.2.1",
	"mkdirp": "^0.5.0",
	"safe-buffer": "^5.1.2",
	"yallist": "^3.0.3"
	},
	"engines": {
	"node": ">=4.5"
	}
	},
	"node_modules/fsevents/node_modules/util-deprecate": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
	"integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=",
	"inBundle": true,
	"license": "MIT",
	"optional": true
	},
	"node_modules/fsevents/node_modules/wide-align": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz",
	"integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==",
	"inBundle": true,
	"license": "ISC",
	"optional": true,
	"dependencies": {
	"string-width": "^1.0.2 \|\| 2"
	}
	},
	"node_modules/fsevents/node_modules/wrappy": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
	"integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/fsevents/node_modules/yallist": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz",
	"integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==",
	"inBundle": true,
	"license": "ISC",
	"optional": true
	},
	"node_modules/function-bind": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz",
	"integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==",
	"dev": true
	},
	"node_modules/gensync": {
	"version": "1.0.0-beta.1",
	"resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.1.tgz",
	"integrity": "sha512-r8EC6NO1sngH/zdD9fiRDLdcgnbayXah+mLgManTaIZJqEC1MZstmnox8KpnI2/fxQwrp5OpCOYWLp4rBl4Jcg==",
	"dev": true,
	"engines": {
	"node": ">=6.9.0"
	}
	},
	"node_modules/get-caller-file": {
	"version": "2.0.5",
	"resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz",
	"integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==",
	"engines": {
	"node": "6.* \|\| 8.* \|\| >= 10.*"
	}
	},
	"node_modules/get-stream": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz",
	"integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==",
	"dependencies": {
	"pump": "^3.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/get-value": {
	"version": "2.0.6",
	"resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz",
	"integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/glob": {
	"version": "7.1.6",
	"resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz",
	"integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==",
	"dependencies": {
	"fs.realpath": "^1.0.0",
	"inflight": "^1.0.4",
	"inherits": "2",
	"minimatch": "^3.0.4",
	"once": "^1.3.0",
	"path-is-absolute": "^1.0.0"
	},
	"engines": {
	"node": "*"
	}
	},
	"node_modules/glob-parent": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz",
	"integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=",
	"dependencies": {
	"is-glob": "^3.1.0",
	"path-dirname": "^1.0.0"
	}
	},
	"node_modules/glob-parent/node_modules/is-glob": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz",
	"integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=",
	"dependencies": {
	"is-extglob": "^2.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/global-modules": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz",
	"integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==",
	"dependencies": {
	"global-prefix": "^3.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/global-modules/node_modules/global-prefix": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz",
	"integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==",
	"dependencies": {
	"ini": "^1.3.5",
	"kind-of": "^6.0.2",
	"which": "^1.3.1"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/global-prefix": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-1.0.2.tgz",
	"integrity": "sha1-2/dDxsFJklk8ZVVoy2btMsASLr4=",
	"dependencies": {
	"expand-tilde": "^2.0.2",
	"homedir-polyfill": "^1.0.1",
	"ini": "^1.3.4",
	"is-windows": "^1.0.1",
	"which": "^1.2.14"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/globals": {
	"version": "9.18.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-9.18.0.tgz",
	"integrity": "sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/graceful-fs": {
	"version": "4.2.3",
	"resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz",
	"integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ=="
	},
	"node_modules/has-ansi": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz",
	"integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=",
	"dependencies": {
	"ansi-regex": "^2.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/has-flag": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz",
	"integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/has-symbols": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz",
	"integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==",
	"dev": true,
	"engines": {
	"node": ">= 0.4"
	}
	},
	"node_modules/has-value": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz",
	"integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=",
	"dependencies": {
	"get-value": "^2.0.6",
	"has-values": "^1.0.0",
	"isobject": "^3.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/has-values": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz",
	"integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=",
	"dependencies": {
	"is-number": "^3.0.0",
	"kind-of": "^4.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/has-values/node_modules/kind-of": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz",
	"integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=",
	"dependencies": {
	"is-buffer": "^1.1.5"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/hash-base": {
	"version": "3.0.4",
	"resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.0.4.tgz",
	"integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=",
	"dependencies": {
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/hash.js": {
	"version": "1.1.7",
	"resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz",
	"integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==",
	"dependencies": {
	"inherits": "^2.0.3",
	"minimalistic-assert": "^1.0.1"
	}
	},
	"node_modules/hmac-drbg": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz",
	"integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=",
	"dependencies": {
	"hash.js": "^1.0.3",
	"minimalistic-assert": "^1.0.0",
	"minimalistic-crypto-utils": "^1.0.1"
	}
	},
	"node_modules/home-or-tmp": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/home-or-tmp/-/home-or-tmp-2.0.0.tgz",
	"integrity": "sha1-42w/LSyufXRqhX440Y1fMqeILbg=",
	"dependencies": {
	"os-homedir": "^1.0.0",
	"os-tmpdir": "^1.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/homedir-polyfill": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/homedir-polyfill/-/homedir-polyfill-1.0.3.tgz",
	"integrity": "sha512-eSmmWE5bZTK2Nou4g0AI3zZ9rswp7GRKoKXS1BLUkvPviOqs4YTN1djQIqrXy9k5gEtdLPy86JjRwsNM9tnDcA==",
	"dependencies": {
	"parse-passwd": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/https-browserify": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz",
	"integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM="
	},
	"node_modules/ieee754": {
	"version": "1.1.13",
	"resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.13.tgz",
	"integrity": "sha512-4vf7I2LYV/HaWerSo3XmlMkp5eZ83i+/CDluXi/IGTs/O1sejBNhTtnxzmRZfvOUqj7lZjqHkeTvpgSFDlWZTg=="
	},
	"node_modules/iferr": {
	"version": "0.1.5",
	"resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz",
	"integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE="
	},
	"node_modules/import-local": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz",
	"integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==",
	"dependencies": {
	"pkg-dir": "^3.0.0",
	"resolve-cwd": "^2.0.0"
	},
	"bin": {
	"import-local-fixture": "fixtures/cli.js"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/imurmurhash": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz",
	"integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=",
	"engines": {
	"node": ">=0.8.19"
	}
	},
	"node_modules/infer-owner": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz",
	"integrity": "sha512-IClj+Xz94+d7irH5qRyfJonOdfTzuDaifE6ZPWfx0N0+/ATZCbuTPq2prFl526urkQd90WyUKIh1DfBQ2hMz9A=="
	},
	"node_modules/inflight": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
	"integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=",
	"dependencies": {
	"once": "^1.3.0",
	"wrappy": "1"
	}
	},
	"node_modules/inherits": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
	"integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ=="
	},
	"node_modules/ini": {
	"version": "1.3.5",
	"resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz",
	"integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==",
	"engines": {
	"node": "*"
	}
	},
	"node_modules/interpret": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/interpret/-/interpret-1.2.0.tgz",
	"integrity": "sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==",
	"engines": {
	"node": ">= 0.10"
	}
	},
	"node_modules/invariant": {
	"version": "2.2.4",
	"resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz",
	"integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==",
	"dependencies": {
	"loose-envify": "^1.0.0"
	}
	},
	"node_modules/invert-kv": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-2.0.0.tgz",
	"integrity": "sha512-wPVv/y/QQ/Uiirj/vh3oP+1Ww+AWehmi1g5fFWGPF6IpCBCDVrhgHRMvrLfdYcwDh3QJbGXDW4JAuzxElLSqKA==",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/is-accessor-descriptor": {
	"version": "0.1.6",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz",
	"integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=",
	"dependencies": {
	"kind-of": "^3.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-accessor-descriptor/node_modules/kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"dependencies": {
	"is-buffer": "^1.1.5"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-binary-path": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz",
	"integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=",
	"dependencies": {
	"binary-extensions": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-buffer": {
	"version": "1.1.6",
	"resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz",
	"integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w=="
	},
	"node_modules/is-data-descriptor": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz",
	"integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=",
	"dependencies": {
	"kind-of": "^3.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-data-descriptor/node_modules/kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"dependencies": {
	"is-buffer": "^1.1.5"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-descriptor": {
	"version": "0.1.6",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz",
	"integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==",
	"dependencies": {
	"is-accessor-descriptor": "^0.1.6",
	"is-data-descriptor": "^0.1.4",
	"kind-of": "^5.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-descriptor/node_modules/kind-of": {
	"version": "5.1.0",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz",
	"integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-extendable": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz",
	"integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-extglob": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
	"integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-finite": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.1.0.tgz",
	"integrity": "sha512-cdyMtqX/BOqqNBBiKlIVkytNHm49MtMlYyn1zxzvJKWmFMlGzm+ry5BBfYyeY9YmNKbRSo/o7OX9w9ale0wg3w==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-fullwidth-code-point": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
	"integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/is-glob": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz",
	"integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==",
	"dependencies": {
	"is-extglob": "^2.1.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-number": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz",
	"integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=",
	"dependencies": {
	"kind-of": "^3.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-number/node_modules/kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"dependencies": {
	"is-buffer": "^1.1.5"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-plain-object": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz",
	"integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==",
	"dependencies": {
	"isobject": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-stream": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz",
	"integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-windows": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz",
	"integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/is-wsl": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz",
	"integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/isarray": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
	"integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE="
	},
	"node_modules/isexe": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
	"integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA="
	},
	"node_modules/isobject": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz",
	"integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/js-tokens": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-3.0.2.tgz",
	"integrity": "sha1-mGbfOVECEw449/mWvOtlRDIJwls="
	},
	"node_modules/jsesc": {
	"version": "1.3.0",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-1.3.0.tgz",
	"integrity": "sha1-RsP+yMGJKxKwgz25vHYiF226s0s=",
	"bin": {
	"jsesc": "bin/jsesc"
	}
	},
	"node_modules/json-parse-better-errors": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz",
	"integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw=="
	},
	"node_modules/json-schema-traverse": {
	"version": "0.4.1",
	"resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz",
	"integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg=="
	},
	"node_modules/json5": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz",
	"integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==",
	"dependencies": {
	"minimist": "^1.2.0"
	},
	"bin": {
	"json5": "lib/cli.js"
	}
	},
	"node_modules/kind-of": {
	"version": "6.0.3",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.3.tgz",
	"integrity": "sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/lcid": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/lcid/-/lcid-2.0.0.tgz",
	"integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==",
	"dependencies": {
	"invert-kv": "^2.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/leven": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/leven/-/leven-3.1.0.tgz",
	"integrity": "sha512-qsda+H8jTaUaN/x5vzW2rzc+8Rw4TAQ/4KjB46IwK5VH+IlVeeeje/EoZRpiXvIqjFgK84QffqPztGI3VBLG1A==",
	"dev": true,
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/levenary": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/levenary/-/levenary-1.1.1.tgz",
	"integrity": "sha512-mkAdOIt79FD6irqjYSs4rdbnlT5vRonMEvBVPVb3XmevfS8kgRXwfes0dhPdEtzTWD/1eNE/Bm/G1iRt6DcnQQ==",
	"dev": true,
	"dependencies": {
	"leven": "^3.1.0"
	},
	"engines": {
	"node": ">= 6"
	}
	},
	"node_modules/linkify-it": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-3.0.2.tgz",
	"integrity": "sha512-gDBO4aHNZS6coiZCKVhSNh43F9ioIL4JwRjLZPkoLIY4yZFwg264Y5lu2x6rb1Js42Gh6Yqm2f6L2AJcnkzinQ==",
	"dependencies": {
	"uc.micro": "^1.0.1"
	}
	},
	"node_modules/loader-runner": {
	"version": "2.4.0",
	"resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz",
	"integrity": "sha512-Jsmr89RcXGIwivFY21FcRrisYZfvLMTWx5kOLc+JTxtpBOG6xML0vzbc6SEQG2FO9/4Fc3wW4LVcB5DmGflaRw==",
	"engines": {
	"node": ">=4.3.0 <5.0.0 \|\| >=5.10"
	}
	},
	"node_modules/loader-utils": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz",
	"integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==",
	"dependencies": {
	"big.js": "^5.2.2",
	"emojis-list": "^3.0.0",
	"json5": "^1.0.1"
	},
	"engines": {
	"node": ">=4.0.0"
	}
	},
	"node_modules/locate-path": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz",
	"integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==",
	"dependencies": {
	"p-locate": "^3.0.0",
	"path-exists": "^3.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/lodash": {
	"version": "4.17.15",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.15.tgz",
	"integrity": "sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A=="
	},
	"node_modules/loose-envify": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz",
	"integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==",
	"dependencies": {
	"js-tokens": "^3.0.0 \|\| ^4.0.0"
	},
	"bin": {
	"loose-envify": "cli.js"
	}
	},
	"node_modules/lru-cache": {
	"version": "5.1.1",
	"resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz",
	"integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==",
	"dependencies": {
	"yallist": "^3.0.2"
	}
	},
	"node_modules/make-dir": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz",
	"integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==",
	"dependencies": {
	"pify": "^4.0.1",
	"semver": "^5.6.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/mamacro": {
	"version": "0.0.3",
	"resolved": "https://registry.npmjs.org/mamacro/-/mamacro-0.0.3.tgz",
	"integrity": "sha512-qMEwh+UujcQ+kbz3T6V+wAmO2U8veoq2w+3wY8MquqwVA3jChfwY+Tk52GZKDfACEPjuZ7r2oJLejwpt8jtwTA=="
	},
	"node_modules/map-age-cleaner": {
	"version": "0.1.3",
	"resolved": "https://registry.npmjs.org/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz",
	"integrity": "sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w==",
	"dependencies": {
	"p-defer": "^1.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/map-cache": {
	"version": "0.2.2",
	"resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz",
	"integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/map-visit": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz",
	"integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=",
	"dependencies": {
	"object-visit": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/markdown-it": {
	"version": "12.0.4",
	"resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-12.0.4.tgz",
	"integrity": "sha512-34RwOXZT8kyuOJy25oJNJoulO8L0bTHYWXcdZBYZqFnjIy3NgjeoM3FmPXIOFQ26/lSHYMr8oc62B6adxXcb3Q==",
	"dependencies": {
	"argparse": "^2.0.1",
	"entities": "~2.1.0",
	"linkify-it": "^3.0.1",
	"mdurl": "^1.0.1",
	"uc.micro": "^1.0.5"
	},
	"bin": {
	"markdown-it": "bin/markdown-it.js"
	}
	},
	"node_modules/md5.js": {
	"version": "1.3.5",
	"resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz",
	"integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==",
	"dependencies": {
	"hash-base": "^3.0.0",
	"inherits": "^2.0.1",
	"safe-buffer": "^5.1.2"
	}
	},
	"node_modules/mdurl": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/mdurl/-/mdurl-1.0.1.tgz",
	"integrity": "sha1-/oWy7HWlkDfyrf7BAP1sYBdhFS4="
	},
	"node_modules/mem": {
	"version": "4.3.0",
	"resolved": "https://registry.npmjs.org/mem/-/mem-4.3.0.tgz",
	"integrity": "sha512-qX2bG48pTqYRVmDB37rn/6PT7LcR8T7oAX3bf99u1Tt1nzxYfxkgqDwUwolPlXweM0XzBOBFzSx4kfp7KP1s/w==",
	"dependencies": {
	"map-age-cleaner": "^0.1.1",
	"mimic-fn": "^2.0.0",
	"p-is-promise": "^2.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/memory-fs": {
	"version": "0.4.1",
	"resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz",
	"integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=",
	"dependencies": {
	"errno": "^0.1.3",
	"readable-stream": "^2.0.1"
	}
	},
	"node_modules/micromatch": {
	"version": "3.1.10",
	"resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz",
	"integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==",
	"dependencies": {
	"arr-diff": "^4.0.0",
	"array-unique": "^0.3.2",
	"braces": "^2.3.1",
	"define-property": "^2.0.2",
	"extend-shallow": "^3.0.2",
	"extglob": "^2.0.4",
	"fragment-cache": "^0.2.1",
	"kind-of": "^6.0.2",
	"nanomatch": "^1.2.9",
	"object.pick": "^1.3.0",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/miller-rabin": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz",
	"integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==",
	"dependencies": {
	"bn.js": "^4.0.0",
	"brorand": "^1.0.1"
	},
	"bin": {
	"miller-rabin": "bin/miller-rabin"
	}
	},
	"node_modules/mimic-fn": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/mimic-fn/-/mimic-fn-2.1.0.tgz",
	"integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/minimalistic-assert": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz",
	"integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A=="
	},
	"node_modules/minimalistic-crypto-utils": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz",
	"integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo="
	},
	"node_modules/minimatch": {
	"version": "3.0.4",
	"resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
	"integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
	"dependencies": {
	"brace-expansion": "^1.1.7"
	},
	"engines": {
	"node": "*"
	}
	},
	"node_modules/minimist": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
	"integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ="
	},
	"node_modules/mississippi": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz",
	"integrity": "sha512-x471SsVjUtBRtcvd4BzKE9kFC+/2TeWgKCgw0bZcw1b9l2X3QX5vCWgF+KaZaYm87Ss//rHnWryupDrgLvmSkA==",
	"dependencies": {
	"concat-stream": "^1.5.0",
	"duplexify": "^3.4.2",
	"end-of-stream": "^1.1.0",
	"flush-write-stream": "^1.0.0",
	"from2": "^2.1.0",
	"parallel-transform": "^1.1.0",
	"pump": "^3.0.0",
	"pumpify": "^1.3.3",
	"stream-each": "^1.1.0",
	"through2": "^2.0.0"
	},
	"engines": {
	"node": ">=4.0.0"
	}
	},
	"node_modules/mixin-deep": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.2.tgz",
	"integrity": "sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==",
	"dependencies": {
	"for-in": "^1.0.2",
	"is-extendable": "^1.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/mixin-deep/node_modules/is-extendable": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
	"integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
	"dependencies": {
	"is-plain-object": "^2.0.4"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/mkdirp": {
	"version": "0.5.1",
	"resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
	"integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
	"dependencies": {
	"minimist": "0.0.8"
	},
	"bin": {
	"mkdirp": "bin/cmd.js"
	}
	},
	"node_modules/mkdirp/node_modules/minimist": {
	"version": "0.0.8",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
	"integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0="
	},
	"node_modules/move-concurrently": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz",
	"integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=",
	"dependencies": {
	"aproba": "^1.1.1",
	"copy-concurrently": "^1.0.0",
	"fs-write-stream-atomic": "^1.0.8",
	"mkdirp": "^0.5.1",
	"rimraf": "^2.5.4",
	"run-queue": "^1.0.3"
	}
	},
	"node_modules/ms": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
	"integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g="
	},
	"node_modules/nan": {
	"version": "2.14.0",
	"resolved": "https://registry.npmjs.org/nan/-/nan-2.14.0.tgz",
	"integrity": "sha512-INOFj37C7k3AfaNTtX8RhsTw7qRy7eLET14cROi9+5HAVbbHuIWUHEauBv5qT4Av2tWasiTY1Jw6puUNqRJXQg==",
	"optional": true
	},
	"node_modules/nanomatch": {
	"version": "1.2.13",
	"resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz",
	"integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==",
	"dependencies": {
	"arr-diff": "^4.0.0",
	"array-unique": "^0.3.2",
	"define-property": "^2.0.2",
	"extend-shallow": "^3.0.2",
	"fragment-cache": "^0.2.1",
	"is-windows": "^1.0.2",
	"kind-of": "^6.0.2",
	"object.pick": "^1.3.0",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/neo-async": {
	"version": "2.6.1",
	"resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.1.tgz",
	"integrity": "sha512-iyam8fBuCUpWeKPGpaNMetEocMt364qkCsfL9JuhjXX6dRnguRVOfk2GZaDpPjcOKiiXCPINZC1GczQ7iTq3Zw=="
	},
	"node_modules/nice-try": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz",
	"integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ=="
	},
	"node_modules/node-libs-browser": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz",
	"integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==",
	"dependencies": {
	"assert": "^1.1.1",
	"browserify-zlib": "^0.2.0",
	"buffer": "^4.3.0",
	"console-browserify": "^1.1.0",
	"constants-browserify": "^1.0.0",
	"crypto-browserify": "^3.11.0",
	"domain-browser": "^1.1.1",
	"events": "^3.0.0",
	"https-browserify": "^1.0.0",
	"os-browserify": "^0.3.0",
	"path-browserify": "0.0.1",
	"process": "^0.11.10",
	"punycode": "^1.2.4",
	"querystring-es3": "^0.2.0",
	"readable-stream": "^2.3.3",
	"stream-browserify": "^2.0.1",
	"stream-http": "^2.7.2",
	"string_decoder": "^1.0.0",
	"timers-browserify": "^2.0.4",
	"tty-browserify": "0.0.0",
	"url": "^0.11.0",
	"util": "^0.11.0",
	"vm-browserify": "^1.0.1"
	}
	},
	"node_modules/node-libs-browser/node_modules/punycode": {
	"version": "1.4.1",
	"resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
	"integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4="
	},
	"node_modules/node-releases": {
	"version": "1.1.61",
	"resolved": "https://registry.npmjs.org/node-releases/-/node-releases-1.1.61.tgz",
	"integrity": "sha512-DD5vebQLg8jLCOzwupn954fbIiZht05DAZs0k2u8NStSe6h9XdsuIQL8hSRKYiU8WUQRznmSDrKGbv3ObOmC7g==",
	"dev": true
	},
	"node_modules/normalize-path": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz",
	"integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/npm-run-path": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz",
	"integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=",
	"dependencies": {
	"path-key": "^2.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/object-assign": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
	"integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/object-copy": {
	"version": "0.1.0",
	"resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz",
	"integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=",
	"dependencies": {
	"copy-descriptor": "^0.1.0",
	"define-property": "^0.2.5",
	"kind-of": "^3.0.3"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/object-copy/node_modules/define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"dependencies": {
	"is-descriptor": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/object-copy/node_modules/kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"dependencies": {
	"is-buffer": "^1.1.5"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/object-keys": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz",
	"integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==",
	"dev": true,
	"engines": {
	"node": ">= 0.4"
	}
	},
	"node_modules/object-visit": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz",
	"integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=",
	"dependencies": {
	"isobject": "^3.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/object.assign": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.0.tgz",
	"integrity": "sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==",
	"dev": true,
	"dependencies": {
	"define-properties": "^1.1.2",
	"function-bind": "^1.1.1",
	"has-symbols": "^1.0.0",
	"object-keys": "^1.0.11"
	},
	"engines": {
	"node": ">= 0.4"
	}
	},
	"node_modules/object.pick": {
	"version": "1.3.0",
	"resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz",
	"integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=",
	"dependencies": {
	"isobject": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/once": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
	"integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=",
	"dependencies": {
	"wrappy": "1"
	}
	},
	"node_modules/orderedmap": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/orderedmap/-/orderedmap-1.1.1.tgz",
	"integrity": "sha512-3Ux8um0zXbVacKUkcytc0u3HgC0b0bBLT+I60r2J/En72cI0nZffqrA7Xtf2Hqs27j1g82llR5Mhbd0Z1XW4AQ=="
	},
	"node_modules/os-browserify": {
	"version": "0.3.0",
	"resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz",
	"integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc="
	},
	"node_modules/os-homedir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz",
	"integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/os-locale": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/os-locale/-/os-locale-3.1.0.tgz",
	"integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==",
	"dependencies": {
	"execa": "^1.0.0",
	"lcid": "^2.0.0",
	"mem": "^4.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/os-tmpdir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz",
	"integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/p-defer": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/p-defer/-/p-defer-1.0.0.tgz",
	"integrity": "sha1-n26xgvbJqozXQwBKfU+WsZaw+ww=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/p-finally": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz",
	"integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/p-is-promise": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/p-is-promise/-/p-is-promise-2.1.0.tgz",
	"integrity": "sha512-Y3W0wlRPK8ZMRbNq97l4M5otioeA5lm1z7bkNkxCka8HSPjR0xRWmpCmc9utiaLP9Jb1eD8BgeIxTW4AIF45Pg==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/p-limit": {
	"version": "2.2.2",
	"resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz",
	"integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==",
	"dependencies": {
	"p-try": "^2.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/p-locate": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz",
	"integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==",
	"dependencies": {
	"p-limit": "^2.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/p-try": {
	"version": "2.2.0",
	"resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz",
	"integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/pako": {
	"version": "1.0.11",
	"resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz",
	"integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw=="
	},
	"node_modules/parallel-transform": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.2.0.tgz",
	"integrity": "sha512-P2vSmIu38uIlvdcU7fDkyrxj33gTUy/ABO5ZUbGowxNCopBq/OoD42bP4UmMrJoPyk4Uqf0mu3mtWBhHCZD8yg==",
	"dependencies": {
	"cyclist": "^1.0.1",
	"inherits": "^2.0.3",
	"readable-stream": "^2.1.5"
	}
	},
	"node_modules/parse-asn1": {
	"version": "5.1.5",
	"resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.5.tgz",
	"integrity": "sha512-jkMYn1dcJqF6d5CpU689bq7w/b5ALS9ROVSpQDPrZsqqesUJii9qutvoT5ltGedNXMO2e16YUWIghG9KxaViTQ==",
	"dependencies": {
	"asn1.js": "^4.0.0",
	"browserify-aes": "^1.0.0",
	"create-hash": "^1.1.0",
	"evp_bytestokey": "^1.0.0",
	"pbkdf2": "^3.0.3",
	"safe-buffer": "^5.1.1"
	}
	},
	"node_modules/parse-passwd": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/parse-passwd/-/parse-passwd-1.0.0.tgz",
	"integrity": "sha1-bVuTSkVpk7I9N/QKOC1vFmao5cY=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/pascalcase": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz",
	"integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/path-browserify": {
	"version": "0.0.1",
	"resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz",
	"integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ=="
	},
	"node_modules/path-dirname": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz",
	"integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA="
	},
	"node_modules/path-exists": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz",
	"integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/path-is-absolute": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
	"integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/path-key": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz",
	"integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/path-parse": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz",
	"integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==",
	"dev": true
	},
	"node_modules/pbkdf2": {
	"version": "3.0.17",
	"resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.0.17.tgz",
	"integrity": "sha512-U/il5MsrZp7mGg3mSQfn742na2T+1/vHDCG5/iTI3X9MKUuYUZVLQhyRsg06mCgDBTd57TxzgZt7P+fYfjRLtA==",
	"dependencies": {
	"create-hash": "^1.1.2",
	"create-hmac": "^1.1.4",
	"ripemd160": "^2.0.1",
	"safe-buffer": "^5.0.1",
	"sha.js": "^2.4.8"
	},
	"engines": {
	"node": ">=0.12"
	}
	},
	"node_modules/pify": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz",
	"integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/pkg-dir": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz",
	"integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==",
	"dependencies": {
	"find-up": "^3.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/posix-character-classes": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz",
	"integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/prettier": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/prettier/-/prettier-2.2.1.tgz",
	"integrity": "sha512-PqyhM2yCjg/oKkFPtTGUojv7gnZAoG80ttl45O6x2Ug/rMJw4wcc9k6aaf2hibP7BGVCCM33gZoGjyvt9mm16Q==",
	"dev": true,
	"bin": {
	"prettier": "bin-prettier.js"
	},
	"engines": {
	"node": ">=10.13.0"
	}
	},
	"node_modules/private": {
	"version": "0.1.8",
	"resolved": "https://registry.npmjs.org/private/-/private-0.1.8.tgz",
	"integrity": "sha512-VvivMrbvd2nKkiG38qjULzlc+4Vx4wm/whI9pQD35YrARNnhxeiRktSOhSukRLFNlzg6Br/cJPet5J/u19r/mg==",
	"engines": {
	"node": ">= 0.6"
	}
	},
	"node_modules/process": {
	"version": "0.11.10",
	"resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz",
	"integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=",
	"engines": {
	"node": ">= 0.6.0"
	}
	},
	"node_modules/process-nextick-args": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz",
	"integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag=="
	},
	"node_modules/promise-inflight": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz",
	"integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM="
	},
	"node_modules/prosemirror-commands": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-commands/-/prosemirror-commands-1.1.3.tgz",
	"integrity": "sha512-YVbKwTR4likoyhuwIUC9egbzHvnFrFUNbiesB0DB/HZ8hBcopQ42Tb4KGlYrS3n+pNDTFObN73CLFY6mYLN2IQ==",
	"dependencies": {
	"prosemirror-model": "^1.0.0",
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"node_modules/prosemirror-dropcursor": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/prosemirror-dropcursor/-/prosemirror-dropcursor-1.3.2.tgz",
	"integrity": "sha512-4c94OUGyobGnwcQI70OXyMhE/9T4aTgjU+CHxkd5c7D+jH/J0mKM/lk+jneFVKt7+E4/M0D9HzRPifu8U28Thw==",
	"dependencies": {
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.1.0",
	"prosemirror-view": "^1.1.0"
	}
	},
	"node_modules/prosemirror-example-setup": {
	"version": "1.1.2",
	- "resolved": "https://registry.npmjs.org/prosemirror-example-setup/-/prosemirror-example-setup-1.1.2.tgz",
	- "integrity": "sha512-MTpIMyqk08jFnzxeRMCinCEMtVSTUtxKgQBGxfCbVe9C6zIOqp9qZZJz5Ojaad1GETySyuj8+OIHHvQsIaaaGQ==",
	+ "resolved": "git+ssh://git@github.com/writefreely/prosemirror-example-setup.git#aaea7d62ebc2fa769139faf8a097449441c8237c",
	+ "license": "MIT",
	"dependencies": {
	"prosemirror-commands": "^1.0.0",
	"prosemirror-dropcursor": "^1.0.0",
	"prosemirror-gapcursor": "^1.0.0",
	"prosemirror-history": "^1.0.0",
	"prosemirror-inputrules": "^1.0.0",
	"prosemirror-keymap": "^1.0.0",
	"prosemirror-menu": "^1.0.0",
	"prosemirror-schema-list": "^1.0.0",
	"prosemirror-state": "^1.0.0"
	}
	},
	"node_modules/prosemirror-gapcursor": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-gapcursor/-/prosemirror-gapcursor-1.1.3.tgz",
	"integrity": "sha512-/lgWvt2AdHjsM6oEsF65z0lhdQJGl6sQSfXSOX8/xjpd8ycfOolhgKZd4TPYpikwnh85JF4l5eIyiFZsl/RQQA==",
	"dependencies": {
	"prosemirror-keymap": "^1.0.0",
	"prosemirror-model": "^1.0.0",
	"prosemirror-state": "^1.0.0",
	"prosemirror-view": "^1.0.0"
	}
	},
	"node_modules/prosemirror-history": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-history/-/prosemirror-history-1.1.3.tgz",
	"integrity": "sha512-zGDotijea+vnfnyyUGyiy1wfOQhf0B/b6zYcCouBV8yo6JmrE9X23M5q7Nf/nATywEZbgRLG70R4DmfSTC+gfg==",
	"dependencies": {
	"prosemirror-state": "^1.2.2",
	"prosemirror-transform": "^1.0.0",
	"rope-sequence": "^1.3.0"
	}
	},
	"node_modules/prosemirror-inputrules": {
	"version": "1.1.2",
	"resolved": "https://registry.npmjs.org/prosemirror-inputrules/-/prosemirror-inputrules-1.1.2.tgz",
	"integrity": "sha512-Ja5Z3BWestlHYGvtSGqyvxMeB8QEuBjlHM8YnKtLGUXMDp965qdDV4goV8lJb17kIWHk7e7JNj6Catuoa3302g==",
	"dependencies": {
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"node_modules/prosemirror-keymap": {
	"version": "1.1.4",
	"resolved": "https://registry.npmjs.org/prosemirror-keymap/-/prosemirror-keymap-1.1.4.tgz",
	"integrity": "sha512-Al8cVUOnDFL4gcI5IDlG6xbZ0aOD/i3B17VT+1JbHWDguCgt/lBHVTHUBcKvvbSg6+q/W4Nj1Fu6bwZSca3xjg==",
	"dependencies": {
	"prosemirror-state": "^1.0.0",
	"w3c-keyname": "^2.2.0"
	}
	},
	"node_modules/prosemirror-markdown": {
	- "resolved": "git+ssh://git@github.com/VV-EE/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2",
	+ "version": "1.5.1",
	+ "resolved": "git+ssh://git@github.com/writefreely/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2",
	+ "license": "MIT",
	"dependencies": {
	"markdown-it": "^10.0.0",
	"prosemirror-model": "^1.0.0"
	}
	},
	"node_modules/prosemirror-markdown/node_modules/argparse": {
	"version": "1.0.10",
	"resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz",
	"integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==",
	"dependencies": {
	"sprintf-js": "~1.0.2"
	}
	},
	"node_modules/prosemirror-markdown/node_modules/entities": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/entities/-/entities-2.0.3.tgz",
	"integrity": "sha512-MyoZ0jgnLvB2X3Lg5HqpFmn1kybDiIfEQmKzTb5apr51Rb+T3KdmMiqa70T+bhGnyv7bQ6WMj2QMHpGMmlrUYQ=="
	},
	"node_modules/prosemirror-markdown/node_modules/linkify-it": {
	"version": "2.2.0",
	"resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-2.2.0.tgz",
	"integrity": "sha512-GnAl/knGn+i1U/wjBz3akz2stz+HrHLsxMwHQGofCDfPvlf+gDKN58UtfmUquTY4/MXeE2x7k19KQmeoZi94Iw==",
	"dependencies": {
	"uc.micro": "^1.0.1"
	}
	},
	"node_modules/prosemirror-markdown/node_modules/markdown-it": {
	"version": "10.0.0",
	"resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-10.0.0.tgz",
	"integrity": "sha512-YWOP1j7UbDNz+TumYP1kpwnP0aEa711cJjrAQrzd0UXlbJfc5aAq0F/PZHjiioqDC1NKgvIMX+o+9Bk7yuM2dg==",
	"dependencies": {
	"argparse": "^1.0.7",
	"entities": "~2.0.0",
	"linkify-it": "^2.0.0",
	"mdurl": "^1.0.1",
	"uc.micro": "^1.0.5"
	},
	"bin": {
	"markdown-it": "bin/markdown-it.js"
	}
	},
	"node_modules/prosemirror-menu": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-menu/-/prosemirror-menu-1.1.3.tgz",
	"integrity": "sha512-G+XiTdiVi1uGeiBR1OqtiVP3p0XyCKec4DYLk75G7J2R/N8OThHt/1StJYDlXPNzqYsQFZfQyPp/UwOL8hD6AA==",
	"dependencies": {
	"crel": "^4.2.0",
	"prosemirror-commands": "^1.0.0",
	"prosemirror-history": "^1.0.0",
	"prosemirror-state": "^1.0.0"
	}
	},
	"node_modules/prosemirror-model": {
	"version": "1.9.1",
	"resolved": "https://registry.npmjs.org/prosemirror-model/-/prosemirror-model-1.9.1.tgz",
	"integrity": "sha512-Qblh8pm1c7Ll64sYLauwwzjimo/tFg1zW3Q3IWhKRhvfOEgRKqa6dC5pRrAa+XHOIjBFEYrqbi52J5bqA2dV8Q==",
	"dependencies": {
	"orderedmap": "^1.1.0"
	}
	},
	"node_modules/prosemirror-schema-list": {
	"version": "1.1.2",
	"resolved": "https://registry.npmjs.org/prosemirror-schema-list/-/prosemirror-schema-list-1.1.2.tgz",
	"integrity": "sha512-dgM9PwtM4twa5WsgSYMB+J8bwjnR43DAD3L9MsR9rKm/nZR5Y85xcjB7gusVMSsbQ2NomMZF03RE6No6mTnclQ==",
	"dependencies": {
	"prosemirror-model": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"node_modules/prosemirror-state": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/prosemirror-state/-/prosemirror-state-1.3.2.tgz",
	"integrity": "sha512-t/JqE3aR0SV9QrzFVkAXsQwsgrQBNs/BDbcFH20RssW0xauqNNdjTXxy/J/kM7F+0zYi6+BRmz7cMMQQFU3mwQ==",
	"dependencies": {
	"prosemirror-model": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"node_modules/prosemirror-transform": {
	"version": "1.2.4",
	"resolved": "https://registry.npmjs.org/prosemirror-transform/-/prosemirror-transform-1.2.4.tgz",
	"integrity": "sha512-0A668uf0EN89L9O9brE05kHcqp7FHmT5YN7Tom58Kj926QqOBs7iNRHDLWxrSaQB5MNZtzDOD9T3EyJ88YDcBg==",
	"dependencies": {
	"prosemirror-model": "^1.0.0"
	}
	},
	"node_modules/prosemirror-view": {
	"version": "1.14.2",
	"resolved": "https://registry.npmjs.org/prosemirror-view/-/prosemirror-view-1.14.2.tgz",
	"integrity": "sha512-9yPVH6OLyaEraHjWHbSk2DB0R/1TsEE6AA1LI+vmCypXXA+zTzNrktUFzBhSJHehXDoEJcQfnl1Wdp5GPSh2+g==",
	"dependencies": {
	"prosemirror-model": "^1.1.0",
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.1.0"
	}
	},
	"node_modules/prr": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz",
	"integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY="
	},
	"node_modules/public-encrypt": {
	"version": "4.0.3",
	"resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz",
	"integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==",
	"dependencies": {
	"bn.js": "^4.1.0",
	"browserify-rsa": "^4.0.0",
	"create-hash": "^1.1.0",
	"parse-asn1": "^5.0.0",
	"randombytes": "^2.0.1",
	"safe-buffer": "^5.1.2"
	}
	},
	"node_modules/pump": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz",
	"integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==",
	"dependencies": {
	"end-of-stream": "^1.1.0",
	"once": "^1.3.1"
	}
	},
	"node_modules/pumpify": {
	"version": "1.5.1",
	"resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz",
	"integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==",
	"dependencies": {
	"duplexify": "^3.6.0",
	"inherits": "^2.0.3",
	"pump": "^2.0.0"
	}
	},
	"node_modules/pumpify/node_modules/pump": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz",
	"integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==",
	"dependencies": {
	"end-of-stream": "^1.1.0",
	"once": "^1.3.1"
	}
	},
	"node_modules/punycode": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz",
	"integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/querystring": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz",
	"integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=",
	"engines": {
	"node": ">=0.4.x"
	}
	},
	"node_modules/querystring-es3": {
	"version": "0.2.1",
	"resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz",
	"integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=",
	"engines": {
	"node": ">=0.4.x"
	}
	},
	"node_modules/randombytes": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz",
	"integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==",
	"dependencies": {
	"safe-buffer": "^5.1.0"
	}
	},
	"node_modules/randomfill": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz",
	"integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==",
	"dependencies": {
	"randombytes": "^2.0.5",
	"safe-buffer": "^5.1.0"
	}
	},
	"node_modules/readable-stream": {
	"version": "2.3.7",
	"resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz",
	"integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==",
	"dependencies": {
	"core-util-is": "~1.0.0",
	"inherits": "~2.0.3",
	"isarray": "~1.0.0",
	"process-nextick-args": "~2.0.0",
	"safe-buffer": "~5.1.1",
	"string_decoder": "~1.1.1",
	"util-deprecate": "~1.0.1"
	}
	},
	"node_modules/readdirp": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz",
	"integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==",
	"dependencies": {
	"graceful-fs": "^4.1.11",
	"micromatch": "^3.1.10",
	"readable-stream": "^2.0.2"
	},
	"engines": {
	"node": ">=0.10"
	}
	},
	"node_modules/regenerate": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/regenerate/-/regenerate-1.4.0.tgz",
	"integrity": "sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg=="
	},
	"node_modules/regenerate-unicode-properties": {
	"version": "8.2.0",
	"resolved": "https://registry.npmjs.org/regenerate-unicode-properties/-/regenerate-unicode-properties-8.2.0.tgz",
	"integrity": "sha512-F9DjY1vKLo/tPePDycuH3dn9H1OTPIkVD9Kz4LODu+F2C75mgjAJ7x/gwy6ZcSNRAAkhNlJSOHRe8k3p+K9WhA==",
	"dev": true,
	"dependencies": {
	"regenerate": "^1.4.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/regenerator-runtime": {
	"version": "0.11.1",
	"resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz",
	"integrity": "sha512-MguG95oij0fC3QV3URf4V2SDYGJhJnJGqvIIgdECeODCT98wSWDAJ94SSuVpYQUoTcGUIL6L4yNB7j1DFFHSBg=="
	},
	"node_modules/regenerator-transform": {
	"version": "0.10.1",
	"resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.10.1.tgz",
	"integrity": "sha512-PJepbvDbuK1xgIgnau7Y90cwaAmO/LCLMI2mPvaXq2heGMR3aWW5/BQvYrhJ8jgmQjXewXvBjzfqKcVOmhjZ6Q==",
	"dependencies": {
	"babel-runtime": "^6.18.0",
	"babel-types": "^6.19.0",
	"private": "^0.1.6"
	}
	},
	"node_modules/regex-not": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz",
	"integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==",
	"dependencies": {
	"extend-shallow": "^3.0.2",
	"safe-regex": "^1.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/regexpu-core": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-2.0.0.tgz",
	"integrity": "sha1-SdA4g3uNz4v6W5pCE5k45uoq4kA=",
	"dependencies": {
	"regenerate": "^1.2.1",
	"regjsgen": "^0.2.0",
	"regjsparser": "^0.1.4"
	}
	},
	"node_modules/regjsgen": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz",
	"integrity": "sha1-bAFq3qxVT3WCP+N6wFuS1aTtsfc="
	},
	"node_modules/regjsparser": {
	"version": "0.1.5",
	"resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz",
	"integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=",
	"dependencies": {
	"jsesc": "~0.5.0"
	},
	"bin": {
	"regjsparser": "bin/parser"
	}
	},
	"node_modules/regjsparser/node_modules/jsesc": {
	"version": "0.5.0",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz",
	"integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=",
	"bin": {
	"jsesc": "bin/jsesc"
	}
	},
	"node_modules/remove-trailing-separator": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz",
	"integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8="
	},
	"node_modules/repeat-element": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz",
	"integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/repeat-string": {
	"version": "1.6.1",
	"resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz",
	"integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=",
	"engines": {
	"node": ">=0.10"
	}
	},
	"node_modules/repeating": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz",
	"integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=",
	"dependencies": {
	"is-finite": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/require-directory": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz",
	"integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/require-main-filename": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz",
	"integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg=="
	},
	"node_modules/resolve": {
	"version": "1.15.1",
	"resolved": "https://registry.npmjs.org/resolve/-/resolve-1.15.1.tgz",
	"integrity": "sha512-84oo6ZTtoTUpjgNEr5SJyzQhzL72gaRodsSfyxC/AXRvwu0Yse9H8eF9IpGo7b8YetZhlI6v7ZQ6bKBFV/6S7w==",
	"dev": true,
	"dependencies": {
	"path-parse": "^1.0.6"
	}
	},
	"node_modules/resolve-cwd": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz",
	"integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=",
	"dependencies": {
	"resolve-from": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/resolve-dir": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/resolve-dir/-/resolve-dir-1.0.1.tgz",
	"integrity": "sha1-eaQGRMNivoLybv/nOcm7U4IEb0M=",
	"dependencies": {
	"expand-tilde": "^2.0.0",
	"global-modules": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/resolve-dir/node_modules/global-modules": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz",
	"integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==",
	"dependencies": {
	"global-prefix": "^1.0.1",
	"is-windows": "^1.0.1",
	"resolve-dir": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/resolve-from": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz",
	"integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=",
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/resolve-url": {
	"version": "0.2.1",
	"resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz",
	"integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo="
	},
	"node_modules/ret": {
	"version": "0.1.15",
	"resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz",
	"integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==",
	"engines": {
	"node": ">=0.12"
	}
	},
	"node_modules/rimraf": {
	"version": "2.7.1",
	"resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz",
	"integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==",
	"dependencies": {
	"glob": "^7.1.3"
	},
	"bin": {
	"rimraf": "bin.js"
	}
	},
	"node_modules/ripemd160": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz",
	"integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==",
	"dependencies": {
	"hash-base": "^3.0.0",
	"inherits": "^2.0.1"
	}
	},
	"node_modules/rope-sequence": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/rope-sequence/-/rope-sequence-1.3.2.tgz",
	"integrity": "sha512-ku6MFrwEVSVmXLvy3dYph3LAMNS0890K7fabn+0YIRQ2T96T9F4gkFf0vf0WW0JUraNWwGRtInEpH7yO4tbQZg=="
	},
	"node_modules/run-queue": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz",
	"integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=",
	"dependencies": {
	"aproba": "^1.1.1"
	}
	},
	"node_modules/safe-buffer": {
	"version": "5.1.2",
	"resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
	"integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g=="
	},
	"node_modules/safe-regex": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz",
	"integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=",
	"dependencies": {
	"ret": "~0.1.10"
	}
	},
	"node_modules/schema-utils": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
	"integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
	"dependencies": {
	"ajv": "^6.1.0",
	"ajv-errors": "^1.0.0",
	"ajv-keywords": "^3.1.0"
	},
	"engines": {
	"node": ">= 4"
	}
	},
	"node_modules/semver": {
	"version": "5.7.1",
	"resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz",
	"integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==",
	"bin": {
	"semver": "bin/semver"
	}
	},
	"node_modules/serialize-javascript": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-2.1.2.tgz",
	"integrity": "sha512-rs9OggEUF0V4jUSecXazOYsLfu7OGK2qIn3c7IPBiffz32XniEp/TX9Xmc9LQfK2nQ2QKHvZ2oygKUGU0lG4jQ=="
	},
	"node_modules/set-blocking": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz",
	"integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc="
	},
	"node_modules/set-value": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.1.tgz",
	"integrity": "sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==",
	"dependencies": {
	"extend-shallow": "^2.0.1",
	"is-extendable": "^0.1.1",
	"is-plain-object": "^2.0.3",
	"split-string": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/set-value/node_modules/extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"dependencies": {
	"is-extendable": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/setimmediate": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz",
	"integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU="
	},
	"node_modules/sha.js": {
	"version": "2.4.11",
	"resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz",
	"integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==",
	"dependencies": {
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	},
	"bin": {
	"sha.js": "bin.js"
	}
	},
	"node_modules/shebang-command": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz",
	"integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=",
	"dependencies": {
	"shebang-regex": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/shebang-regex": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz",
	"integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/signal-exit": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz",
	"integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0="
	},
	"node_modules/slash": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz",
	"integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon": {
	"version": "0.8.2",
	"resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz",
	"integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==",
	"dependencies": {
	"base": "^0.11.1",
	"debug": "^2.2.0",
	"define-property": "^0.2.5",
	"extend-shallow": "^2.0.1",
	"map-cache": "^0.2.2",
	"source-map": "^0.5.6",
	"source-map-resolve": "^0.5.0",
	"use": "^3.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon-node": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz",
	"integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==",
	"dependencies": {
	"define-property": "^1.0.0",
	"isobject": "^3.0.0",
	"snapdragon-util": "^3.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon-node/node_modules/define-property": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
	"integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
	"dependencies": {
	"is-descriptor": "^1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon-node/node_modules/is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon-node/node_modules/is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"dependencies": {
	"kind-of": "^6.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon-node/node_modules/is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"dependencies": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon-util": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz",
	"integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==",
	"dependencies": {
	"kind-of": "^3.2.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon-util/node_modules/kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"dependencies": {
	"is-buffer": "^1.1.5"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon/node_modules/define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"dependencies": {
	"is-descriptor": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/snapdragon/node_modules/extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"dependencies": {
	"is-extendable": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/source-list-map": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.1.tgz",
	"integrity": "sha512-qnQ7gVMxGNxsiL4lEuJwe/To8UnK7fAnmbGEEH8RpLouuKbeEm0lhbQVFIrNSuB+G7tVrAlVsZgETT5nljf+Iw=="
	},
	"node_modules/source-map": {
	"version": "0.5.7",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz",
	"integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/source-map-resolve": {
	"version": "0.5.3",
	"resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.3.tgz",
	"integrity": "sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw==",
	"dependencies": {
	"atob": "^2.1.2",
	"decode-uri-component": "^0.2.0",
	"resolve-url": "^0.2.1",
	"source-map-url": "^0.4.0",
	"urix": "^0.1.0"
	}
	},
	"node_modules/source-map-support": {
	"version": "0.5.16",
	"resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.16.tgz",
	"integrity": "sha512-efyLRJDr68D9hBBNIPWFjhpFzURh+KJykQwvMyW5UiZzYwoF6l4YMMDIJJEyFWxWCqfyxLzz6tSfUFR+kXXsVQ==",
	"dependencies": {
	"buffer-from": "^1.0.0",
	"source-map": "^0.6.0"
	}
	},
	"node_modules/source-map-support/node_modules/source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/source-map-url": {
	"version": "0.4.0",
	"resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz",
	"integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM="
	},
	"node_modules/split-string": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz",
	"integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==",
	"dependencies": {
	"extend-shallow": "^3.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/sprintf-js": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz",
	"integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw="
	},
	"node_modules/ssri": {
	"version": "6.0.1",
	"resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz",
	"integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==",
	"dependencies": {
	"figgy-pudding": "^3.5.1"
	}
	},
	"node_modules/static-extend": {
	"version": "0.1.2",
	"resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz",
	"integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=",
	"dependencies": {
	"define-property": "^0.2.5",
	"object-copy": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/static-extend/node_modules/define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"dependencies": {
	"is-descriptor": "^0.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/stream-browserify": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz",
	"integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==",
	"dependencies": {
	"inherits": "~2.0.1",
	"readable-stream": "^2.0.2"
	}
	},
	"node_modules/stream-each": {
	"version": "1.2.3",
	"resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz",
	"integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==",
	"dependencies": {
	"end-of-stream": "^1.1.0",
	"stream-shift": "^1.0.0"
	}
	},
	"node_modules/stream-http": {
	"version": "2.8.3",
	"resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz",
	"integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==",
	"dependencies": {
	"builtin-status-codes": "^3.0.0",
	"inherits": "^2.0.1",
	"readable-stream": "^2.3.6",
	"to-arraybuffer": "^1.0.0",
	"xtend": "^4.0.0"
	}
	},
	"node_modules/stream-shift": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.1.tgz",
	"integrity": "sha512-AiisoFqQ0vbGcZgQPY1cdP2I76glaVA/RauYR4G4thNFgkTqr90yXTo4LYX60Jl+sIlPNHHdGSwo01AvbKUSVQ=="
	},
	"node_modules/string_decoder": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
	"integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
	"dependencies": {
	"safe-buffer": "~5.1.0"
	}
	},
	"node_modules/string-width": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz",
	"integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==",
	"dependencies": {
	"emoji-regex": "^7.0.1",
	"is-fullwidth-code-point": "^2.0.0",
	"strip-ansi": "^5.1.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/string-width/node_modules/ansi-regex": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz",
	"integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/string-width/node_modules/strip-ansi": {
	"version": "5.2.0",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz",
	"integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==",
	"dependencies": {
	"ansi-regex": "^4.1.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/strip-ansi": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz",
	"integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=",
	"dependencies": {
	"ansi-regex": "^2.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/strip-eof": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz",
	"integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/supports-color": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
	"integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=",
	"engines": {
	"node": ">=0.8.0"
	}
	},
	"node_modules/tapable": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/tapable/-/tapable-1.1.3.tgz",
	"integrity": "sha512-4WK/bYZmj8xLr+HUCODHGF1ZFzsYffasLUgEiMBY4fgtltdO6B4WJtlSbPaDTLpYTcGVwM2qLnFTICEcNxs3kA==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/terser": {
	"version": "4.6.6",
	"resolved": "https://registry.npmjs.org/terser/-/terser-4.6.6.tgz",
	"integrity": "sha512-4lYPyeNmstjIIESr/ysHg2vUPRGf2tzF9z2yYwnowXVuVzLEamPN1Gfrz7f8I9uEPuHcbFlW4PLIAsJoxXyJ1g==",
	"dependencies": {
	"commander": "^2.20.0",
	"source-map": "~0.6.1",
	"source-map-support": "~0.5.12"
	},
	"bin": {
	"terser": "bin/terser"
	},
	"engines": {
	"node": ">=6.0.0"
	}
	},
	"node_modules/terser-webpack-plugin": {
	"version": "1.4.3",
	"resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.3.tgz",
	"integrity": "sha512-QMxecFz/gHQwteWwSo5nTc6UaICqN1bMedC5sMtUc7y3Ha3Q8y6ZO0iCR8pq4RJC8Hjf0FEPEHZqcMB/+DFCrA==",
	"dependencies": {
	"cacache": "^12.0.2",
	"find-cache-dir": "^2.1.0",
	"is-wsl": "^1.1.0",
	"schema-utils": "^1.0.0",
	"serialize-javascript": "^2.1.2",
	"source-map": "^0.6.1",
	"terser": "^4.1.2",
	"webpack-sources": "^1.4.0",
	"worker-farm": "^1.7.0"
	},
	"engines": {
	"node": ">= 6.9.0"
	}
	},
	"node_modules/terser-webpack-plugin/node_modules/source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/terser/node_modules/source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/through2": {
	"version": "2.0.5",
	"resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz",
	"integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==",
	"dependencies": {
	"readable-stream": "~2.3.6",
	"xtend": "~4.0.1"
	}
	},
	"node_modules/timers-browserify": {
	"version": "2.0.11",
	"resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.11.tgz",
	"integrity": "sha512-60aV6sgJ5YEbzUdn9c8kYGIqOubPoUdqQCul3SBAsRCZ40s6Y5cMcrW4dt3/k/EsbLVJNl9n6Vz3fTc+k2GeKQ==",
	"dependencies": {
	"setimmediate": "^1.0.4"
	},
	"engines": {
	"node": ">=0.6.0"
	}
	},
	"node_modules/to-arraybuffer": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz",
	"integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M="
	},
	"node_modules/to-fast-properties": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.3.tgz",
	"integrity": "sha1-uDVx+k2MJbguIxsG46MFXeTKGkc=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/to-object-path": {
	"version": "0.3.0",
	"resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz",
	"integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=",
	"dependencies": {
	"kind-of": "^3.0.2"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/to-object-path/node_modules/kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"dependencies": {
	"is-buffer": "^1.1.5"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/to-regex": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz",
	"integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==",
	"dependencies": {
	"define-property": "^2.0.2",
	"extend-shallow": "^3.0.2",
	"regex-not": "^1.0.2",
	"safe-regex": "^1.1.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/to-regex-range": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz",
	"integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=",
	"dependencies": {
	"is-number": "^3.0.0",
	"repeat-string": "^1.6.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/trim-right": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/trim-right/-/trim-right-1.0.1.tgz",
	"integrity": "sha1-yy4SAwZ+DI3h9hQJS5/kVwTqYAM=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/tslib": {
	"version": "1.11.1",
	"resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz",
	"integrity": "sha512-aZW88SY8kQbU7gpV19lN24LtXh/yD4ZZg6qieAJDDg+YBsJcSmLGK9QpnUjAKVG/xefmvJGd1WUmfpT/g6AJGA=="
	},
	"node_modules/tty-browserify": {
	"version": "0.0.0",
	"resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz",
	"integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY="
	},
	"node_modules/typedarray": {
	"version": "0.0.6",
	"resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz",
	"integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c="
	},
	"node_modules/uc.micro": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/uc.micro/-/uc.micro-1.0.6.tgz",
	"integrity": "sha512-8Y75pvTYkLJW2hWQHXxoqRgV7qb9B+9vFEtidML+7koHUFapnVJAZ6cKs+Qjz5Aw3aZWHMC6u0wJE3At+nSGwA=="
	},
	"node_modules/unicode-canonical-property-names-ecmascript": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-1.0.4.tgz",
	"integrity": "sha512-jDrNnXWHd4oHiTZnx/ZG7gtUTVp+gCcTTKr8L0HjlwphROEW3+Him+IpvC+xcJEFegapiMZyZe02CyuOnRmbnQ==",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/unicode-match-property-ecmascript": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/unicode-match-property-ecmascript/-/unicode-match-property-ecmascript-1.0.4.tgz",
	"integrity": "sha512-L4Qoh15vTfntsn4P1zqnHulG0LdXgjSO035fEpdtp6YxXhMT51Q6vgM5lYdG/5X3MjS+k/Y9Xw4SFCY9IkR0rg==",
	"dev": true,
	"dependencies": {
	"unicode-canonical-property-names-ecmascript": "^1.0.4",
	"unicode-property-aliases-ecmascript": "^1.0.4"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/unicode-match-property-value-ecmascript": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/unicode-match-property-value-ecmascript/-/unicode-match-property-value-ecmascript-1.2.0.tgz",
	"integrity": "sha512-wjuQHGQVofmSJv1uVISKLE5zO2rNGzM/KCYZch/QQvez7C1hUhBIuZ701fYXExuufJFMPhv2SyL8CyoIfMLbIQ==",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/unicode-property-aliases-ecmascript": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/unicode-property-aliases-ecmascript/-/unicode-property-aliases-ecmascript-1.1.0.tgz",
	"integrity": "sha512-PqSoPh/pWetQ2phoj5RLiaqIk4kCNwoV3CI+LfGmWLKI3rE3kl1h59XpX2BjgDrmbxD9ARtQobPGU1SguCYuQg==",
	"dev": true,
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/union-value": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.1.tgz",
	"integrity": "sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==",
	"dependencies": {
	"arr-union": "^3.1.0",
	"get-value": "^2.0.6",
	"is-extendable": "^0.1.1",
	"set-value": "^2.0.1"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/unique-filename": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz",
	"integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==",
	"dependencies": {
	"unique-slug": "^2.0.0"
	}
	},
	"node_modules/unique-slug": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz",
	"integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==",
	"dependencies": {
	"imurmurhash": "^0.1.4"
	}
	},
	"node_modules/unset-value": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz",
	"integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=",
	"dependencies": {
	"has-value": "^0.3.1",
	"isobject": "^3.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/unset-value/node_modules/has-value": {
	"version": "0.3.1",
	"resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz",
	"integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=",
	"dependencies": {
	"get-value": "^2.0.3",
	"has-values": "^0.1.4",
	"isobject": "^2.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/unset-value/node_modules/has-value/node_modules/isobject": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz",
	"integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=",
	"dependencies": {
	"isarray": "1.0.0"
	},
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/unset-value/node_modules/has-values": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz",
	"integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E=",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/upath": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/upath/-/upath-1.2.0.tgz",
	"integrity": "sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg==",
	"engines": {
	"node": ">=4",
	"yarn": "*"
	}
	},
	"node_modules/uri-js": {
	"version": "4.2.2",
	"resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.2.2.tgz",
	"integrity": "sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==",
	"dependencies": {
	"punycode": "^2.1.0"
	}
	},
	"node_modules/urix": {
	"version": "0.1.0",
	"resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz",
	"integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI="
	},
	"node_modules/url": {
	"version": "0.11.0",
	"resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz",
	"integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=",
	"dependencies": {
	"punycode": "1.3.2",
	"querystring": "0.2.0"
	}
	},
	"node_modules/url/node_modules/punycode": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz",
	"integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0="
	},
	"node_modules/use": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz",
	"integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/util": {
	"version": "0.11.1",
	"resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz",
	"integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==",
	"dependencies": {
	"inherits": "2.0.3"
	}
	},
	"node_modules/util-deprecate": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
	"integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8="
	},
	"node_modules/util/node_modules/inherits": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz",
	"integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4="
	},
	"node_modules/v8-compile-cache": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.0.3.tgz",
	"integrity": "sha512-CNmdbwQMBjwr9Gsmohvm0pbL954tJrNzf6gWL3K+QMQf00PF7ERGrEiLgjuU3mKreLC2MeGhUsNV9ybTbLgd3w=="
	},
	"node_modules/vm-browserify": {
	"version": "1.1.2",
	"resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz",
	"integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ=="
	},
	"node_modules/w3c-keyname": {
	"version": "2.2.4",
	"resolved": "https://registry.npmjs.org/w3c-keyname/-/w3c-keyname-2.2.4.tgz",
	"integrity": "sha512-tOhfEwEzFLJzf6d1ZPkYfGj+FWhIpBux9ppoP3rlclw3Z0BZv3N7b7030Z1kYth+6rDuAsXUFr+d0VE6Ed1ikw=="
	},
	"node_modules/watchpack": {
	"version": "1.6.0",
	"resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.6.0.tgz",
	"integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==",
	"dependencies": {
	"chokidar": "^2.0.2",
	"graceful-fs": "^4.1.2",
	"neo-async": "^2.5.0"
	}
	},
	"node_modules/webpack": {
	"version": "4.42.0",
	"resolved": "https://registry.npmjs.org/webpack/-/webpack-4.42.0.tgz",
	"integrity": "sha512-EzJRHvwQyBiYrYqhyjW9AqM90dE4+s1/XtCfn7uWg6cS72zH+2VPFAlsnW0+W0cDi0XRjNKUMoJtpSi50+Ph6w==",
	"dependencies": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-module-context": "1.8.5",
	"@webassemblyjs/wasm-edit": "1.8.5",
	"@webassemblyjs/wasm-parser": "1.8.5",
	"acorn": "^6.2.1",
	"ajv": "^6.10.2",
	"ajv-keywords": "^3.4.1",
	"chrome-trace-event": "^1.0.2",
	"enhanced-resolve": "^4.1.0",
	"eslint-scope": "^4.0.3",
	"json-parse-better-errors": "^1.0.2",
	"loader-runner": "^2.4.0",
	"loader-utils": "^1.2.3",
	"memory-fs": "^0.4.1",
	"micromatch": "^3.1.10",
	"mkdirp": "^0.5.1",
	"neo-async": "^2.6.1",
	"node-libs-browser": "^2.2.1",
	"schema-utils": "^1.0.0",
	"tapable": "^1.1.3",
	"terser-webpack-plugin": "^1.4.3",
	"watchpack": "^1.6.0",
	"webpack-sources": "^1.4.1"
	},
	"bin": {
	"webpack": "bin/webpack.js"
	},
	"engines": {
	"node": ">=6.11.5"
	}
	},
	"node_modules/webpack-cli": {
	"version": "3.3.11",
	"resolved": "https://registry.npmjs.org/webpack-cli/-/webpack-cli-3.3.11.tgz",
	"integrity": "sha512-dXlfuml7xvAFwYUPsrtQAA9e4DOe58gnzSxhgrO/ZM/gyXTBowrsYeubyN4mqGhYdpXMFNyQ6emjJS9M7OBd4g==",
	"dependencies": {
	"chalk": "2.4.2",
	"cross-spawn": "6.0.5",
	"enhanced-resolve": "4.1.0",
	"findup-sync": "3.0.0",
	"global-modules": "2.0.0",
	"import-local": "2.0.0",
	"interpret": "1.2.0",
	"loader-utils": "1.2.3",
	"supports-color": "6.1.0",
	"v8-compile-cache": "2.0.3",
	"yargs": "13.2.4"
	},
	"bin": {
	"webpack-cli": "bin/cli.js"
	},
	"engines": {
	"node": ">=6.11.5"
	}
	},
	"node_modules/webpack-cli/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/webpack-cli/node_modules/chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dependencies": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/webpack-cli/node_modules/chalk/node_modules/supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/webpack-cli/node_modules/emojis-list": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz",
	"integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=",
	"engines": {
	"node": ">= 0.10"
	}
	},
	"node_modules/webpack-cli/node_modules/enhanced-resolve": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.0.tgz",
	"integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==",
	"dependencies": {
	"graceful-fs": "^4.1.2",
	"memory-fs": "^0.4.0",
	"tapable": "^1.0.0"
	},
	"engines": {
	"node": ">=6.9.0"
	}
	},
	"node_modules/webpack-cli/node_modules/loader-utils": {
	"version": "1.2.3",
	"resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz",
	"integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==",
	"dependencies": {
	"big.js": "^5.2.2",
	"emojis-list": "^2.0.0",
	"json5": "^1.0.1"
	},
	"engines": {
	"node": ">=4.0.0"
	}
	},
	"node_modules/webpack-cli/node_modules/supports-color": {
	"version": "6.1.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz",
	"integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==",
	"dependencies": {
	"has-flag": "^3.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/webpack-sources": {
	"version": "1.4.3",
	"resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.4.3.tgz",
	"integrity": "sha512-lgTS3Xhv1lCOKo7SA5TjKXMjpSM4sBjNV5+q2bqesbSPs5FjGmU6jjtBSkX9b4qW87vDIsCIlUPOEhbZrMdjeQ==",
	"dependencies": {
	"source-list-map": "^2.0.0",
	"source-map": "~0.6.1"
	}
	},
	"node_modules/webpack-sources/node_modules/source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
	"engines": {
	"node": ">=0.10.0"
	}
	},
	"node_modules/which": {
	"version": "1.3.1",
	"resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz",
	"integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==",
	"dependencies": {
	"isexe": "^2.0.0"
	},
	"bin": {
	"which": "bin/which"
	}
	},
	"node_modules/which-module": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz",
	"integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho="
	},
	"node_modules/worker-farm": {
	"version": "1.7.0",
	"resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz",
	"integrity": "sha512-rvw3QTZc8lAxyVrqcSGVm5yP/IJ2UcB3U0graE3LCFoZ0Yn2x4EoVSqJKdB/T5M+FLcRPjz4TDacRf3OCfNUzw==",
	"dependencies": {
	"errno": "~0.1.7"
	}
	},
	"node_modules/wrap-ansi": {
	"version": "5.1.0",
	"resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz",
	"integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==",
	"dependencies": {
	"ansi-styles": "^3.2.0",
	"string-width": "^3.0.0",
	"strip-ansi": "^5.0.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/wrap-ansi/node_modules/ansi-regex": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz",
	"integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==",
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/wrap-ansi/node_modules/ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dependencies": {
	"color-convert": "^1.9.0"
	},
	"engines": {
	"node": ">=4"
	}
	},
	"node_modules/wrap-ansi/node_modules/strip-ansi": {
	"version": "5.2.0",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz",
	"integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==",
	"dependencies": {
	"ansi-regex": "^4.1.0"
	},
	"engines": {
	"node": ">=6"
	}
	},
	"node_modules/wrappy": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
	"integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8="
	},
	"node_modules/xtend": {
	"version": "4.0.2",
	"resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz",
	"integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==",
	"engines": {
	"node": ">=0.4"
	}
	},
	"node_modules/y18n": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz",
	"integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w=="
	},
	"node_modules/yallist": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz",
	"integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g=="
	},
	"node_modules/yargs": {
	"version": "13.2.4",
	"resolved": "https://registry.npmjs.org/yargs/-/yargs-13.2.4.tgz",
	"integrity": "sha512-HG/DWAJa1PAnHT9JAhNa8AbAv3FPaiLzioSjCcmuXXhP8MlpHO5vwls4g4j6n30Z74GVQj8Xa62dWVx1QCGklg==",
	"dependencies": {
	"cliui": "^5.0.0",
	"find-up": "^3.0.0",
	"get-caller-file": "^2.0.1",
	"os-locale": "^3.1.0",
	"require-directory": "^2.1.1",
	"require-main-filename": "^2.0.0",
	"set-blocking": "^2.0.0",
	"string-width": "^3.0.0",
	"which-module": "^2.0.0",
	"y18n": "^4.0.0",
	"yargs-parser": "^13.1.0"
	}
	},
	"node_modules/yargs-parser": {
	"version": "13.1.1",
	"resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.1.tgz",
	"integrity": "sha512-oVAVsHz6uFrg3XQheFII8ESO2ssAf9luWuAd6Wexsu4F3OtIW0o8IribPXYrD4WC24LWtPrJlGy87y5udK+dxQ==",
	"dependencies": {
	"camelcase": "^5.0.0",
	"decamelize": "^1.2.0"
	}
	}
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz",
	"integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.8.3"
	}
	},
	"@babel/compat-data": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.11.0.tgz",
	"integrity": "sha512-TPSvJfv73ng0pfnEOh17bYMPQbI95+nGWc71Ss4vZdRBHTDqmM9Z8ZV4rYz8Ks7sfzc95n30k6ODIq5UGnXcYQ==",
	"dev": true,
	"requires": {
	"browserslist": "^4.12.0",
	"invariant": "^2.2.4",
	"semver": "^5.5.0"
	}
	},
	"@babel/core": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/core/-/core-7.8.7.tgz",
	"integrity": "sha512-rBlqF3Yko9cynC5CCFy6+K/w2N+Sq/ff2BPy+Krp7rHlABIr5epbA7OxVeKoMHB39LZOp1UY5SuLjy6uWi35yA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.8.3",
	"@babel/generator": "^7.8.7",
	"@babel/helpers": "^7.8.4",
	"@babel/parser": "^7.8.7",
	"@babel/template": "^7.8.6",
	"@babel/traverse": "^7.8.6",
	"@babel/types": "^7.8.7",
	"convert-source-map": "^1.7.0",
	"debug": "^4.1.0",
	"gensync": "^1.0.0-beta.1",
	"json5": "^2.1.0",
	"lodash": "^4.17.13",
	"resolve": "^1.3.2",
	"semver": "^5.4.1",
	"source-map": "^0.5.0"
	},
	"dependencies": {
	"debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"requires": {
	"ms": "^2.1.1"
	}
	},
	"json5": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/json5/-/json5-2.1.1.tgz",
	"integrity": "sha512-l+3HXD0GEI3huGq1njuqtzYK8OYJyXMkOLtQ53pjWh89tvWS2h6l+1zMkYWqlb57+SiQodKZyvMEFb2X+KrFhQ==",
	"dev": true,
	"requires": {
	"minimist": "^1.2.0"
	}
	},
	"ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	}
	}
	},
	"@babel/generator": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.8.7.tgz",
	"integrity": "sha512-DQwjiKJqH4C3qGiyQCAExJHoZssn49JTMJgZ8SANGgVFdkupcUhLOdkAeoC6kmHZCPfoDG5M0b6cFlSN5wW7Ew==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.8.7",
	"jsesc": "^2.5.1",
	"lodash": "^4.17.13",
	"source-map": "^0.5.0"
	},
	"dependencies": {
	"jsesc": {
	"version": "2.5.2",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz",
	"integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==",
	"dev": true
	}
	}
	},
	"@babel/helper-annotate-as-pure": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.10.4.tgz",
	"integrity": "sha512-XQlqKQP4vXFB7BN8fEEerrmYvHp3fK/rBkRFz9jaJbzK0B1DSfej9Kc7ZzE8Z/OnId1jpJdNAZ3BFQjWG68rcA==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-builder-binary-assignment-operator-visitor": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.10.4.tgz",
	"integrity": "sha512-L0zGlFrGWZK4PbT8AszSfLTM5sDU1+Az/En9VrdT8/LmEiJt4zXt+Jve9DCAnQcbqDhCI+29y/L93mrDzddCcg==",
	"dev": true,
	"requires": {
	"@babel/helper-explode-assignable-expression": "^7.10.4",
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-compilation-targets": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.10.4.tgz",
	"integrity": "sha512-a3rYhlsGV0UHNDvrtOXBg8/OpfV0OKTkxKPzIplS1zpx7CygDcWWxckxZeDd3gzPzC4kUT0A4nVFDK0wGMh4MQ==",
	"dev": true,
	"requires": {
	"@babel/compat-data": "^7.10.4",
	"browserslist": "^4.12.0",
	"invariant": "^2.2.4",
	"levenary": "^1.1.1",
	"semver": "^5.5.0"
	}
	},
	"@babel/helper-create-class-features-plugin": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/helper-create-class-features-plugin/-/helper-create-class-features-plugin-7.10.5.tgz",
	"integrity": "sha512-0nkdeijB7VlZoLT3r/mY3bUkw3T8WG/hNw+FATs/6+pG2039IJWjTYL0VTISqsNHMUTEnwbVnc89WIJX9Qed0A==",
	"dev": true,
	"requires": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-member-expression-to-functions": "^7.10.5",
	"@babel/helper-optimise-call-expression": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.10.4"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.0"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-create-regexp-features-plugin": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-create-regexp-features-plugin/-/helper-create-regexp-features-plugin-7.10.4.tgz",
	"integrity": "sha512-2/hu58IEPKeoLF45DBwx3XFqsbCXmkdAay4spVr2x0jYgRxrSNp+ePwvSsy9g6YSaNDcKIQVPXk1Ov8S2edk2g==",
	"dev": true,
	"requires": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-regex": "^7.10.4",
	"regexpu-core": "^4.7.0"
	},
	"dependencies": {
	"jsesc": {
	"version": "0.5.0",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz",
	"integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=",
	"dev": true
	},
	"regexpu-core": {
	"version": "4.7.0",
	"resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-4.7.0.tgz",
	"integrity": "sha512-TQ4KXRnIn6tz6tjnrXEkD/sshygKH/j5KzK86X8MkeHyZ8qst/LZ89j3X4/8HEIfHANTFIP/AbXakeRhWIl5YQ==",
	"dev": true,
	"requires": {
	"regenerate": "^1.4.0",
	"regenerate-unicode-properties": "^8.2.0",
	"regjsgen": "^0.5.1",
	"regjsparser": "^0.6.4",
	"unicode-match-property-ecmascript": "^1.0.4",
	"unicode-match-property-value-ecmascript": "^1.2.0"
	}
	},
	"regjsgen": {
	"version": "0.5.2",
	"resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.5.2.tgz",
	"integrity": "sha512-OFFT3MfrH90xIW8OOSyUrk6QHD5E9JOTeGodiJeBS3J6IwlgzJMNE/1bZklWz5oTg+9dCMyEetclvCVXOPoN3A==",
	"dev": true
	},
	"regjsparser": {
	"version": "0.6.4",
	"resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.6.4.tgz",
	"integrity": "sha512-64O87/dPDgfk8/RQqC4gkZoGyyWFIEUTTh80CU6CWuK5vkCGyekIx+oKcEIYtP/RAxSQltCZHCNu/mdd7fqlJw==",
	"dev": true,
	"requires": {
	"jsesc": "~0.5.0"
	}
	}
	}
	},
	"@babel/helper-define-map": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/helper-define-map/-/helper-define-map-7.10.5.tgz",
	"integrity": "sha512-fMw4kgFB720aQFXSVaXr79pjjcW5puTCM16+rECJ/plGS+zByelE8l9nCpV1GibxTnFVmUuYG9U8wYfQHdzOEQ==",
	"dev": true,
	"requires": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/types": "^7.10.5",
	"lodash": "^4.17.19"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-explode-assignable-expression": {
	"version": "7.11.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-explode-assignable-expression/-/helper-explode-assignable-expression-7.11.4.tgz",
	"integrity": "sha512-ux9hm3zR4WV1Y3xXxXkdG/0gxF9nvI0YVmKVhvK9AfMoaQkemL3sJpXw+Xbz65azo8qJiEz2XVDUpK3KYhH3ZQ==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-function-name": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.8.3.tgz",
	"integrity": "sha512-BCxgX1BC2hD/oBlIFUgOCQDOPV8nSINxCwM3o93xP4P9Fq6aV5sgv2cOOITDMtCfQ+3PvHp3l689XZvAM9QyOA==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.8.3",
	"@babel/template": "^7.8.3",
	"@babel/types": "^7.8.3"
	}
	},
	"@babel/helper-get-function-arity": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.8.3.tgz",
	"integrity": "sha512-FVDR+Gd9iLjUMY1fzE2SR0IuaJToR4RkCDARVfsBBPSP53GEqSFjD8gNyxg246VUyc/ALRxFaAK8rVG7UT7xRA==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.8.3"
	}
	},
	"@babel/helper-hoist-variables": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.10.4.tgz",
	"integrity": "sha512-wljroF5PgCk2juF69kanHVs6vrLwIPNp6DLD+Lrl3hoQ3PpPPikaDRNFA+0t81NOoMt2DL6WW/mdU8k4k6ZzuA==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-member-expression-to-functions": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.11.0.tgz",
	"integrity": "sha512-JbFlKHFntRV5qKw3YC0CvQnDZ4XMwgzzBbld7Ly4Mj4cbFy3KywcR8NtNctRToMWJOVvLINJv525Gd6wwVEx/Q==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.0"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-module-imports": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.10.4.tgz",
	"integrity": "sha512-nEQJHqYavI217oD9+s5MUBzk6x1IlvoS9WTPfgG43CbMEeStE0v+r+TucWdx8KFGowPGvyOkDT9+7DHedIDnVw==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-module-transforms": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.11.0.tgz",
	"integrity": "sha512-02EVu8COMuTRO1TAzdMtpBPbe6aQ1w/8fePD2YgQmxZU4gpNWaL9gK3Jp7dxlkUlUCJOTaSeA+Hrm1BRQwqIhg==",
	"dev": true,
	"requires": {
	"@babel/helper-module-imports": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4",
	"@babel/helper-simple-access": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.11.0",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.11.0",
	"lodash": "^4.17.19"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.0"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-optimise-call-expression": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.10.4.tgz",
	"integrity": "sha512-n3UGKY4VXwXThEiKrgRAoVPBMqeoPgHVqiHZOanAJCG9nQUL2pLRQirUzl0ioKclHGpGqRgIOkgcIJaIWLpygg==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-plugin-utils": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.10.4.tgz",
	"integrity": "sha512-O4KCvQA6lLiMU9l2eawBPMf1xPP8xPfB3iEQw150hOVTqj/rfXz0ThTb4HEzqQfs2Bmo5Ay8BzxfzVtBrr9dVg==",
	"dev": true
	},
	"@babel/helper-regex": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/helper-regex/-/helper-regex-7.10.5.tgz",
	"integrity": "sha512-68kdUAzDrljqBrio7DYAEgCoJHxppJOERHOgOrDN7WjOzP0ZQ1LsSDRXcemzVZaLvjaJsJEESb6qt+znNuENDg==",
	"dev": true,
	"requires": {
	"lodash": "^4.17.19"
	},
	"dependencies": {
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	}
	}
	},
	"@babel/helper-remap-async-to-generator": {
	"version": "7.11.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-remap-async-to-generator/-/helper-remap-async-to-generator-7.11.4.tgz",
	"integrity": "sha512-tR5vJ/vBa9wFy3m5LLv2faapJLnDFxNWff2SAYkSE4rLUdbp7CdObYFgI7wK4T/Mj4UzpjPwzR8Pzmr5m7MHGA==",
	"dev": true,
	"requires": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-wrap-function": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-replace-supers": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.10.4.tgz",
	"integrity": "sha512-sPxZfFXocEymYTdVK1UNmFPBN+Hv5mJkLPsYWwGBxZAxaWfFu+xqp7b6qWD0yjNuNL2VKc6L5M18tOXUP7NU0A==",
	"dev": true,
	"requires": {
	"@babel/helper-member-expression-to-functions": "^7.10.4",
	"@babel/helper-optimise-call-expression": "^7.10.4",
	"@babel/traverse": "^7.10.4",
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/generator": {
	"version": "7.11.6",
	"resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz",
	"integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.5",
	"jsesc": "^2.5.1",
	"source-map": "^0.5.0"
	}
	},
	"@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.0"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/traverse": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz",
	"integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/generator": "^7.11.5",
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.11.0",
	"@babel/parser": "^7.11.5",
	"@babel/types": "^7.11.5",
	"debug": "^4.1.0",
	"globals": "^11.1.0",
	"lodash": "^4.17.19"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"requires": {
	"ms": "^2.1.1"
	}
	},
	"globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"jsesc": {
	"version": "2.5.2",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz",
	"integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-simple-access": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.10.4.tgz",
	"integrity": "sha512-0fMy72ej/VEvF8ULmX6yb5MtHG4uH4Dbd6I/aHDb/JVg0bbivwt9Wg+h3uMvX+QSFtwr5MeItvazbrc4jtRAXw==",
	"dev": true,
	"requires": {
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-skip-transparent-expression-wrappers": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.11.0.tgz",
	"integrity": "sha512-0XIdiQln4Elglgjbwo9wuJpL/K7AGCY26kmEt0+pRP0TAj4jjyNq1MjoRvikrTVqKcx4Gysxt4cXvVFXP/JO2Q==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.0"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helper-split-export-declaration": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.8.3.tgz",
	"integrity": "sha512-3x3yOeyBhW851hroze7ElzdkeRXQYQbFIb7gLK1WQYsw2GWDay5gAJNw1sWJ0VFP6z5J1whqeXH/WCdCjZv6dA==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.8.3"
	}
	},
	"@babel/helper-validator-identifier": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz",
	"integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==",
	"dev": true
	},
	"@babel/helper-wrap-function": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-wrap-function/-/helper-wrap-function-7.10.4.tgz",
	"integrity": "sha512-6py45WvEF0MhiLrdxtRjKjufwLL1/ob2qDJgg5JgNdojBAZSAKnAjkyOCNug6n+OBl4VW76XjvgSFTdaMcW0Ug==",
	"dev": true,
	"requires": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/traverse": "^7.10.4",
	"@babel/types": "^7.10.4"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/generator": {
	"version": "7.11.6",
	"resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.11.6.tgz",
	"integrity": "sha512-DWtQ1PV3r+cLbySoHrwn9RWEgKMBLLma4OBQloPRyDYvc5msJM9kvTLo1YnlJd1P/ZuKbdli3ijr5q3FvAF3uA==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.5",
	"jsesc": "^2.5.1",
	"source-map": "^0.5.0"
	}
	},
	"@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.0"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/traverse": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.11.5.tgz",
	"integrity": "sha512-EjiPXt+r7LiCZXEfRpSJd+jUMnBd4/9OUv7Nx3+0u9+eimMwJmG0Q98lw4/289JCoxSE8OolDMNZaaF/JZ69WQ==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/generator": "^7.11.5",
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.11.0",
	"@babel/parser": "^7.11.5",
	"@babel/types": "^7.11.5",
	"debug": "^4.1.0",
	"globals": "^11.1.0",
	"lodash": "^4.17.19"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"requires": {
	"ms": "^2.1.1"
	}
	},
	"globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"jsesc": {
	"version": "2.5.2",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz",
	"integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/helpers": {
	"version": "7.8.4",
	"resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.8.4.tgz",
	"integrity": "sha512-VPbe7wcQ4chu4TDQjimHv/5tj73qz88o12EPkO2ValS2QiQS/1F2SsjyIGNnAD0vF/nZS6Cf9i+vW6HIlnaR8w==",
	"dev": true,
	"requires": {
	"@babel/template": "^7.8.3",
	"@babel/traverse": "^7.8.4",
	"@babel/types": "^7.8.3"
	}
	},
	"@babel/highlight": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.8.3.tgz",
	"integrity": "sha512-PX4y5xQUvy0fnEVHrYOarRPXVWafSjTW9T0Hab8gVIawpl2Sj0ORyrygANq+KjcNlSSTw0YCLSNA8OyZ1I4yEg==",
	"dev": true,
	"requires": {
	"chalk": "^2.0.0",
	"esutils": "^2.0.2",
	"js-tokens": "^4.0.0"
	},
	"dependencies": {
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	}
	}
	},
	"@babel/parser": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.8.7.tgz",
	"integrity": "sha512-9JWls8WilDXFGxs0phaXAZgpxTZhSk/yOYH2hTHC0X1yC7Z78IJfvR1vJ+rmJKq3I35td2XzXzN6ZLYlna+r/A==",
	"dev": true
	},
	"@babel/plugin-proposal-async-generator-functions": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-async-generator-functions/-/plugin-proposal-async-generator-functions-7.10.5.tgz",
	"integrity": "sha512-cNMCVezQbrRGvXJwm9fu/1sJj9bHdGAgKodZdLqOQIpfoH3raqmRPBM17+lh7CzhiKRRBrGtZL9WcjxSoGYUSg==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-remap-async-to-generator": "^7.10.4",
	"@babel/plugin-syntax-async-generators": "^7.8.0"
	}
	},
	"@babel/plugin-proposal-class-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-class-properties/-/plugin-proposal-class-properties-7.10.4.tgz",
	"integrity": "sha512-vhwkEROxzcHGNu2mzUC0OFFNXdZ4M23ib8aRRcJSsW8BZK9pQMD7QB7csl97NBbgGZO7ZyHUyKDnxzOaP4IrCg==",
	"dev": true,
	"requires": {
	"@babel/helper-create-class-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-proposal-dynamic-import": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-dynamic-import/-/plugin-proposal-dynamic-import-7.10.4.tgz",
	"integrity": "sha512-up6oID1LeidOOASNXgv/CFbgBqTuKJ0cJjz6An5tWD+NVBNlp3VNSBxv2ZdU7SYl3NxJC7agAQDApZusV6uFwQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-dynamic-import": "^7.8.0"
	}
	},
	"@babel/plugin-proposal-export-namespace-from": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-export-namespace-from/-/plugin-proposal-export-namespace-from-7.10.4.tgz",
	"integrity": "sha512-aNdf0LY6/3WXkhh0Fdb6Zk9j1NMD8ovj3F6r0+3j837Pn1S1PdNtcwJ5EG9WkVPNHPxyJDaxMaAOVq4eki0qbg==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-export-namespace-from": "^7.8.3"
	}
	},
	"@babel/plugin-proposal-json-strings": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-json-strings/-/plugin-proposal-json-strings-7.10.4.tgz",
	"integrity": "sha512-fCL7QF0Jo83uy1K0P2YXrfX11tj3lkpN7l4dMv9Y9VkowkhkQDwFHFd8IiwyK5MZjE8UpbgokkgtcReH88Abaw==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-json-strings": "^7.8.0"
	}
	},
	"@babel/plugin-proposal-logical-assignment-operators": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-logical-assignment-operators/-/plugin-proposal-logical-assignment-operators-7.11.0.tgz",
	"integrity": "sha512-/f8p4z+Auz0Uaf+i8Ekf1iM7wUNLcViFUGiPxKeXvxTSl63B875YPiVdUDdem7hREcI0E0kSpEhS8tF5RphK7Q==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-logical-assignment-operators": "^7.10.4"
	}
	},
	"@babel/plugin-proposal-nullish-coalescing-operator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-nullish-coalescing-operator/-/plugin-proposal-nullish-coalescing-operator-7.10.4.tgz",
	"integrity": "sha512-wq5n1M3ZUlHl9sqT2ok1T2/MTt6AXE0e1Lz4WzWBr95LsAZ5qDXe4KnFuauYyEyLiohvXFMdbsOTMyLZs91Zlw==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0"
	}
	},
	"@babel/plugin-proposal-numeric-separator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-numeric-separator/-/plugin-proposal-numeric-separator-7.10.4.tgz",
	"integrity": "sha512-73/G7QoRoeNkLZFxsoCCvlg4ezE4eM+57PnOqgaPOozd5myfj7p0muD1mRVJvbUWbOzD+q3No2bWbaKy+DJ8DA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-numeric-separator": "^7.10.4"
	}
	},
	"@babel/plugin-proposal-object-rest-spread": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-object-rest-spread/-/plugin-proposal-object-rest-spread-7.11.0.tgz",
	"integrity": "sha512-wzch41N4yztwoRw0ak+37wxwJM2oiIiy6huGCoqkvSTA9acYWcPfn9Y4aJqmFFJ70KTJUu29f3DQ43uJ9HXzEA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-object-rest-spread": "^7.8.0",
	"@babel/plugin-transform-parameters": "^7.10.4"
	}
	},
	"@babel/plugin-proposal-optional-catch-binding": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-catch-binding/-/plugin-proposal-optional-catch-binding-7.10.4.tgz",
	"integrity": "sha512-LflT6nPh+GK2MnFiKDyLiqSqVHkQnVf7hdoAvyTnnKj9xB3docGRsdPuxp6qqqW19ifK3xgc9U5/FwrSaCNX5g==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-syntax-optional-catch-binding": "^7.8.0"
	}
	},
	"@babel/plugin-proposal-optional-chaining": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-chaining/-/plugin-proposal-optional-chaining-7.11.0.tgz",
	"integrity": "sha512-v9fZIu3Y8562RRwhm1BbMRxtqZNFmFA2EG+pT2diuU8PT3H6T/KXoZ54KgYisfOFZHV6PfvAiBIZ9Rcz+/JCxA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-skip-transparent-expression-wrappers": "^7.11.0",
	"@babel/plugin-syntax-optional-chaining": "^7.8.0"
	}
	},
	"@babel/plugin-proposal-private-methods": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-private-methods/-/plugin-proposal-private-methods-7.10.4.tgz",
	"integrity": "sha512-wh5GJleuI8k3emgTg5KkJK6kHNsGEr0uBTDBuQUBJwckk9xs1ez79ioheEVVxMLyPscB0LfkbVHslQqIzWV6Bw==",
	"dev": true,
	"requires": {
	"@babel/helper-create-class-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-proposal-unicode-property-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-proposal-unicode-property-regex/-/plugin-proposal-unicode-property-regex-7.10.4.tgz",
	"integrity": "sha512-H+3fOgPnEXFL9zGYtKQe4IDOPKYlZdF1kqFDQRRb8PK4B8af1vAGK04tF5iQAAsui+mHNBQSAtd2/ndEDe9wuA==",
	"dev": true,
	"requires": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-syntax-async-generators": {
	"version": "7.8.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.8.4.tgz",
	"integrity": "sha512-tycmZxkGfZaxhMRbXlPXuVFpdWlXpir2W4AMhSJgRKzk/eDlIXOhb2LHWoLpDF7TEHylV5zNhykX6KAgHJmTNw==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"@babel/plugin-syntax-class-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-class-properties/-/plugin-syntax-class-properties-7.10.4.tgz",
	"integrity": "sha512-GCSBF7iUle6rNugfURwNmCGG3Z/2+opxAMLs1nND4bhEG5PuxTIggDBoeYYSujAlLtsupzOHYJQgPS3pivwXIA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-syntax-dynamic-import": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-dynamic-import/-/plugin-syntax-dynamic-import-7.8.3.tgz",
	"integrity": "sha512-5gdGbFon+PszYzqs83S3E5mpi7/y/8M9eC90MRTZfduQOYW76ig6SOSPNe41IG5LoP3FGBn2N0RjVDSQiS94kQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"@babel/plugin-syntax-export-namespace-from": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-export-namespace-from/-/plugin-syntax-export-namespace-from-7.8.3.tgz",
	"integrity": "sha512-MXf5laXo6c1IbEbegDmzGPwGNTsHZmEy6QGznu5Sh2UCWvueywb2ee+CCE4zQiZstxU9BMoQO9i6zUFSY0Kj0Q==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.3"
	}
	},
	"@babel/plugin-syntax-json-strings": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.8.3.tgz",
	"integrity": "sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"@babel/plugin-syntax-logical-assignment-operators": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-logical-assignment-operators/-/plugin-syntax-logical-assignment-operators-7.10.4.tgz",
	"integrity": "sha512-d8waShlpFDinQ5MtvGU9xDAOzKH47+FFoney2baFIoMr952hKOLp1HR7VszoZvOsV/4+RRszNY7D17ba0te0ig==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-syntax-nullish-coalescing-operator": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-nullish-coalescing-operator/-/plugin-syntax-nullish-coalescing-operator-7.8.3.tgz",
	"integrity": "sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"@babel/plugin-syntax-numeric-separator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-numeric-separator/-/plugin-syntax-numeric-separator-7.10.4.tgz",
	"integrity": "sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-syntax-object-rest-spread": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.8.3.tgz",
	"integrity": "sha512-XoqMijGZb9y3y2XskN+P1wUGiVwWZ5JmoDRwx5+3GmEplNyVM2s2Dg8ILFQm8rWM48orGy5YpI5Bl8U1y7ydlA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"@babel/plugin-syntax-optional-catch-binding": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.8.3.tgz",
	"integrity": "sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"@babel/plugin-syntax-optional-chaining": {
	"version": "7.8.3",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-chaining/-/plugin-syntax-optional-chaining-7.8.3.tgz",
	"integrity": "sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.8.0"
	}
	},
	"@babel/plugin-syntax-top-level-await": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-syntax-top-level-await/-/plugin-syntax-top-level-await-7.10.4.tgz",
	"integrity": "sha512-ni1brg4lXEmWyafKr0ccFWkJG0CeMt4WV1oyeBW6EFObF4oOHclbkj5cARxAPQyAQ2UTuplJyK4nfkXIMMFvsQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-arrow-functions": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-arrow-functions/-/plugin-transform-arrow-functions-7.10.4.tgz",
	"integrity": "sha512-9J/oD1jV0ZCBcgnoFWFq1vJd4msoKb/TCpGNFyyLt0zABdcvgK3aYikZ8HjzB14c26bc7E3Q1yugpwGy2aTPNA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-async-to-generator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-async-to-generator/-/plugin-transform-async-to-generator-7.10.4.tgz",
	"integrity": "sha512-F6nREOan7J5UXTLsDsZG3DXmZSVofr2tGNwfdrVwkDWHfQckbQXnXSPfD7iO+c/2HGqycwyLST3DnZ16n+cBJQ==",
	"dev": true,
	"requires": {
	"@babel/helper-module-imports": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-remap-async-to-generator": "^7.10.4"
	}
	},
	"@babel/plugin-transform-block-scoped-functions": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoped-functions/-/plugin-transform-block-scoped-functions-7.10.4.tgz",
	"integrity": "sha512-WzXDarQXYYfjaV1szJvN3AD7rZgZzC1JtjJZ8dMHUyiK8mxPRahynp14zzNjU3VkPqPsO38CzxiWO1c9ARZ8JA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-block-scoping": {
	"version": "7.11.1",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoping/-/plugin-transform-block-scoping-7.11.1.tgz",
	"integrity": "sha512-00dYeDE0EVEHuuM+26+0w/SCL0BH2Qy7LwHuI4Hi4MH5gkC8/AqMN5uWFJIsoXZrAphiMm1iXzBw6L2T+eA0ew==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-classes": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-classes/-/plugin-transform-classes-7.10.4.tgz",
	"integrity": "sha512-2oZ9qLjt161dn1ZE0Ms66xBncQH4In8Sqw1YWgBUZuGVJJS5c0OFZXL6dP2MRHrkU/eKhWg8CzFJhRQl50rQxA==",
	"dev": true,
	"requires": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-define-map": "^7.10.4",
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-optimise-call-expression": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4",
	"@babel/helper-split-export-declaration": "^7.10.4",
	"globals": "^11.1.0"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-split-export-declaration": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz",
	"integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.11.0"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/plugin-transform-computed-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-computed-properties/-/plugin-transform-computed-properties-7.10.4.tgz",
	"integrity": "sha512-JFwVDXcP/hM/TbyzGq3l/XWGut7p46Z3QvqFMXTfk6/09m7xZHJUN9xHfsv7vqqD4YnfI5ueYdSJtXqqBLyjBw==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-destructuring": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-destructuring/-/plugin-transform-destructuring-7.10.4.tgz",
	"integrity": "sha512-+WmfvyfsyF603iPa6825mq6Qrb7uLjTOsa3XOFzlYcYDHSS4QmpOWOL0NNBY5qMbvrcf3tq0Cw+v4lxswOBpgA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-dotall-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-dotall-regex/-/plugin-transform-dotall-regex-7.10.4.tgz",
	"integrity": "sha512-ZEAVvUTCMlMFAbASYSVQoxIbHm2OkG2MseW6bV2JjIygOjdVv8tuxrCTzj1+Rynh7ODb8GivUy7dzEXzEhuPaA==",
	"dev": true,
	"requires": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-duplicate-keys": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-duplicate-keys/-/plugin-transform-duplicate-keys-7.10.4.tgz",
	"integrity": "sha512-GL0/fJnmgMclHiBTTWXNlYjYsA7rDrtsazHG6mglaGSTh0KsrW04qml+Bbz9FL0LcJIRwBWL5ZqlNHKTkU3xAA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-exponentiation-operator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-exponentiation-operator/-/plugin-transform-exponentiation-operator-7.10.4.tgz",
	"integrity": "sha512-S5HgLVgkBcRdyQAHbKj+7KyuWx8C6t5oETmUuwz1pt3WTWJhsUV0WIIXuVvfXMxl/QQyHKlSCNNtaIamG8fysw==",
	"dev": true,
	"requires": {
	"@babel/helper-builder-binary-assignment-operator-visitor": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-for-of": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-for-of/-/plugin-transform-for-of-7.10.4.tgz",
	"integrity": "sha512-ItdQfAzu9AlEqmusA/65TqJ79eRcgGmpPPFvBnGILXZH975G0LNjP1yjHvGgfuCxqrPPueXOPe+FsvxmxKiHHQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-function-name/-/plugin-transform-function-name-7.10.4.tgz",
	"integrity": "sha512-OcDCq2y5+E0dVD5MagT5X+yTRbcvFjDI2ZVAottGH6tzqjx/LKpgkUepu3hp/u4tZBzxxpNGwLsAvGBvQ2mJzg==",
	"dev": true,
	"requires": {
	"@babel/helper-function-name": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	},
	"dependencies": {
	"@babel/code-frame": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz",
	"integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==",
	"dev": true,
	"requires": {
	"@babel/highlight": "^7.10.4"
	}
	},
	"@babel/helper-function-name": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz",
	"integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/template": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/highlight": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz",
	"integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"chalk": "^2.0.0",
	"js-tokens": "^4.0.0"
	}
	},
	"@babel/parser": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.11.5.tgz",
	"integrity": "sha512-X9rD8qqm695vgmeaQ4fvz/o3+Wk4ZzQvSHkDBgpYKxpD4qTAUm88ZKtHkVqIOsYFFbIQ6wQYhC6q7pjqVK0E0Q==",
	"dev": true
	},
	"@babel/template": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.10.4.tgz",
	"integrity": "sha512-ZCjD27cGJFUB6nmCB1Enki3r+L5kJveX9pq1SvAUKoICy6CZ9yD8xO086YXdYhvNjBdnekm4ZnaP5yC8Cs/1tA==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.10.4",
	"@babel/parser": "^7.10.4",
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"dev": true,
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"dev": true,
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	}
	},
	"js-tokens": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
	"integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==",
	"dev": true
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"dev": true,
	"requires": {
	"has-flag": "^3.0.0"
	}
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/plugin-transform-literals": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-literals/-/plugin-transform-literals-7.10.4.tgz",
	"integrity": "sha512-Xd/dFSTEVuUWnyZiMu76/InZxLTYilOSr1UlHV+p115Z/Le2Fi1KXkJUYz0b42DfndostYlPub3m8ZTQlMaiqQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-member-expression-literals": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-member-expression-literals/-/plugin-transform-member-expression-literals-7.10.4.tgz",
	"integrity": "sha512-0bFOvPyAoTBhtcJLr9VcwZqKmSjFml1iVxvPL0ReomGU53CX53HsM4h2SzckNdkQcHox1bpAqzxBI1Y09LlBSw==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-modules-amd": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-amd/-/plugin-transform-modules-amd-7.10.5.tgz",
	"integrity": "sha512-elm5uruNio7CTLFItVC/rIzKLfQ17+fX7EVz5W0TMgIHFo1zY0Ozzx+lgwhL4plzl8OzVn6Qasx5DeEFyoNiRw==",
	"dev": true,
	"requires": {
	"@babel/helper-module-transforms": "^7.10.5",
	"@babel/helper-plugin-utils": "^7.10.4",
	"babel-plugin-dynamic-import-node": "^2.3.3"
	}
	},
	"@babel/plugin-transform-modules-commonjs": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.10.4.tgz",
	"integrity": "sha512-Xj7Uq5o80HDLlW64rVfDBhao6OX89HKUmb+9vWYaLXBZOma4gA6tw4Ni1O5qVDoZWUV0fxMYA0aYzOawz0l+1w==",
	"dev": true,
	"requires": {
	"@babel/helper-module-transforms": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-simple-access": "^7.10.4",
	"babel-plugin-dynamic-import-node": "^2.3.3"
	}
	},
	"@babel/plugin-transform-modules-systemjs": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.10.5.tgz",
	"integrity": "sha512-f4RLO/OL14/FP1AEbcsWMzpbUz6tssRaeQg11RH1BP/XnPpRoVwgeYViMFacnkaw4k4wjRSjn3ip1Uw9TaXuMw==",
	"dev": true,
	"requires": {
	"@babel/helper-hoist-variables": "^7.10.4",
	"@babel/helper-module-transforms": "^7.10.5",
	"@babel/helper-plugin-utils": "^7.10.4",
	"babel-plugin-dynamic-import-node": "^2.3.3"
	}
	},
	"@babel/plugin-transform-modules-umd": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-umd/-/plugin-transform-modules-umd-7.10.4.tgz",
	"integrity": "sha512-mohW5q3uAEt8T45YT7Qc5ws6mWgJAaL/8BfWD9Dodo1A3RKWli8wTS+WiQ/knF+tXlPirW/1/MqzzGfCExKECA==",
	"dev": true,
	"requires": {
	"@babel/helper-module-transforms": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-named-capturing-groups-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-named-capturing-groups-regex/-/plugin-transform-named-capturing-groups-regex-7.10.4.tgz",
	"integrity": "sha512-V6LuOnD31kTkxQPhKiVYzYC/Jgdq53irJC/xBSmqcNcqFGV+PER4l6rU5SH2Vl7bH9mLDHcc0+l9HUOe4RNGKA==",
	"dev": true,
	"requires": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4"
	}
	},
	"@babel/plugin-transform-new-target": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-new-target/-/plugin-transform-new-target-7.10.4.tgz",
	"integrity": "sha512-YXwWUDAH/J6dlfwqlWsztI2Puz1NtUAubXhOPLQ5gjR/qmQ5U96DY4FQO8At33JN4XPBhrjB8I4eMmLROjjLjw==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-object-super": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-object-super/-/plugin-transform-object-super-7.10.4.tgz",
	"integrity": "sha512-5iTw0JkdRdJvr7sY0vHqTpnruUpTea32JHmq/atIWqsnNussbRzjEDyWep8UNztt1B5IusBYg8Irb0bLbiEBCQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-replace-supers": "^7.10.4"
	}
	},
	"@babel/plugin-transform-parameters": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-parameters/-/plugin-transform-parameters-7.10.5.tgz",
	"integrity": "sha512-xPHwUj5RdFV8l1wuYiu5S9fqWGM2DrYc24TMvUiRrPVm+SM3XeqU9BcokQX/kEUe+p2RBwy+yoiR1w/Blq6ubw==",
	"dev": true,
	"requires": {
	"@babel/helper-get-function-arity": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	},
	"dependencies": {
	"@babel/helper-get-function-arity": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz",
	"integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==",
	"dev": true,
	"requires": {
	"@babel/types": "^7.10.4"
	}
	},
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/plugin-transform-property-literals": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-property-literals/-/plugin-transform-property-literals-7.10.4.tgz",
	"integrity": "sha512-ofsAcKiUxQ8TY4sScgsGeR2vJIsfrzqvFb9GvJ5UdXDzl+MyYCaBj/FGzXuv7qE0aJcjWMILny1epqelnFlz8g==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-regenerator": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-regenerator/-/plugin-transform-regenerator-7.10.4.tgz",
	"integrity": "sha512-3thAHwtor39A7C04XucbMg17RcZ3Qppfxr22wYzZNcVIkPHfpM9J0SO8zuCV6SZa265kxBJSrfKTvDCYqBFXGw==",
	"dev": true,
	"requires": {
	"regenerator-transform": "^0.14.2"
	},
	"dependencies": {
	"regenerator-transform": {
	"version": "0.14.5",
	"resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.14.5.tgz",
	"integrity": "sha512-eOf6vka5IO151Jfsw2NO9WpGX58W6wWmefK3I1zEGr0lOD0u8rwPaNqQL1aRxUaxLeKO3ArNh3VYg1KbaD+FFw==",
	"dev": true,
	"requires": {
	"@babel/runtime": "^7.8.4"
	}
	}
	}
	},
	"@babel/plugin-transform-reserved-words": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-reserved-words/-/plugin-transform-reserved-words-7.10.4.tgz",
	"integrity": "sha512-hGsw1O6Rew1fkFbDImZIEqA8GoidwTAilwCyWqLBM9f+e/u/sQMQu7uX6dyokfOayRuuVfKOW4O7HvaBWM+JlQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-shorthand-properties": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-shorthand-properties/-/plugin-transform-shorthand-properties-7.10.4.tgz",
	"integrity": "sha512-AC2K/t7o07KeTIxMoHneyX90v3zkm5cjHJEokrPEAGEy3UCp8sLKfnfOIGdZ194fyN4wfX/zZUWT9trJZ0qc+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-spread": {
	"version": "7.11.0",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-spread/-/plugin-transform-spread-7.11.0.tgz",
	"integrity": "sha512-UwQYGOqIdQJe4aWNyS7noqAnN2VbaczPLiEtln+zPowRNlD+79w3oi2TWfYe0eZgd+gjZCbsydN7lzWysDt+gw==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-skip-transparent-expression-wrappers": "^7.11.0"
	}
	},
	"@babel/plugin-transform-sticky-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-sticky-regex/-/plugin-transform-sticky-regex-7.10.4.tgz",
	"integrity": "sha512-Ddy3QZfIbEV0VYcVtFDCjeE4xwVTJWTmUtorAJkn6u/92Z/nWJNV+mILyqHKrUxXYKA2EoCilgoPePymKL4DvQ==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/helper-regex": "^7.10.4"
	}
	},
	"@babel/plugin-transform-template-literals": {
	"version": "7.10.5",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-template-literals/-/plugin-transform-template-literals-7.10.5.tgz",
	"integrity": "sha512-V/lnPGIb+KT12OQikDvgSuesRX14ck5FfJXt6+tXhdkJ+Vsd0lDCVtF6jcB4rNClYFzaB2jusZ+lNISDk2mMMw==",
	"dev": true,
	"requires": {
	"@babel/helper-annotate-as-pure": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-typeof-symbol": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-typeof-symbol/-/plugin-transform-typeof-symbol-7.10.4.tgz",
	"integrity": "sha512-QqNgYwuuW0y0H+kUE/GWSR45t/ccRhe14Fs/4ZRouNNQsyd4o3PG4OtHiIrepbM2WKUBDAXKCAK/Lk4VhzTaGA==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-unicode-escapes": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-escapes/-/plugin-transform-unicode-escapes-7.10.4.tgz",
	"integrity": "sha512-y5XJ9waMti2J+e7ij20e+aH+fho7Wb7W8rNuu72aKRwCHFqQdhkdU2lo3uZ9tQuboEJcUFayXdARhcxLQ3+6Fg==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/plugin-transform-unicode-regex": {
	"version": "7.10.4",
	"resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-regex/-/plugin-transform-unicode-regex-7.10.4.tgz",
	"integrity": "sha512-wNfsc4s8N2qnIwpO/WP2ZiSyjfpTamT2C9V9FDH/Ljub9zw6P3SjkXcFmc0RQUt96k2fmIvtla2MMjgTwIAC+A==",
	"dev": true,
	"requires": {
	"@babel/helper-create-regexp-features-plugin": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4"
	}
	},
	"@babel/preset-env": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/preset-env/-/preset-env-7.11.5.tgz",
	"integrity": "sha512-kXqmW1jVcnB2cdueV+fyBM8estd5mlNfaQi6lwLgRwCby4edpavgbFhiBNjmWA3JpB/yZGSISa7Srf+TwxDQoA==",
	"dev": true,
	"requires": {
	"@babel/compat-data": "^7.11.0",
	"@babel/helper-compilation-targets": "^7.10.4",
	"@babel/helper-module-imports": "^7.10.4",
	"@babel/helper-plugin-utils": "^7.10.4",
	"@babel/plugin-proposal-async-generator-functions": "^7.10.4",
	"@babel/plugin-proposal-class-properties": "^7.10.4",
	"@babel/plugin-proposal-dynamic-import": "^7.10.4",
	"@babel/plugin-proposal-export-namespace-from": "^7.10.4",
	"@babel/plugin-proposal-json-strings": "^7.10.4",
	"@babel/plugin-proposal-logical-assignment-operators": "^7.11.0",
	"@babel/plugin-proposal-nullish-coalescing-operator": "^7.10.4",
	"@babel/plugin-proposal-numeric-separator": "^7.10.4",
	"@babel/plugin-proposal-object-rest-spread": "^7.11.0",
	"@babel/plugin-proposal-optional-catch-binding": "^7.10.4",
	"@babel/plugin-proposal-optional-chaining": "^7.11.0",
	"@babel/plugin-proposal-private-methods": "^7.10.4",
	"@babel/plugin-proposal-unicode-property-regex": "^7.10.4",
	"@babel/plugin-syntax-async-generators": "^7.8.0",
	"@babel/plugin-syntax-class-properties": "^7.10.4",
	"@babel/plugin-syntax-dynamic-import": "^7.8.0",
	"@babel/plugin-syntax-export-namespace-from": "^7.8.3",
	"@babel/plugin-syntax-json-strings": "^7.8.0",
	"@babel/plugin-syntax-logical-assignment-operators": "^7.10.4",
	"@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0",
	"@babel/plugin-syntax-numeric-separator": "^7.10.4",
	"@babel/plugin-syntax-object-rest-spread": "^7.8.0",
	"@babel/plugin-syntax-optional-catch-binding": "^7.8.0",
	"@babel/plugin-syntax-optional-chaining": "^7.8.0",
	"@babel/plugin-syntax-top-level-await": "^7.10.4",
	"@babel/plugin-transform-arrow-functions": "^7.10.4",
	"@babel/plugin-transform-async-to-generator": "^7.10.4",
	"@babel/plugin-transform-block-scoped-functions": "^7.10.4",
	"@babel/plugin-transform-block-scoping": "^7.10.4",
	"@babel/plugin-transform-classes": "^7.10.4",
	"@babel/plugin-transform-computed-properties": "^7.10.4",
	"@babel/plugin-transform-destructuring": "^7.10.4",
	"@babel/plugin-transform-dotall-regex": "^7.10.4",
	"@babel/plugin-transform-duplicate-keys": "^7.10.4",
	"@babel/plugin-transform-exponentiation-operator": "^7.10.4",
	"@babel/plugin-transform-for-of": "^7.10.4",
	"@babel/plugin-transform-function-name": "^7.10.4",
	"@babel/plugin-transform-literals": "^7.10.4",
	"@babel/plugin-transform-member-expression-literals": "^7.10.4",
	"@babel/plugin-transform-modules-amd": "^7.10.4",
	"@babel/plugin-transform-modules-commonjs": "^7.10.4",
	"@babel/plugin-transform-modules-systemjs": "^7.10.4",
	"@babel/plugin-transform-modules-umd": "^7.10.4",
	"@babel/plugin-transform-named-capturing-groups-regex": "^7.10.4",
	"@babel/plugin-transform-new-target": "^7.10.4",
	"@babel/plugin-transform-object-super": "^7.10.4",
	"@babel/plugin-transform-parameters": "^7.10.4",
	"@babel/plugin-transform-property-literals": "^7.10.4",
	"@babel/plugin-transform-regenerator": "^7.10.4",
	"@babel/plugin-transform-reserved-words": "^7.10.4",
	"@babel/plugin-transform-shorthand-properties": "^7.10.4",
	"@babel/plugin-transform-spread": "^7.11.0",
	"@babel/plugin-transform-sticky-regex": "^7.10.4",
	"@babel/plugin-transform-template-literals": "^7.10.4",
	"@babel/plugin-transform-typeof-symbol": "^7.10.4",
	"@babel/plugin-transform-unicode-escapes": "^7.10.4",
	"@babel/plugin-transform-unicode-regex": "^7.10.4",
	"@babel/preset-modules": "^0.1.3",
	"@babel/types": "^7.11.5",
	"browserslist": "^4.12.0",
	"core-js-compat": "^3.6.2",
	"invariant": "^2.2.2",
	"levenary": "^1.1.1",
	"semver": "^5.5.0"
	},
	"dependencies": {
	"@babel/types": {
	"version": "7.11.5",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.11.5.tgz",
	"integrity": "sha512-bvM7Qz6eKnJVFIn+1LPtjlBFPVN5jNDc1XmN15vWe7Q3DPBufWWsLiIvUu7xW87uTG6QoggpIDnUgLQvPheU+Q==",
	"dev": true,
	"requires": {
	"@babel/helper-validator-identifier": "^7.10.4",
	"lodash": "^4.17.19",
	"to-fast-properties": "^2.0.0"
	}
	},
	"lodash": {
	"version": "4.17.20",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz",
	"integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==",
	"dev": true
	},
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@babel/preset-modules": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/@babel/preset-modules/-/preset-modules-0.1.4.tgz",
	"integrity": "sha512-J36NhwnfdzpmH41M1DrnkkgAqhZaqr/NBdPfQ677mLzlaXo+oDiv1deyCDtgAhz8p328otdob0Du7+xgHGZbKg==",
	"dev": true,
	"requires": {
	"@babel/helper-plugin-utils": "^7.0.0",
	"@babel/plugin-proposal-unicode-property-regex": "^7.4.4",
	"@babel/plugin-transform-dotall-regex": "^7.4.4",
	"@babel/types": "^7.4.4",
	"esutils": "^2.0.2"
	}
	},
	"@babel/runtime": {
	"version": "7.11.2",
	"resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.11.2.tgz",
	"integrity": "sha512-TeWkU52so0mPtDcaCTxNBI/IHiz0pZgr8VEFqXFtZWpYD08ZB6FaSwVAS8MKRQAP3bYKiVjwysOJgMFY28o6Tw==",
	"dev": true,
	"requires": {
	"regenerator-runtime": "^0.13.4"
	},
	"dependencies": {
	"regenerator-runtime": {
	"version": "0.13.7",
	"resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.7.tgz",
	"integrity": "sha512-a54FxoJDIr27pgf7IgeQGxmqUNYrcV338lf/6gH456HZ/PhX+5BcwHXG9ajESmwe6WRO0tAzRUrRmNONWgkrew==",
	"dev": true
	}
	}
	},
	"@babel/template": {
	"version": "7.8.6",
	"resolved": "https://registry.npmjs.org/@babel/template/-/template-7.8.6.tgz",
	"integrity": "sha512-zbMsPMy/v0PWFZEhQJ66bqjhH+z0JgMoBWuikXybgG3Gkd/3t5oQ1Rw2WQhnSrsOmsKXnZOx15tkC4qON/+JPg==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.8.3",
	"@babel/parser": "^7.8.6",
	"@babel/types": "^7.8.6"
	}
	},
	"@babel/traverse": {
	"version": "7.8.6",
	"resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.8.6.tgz",
	"integrity": "sha512-2B8l0db/DPi8iinITKuo7cbPznLCEk0kCxDoB9/N6gGNg/gxOXiR/IcymAFPiBwk5w6TtQ27w4wpElgp9btR9A==",
	"dev": true,
	"requires": {
	"@babel/code-frame": "^7.8.3",
	"@babel/generator": "^7.8.6",
	"@babel/helper-function-name": "^7.8.3",
	"@babel/helper-split-export-declaration": "^7.8.3",
	"@babel/parser": "^7.8.6",
	"@babel/types": "^7.8.6",
	"debug": "^4.1.0",
	"globals": "^11.1.0",
	"lodash": "^4.17.13"
	},
	"dependencies": {
	"debug": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz",
	"integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==",
	"dev": true,
	"requires": {
	"ms": "^2.1.1"
	}
	},
	"globals": {
	"version": "11.12.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
	"integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
	"dev": true
	},
	"ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"dev": true
	}
	}
	},
	"@babel/types": {
	"version": "7.8.7",
	"resolved": "https://registry.npmjs.org/@babel/types/-/types-7.8.7.tgz",
	"integrity": "sha512-k2TreEHxFA4CjGkL+GYjRyx35W0Mr7DP5+9q6WMkyKXB+904bYmG40syjMFV0oLlhhFCwWl0vA0DyzTDkwAiJw==",
	"dev": true,
	"requires": {
	"esutils": "^2.0.2",
	"lodash": "^4.17.13",
	"to-fast-properties": "^2.0.0"
	},
	"dependencies": {
	"to-fast-properties": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
	"integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=",
	"dev": true
	}
	}
	},
	"@webassemblyjs/ast": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.8.5.tgz",
	"integrity": "sha512-aJMfngIZ65+t71C3y2nBBg5FFG0Okt9m0XEgWZ7Ywgn1oMAT8cNwx00Uv1cQyHtidq0Xn94R4TAywO+LCQ+ZAQ==",
	"requires": {
	"@webassemblyjs/helper-module-context": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/wast-parser": "1.8.5"
	}
	},
	"@webassemblyjs/floating-point-hex-parser": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.8.5.tgz",
	"integrity": "sha512-9p+79WHru1oqBh9ewP9zW95E3XAo+90oth7S5Re3eQnECGq59ly1Ri5tsIipKGpiStHsUYmY3zMLqtk3gTcOtQ=="
	},
	"@webassemblyjs/helper-api-error": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.8.5.tgz",
	"integrity": "sha512-Za/tnzsvnqdaSPOUXHyKJ2XI7PDX64kWtURyGiJJZKVEdFOsdKUCPTNEVFZq3zJ2R0G5wc2PZ5gvdTRFgm81zA=="
	},
	"@webassemblyjs/helper-buffer": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.8.5.tgz",
	"integrity": "sha512-Ri2R8nOS0U6G49Q86goFIPNgjyl6+oE1abW1pS84BuhP1Qcr5JqMwRFT3Ah3ADDDYGEgGs1iyb1DGX+kAi/c/Q=="
	},
	"@webassemblyjs/helper-code-frame": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.8.5.tgz",
	"integrity": "sha512-VQAadSubZIhNpH46IR3yWO4kZZjMxN1opDrzePLdVKAZ+DFjkGD/rf4v1jap744uPVU6yjL/smZbRIIJTOUnKQ==",
	"requires": {
	"@webassemblyjs/wast-printer": "1.8.5"
	}
	},
	"@webassemblyjs/helper-fsm": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.8.5.tgz",
	"integrity": "sha512-kRuX/saORcg8se/ft6Q2UbRpZwP4y7YrWsLXPbbmtepKr22i8Z4O3V5QE9DbZK908dh5Xya4Un57SDIKwB9eow=="
	},
	"@webassemblyjs/helper-module-context": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.8.5.tgz",
	"integrity": "sha512-/O1B236mN7UNEU4t9X7Pj38i4VoU8CcMHyy3l2cV/kIF4U5KoHXDVqcDuOs1ltkac90IM4vZdHc52t1x8Yfs3g==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"mamacro": "^0.0.3"
	}
	},
	"@webassemblyjs/helper-wasm-bytecode": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.8.5.tgz",
	"integrity": "sha512-Cu4YMYG3Ddl72CbmpjU/wbP6SACcOPVbHN1dI4VJNJVgFwaKf1ppeFJrwydOG3NDHxVGuCfPlLZNyEdIYlQ6QQ=="
	},
	"@webassemblyjs/helper-wasm-section": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.8.5.tgz",
	"integrity": "sha512-VV083zwR+VTrIWWtgIUpqfvVdK4ff38loRmrdDBgBT8ADXYsEZ5mPQ4Nde90N3UYatHdYoDIFb7oHzMncI02tA==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-buffer": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/wasm-gen": "1.8.5"
	}
	},
	"@webassemblyjs/ieee754": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.8.5.tgz",
	"integrity": "sha512-aaCvQYrvKbY/n6wKHb/ylAJr27GglahUO89CcGXMItrOBqRarUMxWLJgxm9PJNuKULwN5n1csT9bYoMeZOGF3g==",
	"requires": {
	"@xtuc/ieee754": "^1.2.0"
	}
	},
	"@webassemblyjs/leb128": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.8.5.tgz",
	"integrity": "sha512-plYUuUwleLIziknvlP8VpTgO4kqNaH57Y3JnNa6DLpu/sGcP6hbVdfdX5aHAV716pQBKrfuU26BJK29qY37J7A==",
	"requires": {
	"@xtuc/long": "4.2.2"
	}
	},
	"@webassemblyjs/utf8": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.8.5.tgz",
	"integrity": "sha512-U7zgftmQriw37tfD934UNInokz6yTmn29inT2cAetAsaU9YeVCveWEwhKL1Mg4yS7q//NGdzy79nlXh3bT8Kjw=="
	},
	"@webassemblyjs/wasm-edit": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.8.5.tgz",
	"integrity": "sha512-A41EMy8MWw5yvqj7MQzkDjU29K7UJq1VrX2vWLzfpRHt3ISftOXqrtojn7nlPsZ9Ijhp5NwuODuycSvfAO/26Q==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-buffer": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/helper-wasm-section": "1.8.5",
	"@webassemblyjs/wasm-gen": "1.8.5",
	"@webassemblyjs/wasm-opt": "1.8.5",
	"@webassemblyjs/wasm-parser": "1.8.5",
	"@webassemblyjs/wast-printer": "1.8.5"
	}
	},
	"@webassemblyjs/wasm-gen": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.8.5.tgz",
	"integrity": "sha512-BCZBT0LURC0CXDzj5FXSc2FPTsxwp3nWcqXQdOZE4U7h7i8FqtFK5Egia6f9raQLpEKT1VL7zr4r3+QX6zArWg==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/ieee754": "1.8.5",
	"@webassemblyjs/leb128": "1.8.5",
	"@webassemblyjs/utf8": "1.8.5"
	}
	},
	"@webassemblyjs/wasm-opt": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.8.5.tgz",
	"integrity": "sha512-HKo2mO/Uh9A6ojzu7cjslGaHaUU14LdLbGEKqTR7PBKwT6LdPtLLh9fPY33rmr5wcOMrsWDbbdCHq4hQUdd37Q==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-buffer": "1.8.5",
	"@webassemblyjs/wasm-gen": "1.8.5",
	"@webassemblyjs/wasm-parser": "1.8.5"
	}
	},
	"@webassemblyjs/wasm-parser": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.8.5.tgz",
	"integrity": "sha512-pi0SYE9T6tfcMkthwcgCpL0cM9nRYr6/6fjgDtL6q/ZqKHdMWvxitRi5JcZ7RI4SNJJYnYNaWy5UUrHQy998lw==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-api-error": "1.8.5",
	"@webassemblyjs/helper-wasm-bytecode": "1.8.5",
	"@webassemblyjs/ieee754": "1.8.5",
	"@webassemblyjs/leb128": "1.8.5",
	"@webassemblyjs/utf8": "1.8.5"
	}
	},
	"@webassemblyjs/wast-parser": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.8.5.tgz",
	"integrity": "sha512-daXC1FyKWHF1i11obK086QRlsMsY4+tIOKgBqI1lxAnkp9xe9YMcgOxm9kLe+ttjs5aWV2KKE1TWJCN57/Btsg==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/floating-point-hex-parser": "1.8.5",
	"@webassemblyjs/helper-api-error": "1.8.5",
	"@webassemblyjs/helper-code-frame": "1.8.5",
	"@webassemblyjs/helper-fsm": "1.8.5",
	"@xtuc/long": "4.2.2"
	}
	},
	"@webassemblyjs/wast-printer": {
	"version": "1.8.5",
	"resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.8.5.tgz",
	"integrity": "sha512-w0U0pD4EhlnvRyeJzBqaVSJAo9w/ce7/WPogeXLzGkO6hzhr4GnQIZ4W4uUt5b9ooAaXPtnXlj0gzsXEOUNYMg==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/wast-parser": "1.8.5",
	"@xtuc/long": "4.2.2"
	}
	},
	"@xtuc/ieee754": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/@xtuc/ieee754/-/ieee754-1.2.0.tgz",
	"integrity": "sha512-DX8nKgqcGwsc0eJSqYt5lwP4DH5FlHnmuWWBRy7X0NcaGR0ZtuyeESgMwTYVEtxmsNGY+qit4QYT/MIYTOTPeA=="
	},
	"@xtuc/long": {
	"version": "4.2.2",
	"resolved": "https://registry.npmjs.org/@xtuc/long/-/long-4.2.2.tgz",
	"integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ=="
	},
	"acorn": {
	"version": "6.4.1",
	"resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.1.tgz",
	"integrity": "sha512-ZVA9k326Nwrj3Cj9jlh3wGFutC2ZornPNARZwsNYqQYgN0EsV2d53w5RN/co65Ohn4sUAUtb1rSUAOD6XN9idA=="
	},
	"ajv": {
	"version": "6.12.0",
	"resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.0.tgz",
	"integrity": "sha512-D6gFiFA0RRLyUbvijN74DWAjXSFxWKaWP7mldxkVhyhAV3+SWA9HEJPHQ2c9soIeTFJqcSdFDGFgdqs1iUU2Hw==",
	"requires": {
	"fast-deep-equal": "^3.1.1",
	"fast-json-stable-stringify": "^2.0.0",
	"json-schema-traverse": "^0.4.1",
	"uri-js": "^4.2.2"
	}
	},
	"ajv-errors": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.1.tgz",
	"integrity": "sha512-DCRfO/4nQ+89p/RK43i8Ezd41EqdGIU4ld7nGF8OQ14oc/we5rEntLCUa7+jrn3nn83BosfwZA0wb4pon2o8iQ=="
	},
	"ajv-keywords": {
	"version": "3.4.1",
	"resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.4.1.tgz",
	"integrity": "sha512-RO1ibKvd27e6FEShVFfPALuHI3WjSVNeK5FIsmme/LYRNxjKuNj+Dt7bucLa6NdSv3JcVTyMlm9kGR84z1XpaQ=="
	},
	"ansi-regex": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz",
	"integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8="
	},
	"ansi-styles": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
	"integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4="
	},
	"anymatch": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz",
	"integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==",
	"requires": {
	"micromatch": "^3.1.4",
	"normalize-path": "^2.1.1"
	},
	"dependencies": {
	"normalize-path": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz",
	"integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=",
	"requires": {
	"remove-trailing-separator": "^1.0.1"
	}
	}
	}
	},
	"aproba": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz",
	"integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw=="
	},
	"argparse": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz",
	"integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q=="
	},
	"arr-diff": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz",
	"integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA="
	},
	"arr-flatten": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz",
	"integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg=="
	},
	"arr-union": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz",
	"integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ="
	},
	"array-unique": {
	"version": "0.3.2",
	"resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz",
	"integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg="
	},
	"asn1.js": {
	"version": "4.10.1",
	"resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-4.10.1.tgz",
	"integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==",
	"requires": {
	"bn.js": "^4.0.0",
	"inherits": "^2.0.1",
	"minimalistic-assert": "^1.0.0"
	}
	},
	"assert": {
	"version": "1.5.0",
	"resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz",
	"integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==",
	"requires": {
	"object-assign": "^4.1.1",
	"util": "0.10.3"
	},
	"dependencies": {
	"inherits": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz",
	"integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE="
	},
	"util": {
	"version": "0.10.3",
	"resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz",
	"integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=",
	"requires": {
	"inherits": "2.0.1"
	}
	}
	}
	},
	"assign-symbols": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz",
	"integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c="
	},
	"async-each": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.3.tgz",
	"integrity": "sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ=="
	},
	"atob": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz",
	"integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg=="
	},
	"babel-code-frame": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-code-frame/-/babel-code-frame-6.26.0.tgz",
	"integrity": "sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=",
	"requires": {
	"chalk": "^1.1.3",
	"esutils": "^2.0.2",
	"js-tokens": "^3.0.2"
	}
	},
	"babel-core": {
	"version": "6.26.3",
	"resolved": "https://registry.npmjs.org/babel-core/-/babel-core-6.26.3.tgz",
	"integrity": "sha512-6jyFLuDmeidKmUEb3NM+/yawG0M2bDZ9Z1qbZP59cyHLz8kYGKYwpJP0UwUKKUiTRNvxfLesJnTedqczP7cTDA==",
	"requires": {
	"babel-code-frame": "^6.26.0",
	"babel-generator": "^6.26.0",
	"babel-helpers": "^6.24.1",
	"babel-messages": "^6.23.0",
	"babel-register": "^6.26.0",
	"babel-runtime": "^6.26.0",
	"babel-template": "^6.26.0",
	"babel-traverse": "^6.26.0",
	"babel-types": "^6.26.0",
	"babylon": "^6.18.0",
	"convert-source-map": "^1.5.1",
	"debug": "^2.6.9",
	"json5": "^0.5.1",
	"lodash": "^4.17.4",
	"minimatch": "^3.0.4",
	"path-is-absolute": "^1.0.1",
	"private": "^0.1.8",
	"slash": "^1.0.0",
	"source-map": "^0.5.7"
	},
	"dependencies": {
	"json5": {
	"version": "0.5.1",
	"resolved": "https://registry.npmjs.org/json5/-/json5-0.5.1.tgz",
	"integrity": "sha1-Hq3nrMASA0rYTiOWdn6tn6VJWCE="
	}
	}
	},
	"babel-generator": {
	"version": "6.26.1",
	"resolved": "https://registry.npmjs.org/babel-generator/-/babel-generator-6.26.1.tgz",
	"integrity": "sha512-HyfwY6ApZj7BYTcJURpM5tznulaBvyio7/0d4zFOeMPUmfxkCjHocCuoLa2SAGzBI8AREcH3eP3758F672DppA==",
	"requires": {
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"detect-indent": "^4.0.0",
	"jsesc": "^1.3.0",
	"lodash": "^4.17.4",
	"source-map": "^0.5.7",
	"trim-right": "^1.0.1"
	}
	},
	"babel-helper-call-delegate": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz",
	"integrity": "sha1-7Oaqzdx25Bw0YfiL/Fdb0Nqi340=",
	"requires": {
	"babel-helper-hoist-variables": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"babel-helper-define-map": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-helper-define-map/-/babel-helper-define-map-6.26.0.tgz",
	"integrity": "sha1-pfVtq0GiX5fstJjH66ypgZ+Vvl8=",
	"requires": {
	"babel-helper-function-name": "^6.24.1",
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"lodash": "^4.17.4"
	}
	},
	"babel-helper-function-name": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz",
	"integrity": "sha1-00dbjAPtmCQqJbSDUasYOZ01gKk=",
	"requires": {
	"babel-helper-get-function-arity": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"babel-helper-get-function-arity": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz",
	"integrity": "sha1-j3eCqpNAfEHTqlCQj4mwMbG2hT0=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-helper-hoist-variables": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz",
	"integrity": "sha1-HssnaJydJVE+rbyZFKc/VAi+enY=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-helper-optimise-call-expression": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-optimise-call-expression/-/babel-helper-optimise-call-expression-6.24.1.tgz",
	"integrity": "sha1-96E0J7qfc/j0+pk8VKl4gtEkQlc=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-helper-regex": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz",
	"integrity": "sha1-MlxZ+QL4LyS3T6zu0DY5VPZJXnI=",
	"requires": {
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"lodash": "^4.17.4"
	}
	},
	"babel-helper-replace-supers": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helper-replace-supers/-/babel-helper-replace-supers-6.24.1.tgz",
	"integrity": "sha1-v22/5Dk40XNpohPKiov3S2qQqxo=",
	"requires": {
	"babel-helper-optimise-call-expression": "^6.24.1",
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"babel-helpers": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-helpers/-/babel-helpers-6.24.1.tgz",
	"integrity": "sha1-NHHenK7DiOXIUOWX5Yom3fN2ArI=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"babel-loader": {
	"version": "8.0.6",
	"resolved": "https://registry.npmjs.org/babel-loader/-/babel-loader-8.0.6.tgz",
	"integrity": "sha512-4BmWKtBOBm13uoUwd08UwjZlaw3O9GWf456R9j+5YykFZ6LUIjIKLc0zEZf+hauxPOJs96C8k6FvYD09vWzhYw==",
	"dev": true,
	"requires": {
	"find-cache-dir": "^2.0.0",
	"loader-utils": "^1.0.2",
	"mkdirp": "^0.5.1",
	"pify": "^4.0.1"
	}
	},
	"babel-messages": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-messages/-/babel-messages-6.23.0.tgz",
	"integrity": "sha1-8830cDhYA1sqKVHG7F7fbGLyYw4=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-check-es2015-constants": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz",
	"integrity": "sha1-NRV7EBQm/S/9PaP3XH0ekYNbv4o=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-dynamic-import-node": {
	"version": "2.3.3",
	"resolved": "https://registry.npmjs.org/babel-plugin-dynamic-import-node/-/babel-plugin-dynamic-import-node-2.3.3.tgz",
	"integrity": "sha512-jZVI+s9Zg3IqA/kdi0i6UDCybUI3aSBLnglhYbSSjKlV7yF1F/5LWv8MakQmvYpnbJDS6fcBL2KzHSxNCMtWSQ==",
	"dev": true,
	"requires": {
	"object.assign": "^4.1.0"
	}
	},
	"babel-plugin-transform-es2015-arrow-functions": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-arrow-functions/-/babel-plugin-transform-es2015-arrow-functions-6.22.0.tgz",
	"integrity": "sha1-RSaSy3EdX3ncf4XkQM5BufJE0iE=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-block-scoped-functions": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoped-functions/-/babel-plugin-transform-es2015-block-scoped-functions-6.22.0.tgz",
	"integrity": "sha1-u8UbSflk1wy42OC5ToICRs46YUE=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-block-scoping": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-block-scoping/-/babel-plugin-transform-es2015-block-scoping-6.26.0.tgz",
	"integrity": "sha1-1w9SmcEwjQXBL0Y4E7CgnnOxiV8=",
	"requires": {
	"babel-runtime": "^6.26.0",
	"babel-template": "^6.26.0",
	"babel-traverse": "^6.26.0",
	"babel-types": "^6.26.0",
	"lodash": "^4.17.4"
	}
	},
	"babel-plugin-transform-es2015-classes": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-classes/-/babel-plugin-transform-es2015-classes-6.24.1.tgz",
	"integrity": "sha1-WkxYpQyclGHlZLSyo7+ryXolhNs=",
	"requires": {
	"babel-helper-define-map": "^6.24.1",
	"babel-helper-function-name": "^6.24.1",
	"babel-helper-optimise-call-expression": "^6.24.1",
	"babel-helper-replace-supers": "^6.24.1",
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-computed-properties": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-computed-properties/-/babel-plugin-transform-es2015-computed-properties-6.24.1.tgz",
	"integrity": "sha1-b+Ko0WiV1WNPTNmZttNICjCBWbM=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-destructuring": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz",
	"integrity": "sha1-mXux8auWf2gtKwh2/jWNYOdlxW0=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-duplicate-keys": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-duplicate-keys/-/babel-plugin-transform-es2015-duplicate-keys-6.24.1.tgz",
	"integrity": "sha1-c+s9MQypaePvnskcU3QabxV2Qj4=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-for-of": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-for-of/-/babel-plugin-transform-es2015-for-of-6.23.0.tgz",
	"integrity": "sha1-9HyVsrYT3x0+zC/bdXNiPHUkhpE=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-function-name": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz",
	"integrity": "sha1-g0yJhTvDaxrw86TF26qU/Y6sqos=",
	"requires": {
	"babel-helper-function-name": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-literals": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-literals/-/babel-plugin-transform-es2015-literals-6.22.0.tgz",
	"integrity": "sha1-T1SgLWzWbPkVKAAZox0xklN3yi4=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-modules-amd": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-amd/-/babel-plugin-transform-es2015-modules-amd-6.24.1.tgz",
	"integrity": "sha1-Oz5UAXI5hC1tGcMBHEvS8AoA0VQ=",
	"requires": {
	"babel-plugin-transform-es2015-modules-commonjs": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-modules-commonjs": {
	"version": "6.26.2",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.2.tgz",
	"integrity": "sha512-CV9ROOHEdrjcwhIaJNBGMBCodN+1cfkwtM1SbUHmvyy35KGT7fohbpOxkE2uLz1o6odKK2Ck/tz47z+VqQfi9Q==",
	"requires": {
	"babel-plugin-transform-strict-mode": "^6.24.1",
	"babel-runtime": "^6.26.0",
	"babel-template": "^6.26.0",
	"babel-types": "^6.26.0"
	}
	},
	"babel-plugin-transform-es2015-modules-systemjs": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-systemjs/-/babel-plugin-transform-es2015-modules-systemjs-6.24.1.tgz",
	"integrity": "sha1-/4mhQrkRmpBhlfXxBuzzBdlAfSM=",
	"requires": {
	"babel-helper-hoist-variables": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-modules-umd": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-modules-umd/-/babel-plugin-transform-es2015-modules-umd-6.24.1.tgz",
	"integrity": "sha1-rJl+YoXNGO1hdq22B9YCNErThGg=",
	"requires": {
	"babel-plugin-transform-es2015-modules-amd": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-object-super": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-object-super/-/babel-plugin-transform-es2015-object-super-6.24.1.tgz",
	"integrity": "sha1-JM72muIcuDp/hgPa0CH1cusnj40=",
	"requires": {
	"babel-helper-replace-supers": "^6.24.1",
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-parameters": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz",
	"integrity": "sha1-V6w1GrScrxSpfNE7CfZv3wpiXys=",
	"requires": {
	"babel-helper-call-delegate": "^6.24.1",
	"babel-helper-get-function-arity": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-template": "^6.24.1",
	"babel-traverse": "^6.24.1",
	"babel-types": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-shorthand-properties": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-shorthand-properties/-/babel-plugin-transform-es2015-shorthand-properties-6.24.1.tgz",
	"integrity": "sha1-JPh11nIch2YbvZmkYi5R8U3jiqA=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-spread": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz",
	"integrity": "sha1-1taKmfia7cRTbIGlQujdnxdG+NE=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-sticky-regex": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz",
	"integrity": "sha1-AMHNsaynERLN8M9hJsLta0V8zbw=",
	"requires": {
	"babel-helper-regex": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-plugin-transform-es2015-template-literals": {
	"version": "6.22.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-template-literals/-/babel-plugin-transform-es2015-template-literals-6.22.0.tgz",
	"integrity": "sha1-qEs0UPfp+PH2g51taH2oS7EjbY0=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-typeof-symbol": {
	"version": "6.23.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-typeof-symbol/-/babel-plugin-transform-es2015-typeof-symbol-6.23.0.tgz",
	"integrity": "sha1-3sCfHN3/lLUqxz1QXITfWdzOs3I=",
	"requires": {
	"babel-runtime": "^6.22.0"
	}
	},
	"babel-plugin-transform-es2015-unicode-regex": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz",
	"integrity": "sha1-04sS9C6nMj9yk4fxinxa4frrNek=",
	"requires": {
	"babel-helper-regex": "^6.24.1",
	"babel-runtime": "^6.22.0",
	"regexpu-core": "^2.0.0"
	}
	},
	"babel-plugin-transform-regenerator": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.26.0.tgz",
	"integrity": "sha1-4HA2lvveJ/Cj78rPi03KL3s6jy8=",
	"requires": {
	"regenerator-transform": "^0.10.0"
	}
	},
	"babel-plugin-transform-strict-mode": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz",
	"integrity": "sha1-1fr3qleKZbvlkc9e2uBKDGcCB1g=",
	"requires": {
	"babel-runtime": "^6.22.0",
	"babel-types": "^6.24.1"
	}
	},
	"babel-preset-es2015": {
	"version": "6.24.1",
	"resolved": "https://registry.npmjs.org/babel-preset-es2015/-/babel-preset-es2015-6.24.1.tgz",
	"integrity": "sha1-1EBQ1rwsn+6nAqrzjXJ6AhBTiTk=",
	"requires": {
	"babel-plugin-check-es2015-constants": "^6.22.0",
	"babel-plugin-transform-es2015-arrow-functions": "^6.22.0",
	"babel-plugin-transform-es2015-block-scoped-functions": "^6.22.0",
	"babel-plugin-transform-es2015-block-scoping": "^6.24.1",
	"babel-plugin-transform-es2015-classes": "^6.24.1",
	"babel-plugin-transform-es2015-computed-properties": "^6.24.1",
	"babel-plugin-transform-es2015-destructuring": "^6.22.0",
	"babel-plugin-transform-es2015-duplicate-keys": "^6.24.1",
	"babel-plugin-transform-es2015-for-of": "^6.22.0",
	"babel-plugin-transform-es2015-function-name": "^6.24.1",
	"babel-plugin-transform-es2015-literals": "^6.22.0",
	"babel-plugin-transform-es2015-modules-amd": "^6.24.1",
	"babel-plugin-transform-es2015-modules-commonjs": "^6.24.1",
	"babel-plugin-transform-es2015-modules-systemjs": "^6.24.1",
	"babel-plugin-transform-es2015-modules-umd": "^6.24.1",
	"babel-plugin-transform-es2015-object-super": "^6.24.1",
	"babel-plugin-transform-es2015-parameters": "^6.24.1",
	"babel-plugin-transform-es2015-shorthand-properties": "^6.24.1",
	"babel-plugin-transform-es2015-spread": "^6.22.0",
	"babel-plugin-transform-es2015-sticky-regex": "^6.24.1",
	"babel-plugin-transform-es2015-template-literals": "^6.22.0",
	"babel-plugin-transform-es2015-typeof-symbol": "^6.22.0",
	"babel-plugin-transform-es2015-unicode-regex": "^6.24.1",
	"babel-plugin-transform-regenerator": "^6.24.1"
	}
	},
	"babel-register": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-register/-/babel-register-6.26.0.tgz",
	"integrity": "sha1-btAhFz4vy0htestFxgCahW9kcHE=",
	"requires": {
	"babel-core": "^6.26.0",
	"babel-runtime": "^6.26.0",
	"core-js": "^2.5.0",
	"home-or-tmp": "^2.0.0",
	"lodash": "^4.17.4",
	"mkdirp": "^0.5.1",
	"source-map-support": "^0.4.15"
	},
	"dependencies": {
	"source-map-support": {
	"version": "0.4.18",
	"resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.4.18.tgz",
	"integrity": "sha512-try0/JqxPLF9nOjvSta7tVondkP5dwgyLDjVoyMDlmjugT2lRZ1OfsrYTkCd2hkDnJTKRbO/Rl3orm8vlsUzbA==",
	"requires": {
	"source-map": "^0.5.6"
	}
	}
	}
	},
	"babel-runtime": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-runtime/-/babel-runtime-6.26.0.tgz",
	"integrity": "sha1-llxwWGaOgrVde/4E/yM3vItWR/4=",
	"requires": {
	"core-js": "^2.4.0",
	"regenerator-runtime": "^0.11.0"
	}
	},
	"babel-template": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-template/-/babel-template-6.26.0.tgz",
	"integrity": "sha1-3gPi0WOWsGn0bdn/+FIfsaDjXgI=",
	"requires": {
	"babel-runtime": "^6.26.0",
	"babel-traverse": "^6.26.0",
	"babel-types": "^6.26.0",
	"babylon": "^6.18.0",
	"lodash": "^4.17.4"
	}
	},
	"babel-traverse": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-traverse/-/babel-traverse-6.26.0.tgz",
	"integrity": "sha1-RqnL1+3MYsjlwGTi0tjQ9ANXZu4=",
	"requires": {
	"babel-code-frame": "^6.26.0",
	"babel-messages": "^6.23.0",
	"babel-runtime": "^6.26.0",
	"babel-types": "^6.26.0",
	"babylon": "^6.18.0",
	"debug": "^2.6.8",
	"globals": "^9.18.0",
	"invariant": "^2.2.2",
	"lodash": "^4.17.4"
	}
	},
	"babel-types": {
	"version": "6.26.0",
	"resolved": "https://registry.npmjs.org/babel-types/-/babel-types-6.26.0.tgz",
	"integrity": "sha1-o7Bz+Uq0nrb6Vc1lInozQ4BjJJc=",
	"requires": {
	"babel-runtime": "^6.26.0",
	"esutils": "^2.0.2",
	"lodash": "^4.17.4",
	"to-fast-properties": "^1.0.3"
	}
	},
	"babylon": {
	"version": "6.18.0",
	"resolved": "https://registry.npmjs.org/babylon/-/babylon-6.18.0.tgz",
	"integrity": "sha512-q/UEjfGJ2Cm3oKV71DJz9d25TPnq5rhBVL2Q4fA5wcC3jcrdn7+SssEybFIxwAvvP+YCsCYNKughoF33GxgycQ=="
	},
	"balanced-match": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz",
	"integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c="
	},
	"base": {
	"version": "0.11.2",
	"resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz",
	"integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==",
	"requires": {
	"cache-base": "^1.0.1",
	"class-utils": "^0.3.5",
	"component-emitter": "^1.2.1",
	"define-property": "^1.0.0",
	"isobject": "^3.0.1",
	"mixin-deep": "^1.2.0",
	"pascalcase": "^0.1.1"
	},
	"dependencies": {
	"define-property": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
	"integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
	"requires": {
	"is-descriptor": "^1.0.0"
	}
	},
	"is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"requires": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	}
	}
	}
	},
	"base64-js": {
	"version": "1.3.1",
	"resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.1.tgz",
	"integrity": "sha512-mLQ4i2QO1ytvGWFWmcngKO//JXAQueZvwEKtjgQFM4jIK0kU+ytMfplL8j+n5mspOfjHwoAg+9yhb7BwAHm36g=="
	},
	"big.js": {
	"version": "5.2.2",
	"resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz",
	"integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ=="
	},
	"binary-extensions": {
	"version": "1.13.1",
	"resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz",
	"integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw=="
	},
	"bindings": {
	"version": "1.5.0",
	"resolved": "https://registry.npmjs.org/bindings/-/bindings-1.5.0.tgz",
	"integrity": "sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==",
	"optional": true,
	"requires": {
	"file-uri-to-path": "1.0.0"
	}
	},
	"bluebird": {
	"version": "3.7.2",
	"resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.7.2.tgz",
	"integrity": "sha512-XpNj6GDQzdfW+r2Wnn7xiSAd7TM3jzkxGXBGTtWKuSXv1xUV+azxAm8jdWZN06QTQk+2N2XB9jRDkvbmQmcRtg=="
	},
	"bn.js": {
	"version": "4.11.8",
	"resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.8.tgz",
	"integrity": "sha512-ItfYfPLkWHUjckQCk8xC+LwxgK8NYcXywGigJgSwOP8Y2iyWT4f2vsZnoOXTTbo+o5yXmIUJ4gn5538SO5S3gA=="
	},
	"brace-expansion": {
	"version": "1.1.11",
	"resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
	"integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
	"requires": {
	"balanced-match": "^1.0.0",
	"concat-map": "0.0.1"
	}
	},
	"braces": {
	"version": "2.3.2",
	"resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz",
	"integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==",
	"requires": {
	"arr-flatten": "^1.1.0",
	"array-unique": "^0.3.2",
	"extend-shallow": "^2.0.1",
	"fill-range": "^4.0.0",
	"isobject": "^3.0.1",
	"repeat-element": "^1.1.2",
	"snapdragon": "^0.8.1",
	"snapdragon-node": "^2.0.1",
	"split-string": "^3.0.2",
	"to-regex": "^3.0.1"
	},
	"dependencies": {
	"extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"requires": {
	"is-extendable": "^0.1.0"
	}
	}
	}
	},
	"brorand": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz",
	"integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8="
	},
	"browserify-aes": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz",
	"integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==",
	"requires": {
	"buffer-xor": "^1.0.3",
	"cipher-base": "^1.0.0",
	"create-hash": "^1.1.0",
	"evp_bytestokey": "^1.0.3",
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	}
	},
	"browserify-cipher": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz",
	"integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==",
	"requires": {
	"browserify-aes": "^1.0.4",
	"browserify-des": "^1.0.0",
	"evp_bytestokey": "^1.0.0"
	}
	},
	"browserify-des": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz",
	"integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==",
	"requires": {
	"cipher-base": "^1.0.1",
	"des.js": "^1.0.0",
	"inherits": "^2.0.1",
	"safe-buffer": "^5.1.2"
	}
	},
	"browserify-rsa": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz",
	"integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=",
	"requires": {
	"bn.js": "^4.1.0",
	"randombytes": "^2.0.1"
	}
	},
	"browserify-sign": {
	"version": "4.0.4",
	"resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.0.4.tgz",
	"integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=",
	"requires": {
	"bn.js": "^4.1.1",
	"browserify-rsa": "^4.0.0",
	"create-hash": "^1.1.0",
	"create-hmac": "^1.1.2",
	"elliptic": "^6.0.0",
	"inherits": "^2.0.1",
	"parse-asn1": "^5.0.0"
	}
	},
	"browserify-zlib": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz",
	"integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==",
	"requires": {
	"pako": "~1.0.5"
	}
	},
	"browserslist": {
	"version": "4.14.1",
	"resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.14.1.tgz",
	"integrity": "sha512-zyBTIHydW37pnb63c7fHFXUG6EcqWOqoMdDx6cdyaDFriZ20EoVxcE95S54N+heRqY8m8IUgB5zYta/gCwSaaA==",
	"dev": true,
	"requires": {
	"caniuse-lite": "^1.0.30001124",
	"electron-to-chromium": "^1.3.562",
	"escalade": "^3.0.2",
	"node-releases": "^1.1.60"
	}
	},
	"buffer": {
	"version": "4.9.2",
	"resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz",
	"integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==",
	"requires": {
	"base64-js": "^1.0.2",
	"ieee754": "^1.1.4",
	"isarray": "^1.0.0"
	}
	},
	"buffer-from": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz",
	"integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A=="
	},
	"buffer-xor": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz",
	"integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk="
	},
	"builtin-status-codes": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz",
	"integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug="
	},
	"cacache": {
	"version": "12.0.3",
	"resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.3.tgz",
	"integrity": "sha512-kqdmfXEGFepesTuROHMs3MpFLWrPkSSpRqOw80RCflZXy/khxaArvFrQ7uJxSUduzAufc6G0g1VUCOZXxWavPw==",
	"requires": {
	"bluebird": "^3.5.5",
	"chownr": "^1.1.1",
	"figgy-pudding": "^3.5.1",
	"glob": "^7.1.4",
	"graceful-fs": "^4.1.15",
	"infer-owner": "^1.0.3",
	"lru-cache": "^5.1.1",
	"mississippi": "^3.0.0",
	"mkdirp": "^0.5.1",
	"move-concurrently": "^1.0.1",
	"promise-inflight": "^1.0.1",
	"rimraf": "^2.6.3",
	"ssri": "^6.0.1",
	"unique-filename": "^1.1.1",
	"y18n": "^4.0.0"
	}
	},
	"cache-base": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz",
	"integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==",
	"requires": {
	"collection-visit": "^1.0.0",
	"component-emitter": "^1.2.1",
	"get-value": "^2.0.6",
	"has-value": "^1.0.0",
	"isobject": "^3.0.1",
	"set-value": "^2.0.0",
	"to-object-path": "^0.3.0",
	"union-value": "^1.0.0",
	"unset-value": "^1.0.0"
	}
	},
	"camelcase": {
	"version": "5.3.1",
	"resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz",
	"integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg=="
	},
	"caniuse-lite": {
	"version": "1.0.30001125",
	"resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001125.tgz",
	"integrity": "sha512-9f+r7BW8Qli917mU3j0fUaTweT3f3vnX/Lcs+1C73V+RADmFme+Ih0Br8vONQi3X0lseOe6ZHfsZLCA8MSjxUA==",
	"dev": true
	},
	"chalk": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
	"integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
	"requires": {
	"ansi-styles": "^2.2.1",
	"escape-string-regexp": "^1.0.2",
	"has-ansi": "^2.0.0",
	"strip-ansi": "^3.0.0",
	"supports-color": "^2.0.0"
	}
	},
	"chokidar": {
	"version": "2.1.8",
	"resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz",
	"integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==",
	"requires": {
	"anymatch": "^2.0.0",
	"async-each": "^1.0.1",
	"braces": "^2.3.2",
	"fsevents": "^1.2.7",
	"glob-parent": "^3.1.0",
	"inherits": "^2.0.3",
	"is-binary-path": "^1.0.0",
	"is-glob": "^4.0.0",
	"normalize-path": "^3.0.0",
	"path-is-absolute": "^1.0.0",
	"readdirp": "^2.2.1",
	"upath": "^1.1.1"
	}
	},
	"chownr": {
	"version": "1.1.4",
	"resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.4.tgz",
	"integrity": "sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg=="
	},
	"chrome-trace-event": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-1.0.2.tgz",
	"integrity": "sha512-9e/zx1jw7B4CO+c/RXoCsfg/x1AfUBioy4owYH0bJprEYAx5hRFLRhWBqHAG57D0ZM4H7vxbP7bPe0VwhQRYDQ==",
	"requires": {
	"tslib": "^1.9.0"
	}
	},
	"cipher-base": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz",
	"integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==",
	"requires": {
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	}
	},
	"class-utils": {
	"version": "0.3.6",
	"resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz",
	"integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==",
	"requires": {
	"arr-union": "^3.1.0",
	"define-property": "^0.2.5",
	"isobject": "^3.0.0",
	"static-extend": "^0.1.1"
	},
	"dependencies": {
	"define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"requires": {
	"is-descriptor": "^0.1.0"
	}
	}
	}
	},
	"cliui": {
	"version": "5.0.0",
	"resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz",
	"integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==",
	"requires": {
	"string-width": "^3.1.0",
	"strip-ansi": "^5.2.0",
	"wrap-ansi": "^5.1.0"
	},
	"dependencies": {
	"ansi-regex": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz",
	"integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg=="
	},
	"strip-ansi": {
	"version": "5.2.0",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz",
	"integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==",
	"requires": {
	"ansi-regex": "^4.1.0"
	}
	}
	}
	},
	"collection-visit": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz",
	"integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=",
	"requires": {
	"map-visit": "^1.0.0",
	"object-visit": "^1.0.0"
	}
	},
	"color-convert": {
	"version": "1.9.3",
	"resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz",
	"integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==",
	"requires": {
	"color-name": "1.1.3"
	}
	},
	"color-name": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz",
	"integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU="
	},
	"commander": {
	"version": "2.20.3",
	"resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz",
	"integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ=="
	},
	"commondir": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz",
	"integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs="
	},
	"component-emitter": {
	"version": "1.3.0",
	"resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz",
	"integrity": "sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg=="
	},
	"concat-map": {
	"version": "0.0.1",
	"resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
	"integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s="
	},
	"concat-stream": {
	"version": "1.6.2",
	"resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz",
	"integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==",
	"requires": {
	"buffer-from": "^1.0.0",
	"inherits": "^2.0.3",
	"readable-stream": "^2.2.2",
	"typedarray": "^0.0.6"
	}
	},
	"console-browserify": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz",
	"integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA=="
	},
	"constants-browserify": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz",
	"integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U="
	},
	"convert-source-map": {
	"version": "1.7.0",
	"resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz",
	"integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==",
	"requires": {
	"safe-buffer": "~5.1.1"
	}
	},
	"copy-concurrently": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz",
	"integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==",
	"requires": {
	"aproba": "^1.1.1",
	"fs-write-stream-atomic": "^1.0.8",
	"iferr": "^0.1.5",
	"mkdirp": "^0.5.1",
	"rimraf": "^2.5.4",
	"run-queue": "^1.0.0"
	}
	},
	"copy-descriptor": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz",
	"integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40="
	},
	"core-js": {
	"version": "2.6.11",
	"resolved": "https://registry.npmjs.org/core-js/-/core-js-2.6.11.tgz",
	"integrity": "sha512-5wjnpaT/3dV+XB4borEsnAYQchn00XSgTAWKDkEqv+K8KevjbzmofK6hfJ9TZIlpj2N0xQpazy7PiRQiWHqzWg=="
	},
	"core-js-compat": {
	"version": "3.6.5",
	"resolved": "https://registry.npmjs.org/core-js-compat/-/core-js-compat-3.6.5.tgz",
	"integrity": "sha512-7ItTKOhOZbznhXAQ2g/slGg1PJV5zDO/WdkTwi7UEOJmkvsE32PWvx6mKtDjiMpjnR2CNf6BAD6sSxIlv7ptng==",
	"dev": true,
	"requires": {
	"browserslist": "^4.8.5",
	"semver": "7.0.0"
	},
	"dependencies": {
	"semver": {
	"version": "7.0.0",
	"resolved": "https://registry.npmjs.org/semver/-/semver-7.0.0.tgz",
	"integrity": "sha512-+GB6zVA9LWh6zovYQLALHwv5rb2PHGlJi3lfiqIHxR0uuwCgefcOJc59v9fv1w8GbStwxuuqqAjI9NMAOOgq1A==",
	"dev": true
	}
	}
	},
	"core-util-is": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
	"integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac="
	},
	"create-ecdh": {
	"version": "4.0.3",
	"resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.3.tgz",
	"integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==",
	"requires": {
	"bn.js": "^4.1.0",
	"elliptic": "^6.0.0"
	}
	},
	"create-hash": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz",
	"integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==",
	"requires": {
	"cipher-base": "^1.0.1",
	"inherits": "^2.0.1",
	"md5.js": "^1.3.4",
	"ripemd160": "^2.0.1",
	"sha.js": "^2.4.0"
	}
	},
	"create-hmac": {
	"version": "1.1.7",
	"resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz",
	"integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==",
	"requires": {
	"cipher-base": "^1.0.3",
	"create-hash": "^1.1.0",
	"inherits": "^2.0.1",
	"ripemd160": "^2.0.0",
	"safe-buffer": "^5.0.1",
	"sha.js": "^2.4.8"
	}
	},
	"crel": {
	"version": "4.2.0",
	"resolved": "https://registry.npmjs.org/crel/-/crel-4.2.0.tgz",
	"integrity": "sha512-ZBVhTmtapdjEn8rTcTR/ePE0JSNfHzZfDkD3eAnsQEBmkQW9r14mzq6tK5Hkw6r26l7XxlU2Ox1nfHsmGIj0zQ=="
	},
	"cross-spawn": {
	"version": "6.0.5",
	"resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz",
	"integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==",
	"requires": {
	"nice-try": "^1.0.4",
	"path-key": "^2.0.1",
	"semver": "^5.5.0",
	"shebang-command": "^1.2.0",
	"which": "^1.2.9"
	}
	},
	"crypto-browserify": {
	"version": "3.12.0",
	"resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz",
	"integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==",
	"requires": {
	"browserify-cipher": "^1.0.0",
	"browserify-sign": "^4.0.0",
	"create-ecdh": "^4.0.0",
	"create-hash": "^1.1.0",
	"create-hmac": "^1.1.0",
	"diffie-hellman": "^5.0.0",
	"inherits": "^2.0.1",
	"pbkdf2": "^3.0.3",
	"public-encrypt": "^4.0.0",
	"randombytes": "^2.0.0",
	"randomfill": "^1.0.3"
	}
	},
	"cyclist": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz",
	"integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk="
	},
	"debug": {
	"version": "2.6.9",
	"resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
	"integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
	"requires": {
	"ms": "2.0.0"
	}
	},
	"decamelize": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz",
	"integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA="
	},
	"decode-uri-component": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz",
	"integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU="
	},
	"define-properties": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz",
	"integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==",
	"dev": true,
	"requires": {
	"object-keys": "^1.0.12"
	}
	},
	"define-property": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz",
	"integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==",
	"requires": {
	"is-descriptor": "^1.0.2",
	"isobject": "^3.0.1"
	},
	"dependencies": {
	"is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"requires": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	}
	}
	}
	},
	"des.js": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz",
	"integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==",
	"requires": {
	"inherits": "^2.0.1",
	"minimalistic-assert": "^1.0.0"
	}
	},
	"detect-file": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/detect-file/-/detect-file-1.0.0.tgz",
	"integrity": "sha1-8NZtA2cqglyxtzvbP+YjEMjlUrc="
	},
	"detect-indent": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/detect-indent/-/detect-indent-4.0.0.tgz",
	"integrity": "sha1-920GQ1LN9Docts5hnE7jqUdd4gg=",
	"requires": {
	"repeating": "^2.0.0"
	}
	},
	"diffie-hellman": {
	"version": "5.0.3",
	"resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz",
	"integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==",
	"requires": {
	"bn.js": "^4.1.0",
	"miller-rabin": "^4.0.0",
	"randombytes": "^2.0.0"
	}
	},
	"domain-browser": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz",
	"integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA=="
	},
	"duplexify": {
	"version": "3.7.1",
	"resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz",
	"integrity": "sha512-07z8uv2wMyS51kKhD1KsdXJg5WQ6t93RneqRxUHnskXVtlYYkLqM0gqStQZ3pj073g687jPCHrqNfCzawLYh5g==",
	"requires": {
	"end-of-stream": "^1.0.0",
	"inherits": "^2.0.1",
	"readable-stream": "^2.0.0",
	"stream-shift": "^1.0.0"
	}
	},
	"electron-to-chromium": {
	"version": "1.3.564",
	"resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.564.tgz",
	"integrity": "sha512-fNaYN3EtKQWLQsrKXui8mzcryJXuA0LbCLoizeX6oayG2emBaS5MauKjCPAvc29NEY4FpLHIUWiP+Y0Bfrs5dg==",
	"dev": true
	},
	"elliptic": {
	"version": "6.5.2",
	"resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.2.tgz",
	"integrity": "sha512-f4x70okzZbIQl/NSRLkI/+tteV/9WqL98zx+SQ69KbXxmVrmjwsNUPn/gYJJ0sHvEak24cZgHIPegRePAtA/xw==",
	"requires": {
	"bn.js": "^4.4.0",
	"brorand": "^1.0.1",
	"hash.js": "^1.0.0",
	"hmac-drbg": "^1.0.0",
	"inherits": "^2.0.1",
	"minimalistic-assert": "^1.0.0",
	"minimalistic-crypto-utils": "^1.0.0"
	}
	},
	"emoji-regex": {
	"version": "7.0.3",
	"resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz",
	"integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA=="
	},
	"emojis-list": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-3.0.0.tgz",
	"integrity": "sha512-/kyM18EfinwXZbno9FyUGeFh87KC8HRQBQGildHZbEuRyWFOmv1U10o9BBp8XVZDVNNuQKyIGIu5ZYAAXJ0V2Q=="
	},
	"end-of-stream": {
	"version": "1.4.4",
	"resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz",
	"integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==",
	"requires": {
	"once": "^1.4.0"
	}
	},
	"enhanced-resolve": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.1.tgz",
	"integrity": "sha512-98p2zE+rL7/g/DzMHMTF4zZlCgeVdJ7yr6xzEpJRYwFYrGi9ANdn5DnJURg6RpBkyk60XYDnWIv51VfIhfNGuA==",
	"requires": {
	"graceful-fs": "^4.1.2",
	"memory-fs": "^0.5.0",
	"tapable": "^1.0.0"
	},
	"dependencies": {
	"memory-fs": {
	"version": "0.5.0",
	"resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.5.0.tgz",
	"integrity": "sha512-jA0rdU5KoQMC0e6ppoNRtpp6vjFq6+NY7r8hywnC7V+1Xj/MtHwGIbB1QaK/dunyjWteJzmkpd7ooeWg10T7GA==",
	"requires": {
	"errno": "^0.1.3",
	"readable-stream": "^2.0.1"
	}
	}
	}
	},
	"entities": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/entities/-/entities-2.1.0.tgz",
	"integrity": "sha512-hCx1oky9PFrJ611mf0ifBLBRW8lUUVRlFolb5gWRfIELabBlbp9xZvrqZLZAs+NxFnbfQoeGd8wDkygjg7U85w=="
	},
	"errno": {
	"version": "0.1.7",
	"resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz",
	"integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==",
	"requires": {
	"prr": "~1.0.1"
	}
	},
	"escalade": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/escalade/-/escalade-3.0.2.tgz",
	"integrity": "sha512-gPYAU37hYCUhW5euPeR+Y74F7BL+IBsV93j5cvGriSaD1aG6MGsqsV1yamRdrWrb2j3aiZvb0X+UBOWpx3JWtQ==",
	"dev": true
	},
	"escape-string-regexp": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz",
	"integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ="
	},
	"eslint-scope": {
	"version": "4.0.3",
	"resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-4.0.3.tgz",
	"integrity": "sha512-p7VutNr1O/QrxysMo3E45FjYDTeXBy0iTltPFNSqKAIfjDSXC+4dj+qfyuD8bfAXrW/y6lW3O76VaYNPKfpKrg==",
	"requires": {
	"esrecurse": "^4.1.0",
	"estraverse": "^4.1.1"
	}
	},
	"esrecurse": {
	"version": "4.2.1",
	"resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.2.1.tgz",
	"integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==",
	"requires": {
	"estraverse": "^4.1.0"
	}
	},
	"estraverse": {
	"version": "4.3.0",
	"resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.3.0.tgz",
	"integrity": "sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw=="
	},
	"esutils": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz",
	"integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g=="
	},
	"events": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/events/-/events-3.1.0.tgz",
	"integrity": "sha512-Rv+u8MLHNOdMjTAFeT3nCjHn2aGlx435FP/sDHNaRhDEMwyI/aB22Kj2qIN8R0cw3z28psEQLYwxVKLsKrMgWg=="
	},
	"evp_bytestokey": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz",
	"integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==",
	"requires": {
	"md5.js": "^1.3.4",
	"safe-buffer": "^5.1.1"
	}
	},
	"execa": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/execa/-/execa-1.0.0.tgz",
	"integrity": "sha512-adbxcyWV46qiHyvSp50TKt05tB4tK3HcmF7/nxfAdhnox83seTDbwnaqKO4sXRy7roHAIFqJP/Rw/AuEbX61LA==",
	"requires": {
	"cross-spawn": "^6.0.0",
	"get-stream": "^4.0.0",
	"is-stream": "^1.1.0",
	"npm-run-path": "^2.0.0",
	"p-finally": "^1.0.0",
	"signal-exit": "^3.0.0",
	"strip-eof": "^1.0.0"
	}
	},
	"expand-brackets": {
	"version": "2.1.4",
	"resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz",
	"integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=",
	"requires": {
	"debug": "^2.3.3",
	"define-property": "^0.2.5",
	"extend-shallow": "^2.0.1",
	"posix-character-classes": "^0.1.0",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.1"
	},
	"dependencies": {
	"define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"requires": {
	"is-descriptor": "^0.1.0"
	}
	},
	"extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"requires": {
	"is-extendable": "^0.1.0"
	}
	}
	}
	},
	"expand-tilde": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/expand-tilde/-/expand-tilde-2.0.2.tgz",
	"integrity": "sha1-l+gBqgUt8CRU3kawK/YhZCzchQI=",
	"requires": {
	"homedir-polyfill": "^1.0.1"
	}
	},
	"extend-shallow": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz",
	"integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=",
	"requires": {
	"assign-symbols": "^1.0.0",
	"is-extendable": "^1.0.1"
	},
	"dependencies": {
	"is-extendable": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
	"integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
	"requires": {
	"is-plain-object": "^2.0.4"
	}
	}
	}
	},
	"extglob": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz",
	"integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==",
	"requires": {
	"array-unique": "^0.3.2",
	"define-property": "^1.0.0",
	"expand-brackets": "^2.1.4",
	"extend-shallow": "^2.0.1",
	"fragment-cache": "^0.2.1",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.1"
	},
	"dependencies": {
	"define-property": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
	"integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
	"requires": {
	"is-descriptor": "^1.0.0"
	}
	},
	"extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"requires": {
	"is-extendable": "^0.1.0"
	}
	},
	"is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"requires": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	}
	}
	}
	},
	"fast-deep-equal": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.1.tgz",
	"integrity": "sha512-8UEa58QDLauDNfpbrX55Q9jrGHThw2ZMdOky5Gl1CDtVeJDPVrG4Jxx1N8jw2gkWaff5UUuX1KJd+9zGe2B+ZA=="
	},
	"fast-json-stable-stringify": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz",
	"integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw=="
	},
	"figgy-pudding": {
	"version": "3.5.1",
	"resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.1.tgz",
	"integrity": "sha512-vNKxJHTEKNThjfrdJwHc7brvM6eVevuO5nTj6ez8ZQ1qbXTvGthucRF7S4vf2cr71QVnT70V34v0S1DyQsti0w=="
	},
	"file-uri-to-path": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz",
	"integrity": "sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==",
	"optional": true
	},
	"fill-range": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz",
	"integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=",
	"requires": {
	"extend-shallow": "^2.0.1",
	"is-number": "^3.0.0",
	"repeat-string": "^1.6.1",
	"to-regex-range": "^2.1.0"
	},
	"dependencies": {
	"extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"requires": {
	"is-extendable": "^0.1.0"
	}
	}
	}
	},
	"find-cache-dir": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz",
	"integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==",
	"requires": {
	"commondir": "^1.0.1",
	"make-dir": "^2.0.0",
	"pkg-dir": "^3.0.0"
	}
	},
	"find-up": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz",
	"integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==",
	"requires": {
	"locate-path": "^3.0.0"
	}
	},
	"findup-sync": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/findup-sync/-/findup-sync-3.0.0.tgz",
	"integrity": "sha512-YbffarhcicEhOrm4CtrwdKBdCuz576RLdhJDsIfvNtxUuhdRet1qZcsMjqbePtAseKdAnDyM/IyXbu7PRPRLYg==",
	"requires": {
	"detect-file": "^1.0.0",
	"is-glob": "^4.0.0",
	"micromatch": "^3.0.4",
	"resolve-dir": "^1.0.1"
	}
	},
	"flush-write-stream": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.1.1.tgz",
	"integrity": "sha512-3Z4XhFZ3992uIq0XOqb9AreonueSYphE6oYbpt5+3u06JWklbsPkNv3ZKkP9Bz/r+1MWCaMoSQ28P85+1Yc77w==",
	"requires": {
	"inherits": "^2.0.3",
	"readable-stream": "^2.3.6"
	}
	},
	"for-in": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz",
	"integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA="
	},
	"fragment-cache": {
	"version": "0.2.1",
	"resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz",
	"integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=",
	"requires": {
	"map-cache": "^0.2.2"
	}
	},
	"from2": {
	"version": "2.3.0",
	"resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz",
	"integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=",
	"requires": {
	"inherits": "^2.0.1",
	"readable-stream": "^2.0.0"
	}
	},
	"fs-write-stream-atomic": {
	"version": "1.0.10",
	"resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz",
	"integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=",
	"requires": {
	"graceful-fs": "^4.1.2",
	"iferr": "^0.1.5",
	"imurmurhash": "^0.1.4",
	"readable-stream": "1 \|\| 2"
	}
	},
	"fs.realpath": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
	"integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8="
	},
	"fsevents": {
	"version": "1.2.11",
	"resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.11.tgz",
	"integrity": "sha512-+ux3lx6peh0BpvY0JebGyZoiR4D+oYzdPZMKJwkZ+sFkNJzpL7tXc/wehS49gUAxg3tmMHPHZkA8JU2rhhgDHw==",
	"optional": true,
	"requires": {
	"bindings": "^1.5.0",
	"nan": "^2.12.1",
	"node-pre-gyp": "*"
	},
	"dependencies": {
	"abbrev": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz",
	"integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==",
	"bundled": true,
	"optional": true
	},
	"ansi-regex": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz",
	"integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=",
	"bundled": true,
	"optional": true
	},
	"aproba": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz",
	"integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==",
	"bundled": true,
	"optional": true
	},
	"are-we-there-yet": {
	"version": "1.1.5",
	"resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz",
	"integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==",
	"bundled": true,
	"optional": true,
	"requires": {
	"delegates": "^1.0.0",
	"readable-stream": "^2.0.6"
	}
	},
	"balanced-match": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz",
	"integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=",
	"bundled": true,
	"optional": true
	},
	"brace-expansion": {
	"version": "1.1.11",
	"resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
	"integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"balanced-match": "^1.0.0",
	"concat-map": "0.0.1"
	}
	},
	"chownr": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.3.tgz",
	"integrity": "sha512-i70fVHhmV3DtTl6nqvZOnIjbY0Pe4kAUjwHj8z0zAdgBtYrJyYwLKCCuRBQ5ppkyL0AkN7HKRnETdmdp1zqNXw==",
	"bundled": true,
	"optional": true
	},
	"code-point-at": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz",
	"integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=",
	"bundled": true,
	"optional": true
	},
	"concat-map": {
	"version": "0.0.1",
	"resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
	"integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=",
	"bundled": true,
	"optional": true
	},
	"console-control-strings": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz",
	"integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=",
	"bundled": true,
	"optional": true
	},
	"core-util-is": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
	"integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=",
	"bundled": true,
	"optional": true
	},
	"debug": {
	"version": "3.2.6",
	"resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz",
	"integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==",
	"bundled": true,
	"optional": true,
	"requires": {
	"ms": "^2.1.1"
	}
	},
	"deep-extend": {
	"version": "0.6.0",
	"resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz",
	"integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==",
	"bundled": true,
	"optional": true
	},
	"delegates": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz",
	"integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=",
	"bundled": true,
	"optional": true
	},
	"detect-libc": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-1.0.3.tgz",
	"integrity": "sha1-+hN8S9aY7fVc1c0CrFWfkaTEups=",
	"bundled": true,
	"optional": true
	},
	"fs-minipass": {
	"version": "1.2.7",
	"resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-1.2.7.tgz",
	"integrity": "sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"minipass": "^2.6.0"
	}
	},
	"fs.realpath": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
	"integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=",
	"bundled": true,
	"optional": true
	},
	"gauge": {
	"version": "2.7.4",
	"resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz",
	"integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=",
	"bundled": true,
	"optional": true,
	"requires": {
	"aproba": "^1.0.3",
	"console-control-strings": "^1.0.0",
	"has-unicode": "^2.0.0",
	"object-assign": "^4.1.0",
	"signal-exit": "^3.0.0",
	"string-width": "^1.0.1",
	"strip-ansi": "^3.0.1",
	"wide-align": "^1.1.0"
	}
	},
	"glob": {
	"version": "7.1.6",
	"resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz",
	"integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"fs.realpath": "^1.0.0",
	"inflight": "^1.0.4",
	"inherits": "2",
	"minimatch": "^3.0.4",
	"once": "^1.3.0",
	"path-is-absolute": "^1.0.0"
	}
	},
	"has-unicode": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz",
	"integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=",
	"bundled": true,
	"optional": true
	},
	"iconv-lite": {
	"version": "0.4.24",
	"resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz",
	"integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"safer-buffer": ">= 2.1.2 < 3"
	}
	},
	"ignore-walk": {
	"version": "3.0.3",
	"resolved": "https://registry.npmjs.org/ignore-walk/-/ignore-walk-3.0.3.tgz",
	"integrity": "sha512-m7o6xuOaT1aqheYHKf8W6J5pYH85ZI9w077erOzLje3JsB1gkafkAhHHY19dqjulgIZHFm32Cp5uNZgcQqdJKw==",
	"bundled": true,
	"optional": true,
	"requires": {
	"minimatch": "^3.0.4"
	}
	},
	"inflight": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
	"integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=",
	"bundled": true,
	"optional": true,
	"requires": {
	"once": "^1.3.0",
	"wrappy": "1"
	}
	},
	"inherits": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
	"integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==",
	"bundled": true,
	"optional": true
	},
	"ini": {
	"version": "1.3.5",
	"resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz",
	"integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==",
	"bundled": true,
	"optional": true
	},
	"is-fullwidth-code-point": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz",
	"integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=",
	"bundled": true,
	"optional": true,
	"requires": {
	"number-is-nan": "^1.0.0"
	}
	},
	"isarray": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
	"integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=",
	"bundled": true,
	"optional": true
	},
	"minimatch": {
	"version": "3.0.4",
	"resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
	"integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"brace-expansion": "^1.1.7"
	}
	},
	"minimist": {
	"version": "0.0.8",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
	"integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=",
	"bundled": true,
	"optional": true
	},
	"minipass": {
	"version": "2.9.0",
	"resolved": "https://registry.npmjs.org/minipass/-/minipass-2.9.0.tgz",
	"integrity": "sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==",
	"bundled": true,
	"optional": true,
	"requires": {
	"safe-buffer": "^5.1.2",
	"yallist": "^3.0.0"
	}
	},
	"minizlib": {
	"version": "1.3.3",
	"resolved": "https://registry.npmjs.org/minizlib/-/minizlib-1.3.3.tgz",
	"integrity": "sha512-6ZYMOEnmVsdCeTJVE0W9ZD+pVnE8h9Hma/iOwwRDsdQoePpoX56/8B6z3P9VNwppJuBKNRuFDRNRqRWexT9G9Q==",
	"bundled": true,
	"optional": true,
	"requires": {
	"minipass": "^2.9.0"
	}
	},
	"mkdirp": {
	"version": "0.5.1",
	"resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
	"integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
	"bundled": true,
	"optional": true,
	"requires": {
	"minimist": "0.0.8"
	}
	},
	"ms": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
	"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
	"bundled": true,
	"optional": true
	},
	"needle": {
	"version": "2.4.0",
	"resolved": "https://registry.npmjs.org/needle/-/needle-2.4.0.tgz",
	"integrity": "sha512-4Hnwzr3mi5L97hMYeNl8wRW/Onhy4nUKR/lVemJ8gJedxxUyBLm9kkrDColJvoSfwi0jCNhD+xCdOtiGDQiRZg==",
	"bundled": true,
	"optional": true,
	"requires": {
	"debug": "^3.2.6",
	"iconv-lite": "^0.4.4",
	"sax": "^1.2.4"
	}
	},
	"node-pre-gyp": {
	"version": "0.14.0",
	"resolved": "https://registry.npmjs.org/node-pre-gyp/-/node-pre-gyp-0.14.0.tgz",
	"integrity": "sha512-+CvDC7ZttU/sSt9rFjix/P05iS43qHCOOGzcr3Ry99bXG7VX953+vFyEuph/tfqoYu8dttBkE86JSKBO2OzcxA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"detect-libc": "^1.0.2",
	"mkdirp": "^0.5.1",
	"needle": "^2.2.1",
	"nopt": "^4.0.1",
	"npm-packlist": "^1.1.6",
	"npmlog": "^4.0.2",
	"rc": "^1.2.7",
	"rimraf": "^2.6.1",
	"semver": "^5.3.0",
	"tar": "^4.4.2"
	}
	},
	"nopt": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/nopt/-/nopt-4.0.1.tgz",
	"integrity": "sha1-0NRoWv1UFRk8jHUFYC0NF81kR00=",
	"bundled": true,
	"optional": true,
	"requires": {
	"abbrev": "1",
	"osenv": "^0.1.4"
	}
	},
	"npm-bundled": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/npm-bundled/-/npm-bundled-1.1.1.tgz",
	"integrity": "sha512-gqkfgGePhTpAEgUsGEgcq1rqPXA+tv/aVBlgEzfXwA1yiUJF7xtEt3CtVwOjNYQOVknDk0F20w58Fnm3EtG0fA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"npm-normalize-package-bin": "^1.0.1"
	}
	},
	"npm-normalize-package-bin": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/npm-normalize-package-bin/-/npm-normalize-package-bin-1.0.1.tgz",
	"integrity": "sha512-EPfafl6JL5/rU+ot6P3gRSCpPDW5VmIzX959Ob1+ySFUuuYHWHekXpwdUZcKP5C+DS4GEtdJluwBjnsNDl+fSA==",
	"bundled": true,
	"optional": true
	},
	"npm-packlist": {
	"version": "1.4.7",
	"resolved": "https://registry.npmjs.org/npm-packlist/-/npm-packlist-1.4.7.tgz",
	"integrity": "sha512-vAj7dIkp5NhieaGZxBJB8fF4R0078rqsmhJcAfXZ6O7JJhjhPK96n5Ry1oZcfLXgfun0GWTZPOxaEyqv8GBykQ==",
	"bundled": true,
	"optional": true,
	"requires": {
	"ignore-walk": "^3.0.1",
	"npm-bundled": "^1.0.1"
	}
	},
	"npmlog": {
	"version": "4.1.2",
	"resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz",
	"integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==",
	"bundled": true,
	"optional": true,
	"requires": {
	"are-we-there-yet": "~1.1.2",
	"console-control-strings": "~1.1.0",
	"gauge": "~2.7.3",
	"set-blocking": "~2.0.0"
	}
	},
	"number-is-nan": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz",
	"integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=",
	"bundled": true,
	"optional": true
	},
	"object-assign": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
	"integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=",
	"bundled": true,
	"optional": true
	},
	"once": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
	"integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=",
	"bundled": true,
	"optional": true,
	"requires": {
	"wrappy": "1"
	}
	},
	"os-homedir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz",
	"integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=",
	"bundled": true,
	"optional": true
	},
	"os-tmpdir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz",
	"integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=",
	"bundled": true,
	"optional": true
	},
	"osenv": {
	"version": "0.1.5",
	"resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz",
	"integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==",
	"bundled": true,
	"optional": true,
	"requires": {
	"os-homedir": "^1.0.0",
	"os-tmpdir": "^1.0.0"
	}
	},
	"path-is-absolute": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
	"integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=",
	"bundled": true,
	"optional": true
	},
	"process-nextick-args": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz",
	"integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==",
	"bundled": true,
	"optional": true
	},
	"rc": {
	"version": "1.2.8",
	"resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz",
	"integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==",
	"bundled": true,
	"optional": true,
	"requires": {
	"deep-extend": "^0.6.0",
	"ini": "~1.3.0",
	"minimist": "^1.2.0",
	"strip-json-comments": "~2.0.1"
	},
	"dependencies": {
	"minimist": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
	"integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
	"bundled": true,
	"optional": true
	}
	}
	},
	"readable-stream": {
	"version": "2.3.6",
	"resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz",
	"integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==",
	"bundled": true,
	"optional": true,
	"requires": {
	"core-util-is": "~1.0.0",
	"inherits": "~2.0.3",
	"isarray": "~1.0.0",
	"process-nextick-args": "~2.0.0",
	"safe-buffer": "~5.1.1",
	"string_decoder": "~1.1.1",
	"util-deprecate": "~1.0.1"
	}
	},
	"rimraf": {
	"version": "2.7.1",
	"resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz",
	"integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==",
	"bundled": true,
	"optional": true,
	"requires": {
	"glob": "^7.1.3"
	}
	},
	"safe-buffer": {
	"version": "5.1.2",
	"resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
	"integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==",
	"bundled": true,
	"optional": true
	},
	"safer-buffer": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
	"integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==",
	"bundled": true,
	"optional": true
	},
	"sax": {
	"version": "1.2.4",
	"resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz",
	"integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==",
	"bundled": true,
	"optional": true
	},
	"semver": {
	"version": "5.7.1",
	"resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz",
	"integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==",
	"bundled": true,
	"optional": true
	},
	"set-blocking": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz",
	"integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=",
	"bundled": true,
	"optional": true
	},
	"signal-exit": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz",
	"integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=",
	"bundled": true,
	"optional": true
	},
	"string_decoder": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
	"integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
	"bundled": true,
	"optional": true,
	"requires": {
	"safe-buffer": "~5.1.0"
	}
	},
	"string-width": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz",
	"integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=",
	"bundled": true,
	"optional": true,
	"requires": {
	"code-point-at": "^1.0.0",
	"is-fullwidth-code-point": "^1.0.0",
	"strip-ansi": "^3.0.0"
	}
	},
	"strip-ansi": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz",
	"integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=",
	"bundled": true,
	"optional": true,
	"requires": {
	"ansi-regex": "^2.0.0"
	}
	},
	"strip-json-comments": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz",
	"integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=",
	"bundled": true,
	"optional": true
	},
	"tar": {
	"version": "4.4.13",
	"resolved": "https://registry.npmjs.org/tar/-/tar-4.4.13.tgz",
	"integrity": "sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"chownr": "^1.1.1",
	"fs-minipass": "^1.2.5",
	"minipass": "^2.8.6",
	"minizlib": "^1.2.1",
	"mkdirp": "^0.5.0",
	"safe-buffer": "^5.1.2",
	"yallist": "^3.0.3"
	}
	},
	"util-deprecate": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
	"integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=",
	"bundled": true,
	"optional": true
	},
	"wide-align": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz",
	"integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==",
	"bundled": true,
	"optional": true,
	"requires": {
	"string-width": "^1.0.2 \|\| 2"
	}
	},
	"wrappy": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
	"integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=",
	"bundled": true,
	"optional": true
	},
	"yallist": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz",
	"integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==",
	"bundled": true,
	"optional": true
	}
	}
	},
	"function-bind": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz",
	"integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==",
	"dev": true
	},
	"gensync": {
	"version": "1.0.0-beta.1",
	"resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.1.tgz",
	"integrity": "sha512-r8EC6NO1sngH/zdD9fiRDLdcgnbayXah+mLgManTaIZJqEC1MZstmnox8KpnI2/fxQwrp5OpCOYWLp4rBl4Jcg==",
	"dev": true
	},
	"get-caller-file": {
	"version": "2.0.5",
	"resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz",
	"integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg=="
	},
	"get-stream": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz",
	"integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==",
	"requires": {
	"pump": "^3.0.0"
	}
	},
	"get-value": {
	"version": "2.0.6",
	"resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz",
	"integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg="
	},
	"glob": {
	"version": "7.1.6",
	"resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz",
	"integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==",
	"requires": {
	"fs.realpath": "^1.0.0",
	"inflight": "^1.0.4",
	"inherits": "2",
	"minimatch": "^3.0.4",
	"once": "^1.3.0",
	"path-is-absolute": "^1.0.0"
	}
	},
	"glob-parent": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz",
	"integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=",
	"requires": {
	"is-glob": "^3.1.0",
	"path-dirname": "^1.0.0"
	},
	"dependencies": {
	"is-glob": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz",
	"integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=",
	"requires": {
	"is-extglob": "^2.1.0"
	}
	}
	}
	},
	"global-modules": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz",
	"integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==",
	"requires": {
	"global-prefix": "^3.0.0"
	},
	"dependencies": {
	"global-prefix": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz",
	"integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==",
	"requires": {
	"ini": "^1.3.5",
	"kind-of": "^6.0.2",
	"which": "^1.3.1"
	}
	}
	}
	},
	"global-prefix": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-1.0.2.tgz",
	"integrity": "sha1-2/dDxsFJklk8ZVVoy2btMsASLr4=",
	"requires": {
	"expand-tilde": "^2.0.2",
	"homedir-polyfill": "^1.0.1",
	"ini": "^1.3.4",
	"is-windows": "^1.0.1",
	"which": "^1.2.14"
	}
	},
	"globals": {
	"version": "9.18.0",
	"resolved": "https://registry.npmjs.org/globals/-/globals-9.18.0.tgz",
	"integrity": "sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ=="
	},
	"graceful-fs": {
	"version": "4.2.3",
	"resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz",
	"integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ=="
	},
	"has-ansi": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz",
	"integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=",
	"requires": {
	"ansi-regex": "^2.0.0"
	}
	},
	"has-flag": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz",
	"integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0="
	},
	"has-symbols": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz",
	"integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==",
	"dev": true
	},
	"has-value": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz",
	"integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=",
	"requires": {
	"get-value": "^2.0.6",
	"has-values": "^1.0.0",
	"isobject": "^3.0.0"
	}
	},
	"has-values": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz",
	"integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=",
	"requires": {
	"is-number": "^3.0.0",
	"kind-of": "^4.0.0"
	},
	"dependencies": {
	"kind-of": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz",
	"integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=",
	"requires": {
	"is-buffer": "^1.1.5"
	}
	}
	}
	},
	"hash-base": {
	"version": "3.0.4",
	"resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.0.4.tgz",
	"integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=",
	"requires": {
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	}
	},
	"hash.js": {
	"version": "1.1.7",
	"resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz",
	"integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==",
	"requires": {
	"inherits": "^2.0.3",
	"minimalistic-assert": "^1.0.1"
	}
	},
	"hmac-drbg": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz",
	"integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=",
	"requires": {
	"hash.js": "^1.0.3",
	"minimalistic-assert": "^1.0.0",
	"minimalistic-crypto-utils": "^1.0.1"
	}
	},
	"home-or-tmp": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/home-or-tmp/-/home-or-tmp-2.0.0.tgz",
	"integrity": "sha1-42w/LSyufXRqhX440Y1fMqeILbg=",
	"requires": {
	"os-homedir": "^1.0.0",
	"os-tmpdir": "^1.0.1"
	}
	},
	"homedir-polyfill": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/homedir-polyfill/-/homedir-polyfill-1.0.3.tgz",
	"integrity": "sha512-eSmmWE5bZTK2Nou4g0AI3zZ9rswp7GRKoKXS1BLUkvPviOqs4YTN1djQIqrXy9k5gEtdLPy86JjRwsNM9tnDcA==",
	"requires": {
	"parse-passwd": "^1.0.0"
	}
	},
	"https-browserify": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz",
	"integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM="
	},
	"ieee754": {
	"version": "1.1.13",
	"resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.13.tgz",
	"integrity": "sha512-4vf7I2LYV/HaWerSo3XmlMkp5eZ83i+/CDluXi/IGTs/O1sejBNhTtnxzmRZfvOUqj7lZjqHkeTvpgSFDlWZTg=="
	},
	"iferr": {
	"version": "0.1.5",
	"resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz",
	"integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE="
	},
	"import-local": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz",
	"integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==",
	"requires": {
	"pkg-dir": "^3.0.0",
	"resolve-cwd": "^2.0.0"
	}
	},
	"imurmurhash": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz",
	"integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o="
	},
	"infer-owner": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz",
	"integrity": "sha512-IClj+Xz94+d7irH5qRyfJonOdfTzuDaifE6ZPWfx0N0+/ATZCbuTPq2prFl526urkQd90WyUKIh1DfBQ2hMz9A=="
	},
	"inflight": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
	"integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=",
	"requires": {
	"once": "^1.3.0",
	"wrappy": "1"
	}
	},
	"inherits": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
	"integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ=="
	},
	"ini": {
	"version": "1.3.5",
	"resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz",
	"integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw=="
	},
	"interpret": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/interpret/-/interpret-1.2.0.tgz",
	"integrity": "sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw=="
	},
	"invariant": {
	"version": "2.2.4",
	"resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz",
	"integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==",
	"requires": {
	"loose-envify": "^1.0.0"
	}
	},
	"invert-kv": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-2.0.0.tgz",
	"integrity": "sha512-wPVv/y/QQ/Uiirj/vh3oP+1Ww+AWehmi1g5fFWGPF6IpCBCDVrhgHRMvrLfdYcwDh3QJbGXDW4JAuzxElLSqKA=="
	},
	"is-accessor-descriptor": {
	"version": "0.1.6",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz",
	"integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=",
	"requires": {
	"kind-of": "^3.0.2"
	},
	"dependencies": {
	"kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"requires": {
	"is-buffer": "^1.1.5"
	}
	}
	}
	},
	"is-binary-path": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz",
	"integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=",
	"requires": {
	"binary-extensions": "^1.0.0"
	}
	},
	"is-buffer": {
	"version": "1.1.6",
	"resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz",
	"integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w=="
	},
	"is-data-descriptor": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz",
	"integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=",
	"requires": {
	"kind-of": "^3.0.2"
	},
	"dependencies": {
	"kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"requires": {
	"is-buffer": "^1.1.5"
	}
	}
	}
	},
	"is-descriptor": {
	"version": "0.1.6",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz",
	"integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==",
	"requires": {
	"is-accessor-descriptor": "^0.1.6",
	"is-data-descriptor": "^0.1.4",
	"kind-of": "^5.0.0"
	},
	"dependencies": {
	"kind-of": {
	"version": "5.1.0",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz",
	"integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw=="
	}
	}
	},
	"is-extendable": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz",
	"integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik="
	},
	"is-extglob": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
	"integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI="
	},
	"is-finite": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.1.0.tgz",
	"integrity": "sha512-cdyMtqX/BOqqNBBiKlIVkytNHm49MtMlYyn1zxzvJKWmFMlGzm+ry5BBfYyeY9YmNKbRSo/o7OX9w9ale0wg3w=="
	},
	"is-fullwidth-code-point": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
	"integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8="
	},
	"is-glob": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz",
	"integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==",
	"requires": {
	"is-extglob": "^2.1.1"
	}
	},
	"is-number": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz",
	"integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=",
	"requires": {
	"kind-of": "^3.0.2"
	},
	"dependencies": {
	"kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"requires": {
	"is-buffer": "^1.1.5"
	}
	}
	}
	},
	"is-plain-object": {
	"version": "2.0.4",
	"resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz",
	"integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==",
	"requires": {
	"isobject": "^3.0.1"
	}
	},
	"is-stream": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz",
	"integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ="
	},
	"is-windows": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz",
	"integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA=="
	},
	"is-wsl": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz",
	"integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0="
	},
	"isarray": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
	"integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE="
	},
	"isexe": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
	"integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA="
	},
	"isobject": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz",
	"integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8="
	},
	"js-tokens": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-3.0.2.tgz",
	"integrity": "sha1-mGbfOVECEw449/mWvOtlRDIJwls="
	},
	"jsesc": {
	"version": "1.3.0",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-1.3.0.tgz",
	"integrity": "sha1-RsP+yMGJKxKwgz25vHYiF226s0s="
	},
	"json-parse-better-errors": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz",
	"integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw=="
	},
	"json-schema-traverse": {
	"version": "0.4.1",
	"resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz",
	"integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg=="
	},
	"json5": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz",
	"integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==",
	"requires": {
	"minimist": "^1.2.0"
	}
	},
	"kind-of": {
	"version": "6.0.3",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.3.tgz",
	"integrity": "sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw=="
	},
	"lcid": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/lcid/-/lcid-2.0.0.tgz",
	"integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==",
	"requires": {
	"invert-kv": "^2.0.0"
	}
	},
	"leven": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/leven/-/leven-3.1.0.tgz",
	"integrity": "sha512-qsda+H8jTaUaN/x5vzW2rzc+8Rw4TAQ/4KjB46IwK5VH+IlVeeeje/EoZRpiXvIqjFgK84QffqPztGI3VBLG1A==",
	"dev": true
	},
	"levenary": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/levenary/-/levenary-1.1.1.tgz",
	"integrity": "sha512-mkAdOIt79FD6irqjYSs4rdbnlT5vRonMEvBVPVb3XmevfS8kgRXwfes0dhPdEtzTWD/1eNE/Bm/G1iRt6DcnQQ==",
	"dev": true,
	"requires": {
	"leven": "^3.1.0"
	}
	},
	"linkify-it": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-3.0.2.tgz",
	"integrity": "sha512-gDBO4aHNZS6coiZCKVhSNh43F9ioIL4JwRjLZPkoLIY4yZFwg264Y5lu2x6rb1Js42Gh6Yqm2f6L2AJcnkzinQ==",
	"requires": {
	"uc.micro": "^1.0.1"
	}
	},
	"loader-runner": {
	"version": "2.4.0",
	"resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz",
	"integrity": "sha512-Jsmr89RcXGIwivFY21FcRrisYZfvLMTWx5kOLc+JTxtpBOG6xML0vzbc6SEQG2FO9/4Fc3wW4LVcB5DmGflaRw=="
	},
	"loader-utils": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz",
	"integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==",
	"requires": {
	"big.js": "^5.2.2",
	"emojis-list": "^3.0.0",
	"json5": "^1.0.1"
	}
	},
	"locate-path": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz",
	"integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==",
	"requires": {
	"p-locate": "^3.0.0",
	"path-exists": "^3.0.0"
	}
	},
	"lodash": {
	"version": "4.17.15",
	"resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.15.tgz",
	"integrity": "sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A=="
	},
	"loose-envify": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz",
	"integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==",
	"requires": {
	"js-tokens": "^3.0.0 \|\| ^4.0.0"
	}
	},
	"lru-cache": {
	"version": "5.1.1",
	"resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz",
	"integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==",
	"requires": {
	"yallist": "^3.0.2"
	}
	},
	"make-dir": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz",
	"integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==",
	"requires": {
	"pify": "^4.0.1",
	"semver": "^5.6.0"
	}
	},
	"mamacro": {
	"version": "0.0.3",
	"resolved": "https://registry.npmjs.org/mamacro/-/mamacro-0.0.3.tgz",
	"integrity": "sha512-qMEwh+UujcQ+kbz3T6V+wAmO2U8veoq2w+3wY8MquqwVA3jChfwY+Tk52GZKDfACEPjuZ7r2oJLejwpt8jtwTA=="
	},
	"map-age-cleaner": {
	"version": "0.1.3",
	"resolved": "https://registry.npmjs.org/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz",
	"integrity": "sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w==",
	"requires": {
	"p-defer": "^1.0.0"
	}
	},
	"map-cache": {
	"version": "0.2.2",
	"resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz",
	"integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8="
	},
	"map-visit": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz",
	"integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=",
	"requires": {
	"object-visit": "^1.0.0"
	}
	},
	"markdown-it": {
	"version": "12.0.4",
	"resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-12.0.4.tgz",
	"integrity": "sha512-34RwOXZT8kyuOJy25oJNJoulO8L0bTHYWXcdZBYZqFnjIy3NgjeoM3FmPXIOFQ26/lSHYMr8oc62B6adxXcb3Q==",
	"requires": {
	"argparse": "^2.0.1",
	"entities": "~2.1.0",
	"linkify-it": "^3.0.1",
	"mdurl": "^1.0.1",
	"uc.micro": "^1.0.5"
	}
	},
	"md5.js": {
	"version": "1.3.5",
	"resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz",
	"integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==",
	"requires": {
	"hash-base": "^3.0.0",
	"inherits": "^2.0.1",
	"safe-buffer": "^5.1.2"
	}
	},
	"mdurl": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/mdurl/-/mdurl-1.0.1.tgz",
	"integrity": "sha1-/oWy7HWlkDfyrf7BAP1sYBdhFS4="
	},
	"mem": {
	"version": "4.3.0",
	"resolved": "https://registry.npmjs.org/mem/-/mem-4.3.0.tgz",
	"integrity": "sha512-qX2bG48pTqYRVmDB37rn/6PT7LcR8T7oAX3bf99u1Tt1nzxYfxkgqDwUwolPlXweM0XzBOBFzSx4kfp7KP1s/w==",
	"requires": {
	"map-age-cleaner": "^0.1.1",
	"mimic-fn": "^2.0.0",
	"p-is-promise": "^2.0.0"
	}
	},
	"memory-fs": {
	"version": "0.4.1",
	"resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz",
	"integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=",
	"requires": {
	"errno": "^0.1.3",
	"readable-stream": "^2.0.1"
	}
	},
	"micromatch": {
	"version": "3.1.10",
	"resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz",
	"integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==",
	"requires": {
	"arr-diff": "^4.0.0",
	"array-unique": "^0.3.2",
	"braces": "^2.3.1",
	"define-property": "^2.0.2",
	"extend-shallow": "^3.0.2",
	"extglob": "^2.0.4",
	"fragment-cache": "^0.2.1",
	"kind-of": "^6.0.2",
	"nanomatch": "^1.2.9",
	"object.pick": "^1.3.0",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.2"
	}
	},
	"miller-rabin": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz",
	"integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==",
	"requires": {
	"bn.js": "^4.0.0",
	"brorand": "^1.0.1"
	}
	},
	"mimic-fn": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/mimic-fn/-/mimic-fn-2.1.0.tgz",
	"integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg=="
	},
	"minimalistic-assert": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz",
	"integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A=="
	},
	"minimalistic-crypto-utils": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz",
	"integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo="
	},
	"minimatch": {
	"version": "3.0.4",
	"resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
	"integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
	"requires": {
	"brace-expansion": "^1.1.7"
	}
	},
	"minimist": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
	"integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ="
	},
	"mississippi": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz",
	"integrity": "sha512-x471SsVjUtBRtcvd4BzKE9kFC+/2TeWgKCgw0bZcw1b9l2X3QX5vCWgF+KaZaYm87Ss//rHnWryupDrgLvmSkA==",
	"requires": {
	"concat-stream": "^1.5.0",
	"duplexify": "^3.4.2",
	"end-of-stream": "^1.1.0",
	"flush-write-stream": "^1.0.0",
	"from2": "^2.1.0",
	"parallel-transform": "^1.1.0",
	"pump": "^3.0.0",
	"pumpify": "^1.3.3",
	"stream-each": "^1.1.0",
	"through2": "^2.0.0"
	}
	},
	"mixin-deep": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.2.tgz",
	"integrity": "sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==",
	"requires": {
	"for-in": "^1.0.2",
	"is-extendable": "^1.0.1"
	},
	"dependencies": {
	"is-extendable": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
	"integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
	"requires": {
	"is-plain-object": "^2.0.4"
	}
	}
	}
	},
	"mkdirp": {
	"version": "0.5.1",
	"resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
	"integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
	"requires": {
	"minimist": "0.0.8"
	},
	"dependencies": {
	"minimist": {
	"version": "0.0.8",
	"resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
	"integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0="
	}
	}
	},
	"move-concurrently": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz",
	"integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=",
	"requires": {
	"aproba": "^1.1.1",
	"copy-concurrently": "^1.0.0",
	"fs-write-stream-atomic": "^1.0.8",
	"mkdirp": "^0.5.1",
	"rimraf": "^2.5.4",
	"run-queue": "^1.0.3"
	}
	},
	"ms": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
	"integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g="
	},
	"nan": {
	"version": "2.14.0",
	"resolved": "https://registry.npmjs.org/nan/-/nan-2.14.0.tgz",
	"integrity": "sha512-INOFj37C7k3AfaNTtX8RhsTw7qRy7eLET14cROi9+5HAVbbHuIWUHEauBv5qT4Av2tWasiTY1Jw6puUNqRJXQg==",
	"optional": true
	},
	"nanomatch": {
	"version": "1.2.13",
	"resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz",
	"integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==",
	"requires": {
	"arr-diff": "^4.0.0",
	"array-unique": "^0.3.2",
	"define-property": "^2.0.2",
	"extend-shallow": "^3.0.2",
	"fragment-cache": "^0.2.1",
	"is-windows": "^1.0.2",
	"kind-of": "^6.0.2",
	"object.pick": "^1.3.0",
	"regex-not": "^1.0.0",
	"snapdragon": "^0.8.1",
	"to-regex": "^3.0.1"
	}
	},
	"neo-async": {
	"version": "2.6.1",
	"resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.1.tgz",
	"integrity": "sha512-iyam8fBuCUpWeKPGpaNMetEocMt364qkCsfL9JuhjXX6dRnguRVOfk2GZaDpPjcOKiiXCPINZC1GczQ7iTq3Zw=="
	},
	"nice-try": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz",
	"integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ=="
	},
	"node-libs-browser": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz",
	"integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==",
	"requires": {
	"assert": "^1.1.1",
	"browserify-zlib": "^0.2.0",
	"buffer": "^4.3.0",
	"console-browserify": "^1.1.0",
	"constants-browserify": "^1.0.0",
	"crypto-browserify": "^3.11.0",
	"domain-browser": "^1.1.1",
	"events": "^3.0.0",
	"https-browserify": "^1.0.0",
	"os-browserify": "^0.3.0",
	"path-browserify": "0.0.1",
	"process": "^0.11.10",
	"punycode": "^1.2.4",
	"querystring-es3": "^0.2.0",
	"readable-stream": "^2.3.3",
	"stream-browserify": "^2.0.1",
	"stream-http": "^2.7.2",
	"string_decoder": "^1.0.0",
	"timers-browserify": "^2.0.4",
	"tty-browserify": "0.0.0",
	"url": "^0.11.0",
	"util": "^0.11.0",
	"vm-browserify": "^1.0.1"
	},
	"dependencies": {
	"punycode": {
	"version": "1.4.1",
	"resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
	"integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4="
	}
	}
	},
	"node-releases": {
	"version": "1.1.61",
	"resolved": "https://registry.npmjs.org/node-releases/-/node-releases-1.1.61.tgz",
	"integrity": "sha512-DD5vebQLg8jLCOzwupn954fbIiZht05DAZs0k2u8NStSe6h9XdsuIQL8hSRKYiU8WUQRznmSDrKGbv3ObOmC7g==",
	"dev": true
	},
	"normalize-path": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz",
	"integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA=="
	},
	"npm-run-path": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz",
	"integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=",
	"requires": {
	"path-key": "^2.0.0"
	}
	},
	"object-assign": {
	"version": "4.1.1",
	"resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
	"integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM="
	},
	"object-copy": {
	"version": "0.1.0",
	"resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz",
	"integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=",
	"requires": {
	"copy-descriptor": "^0.1.0",
	"define-property": "^0.2.5",
	"kind-of": "^3.0.3"
	},
	"dependencies": {
	"define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"requires": {
	"is-descriptor": "^0.1.0"
	}
	},
	"kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"requires": {
	"is-buffer": "^1.1.5"
	}
	}
	}
	},
	"object-keys": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz",
	"integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==",
	"dev": true
	},
	"object-visit": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz",
	"integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=",
	"requires": {
	"isobject": "^3.0.0"
	}
	},
	"object.assign": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.0.tgz",
	"integrity": "sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==",
	"dev": true,
	"requires": {
	"define-properties": "^1.1.2",
	"function-bind": "^1.1.1",
	"has-symbols": "^1.0.0",
	"object-keys": "^1.0.11"
	}
	},
	"object.pick": {
	"version": "1.3.0",
	"resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz",
	"integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=",
	"requires": {
	"isobject": "^3.0.1"
	}
	},
	"once": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
	"integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=",
	"requires": {
	"wrappy": "1"
	}
	},
	"orderedmap": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/orderedmap/-/orderedmap-1.1.1.tgz",
	"integrity": "sha512-3Ux8um0zXbVacKUkcytc0u3HgC0b0bBLT+I60r2J/En72cI0nZffqrA7Xtf2Hqs27j1g82llR5Mhbd0Z1XW4AQ=="
	},
	"os-browserify": {
	"version": "0.3.0",
	"resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz",
	"integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc="
	},
	"os-homedir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz",
	"integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M="
	},
	"os-locale": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/os-locale/-/os-locale-3.1.0.tgz",
	"integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==",
	"requires": {
	"execa": "^1.0.0",
	"lcid": "^2.0.0",
	"mem": "^4.0.0"
	}
	},
	"os-tmpdir": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz",
	"integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ="
	},
	"p-defer": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/p-defer/-/p-defer-1.0.0.tgz",
	"integrity": "sha1-n26xgvbJqozXQwBKfU+WsZaw+ww="
	},
	"p-finally": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz",
	"integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4="
	},
	"p-is-promise": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/p-is-promise/-/p-is-promise-2.1.0.tgz",
	"integrity": "sha512-Y3W0wlRPK8ZMRbNq97l4M5otioeA5lm1z7bkNkxCka8HSPjR0xRWmpCmc9utiaLP9Jb1eD8BgeIxTW4AIF45Pg=="
	},
	"p-limit": {
	"version": "2.2.2",
	"resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz",
	"integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==",
	"requires": {
	"p-try": "^2.0.0"
	}
	},
	"p-locate": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz",
	"integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==",
	"requires": {
	"p-limit": "^2.0.0"
	}
	},
	"p-try": {
	"version": "2.2.0",
	"resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz",
	"integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ=="
	},
	"pako": {
	"version": "1.0.11",
	"resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz",
	"integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw=="
	},
	"parallel-transform": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.2.0.tgz",
	"integrity": "sha512-P2vSmIu38uIlvdcU7fDkyrxj33gTUy/ABO5ZUbGowxNCopBq/OoD42bP4UmMrJoPyk4Uqf0mu3mtWBhHCZD8yg==",
	"requires": {
	"cyclist": "^1.0.1",
	"inherits": "^2.0.3",
	"readable-stream": "^2.1.5"
	}
	},
	"parse-asn1": {
	"version": "5.1.5",
	"resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.5.tgz",
	"integrity": "sha512-jkMYn1dcJqF6d5CpU689bq7w/b5ALS9ROVSpQDPrZsqqesUJii9qutvoT5ltGedNXMO2e16YUWIghG9KxaViTQ==",
	"requires": {
	"asn1.js": "^4.0.0",
	"browserify-aes": "^1.0.0",
	"create-hash": "^1.1.0",
	"evp_bytestokey": "^1.0.0",
	"pbkdf2": "^3.0.3",
	"safe-buffer": "^5.1.1"
	}
	},
	"parse-passwd": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/parse-passwd/-/parse-passwd-1.0.0.tgz",
	"integrity": "sha1-bVuTSkVpk7I9N/QKOC1vFmao5cY="
	},
	"pascalcase": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz",
	"integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ="
	},
	"path-browserify": {
	"version": "0.0.1",
	"resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz",
	"integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ=="
	},
	"path-dirname": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz",
	"integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA="
	},
	"path-exists": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz",
	"integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU="
	},
	"path-is-absolute": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
	"integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18="
	},
	"path-key": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz",
	"integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A="
	},
	"path-parse": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz",
	"integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==",
	"dev": true
	},
	"pbkdf2": {
	"version": "3.0.17",
	"resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.0.17.tgz",
	"integrity": "sha512-U/il5MsrZp7mGg3mSQfn742na2T+1/vHDCG5/iTI3X9MKUuYUZVLQhyRsg06mCgDBTd57TxzgZt7P+fYfjRLtA==",
	"requires": {
	"create-hash": "^1.1.2",
	"create-hmac": "^1.1.4",
	"ripemd160": "^2.0.1",
	"safe-buffer": "^5.0.1",
	"sha.js": "^2.4.8"
	}
	},
	"pify": {
	"version": "4.0.1",
	"resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz",
	"integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g=="
	},
	"pkg-dir": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz",
	"integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==",
	"requires": {
	"find-up": "^3.0.0"
	}
	},
	"posix-character-classes": {
	"version": "0.1.1",
	"resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz",
	"integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs="
	},
	"prettier": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/prettier/-/prettier-2.2.1.tgz",
	"integrity": "sha512-PqyhM2yCjg/oKkFPtTGUojv7gnZAoG80ttl45O6x2Ug/rMJw4wcc9k6aaf2hibP7BGVCCM33gZoGjyvt9mm16Q==",
	"dev": true
	},
	"private": {
	"version": "0.1.8",
	"resolved": "https://registry.npmjs.org/private/-/private-0.1.8.tgz",
	"integrity": "sha512-VvivMrbvd2nKkiG38qjULzlc+4Vx4wm/whI9pQD35YrARNnhxeiRktSOhSukRLFNlzg6Br/cJPet5J/u19r/mg=="
	},
	"process": {
	"version": "0.11.10",
	"resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz",
	"integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI="
	},
	"process-nextick-args": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz",
	"integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag=="
	},
	"promise-inflight": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz",
	"integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM="
	},
	"prosemirror-commands": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-commands/-/prosemirror-commands-1.1.3.tgz",
	"integrity": "sha512-YVbKwTR4likoyhuwIUC9egbzHvnFrFUNbiesB0DB/HZ8hBcopQ42Tb4KGlYrS3n+pNDTFObN73CLFY6mYLN2IQ==",
	"requires": {
	"prosemirror-model": "^1.0.0",
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"prosemirror-dropcursor": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/prosemirror-dropcursor/-/prosemirror-dropcursor-1.3.2.tgz",
	"integrity": "sha512-4c94OUGyobGnwcQI70OXyMhE/9T4aTgjU+CHxkd5c7D+jH/J0mKM/lk+jneFVKt7+E4/M0D9HzRPifu8U28Thw==",
	"requires": {
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.1.0",
	"prosemirror-view": "^1.1.0"
	}
	},
	"prosemirror-example-setup": {
	- "version": "1.1.2",
	- "resolved": "https://registry.npmjs.org/prosemirror-example-setup/-/prosemirror-example-setup-1.1.2.tgz",
	- "integrity": "sha512-MTpIMyqk08jFnzxeRMCinCEMtVSTUtxKgQBGxfCbVe9C6zIOqp9qZZJz5Ojaad1GETySyuj8+OIHHvQsIaaaGQ==",
	+ "version": "git+ssh://git@github.com/writefreely/prosemirror-example-setup.git#aaea7d62ebc2fa769139faf8a097449441c8237c",
	+ "from": "prosemirror-example-setup@github:writefreely/prosemirror-example-setup",
	"requires": {
	"prosemirror-commands": "^1.0.0",
	"prosemirror-dropcursor": "^1.0.0",
	"prosemirror-gapcursor": "^1.0.0",
	"prosemirror-history": "^1.0.0",
	"prosemirror-inputrules": "^1.0.0",
	"prosemirror-keymap": "^1.0.0",
	"prosemirror-menu": "^1.0.0",
	"prosemirror-schema-list": "^1.0.0",
	"prosemirror-state": "^1.0.0"
	}
	},
	"prosemirror-gapcursor": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-gapcursor/-/prosemirror-gapcursor-1.1.3.tgz",
	"integrity": "sha512-/lgWvt2AdHjsM6oEsF65z0lhdQJGl6sQSfXSOX8/xjpd8ycfOolhgKZd4TPYpikwnh85JF4l5eIyiFZsl/RQQA==",
	"requires": {
	"prosemirror-keymap": "^1.0.0",
	"prosemirror-model": "^1.0.0",
	"prosemirror-state": "^1.0.0",
	"prosemirror-view": "^1.0.0"
	}
	},
	"prosemirror-history": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-history/-/prosemirror-history-1.1.3.tgz",
	"integrity": "sha512-zGDotijea+vnfnyyUGyiy1wfOQhf0B/b6zYcCouBV8yo6JmrE9X23M5q7Nf/nATywEZbgRLG70R4DmfSTC+gfg==",
	"requires": {
	"prosemirror-state": "^1.2.2",
	"prosemirror-transform": "^1.0.0",
	"rope-sequence": "^1.3.0"
	}
	},
	"prosemirror-inputrules": {
	"version": "1.1.2",
	"resolved": "https://registry.npmjs.org/prosemirror-inputrules/-/prosemirror-inputrules-1.1.2.tgz",
	"integrity": "sha512-Ja5Z3BWestlHYGvtSGqyvxMeB8QEuBjlHM8YnKtLGUXMDp965qdDV4goV8lJb17kIWHk7e7JNj6Catuoa3302g==",
	"requires": {
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"prosemirror-keymap": {
	"version": "1.1.4",
	"resolved": "https://registry.npmjs.org/prosemirror-keymap/-/prosemirror-keymap-1.1.4.tgz",
	"integrity": "sha512-Al8cVUOnDFL4gcI5IDlG6xbZ0aOD/i3B17VT+1JbHWDguCgt/lBHVTHUBcKvvbSg6+q/W4Nj1Fu6bwZSca3xjg==",
	"requires": {
	"prosemirror-state": "^1.0.0",
	"w3c-keyname": "^2.2.0"
	}
	},
	"prosemirror-markdown": {
	- "version": "git+ssh://git@github.com/VV-EE/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2",
	- "from": "prosemirror-markdown@github:VV-EE/prosemirror-markdown",
	+ "version": "git+ssh://git@github.com/writefreely/prosemirror-markdown.git#809d0a444cf4d366d7c0c350d881df1b55d172f2",
	+ "from": "prosemirror-markdown@github:writefreely/prosemirror-markdown",
	"requires": {
	"markdown-it": "^10.0.0",
	"prosemirror-model": "^1.0.0"
	},
	"dependencies": {
	"argparse": {
	"version": "1.0.10",
	"resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz",
	"integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==",
	"requires": {
	"sprintf-js": "~1.0.2"
	}
	},
	"entities": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/entities/-/entities-2.0.3.tgz",
	"integrity": "sha512-MyoZ0jgnLvB2X3Lg5HqpFmn1kybDiIfEQmKzTb5apr51Rb+T3KdmMiqa70T+bhGnyv7bQ6WMj2QMHpGMmlrUYQ=="
	},
	"linkify-it": {
	"version": "2.2.0",
	"resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-2.2.0.tgz",
	"integrity": "sha512-GnAl/knGn+i1U/wjBz3akz2stz+HrHLsxMwHQGofCDfPvlf+gDKN58UtfmUquTY4/MXeE2x7k19KQmeoZi94Iw==",
	"requires": {
	"uc.micro": "^1.0.1"
	}
	},
	"markdown-it": {
	"version": "10.0.0",
	"resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-10.0.0.tgz",
	"integrity": "sha512-YWOP1j7UbDNz+TumYP1kpwnP0aEa711cJjrAQrzd0UXlbJfc5aAq0F/PZHjiioqDC1NKgvIMX+o+9Bk7yuM2dg==",
	"requires": {
	"argparse": "^1.0.7",
	"entities": "~2.0.0",
	"linkify-it": "^2.0.0",
	"mdurl": "^1.0.1",
	"uc.micro": "^1.0.5"
	}
	}
	}
	},
	"prosemirror-menu": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/prosemirror-menu/-/prosemirror-menu-1.1.3.tgz",
	"integrity": "sha512-G+XiTdiVi1uGeiBR1OqtiVP3p0XyCKec4DYLk75G7J2R/N8OThHt/1StJYDlXPNzqYsQFZfQyPp/UwOL8hD6AA==",
	"requires": {
	"crel": "^4.2.0",
	"prosemirror-commands": "^1.0.0",
	"prosemirror-history": "^1.0.0",
	"prosemirror-state": "^1.0.0"
	}
	},
	"prosemirror-model": {
	"version": "1.9.1",
	"resolved": "https://registry.npmjs.org/prosemirror-model/-/prosemirror-model-1.9.1.tgz",
	"integrity": "sha512-Qblh8pm1c7Ll64sYLauwwzjimo/tFg1zW3Q3IWhKRhvfOEgRKqa6dC5pRrAa+XHOIjBFEYrqbi52J5bqA2dV8Q==",
	"requires": {
	"orderedmap": "^1.1.0"
	}
	},
	"prosemirror-schema-list": {
	"version": "1.1.2",
	"resolved": "https://registry.npmjs.org/prosemirror-schema-list/-/prosemirror-schema-list-1.1.2.tgz",
	"integrity": "sha512-dgM9PwtM4twa5WsgSYMB+J8bwjnR43DAD3L9MsR9rKm/nZR5Y85xcjB7gusVMSsbQ2NomMZF03RE6No6mTnclQ==",
	"requires": {
	"prosemirror-model": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"prosemirror-state": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/prosemirror-state/-/prosemirror-state-1.3.2.tgz",
	"integrity": "sha512-t/JqE3aR0SV9QrzFVkAXsQwsgrQBNs/BDbcFH20RssW0xauqNNdjTXxy/J/kM7F+0zYi6+BRmz7cMMQQFU3mwQ==",
	"requires": {
	"prosemirror-model": "^1.0.0",
	"prosemirror-transform": "^1.0.0"
	}
	},
	"prosemirror-transform": {
	"version": "1.2.4",
	"resolved": "https://registry.npmjs.org/prosemirror-transform/-/prosemirror-transform-1.2.4.tgz",
	"integrity": "sha512-0A668uf0EN89L9O9brE05kHcqp7FHmT5YN7Tom58Kj926QqOBs7iNRHDLWxrSaQB5MNZtzDOD9T3EyJ88YDcBg==",
	"requires": {
	"prosemirror-model": "^1.0.0"
	}
	},
	"prosemirror-view": {
	"version": "1.14.2",
	"resolved": "https://registry.npmjs.org/prosemirror-view/-/prosemirror-view-1.14.2.tgz",
	"integrity": "sha512-9yPVH6OLyaEraHjWHbSk2DB0R/1TsEE6AA1LI+vmCypXXA+zTzNrktUFzBhSJHehXDoEJcQfnl1Wdp5GPSh2+g==",
	"requires": {
	"prosemirror-model": "^1.1.0",
	"prosemirror-state": "^1.0.0",
	"prosemirror-transform": "^1.1.0"
	}
	},
	"prr": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz",
	"integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY="
	},
	"public-encrypt": {
	"version": "4.0.3",
	"resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz",
	"integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==",
	"requires": {
	"bn.js": "^4.1.0",
	"browserify-rsa": "^4.0.0",
	"create-hash": "^1.1.0",
	"parse-asn1": "^5.0.0",
	"randombytes": "^2.0.1",
	"safe-buffer": "^5.1.2"
	}
	},
	"pump": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz",
	"integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==",
	"requires": {
	"end-of-stream": "^1.1.0",
	"once": "^1.3.1"
	}
	},
	"pumpify": {
	"version": "1.5.1",
	"resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz",
	"integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==",
	"requires": {
	"duplexify": "^3.6.0",
	"inherits": "^2.0.3",
	"pump": "^2.0.0"
	},
	"dependencies": {
	"pump": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz",
	"integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==",
	"requires": {
	"end-of-stream": "^1.1.0",
	"once": "^1.3.1"
	}
	}
	}
	},
	"punycode": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz",
	"integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A=="
	},
	"querystring": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz",
	"integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA="
	},
	"querystring-es3": {
	"version": "0.2.1",
	"resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz",
	"integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM="
	},
	"randombytes": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz",
	"integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==",
	"requires": {
	"safe-buffer": "^5.1.0"
	}
	},
	"randomfill": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz",
	"integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==",
	"requires": {
	"randombytes": "^2.0.5",
	"safe-buffer": "^5.1.0"
	}
	},
	"readable-stream": {
	"version": "2.3.7",
	"resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz",
	"integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==",
	"requires": {
	"core-util-is": "~1.0.0",
	"inherits": "~2.0.3",
	"isarray": "~1.0.0",
	"process-nextick-args": "~2.0.0",
	"safe-buffer": "~5.1.1",
	"string_decoder": "~1.1.1",
	"util-deprecate": "~1.0.1"
	}
	},
	"readdirp": {
	"version": "2.2.1",
	"resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz",
	"integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==",
	"requires": {
	"graceful-fs": "^4.1.11",
	"micromatch": "^3.1.10",
	"readable-stream": "^2.0.2"
	}
	},
	"regenerate": {
	"version": "1.4.0",
	"resolved": "https://registry.npmjs.org/regenerate/-/regenerate-1.4.0.tgz",
	"integrity": "sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg=="
	},
	"regenerate-unicode-properties": {
	"version": "8.2.0",
	"resolved": "https://registry.npmjs.org/regenerate-unicode-properties/-/regenerate-unicode-properties-8.2.0.tgz",
	"integrity": "sha512-F9DjY1vKLo/tPePDycuH3dn9H1OTPIkVD9Kz4LODu+F2C75mgjAJ7x/gwy6ZcSNRAAkhNlJSOHRe8k3p+K9WhA==",
	"dev": true,
	"requires": {
	"regenerate": "^1.4.0"
	}
	},
	"regenerator-runtime": {
	"version": "0.11.1",
	"resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz",
	"integrity": "sha512-MguG95oij0fC3QV3URf4V2SDYGJhJnJGqvIIgdECeODCT98wSWDAJ94SSuVpYQUoTcGUIL6L4yNB7j1DFFHSBg=="
	},
	"regenerator-transform": {
	"version": "0.10.1",
	"resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.10.1.tgz",
	"integrity": "sha512-PJepbvDbuK1xgIgnau7Y90cwaAmO/LCLMI2mPvaXq2heGMR3aWW5/BQvYrhJ8jgmQjXewXvBjzfqKcVOmhjZ6Q==",
	"requires": {
	"babel-runtime": "^6.18.0",
	"babel-types": "^6.19.0",
	"private": "^0.1.6"
	}
	},
	"regex-not": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz",
	"integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==",
	"requires": {
	"extend-shallow": "^3.0.2",
	"safe-regex": "^1.1.0"
	}
	},
	"regexpu-core": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-2.0.0.tgz",
	"integrity": "sha1-SdA4g3uNz4v6W5pCE5k45uoq4kA=",
	"requires": {
	"regenerate": "^1.2.1",
	"regjsgen": "^0.2.0",
	"regjsparser": "^0.1.4"
	}
	},
	"regjsgen": {
	"version": "0.2.0",
	"resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz",
	"integrity": "sha1-bAFq3qxVT3WCP+N6wFuS1aTtsfc="
	},
	"regjsparser": {
	"version": "0.1.5",
	"resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz",
	"integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=",
	"requires": {
	"jsesc": "~0.5.0"
	},
	"dependencies": {
	"jsesc": {
	"version": "0.5.0",
	"resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz",
	"integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0="
	}
	}
	},
	"remove-trailing-separator": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz",
	"integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8="
	},
	"repeat-element": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz",
	"integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g=="
	},
	"repeat-string": {
	"version": "1.6.1",
	"resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz",
	"integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc="
	},
	"repeating": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz",
	"integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=",
	"requires": {
	"is-finite": "^1.0.0"
	}
	},
	"require-directory": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz",
	"integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I="
	},
	"require-main-filename": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz",
	"integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg=="
	},
	"resolve": {
	"version": "1.15.1",
	"resolved": "https://registry.npmjs.org/resolve/-/resolve-1.15.1.tgz",
	"integrity": "sha512-84oo6ZTtoTUpjgNEr5SJyzQhzL72gaRodsSfyxC/AXRvwu0Yse9H8eF9IpGo7b8YetZhlI6v7ZQ6bKBFV/6S7w==",
	"dev": true,
	"requires": {
	"path-parse": "^1.0.6"
	}
	},
	"resolve-cwd": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz",
	"integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=",
	"requires": {
	"resolve-from": "^3.0.0"
	}
	},
	"resolve-dir": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/resolve-dir/-/resolve-dir-1.0.1.tgz",
	"integrity": "sha1-eaQGRMNivoLybv/nOcm7U4IEb0M=",
	"requires": {
	"expand-tilde": "^2.0.0",
	"global-modules": "^1.0.0"
	},
	"dependencies": {
	"global-modules": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz",
	"integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==",
	"requires": {
	"global-prefix": "^1.0.1",
	"is-windows": "^1.0.1",
	"resolve-dir": "^1.0.0"
	}
	}
	}
	},
	"resolve-from": {
	"version": "3.0.0",
	"resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz",
	"integrity": "sha1-six699nWiBvItuZTM17rywoYh0g="
	},
	"resolve-url": {
	"version": "0.2.1",
	"resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz",
	"integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo="
	},
	"ret": {
	"version": "0.1.15",
	"resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz",
	"integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg=="
	},
	"rimraf": {
	"version": "2.7.1",
	"resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz",
	"integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==",
	"requires": {
	"glob": "^7.1.3"
	}
	},
	"ripemd160": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz",
	"integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==",
	"requires": {
	"hash-base": "^3.0.0",
	"inherits": "^2.0.1"
	}
	},
	"rope-sequence": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/rope-sequence/-/rope-sequence-1.3.2.tgz",
	"integrity": "sha512-ku6MFrwEVSVmXLvy3dYph3LAMNS0890K7fabn+0YIRQ2T96T9F4gkFf0vf0WW0JUraNWwGRtInEpH7yO4tbQZg=="
	},
	"run-queue": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz",
	"integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=",
	"requires": {
	"aproba": "^1.1.1"
	}
	},
	"safe-buffer": {
	"version": "5.1.2",
	"resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
	"integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g=="
	},
	"safe-regex": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz",
	"integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=",
	"requires": {
	"ret": "~0.1.10"
	}
	},
	"schema-utils": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
	"integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
	"requires": {
	"ajv": "^6.1.0",
	"ajv-errors": "^1.0.0",
	"ajv-keywords": "^3.1.0"
	}
	},
	"semver": {
	"version": "5.7.1",
	"resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz",
	"integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ=="
	},
	"serialize-javascript": {
	"version": "2.1.2",
	"resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-2.1.2.tgz",
	"integrity": "sha512-rs9OggEUF0V4jUSecXazOYsLfu7OGK2qIn3c7IPBiffz32XniEp/TX9Xmc9LQfK2nQ2QKHvZ2oygKUGU0lG4jQ=="
	},
	"set-blocking": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz",
	"integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc="
	},
	"set-value": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.1.tgz",
	"integrity": "sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==",
	"requires": {
	"extend-shallow": "^2.0.1",
	"is-extendable": "^0.1.1",
	"is-plain-object": "^2.0.3",
	"split-string": "^3.0.1"
	},
	"dependencies": {
	"extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"requires": {
	"is-extendable": "^0.1.0"
	}
	}
	}
	},
	"setimmediate": {
	"version": "1.0.5",
	"resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz",
	"integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU="
	},
	"sha.js": {
	"version": "2.4.11",
	"resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz",
	"integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==",
	"requires": {
	"inherits": "^2.0.1",
	"safe-buffer": "^5.0.1"
	}
	},
	"shebang-command": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz",
	"integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=",
	"requires": {
	"shebang-regex": "^1.0.0"
	}
	},
	"shebang-regex": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz",
	"integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM="
	},
	"signal-exit": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz",
	"integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0="
	},
	"slash": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz",
	"integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU="
	},
	"snapdragon": {
	"version": "0.8.2",
	"resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz",
	"integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==",
	"requires": {
	"base": "^0.11.1",
	"debug": "^2.2.0",
	"define-property": "^0.2.5",
	"extend-shallow": "^2.0.1",
	"map-cache": "^0.2.2",
	"source-map": "^0.5.6",
	"source-map-resolve": "^0.5.0",
	"use": "^3.1.0"
	},
	"dependencies": {
	"define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"requires": {
	"is-descriptor": "^0.1.0"
	}
	},
	"extend-shallow": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
	"integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
	"requires": {
	"is-extendable": "^0.1.0"
	}
	}
	}
	},
	"snapdragon-node": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz",
	"integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==",
	"requires": {
	"define-property": "^1.0.0",
	"isobject": "^3.0.0",
	"snapdragon-util": "^3.0.1"
	},
	"dependencies": {
	"define-property": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
	"integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
	"requires": {
	"is-descriptor": "^1.0.0"
	}
	},
	"is-accessor-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
	"integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-data-descriptor": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
	"integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
	"requires": {
	"kind-of": "^6.0.0"
	}
	},
	"is-descriptor": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
	"integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
	"requires": {
	"is-accessor-descriptor": "^1.0.0",
	"is-data-descriptor": "^1.0.0",
	"kind-of": "^6.0.2"
	}
	}
	}
	},
	"snapdragon-util": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz",
	"integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==",
	"requires": {
	"kind-of": "^3.2.0"
	},
	"dependencies": {
	"kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"requires": {
	"is-buffer": "^1.1.5"
	}
	}
	}
	},
	"source-list-map": {
	"version": "2.0.1",
	"resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.1.tgz",
	"integrity": "sha512-qnQ7gVMxGNxsiL4lEuJwe/To8UnK7fAnmbGEEH8RpLouuKbeEm0lhbQVFIrNSuB+G7tVrAlVsZgETT5nljf+Iw=="
	},
	"source-map": {
	"version": "0.5.7",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz",
	"integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w="
	},
	"source-map-resolve": {
	"version": "0.5.3",
	"resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.3.tgz",
	"integrity": "sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw==",
	"requires": {
	"atob": "^2.1.2",
	"decode-uri-component": "^0.2.0",
	"resolve-url": "^0.2.1",
	"source-map-url": "^0.4.0",
	"urix": "^0.1.0"
	}
	},
	"source-map-support": {
	"version": "0.5.16",
	"resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.16.tgz",
	"integrity": "sha512-efyLRJDr68D9hBBNIPWFjhpFzURh+KJykQwvMyW5UiZzYwoF6l4YMMDIJJEyFWxWCqfyxLzz6tSfUFR+kXXsVQ==",
	"requires": {
	"buffer-from": "^1.0.0",
	"source-map": "^0.6.0"
	},
	"dependencies": {
	"source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g=="
	}
	}
	},
	"source-map-url": {
	"version": "0.4.0",
	"resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz",
	"integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM="
	},
	"split-string": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz",
	"integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==",
	"requires": {
	"extend-shallow": "^3.0.0"
	}
	},
	"sprintf-js": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz",
	"integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw="
	},
	"ssri": {
	"version": "6.0.1",
	"resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz",
	"integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==",
	"requires": {
	"figgy-pudding": "^3.5.1"
	}
	},
	"static-extend": {
	"version": "0.1.2",
	"resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz",
	"integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=",
	"requires": {
	"define-property": "^0.2.5",
	"object-copy": "^0.1.0"
	},
	"dependencies": {
	"define-property": {
	"version": "0.2.5",
	"resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
	"integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
	"requires": {
	"is-descriptor": "^0.1.0"
	}
	}
	}
	},
	"stream-browserify": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz",
	"integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==",
	"requires": {
	"inherits": "~2.0.1",
	"readable-stream": "^2.0.2"
	}
	},
	"stream-each": {
	"version": "1.2.3",
	"resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz",
	"integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==",
	"requires": {
	"end-of-stream": "^1.1.0",
	"stream-shift": "^1.0.0"
	}
	},
	"stream-http": {
	"version": "2.8.3",
	"resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz",
	"integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==",
	"requires": {
	"builtin-status-codes": "^3.0.0",
	"inherits": "^2.0.1",
	"readable-stream": "^2.3.6",
	"to-arraybuffer": "^1.0.0",
	"xtend": "^4.0.0"
	}
	},
	"stream-shift": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.1.tgz",
	"integrity": "sha512-AiisoFqQ0vbGcZgQPY1cdP2I76glaVA/RauYR4G4thNFgkTqr90yXTo4LYX60Jl+sIlPNHHdGSwo01AvbKUSVQ=="
	},
	"string_decoder": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
	"integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
	"requires": {
	"safe-buffer": "~5.1.0"
	}
	},
	"string-width": {
	"version": "3.1.0",
	"resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz",
	"integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==",
	"requires": {
	"emoji-regex": "^7.0.1",
	"is-fullwidth-code-point": "^2.0.0",
	"strip-ansi": "^5.1.0"
	},
	"dependencies": {
	"ansi-regex": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz",
	"integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg=="
	},
	"strip-ansi": {
	"version": "5.2.0",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz",
	"integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==",
	"requires": {
	"ansi-regex": "^4.1.0"
	}
	}
	}
	},
	"strip-ansi": {
	"version": "3.0.1",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz",
	"integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=",
	"requires": {
	"ansi-regex": "^2.0.0"
	}
	},
	"strip-eof": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz",
	"integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8="
	},
	"supports-color": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
	"integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc="
	},
	"tapable": {
	"version": "1.1.3",
	"resolved": "https://registry.npmjs.org/tapable/-/tapable-1.1.3.tgz",
	"integrity": "sha512-4WK/bYZmj8xLr+HUCODHGF1ZFzsYffasLUgEiMBY4fgtltdO6B4WJtlSbPaDTLpYTcGVwM2qLnFTICEcNxs3kA=="
	},
	"terser": {
	"version": "4.6.6",
	"resolved": "https://registry.npmjs.org/terser/-/terser-4.6.6.tgz",
	"integrity": "sha512-4lYPyeNmstjIIESr/ysHg2vUPRGf2tzF9z2yYwnowXVuVzLEamPN1Gfrz7f8I9uEPuHcbFlW4PLIAsJoxXyJ1g==",
	"requires": {
	"commander": "^2.20.0",
	"source-map": "~0.6.1",
	"source-map-support": "~0.5.12"
	},
	"dependencies": {
	"source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g=="
	}
	}
	},
	"terser-webpack-plugin": {
	"version": "1.4.3",
	"resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.3.tgz",
	"integrity": "sha512-QMxecFz/gHQwteWwSo5nTc6UaICqN1bMedC5sMtUc7y3Ha3Q8y6ZO0iCR8pq4RJC8Hjf0FEPEHZqcMB/+DFCrA==",
	"requires": {
	"cacache": "^12.0.2",
	"find-cache-dir": "^2.1.0",
	"is-wsl": "^1.1.0",
	"schema-utils": "^1.0.0",
	"serialize-javascript": "^2.1.2",
	"source-map": "^0.6.1",
	"terser": "^4.1.2",
	"webpack-sources": "^1.4.0",
	"worker-farm": "^1.7.0"
	},
	"dependencies": {
	"source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g=="
	}
	}
	},
	"through2": {
	"version": "2.0.5",
	"resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz",
	"integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==",
	"requires": {
	"readable-stream": "~2.3.6",
	"xtend": "~4.0.1"
	}
	},
	"timers-browserify": {
	"version": "2.0.11",
	"resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.11.tgz",
	"integrity": "sha512-60aV6sgJ5YEbzUdn9c8kYGIqOubPoUdqQCul3SBAsRCZ40s6Y5cMcrW4dt3/k/EsbLVJNl9n6Vz3fTc+k2GeKQ==",
	"requires": {
	"setimmediate": "^1.0.4"
	}
	},
	"to-arraybuffer": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz",
	"integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M="
	},
	"to-fast-properties": {
	"version": "1.0.3",
	"resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.3.tgz",
	"integrity": "sha1-uDVx+k2MJbguIxsG46MFXeTKGkc="
	},
	"to-object-path": {
	"version": "0.3.0",
	"resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz",
	"integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=",
	"requires": {
	"kind-of": "^3.0.2"
	},
	"dependencies": {
	"kind-of": {
	"version": "3.2.2",
	"resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
	"integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
	"requires": {
	"is-buffer": "^1.1.5"
	}
	}
	}
	},
	"to-regex": {
	"version": "3.0.2",
	"resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz",
	"integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==",
	"requires": {
	"define-property": "^2.0.2",
	"extend-shallow": "^3.0.2",
	"regex-not": "^1.0.2",
	"safe-regex": "^1.1.0"
	}
	},
	"to-regex-range": {
	"version": "2.1.1",
	"resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz",
	"integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=",
	"requires": {
	"is-number": "^3.0.0",
	"repeat-string": "^1.6.1"
	}
	},
	"trim-right": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/trim-right/-/trim-right-1.0.1.tgz",
	"integrity": "sha1-yy4SAwZ+DI3h9hQJS5/kVwTqYAM="
	},
	"tslib": {
	"version": "1.11.1",
	"resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz",
	"integrity": "sha512-aZW88SY8kQbU7gpV19lN24LtXh/yD4ZZg6qieAJDDg+YBsJcSmLGK9QpnUjAKVG/xefmvJGd1WUmfpT/g6AJGA=="
	},
	"tty-browserify": {
	"version": "0.0.0",
	"resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz",
	"integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY="
	},
	"typedarray": {
	"version": "0.0.6",
	"resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz",
	"integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c="
	},
	"uc.micro": {
	"version": "1.0.6",
	"resolved": "https://registry.npmjs.org/uc.micro/-/uc.micro-1.0.6.tgz",
	"integrity": "sha512-8Y75pvTYkLJW2hWQHXxoqRgV7qb9B+9vFEtidML+7koHUFapnVJAZ6cKs+Qjz5Aw3aZWHMC6u0wJE3At+nSGwA=="
	},
	"unicode-canonical-property-names-ecmascript": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-1.0.4.tgz",
	"integrity": "sha512-jDrNnXWHd4oHiTZnx/ZG7gtUTVp+gCcTTKr8L0HjlwphROEW3+Him+IpvC+xcJEFegapiMZyZe02CyuOnRmbnQ==",
	"dev": true
	},
	"unicode-match-property-ecmascript": {
	"version": "1.0.4",
	"resolved": "https://registry.npmjs.org/unicode-match-property-ecmascript/-/unicode-match-property-ecmascript-1.0.4.tgz",
	"integrity": "sha512-L4Qoh15vTfntsn4P1zqnHulG0LdXgjSO035fEpdtp6YxXhMT51Q6vgM5lYdG/5X3MjS+k/Y9Xw4SFCY9IkR0rg==",
	"dev": true,
	"requires": {
	"unicode-canonical-property-names-ecmascript": "^1.0.4",
	"unicode-property-aliases-ecmascript": "^1.0.4"
	}
	},
	"unicode-match-property-value-ecmascript": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/unicode-match-property-value-ecmascript/-/unicode-match-property-value-ecmascript-1.2.0.tgz",
	"integrity": "sha512-wjuQHGQVofmSJv1uVISKLE5zO2rNGzM/KCYZch/QQvez7C1hUhBIuZ701fYXExuufJFMPhv2SyL8CyoIfMLbIQ==",
	"dev": true
	},
	"unicode-property-aliases-ecmascript": {
	"version": "1.1.0",
	"resolved": "https://registry.npmjs.org/unicode-property-aliases-ecmascript/-/unicode-property-aliases-ecmascript-1.1.0.tgz",
	"integrity": "sha512-PqSoPh/pWetQ2phoj5RLiaqIk4kCNwoV3CI+LfGmWLKI3rE3kl1h59XpX2BjgDrmbxD9ARtQobPGU1SguCYuQg==",
	"dev": true
	},
	"union-value": {
	"version": "1.0.1",
	"resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.1.tgz",
	"integrity": "sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==",
	"requires": {
	"arr-union": "^3.1.0",
	"get-value": "^2.0.6",
	"is-extendable": "^0.1.1",
	"set-value": "^2.0.1"
	}
	},
	"unique-filename": {
	"version": "1.1.1",
	"resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz",
	"integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==",
	"requires": {
	"unique-slug": "^2.0.0"
	}
	},
	"unique-slug": {
	"version": "2.0.2",
	"resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz",
	"integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==",
	"requires": {
	"imurmurhash": "^0.1.4"
	}
	},
	"unset-value": {
	"version": "1.0.0",
	"resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz",
	"integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=",
	"requires": {
	"has-value": "^0.3.1",
	"isobject": "^3.0.0"
	},
	"dependencies": {
	"has-value": {
	"version": "0.3.1",
	"resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz",
	"integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=",
	"requires": {
	"get-value": "^2.0.3",
	"has-values": "^0.1.4",
	"isobject": "^2.0.0"
	},
	"dependencies": {
	"isobject": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz",
	"integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=",
	"requires": {
	"isarray": "1.0.0"
	}
	}
	}
	},
	"has-values": {
	"version": "0.1.4",
	"resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz",
	"integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E="
	}
	}
	},
	"upath": {
	"version": "1.2.0",
	"resolved": "https://registry.npmjs.org/upath/-/upath-1.2.0.tgz",
	"integrity": "sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg=="
	},
	"uri-js": {
	"version": "4.2.2",
	"resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.2.2.tgz",
	"integrity": "sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==",
	"requires": {
	"punycode": "^2.1.0"
	}
	},
	"urix": {
	"version": "0.1.0",
	"resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz",
	"integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI="
	},
	"url": {
	"version": "0.11.0",
	"resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz",
	"integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=",
	"requires": {
	"punycode": "1.3.2",
	"querystring": "0.2.0"
	},
	"dependencies": {
	"punycode": {
	"version": "1.3.2",
	"resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz",
	"integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0="
	}
	}
	},
	"use": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz",
	"integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ=="
	},
	"util": {
	"version": "0.11.1",
	"resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz",
	"integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==",
	"requires": {
	"inherits": "2.0.3"
	},
	"dependencies": {
	"inherits": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz",
	"integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4="
	}
	}
	},
	"util-deprecate": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
	"integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8="
	},
	"v8-compile-cache": {
	"version": "2.0.3",
	"resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.0.3.tgz",
	"integrity": "sha512-CNmdbwQMBjwr9Gsmohvm0pbL954tJrNzf6gWL3K+QMQf00PF7ERGrEiLgjuU3mKreLC2MeGhUsNV9ybTbLgd3w=="
	},
	"vm-browserify": {
	"version": "1.1.2",
	"resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz",
	"integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ=="
	},
	"w3c-keyname": {
	"version": "2.2.4",
	"resolved": "https://registry.npmjs.org/w3c-keyname/-/w3c-keyname-2.2.4.tgz",
	"integrity": "sha512-tOhfEwEzFLJzf6d1ZPkYfGj+FWhIpBux9ppoP3rlclw3Z0BZv3N7b7030Z1kYth+6rDuAsXUFr+d0VE6Ed1ikw=="
	},
	"watchpack": {
	"version": "1.6.0",
	"resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.6.0.tgz",
	"integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==",
	"requires": {
	"chokidar": "^2.0.2",
	"graceful-fs": "^4.1.2",
	"neo-async": "^2.5.0"
	}
	},
	"webpack": {
	"version": "4.42.0",
	"resolved": "https://registry.npmjs.org/webpack/-/webpack-4.42.0.tgz",
	"integrity": "sha512-EzJRHvwQyBiYrYqhyjW9AqM90dE4+s1/XtCfn7uWg6cS72zH+2VPFAlsnW0+W0cDi0XRjNKUMoJtpSi50+Ph6w==",
	"requires": {
	"@webassemblyjs/ast": "1.8.5",
	"@webassemblyjs/helper-module-context": "1.8.5",
	"@webassemblyjs/wasm-edit": "1.8.5",
	"@webassemblyjs/wasm-parser": "1.8.5",
	"acorn": "^6.2.1",
	"ajv": "^6.10.2",
	"ajv-keywords": "^3.4.1",
	"chrome-trace-event": "^1.0.2",
	"enhanced-resolve": "^4.1.0",
	"eslint-scope": "^4.0.3",
	"json-parse-better-errors": "^1.0.2",
	"loader-runner": "^2.4.0",
	"loader-utils": "^1.2.3",
	"memory-fs": "^0.4.1",
	"micromatch": "^3.1.10",
	"mkdirp": "^0.5.1",
	"neo-async": "^2.6.1",
	"node-libs-browser": "^2.2.1",
	"schema-utils": "^1.0.0",
	"tapable": "^1.1.3",
	"terser-webpack-plugin": "^1.4.3",
	"watchpack": "^1.6.0",
	"webpack-sources": "^1.4.1"
	}
	},
	"webpack-cli": {
	"version": "3.3.11",
	"resolved": "https://registry.npmjs.org/webpack-cli/-/webpack-cli-3.3.11.tgz",
	"integrity": "sha512-dXlfuml7xvAFwYUPsrtQAA9e4DOe58gnzSxhgrO/ZM/gyXTBowrsYeubyN4mqGhYdpXMFNyQ6emjJS9M7OBd4g==",
	"requires": {
	"chalk": "2.4.2",
	"cross-spawn": "6.0.5",
	"enhanced-resolve": "4.1.0",
	"findup-sync": "3.0.0",
	"global-modules": "2.0.0",
	"import-local": "2.0.0",
	"interpret": "1.2.0",
	"loader-utils": "1.2.3",
	"supports-color": "6.1.0",
	"v8-compile-cache": "2.0.3",
	"yargs": "13.2.4"
	},
	"dependencies": {
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"chalk": {
	"version": "2.4.2",
	"resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
	"integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
	"requires": {
	"ansi-styles": "^3.2.1",
	"escape-string-regexp": "^1.0.5",
	"supports-color": "^5.3.0"
	},
	"dependencies": {
	"supports-color": {
	"version": "5.5.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
	"integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
	"requires": {
	"has-flag": "^3.0.0"
	}
	}
	}
	},
	"emojis-list": {
	"version": "2.1.0",
	"resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz",
	"integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k="
	},
	"enhanced-resolve": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.0.tgz",
	"integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==",
	"requires": {
	"graceful-fs": "^4.1.2",
	"memory-fs": "^0.4.0",
	"tapable": "^1.0.0"
	}
	},
	"loader-utils": {
	"version": "1.2.3",
	"resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz",
	"integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==",
	"requires": {
	"big.js": "^5.2.2",
	"emojis-list": "^2.0.0",
	"json5": "^1.0.1"
	}
	},
	"supports-color": {
	"version": "6.1.0",
	"resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz",
	"integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==",
	"requires": {
	"has-flag": "^3.0.0"
	}
	}
	}
	},
	"webpack-sources": {
	"version": "1.4.3",
	"resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.4.3.tgz",
	"integrity": "sha512-lgTS3Xhv1lCOKo7SA5TjKXMjpSM4sBjNV5+q2bqesbSPs5FjGmU6jjtBSkX9b4qW87vDIsCIlUPOEhbZrMdjeQ==",
	"requires": {
	"source-list-map": "^2.0.0",
	"source-map": "~0.6.1"
	},
	"dependencies": {
	"source-map": {
	"version": "0.6.1",
	"resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
	"integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g=="
	}
	}
	},
	"which": {
	"version": "1.3.1",
	"resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz",
	"integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==",
	"requires": {
	"isexe": "^2.0.0"
	}
	},
	"which-module": {
	"version": "2.0.0",
	"resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz",
	"integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho="
	},
	"worker-farm": {
	"version": "1.7.0",
	"resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz",
	"integrity": "sha512-rvw3QTZc8lAxyVrqcSGVm5yP/IJ2UcB3U0graE3LCFoZ0Yn2x4EoVSqJKdB/T5M+FLcRPjz4TDacRf3OCfNUzw==",
	"requires": {
	"errno": "~0.1.7"
	}
	},
	"wrap-ansi": {
	"version": "5.1.0",
	"resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz",
	"integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==",
	"requires": {
	"ansi-styles": "^3.2.0",
	"string-width": "^3.0.0",
	"strip-ansi": "^5.0.0"
	},
	"dependencies": {
	"ansi-regex": {
	"version": "4.1.0",
	"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz",
	"integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg=="
	},
	"ansi-styles": {
	"version": "3.2.1",
	"resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
	"integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
	"requires": {
	"color-convert": "^1.9.0"
	}
	},
	"strip-ansi": {
	"version": "5.2.0",
	"resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz",
	"integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==",
	"requires": {
	"ansi-regex": "^4.1.0"
	}
	}
	}
	},
	"wrappy": {
	"version": "1.0.2",
	"resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
	"integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8="
	},
	"xtend": {
	"version": "4.0.2",
	"resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz",
	"integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ=="
	},
	"y18n": {
	"version": "4.0.0",
	"resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz",
	"integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w=="
	},
	"yallist": {
	"version": "3.1.1",
	"resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz",
	"integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g=="
	},
	"yargs": {
	"version": "13.2.4",
	"resolved": "https://registry.npmjs.org/yargs/-/yargs-13.2.4.tgz",
	"integrity": "sha512-HG/DWAJa1PAnHT9JAhNa8AbAv3FPaiLzioSjCcmuXXhP8MlpHO5vwls4g4j6n30Z74GVQj8Xa62dWVx1QCGklg==",
	"requires": {
	"cliui": "^5.0.0",
	"find-up": "^3.0.0",
	"get-caller-file": "^2.0.1",
	"os-locale": "^3.1.0",
	"require-directory": "^2.1.1",
	"require-main-filename": "^2.0.0",
	"set-blocking": "^2.0.0",
	"string-width": "^3.0.0",
	"which-module": "^2.0.0",
	"y18n": "^4.0.0",
	"yargs-parser": "^13.1.0"
	}
	},
	"yargs-parser": {
	"version": "13.1.1",
	"resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.1.tgz",
	"integrity": "sha512-oVAVsHz6uFrg3XQheFII8ESO2ssAf9luWuAd6Wexsu4F3OtIW0o8IribPXYrD4WC24LWtPrJlGy87y5udK+dxQ==",
	"requires": {
	"camelcase": "^5.0.0",
	"decamelize": "^1.2.0"
	}
	}
	}
	}
	diff --git a/prose/prose.js b/prose/prose.js
	index ae8b3ce..cb39c6d 100644
	--- a/prose/prose.js
	+++ b/prose/prose.js
	@@ -1,112 +1,120 @@
	// class MarkdownView {
	// constructor(target, content) {
	// this.textarea = target.appendChild(document.createElement("textarea"))
	// this.textarea.value = content
	// }

	// get content() { return this.textarea.value }
	// focus() { this.textarea.focus() }
	// destroy() { this.textarea.remove() }
	// }

	import { EditorView } from "prosemirror-view";
	import { EditorState, TextSelection } from "prosemirror-state";
	import { exampleSetup } from "prosemirror-example-setup";
	import { keymap } from "prosemirror-keymap";

	import { writeFreelyMarkdownParser } from "./markdownParser";
	import { writeFreelyMarkdownSerializer } from "./markdownSerializer";
	import { writeFreelySchema } from "./schema";
	import { getMenu } from "./menu";

	let $title = document.querySelector("#title");
	let $content = document.querySelector("#content");

	// Bugs:
	// 1. When there's just an empty line and a hard break is inserted with shift-enter then two enters are inserted
	// which do not show up in the markdown ( maybe bc. they are training enters )

	class ProseMirrorView {
	constructor(target, content) {
	let typingTimer;
	let localDraft = localStorage.getItem(window.draftKey);
	if (localDraft != null) {
	content = localDraft;
	}
	if (content.indexOf("# ") === 0) {
	let eol = content.indexOf("\n");
	let title = content.substring("# ".length, eol);
	content = content.substring(eol + "\n\n".length);
	$title.value = title;
	}

	const doc = writeFreelyMarkdownParser.parse(content)

	this.view = new EditorView(target, {
	state: EditorState.create({
	doc,
	plugins: [
	keymap({
	"Mod-Enter": () => {
	document.getElementById("publish").click();
	return true;
	},
	"Mod-k": () => {
	const linkButton = document.querySelector(
	".ProseMirror-icon[title='Add or remove link']"
	);
	linkButton.dispatchEvent(new Event("mousedown"));
	return true;
	},
	}),
	...exampleSetup({
	schema: writeFreelySchema,
	menuContent: getMenu(),
	}),
	],
	}),
	dispatchTransaction(transaction) {
	let newState = this.state.apply(transaction);
	const newContent = writeFreelyMarkdownSerializer
	.serialize(newState.doc)
	// Replace all \\\ns ( not followed by a \n ) with \n
	.replace(/(\\\n)(\n{0,1})/g, (match, p1, p2) =>
	p2 !== "\n" ? "\n" + p2 : match
	);
	$content.value = newContent;
	let draft = "";
	if ($title.value != null && $title.value !== "") {
	draft = "# " + $title.value + "\n\n";
	}
	draft += newContent;
	clearTimeout(typingTimer);
	typingTimer = setTimeout(doneTyping, doneTypingInterval);
	this.updateState(newState);
	},
	+ handleDOMEvents: {
	+ drop: (view, event) => {
	+ // If a file is dropped externally into the editor, do not insert anything. This will not trigger if an image has been inserted after upload and is dragged and dropped internally to change its position.
	+ if (event.dataTransfer.files.length > 0) {
	+ event.preventDefault();
	+ }
	+ }
	+ },
	});
	// Editor is focused to the last position. This is a workaround for a bug:
	// 1. 1 type something in an existing entry
	// 2. reload - works fine, the draft is reloaded
	// 3. reload again - the draft is somehow removed from localStorage and the original content is loaded
	// When the editor is focused the content is re-saved to localStorage

	// This is also useful for editing, so it's not a bad thing even
	const lastPosition = this.view.state.doc.content.size;
	const selection = TextSelection.create(this.view.state.doc, lastPosition);
	this.view.dispatch(this.view.state.tr.setSelection(selection));
	this.view.focus();
	}

	get content() {
	return writeFreelyMarkdownSerializer.serialize(this.view.state.doc);
	}
	focus() {
	this.view.focus();
	}
	destroy() {
	this.view.destroy();
	}
	}

	let place = document.querySelector("#editor");
	let view = new ProseMirrorView(place, $content.value);
	diff --git a/read.go b/read.go
	index f2706a9..a8c2352 100644
	--- a/read.go
	+++ b/read.go
	@@ -1,342 +1,342 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"fmt"
	"html/template"
	"math"
	"net/http"
	"strconv"
	"time"

	. "github.com/gorilla/feeds"
	"github.com/gorilla/mux"
	stripmd "github.com/writeas/go-strip-markdown/v2"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/log"
	"github.com/writeas/web-core/memo"
	"github.com/writefreely/writefreely/page"
	)

	const (
	tlFeedLimit = 100
	tlAPIPageLimit = 10
	tlMaxAuthorPosts = 5
	tlPostsPerPage = 16
	tlMaxPostCache = 250
	tlCacheDur = 10 * time.Minute
	)

	type localTimeline struct {
	m *memo.Memo
	posts *[]PublicPost

	// Configuration values
	postsPerPage int
	}

	type readPublication struct {
	page.StaticPage
	Posts *[]PublicPost
	CurrentPage int
	TotalPages int
	SelTopic string
	IsAdmin bool
	CanInvite bool

	// Customizable page content
	ContentTitle string
	Content template.HTML
	}

	func initLocalTimeline(app *App) {
	app.timeline = &localTimeline{
	postsPerPage: tlPostsPerPage,
	m: memo.New(app.FetchPublicPosts, tlCacheDur),
	}
	}

	// satisfies memo.Func
	func (app *App) FetchPublicPosts() (interface{}, error) {
	// Conditions
	limit := fmt.Sprintf("LIMIT %d", tlMaxPostCache)
	// This is better than the hard limit when limiting posts from individual authors
	// ageCond := `p.created >= ` + app.db.dateSub(3, "month") + ` AND `

	// Finds all public posts and posts in a public collection published during the owner's active subscription period and within the last 3 months
	rows, err := app.db.Query(`SELECT p.id, c.id, alias, c.title, p.slug, p.title, p.content, p.text_appearance, p.language, p.rtl, p.created, p.updated
	FROM collections c
	LEFT JOIN posts p ON p.collection_id = c.id
	LEFT JOIN users u ON u.id = p.owner_id
	WHERE c.privacy = 1 AND (p.created <= ` + app.db.now() + ` AND pinned_position IS NULL) AND u.status = 0
	ORDER BY p.created DESC
	` + limit)
	if err != nil {
	log.Error("Failed selecting from posts: %v", err)
	return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts." + err.Error()}
	}
	defer rows.Close()

	ap := map[string]uint{}

	posts := []PublicPost{}
	for rows.Next() {
	p := &Post{}
	c := &Collection{}
	var alias, title sql.NullString
	err = rows.Scan(&p.ID, &c.ID, &alias, &title, &p.Slug, &p.Title, &p.Content, &p.Font, &p.Language, &p.RTL, &p.Created, &p.Updated)
	if err != nil {
	log.Error("[READ] Unable to scan row, skipping: %v", err)
	continue
	}
	c.hostName = app.cfg.App.Host

	isCollectionPost := alias.Valid
	if isCollectionPost {
	c.Alias = alias.String
	if c.Alias != "" && ap[c.Alias] == tlMaxAuthorPosts {
	// Don't add post if we've hit the post-per-author limit
	continue
	}

	c.Public = true
	c.Title = title.String
	c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer")
	}

	p.extractData()
	p.handlePremiumContent(c, false, false, app.cfg)
	p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), "", app.cfg))
	fp := p.processPost()
	if isCollectionPost {
	fp.Collection = &CollectionObj{Collection: *c}
	}

	posts = append(posts, fp)
	ap[c.Alias]++
	}

	return posts, nil
	}

	func viewLocalTimelineAPI(app App, w http.ResponseWriter, r http.Request) error {
	updateTimelineCache(app.timeline, false)

	skip, _ := strconv.Atoi(r.FormValue("skip"))

	posts := []PublicPost{}
	for i := skip; i < skip+tlAPIPageLimit && i < len(*app.timeline.posts); i++ {
	posts = append(posts, (*app.timeline.posts)[i])
	}

	return impart.WriteSuccess(w, posts, http.StatusOK)
	}

	func viewLocalTimeline(app App, w http.ResponseWriter, r http.Request) error {
	if !app.cfg.App.LocalTimeline {
	return impart.HTTPError{http.StatusNotFound, "Page doesn't exist."}
	}

	vars := mux.Vars(r)
	var p int
	page := 1
	p, _ = strconv.Atoi(vars["page"])
	if p > 0 {
	page = p
	}

	return showLocalTimeline(app, w, r, page, vars["author"], vars["tag"])
	}

	// updateTimelineCache will reset and update the cache if it is stale or
	// the boolean passed in is true.
	func updateTimelineCache(tl *localTimeline, reset bool) {
	if reset {
	tl.m.Reset()
	}

	// Fetch posts if the cache is empty, has been reset or enough time has
	// passed since last cache.
	if tl.posts == nil \|\| reset \|\| tl.m.Invalidate() {
	log.Info("[READ] Updating post cache")

	postsInterfaces, err := tl.m.Get()
	if err != nil {
	log.Error("[READ] Unable to cache posts: %v", err)
	} else {
	castPosts := postsInterfaces.([]PublicPost)
	tl.posts = &castPosts
	}
	}

	}

	func showLocalTimeline(app App, w http.ResponseWriter, r http.Request, page int, author, tag string) error {
	updateTimelineCache(app.timeline, false)

	pl := len(*(app.timeline.posts))
	ttlPages := int(math.Ceil(float64(pl) / float64(app.timeline.postsPerPage)))

	start := 0
	if page > 1 {
	start = app.timeline.postsPerPage * (page - 1)
	if start > pl {
	return impart.HTTPError{http.StatusFound, fmt.Sprintf("/read/p/%d", ttlPages)}
	}
	}
	end := app.timeline.postsPerPage * page
	if end > pl {
	end = pl
	}
	var posts []PublicPost
	if author != "" {
	posts = []PublicPost{}
	for _, p := range *app.timeline.posts {
	if author == "anonymous" {
	if p.Collection == nil {
	posts = append(posts, p)
	}
	} else if p.Collection != nil && p.Collection.Alias == author {
	posts = append(posts, p)
	}
	}
	} else if tag != "" {
	posts = []PublicPost{}
	for _, p := range *app.timeline.posts {
	if p.HasTag(tag) {
	posts = append(posts, p)
	}
	}
	} else {
	posts = *app.timeline.posts
	posts = posts[start:end]
	}

	d := &readPublication{
	StaticPage: pageForReq(app, r),
	Posts: &posts,
	CurrentPage: page,
	TotalPages: ttlPages,
	SelTopic: tag,
	}
	if app.cfg.App.Chorus {
	u := getUserSession(app, r)
	d.IsAdmin = u != nil && u.IsAdmin()
	d.CanInvite = canUserInvite(app.cfg, d.IsAdmin)
	}
	c, err := getReaderSection(app)
	if err != nil {
	return err
	}
	d.ContentTitle = c.Title.String
	d.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg))

	err = templates["read"].ExecuteTemplate(w, "base", d)
	if err != nil {
	log.Error("Unable to render reader: %v", err)
	fmt.Fprintf(w, ":(")
	}
	return nil
	}

	// NextPageURL provides a full URL for the next page of collection posts
	func (c *readPublication) NextPageURL(n int) string {
	return fmt.Sprintf("/read/p/%d", n+1)
	}

	// PrevPageURL provides a full URL for the previous page of collection posts,
	// returning a /page/N result for pages >1
	func (c *readPublication) PrevPageURL(n int) string {
	if n == 2 {
	// Previous page is 1; no need for /p/ prefix
	return "/read"
	}
	return fmt.Sprintf("/read/p/%d", n-1)
	}

	// handlePostIDRedirect handles a route where a post ID is given and redirects
	// the user to the canonical post URL.
	func handlePostIDRedirect(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)
	postID := vars["post"]
	p, err := app.db.GetPost(postID, 0)
	if err != nil {
	return err
	}

	if !p.CollectionID.Valid {
	// No collection; send to normal URL
	// NOTE: not handling single user blogs here since this handler is only used for the Reader
	return impart.HTTPError{http.StatusFound, app.cfg.App.Host + "/" + postID + ".md"}
	}

	c, err := app.db.GetCollectionBy("id = ?", fmt.Sprintf("%d", p.CollectionID.Int64))
	if err != nil {
	return err
	}
	c.hostName = app.cfg.App.Host

	// Retrieve collection information and send user to canonical URL
	return impart.HTTPError{http.StatusFound, c.CanonicalURL() + p.Slug.String}
	}

	func viewLocalTimelineFeed(app App, w http.ResponseWriter, req http.Request) error {
	if !app.cfg.App.LocalTimeline {
	return impart.HTTPError{http.StatusNotFound, "Page doesn't exist."}
	}

	updateTimelineCache(app.timeline, false)

	feed := &Feed{
	Title: app.cfg.App.SiteName + " Reader",
	Link: &Link{Href: app.cfg.App.Host},
	Description: "Read the latest posts from " + app.cfg.App.SiteName + ".",
	Created: time.Now(),
	}

	c := 0
	var title, permalink, author string
	for _, p := range *app.timeline.posts {
	if c == tlFeedLimit {
	break
	}

	title = p.PlainDisplayTitle()
	permalink = p.CanonicalURL(app.cfg.App.Host)
	if p.Collection != nil {
	author = p.Collection.Title
	} else {
	author = "Anonymous"
	}
	i := &Item{
	Id: app.cfg.App.Host + "/read/a/" + p.ID,
	Title: title,
	Link: &Link{Href: permalink},
	Description: "<![CDATA[" + stripmd.Strip(p.Content) + "]]>",
	Content: applyMarkdown([]byte(p.Content), "", app.cfg),
	Author: &Author{author, ""},
	Created: p.Created,
	Updated: p.Updated,
	}
	feed.Items = append(feed.Items, i)
	c++
	}

	rss, err := feed.ToRss()
	if err != nil {
	return err
	}

	fmt.Fprint(w, rss)
	return nil
	}
	diff --git a/request.go b/request.go
	index 2eb29f5..0bb6e92 100644
	--- a/request.go
	+++ b/request.go
	@@ -1,22 +1,22 @@
	/*
	- * Copyright © 2018 A Bunch Tell LLC.
	+ * Copyright © 2018 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"mime"
	"net/http"
	)

	func IsJSON(r *http.Request) bool {
	ct, _, _ := mime.ParseMediaType(r.Header.Get("Content-Type"))
	accept := r.Header.Get("Accept")
	return ct == "application/json" \|\| accept == "application/json"
	}
	diff --git a/routes.go b/routes.go
	index e1b6261..6f4e592 100644
	--- a/routes.go
	+++ b/routes.go
	@@ -1,242 +1,242 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"net/http"
	"net/url"
	"path/filepath"
	"strings"

	"github.com/gorilla/csrf"
	"github.com/gorilla/mux"
	"github.com/writeas/go-webfinger"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/go-nodeinfo"
	)

	// InitStaticRoutes adds routes for serving static files.
	// TODO: this should just be a func, not method
	func (app App) InitStaticRoutes(r mux.Router) {
	// Handle static files
	fs := http.FileServer(http.Dir(filepath.Join(app.cfg.Server.StaticParentDir, staticDir)))
	fs = cacheControl(fs)
	app.shttp = http.NewServeMux()
	app.shttp.Handle("/", fs)
	r.PathPrefix("/").Handler(fs)
	}

	// InitRoutes adds dynamic routes for the given mux.Router.
	func InitRoutes(apper Apper, r mux.Router) mux.Router {
	// Create handler
	handler := NewWFHandler(apper)

	// Set up routes
	hostSubroute := apper.App().cfg.App.Host[strings.Index(apper.App().cfg.App.Host, "://")+3:]
	if apper.App().cfg.App.SingleUser {
	hostSubroute = "{domain}"
	} else {
	if strings.HasPrefix(hostSubroute, "localhost") {
	hostSubroute = "localhost"
	}
	}

	if apper.App().cfg.App.SingleUser {
	log.Info("Adding %s routes (single user)...", hostSubroute)
	} else {
	log.Info("Adding %s routes (multi-user)...", hostSubroute)
	}

	// Primary app routes
	write := r.PathPrefix("/").Subrouter()

	// Federation endpoint configurations
	wf := webfinger.Default(wfResolver{apper.App().db, apper.App().cfg})
	wf.NoTLSHandler = nil

	// Federation endpoints
	// host-meta
	write.HandleFunc("/.well-known/host-meta", handler.Web(handleViewHostMeta, UserLevelReader))
	// webfinger
	write.HandleFunc(webfinger.WebFingerPath, handler.LogHandlerFunc(http.HandlerFunc(wf.Webfinger)))
	// nodeinfo
	niCfg := nodeInfoConfig(apper.App().db, apper.App().cfg)
	ni := nodeinfo.NewService(*niCfg, nodeInfoResolver{apper.App().cfg, apper.App().db})
	write.HandleFunc(nodeinfo.NodeInfoPath, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfoDiscover)))
	write.HandleFunc(niCfg.InfoURL, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfo)))

	// handle mentions
	write.HandleFunc("/@/{handle}", handler.Web(handleViewMention, UserLevelReader))

	configureSlackOauth(handler, write, apper.App())
	configureWriteAsOauth(handler, write, apper.App())
	configureGitlabOauth(handler, write, apper.App())
	configureGenericOauth(handler, write, apper.App())
	configureGiteaOauth(handler, write, apper.App())

	// Set up dyamic page handlers
	// Handle auth
	auth := write.PathPrefix("/api/auth/").Subrouter()
	if apper.App().cfg.App.OpenRegistration {
	auth.HandleFunc("/signup", handler.All(apiSignup)).Methods("POST")
	}
	auth.HandleFunc("/login", handler.All(login)).Methods("POST")
	auth.HandleFunc("/read", handler.WebErrors(handleWebCollectionUnlock, UserLevelNone)).Methods("POST")
	auth.HandleFunc("/me", handler.All(handleAPILogout)).Methods("DELETE")

	// Handle logged in user sections
	me := write.PathPrefix("/me").Subrouter()
	me.HandleFunc("/", handler.Redirect("/me", UserLevelUser))
	me.HandleFunc("/c", handler.Redirect("/me/c/", UserLevelUser)).Methods("GET")
	me.HandleFunc("/c/", handler.User(viewCollections)).Methods("GET")
	me.HandleFunc("/c/{collection}", handler.User(viewEditCollection)).Methods("GET")
	me.HandleFunc("/c/{collection}/stats", handler.User(viewStats)).Methods("GET")
	me.Path("/delete").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(handleUserDelete))).Methods("POST")
	me.HandleFunc("/posts", handler.Redirect("/me/posts/", UserLevelUser)).Methods("GET")
	me.HandleFunc("/posts/", handler.User(viewArticles)).Methods("GET")
	me.HandleFunc("/posts/export.csv", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
	me.HandleFunc("/posts/export.zip", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
	me.HandleFunc("/posts/export.json", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
	me.HandleFunc("/export", handler.User(viewExportOptions)).Methods("GET")
	me.HandleFunc("/export.json", handler.Download(viewExportFull, UserLevelUser)).Methods("GET")
	me.HandleFunc("/import", handler.User(viewImport)).Methods("GET")
	me.Path("/settings").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(viewSettings))).Methods("GET")
	me.HandleFunc("/invites", handler.User(handleViewUserInvites)).Methods("GET")
	me.HandleFunc("/logout", handler.Web(viewLogout, UserLevelNone)).Methods("GET")

	write.HandleFunc("/api/me", handler.All(viewMeAPI)).Methods("GET")
	apiMe := write.PathPrefix("/api/me/").Subrouter()
	apiMe.HandleFunc("/", handler.All(viewMeAPI)).Methods("GET")
	apiMe.HandleFunc("/posts", handler.UserWebAPI(viewMyPostsAPI)).Methods("GET")
	apiMe.HandleFunc("/collections", handler.UserAPI(viewMyCollectionsAPI)).Methods("GET")
	apiMe.HandleFunc("/password", handler.All(updatePassphrase)).Methods("POST")
	apiMe.HandleFunc("/self", handler.All(updateSettings)).Methods("POST")
	apiMe.HandleFunc("/invites", handler.User(handleCreateUserInvite)).Methods("POST")
	apiMe.HandleFunc("/import", handler.User(handleImport)).Methods("POST")
	apiMe.HandleFunc("/oauth/remove", handler.User(removeOauth)).Methods("POST")

	// Sign up validation
	write.HandleFunc("/api/alias", handler.All(handleUsernameCheck)).Methods("POST")

	write.HandleFunc("/api/markdown", handler.All(handleRenderMarkdown)).Methods("POST")

	instanceURL, _ := url.Parse(apper.App().Config().App.Host)
	host := instanceURL.Host

	// Handle collections
	write.HandleFunc("/api/collections", handler.All(newCollection)).Methods("POST")
	apiColls := write.PathPrefix("/api/collections/").Subrouter()
	apiColls.HandleFunc("/monetization-pointer", handler.PlainTextAPI(handleSPSPEndpoint)).Methods("GET")
	apiColls.HandleFunc("/"+host, handler.AllReader(fetchCollection)).Methods("GET")
	apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.AllReader(fetchCollection)).Methods("GET")
	apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.All(existingCollection)).Methods("POST", "DELETE")
	apiColls.HandleFunc("/{alias}/posts", handler.AllReader(fetchCollectionPosts)).Methods("GET")
	apiColls.HandleFunc("/{alias}/posts", handler.All(newPost)).Methods("POST")
	apiColls.HandleFunc("/{alias}/posts/{post}", handler.AllReader(fetchPost)).Methods("GET")
	apiColls.HandleFunc("/{alias}/posts/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST")
	apiColls.HandleFunc("/{alias}/posts/{post}/splitcontent", handler.AllReader(handleGetSplitContent)).Methods("GET", "POST")
	apiColls.HandleFunc("/{alias}/posts/{post}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET")
	apiColls.HandleFunc("/{alias}/collect", handler.All(addPost)).Methods("POST")
	apiColls.HandleFunc("/{alias}/pin", handler.All(pinPost)).Methods("POST")
	apiColls.HandleFunc("/{alias}/unpin", handler.All(pinPost)).Methods("POST")
	apiColls.HandleFunc("/{alias}/email/subscribe", handler.All(handleCreateEmailSubscription)).Methods("POST")
	apiColls.HandleFunc("/{alias}/email/subscribe", handler.All(handleDeleteEmailSubscription)).Methods("DELETE")
	apiColls.HandleFunc("/{collection}/email/unsubscribe", handler.All(handleDeleteEmailSubscription)).Methods("GET")
	apiColls.HandleFunc("/{alias}/inbox", handler.All(handleFetchCollectionInbox)).Methods("POST")
	apiColls.HandleFunc("/{alias}/outbox", handler.AllReader(handleFetchCollectionOutbox)).Methods("GET")
	apiColls.HandleFunc("/{alias}/following", handler.AllReader(handleFetchCollectionFollowing)).Methods("GET")
	apiColls.HandleFunc("/{alias}/followers", handler.AllReader(handleFetchCollectionFollowers)).Methods("GET")

	// Handle posts
	write.HandleFunc("/api/posts", handler.All(newPost)).Methods("POST")
	posts := write.PathPrefix("/api/posts/").Subrouter()
	posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.AllReader(fetchPost)).Methods("GET")
	posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST", "PUT")
	posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}", handler.All(deletePost)).Methods("DELETE")
	posts.HandleFunc("/{post:[a-zA-Z0-9]{10}}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET")
	posts.HandleFunc("/claim", handler.All(addPost)).Methods("POST")
	posts.HandleFunc("/disperse", handler.All(dispersePost)).Methods("POST")

	write.HandleFunc("/auth/signup", handler.Web(handleWebSignup, UserLevelNoneRequired)).Methods("POST")
	write.HandleFunc("/auth/login", handler.Web(webLogin, UserLevelNoneRequired)).Methods("POST")

	write.HandleFunc("/admin", handler.Admin(handleViewAdminDash)).Methods("GET")
	write.HandleFunc("/admin/monitor", handler.Admin(handleViewAdminMonitor)).Methods("GET")
	write.HandleFunc("/admin/settings", handler.Admin(handleViewAdminSettings)).Methods("GET")
	write.HandleFunc("/admin/users", handler.Admin(handleViewAdminUsers)).Methods("GET")
	write.HandleFunc("/admin/user/{username}", handler.Admin(handleViewAdminUser)).Methods("GET")
	write.HandleFunc("/admin/user/{username}/delete", handler.Admin(handleAdminDeleteUser)).Methods("POST")
	write.HandleFunc("/admin/user/{username}/status", handler.Admin(handleAdminToggleUserStatus)).Methods("POST")
	write.HandleFunc("/admin/user/{username}/passphrase", handler.Admin(handleAdminResetUserPass)).Methods("POST")
	write.HandleFunc("/admin/pages", handler.Admin(handleViewAdminPages)).Methods("GET")
	write.HandleFunc("/admin/page/{slug}", handler.Admin(handleViewAdminPage)).Methods("GET")
	write.HandleFunc("/admin/update/config", handler.AdminApper(handleAdminUpdateConfig)).Methods("POST")
	write.HandleFunc("/admin/update/{page}", handler.Admin(handleAdminUpdateSite)).Methods("POST")
	write.HandleFunc("/admin/updates", handler.Admin(handleViewAdminUpdates)).Methods("GET")

	// Handle special pages first
	write.HandleFunc("/login", handler.Web(viewLogin, UserLevelNoneRequired))
	write.HandleFunc("/signup", handler.Web(handleViewLanding, UserLevelNoneRequired))
	write.HandleFunc("/invite/{code:[a-zA-Z0-9]+}", handler.Web(handleViewInvite, UserLevelOptional)).Methods("GET")
	// TODO: show a reader-specific 404 page if the function is disabled
	write.HandleFunc("/read", handler.Web(viewLocalTimeline, UserLevelReader))
	RouteRead(handler, UserLevelReader, write.PathPrefix("/read").Subrouter())

	draftEditPrefix := ""
	if apper.App().cfg.App.SingleUser {
	draftEditPrefix = "/d"
	write.HandleFunc("/me/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
	} else {
	write.HandleFunc("/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
	}

	// All the existing stuff
	write.HandleFunc(draftEditPrefix+"/{action}/edit", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
	write.HandleFunc(draftEditPrefix+"/{action}/meta", handler.Web(handleViewMeta, UserLevelUser)).Methods("GET")
	// Collections
	if apper.App().cfg.App.SingleUser {
	RouteCollections(handler, write.PathPrefix("/").Subrouter())
	} else {
	write.HandleFunc("/{prefix:[@~$!\\-+]}{collection}", handler.Web(handleViewCollection, UserLevelReader))
	write.HandleFunc("/{collection}/", handler.Web(handleViewCollection, UserLevelReader))
	RouteCollections(handler, write.PathPrefix("/{prefix:[@~$!\\-+]?}{collection}").Subrouter())
	// Posts
	}
	write.HandleFunc(draftEditPrefix+"/{post}", handler.Web(handleViewPost, UserLevelOptional))
	write.HandleFunc("/", handler.Web(handleViewHome, UserLevelOptional))

	return r
	}

	func RouteCollections(handler Handler, r mux.Router) {
	r.HandleFunc("/logout", handler.Web(handleLogOutCollection, UserLevelOptional))
	r.HandleFunc("/page/{page:[0-9]+}", handler.Web(handleViewCollection, UserLevelReader))
	r.HandleFunc("/tag:{tag}", handler.Web(handleViewCollectionTag, UserLevelReader))
	r.HandleFunc("/tag:{tag}/feed/", handler.Web(ViewFeed, UserLevelReader))
	r.HandleFunc("/sitemap.xml", handler.AllReader(handleViewSitemap))
	r.HandleFunc("/feed/", handler.AllReader(ViewFeed))
	r.HandleFunc("/email/confirm/{subscriber}", handler.All(handleConfirmEmailSubscription)).Methods("GET")
	r.HandleFunc("/email/unsubscribe/{subscriber}", handler.All(handleDeleteEmailSubscription)).Methods("GET")
	r.HandleFunc("/{slug}", handler.CollectionPostOrStatic)
	r.HandleFunc("/{slug}/edit", handler.Web(handleViewPad, UserLevelUser))
	r.HandleFunc("/{slug}/edit/meta", handler.Web(handleViewMeta, UserLevelUser))
	r.HandleFunc("/{slug}/", handler.Web(handleCollectionPostRedirect, UserLevelReader)).Methods("GET")
	}

	func RouteRead(handler Handler, readPerm UserLevelFunc, r mux.Router) {
	r.HandleFunc("/api/posts", handler.Web(viewLocalTimelineAPI, readPerm))
	r.HandleFunc("/p/{page}", handler.Web(viewLocalTimeline, readPerm))
	r.HandleFunc("/feed/", handler.Web(viewLocalTimelineFeed, readPerm))
	r.HandleFunc("/t/{tag}", handler.Web(viewLocalTimeline, readPerm))
	r.HandleFunc("/a/{post}", handler.Web(handlePostIDRedirect, readPerm))
	r.HandleFunc("/{author}", handler.Web(viewLocalTimeline, readPerm))
	r.HandleFunc("/", handler.Web(viewLocalTimeline, readPerm))
	}
	diff --git a/scripts/invalidate-css.sh b/scripts/invalidate-css.sh
	index c411f70..295599e 100755
	--- a/scripts/invalidate-css.sh
	+++ b/scripts/invalidate-css.sh
	@@ -1,37 +1,37 @@
	#!/bin/bash
	#
	-# Copyright © 2020 A Bunch Tell LLC.
	+# Copyright © 2020 Musing Studio LLC.
	#
	# This file is part of WriteFreely.
	#
	# WriteFreely is free software: you can redistribute it and/or modify
	# it under the terms of the GNU Affero General Public License, included
	# in the LICENSE file in this source code package.
	#
	###############################################################################
	#
	# WriteFreely CSS invalidation script
	#
	# usage: ./invalidate-css.sh <build-directory>
	#
	# This script provides an automated way to invalidate stylesheets cached in the
	# browser. It uses the last git commit hashes of the most frequently modified
	# LESS files in the project and appends them to the stylesheet `href` in all
	# template files.
	#
	# This is designed to be used when building a WriteFreely release.
	#
	###############################################################################

	# Get parent build directory from first argument
	buildDir=$1

	# Get short hash of each primary LESS file's last commit
	cssHash=$(git log -n 1 --pretty=format:%h -- less/core.less)
	cssNewHash=$(git log -n 1 --pretty=format:%h -- less/new-core.less)
	cssPadHash=$(git log -n 1 --pretty=format:%h -- less/pad.less)

	echo "Adding write.css version ($cssHash $cssNewHash $cssPadHash) to .tmpl files..."
	cd "$buildDir/templates" \|\| exit 1
	find . -type f -name "*.tmpl" -print0 \| xargs -0 sed -i "s/write.css/write.css?${cssHash}${cssNewHash}${cssPadHash}/g"
	find . -type f -name "*.tmpl" -print0 \| xargs -0 sed -i "s/{{.Theme}}.css/{{.Theme}}.css?${cssHash}${cssNewHash}${cssPadHash}/g"
	\ No newline at end of file
	diff --git a/scripts/upgrade-server.sh b/scripts/upgrade-server.sh
	index 581085d..b129943 100755
	--- a/scripts/upgrade-server.sh
	+++ b/scripts/upgrade-server.sh
	@@ -1,108 +1,108 @@
	#! /bin/bash
	###############################################################################
	## writefreely update script ##
	## ##
	## WARNING: running this script will overwrite any modifed assets or ##
	## template files. If you have any custom changes to these files you ##
	## should back them up FIRST. ##
	## ##
	## This must be run from the web application root directory ##
	## i.e. /var/www/writefreely, and operates under the assumption that you##
	## have not installed the binary `writefreely` in another location. ##
	###############################################################################
	#
	-# Copyright © 2019-2020 A Bunch Tell LLC.
	+# Copyright © 2019-2020 Musing Studio LLC.
	#
	# This file is part of WriteFreely.
	#
	# WriteFreely is free software: you can redistribute it and/or modify
	# it under the terms of the GNU Affero General Public License, included
	# in the LICENSE file in this source code package.
	#


	# only execute as root, or use sudo

	if [[ `id -u` -ne 0 ]]; then
	echo "You must login as root, or execute this script with sudo"
	exit 10
	fi

	# go ahead and check for the latest release on linux
	echo "Checking for updates..."

	url=`curl -s https://api.github.com/repos/writeas/writefreely/releases/latest \| grep 'browser_' \| grep 'linux' \| grep 'amd64' \| cut -d\" -f4`

	# check current version

	bin_output=`./writefreely -v`
	if [ -z "$bin_output" ]; then
	exit 1
	fi

	current=${bin_output:12:5}
	echo "Current version is v$current"

	# grab latest version number
	IFS='/'
	read -ra parts <<< "$url"

	latest=${parts[-2]}
	echo "Latest release is $latest"


	IFS='.'
	read -ra cv <<< "$current"
	read -ra lv <<< "${latest#v}"

	IFS=' '
	tempdir=$(mktemp -d)


	if [[ ${lv[0]} -gt ${cv[0]} ]]; then
	echo "New major version available."
	echo "Downloading..."
	`wget -P $tempdir -q --show-progress $url`
	elif [[ ${lv[0]} -eq ${cv[0]} ]] && [[ ${lv[1]} -gt ${cv[1]} ]]; then
	echo "New minor version available."
	echo "Downloading..."
	`wget -P $tempdir -q --show-progress $url`
	elif [[ ${lv[2]} -gt ${cv[2]} ]]; then
	echo "New patch version available."
	echo "Downloading..."
	`wget -P $tempdir -q --show-progress $url`
	else
	echo "Up to date."
	exit 0
	fi

	filename=${parts[-1]}

	# extract
	echo "Extracting files..."
	tar -zxf $tempdir/$filename -C $tempdir

	# stop service
	echo "Stopping writefreely systemd service..."
	if `systemctl start writefreely`; then
	echo "Success, service stopped."
	else
	echo "Upgrade failed to stop the systemd service, exiting early."
	exit 1
	fi

	# copy files
	echo "Copying files..."
	cp -r $tempdir/writefreely/{pages,static,templates,writefreely} .

	# migrate db
	./writefreely -migrate

	# restart service
	echo "Starting writefreely systemd service..."
	if `systemctl start writefreely`; then
	echo "Success, version has been upgraded to $latest."
	else
	echo "Upgrade complete, but failed to restart service."
	exit 1
	fi
	diff --git a/session.go b/session.go
	index 100842f..03d3963 100644
	--- a/session.go
	+++ b/session.go
	@@ -1,145 +1,146 @@
	/*
	- * Copyright © 2018-2019 A Bunch Tell LLC.
	+ * Copyright © 2018-2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"encoding/gob"
	"github.com/gorilla/sessions"
	"github.com/writeas/web-core/log"
	"net/http"
	"strings"
	)

	const (
	day = 86400
	sessionLength = 180 * day

	userEmailCookieName = "ue"
	userEmailCookieVal = "email"

	cookieName = "wfu"
	cookieUserVal = "u"

	blogPassCookieName = "ub"
	)

	// InitSession creates the cookie store. It depends on the keychain already
	// being loaded.
	func (app *App) InitSession() {
	// Register complex data types we'll be storing in cookies
	gob.Register(&User{})

	// Create the cookie store
	store := sessions.NewCookieStore(app.keys.CookieAuthKey, app.keys.CookieKey)
	store.Options = &sessions.Options{
	Path: "/",
	MaxAge: sessionLength,
	HttpOnly: true,
	Secure: strings.HasPrefix(app.cfg.App.Host, "https://"),
	}
	if store.Options.Secure {
	store.Options.SameSite = http.SameSiteNoneMode
	}
	app.sessionStore = store
	}

	func getSessionFlashes(app App, w http.ResponseWriter, r http.Request, session *sessions.Session) ([]string, error) {
	var err error
	if session == nil {
	session, err = app.sessionStore.Get(r, cookieName)
	if err != nil {
	return nil, err
	}
	}

	f := []string{}
	if flashes := session.Flashes(); len(flashes) > 0 {
	for _, flash := range flashes {
	if str, ok := flash.(string); ok {
	f = append(f, str)
	}
	}
	}
	saveUserSession(app, r, w)

	return f, nil
	}

	func addSessionFlash(app App, w http.ResponseWriter, r http.Request, m string, session *sessions.Session) error {
	var err error
	if session == nil {
	session, err = app.sessionStore.Get(r, cookieName)
	}

	if err != nil {
	log.Error("Unable to add flash '%s': %v", m, err)
	return err
	}

	session.AddFlash(m)
	saveUserSession(app, r, w)
	return nil
	}

	func getUserAndSession(app App, r http.Request) (User, sessions.Session) {
	session, err := app.sessionStore.Get(r, cookieName)
	if err == nil {
	// Got the currently logged-in user
	val := session.Values[cookieUserVal]
	var u = &User{}
	var ok bool
	if u, ok = val.(*User); ok {
	return u, session
	}
	}

	return nil, nil
	}

	func getUserSession(app App, r http.Request) *User {
	u, _ := getUserAndSession(app, r)
	return u
	}

	func saveUserSession(app App, r http.Request, w http.ResponseWriter) error {
	session, err := app.sessionStore.Get(r, cookieName)
	if err != nil {
	return ErrInternalCookieSession
	}

	// Extend the session
	session.Options.MaxAge = int(sessionLength)

	// Remove any information that accidentally got added
	// FIXME: find where Plan information is getting saved to cookie.
	val := session.Values[cookieUserVal]
	var u = &User{}
	var ok bool
	if u, ok = val.(*User); ok {
	session.Values[cookieUserVal] = u.Cookie()
	}

	err = session.Save(r, w)
	if err != nil {
	log.Error("Couldn't saveUserSession: %v", err)
	}
	return err
	}

	-func getFullUserSession(app App, r http.Request) *User {
	+func getFullUserSession(app App, r http.Request) (*User, error) {
	u := getUserSession(app, r)
	if u == nil {
	- return nil
	+ return nil, nil
	}

	- u, _ = app.db.GetUserByID(u.ID)
	- return u
	+ var err error
	+ u, err = app.db.GetUserByID(u.ID)
	+ return u, err
	}
	diff --git a/sitemap.go b/sitemap.go
	index 00e148f..0bbcefb 100644
	--- a/sitemap.go
	+++ b/sitemap.go
	@@ -1,109 +1,109 @@
	/*
	- * Copyright © 2018-2019 A Bunch Tell LLC.
	+ * Copyright © 2018-2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"fmt"
	"net/http"
	"time"

	"github.com/gorilla/mux"
	"github.com/ikeikeikeike/go-sitemap-generator/v2/stm"
	"github.com/writeas/web-core/log"
	)

	func buildSitemap(host, alias string) *stm.Sitemap {
	sm := stm.NewSitemap(0)
	sm.SetDefaultHost(host)
	if alias != "/" {
	sm.SetSitemapsPath(alias)
	}

	sm.Create()

	// Note: Do not call `sm.Finalize()` because it flushes
	// the underlying datastructure from memory to disk.

	return sm
	}

	func handleViewSitemap(app App, w http.ResponseWriter, r http.Request) error {
	vars := mux.Vars(r)

	// Determine canonical blog URL
	alias := vars["collection"]
	subdomain := vars["subdomain"]
	isSubdomain := subdomain != ""
	if isSubdomain {
	alias = subdomain
	}

	host := fmt.Sprintf("%s/%s/", app.cfg.App.Host, alias)
	var c *Collection
	var err error
	pre := "/"
	if app.cfg.App.SingleUser {
	c, err = app.db.GetCollectionByID(1)
	} else {
	c, err = app.db.GetCollection(alias)
	}
	if err != nil {
	return err
	}
	c.hostName = app.cfg.App.Host

	if !isSubdomain {
	pre += alias + "/"
	}
	host = c.CanonicalURL()

	sm := buildSitemap(host, pre)
	posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false)
	if err != nil {
	log.Error("Error getting posts: %v", err)
	return err
	}
	lastSiteMod := time.Now()
	for i, p := range *posts {
	if i == 0 {
	lastSiteMod = p.Updated
	}
	u := stm.URL{
	{"loc", p.Slug.String},
	{"changefreq", "weekly"},
	{"mobile", true},
	{"lastmod", p.Updated},
	}
	if len(p.Images) > 0 {
	imgs := []stm.URL{}
	for _, i := range p.Images {
	imgs = append(imgs, stm.URL{
	{"loc", i},
	{"title", ""},
	})
	}
	u = append(u, []interface{}{"image", imgs})
	}
	sm.Add(u)
	}

	// Add top URL
	sm.Add(stm.URL{
	{"loc", pre},
	{"changefreq", "daily"},
	{"priority", "1.0"},
	{"lastmod", lastSiteMod},
	})

	w.Write(sm.XMLContent())

	return nil
	}
	diff --git a/static/js/modals.js b/static/js/modals.js
	index 6705afa..0910d7e 100644
	--- a/static/js/modals.js
	+++ b/static/js/modals.js
	@@ -1,24 +1,24 @@
	/*
	- * Copyright © 2016-2021 A Bunch Tell LLC.
	+ * Copyright © 2016-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	function showModal(id) {
	document.getElementById('overlay').style.display = 'block';
	document.getElementById('modal-'+id).style.display = 'block';
	}

	var closeModals = function(e) {
	e.preventDefault();
	document.getElementById('overlay').style.display = 'none';
	var modals = document.querySelectorAll('.modal');
	for (var i=0; i<modals.length; i++) {
	modals[i].style.display = 'none';
	}
	};
	H.getEl('overlay').on('click', closeModals);
	\ No newline at end of file
	diff --git a/static/js/webmonetization.js b/static/js/webmonetization.js
	index bbd828c..0e5faa7 100644
	--- a/static/js/webmonetization.js
	+++ b/static/js/webmonetization.js
	@@ -1,94 +1,94 @@
	/*
	- * Copyright © 2020-2021 A Bunch Tell LLC.
	+ * Copyright © 2020-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	let unlockingSplitContent = false;
	let unlockedSplitContent = false;
	let pendingSplitContent = false;

	function showWMPaywall($content, $split) {
	let $readmoreSell = document.createElement('div')
	$readmoreSell.id = 'readmore-sell';
	$content.insertAdjacentElement('beforeend', $readmoreSell);
	$readmoreSell.appendChild($split);
	$readmoreSell.insertAdjacentHTML("beforeend", '\n\n<p class="font sans">For <strong>$5 per month</strong>, you can read this and other great writing across our site and other websites that support Web Monetization.</p>')
	$readmoreSell.insertAdjacentHTML("beforeend", '\n\n<p class="font sans"><a href="https://coil.com/signup?ref=writefreely" class="btn cta" target="coil">Get started</a> <a href="https://coil.com/?ref=writefreely" class="btn cta secondary">Learn more</a></p>')
	}

	function initMonetization() {
	let $content = document.querySelector('.e-content')
	let $post = document.getElementById('post-body')
	let $split = $post.querySelector('.split')
	if (document.monetization === undefined \|\| $split == null) {
	if ($split) {
	showWMPaywall($content, $split)
	}
	return
	}

	document.monetization.addEventListener('monetizationstop', function(event) {
	if (pendingSplitContent) {
	// We've seen the 'pending' activity, so we can assume things will work
	document.monetization.removeEventListener('monetizationstop', progressHandler)
	return
	}

	// We're getting 'stop' without ever starting, so display the paywall.
	showWMPaywall($content, $split)
	});

	document.monetization.addEventListener('monetizationpending', function (event) {
	pendingSplitContent = true
	})

	let progressHandler = function(event) {
	if (unlockedSplitContent) {
	document.monetization.removeEventListener('monetizationprogress', progressHandler)
	return
	}
	if (!unlockingSplitContent && !unlockedSplitContent) {
	unlockingSplitContent = true
	getSplitContent(event.detail.receipt, function (status, data) {
	unlockingSplitContent = false
	if (status == 200) {
	$split.textContent = "Your subscriber perks start here."
	$split.insertAdjacentHTML("afterend", "\n\n"+data.data.html_body)
	} else {
	$split.textContent = "Something went wrong while unlocking subscriber content."
	}
	unlockedSplitContent = true
	})
	}
	}

	function getSplitContent(receipt, callback) {
	let params = "receipt="+encodeURIComponent(receipt)

	let http = new XMLHttpRequest();
	http.open("POST", "/api/collections/" + window.collAlias + "/posts/" + window.postSlug + "/splitcontent", true);

	// Send the proper header information along with the request
	http.setRequestHeader("Content-type", "application/x-www-form-urlencoded");

	http.onreadystatechange = function () {
	if (http.readyState == 4) {
	callback(http.status, JSON.parse(http.responseText));
	}
	}
	http.send(params);
	}

	document.monetization.addEventListener('monetizationstart', function() {
	if (!unlockedSplitContent) {
	$split.textContent = "Unlocking subscriber content..."
	}
	document.monetization.removeEventListener('monetizationstart', progressHandler)
	});
	document.monetization.addEventListener('monetizationprogress', progressHandler);
	}
	\ No newline at end of file
	diff --git a/templates.go b/templates.go
	index e0c728e..ecd8750 100644
	--- a/templates.go
	+++ b/templates.go
	@@ -1,229 +1,229 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"errors"
	"html/template"
	"io"
	"io/ioutil"
	"net/http"
	"os"
	"path/filepath"
	"strings"

	"github.com/dustin/go-humanize"
	"github.com/writeas/web-core/l10n"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/config"
	)

	var (
	templates = map[string]*template.Template{}
	pages = map[string]*template.Template{}
	userPages = map[string]*template.Template{}
	funcMap = template.FuncMap{
	"largeNumFmt": largeNumFmt,
	"pluralize": pluralize,
	"isRTL": isRTL,
	"isLTR": isLTR,
	"localstr": localStr,
	"localhtml": localHTML,
	"tolower": strings.ToLower,
	"title": strings.Title,
	"hasPrefix": strings.HasPrefix,
	"hasSuffix": strings.HasSuffix,
	"dict": dict,
	}
	)

	const (
	templatesDir = "templates"
	pagesDir = "pages"
	)

	func showUserPage(w http.ResponseWriter, name string, obj interface{}) {
	if obj == nil {
	log.Error("showUserPage: data is nil!")
	return
	}
	if err := userPages[filepath.Join("user", name+".tmpl")].ExecuteTemplate(w, name, obj); err != nil {
	log.Error("Error parsing %s: %v", name, err)
	}
	}

	func initTemplate(parentDir, name string) {
	if debugging {
	log.Info(" " + filepath.Join(parentDir, templatesDir, name+".tmpl"))
	}

	files := []string{
	filepath.Join(parentDir, templatesDir, name+".tmpl"),
	filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
	filepath.Join(parentDir, templatesDir, "base.tmpl"),
	filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
	}
	if name == "collection" \|\| name == "collection-tags" \|\| name == "chorus-collection" \|\| name == "read" {
	// These pages list out collection posts, so we also parse templatesDir + "include/posts.tmpl"
	files = append(files, filepath.Join(parentDir, templatesDir, "include", "posts.tmpl"))
	}
	if name == "chorus-collection" \|\| name == "chorus-collection-post" {
	files = append(files, filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"))
	}
	if name == "collection" \|\| name == "collection-tags" \|\| name == "collection-post" \|\| name == "post" \|\| name == "chorus-collection" \|\| name == "chorus-collection-post" {
	files = append(files, filepath.Join(parentDir, templatesDir, "include", "post-render.tmpl"))
	}
	templates[name] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...))
	}

	func initPage(parentDir, path, key string) {
	if debugging {
	log.Info(" [%s] %s", key, path)
	}

	files := []string{
	path,
	filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
	filepath.Join(parentDir, templatesDir, "base.tmpl"),
	filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
	}

	if key == "login.tmpl" \|\| key == "landing.tmpl" \|\| key == "signup.tmpl" {
	files = append(files, filepath.Join(parentDir, templatesDir, "include", "oauth.tmpl"))
	}

	pages[key] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...))
	}

	func initUserPage(parentDir, path, key string) {
	if debugging {
	log.Info(" [%s] %s", key, path)
	}

	userPages[key] = template.Must(template.New(key).Funcs(funcMap).ParseFiles(
	path,
	filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"),
	filepath.Join(parentDir, templatesDir, "user", "include", "footer.tmpl"),
	filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
	filepath.Join(parentDir, templatesDir, "user", "include", "nav.tmpl"),
	))
	}

	// InitTemplates loads all template files from the configured parent dir.
	func InitTemplates(cfg *config.Config) error {
	log.Info("Loading templates...")
	tmplFiles, err := ioutil.ReadDir(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir))
	if err != nil {
	return err
	}

	for _, f := range tmplFiles {
	if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
	parts := strings.Split(f.Name(), ".")
	key := parts[0]
	initTemplate(cfg.Server.TemplatesParentDir, key)
	}
	}

	log.Info("Loading pages...")
	// Initialize all static pages that use the base template
	filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, pagesDir), func(path string, i os.FileInfo, err error) error {
	if !i.IsDir() && !strings.HasPrefix(i.Name(), ".") {
	key := i.Name()
	initPage(cfg.Server.PagesParentDir, path, key)
	}

	return nil
	})

	log.Info("Loading user pages...")
	// Initialize all user pages that use base templates
	filepath.Walk(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir, "user"), func(path string, f os.FileInfo, err error) error {
	if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
	corePath := path
	if cfg.Server.TemplatesParentDir != "" {
	corePath = corePath[len(cfg.Server.TemplatesParentDir)+1:]
	}
	parts := strings.Split(corePath, string(filepath.Separator))
	key := f.Name()
	if len(parts) > 2 {
	key = filepath.Join(parts[1], f.Name())
	}
	initUserPage(cfg.Server.TemplatesParentDir, path, key)
	}

	return nil
	})

	return nil
	}

	// renderPage retrieves the given template and renders it to the given io.Writer.
	// If something goes wrong, the error is logged and returned.
	func renderPage(w io.Writer, tmpl string, data interface{}) error {
	err := pages[tmpl].ExecuteTemplate(w, "base", data)
	if err != nil {
	log.Error("%v", err)
	}
	return err
	}

	func largeNumFmt(n int64) string {
	return humanize.Comma(n)
	}

	func pluralize(singular, plural string, n int64) string {
	if n == 1 {
	return singular
	}
	return plural
	}

	func isRTL(d string) bool {
	return d == "rtl"
	}

	func isLTR(d string) bool {
	return d == "ltr" \|\| d == "auto"
	}

	func localStr(term, lang string) string {
	s := l10n.Strings(lang)[term]
	if s == "" {
	s = l10n.Strings("")[term]
	}
	return s
	}

	func localHTML(term, lang string) template.HTML {
	s := l10n.Strings(lang)[term]
	if s == "" {
	s = l10n.Strings("")[term]
	}
	s = strings.Replace(s, "write.as", "<a href=\"https://writefreely.org\">writefreely</a>", 1)
	return template.HTML(s)
	}

	// from: https://stackoverflow.com/a/18276968/1549194
	func dict(values ...interface{}) (map[string]interface{}, error) {
	if len(values)%2 != 0 {
	return nil, errors.New("dict: invalid number of parameters")
	}
	dict := make(map[string]interface{}, len(values)/2)
	for i := 0; i < len(values); i += 2 {
	key, ok := values[i].(string)
	if !ok {
	return nil, errors.New("dict: keys must be strings")
	}
	dict[key] = values[i+1]
	}
	return dict, nil
	}
	diff --git a/templates/bare.tmpl b/templates/bare.tmpl
	index f76eed9..a5f9910 100644
	--- a/templates/bare.tmpl
	+++ b/templates/bare.tmpl
	@@ -1,265 +1,266 @@
	{{define "pad"}}<!DOCTYPE HTML>
	<html>
	<head>

	<title>{{if .Editing}}Editing {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}}{{else}}New Post{{end}} — {{.SiteName}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="google" value="notranslate">
	</head>
	<body id="pad" class="light">

	<div id="overlay"></div>

	<textarea id="writer" placeholder="Write..." class="{{.Post.Font}}" autofocus>{{if .Post.Title}}# {{.Post.Title}}

	{{end}}{{.Post.Content}}</textarea>

	<div class="alert success hidden" id="edited-elsewhere">This post has been updated elsewhere since you last published! <a href="#" id="erase-edit">Delete draft and reload</a>.</div>

	<header id="tools">
	<div id="clip">
	{{if not .SingleUser}}<h1>{{if .Chorus}}<a href="/" title="Home">{{else}}<a href="/me/c/" title="View blogs">{{end}}{{.SiteName}}</a></h1>{{end}}
	<nav id="target" {{if .SingleUser}}style="margin-left:0"{{end}}><ul>
	<li>{{if .Blogs}}<a href="{{$c := index .Blogs 0}}{{$c.CanonicalURL}}">My Posts</a>{{else}}<a>Draft</a>{{end}}</li>
	</ul></nav>
	<span id="wc" class="hidden if-room room-4">0 words</span>
	</div>
	<noscript style="margin-left: 2em;"><strong>NOTE</strong>: for now, you'll need Javascript enabled to post.</noscript>
	<div id="belt">
	{{if .Editing}}<div class="tool hidden if-room"><a href="{{if .EditCollection}}{{.EditCollection.CanonicalURL}}{{.Post.Slug}}/edit/meta{{else}}/{{if .SingleUser}}d/{{end}}{{.Post.Id}}/meta{{end}}" title="Edit post metadata" id="edit-meta"><img class="ic-24dp" src="/img/ic_info_dark@2x.png" /></a></div>{{end}}
	<div class="tool"><button title="Publish your writing" id="publish" style="font-weight: bold">Post</button></div>
	</div>
	</header>

	<script src="/js/h.js"></script>
	<script>
	var $writer = H.getEl('writer');
	var $btnPublish = H.getEl('publish');
	var $btnEraseEdit = H.getEl('edited-elsewhere');
	var $wc = H.getEl("wc");
	var updateWordCount = function() {
	var words = 0;
	var val = $writer.el.value.trim();
	if (val != '') {
	words = $writer.el.value.trim().replace(/\s+/gi, ' ').split(' ').length;
	}
	$wc.el.innerText = words + " word" + (words != 1 ? "s" : "");
	};
	var setButtonStates = function() {
	if (!canPublish) {
	$btnPublish.el.className = 'disabled';
	return;
	}
	if ($writer.el.value.length === 0 \|\| (draftDoc != 'lastDoc' && $writer.el.value == origDoc)) {
	$btnPublish.el.className = 'disabled';
	} else {
	$btnPublish.el.className = '';
	}
	};
	{{if .Post.Id}}var draftDoc = 'draft{{.Post.Id}}';
	var origDoc = '{{.Post.Content}}';{{else}}var draftDoc = 'lastDoc';{{end}}
	var updatedStr = '{{.Post.Updated8601}}';
	var updated = null;
	if (updatedStr != '') {
	updated = new Date(updatedStr);
	}
	var ok = H.load($writer, draftDoc, true, updated);
	if (!ok) {
	// Show "edited elsewhere" warning
	$btnEraseEdit.el.classList.remove('hidden');
	}
	var defaultTimeSet = false;
	updateWordCount();

	var typingTimer;
	var doneTypingInterval = 200;

	var posts;
	{{if and .Post.Id (not .Post.Slug)}}
	var token = null;
	var curPostIdx;
	posts = JSON.parse(H.get('posts', '[]'));
	for (var i=0; i<posts.length; i++) {
	if (posts[i].id == "{{.Post.Id}}") {
	token = posts[i].token;
	break;
	}
	}
	var canPublish = token != null;
	{{else}}var canPublish = true;{{end}}
	var publishing = false;
	var justPublished = false;

	var publish = function(content, font) {
	{{if and (and .Post.Id (not .Post.Slug)) (not .User)}}
	if (!token) {
	alert("You don't have permission to update this post.");
	return;
	}
	{{end}}
	publishing = true;
	$btnPublish.el.textContent = 'Posting...';
	$btnPublish.el.disabled = true;

	var http = new XMLHttpRequest();
	var post = H.getTitleStrict(content);

	var params = {
	body: post.content,
	title: post.title,
	font: font
	};
	{{ if .Post.Slug }}
	var url = "/api/collections/{{.EditCollection.Alias}}/posts/{{.Post.Id}}";
	{{ else if .Post.Id }}
	var url = "/api/posts/{{.Post.Id}}";
	if (typeof token === 'undefined' \|\| !token) {
	token = "";
	}
	params.token = token;
	{{ else }}
	var lang = navigator.languages ? navigator.languages[0] : (navigator.language \|\| navigator.userLanguage);
	lang = lang.substring(0, 2);
	params.lang = lang;

	var url = "/api/posts";
	var postTarget = '{{if .Blogs}}{{$c := index .Blogs 0}}{{$c.Alias}}{{else}}anonymous{{end}}';
	if (postTarget != 'anonymous') {
	url = "/api/collections/" + postTarget + "/posts";
	}
	{{ end }}

	http.open("POST", url, true);

	// Send the proper header information along with the request
	http.setRequestHeader("Content-type", "application/json");

	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	publishing = false;
	if (http.status == 200 \|\| http.status == 201) {
	data = JSON.parse(http.responseText);
	id = data.data.id;
	nextURL = '{{if .SingleUser}}/d{{end}}/'+id;
	localStorage.setItem('draft'+id+'-published', new Date().toISOString());

	{{ if not .Post.Id }}
	// Post created
	if (postTarget != 'anonymous') {
	nextURL = {{if not .SingleUser}}'/'+postTarget+{{end}}'/'+data.data.slug;
	}
	editToken = data.data.token;

	{{ if not .User }}if (postTarget == 'anonymous') {
	// Save the data
	var posts = JSON.parse(H.get('posts', '[]'));

	{{if .Post.Id}}var newPost = H.createPost("{{.Post.Id}}", token, content);
	for (var i=0; i<posts.length; i++) {
	if (posts[i].id == "{{.Post.Id}}") {
	posts[i].title = newPost.title;
	posts[i].summary = newPost.summary;
	break;
	}
	}
	nextURL = "/pad/posts";{{else}}posts.push(H.createPost(id, editToken, content));{{end}}

	H.set('posts', JSON.stringify(posts));
	}
	{{ end }}
	{{ end }}

	justPublished = true;
	if (draftDoc != 'lastDoc') {
	H.remove(draftDoc);
	{{if .Editing}}H.remove('draft{{.Post.Id}}font');{{end}}
	} else {
	H.set(draftDoc, '');
	}

	{{if .EditCollection}}
	window.location = '{{.EditCollection.CanonicalURL}}{{.Post.Slug}}';
	{{else}}
	window.location = nextURL;
	{{end}}
	} else {
	$btnPublish.el.textContent = 'Post';
	alert("Failed to post. Please try again.");
	}
	}
	}
	http.send(JSON.stringify(params));
	};

	setButtonStates();
	$writer.on('keyup input', function() {
	setButtonStates();
	clearTimeout(typingTimer);
	typingTimer = setTimeout(doneTyping, doneTypingInterval);
	}, false);
	$writer.on('keydown', function(e) {
	clearTimeout(typingTimer);
	if (e.keyCode == 13 && (e.metaKey \|\| e.ctrlKey)) {
	$btnPublish.el.click();
	}
	});
	$btnPublish.on('click', function(e) {
	e.preventDefault();
	if (!publishing && $writer.el.value) {
	var content = $writer.el.value;
	publish(content, selectedFont);
	}
	});
	H.getEl('erase-edit').on('click', function(e) {
	e.preventDefault();
	H.remove(draftDoc);
	H.remove(draftDoc+'-published');
	justPublished = true; // Block auto-save
	location.reload();
	});

	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	var selectedFont = H.get('{{if .Editing}}draft{{.Post.Id}}font{{else}}padFont{{end}}', '{{.Post.Font}}');

	var doneTyping = function() {
	if (draftDoc == 'lastDoc' \|\| $writer.el.value != origDoc) {
	H.save($writer, draftDoc);
	if (!defaultTimeSet) {
	var lastLocalPublishStr = localStorage.getItem(draftDoc+'-published');
	if (lastLocalPublishStr == null \|\| lastLocalPublishStr == '') {
	localStorage.setItem(draftDoc+'-published', updatedStr);
	}
	defaultTimeSet = true;
	}
	updateWordCount();
	}
	};
	window.addEventListener('beforeunload', function(e) {
	if (draftDoc != 'lastDoc' && $writer.el.value == origDoc) {
	H.remove(draftDoc);
	H.remove(draftDoc+'-published');
	} else if (!justPublished) {
	doneTyping();
	}
	});

	try {
	(function() {
	var wf=document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type='text/javascript';
	wf.async='true';
	var s=document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {
	// whatevs
	}
	</script>
	</body>
	</html>{{end}}
	diff --git a/templates/base.tmpl b/templates/base.tmpl
	index 604d0ff..273c2b9 100644
	--- a/templates/base.tmpl
	+++ b/templates/base.tmpl
	@@ -1,93 +1,94 @@
	{{define "base"}}<!DOCTYPE HTML>
	<html>
	<head>
	{{ template "head" . }}
	- <link rel="stylesheet" type="text/css" href="{{.Host}}/css/{{.Theme}}.css" />
	- <link rel="shortcut icon" href="{{.Host}}/favicon.ico" />
	+ <link rel="stylesheet" type="text/css" href="/css/{{.Theme}}.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	+ <link rel="shortcut icon" href="/favicon.ico" />
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="application-name" content="{{.SiteName}}">
	<meta name="application-url" content="{{.Host}}">
	<meta property="og:site_name" content="{{.SiteName}}" />
	</head>
	<body {{template "body-attrs" .}}>
	<div id="overlay"></div>
	<header>
	{{ if .Chorus }}<nav id="full-nav">
	<div class="left-side">
	<h2><a href="/">{{.SiteName}}</a></h2>
	</div>
	{{ else }}
	<h2><a href="/">{{.SiteName}}</a></h2>
	{{ end }}
	{{if not .SingleUser}}
	<nav id="user-nav">
	{{if .Username}}
	<nav class="dropdown-nav">
	<ul><li class="has-submenu"><a>{{.Username}}</a> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /><ul>
	{{if .IsAdmin}}<li><a href="/admin">Admin dashboard</a></li>{{end}}
	<li><a href="/me/settings">Account settings</a></li>
	<li><a href="/me/export">Export</a></li>
	{{if .CanInvite}}<li><a href="/me/invites">Invite people</a></li>{{end}}
	<li class="separator"><hr /></li>
	<li><a href="/me/logout">Log out</a></li>
	</ul></li>
	</ul>
	</nav>
	{{end}}
	<nav class="tabs">
	{{ if and .SimpleNav (not .SingleUser) }}
	{{if and (and .LocalTimeline .CanViewReader) .Chorus}}<a href="/"{{if eq .Path "/"}} class="selected"{{end}}>Home</a>{{end}}
	{{ end }}
	{{if or .Chorus (not .Username)}}<a href="/about"{{if eq .Path "/about"}} class="selected"{{end}}>About</a>{{end}}
	{{ if not .SingleUser }}
	{{ if .Username }}
	{{if or (not .Chorus) (gt .MaxBlogs 1)}}<a href="/me/c/"{{if eq .Path "/me/c/"}} class="selected"{{end}}>Blogs</a>{{end}}
	{{if and (and .Chorus (eq .MaxBlogs 1)) .Username}}<a href="/{{.Username}}/"{{if eq .Path (printf "/%s/" .Username)}} class="selected"{{end}}>My Posts</a>{{end}}
	{{if not .DisableDrafts}}<a href="/me/posts/"{{if eq .Path "/me/posts/"}} class="selected"{{end}}>Drafts</a>{{end}}
	{{ end }}
	{{if and (and .LocalTimeline .CanViewReader) (not .Chorus)}}<a href="/read"{{if eq .Path "/read"}} class="selected"{{end}}>Reader</a>{{end}}
	{{if eq .SignupPath "/signup"}}<a href="/signup"{{if eq .Path "/signup"}} class="selected"{{end}}>Sign up</a>{{end}}
	{{if and (not .Username) (not .Private)}}<a href="/login"{{if eq .Path "/login"}} class="selected"{{end}}>Log in</a>{{else if .SimpleNav}}<a href="/me/logout">Log out</a>{{end}}
	{{ end }}
	</nav>
	{{if .Chorus}}{{if .Username}}<div class="right-side" style="font-size: 0.86em;">
	<a class="simple-btn" href="/new">New Post</a>
	</div>{{end}}
	</nav>
	{{end}}
	</nav>
	{{end}}
	</header>

	<div id="official-writing">
	{{ template "content" . }}
	</div>

	{{ template "footer" . }}

	{{if not .JSDisabled}}
	<script type="text/javascript" src="/js/menu.js"></script>
	<script type="text/javascript">
	{{if .WebFonts}}
	try { // Google Fonts
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) { /* ¯\_(ツ)_/¯ */ }
	{{end}}
	</script>
	{{else}}
	- {{if .WebFonts}}<link href="{{.Host}}/css/fonts.css" rel="stylesheet" type="text/css" />{{end}}
	+ {{if .WebFonts}}<link href="/css/fonts.css" rel="stylesheet" type="text/css" />{{end}}
	{{end}}
	</body>
	</html>{{end}}
	{{define "body-attrs"}}{{end}}
	diff --git a/templates/chorus-collection-post.tmpl b/templates/chorus-collection-post.tmpl
	index 537e4ef..468455c 100644
	--- a/templates/chorus-collection-post.tmpl
	+++ b/templates/chorus-collection-post.tmpl
	@@ -1,154 +1,155 @@
	{{define "post"}}<!DOCTYPE HTML>
	<html {{if .Language.Valid}}lang="{{.Language.String}}"{{end}} dir="{{.Direction}}">
	<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
	<meta charset="utf-8">

	<title>{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{.Collection.DisplayTitle}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />
	<link rel="canonical" href="{{.CanonicalURL .Host}}" />
	<meta name="generator" content="WriteFreely">
	<meta name="title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
	<meta name="description" content="{{.Summary}}">
	{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
	<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
	<meta name="author" content="{{.Collection.Title}}" />
	<meta itemprop="description" content="{{.Summary}}">
	<meta itemprop="datePublished" content="{{.CreatedDate}}" />
	<meta name="twitter:card" content="summary">
	<meta name="twitter:description" content="{{.Summary}}">
	<meta name="twitter:title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
	{{if gt (len .Images) 0}}<meta name="twitter:image" content="{{index .Images 0}}">{{else}}<meta name="twitter:image" content="{{.Collection.AvatarURL}}">{{end}}
	<meta property="og:title" content="{{.PlainDisplayTitle}}" />
	<meta property="og:description" content="{{.Summary}}" />
	<meta property="og:site_name" content="{{.Collection.DisplayTitle}}" />
	<meta property="og:type" content="article" />
	<meta property="og:url" content="{{.CanonicalURL .Host}}" />
	<meta property="og:updated_time" content="{{.Created8601}}" />
	{{range .Images}}<meta property="og:image" content="{{.}}" />{{else}}<meta property="og:image" content="{{.Collection.AvatarURL}}">{{end}}
	<meta property="article:published_time" content="{{.Created8601}}">
	{{template "collection-meta" .}}
	{{if .Collection.StyleSheet}}<style type="text/css">{{.Collection.StyleSheetDisplay}}</style>{{end}}
	<style type="text/css">
	body footer {
	max-width: 40rem;
	margin: 0 auto;
	}
	body#post header {
	padding: 1em 1rem;
	}
	</style>

	{{if .Collection.RenderMathJax}}
	<!-- Add mathjax logic -->
	{{template "mathjax" . }}
	{{end}}

	<!-- Add highlighting logic -->
	{{template "highlighting" .}}

	</head>
	<body id="post">

	<div id="overlay"></div>

	{{template "user-navigation" .}}

	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}
	<article id="post-body" class="{{.Font}} h-entry">{{if .IsScheduled}}<p class="badge">Scheduled</p>{{end}}{{if .Title.String}}<h2 id="title" class="p-name{{if $.Collection.Format.ShowDates}} dated{{end}}">{{.FormattedDisplayTitle}}</h2>{{end}}{{if and $.Collection.Format.ShowDates (not .IsPinned)}}<time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}">{{.DisplayDate}}</time>{{end}}<div class="e-content">{{.HTMLContent}}</div></article>

	{{ if .Collection.ShowFooterBranding }}
	<footer dir="ltr">
	<p style="text-align: left">Published by <a rel="author" href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a>
	{{ if .IsOwner }} · <span class="views" dir="ltr"><strong>{{largeNumFmt .Views}}</strong> {{pluralize "view" "views" .Views}}</span>
	· <a class="xtra-feature" href="/{{if not .SingleUser}}{{.Collection.Alias}}/{{end}}{{.Slug.String}}/edit" dir="{{.Direction}}">Edit</a>
	{{if .IsPinned}} · <a class="xtra-feature unpin" href="/{{.Collection.Alias}}/{{.Slug.String}}/unpin" dir="{{.Direction}}" onclick="unpinPost(event, '{{.ID}}')">Unpin</a>{{end}}
	{{ end }}
	</p>
	<nav>
	{{if .PinnedPosts}}
	{{range .PinnedPosts}}<a class="pinned{{if eq .Slug.String $.Slug.String}} selected{{end}}" href="{{if not $.SingleUser}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}
	{{end}}
	</nav>
	<hr>
	<nav><p style="font-size: 0.9em">{{localhtml "published with write.as" .Language.String}}</p></nav>
	</footer>
	{{ end }}
	</body>

	{{if .Collection.CanShowScript}}
	{{range .Collection.ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
	{{if .Collection.Script}}<script type="text/javascript">{{.Collection.ScriptDisplay}}</script>{{end}}
	{{end}}
	<script src="/js/localdate.js"></script>
	<script type="text/javascript">

	var pinning = false;
	function unpinPost(e, postID) {
	e.preventDefault();
	if (pinning) {
	return;
	}
	pinning = true;

	var $footer = document.getElementsByTagName('footer')[0];
	var callback = function() {
	// Hide current page
	var $pinnedNavLink = $footer.getElementsByTagName('nav')[0].querySelector('.pinned.selected');
	$pinnedNavLink.style.display = 'none';
	};

	var $pinBtn = $footer.getElementsByClassName('unpin')[0];
	$pinBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/collections/{{.Collection.Alias}}/unpin";
	var params = [ { "id": postID } ];
	http.open("POST", url, true);
	http.setRequestHeader("Content-type", "application/json");
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	pinning = false;
	if (http.status == 200) {
	callback();
	$pinBtn.style.display = 'none';
	$pinBtn.innerHTML = 'Pin';
	} else if (http.status == 409) {
	$pinBtn.innerHTML = 'Unpin';
	} else {
	$pinBtn.innerHTML = 'Unpin';
	alert("Failed to unpin." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send(JSON.stringify(params));
	};

	try { // Fonts
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) { /* ¯\_(ツ)_/¯ */ }
	</script>

	{{if and .Monetization (not .IsOwner)}}
	<script src="/js/webmonetization.js"></script>
	<script>
	window.collAlias = '{{.Collection.Alias}}'
	window.postSlug = '{{.Slug.String}}'
	initMonetization()
	</script>
	{{end}}
	</html>{{end}}
	diff --git a/templates/chorus-collection.tmpl b/templates/chorus-collection.tmpl
	index d105dff..2bc165d 100644
	--- a/templates/chorus-collection.tmpl
	+++ b/templates/chorus-collection.tmpl
	@@ -1,235 +1,236 @@
	{{define "collection"}}<!DOCTYPE HTML>
	<html {{if .Language}}lang="{{.Language}}"{{end}} dir="{{.Direction}}">
	<head>
	<meta charset="utf-8">

	<title>{{.DisplayTitle}}{{if not .SingleUser}} — {{.SiteName}}{{end}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	<link rel="canonical" href="{{.CanonicalURL}}">
	{{if gt .CurrentPage 1}}<link rel="prev" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
	{{if lt .CurrentPage .TotalPages}}<link rel="next" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
	{{if not .IsPrivate}}<link rel="alternate" type="application/rss+xml" title="{{.DisplayTitle}} » Feed" href="{{.CanonicalURL}}feed/" />{{end}}
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="generator" content="WriteFreely">
	<meta name="description" content="{{.Description}}">
	<meta itemprop="name" content="{{.DisplayTitle}}">
	<meta itemprop="description" content="{{.Description}}">
	<meta name="twitter:card" content="summary">
	<meta name="twitter:title" content="{{.DisplayTitle}}">
	<meta name="twitter:image" content="{{.AvatarURL}}">
	<meta name="twitter:description" content="{{.Description}}">
	<meta property="og:title" content="{{.DisplayTitle}}" />
	<meta property="og:site_name" content="{{.DisplayTitle}}" />
	<meta property="og:type" content="article" />
	<meta property="og:url" content="{{.CanonicalURL}}" />
	<meta property="og:description" content="{{.Description}}" />
	<meta property="og:image" content="{{.AvatarURL}}">
	{{template "collection-meta" .}}
	{{if .StyleSheet}}<style type="text/css">{{.StyleSheetDisplay}}</style>{{end}}
	<style type="text/css">
	body#collection header {
	max-width: 40em;
	margin: 1em auto;
	text-align: left;
	padding: 0;
	}
	body#collection header.multiuser {
	max-width: 100%;
	margin: 1em;
	}
	body#collection header nav:not(.pinned-posts) {
	display: inline;
	}
	body#collection header nav.dropdown-nav,
	body#collection header nav.tabs,
	body#collection header nav.tabs a:first-child {
	margin: 0 0 0 1em;
	}
	</style>

	{{if .RenderMathJax}}
	<!-- Add mathjax logic -->
	{{template "mathjax" .}}
	{{end}}

	<!-- Add highlighting logic -->
	{{template "highlighting" . }}

	</head>
	<body id="collection" itemscope itemtype="http://schema.org/WebPage">
	{{template "user-navigation" .}}

	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}
	<header>
	<h1 dir="{{.Direction}}" id="blog-title"><a href="/{{if .IsTopLevel}}{{else}}{{.Prefix}}{{.Alias}}/{{end}}" class="h-card p-author u-url" rel="me author">{{.DisplayTitle}}</a></h1>
	{{if .Description}}<p class="description p-note">{{.Description}}</p>{{end}}
	{{/if not .Public/}}
	<!--p class="meta-note"><span>Private collection</span>. Only you can see this page.</p-->
	{{/end/}}
	{{if .PinnedPosts}}<nav class="pinned-posts">
	{{range .PinnedPosts}}<a class="pinned" href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}</nav>
	{{end}}
	</header>

	{{if .Posts}}<section id="wrapper" itemscope itemtype="http://schema.org/Blog">{{else}}<div id="wrapper">{{end}}

	{{if .IsWelcome}}
	<div id="welcome">
	<h2>Welcome, <strong>{{.Username}}</strong>!</h2>
	<p>This is your new blog.</p>
	<p><a class="simple-cta" href="/#{{.Alias}}">Start writing</a>, or <a class="simple-cta" href="/me/c/{{.Alias}}">customize</a> your blog.</p>
	<p>Check out our <a class="simple-cta" href="https://guides.write.as/writing/?pk_campaign=welcome">writing guide</a> to see what else you can do, and <a class="simple-cta" href="/contact">get in touch</a> anytime with questions or feedback.</p>
	</div>
	{{end}}

	{{template "posts" .}}

	{{if gt .TotalPages 1}}<nav id="paging" class="content-container clearfix">
	{{if or (and .Format.Ascending (le .CurrentPage .TotalPages)) (isRTL .Direction)}}
	{{if gt .CurrentPage 1}}<a href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">⇠ {{if and .Format.Ascending (le .CurrentPage .TotalPages)}}Previous{{else}}Newer{{end}}</a>{{end}}
	{{if lt .CurrentPage .TotalPages}}<a style="float:right;" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{if and .Format.Ascending (lt .CurrentPage .TotalPages)}}Next{{else}}Older{{end}} ⇢</a>{{end}}
	{{else}}
	{{if lt .CurrentPage .TotalPages}}<a href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">⇠ Older</a>{{end}}
	{{if gt .CurrentPage 1}}<a style="float:right;" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">Newer ⇢</a>{{end}}
	{{end}}
	</nav>{{end}}

	{{if .Posts}}</section>{{else}}</div>{{end}}

	{{if .ShowFooterBranding }}
	<footer>
	<hr />
	<nav dir="ltr">
	{{if not .SingleUser}}<a class="home pubd" href="/">{{.SiteName}}</a> · {{end}}powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a>
	</nav>
	</footer>
	{{ end }}
	</body>

	{{if .CanShowScript}}
	{{range .ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
	{{if .Script}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
	{{end}}
	<script src="/js/h.js"></script>
	<script src="/js/localdate.js"></script>
	<script src="/js/postactions.js"></script>
	<script type="text/javascript">
	var deleting = false;
	function delPost(e, id, owned) {
	e.preventDefault();
	if (deleting) {
	return;
	}

	// TODO: UNDO!
	if (window.confirm('Are you sure you want to delete this post?')) {
	// AJAX
	deletePost(id, "", function() {
	// Remove post from list
	var $postEl = document.getElementById('post-' + id);
	$postEl.parentNode.removeChild($postEl);
	// TODO: add next post from this collection at the bottom
	});
	}
	}

	var deletePost = function(postID, token, callback) {
	deleting = true;

	var $delBtn = document.getElementById('post-' + postID).getElementsByClassName('delete action')[0];
	$delBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/posts/" + postID;
	http.open("DELETE", url, true);
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	deleting = false;
	if (http.status == 204) {
	callback();
	} else if (http.status == 409) {
	$delBtn.innerHTML = 'delete';
	alert("Post is synced to another account. Delete the post from that account instead.");
	// TODO: show "remove" button instead of "delete" now
	// Persist that state.
	// Have it remove the post locally only.
	} else {
	$delBtn.innerHTML = 'delete';
	alert("Failed to delete." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send();
	};

	var pinning = false;
	function pinPost(e, postID, slug, title) {
	e.preventDefault();
	if (pinning) {
	return;
	}
	pinning = true;

	var callback = function() {
	// Visibly remove post from collection
	var $postEl = document.getElementById('post-' + postID);
	$postEl.parentNode.removeChild($postEl);
	var $header = document.querySelector('header:not(.multiuser)');
	var $pinnedNavs = $header.getElementsByTagName('nav');
	// Add link to nav
	var link = '<a class="pinned" href="/{{.Alias}}/'+slug+'">'+title+'</a>';
	if ($pinnedNavs.length == 0) {
	$header.insertAdjacentHTML("beforeend", '<nav>'+link+'</nav>');
	} else {
	$pinnedNavs[0].insertAdjacentHTML("beforeend", link);
	}
	};

	var $pinBtn = document.getElementById('post-' + postID).getElementsByClassName('pin action')[0];
	$pinBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/collections/{{.Alias}}/pin";
	var params = [ { "id": postID } ];
	http.open("POST", url, true);
	http.setRequestHeader("Content-type", "application/json");
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	pinning = false;
	if (http.status == 200) {
	callback();
	} else if (http.status == 409) {
	$pinBtn.innerHTML = 'pin';
	alert("Post is synced to another account. Delete the post from that account instead.");
	// TODO: show "remove" button instead of "delete" now
	// Persist that state.
	// Have it remove the post locally only.
	} else {
	$pinBtn.innerHTML = 'pin';
	alert("Failed to pin." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send(JSON.stringify(params));
	};

	try {
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {}
	</script>
	</html>{{end}}
	diff --git a/templates/classic.tmpl b/templates/classic.tmpl
	index ecc8cb9..7032f58 100644
	--- a/templates/classic.tmpl
	+++ b/templates/classic.tmpl
	@@ -1,401 +1,402 @@
	{{define "pad"}}<!DOCTYPE HTML>
	<html>
	<head>

	<title>{{if .Editing}}Editing {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}}{{else}}New Post{{end}} — {{.SiteName}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	<link rel="stylesheet" type="text/css" href="/css/prose.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="google" value="notranslate">
	</head>
	<body id="pad" class="light classic">

	<div id="overlay"></div>

	<!-- <div style="text-align: center"> -->
	<!-- <label style="border-right: 1px solid silver"> -->
	<!-- Markdown <input type=radio name=inputformat value=markdown checked> </label> -->
	<!-- <label> <input type=radio name=inputformat value=prosemirror> WYSIWYM</label> -->
	<!-- </div> -->
	<input type="text" id="title" name="title" placeholder="Title..." {{if .Post.Title}}value="{{.Post.Title}}"{{end}} autofocus />
	<div id="editor" style="margin-bottom: 0"></div>

	<div style="display: none"><textarea id="content"{{if .Post.Content }} value={{.Post.Content}}>{{.Post.Content}}{{else}}>{{end}}</textarea></div>

	<header id="tools">
	<div id="clip">
	{{if not .SingleUser}}<h1><a href="/me/c/" title="View blogs"><img class="ic-24dp" src="/img/ic_blogs_dark@2x.png" /></a></h1>{{end}}
	<nav id="target" {{if .SingleUser}}style="margin-left:0"{{end}}><ul>
	{{if .Editing}}<li>{{if .EditCollection}}<a href="{{.EditCollection.CanonicalURL}}">{{.EditCollection.Title}}</a>{{else}}<a>Draft</a>{{end}}</li>
	{{else}}<li><a id="publish-to"><span id="target-name">Draft</span> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /></a>
	<ul>
	<li class="menu-heading">Publish to...</li>
	{{if .Blogs}}{{range $idx, $el := .Blogs}}
	<li class="target{{if eq $idx 0}} selected{{end}}" id="blog-{{$el.Alias}}"><a href="#{{$el.Alias}}"><i class="material-icons md-18">public</i> {{if $el.Title}}{{$el.Title}}{{else}}{{$el.Alias}}{{end}}</a></li>
	{{end}}{{end}}
	<li class="target" id="blog-anonymous"><a href="#anonymous"><i class="material-icons md-18">description</i> <em>Draft</em></a></li>
	<li id="user-separator" class="separator"><hr /></li>
	{{ if .SingleUser }}
	<li><a href="/"><i class="material-icons md-18">launch</i> View Blog</a></li>
	<li><a href="/me/c/{{.Username}}"><i class="material-icons md-18">palette</i> Customize</a></li>
	<li><a href="/me/c/{{.Username}}/stats"><i class="material-icons md-18">trending_up</i> Stats</a></li>
	{{ else }}
	<li><a href="/me/c/"><i class="material-icons md-18">library_books</i> View Blogs</a></li>
	{{ end }}
	<li><a href="/me/posts/"><i class="material-icons md-18">view_list</i> View Drafts</a></li>
	<li><a href="/me/logout"><i class="material-icons md-18">power_settings_new</i> Log out</a></li>
	</ul>
	</li>{{end}}
	</ul></nav>
	<nav id="font-picker" class="if-room room-3 hidden" style="margin-left:-1em"><ul>
	<li><a href="#" id="" onclick="return false"><img class="ic-24dp" src="/img/ic_font_dark@2x.png" /> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /></a>
	<ul style="text-align: center">
	<li class="menu-heading">Font</li>
	<li class="selected"><a class="font norm" href="#norm">Serif</a></li>
	<li><a class="font sans" href="#sans">Sans-serif</a></li>
	<li><a class="font wrap" href="#wrap">Monospace</a></li>
	</ul>
	</li>
	</ul></nav>
	<span id="wc" class="hidden if-room room-4">0 words</span>
	</div>
	<noscript style="margin-left: 2em;"><strong>NOTE</strong>: for now, you'll need Javascript enabled to post.</noscript>
	<div id="belt">
	{{if .Editing}}<div class="tool hidden if-room"><a href="{{if .EditCollection}}{{.EditCollection.CanonicalURL}}{{.Post.Slug}}/edit/meta{{else}}/{{if .SingleUser}}d/{{end}}{{.Post.Id}}/meta{{end}}" title="Edit post metadata" id="edit-meta"><img class="ic-24dp" src="/img/ic_info_dark@2x.png" /></a></div>{{end}}
	<div class="tool hidden if-room room-2"><a href="#theme" title="Toggle theme" id="toggle-theme"><img class="ic-24dp" src="/img/ic_brightness_dark@2x.png" /></a></div>
	<div class="tool if-room room-1"><a href="{{if not .User}}/pad/posts{{else}}/me/posts/{{end}}" title="View posts" id="view-posts"><img class="ic-24dp" src="/img/ic_list_dark@2x.png" /></a></div>
	<div class="tool"><a href="#publish" title="Publish" id="publish"><img class="ic-24dp" src="/img/ic_send_dark@2x.png" /></a></div>
	</div>
	</header>

	<script src="/js/h.js"></script>
	<script>
	function toggleTheme() {
	var btns = Array.prototype.slice.call(document.getElementById('tools').querySelectorAll('a img'));
	var newTheme = '';
	if (document.body.classList.contains('light')) {
	newTheme = 'dark';
	document.body.className = document.body.className.replace(/(?:^\|\s)light(?!\S)/g, newTheme);
	for (var i=0; i<btns.length; i++) {
	btns[i].src = btns[i].src.replace('_dark@2x.png', '@2x.png');
	}
	} else {
	newTheme = 'light';
	document.body.className = document.body.className.replace(/(?:^\|\s)dark(?!\S)/g, newTheme);
	for (var i=0; i<btns.length; i++) {
	btns[i].src = btns[i].src.replace('@2x.png', '_dark@2x.png');
	}
	}
	H.set('padTheme', newTheme);
	}
	if (H.get('padTheme', 'light') != 'light') {
	toggleTheme();
	}
	var $title = H.getEl('title');
	var $writer = H.getQEl('div.ProseMirror');
	var $content = H.getEl('content');
	var $btnPublish = H.getEl('publish');
	var $wc = H.getEl("wc");
	var updateWordCount = function() {
	var words = 0;
	var val = $content.el.value.trim();
	if (val != '') {
	words = $content.el.value.trim().replace(/\s+/gi, ' ').split(' ').length;
	}
	val = $title.el.value.trim();
	if (val != '') {
	words += $title.el.value.trim().replace(/\s+/gi, ' ').split(' ').length;
	}
	$wc.el.innerText = words + " word" + (words != 1 ? "s" : "");
	};
	var setButtonStates = function() {
	if (!canPublish) {
	$btnPublish.el.className = 'disabled';
	return;
	}
	if ($content.el.value.length === 0 \|\| (draftDoc != 'lastDoc' && $content.el.value == origDoc)) {
	$btnPublish.el.className = 'disabled';
	} else {
	$btnPublish.el.className = '';
	}
	};
	{{if .Post.Id}}var draftDoc = 'draft{{.Post.Id}}';
	var origDoc = '{{.Post.Content}}';{{else}}var draftDoc = 'lastDoc';{{end}}

	// ProseMirror editor
	window.draftKey = draftDoc;

	// H.loadClassic($title, $writer, draftDoc, true);
	updateWordCount();

	var typingTimer;
	var doneTypingInterval = 200;

	var posts;
	{{if and .Post.Id (not .Post.Slug)}}
	var token = null;
	var curPostIdx;
	posts = JSON.parse(H.get('posts', '[]'));
	for (var i=0; i<posts.length; i++) {
	if (posts[i].id == "{{.Post.Id}}") {
	token = posts[i].token;
	break;
	}
	}
	var canPublish = token != null;
	{{else}}var canPublish = true;{{end}}
	var publishing = false;
	var justPublished = false;
	var silenced = {{.Silenced}};
	var publish = function(title, content, font) {
	if (silenced === true) {
	alert("Your account is silenced, so you can't publish or update posts.");
	return;
	}
	{{if and (and .Post.Id (not .Post.Slug)) (not .User)}}
	if (!token) {
	alert("You don't have permission to update this post.");
	return;
	}
	if ($btnPublish.el.className == 'disabled') {
	return;
	}
	{{end}}
	$btnPublish.el.children[0].textContent = 'more_horiz';
	publishing = true;
	var xpostTarg = H.get('crosspostTarget', '[]');

	var http = new XMLHttpRequest();
	var post = H.getTitleStrict(content);

	var params = {
	body: post.content,
	title: title,
	font: font
	};
	{{ if .Post.Slug }}
	var url = "/api/collections/{{.EditCollection.Alias}}/posts/{{.Post.Id}}";
	{{ else if .Post.Id }}
	var url = "/api/posts/{{.Post.Id}}";
	if (typeof token === 'undefined' \|\| !token) {
	token = "";
	}
	params.token = token;
	{{ else }}
	var lang = navigator.languages ? navigator.languages[0] : (navigator.language \|\| navigator.userLanguage);
	lang = lang.substring(0, 2);
	params.lang = lang;

	var url = "/api/posts";
	var postTarget = H.get('postTarget', 'anonymous');
	if (postTarget != 'anonymous') {
	url = "/api/collections/" + postTarget + "/posts";
	}
	params.crosspost = JSON.parse(xpostTarg);
	{{ end }}

	http.open("POST", url, true);

	// Send the proper header information along with the request
	http.setRequestHeader("Content-type", "application/json");

	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	publishing = false;
	if (http.status == 200 \|\| http.status == 201) {
	data = JSON.parse(http.responseText);
	id = data.data.id;
	nextURL = '{{if .SingleUser}}/d{{end}}/'+id;

	{{ if not .Post.Id }}
	// Post created
	if (postTarget != 'anonymous') {
	nextURL = {{if not .SingleUser}}'/'+postTarget+{{end}}'/'+data.data.slug;
	}
	editToken = data.data.token;

	{{ if not .User }}if (postTarget == 'anonymous') {
	// Save the data
	var posts = JSON.parse(H.get('posts', '[]'));

	{{if .Post.Id}}var newPost = H.createPost("{{.Post.Id}}", token, content);
	for (var i=0; i<posts.length; i++) {
	if (posts[i].id == "{{.Post.Id}}") {
	posts[i].title = newPost.title;
	posts[i].summary = newPost.summary;
	break;
	}
	}
	nextURL = "/pad/posts";{{else}}posts.push(H.createPost(id, editToken, content));{{end}}

	H.set('posts', JSON.stringify(posts));
	}
	{{ end }}
	{{ end }}

	justPublished = true;
	if (draftDoc != 'lastDoc') {
	H.remove(draftDoc);
	{{if .Editing}}H.remove('draft{{.Post.Id}}font');{{end}}
	} else {
	H.set(draftDoc, '');
	}

	{{if .EditCollection}}
	window.location = '{{.EditCollection.CanonicalURL}}{{.Post.Slug}}';
	{{else}}
	window.location = nextURL;
	{{end}}
	} else {
	$btnPublish.el.children[0].textContent = 'send';
	alert("Failed to post. Please try again.");
	}
	}
	}
	http.send(JSON.stringify(params));
	};

	setButtonStates();
	$title.on('keydown', function(e) {
	if (e.keyCode == 13) {
	if (e.metaKey \|\| e.ctrlKey) {
	$btnPublish.el.click();
	} else {
	e.preventDefault();
	$writer.el.focus();
	}
	}
	});
	/*
	$writer.on('keyup input', function() {
	setButtonStates();
	clearTimeout(typingTimer);
	typingTimer = setTimeout(doneTyping, doneTypingInterval);
	}, false);
	$writer.on('keydown', function(e) {
	clearTimeout(typingTimer);
	if (e.keyCode == 13 && (e.metaKey \|\| e.ctrlKey)) {
	$btnPublish.el.click();
	}
	});
	*/
	$btnPublish.on('click', function(e) {
	e.preventDefault();
	if (!publishing && ($title.el.value \|\| $content.el.value)) {
	var title = $title.el.value;
	var content = $content.el.value;
	publish(title, content, selectedFont);
	}
	});

	H.getEl('toggle-theme').on('click', function(e) {
	e.preventDefault();
	var newTheme = 'light';
	if (document.body.className == 'light') {
	newTheme = 'dark';
	}
	toggleTheme();
	});

	var targets = document.querySelectorAll('#target li.target a');
	for (var i=0; i<targets.length; i++) {
	targets[i].addEventListener('click', function(e) {
	e.preventDefault();
	var targetName = this.href.substring(this.href.indexOf('#')+1);
	H.set('postTarget', targetName);

	document.querySelector('#target li.target.selected').classList.remove('selected');
	this.parentElement.classList.add('selected');
	var newText = this.innerText.split(' ');
	newText.shift();
	document.getElementById('target-name').innerText = newText.join(' ');
	});
	}
	var postTarget = H.get('postTarget', '{{if .Blogs}}{{$blog := index .Blogs 0}}{{$blog.Alias}}{{else}}anonymous{{end}}');
	if (location.hash != '') {
	postTarget = location.hash.substring(1);
	// TODO: pushState to /pad (or whatever the URL is) so we live on a clean URL
	location.hash = '';
	}
	var pte = document.querySelector('#target li.target#blog-'+postTarget+' a');
	if (pte != null) {
	pte.click();
	} else {
	postTarget = 'anonymous';
	H.set('postTarget', postTarget);
	}

	var sansLoaded = false;
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	var loadSans = function() {
	if (sansLoaded) return;
	sansLoaded = true;
	WebFontConfig.custom.families.push('Open+Sans:400,700:latin');
	try {
	(function() {
	var wf=document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type='text/javascript';
	wf.async='true';
	var s=document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {}
	};
	var fonts = document.querySelectorAll('nav#font-picker a.font');
	for (var i=0; i<fonts.length; i++) {
	fonts[i].addEventListener('click', function(e) {
	e.preventDefault();
	selectedFont = this.href.substring(this.href.indexOf('#')+1);
	// TODO: don't change classes on the editor window
	//$title.el.className = selectedFont;
	//$writer.el.className = selectedFont;
	document.querySelector('nav#font-picker li.selected').classList.remove('selected');
	this.parentElement.classList.add('selected');
	H.set('{{if .Editing}}draft{{.Post.Id}}font{{else}}padFont{{end}}', selectedFont);
	if (selectedFont == 'sans') {
	loadSans();
	}
	});
	}
	var selectedFont = H.get('{{if .Editing}}draft{{.Post.Id}}font{{else}}padFont{{end}}', '{{.Post.Font}}');
	var sfe = document.querySelector('nav#font-picker a.font.'+selectedFont);
	if (sfe != null) {
	sfe.click();
	}

	var doneTyping = function() {
	if (draftDoc == 'lastDoc' \|\| $content.el.value != origDoc) {
	H.saveClassic($title, $content, draftDoc);
	updateWordCount();
	}
	};
	window.addEventListener('beforeunload', function(e) {
	if (draftDoc != 'lastDoc' && $content.el.value == origDoc) {
	H.remove(draftDoc);
	} else if (!justPublished) {
	doneTyping();
	}
	});

	try {
	(function() {
	var wf=document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type='text/javascript';
	wf.async='true';
	var s=document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {
	// whatevs
	}
	</script>
	<script src="/js/prose.bundle.js"></script>
	<link href="/css/icons.css" rel="stylesheet">
	</body>
	</html>{{end}}
	diff --git a/templates/collection-post.tmpl b/templates/collection-post.tmpl
	index 5d56abd..54d5298 100644
	--- a/templates/collection-post.tmpl
	+++ b/templates/collection-post.tmpl
	@@ -1,144 +1,145 @@
	{{define "post"}}<!DOCTYPE HTML>
	<html {{if .Language.Valid}}lang="{{.Language.String}}"{{end}} dir="{{.Direction}}">
	<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
	<meta charset="utf-8">

	<title>{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{.Collection.DisplayTitle}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />
	{{ if .IsFound }}
	<link rel="canonical" href="{{.CanonicalURL .Host}}" />
	<meta name="generator" content="WriteFreely">
	<meta name="title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
	<meta name="description" content="{{.Summary}}">
	{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
	<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
	<meta name="author" content="{{.Collection.Title}}" />
	<meta itemprop="description" content="{{.Summary}}">
	<meta itemprop="datePublished" content="{{.CreatedDate}}" />
	<meta name="twitter:card" content="summary">
	<meta name="twitter:description" content="{{.Summary}}">
	<meta name="twitter:title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
	{{if gt (len .Images) 0}}<meta name="twitter:image" content="{{index .Images 0}}">{{else}}<meta name="twitter:image" content="{{.Collection.AvatarURL}}">{{end}}
	<meta property="og:title" content="{{.PlainDisplayTitle}}" />
	<meta property="og:description" content="{{.Summary}}" />
	<meta property="og:site_name" content="{{.Collection.DisplayTitle}}" />
	<meta property="og:type" content="article" />
	<meta property="og:url" content="{{.CanonicalURL .Host}}" />
	<meta property="og:updated_time" content="{{.Created8601}}" />
	{{range .Images}}<meta property="og:image" content="{{.}}" />{{else}}<meta property="og:image" content="{{.Collection.AvatarURL}}">{{end}}
	<meta property="article:published_time" content="{{.Created8601}}">
	{{ end }}
	{{template "collection-meta" .}}
	{{if .Collection.StyleSheet}}<style type="text/css">{{.Collection.StyleSheetDisplay}}</style>{{end}}

	{{if .Collection.RenderMathJax}}
	<!-- Add mathjax logic -->
	{{template "mathjax" . }}
	{{end}}

	<!-- Add highlighting logic -->
	{{template "highlighting" .}}

	</head>
	<body id="post">

	<div id="overlay"></div>

	<header>
	<h1 dir="{{.Direction}}" id="blog-title"><a rel="author" href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a></h1>
	<nav>
	{{if .PinnedPosts}}
	{{range .PinnedPosts}}<a class="pinned{{if eq .Slug.String $.Slug.String}} selected{{end}}" href="{{if not $.SingleUser}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}
	{{end}}
	{{ if and .IsOwner .IsFound }}<span class="views" dir="ltr"><strong>{{largeNumFmt .Views}}</strong> {{pluralize "view" "views" .Views}}</span>
	<a class="xtra-feature" href="/{{if not .SingleUser}}{{.Collection.Alias}}/{{end}}{{.Slug.String}}/edit" dir="{{.Direction}}">Edit</a>
	{{if .IsPinned}}<a class="xtra-feature unpin" href="/{{.Collection.Alias}}/{{.Slug.String}}/unpin" dir="{{.Direction}}" onclick="unpinPost(event, '{{.ID}}')">Unpin</a>{{end}}
	{{ end }}
	</nav>
	</header>

	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}
	<article id="post-body" class="{{.Font}} h-entry {{if not .IsFound}}error-page{{end}}">{{if .IsScheduled}}<p class="badge">Scheduled</p>{{end}}{{if .Title.String}}<h2 id="title" class="p-name{{if and $.Collection.Format.ShowDates (not .IsPinned)}} dated{{end}}">{{.FormattedDisplayTitle}}</h2>{{end}}{{if and $.Collection.Format.ShowDates (not .IsPinned) .IsFound}}<time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}">{{.DisplayDate}}</time>{{end}}<div class="e-content">{{.HTMLContent}}</div></article>

	{{ if .Collection.ShowFooterBranding }}
	<footer dir="ltr"><hr><nav><p style="font-size: 0.9em">{{localhtml "published with write.as" .Language.String}}</p></nav></footer>
	{{ end }}
	</body>

	{{if .Collection.CanShowScript}}
	{{range .Collection.ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
	{{if .Collection.Script}}<script type="text/javascript">{{.Collection.ScriptDisplay}}</script>{{end}}
	{{end}}
	<script src="/js/localdate.js"></script>
	<script type="text/javascript">

	var pinning = false;
	function unpinPost(e, postID) {
	e.preventDefault();
	if (pinning) {
	return;
	}
	pinning = true;

	var $header = document.getElementsByTagName('header')[0];
	var callback = function() {
	// Hide current page
	var $pinnedNavLink = $header.getElementsByTagName('nav')[0].querySelector('.pinned.selected');
	$pinnedNavLink.style.display = 'none';
	};

	var $pinBtn = $header.getElementsByClassName('unpin')[0];
	$pinBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/collections/{{.Collection.Alias}}/unpin";
	var params = [ { "id": postID } ];
	http.open("POST", url, true);
	http.setRequestHeader("Content-type", "application/json");
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	pinning = false;
	if (http.status == 200) {
	callback();
	$pinBtn.style.display = 'none';
	$pinBtn.innerHTML = 'Pin';
	} else if (http.status == 409) {
	$pinBtn.innerHTML = 'Unpin';
	} else {
	$pinBtn.innerHTML = 'Unpin';
	alert("Failed to unpin." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send(JSON.stringify(params));
	};

	try { // Fonts
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) { /* ¯\_(ツ)_/¯ */ }
	</script>

	{{if and .Monetization (not .IsOwner)}}
	<script src="/js/webmonetization.js"></script>
	<script>
	window.collAlias = '{{.Collection.Alias}}'
	window.postSlug = '{{.Slug.String}}'
	initMonetization()
	</script>
	{{end}}
	</html>{{end}}
	diff --git a/templates/collection-tags.tmpl b/templates/collection-tags.tmpl
	index e2f8962..6a989a7 100644
	--- a/templates/collection-tags.tmpl
	+++ b/templates/collection-tags.tmpl
	@@ -1,199 +1,200 @@
	{{define "collection-tags"}}<!DOCTYPE HTML>
	<html>
	<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
	<meta charset="utf-8">

	<title>{{.Tag}} — {{.Collection.DisplayTitle}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	{{if not .Collection.IsPrivate}}<link rel="alternate" type="application/rss+xml" title="{{.Tag}} posts on {{.DisplayTitle}}" href="{{.CanonicalURL}}tag:{{.Tag}}/feed/" />{{end}}
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />
	<link rel="canonical" href="{{.CanonicalURL}}tag:{{.Tag \| tolower}}" />
	<meta name="generator" content="Write.as">
	<meta name="title" content="{{.Tag}} — {{.Collection.DisplayTitle}}">
	<meta name="description" content="{{.Tag}} posts on {{.Collection.DisplayTitle}}">
	<meta name="application-name" content="Write.as">
	<meta name="application-url" content="https://write.as">
	{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
	<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
	<meta itemprop="name" content="{{.Collection.DisplayTitle}}">
	<meta itemprop="description" content="{{.Tag}} posts on {{.Collection.DisplayTitle}}">
	<meta name="twitter:card" content="summary">
	<meta name="twitter:site" content="@writeas__">
	<meta name="twitter:description" content="{{.Tag}} posts on {{.Collection.DisplayTitle}}">
	<meta name="twitter:title" content="{{.Tag}} — {{.Collection.DisplayTitle}}">
	<meta name="twitter:image" content="{{.Collection.AvatarURL}}">
	<meta property="og:title" content="{{.Tag}} — {{.Collection.DisplayTitle}}" />
	<meta property="og:site_name" content="{{.DisplayTitle}}" />
	<meta property="og:type" content="article" />
	<meta property="og:url" content="{{.CanonicalURL}}tag:{{.Tag}}" />
	<meta property="og:image" content="{{.Collection.AvatarURL}}">
	{{template "collection-meta" .}}
	{{if .Collection.StyleSheet}}<style type="text/css">{{.Collection.StyleSheetDisplay}}</style>{{end}}

	{{if .Collection.RenderMathJax}}
	<!-- Add mathjax logic -->
	{{template "mathjax" .}}
	{{end}}

	<!-- Add highlighting logic -->
	{{template "highlighting" . }}

	</head>
	<body id="subpage">

	<div id="overlay"></div>

	<header>
	<h1 dir="{{.Direction}}" id="blog-title"><a href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a></h1>
	<nav>
	{{if .PinnedPosts}}
	{{range .PinnedPosts}}<a class="pinned" href="{{if not $.SingleUser}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.DisplayTitle}}</a>{{end}}
	{{end}}
	</nav>
	</header>

	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}
	{{if .Posts}}<section id="wrapper" itemscope itemtype="http://schema.org/Blog">{{else}}<div id="wrapper">{{end}}
	<h1>{{.Tag}}</h1>
	{{template "posts" .}}
	{{if .Posts}}</section>{{else}}</div>{{end}}

	{{ if .Collection.ShowFooterBranding }}
	<footer dir="ltr">
	<hr>
	<nav>
	<p style="font-size: 0.9em"><a class="home pubd" href="/">{{.SiteName}}</a> · powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a></p>
	</nav>
	</footer>
	{{ end }}
	</body>

	{{if .CanShowScript}}
	{{range .ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
	{{if .Collection.Script}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
	{{end}}
	<script src="/js/localdate.js"></script>
	{{if .IsOwner}}
	<script src="/js/h.js"></script>
	<script src="/js/postactions.js"></script>
	{{end}}
	<script type="text/javascript">
	{{if .IsOwner}}
	var deleting = false;
	function delPost(e, id, owned) {
	e.preventDefault();
	if (deleting) {
	return;
	}

	// TODO: UNDO!
	if (window.confirm('Are you sure you want to delete this post?')) {
	// AJAX
	deletePost(id, "", function() {
	// Remove post from list
	var $postEl = document.getElementById('post-' + id);
	$postEl.parentNode.removeChild($postEl);
	// TODO: add next post from this collection at the bottom
	});
	}
	}

	var deletePost = function(postID, token, callback) {
	deleting = true;

	var $delBtn = document.getElementById('post-' + postID).getElementsByClassName('delete action')[0];
	$delBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/posts/" + postID;
	http.open("DELETE", url, true);
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	deleting = false;
	if (http.status == 204) {
	callback();
	} else if (http.status == 409) {
	$delBtn.innerHTML = 'delete';
	alert("Post is synced to another account. Delete the post from that account instead.");
	// TODO: show "remove" button instead of "delete" now
	// Persist that state.
	// Have it remove the post locally only.
	} else {
	$delBtn.innerHTML = 'delete';
	alert("Failed to delete." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send();
	};

	var pinning = false;
	function pinPost(e, postID, slug, title) {
	e.preventDefault();
	if (pinning) {
	return;
	}
	pinning = true;

	var callback = function() {
	// Visibly remove post from collection
	var $postEl = document.getElementById('post-' + postID);
	$postEl.parentNode.removeChild($postEl);
	var $header = document.getElementsByTagName('header')[0];
	var $pinnedNavs = $header.getElementsByTagName('nav');
	// Add link to nav
	var link = '<a class="pinned" href="{{if not .SingleUser}}/{{.Alias}}/{{end}}'+slug+'">'+title+'</a>';
	if ($pinnedNavs.length == 0) {
	$header.insertAdjacentHTML("beforeend", '<nav>'+link+'</nav>');
	} else {
	$pinnedNavs[0].insertAdjacentHTML("beforeend", link);
	}
	};

	var $pinBtn = document.getElementById('post-' + postID).getElementsByClassName('pin action')[0];
	$pinBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/collections/{{.Alias}}/pin";
	var params = [ { "id": postID } ];
	http.open("POST", url, true);
	http.setRequestHeader("Content-type", "application/json");
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	pinning = false;
	if (http.status == 200) {
	callback();
	} else if (http.status == 409) {
	$pinBtn.innerHTML = 'pin';
	alert("Post is synced to another account. Delete the post from that account instead.");
	// TODO: show "remove" button instead of "delete" now
	// Persist that state.
	// Have it remove the post locally only.
	} else {
	$pinBtn.innerHTML = 'pin';
	alert("Failed to pin." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send(JSON.stringify(params));
	};
	{{end}}
	try { // Fonts
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) { /* ¯\_(ツ)_/¯ */ }
	</script>
	</html>{{end}}
	diff --git a/templates/collection.tmpl b/templates/collection.tmpl
	index 7669c88..d014a7c 100644
	--- a/templates/collection.tmpl
	+++ b/templates/collection.tmpl
	@@ -1,259 +1,260 @@
	{{define "collection"}}<!DOCTYPE HTML>
	<html {{if .Language}}lang="{{.Language}}"{{end}} dir="{{.Direction}}">
	<head>
	<meta charset="utf-8">

	<title>{{.DisplayTitle}}{{if not .SingleUser}} — {{.SiteName}}{{end}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	<link rel="canonical" href="{{.CanonicalURL}}">
	{{if gt .CurrentPage 1}}<link rel="prev" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
	{{if lt .CurrentPage .TotalPages}}<link rel="next" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{end}}
	{{if not .IsPrivate}}<link rel="alternate" type="application/rss+xml" title="{{.DisplayTitle}} » Feed" href="{{.CanonicalURL}}feed/" />{{end}}
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="generator" content="WriteFreely">
	- <meta name="description" content="{{.Description}}">
	+ <meta name="description" content="{{.PlainDescription}}">
	<meta itemprop="name" content="{{.DisplayTitle}}">
	- <meta itemprop="description" content="{{.Description}}">
	+ <meta itemprop="description" content="{{.PlainDescription}}">
	<meta name="twitter:card" content="summary">
	<meta name="twitter:title" content="{{.DisplayTitle}}">
	<meta name="twitter:image" content="{{.AvatarURL}}">
	- <meta name="twitter:description" content="{{.Description}}">
	+ <meta name="twitter:description" content="{{.PlainDescription}}">
	<meta property="og:title" content="{{.DisplayTitle}}" />
	<meta property="og:site_name" content="{{.DisplayTitle}}" />
	<meta property="og:type" content="article" />
	<meta property="og:url" content="{{.CanonicalURL}}" />
	- <meta property="og:description" content="{{.Description}}" />
	+ <meta property="og:description" content="{{.PlainDescription}}" />
	<meta property="og:image" content="{{.AvatarURL}}">
	{{template "collection-meta" .}}
	{{if .StyleSheet}}<style type="text/css">{{.StyleSheetDisplay}}</style>{{end}}

	{{if .RenderMathJax}}
	<!-- Add mathjax logic -->
	{{template "mathjax" .}}
	{{end}}

	<!-- Add highlighting logic -->
	{{template "highlighting" . }}

	</head>
	<body id="collection" itemscope itemtype="http://schema.org/WebPage">
	{{if or .IsOwner .SingleUser}}
	<nav id="manage"><ul>
	<li class="has-submenu"><a onclick="void(0)">☰ Menu</a>
	<ul>
	{{ if .IsOwner }}
	{{if .SingleUser}}
	<li><a href="/me/new">New Post</a></li>
	{{else}}
	<li><a href="/#{{.Alias}}" class="write">{{.SiteName}}</a></li>
	{{end}}
	{{if .SimpleNav}}<li><a href="/new#{{.Alias}}">New Post</a></li>{{end}}
	<li><a href="/me/c/{{.Alias}}">Customize</a></li>
	<li><a href="/me/c/{{.Alias}}/stats">Stats</a></li>
	<li class="separator"><hr /></li>
	{{if not .SingleUser}}<li><a href="/me/c/"><img class="ic-18dp" src="/img/ic_blogs_dark@2x.png" /> View Blogs</a></li>{{end}}
	<li><a href="/me/posts/"><img class="ic-18dp" src="/img/ic_list_dark@2x.png" /> View Drafts</a></li>
	{{ else }}
	<li><a href="/login">Log in{{if .IsProtected}} to {{.DisplayTitle}}{{end}}</a></li>
	{{if .IsProtected}}
	<li class="separator"><hr /></li>
	<li><a href="/logout">Log out</a></li>
	{{end}}
	{{ end }}
	</ul>
	</li>
	</ul></nav>
	{{else if .IsCollLoggedIn}}
	<nav id="manage" class="shiny"><ul>
	<li class="has-submenu"><a onclick="void(0)">☰ Menu</a>
	<ul>
	<li class="menu-heading" style="padding: .5rem .75rem; box-sizing: border-box;">{{.DisplayTitle}}</li>
	<li><a href="{{.CanonicalURL}}logout">Log out</a></li>
	</ul>
	</li>
	</ul></nav>
	{{end}}

	<header>
	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}
	<h1 dir="{{.Direction}}" id="blog-title">{{if .Posts}}{{else}}<span class="writeas-prefix"><a href="/">write.as</a></span> {{end}}<a href="/{{if .IsTopLevel}}{{else}}{{.Prefix}}{{.Alias}}/{{end}}" class="h-card p-author u-url" rel="me author">{{.DisplayTitle}}</a></h1>
	- {{if .Description}}<p class="description p-note">{{.Description}}</p>{{end}}
	+ {{if .Description}}<p class="description p-note">{{.DisplayDescription}}</p>{{end}}
	{{/if not .Public/}}
	<!--p class="meta-note"><span>Private collection</span>. Only you can see this page.</p-->
	{{/end/}}
	{{if .PinnedPosts}}<nav>
	{{range .PinnedPosts}}<a class="pinned" href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}</nav>
	{{end}}
	</header>

	{{if .Posts}}<section id="wrapper" itemscope itemtype="http://schema.org/Blog">{{else}}<div id="wrapper">{{end}}

	{{if .IsWelcome}}
	<div id="welcome">
	<h2>Welcome, <strong>{{.Username}}</strong>!</h2>
	<p>This is your new blog.</p>
	<p><a class="simple-cta" href="/#{{.Alias}}">Start writing</a>, or <a class="simple-cta" href="/me/c/{{.Alias}}">customize</a> your blog.</p>
	<p>Check out our <a class="simple-cta" href="https://guides.write.as/writing/?pk_campaign=welcome">writing guide</a> to see what else you can do, and <a class="simple-cta" href="/contact">get in touch</a> anytime with questions or feedback.</p>
	</div>
	{{end}}

	{{if .Flash}}
	<div class="alert success flash">
	<p>{{.Flash}}</p>
	</div>
	{{end}}

	{{template "posts" .}}

	{{if gt .TotalPages 1}}<nav id="paging" class="content-container clearfix">
	{{if or (and .Format.Ascending (le .CurrentPage .TotalPages)) (isRTL .Direction)}}
	{{if gt .CurrentPage 1}}<a href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">⇠ {{if and .Format.Ascending (le .CurrentPage .TotalPages)}}Previous{{else}}Newer{{end}}</a>{{end}}
	{{if lt .CurrentPage .TotalPages}}<a style="float:right;" href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">{{if and .Format.Ascending (lt .CurrentPage .TotalPages)}}Next{{else}}Older{{end}} ⇢</a>{{end}}
	{{else}}
	{{if lt .CurrentPage .TotalPages}}<a href="{{.NextPageURL .Prefix .CurrentPage .IsTopLevel}}">⇠ Older</a>{{end}}
	{{if gt .CurrentPage 1}}<a style="float:right;" href="{{.PrevPageURL .Prefix .CurrentPage .IsTopLevel}}">Newer ⇢</a>{{end}}
	{{end}}
	</nav>{{end}}

	{{if not .IsWelcome}}{{template "emailsubscribe" .}}{{end}}

	{{if .Posts}}</section>{{else}}</div>{{end}}

	{{if .ShowFooterBranding }}
	<footer>
	<hr />
	<nav dir="ltr">
	{{if not .SingleUser}}<a class="home pubd" href="/">{{.SiteName}}</a> · {{end}}powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a>
	</nav>
	</footer>
	{{ end }}
	</body>

	{{if .CanShowScript}}
	{{range .ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
	{{if .Script}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
	{{end}}
	<script src="/js/h.js"></script>
	<script src="/js/postactions.js"></script>
	<script src="/js/localdate.js"></script>
	<script type="text/javascript" src="/js/menu.js"></script>
	<script type="text/javascript">
	var deleting = false;
	function delPost(e, id, owned) {
	e.preventDefault();
	if (deleting) {
	return;
	}

	// TODO: UNDO!
	if (window.confirm('Are you sure you want to delete this post?')) {
	// AJAX
	deletePost(id, "", function() {
	// Remove post from list
	var $postEl = document.getElementById('post-' + id);
	$postEl.parentNode.removeChild($postEl);
	// TODO: add next post from this collection at the bottom
	});
	}
	}

	var deletePost = function(postID, token, callback) {
	deleting = true;

	var $delBtn = document.getElementById('post-' + postID).getElementsByClassName('delete action')[0];
	$delBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/posts/" + postID;
	http.open("DELETE", url, true);
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	deleting = false;
	if (http.status == 204) {
	callback();
	} else if (http.status == 409) {
	$delBtn.innerHTML = 'delete';
	alert("Post is synced to another account. Delete the post from that account instead.");
	// TODO: show "remove" button instead of "delete" now
	// Persist that state.
	// Have it remove the post locally only.
	} else {
	$delBtn.innerHTML = 'delete';
	alert("Failed to delete." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send();
	};

	var pinning = false;
	function pinPost(e, postID, slug, title) {
	e.preventDefault();
	if (pinning) {
	return;
	}
	pinning = true;

	var callback = function() {
	// Visibly remove post from collection
	var $postEl = document.getElementById('post-' + postID);
	$postEl.parentNode.removeChild($postEl);
	var $header = document.getElementsByTagName('header')[0];
	var $pinnedNavs = $header.getElementsByTagName('nav');
	// Add link to nav
	var link = '<a class="pinned" href="{{if not .SingleUser}}/{{.Alias}}/{{end}}'+slug+'">'+title+'</a>';
	if ($pinnedNavs.length == 0) {
	$header.insertAdjacentHTML("beforeend", '<nav>'+link+'</nav>');
	} else {
	$pinnedNavs[0].insertAdjacentHTML("beforeend", link);
	}
	};

	var $pinBtn = document.getElementById('post-' + postID).getElementsByClassName('pin action')[0];
	$pinBtn.innerHTML = '...';

	var http = new XMLHttpRequest();
	var url = "/api/collections/{{.Alias}}/pin";
	var params = [ { "id": postID } ];
	http.open("POST", url, true);
	http.setRequestHeader("Content-type", "application/json");
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	pinning = false;
	if (http.status == 200) {
	callback();
	} else if (http.status == 409) {
	$pinBtn.innerHTML = 'pin';
	alert("Post is synced to another account. Delete the post from that account instead.");
	// TODO: show "remove" button instead of "delete" now
	// Persist that state.
	// Have it remove the post locally only.
	} else {
	$pinBtn.innerHTML = 'pin';
	alert("Failed to pin." + (http.status>=500?" Please try again.":""));
	}
	}
	}
	http.send(JSON.stringify(params));
	};

	try {
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {}
	</script>
	</html>{{end}}
	diff --git a/templates/edit-meta.tmpl b/templates/edit-meta.tmpl
	index 9f7faed..d3f93a8 100644
	--- a/templates/edit-meta.tmpl
	+++ b/templates/edit-meta.tmpl
	@@ -1,374 +1,375 @@
	{{define "edit-meta"}}<!DOCTYPE HTML>
	<html>
	<head>

	<title>Edit metadata: {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}} — {{.SiteName}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />
	<style type="text/css">
	dt {
	width: 8em;
	}
	.error {
	display: none;
	}
	.mono {
	font-style: normal;
	}
	#set-now {
	font-style: italic;
	margin-left: 0.25rem;
	}
	.content-container h2 a {
	font-size: .6em;
	font-weight: normal;
	margin-left: 1em;
	}
	.content-container h2 a:link, .content-container h2 a:visited {
	color: blue;
	}
	.content-container h2 a:hover {
	text-decoration: underline;
	}
	</style>

	</head>
	<body id="pad-sub" class="light">

	<header id="tools">
	<div id="clip">
	<h1><a href="/me/c/" title="View blogs"><img class="ic-24dp" src="/img/ic_blogs_dark@2x.png" /></a></h1>
	<nav id="target" class=""><ul>
	<li>{{if .EditCollection}}<a href="{{.EditCollection.CanonicalURL}}">{{.EditCollection.Title}}</a>{{else}}<a>Draft</a>{{end}}</li>
	</ul></nav>
	</div>
	<div id="belt">
	<div class="tool if-room"><a href="{{if .EditCollection}}{{.EditCollection.CanonicalURL}}{{.Post.Slug}}/edit{{else}}/{{.Post.Id}}/edit{{end}}" title="Edit post" id="edit"><img class="ic-24dp" src="/img/ic_edit_dark@2x.png" /></a></div>
	<div class="tool if-room room-2"><a href="#theme" title="Toggle theme" id="toggle-theme"><img class="ic-24dp" src="/img/ic_brightness_dark@2x.png" /></a></div>
	<div class="tool if-room room-1"><a href="/me/posts/" title="View posts" id="view-posts"><img class="ic-24dp" src="/img/ic_list_dark@2x.png" /></a></div>
	</div>
	</header>

	<div class="content-container tight">
	<form action="/api/{{if .EditCollection}}collections/{{.EditCollection.Alias}}/{{end}}posts/{{.Post.Id}}" method="post" onsubmit="return updateMeta()">
	<h2>Edit metadata: {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}} <a href="/{{if .EditCollection}}{{if not .SingleUser}}{{.EditCollection.Alias}}/{{end}}{{.Post.Slug}}{{else}}{{if .SingleUser}}d/{{end}}{{.Post.Id}}{{end}}">view post</a></h2>

	{{if .Flashes}}<ul class="errors">
	{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
	</ul>{{end}}

	<dl class="dl-horizontal">
	{{if .EditCollection}}
	<dt><label for="slug">Slug</label></dt>
	<dd><input type="text" id="slug" name="slug" value="{{.Post.Slug}}" /></dd>
	{{end}}
	<dt><label for="lang">Language</label></dt>
	<dd>
	- <select name="lang" id="lang" dir="auto">
	+ <select name="lang" id="lang" dir="auto" class="inputform">
	<option value=""></option>
	<option value="ab"{{if eq "ab" .Post.Language.String}} selected="selected"{{end}}>аҧсуа бызшәа, аҧсшәа</option>
	<option value="aa"{{if eq "aa" .Post.Language.String}} selected="selected"{{end}}>Afaraf</option>
	<option value="af"{{if eq "af" .Post.Language.String}} selected="selected"{{end}}>Afrikaans</option>
	<option value="ak"{{if eq "ak" .Post.Language.String}} selected="selected"{{end}}>Akan</option>
	<option value="sq"{{if eq "sq" .Post.Language.String}} selected="selected"{{end}}>Shqip</option>
	<option value="am"{{if eq "am" .Post.Language.String}} selected="selected"{{end}}>አማርኛ</option>
	<option dir="rtl" value="ar"{{if eq "ar" .Post.Language.String}} selected="selected"{{end}}>العربية</option>
	<option value="an"{{if eq "an" .Post.Language.String}} selected="selected"{{end}}>aragonés</option>
	<option value="hy"{{if eq "hy" .Post.Language.String}} selected="selected"{{end}}>Հայերեն</option>
	<option value="as"{{if eq "as" .Post.Language.String}} selected="selected"{{end}}>অসমীয়া</option>
	<option value="av"{{if eq "av" .Post.Language.String}} selected="selected"{{end}}>авар мацӀ, магӀарул мацӀ</option>
	<option value="ae"{{if eq "ae" .Post.Language.String}} selected="selected"{{end}}>avesta</option>
	<option value="ay"{{if eq "ay" .Post.Language.String}} selected="selected"{{end}}>aymar aru</option>
	<option value="az"{{if eq "az" .Post.Language.String}} selected="selected"{{end}}>azərbaycan dili</option>
	<option value="bm"{{if eq "bm" .Post.Language.String}} selected="selected"{{end}}>bamanankan</option>
	<option value="ba"{{if eq "ba" .Post.Language.String}} selected="selected"{{end}}>башҡорт теле</option>
	<option value="eu"{{if eq "eu" .Post.Language.String}} selected="selected"{{end}}>euskara, euskera</option>
	<option value="be"{{if eq "be" .Post.Language.String}} selected="selected"{{end}}>беларуская мова</option>
	<option value="bn"{{if eq "bn" .Post.Language.String}} selected="selected"{{end}}>বাংলা</option>
	<option value="bh"{{if eq "bh" .Post.Language.String}} selected="selected"{{end}}>भोजपुरी</option>
	<option value="bi"{{if eq "bi" .Post.Language.String}} selected="selected"{{end}}>Bislama</option>
	<option value="bs"{{if eq "bs" .Post.Language.String}} selected="selected"{{end}}>bosanski jezik</option>
	<option value="br"{{if eq "br" .Post.Language.String}} selected="selected"{{end}}>brezhoneg</option>
	<option value="bg"{{if eq "bg" .Post.Language.String}} selected="selected"{{end}}>български език</option>
	<option value="my"{{if eq "my" .Post.Language.String}} selected="selected"{{end}}>ဗမာစာ</option>
	<option value="ca"{{if eq "ca" .Post.Language.String}} selected="selected"{{end}}>català</option>
	<option value="ch"{{if eq "ch" .Post.Language.String}} selected="selected"{{end}}>Chamoru</option>
	<option value="ce"{{if eq "ce" .Post.Language.String}} selected="selected"{{end}}>нохчийн мотт</option>
	<option value="ny"{{if eq "ny" .Post.Language.String}} selected="selected"{{end}}>chiCheŵa, chinyanja</option>
	<option value="zh"{{if eq "zh" .Post.Language.String}} selected="selected"{{end}}>中文 (Zhōngwén), 汉语, 漢語</option>
	<option value="cv"{{if eq "cv" .Post.Language.String}} selected="selected"{{end}}>чӑваш чӗлхи</option>
	<option value="kw"{{if eq "kw" .Post.Language.String}} selected="selected"{{end}}>Kernewek</option>
	<option value="co"{{if eq "co" .Post.Language.String}} selected="selected"{{end}}>corsu, lingua corsa</option>
	<option value="cr"{{if eq "cr" .Post.Language.String}} selected="selected"{{end}}>ᓀᐦᐃᔭᐍᐏᐣ</option>
	<option value="hr"{{if eq "hr" .Post.Language.String}} selected="selected"{{end}}>hrvatski jezik</option>
	<option value="cs"{{if eq "cs" .Post.Language.String}} selected="selected"{{end}}>čeština, český jazyk</option>
	<option value="da"{{if eq "da" .Post.Language.String}} selected="selected"{{end}}>dansk</option>
	<option dir="rtl" value="dv"{{if eq "dv" .Post.Language.String}} selected="selected"{{end}}>ދިވެހި</option>
	<option value="nl"{{if eq "nl" .Post.Language.String}} selected="selected"{{end}}>Nederlands, Vlaams</option>
	<option value="dz"{{if eq "dz" .Post.Language.String}} selected="selected"{{end}}>རྫོང་ཁ</option>
	<option value="en"{{if eq "en" .Post.Language.String}} selected="selected"{{end}}>English</option>
	<option value="eo"{{if eq "eo" .Post.Language.String}} selected="selected"{{end}}>Esperanto</option>
	<option value="et"{{if eq "et" .Post.Language.String}} selected="selected"{{end}}>eesti, eesti keel</option>
	<option value="ee"{{if eq "ee" .Post.Language.String}} selected="selected"{{end}}>Eʋegbe</option>
	<option value="fo"{{if eq "fo" .Post.Language.String}} selected="selected"{{end}}>føroyskt</option>
	<option value="fj"{{if eq "fj" .Post.Language.String}} selected="selected"{{end}}>vosa Vakaviti</option>
	<option value="fi"{{if eq "fi" .Post.Language.String}} selected="selected"{{end}}>suomi, suomen kieli</option>
	<option value="fr"{{if eq "fr" .Post.Language.String}} selected="selected"{{end}}>français, langue française</option>
	<option value="ff"{{if eq "ff" .Post.Language.String}} selected="selected"{{end}}>Fulfulde, Pulaar, Pular</option>
	<option value="gl"{{if eq "gl" .Post.Language.String}} selected="selected"{{end}}>Galego</option>
	<option value="ka"{{if eq "ka" .Post.Language.String}} selected="selected"{{end}}>ქართული</option>
	<option value="de"{{if eq "de" .Post.Language.String}} selected="selected"{{end}}>Deutsch</option>
	<option value="el"{{if eq "el" .Post.Language.String}} selected="selected"{{end}}>ελληνικά</option>
	<option value="gn"{{if eq "gn" .Post.Language.String}} selected="selected"{{end}}>Avañe'ẽ</option>
	<option value="gu"{{if eq "gu" .Post.Language.String}} selected="selected"{{end}}>ગુજરાતી</option>
	<option value="ht"{{if eq "ht" .Post.Language.String}} selected="selected"{{end}}>Kreyòl ayisyen</option>
	<option dir="rtl" value="ha"{{if eq "ha" .Post.Language.String}} selected="selected"{{end}}>(Hausa) هَوُسَ</option>
	<option dir="rtl" value="he"{{if eq "he" .Post.Language.String}} selected="selected"{{end}}>עברית</option>
	<option value="hz"{{if eq "hz" .Post.Language.String}} selected="selected"{{end}}>Otjiherero</option>
	<option value="hi"{{if eq "hi" .Post.Language.String}} selected="selected"{{end}}>हिन्दी, हिंदी</option>
	<option value="ho"{{if eq "ho" .Post.Language.String}} selected="selected"{{end}}>Hiri Motu</option>
	<option value="hu"{{if eq "hu" .Post.Language.String}} selected="selected"{{end}}>magyar</option>
	<option value="ia"{{if eq "ia" .Post.Language.String}} selected="selected"{{end}}>Interlingua</option>
	<option value="id"{{if eq "id" .Post.Language.String}} selected="selected"{{end}}>Bahasa Indonesia</option>
	<option value="ie"{{if eq "ie" .Post.Language.String}} selected="selected"{{end}}>Interlingue</option>
	<option value="ga"{{if eq "ga" .Post.Language.String}} selected="selected"{{end}}>Gaeilge</option>
	<option value="ig"{{if eq "ig" .Post.Language.String}} selected="selected"{{end}}>Asụsụ Igbo</option>
	<option value="ik"{{if eq "ik" .Post.Language.String}} selected="selected"{{end}}>Iñupiaq, Iñupiatun</option>
	<option value="io"{{if eq "io" .Post.Language.String}} selected="selected"{{end}}>Ido</option>
	<option value="is"{{if eq "is" .Post.Language.String}} selected="selected"{{end}}>Íslenska</option>
	<option value="it"{{if eq "it" .Post.Language.String}} selected="selected"{{end}}>Italiano</option>
	<option value="iu"{{if eq "iu" .Post.Language.String}} selected="selected"{{end}}>ᐃᓄᒃᑎᑐᑦ</option>
	<option value="ja"{{if eq "ja" .Post.Language.String}} selected="selected"{{end}}>日本語 (にほんご)</option>
	<option value="jv"{{if eq "jv" .Post.Language.String}} selected="selected"{{end}}>ꦧꦱꦗꦮ, Basa Jawa</option>
	<option value="kl"{{if eq "kl" .Post.Language.String}} selected="selected"{{end}}>kalaallisut, kalaallit oqaasii</option>
	<option value="kn"{{if eq "kn" .Post.Language.String}} selected="selected"{{end}}>ಕನ್ನಡ</option>
	<option value="kr"{{if eq "kr" .Post.Language.String}} selected="selected"{{end}}>Kanuri</option>
	<option value="ks"{{if eq "ks" .Post.Language.String}} selected="selected"{{end}}>कश्मीरी, كشميري‎</option>
	<option value="kk"{{if eq "kk" .Post.Language.String}} selected="selected"{{end}}>қазақ тілі</option>
	<option value="km"{{if eq "km" .Post.Language.String}} selected="selected"{{end}}>ខ្មែរ, ខេមរភាសា, ភាសាខ្មែរ</option>
	<option value="ki"{{if eq "ki" .Post.Language.String}} selected="selected"{{end}}>Gĩkũyũ</option>
	<option value="rw"{{if eq "rw" .Post.Language.String}} selected="selected"{{end}}>Ikinyarwanda</option>
	<option value="ky"{{if eq "ky" .Post.Language.String}} selected="selected"{{end}}>Кыргызча, Кыргыз тили</option>
	<option value="kv"{{if eq "kv" .Post.Language.String}} selected="selected"{{end}}>коми кыв</option>
	<option value="kg"{{if eq "kg" .Post.Language.String}} selected="selected"{{end}}>Kikongo</option>
	<option value="ko"{{if eq "ko" .Post.Language.String}} selected="selected"{{end}}>한국어</option>
	<option value="ku"{{if eq "ku" .Post.Language.String}} selected="selected"{{end}}>Kurdî, كوردی‎</option>
	<option value="kj"{{if eq "kj" .Post.Language.String}} selected="selected"{{end}}>Kuanyama</option>
	<option value="la"{{if eq "la" .Post.Language.String}} selected="selected"{{end}}>latine, lingua latina</option>
	<option value="lb"{{if eq "lb" .Post.Language.String}} selected="selected"{{end}}>Lëtzebuergesch</option>
	<option value="lg"{{if eq "lg" .Post.Language.String}} selected="selected"{{end}}>Luganda</option>
	<option value="li"{{if eq "li" .Post.Language.String}} selected="selected"{{end}}>Limburgs</option>
	<option value="ln"{{if eq "ln" .Post.Language.String}} selected="selected"{{end}}>Lingála</option>
	<option value="lo"{{if eq "lo" .Post.Language.String}} selected="selected"{{end}}>ພາສາລາວ</option>
	<option value="lt"{{if eq "lt" .Post.Language.String}} selected="selected"{{end}}>lietuvių kalba</option>
	<option value="lu"{{if eq "lu" .Post.Language.String}} selected="selected"{{end}}>Kiluba</option>
	<option value="lv"{{if eq "lv" .Post.Language.String}} selected="selected"{{end}}>Latviešu Valoda</option>
	<option value="gv"{{if eq "gv" .Post.Language.String}} selected="selected"{{end}}>Gaelg, Gailck</option>
	<option value="mk"{{if eq "mk" .Post.Language.String}} selected="selected"{{end}}>македонски јазик</option>
	<option value="mg"{{if eq "mg" .Post.Language.String}} selected="selected"{{end}}>fiteny malagasy</option>
	<option value="ms"{{if eq "ms" .Post.Language.String}} selected="selected"{{end}}>Bahasa Melayu, بهاس ملايو‎</option>
	<option value="ml"{{if eq "ml" .Post.Language.String}} selected="selected"{{end}}>മലയാളം</option>
	<option value="mt"{{if eq "mt" .Post.Language.String}} selected="selected"{{end}}>Malti</option>
	<option value="mi"{{if eq "mi" .Post.Language.String}} selected="selected"{{end}}>te reo Māori</option>
	<option value="mr"{{if eq "mr" .Post.Language.String}} selected="selected"{{end}}>मराठी</option>
	<option value="mh"{{if eq "mh" .Post.Language.String}} selected="selected"{{end}}>Kajin M̧ajeļ</option>
	<option value="mn"{{if eq "mn" .Post.Language.String}} selected="selected"{{end}}>Монгол хэл</option>
	<option value="na"{{if eq "na" .Post.Language.String}} selected="selected"{{end}}>Dorerin Naoero</option>
	<option value="nv"{{if eq "nv" .Post.Language.String}} selected="selected"{{end}}>Diné bizaad</option>
	<option value="nd"{{if eq "nd" .Post.Language.String}} selected="selected"{{end}}>isiNdebele</option>
	<option value="ne"{{if eq "ne" .Post.Language.String}} selected="selected"{{end}}>नेपाली</option>
	<option value="ng"{{if eq "ng" .Post.Language.String}} selected="selected"{{end}}>Owambo</option>
	<option value="nb"{{if eq "nb" .Post.Language.String}} selected="selected"{{end}}>Norsk Bokmål</option>
	<option value="nn"{{if eq "nn" .Post.Language.String}} selected="selected"{{end}}>Norsk Nynorsk</option>
	<option value="no"{{if eq "no" .Post.Language.String}} selected="selected"{{end}}>Norsk</option>
	<option value="ii"{{if eq "ii" .Post.Language.String}} selected="selected"{{end}}>ꆈꌠ꒿ Nuosuhxop</option>
	<option value="nr"{{if eq "nr" .Post.Language.String}} selected="selected"{{end}}>isiNdebele</option>
	<option value="oc"{{if eq "oc" .Post.Language.String}} selected="selected"{{end}}>occitan, lenga d'òc</option>
	<option value="oj"{{if eq "oj" .Post.Language.String}} selected="selected"{{end}}>ᐊᓂᔑᓈᐯᒧᐎᓐ</option>
	<option value="cu"{{if eq "cu" .Post.Language.String}} selected="selected"{{end}}>ѩзыкъ словѣньскъ</option>
	<option value="om"{{if eq "om" .Post.Language.String}} selected="selected"{{end}}>Afaan Oromoo</option>
	<option value="or"{{if eq "or" .Post.Language.String}} selected="selected"{{end}}>ଓଡ଼ିଆ</option>
	<option value="os"{{if eq "os" .Post.Language.String}} selected="selected"{{end}}>ирон æвзаг</option>
	<option value="pa"{{if eq "pa" .Post.Language.String}} selected="selected"{{end}}>ਪੰਜਾਬੀ</option>
	<option value="pi"{{if eq "pi" .Post.Language.String}} selected="selected"{{end}}>पाऴि</option>
	<option dir="rtl" value="fa"{{if eq "fa" .Post.Language.String}} selected="selected"{{end}}>فارسی</option>
	<option value="pl"{{if eq "pl" .Post.Language.String}} selected="selected"{{end}}>Język Polski, Polszczyzna</option>
	<option dir="rtl" value="ps"{{if eq "ps" .Post.Language.String}} selected="selected"{{end}}>پښتو</option>
	<option value="pt"{{if eq "pt" .Post.Language.String}} selected="selected"{{end}}>Português</option>
	<option value="qu"{{if eq "qu" .Post.Language.String}} selected="selected"{{end}}>Runa Simi, Kichwa</option>
	<option value="rm"{{if eq "rm" .Post.Language.String}} selected="selected"{{end}}>Rumantsch Grischun</option>
	<option value="rn"{{if eq "rn" .Post.Language.String}} selected="selected"{{end}}>Ikirundi</option>
	<option value="ro"{{if eq "ro" .Post.Language.String}} selected="selected"{{end}}>Română</option>
	<option value="ru"{{if eq "ru" .Post.Language.String}} selected="selected"{{end}}>Русский</option>
	<option value="sa"{{if eq "sa" .Post.Language.String}} selected="selected"{{end}}>संस्कृतम्</option>
	<option value="sc"{{if eq "sc" .Post.Language.String}} selected="selected"{{end}}>sardu</option>
	<option value="sd"{{if eq "sd" .Post.Language.String}} selected="selected"{{end}}>सिन्धी, سنڌي، سندھی‎</option>
	<option value="se"{{if eq "se" .Post.Language.String}} selected="selected"{{end}}>Davvisámegiella</option>
	<option value="sm"{{if eq "sm" .Post.Language.String}} selected="selected"{{end}}>gagana fa'a Samoa</option>
	<option value="sg"{{if eq "sg" .Post.Language.String}} selected="selected"{{end}}>yângâ tî sängö</option>
	<option value="sr"{{if eq "sr" .Post.Language.String}} selected="selected"{{end}}>српски језик</option>
	<option value="gd"{{if eq "gd" .Post.Language.String}} selected="selected"{{end}}>Gàidhlig</option>
	<option value="sn"{{if eq "sn" .Post.Language.String}} selected="selected"{{end}}>chiShona</option>
	<option value="si"{{if eq "si" .Post.Language.String}} selected="selected"{{end}}>සිංහල</option>
	<option value="sk"{{if eq "sk" .Post.Language.String}} selected="selected"{{end}}>Slovenčina, Slovenský Jazyk</option>
	<option value="sl"{{if eq "sl" .Post.Language.String}} selected="selected"{{end}}>Slovenski Jezik, Slovenščina</option>
	<option value="so"{{if eq "so" .Post.Language.String}} selected="selected"{{end}}>Soomaaliga, af Soomaali</option>
	<option value="st"{{if eq "st" .Post.Language.String}} selected="selected"{{end}}>Sesotho</option>
	<option value="es"{{if eq "es" .Post.Language.String}} selected="selected"{{end}}>Español</option>
	<option value="su"{{if eq "su" .Post.Language.String}} selected="selected"{{end}}>Basa Sunda</option>
	<option value="sw"{{if eq "sw" .Post.Language.String}} selected="selected"{{end}}>Kiswahili</option>
	<option value="ss"{{if eq "ss" .Post.Language.String}} selected="selected"{{end}}>SiSwati</option>
	<option value="sv"{{if eq "sv" .Post.Language.String}} selected="selected"{{end}}>Svenska</option>
	<option value="ta"{{if eq "ta" .Post.Language.String}} selected="selected"{{end}}>தமிழ்</option>
	<option value="te"{{if eq "te" .Post.Language.String}} selected="selected"{{end}}>తెలుగు</option>
	<option value="tg"{{if eq "tg" .Post.Language.String}} selected="selected"{{end}}>тоҷикӣ, toçikī, تاجیکی‎</option>
	<option value="th"{{if eq "th" .Post.Language.String}} selected="selected"{{end}}>ไทย</option>
	<option value="ti"{{if eq "ti" .Post.Language.String}} selected="selected"{{end}}>ትግርኛ</option>
	<option value="bo"{{if eq "bo" .Post.Language.String}} selected="selected"{{end}}>བོད་ཡིག</option>
	<option value="tk"{{if eq "tk" .Post.Language.String}} selected="selected"{{end}}>Türkmen, Түркмен</option>
	<option value="tl"{{if eq "tl" .Post.Language.String}} selected="selected"{{end}}>Wikang Tagalog</option>
	<option value="tn"{{if eq "tn" .Post.Language.String}} selected="selected"{{end}}>Setswana</option>
	<option value="to"{{if eq "to" .Post.Language.String}} selected="selected"{{end}}>Faka Tonga</option>
	<option value="tr"{{if eq "tr" .Post.Language.String}} selected="selected"{{end}}>Türkçe</option>
	<option value="ts"{{if eq "ts" .Post.Language.String}} selected="selected"{{end}}>Xitsonga</option>
	<option value="tt"{{if eq "tt" .Post.Language.String}} selected="selected"{{end}}>татар теле, tatar tele</option>
	<option value="tw"{{if eq "tw" .Post.Language.String}} selected="selected"{{end}}>Twi</option>
	<option value="ty"{{if eq "ty" .Post.Language.String}} selected="selected"{{end}}>Reo Tahiti</option>
	<option value="ug"{{if eq "ug" .Post.Language.String}} selected="selected"{{end}}>ئۇيغۇرچە‎, Uyghurche</option>
	<option value="uk"{{if eq "uk" .Post.Language.String}} selected="selected"{{end}}>Українська</option>
	<option dir="rtl" value="ur"{{if eq "ur" .Post.Language.String}} selected="selected"{{end}}>اردو</option>
	<option value="uz"{{if eq "uz" .Post.Language.String}} selected="selected"{{end}}>Oʻzbek, Ўзбек, أۇزبېك‎</option>
	<option value="ve"{{if eq "ve" .Post.Language.String}} selected="selected"{{end}}>Tshivenḓa</option>
	<option value="vi"{{if eq "vi" .Post.Language.String}} selected="selected"{{end}}>Tiếng Việt</option>
	<option value="vo"{{if eq "vo" .Post.Language.String}} selected="selected"{{end}}>Volapük</option>
	<option value="wa"{{if eq "wa" .Post.Language.String}} selected="selected"{{end}}>Walon</option>
	<option value="cy"{{if eq "cy" .Post.Language.String}} selected="selected"{{end}}>Cymraeg</option>
	<option value="wo"{{if eq "wo" .Post.Language.String}} selected="selected"{{end}}>Wollof</option>
	<option value="fy"{{if eq "fy" .Post.Language.String}} selected="selected"{{end}}>Frysk</option>
	<option value="xh"{{if eq "xh" .Post.Language.String}} selected="selected"{{end}}>isiXhosa</option>
	<option dir="rtl" value="yi"{{if eq "yi" .Post.Language.String}} selected="selected"{{end}}>ייִדיש</option>
	<option value="yo"{{if eq "yo" .Post.Language.String}} selected="selected"{{end}}>Yorùbá</option>
	<option value="za"{{if eq "za" .Post.Language.String}} selected="selected"{{end}}>Saɯ cueŋƅ, Saw cuengh</option>
	<option value="zu"{{if eq "zu" .Post.Language.String}} selected="selected"{{end}}>isiZulu</option>
	</select>
	</dd>
	<dt><label for="rtl">Direction</label></dt>
	<dd><input type="checkbox" id="rtl" name="rtl" {{if .Post.IsRTL.Bool}}checked="checked"{{end}} /><label for="rtl"> right-to-left</label></dd>
	<dt><label for="created">Created</label></dt>
	<dd>
	<input type="text" id="created" name="created" value="{{.Post.UserFacingCreated}}" data-time="{{.Post.Created8601}}" placeholder="YYYY-MM-DD HH:MM:SS" maxlength="19" /> <span id="tz">UTC</span> <a href="#" id="set-now">now</a>
	<p class="error" id="create-error">Date format should be: <span class="mono"><abbr title="The full year">YYYY</abbr>-<abbr title="The numeric month of the year, where January = 1, with a zero in front if less than 10">MM</abbr>-<abbr title="The day of the month, with a zero in front if less than 10">DD</abbr> <abbr title="The hour (00-23), with a zero in front if less than 10.">HH</abbr>:<abbr title="The minute of the hour (00-59), with a zero in front if less than 10.">MM</abbr>:<abbr title="The seconds (00-59), with a zero in front if less than 10.">SS</abbr></span></p>
	</dd>
	<dt> </dt><dd><input type="submit" value="Save changes" /></dd>
	</dl>
	<input type="hidden" name="web" value="true" />
	</form>
	</div>

	<script src="/js/h.js"></script>
	<script>
	function updateMeta() {
	if ({{.Silenced}}) {
	alert("Your account is silenced, so you can't edit posts.");
	return
	}
	document.getElementById('create-error').style.display = 'none';
	var $created = document.getElementById('created');
	var dateStr = $created.value.trim();
	var m = dateStr.match(/^[0-9]{4}-[0-9]{1,2}-[0-9]{1,2}( [0-9]{1,2}:[0-9]{1,2}(:[0-9]{1,2})?)?$/);
	if (!m) {
	document.getElementById('create-error').style.display = 'block';
	return false;
	}
	// Break up the date and parse. This ensures cross-browser compatibility
	var p = dateStr.split(/[^0-9]/);
	var d = new Date(p[0], p[1]-1, p[2], p[3] ? p[3] : 0, p[4] ? p[4] : 0, p[5] ? p[5] : 0);
	$created.value = d.getUTCFullYear() + '-' + ('0' + (d.getUTCMonth()+1)).slice(-2) + '-' + ('0' + d.getUTCDate()).slice(-2)+' '+('0'+d.getUTCHours()).slice(-2)+':'+('0'+d.getUTCMinutes()).slice(-2)+':'+('0'+d.getUTCSeconds()).slice(-2);
	var $tz = document.getElementById('tz');
	$tz.style.display = "inline";
	var $submit = document.querySelector('input[type=submit]');
	$submit.value = "Saving...";
	$submit.disabled = true;
	return true;
	}
	function dateToStr(d) {
	return d.getFullYear() + '-' + ('0' + (d.getMonth()+1)).slice(-2) + '-' + ('0' + d.getDate()).slice(-2)+' '+('0'+d.getHours()).slice(-2)+':'+('0'+d.getMinutes()).slice(-2)+':'+('0'+d.getSeconds()).slice(-2);
	}
	function setLocalTime() {
	var $created = document.getElementById('created');
	var d = new Date($created.getAttribute('data-time'));
	$created.value = dateToStr(d);
	var $tz = document.getElementById('tz');
	$tz.style.display = "none";
	}
	setLocalTime();
	function setToNow() {
	var $created = document.getElementById('created');
	$created.value = dateToStr(new Date());
	}
	H.getEl('set-now').on('click', function(e) {
	e.preventDefault();
	setToNow();
	});
	function toggleTheme() {
	var btns = Array.prototype.slice.call(document.getElementById('tools').querySelectorAll('a img'));
	if (document.body.className == 'light') {
	document.body.className = 'dark';
	for (var i=0; i<btns.length; i++) {
	btns[i].src = btns[i].src.replace('_dark@2x.png', '@2x.png');
	}
	} else {
	document.body.className = 'light';
	for (var i=0; i<btns.length; i++) {
	btns[i].src = btns[i].src.replace('@2x.png', '_dark@2x.png');
	}
	}
	H.set('padTheme', document.body.className);
	}
	if (H.get('padTheme', 'light') != 'light') {
	toggleTheme();
	}

	var setButtonStates = function() {
	if (!canPublish) {
	$btnPublish.el.className = 'disabled';
	return;
	}
	if ($writer.el.value.length === 0 \|\| (draftDoc != 'lastDoc' && $writer.el.value == origDoc)) {
	$btnPublish.el.className = 'disabled';
	} else {
	$btnPublish.el.className = '';
	}
	};

	H.getEl('toggle-theme').on('click', function(e) {
	e.preventDefault();
	try {
	var newTheme = 'light';
	if (document.body.className == 'light') {
	newTheme = 'dark';
	}
	} catch(e) {}
	toggleTheme();
	});

	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	try {
	(function() {
	var wf=document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type='text/javascript';
	wf.async='true';
	var s=document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {
	// whatevs
	}
	</script>
	<link href="/css/icons.css" rel="stylesheet">
	</body>
	</html>{{end}}
	diff --git a/templates/pad.tmpl b/templates/pad.tmpl
	index 8da063e..555bbb3 100644
	--- a/templates/pad.tmpl
	+++ b/templates/pad.tmpl
	@@ -1,420 +1,421 @@
	{{define "pad"}}<!DOCTYPE HTML>
	<html>
	<head>

	<title>{{if .Editing}}Editing {{if .Post.Title}}{{.Post.Title}}{{else}}{{.Post.Id}}{{end}}{{else}}New Post{{end}} — {{.SiteName}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="google" value="notranslate">
	</head>
	<body id="pad" class="light">

	<div id="overlay"></div>

	<textarea id="writer" placeholder="Write..." class="{{.Post.Font}}" autofocus>{{if .Post.Title}}# {{.Post.Title}}

	{{end}}{{.Post.Content}}</textarea>

	<div class="alert success hidden" id="edited-elsewhere">This post has been updated elsewhere since you last published! <a href="#" id="erase-edit">Delete draft and reload</a>.</div>

	<header id="tools">
	<div id="clip">
	{{if not .SingleUser}}<h1><a href="/me/c/" title="View blogs"><img class="ic-24dp" src="/img/ic_blogs_dark@2x.png" /></a></h1>{{end}}
	<nav id="target" {{if .SingleUser}}style="margin-left:0"{{end}}><ul>
	{{if .Editing}}<li>{{if .EditCollection}}<a href="{{.EditCollection.CanonicalURL}}">{{.EditCollection.Title}}</a>{{else}}<a>Draft</a>{{end}}</li>
	- {{else}}<li class="has-submenu"><a id="publish-to"><span id="target-name">Draft</span> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /></a>
	+ {{else}}<li class="has-submenu"><a href="#" id="publish-to" onclick="return false"><span id="target-name">Draft</span> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /></a>
	<ul>
	<li class="menu-heading">Publish to...</li>
	{{if .Blogs}}{{range $idx, $el := .Blogs}}
	<li class="target{{if eq $idx 0}} selected{{end}}" id="blog-{{$el.Alias}}"><a href="#{{$el.Alias}}"><i class="material-icons md-18">public</i> {{if $el.Title}}{{$el.Title}}{{else}}{{$el.Alias}}{{end}}</a></li>
	{{end}}{{end}}
	<li class="target" id="blog-anonymous"><a href="#anonymous"><i class="material-icons md-18">description</i> <em>Draft</em></a></li>
	<li id="user-separator" class="separator"><hr /></li>
	{{ if .SingleUser }}
	<li><a href="/"><i class="material-icons md-18">launch</i> View Blog</a></li>
	<li><a href="/me/c/{{.Username}}"><i class="material-icons md-18">palette</i> Customize</a></li>
	<li><a href="/me/c/{{.Username}}/stats"><i class="material-icons md-18">trending_up</i> Stats</a></li>
	{{ else }}
	<li><a href="/me/c/"><i class="material-icons md-18">library_books</i> View Blogs</a></li>
	{{ end }}
	<li><a href="/me/posts/"><i class="material-icons md-18">view_list</i> View Drafts</a></li>
	<li><a href="/me/logout"><i class="material-icons md-18">power_settings_new</i> Log out</a></li>
	</ul>
	</li>{{end}}
	</ul></nav>
	<nav id="font-picker" class="if-room room-3 hidden" style="margin-left:-1em"><ul>
	<li class="has-submenu"><a href="#" id="" onclick="return false"><img class="ic-24dp" src="/img/ic_font_dark@2x.png" /> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /></a>
	<ul style="text-align: center">
	<li class="menu-heading">Font</li>
	<li class="selected"><a class="font norm" href="#norm">Serif</a></li>
	<li><a class="font sans" href="#sans">Sans-serif</a></li>
	<li><a class="font wrap" href="#wrap">Monospace</a></li>
	</ul>
	</li>
	</ul></nav>
	<span id="wc" class="hidden if-room room-4">0 words</span>
	</div>
	<noscript style="margin-left: 2em;"><strong>NOTE</strong>: for now, you'll need Javascript enabled to post.</noscript>
	<div id="belt">
	{{if .Editing}}<div class="tool hidden if-room"><a href="{{if .EditCollection}}{{.EditCollection.CanonicalURL}}{{.Post.Slug}}/edit/meta{{else}}/{{if .SingleUser}}d/{{end}}{{.Post.Id}}/meta{{end}}" title="Edit post metadata" id="edit-meta"><img class="ic-24dp" src="/img/ic_info_dark@2x.png" /></a></div>{{end}}
	<div class="tool hidden if-room room-2"><a href="#theme" title="Toggle theme" id="toggle-theme"><img class="ic-24dp" src="/img/ic_brightness_dark@2x.png" /></a></div>
	<div class="tool if-room room-1"><a href="{{if not .User}}/pad/posts{{else}}/me/posts/{{end}}" title="View posts" id="view-posts"><img class="ic-24dp" src="/img/ic_list_dark@2x.png" /></a></div>
	<div class="tool"><a href="#publish" title="Publish" id="publish"><img class="ic-24dp" src="/img/ic_send_dark@2x.png" /></a></div>
	</div>
	</header>

	<script src="/js/h.js"></script>
	<script type="text/javascript" src="/js/menu.js"></script>
	<script>
	function toggleTheme() {
	if (document.body.classList.contains('light')) {
	setTheme('dark');
	} else {
	setTheme('light');
	}
	H.set('padTheme', newTheme);
	}

	function setTheme(newTheme) {
	document.body.classList.remove('light');
	document.body.classList.remove('dark');
	document.body.classList.add(newTheme);
	var btns = Array.prototype.slice.call(document.getElementById('tools').querySelectorAll('a img'));
	if (newTheme == 'light') {
	// check if current theme is dark otherwise we'll get `_dark_dark@2x.png`
	if (H.get('padTheme', 'auto') == 'dark'){
	for (var i=0; i<btns.length; i++) {
	btns[i].src = btns[i].src.replace('@2x.png', '_dark@2x.png');
	}
	}
	} else {
	for (var i=0; i<btns.length; i++) {
	btns[i].src = btns[i].src.replace('_dark@2x.png', '@2x.png');
	}
	}
	H.set('padTheme', newTheme);
	}

	if (H.get('padTheme', 'auto') == 'light') {
	setTheme('light');
	} else if (H.get('padTheme', 'auto') == 'dark') {
	setTheme('dark');
	} else {
	const isDarkMode = window.matchMedia("(prefers-color-scheme: dark)").matches
	if (isDarkMode) {
	setTheme('dark');
	} else {
	setTheme('light');
	}
	}

	var $writer = H.getEl('writer');
	var $btnPublish = H.getEl('publish');
	var $btnEraseEdit = H.getEl('edited-elsewhere');
	var $wc = H.getEl("wc");
	var updateWordCount = function() {
	var words = 0;
	var val = $writer.el.value.trim();
	if (val != '') {
	words = $writer.el.value.trim().replace(/\s+/gi, ' ').split(' ').length;
	}
	$wc.el.innerText = words + " word" + (words != 1 ? "s" : "");
	};
	var setButtonStates = function() {
	if (!canPublish) {
	$btnPublish.el.className = 'disabled';
	return;
	}
	if ($writer.el.value.length === 0 \|\| (draftDoc != 'lastDoc' && $writer.el.value == origDoc)) {
	$btnPublish.el.className = 'disabled';
	} else {
	$btnPublish.el.className = '';
	}
	};
	{{if .Post.Id}}var draftDoc = 'draft{{.Post.Id}}';
	var origDoc = '{{.Post.Content}}';{{else}}var draftDoc = 'lastDoc';{{end}}
	var updatedStr = '{{.Post.Updated8601}}';
	var updated = null;
	if (updatedStr != '') {
	updated = new Date(updatedStr);
	}
	var ok = H.load($writer, draftDoc, true, updated);
	if (!ok) {
	// Show "edited elsewhere" warning
	$btnEraseEdit.el.classList.remove('hidden');
	}
	var defaultTimeSet = false;
	updateWordCount();

	var typingTimer;
	var doneTypingInterval = 200;

	var posts;
	{{if and .Post.Id (not .Post.Slug)}}
	var token = null;
	var curPostIdx;
	posts = JSON.parse(H.get('posts', '[]'));
	for (var i=0; i<posts.length; i++) {
	if (posts[i].id == "{{.Post.Id}}") {
	token = posts[i].token;
	break;
	}
	}
	var canPublish = token != null;
	{{else}}var canPublish = true;{{end}}
	var publishing = false;
	var justPublished = false;
	var silenced = {{.Silenced}};
	var publish = function(content, font) {
	if (silenced === true) {
	alert("Your account is silenced, so you can't publish or update posts.");
	return;
	}
	{{if and (and .Post.Id (not .Post.Slug)) (not .User)}}
	if (!token) {
	alert("You don't have permission to update this post.");
	return;
	}
	if ($btnPublish.el.className == 'disabled') {
	return;
	}
	{{end}}
	$btnPublish.el.children[0].textContent = 'more_horiz';
	publishing = true;
	var xpostTarg = H.get('crosspostTarget', '[]');

	var http = new XMLHttpRequest();
	var post = H.getTitleStrict(content);

	var params = {
	body: post.content,
	title: post.title,
	font: font
	};

	{{ if .Post.Slug }}
	var url = "/api/collections/{{.EditCollection.Alias}}/posts/{{.Post.Id}}";
	{{ else if .Post.Id }}
	var url = "/api/posts/{{.Post.Id}}";
	if (typeof token === 'undefined' \|\| !token) {
	token = "";
	}
	params.token = token;
	{{ else }}
	var lang = navigator.languages ? navigator.languages[0] : (navigator.language \|\| navigator.userLanguage);
	lang = lang.substring(0, 2);
	params.lang = lang;

	var url = "/api/posts";
	var postTarget = H.get('postTarget', 'anonymous');
	if (postTarget != 'anonymous') {
	url = "/api/collections/" + postTarget + "/posts";
	}
	params.crosspost = JSON.parse(xpostTarg);
	{{ end }}

	http.open("POST", url, true);

	// Send the proper header information along with the request
	http.setRequestHeader("Content-type", "application/json");

	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	publishing = false;
	if (http.status == 200 \|\| http.status == 201) {
	data = JSON.parse(http.responseText);
	id = data.data.id;
	nextURL = '{{if .SingleUser}}/d{{end}}/'+id;
	localStorage.setItem('draft'+id+'-published', new Date().toISOString());

	{{ if not .Post.Id }}
	// Post created
	if (postTarget != 'anonymous') {
	nextURL = {{if not .SingleUser}}'/'+postTarget+{{end}}'/'+data.data.slug;
	}
	editToken = data.data.token;

	{{ if not .User }}if (postTarget == 'anonymous') {
	// Save the data
	var posts = JSON.parse(H.get('posts', '[]'));

	{{if .Post.Id}}var newPost = H.createPost("{{.Post.Id}}", token, content);
	for (var i=0; i<posts.length; i++) {
	if (posts[i].id == "{{.Post.Id}}") {
	posts[i].title = newPost.title;
	posts[i].summary = newPost.summary;
	break;
	}
	}
	nextURL = "/pad/posts";{{else}}posts.push(H.createPost(id, editToken, content));{{end}}

	H.set('posts', JSON.stringify(posts));
	}
	{{ end }}
	{{ end }}

	justPublished = true;
	if (draftDoc != 'lastDoc') {
	H.remove(draftDoc);
	{{if .Editing}}H.remove('draft{{.Post.Id}}font');{{end}}
	} else {
	H.set(draftDoc, '');
	}

	{{if .EditCollection}}
	window.location = '{{.EditCollection.CanonicalURL}}{{.Post.Slug}}';
	{{else}}
	window.location = nextURL;
	{{end}}
	} else {
	$btnPublish.el.children[0].textContent = 'send';
	alert("Failed to post. Please try again.");
	}
	}
	}
	http.send(JSON.stringify(params));
	};

	setButtonStates();
	$writer.on('keyup input', function() {
	setButtonStates();
	clearTimeout(typingTimer);
	typingTimer = setTimeout(doneTyping, doneTypingInterval);
	}, false);
	$writer.on('keydown', function(e) {
	clearTimeout(typingTimer);
	if (e.keyCode == 13 && (e.metaKey \|\| e.ctrlKey)) {
	$btnPublish.el.click();
	}
	});
	$btnPublish.on('click', function(e) {
	e.preventDefault();
	if (!publishing && $writer.el.value) {
	var content = $writer.el.value;
	publish(content, selectedFont);
	}
	});
	H.getEl('erase-edit').on('click', function(e) {
	e.preventDefault();
	H.remove(draftDoc);
	H.remove(draftDoc+'-published');
	justPublished = true; // Block auto-save
	location.reload();
	});

	H.getEl('toggle-theme').on('click', function(e) {
	e.preventDefault();
	var newTheme = 'light';
	if (document.body.className == 'light') {
	newTheme = 'dark';
	}
	toggleTheme();
	});

	var targets = document.querySelectorAll('#target li.target a');
	for (var i=0; i<targets.length; i++) {
	targets[i].addEventListener('click', function(e) {
	e.preventDefault();
	var targetName = this.href.substring(this.href.indexOf('#')+1);
	H.set('postTarget', targetName);

	document.querySelector('#target li.target.selected').classList.remove('selected');
	this.parentElement.classList.add('selected');
	var newText = this.innerText.split(' ');
	newText.shift();
	document.getElementById('target-name').innerText = newText.join(' ');
	});
	}
	var postTarget = H.get('postTarget', '{{if .Blogs}}{{$blog := index .Blogs 0}}{{$blog.Alias}}{{else}}anonymous{{end}}');
	if (location.hash != '') {
	postTarget = location.hash.substring(1);
	// TODO: pushState to /pad (or whatever the URL is) so we live on a clean URL
	location.hash = '';
	}
	var pte = document.querySelector('#target li.target#blog-'+postTarget+' a');
	if (pte != null) {
	pte.click();
	} else {
	postTarget = 'anonymous';
	H.set('postTarget', postTarget);
	}

	var sansLoaded = false;
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	var loadSans = function() {
	if (sansLoaded) return;
	sansLoaded = true;
	WebFontConfig.custom.families.push('Open+Sans:400,700:latin');
	try {
	(function() {
	var wf=document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type='text/javascript';
	wf.async='true';
	var s=document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {}
	};
	var fonts = document.querySelectorAll('nav#font-picker a.font');
	for (var i=0; i<fonts.length; i++) {
	fonts[i].addEventListener('click', function(e) {
	e.preventDefault();
	selectedFont = this.href.substring(this.href.indexOf('#')+1);
	$writer.el.className = selectedFont;
	document.querySelector('nav#font-picker li.selected').classList.remove('selected');
	this.parentElement.classList.add('selected');
	H.set('{{if .Editing}}draft{{.Post.Id}}font{{else}}padFont{{end}}', selectedFont);
	if (selectedFont == 'sans') {
	loadSans();
	}
	});
	}
	var selectedFont = H.get('{{if .Editing}}draft{{.Post.Id}}font{{else}}padFont{{end}}', '{{.Post.Font}}');
	var sfe = document.querySelector('nav#font-picker a.font.'+selectedFont);
	if (sfe != null) {
	sfe.click();
	}

	var doneTyping = function() {
	if (draftDoc == 'lastDoc' \|\| $writer.el.value != origDoc) {
	H.save($writer, draftDoc);
	if (!defaultTimeSet) {
	var lastLocalPublishStr = localStorage.getItem(draftDoc+'-published');
	if (lastLocalPublishStr == null \|\| lastLocalPublishStr == '') {
	localStorage.setItem(draftDoc+'-published', updatedStr);
	}
	defaultTimeSet = true;
	}
	updateWordCount();
	}
	};
	window.addEventListener('beforeunload', function(e) {
	if (draftDoc != 'lastDoc' && $writer.el.value == origDoc) {
	H.remove(draftDoc);
	H.remove(draftDoc+'-published');
	} else if (!justPublished) {
	doneTyping();
	}
	});

	try {
	(function() {
	var wf=document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type='text/javascript';
	wf.async='true';
	var s=document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {
	// whatevs
	}
	</script>
	<link href="/css/icons.css" rel="stylesheet">
	</body>
	</html>{{end}}
	diff --git a/templates/password-collection.tmpl b/templates/password-collection.tmpl
	index c1c9083..fde4edc 100644
	--- a/templates/password-collection.tmpl
	+++ b/templates/password-collection.tmpl
	@@ -1,87 +1,88 @@
	{{define "password-collection"}}<!DOCTYPE HTML>
	<html {{if .Language}}lang="{{.Language}}"{{end}} dir="{{.Direction}}">
	<head>
	<meta charset="utf-8">

	<title>{{.DisplayTitle}}{{if not .SingleUser}} — {{.SiteName}}{{end}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	<link rel="canonical" href="{{.CanonicalURL}}">
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="description" content="{{.Description}}">
	<meta itemprop="name" content="{{.DisplayTitle}}">
	<meta itemprop="description" content="{{.Description}}">
	<meta name="twitter:card" content="summary">
	<meta name="twitter:title" content="{{.DisplayTitle}}">
	<meta name="twitter:description" content="{{.Description}}">
	<meta property="og:title" content="{{.DisplayTitle}}" />
	<meta property="og:site_name" content="{{.DisplayTitle}}" />
	<meta property="og:type" content="article" />
	<meta property="og:url" content="{{.CanonicalURL}}" />
	<meta property="og:description" content="{{.Description}}" />
	{{if .StyleSheet}}<style type="text/css">{{.StyleSheetDisplay}}</style>{{end}}

	</head>
	<body id="collection" itemscope itemtype="http://schema.org/WebPage">
	{{if .SingleUser}}
	<nav id="manage">
	<ul>
	<li class="has-submenu"><a onclick="void(0)">☰ Menu</a>
	<ul>
	<li><a href="/login">Log in</a></li>
	</ul>
	</li>
	</ul>
	</nav>
	{{end}}

	<header>
	<h1 dir="{{.Direction}}" id="blog-title"><a href="/{{.Alias}}/" class="h-card p-author u-url" rel="me author">{{.DisplayTitle}}</a></h1>
	</header>

	<div id="wrapper">

	<div class="access">
	<form method="post" action="/api/auth/read">
	{{if .Flashes}}<ul class="errors">
	{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
	</ul>{{else}}
	<h2>This blog requires a password.</h2>
	{{end}}
	<input type="hidden" name="alias" value="{{.Alias}}" />
	<input type="hidden" name="to" value="{{.Next}}" />
	<input type="password" autocomplete="new-password" name="password" tabindex="1" autofocus />
	<p><input type="submit" value="Enter" /></p>
	</form>
	</div>
	</div>

	<footer>
	<hr />
	<nav dir="ltr">
	<a class="home pubd" href="/">{{.SiteName}}</a> · powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a>
	</nav>
	</footer>
	</body>

	{{if and .Script .CanShowScript}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
	<script src="/js/h.js"></script>
	<script src="/js/postactions.js"></script>
	<script type="text/javascript">
	try {
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) {}
	</script>
	</html>{{end}}
	diff --git a/templates/post.tmpl b/templates/post.tmpl
	index 15b479d..9398425 100644
	--- a/templates/post.tmpl
	+++ b/templates/post.tmpl
	@@ -1,101 +1,102 @@
	{{define "post"}}<!DOCTYPE HTML>
	<html {{if .Language}}lang="{{.Language}}"{{end}} dir="{{.Direction}}">
	<head prefix="og: http://ogp.me/ns#">
	<meta charset="utf-8">

	<title>{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}} {{localhtml "title dash" .Language}} {{.SiteName}}</title>

	{{if .IsCode}}
	<link rel="stylesheet" href="/css/lib/mono-blue.min.css">
	{{end}}
	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	<link rel="canonical" href="{{.Host}}/{{if .SingleUser}}d/{{end}}{{.ID}}" />
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />

	<meta name="generator" content="{{.SiteName}}">
	<meta name="title" content="{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}}">
	<meta name="description" content="{{.Description}}">
	<meta itemprop="name" content="{{.SiteName}}">
	<meta itemprop="description" content="{{.Description}}">
	<meta name="twitter:card" content="summary">
	<meta name="twitter:title" content="{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}}">
	<meta name="twitter:description" content="{{.Description}}">
	{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
	<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
	{{if gt (len .Images) 0}}<meta name="twitter:image" content="{{index .Images 0}}">{{else}}<meta name="twitter:image" content="{{.Host}}/img/wf-sq.png">{{end}}
	<meta property="og:title" content="{{if .Title}}{{.Title}}{{else}}{{.GenTitle}}{{end}}" />
	<meta property="og:site_name" content="{{.SiteName}}" />
	<meta property="og:type" content="article" />
	<meta property="og:url" content="{{.Host}}/{{if .SingleUser}}d/{{end}}{{.ID}}" />
	<meta property="og:description" content="{{.Description}}" />
	{{range .Images}}<meta property="og:image" content="{{.}}" />{{else}}<meta property="og:image" content="{{.Host}}/img/wf-sq.png">{{end}}
	{{if .Author}}<meta property="article:author" content="https://{{.Author}}" />{{end}}
	<!-- Add highlighting logic -->
	{{template "highlighting" .}}
	</head>
	<body id="post">
	<header>
	<h1 dir="{{.Direction}}"><a href="/">{{.SiteName}}</a></h1>
	<nav>
	<span class="views{{if not .IsOwner}} owner-visible{{end}}" dir="ltr"><strong>{{largeNumFmt .Views}}</strong> {{pluralize "view" "views" .Views}}</span>
	{{if .IsCode}}<a href="/{{.ID}}.txt" rel="noindex" dir="{{.Direction}}">View raw</a>{{end}}
	{{ if .Username }}
	{{if .IsOwner}}
	<a href="/{{if .SingleUser}}d/{{end}}{{.ID}}/edit" dir="{{.Direction}}">Edit</a>
	{{end}}
	<a class="xtra-feature dash-nav" href="/me/posts/" dir="{{.Direction}}">Drafts</a>
	{{ end }}
	</nav>
	</header>

	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}

	<article class="{{.Font}} h-entry">{{if .Title}}<h2 id="title" class="p-name">{{.Title}}</h2>{{end}}{{ if .IsPlainText }}<p id="post-body" class="e-content">{{.Content}}</p>{{ else }}<div id="post-body" class="e-content">{{.HTMLContent}}</div>{{ end }}</article>

	<footer dir="ltr"><hr><nav><p style="font-size: 0.9em">{{localhtml "published with write.as" .Language}}</p></nav></footer>
	</body>

	{{if .IsCode}}
	<script src="/js/highlight.min.js"></script>
	<script>
	hljs.highlightBlock(document.getElementById('post-body'));
	</script>
	{{else}}
	<script src="/js/h.js"></script>
	{{if .IsPlainText}}<script src="/js/twitter-text.min.js"></script>{{end}}
	{{end}}
	<script type="text/javascript">
	try {
	WebFontConfig = {
	custom: { families: [ 'Lora:400,700:latin'{{if eq .Font "sans"}}, 'Open+Sans:400,700:latin'{{end}} ], urls: [ '/css/fonts.css' ] }
	};
	(function() {
	var wf = document.createElement('script');
	wf.src = '/js/webfont.js';
	wf.type = 'text/javascript';
	wf.async = 'true';
	var s = document.getElementsByTagName('script')[0];
	s.parentNode.insertBefore(wf, s);
	})();
	} catch (e) { /* ¯\_(ツ)_/¯ */ }

	var posts = localStorage.getItem('posts');
	if (posts != null) {
	posts = JSON.parse(posts);
	var $nav = document.getElementsByTagName('nav')[0];
	for (var i=0; i<posts.length; i++) {
	if (posts[i].id == "{{.ID}}") {
	$nav.innerHTML = $nav.innerHTML + '<a class="xtra-feature" href="/edit/{{.ID}}" dir="{{.Direction}}">Edit</a>';
	var $ownerVis = document.querySelectorAll('.owner-visible');
	for (var i=0; i<$ownerVis.length; i++) {
	$ownerVis[i].classList.remove('owner-visible');
	}
	break;
	}
	}
	}
	</script>
	</html>{{end}}
	diff --git a/templates/user/collection.tmpl b/templates/user/collection.tmpl
	index d8cbb36..eec1b10 100644
	--- a/templates/user/collection.tmpl
	+++ b/templates/user/collection.tmpl
	@@ -1,315 +1,311 @@
	-{{define "upgrade"}}
	-<p><a href="/me/plan?to=/me/c/{{.Alias}}">Upgrade</a> for <span>$40 / year</span> to edit.</p>
	-{{end}}
	-
	{{define "collection"}}
	{{template "header" .}}

	<style>
	textarea.section.norm {
	font-family: Lora,'Palatino Linotype','Book Antiqua','New York','DejaVu serif',serif !important;
	min-height: 10em;
	max-height: 20em;
	resize: vertical;
	}
	@media (pointer: coarse) {
	.codable {
	font-size: 0.75em !important;
	height: 17em !important;
	}
	}
	</style>

	<div class="content-container snug">
	<div id="overlay"></div>

	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}

	{{template "collection-breadcrumbs" .}}

	<h1>Customize</h1>

	{{template "collection-nav" (dict "Alias" .Alias "Path" .Path "SingleUser" .SingleUser)}}

	{{if .Flashes}}<ul class="errors">
	{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
	</ul>{{end}}

	<form name="customize-form" action="/api/collections/{{.Alias}}" method="post" onsubmit="return disableSubmit()">
	<div id="collection-options">
	<div style="text-align:center">
	<h1><input type="text" name="title" id="title" value="{{.DisplayTitle}}" placeholder="Title" /></h1>
	- <p><input type="text" name="description" id="description" value="{{.Description}}" placeholder="Description" /></p>
	+ <p><input type="text" name="description" id="description" value="{{.Description}}" placeholder="Description" maxlength="160" /></p>
	</div>

	<div class="option">
	<h2><a name="preferred-url"></a>URL</h2>
	<div class="section">
	{{if eq .Alias .Username}}<p style="font-size: 0.8em">This blog uses your username in its URL{{if .Federation}} and fediverse handle{{end}}. You can change it in your <a href="/me/settings">Account Settings</a>.</p>{{end}}
	<ul style="list-style:none">
	<li>
	{{.FriendlyHost}}/<strong>{{.Alias}}</strong>/
	</li>
	<li>
	<strong id="normal-handle-env" class="fedi-handle" {{if not .Federation}}style="display:none"{{end}}>@<span id="fedi-handle">{{.Alias}}</span>@<span id="fedi-domain">{{.FriendlyHost}}</span></strong>
	</li>
	</ul>
	</div>
	</div>

	<div class="option">
	<h2>Publicity</h2>
	<div class="section">
	<ul style="list-style:none">
	<li>
	<label><input type="radio" name="visibility" id="visibility-unlisted" value="0" {{if .IsUnlisted}}checked="checked"{{end}} />
	Unlisted
	</label>
	<p>This blog is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.</p>
	</li>
	<li>
	<label class="option-text"><input type="radio" name="visibility" id="visibility-private" value="2" {{if .IsPrivate}}checked="checked"{{end}} />
	Private
	</label>
	<p>Only you may read this blog (while you're logged in).</p>
	</li>
	<li>
	<label class="option-text"><input type="radio" name="visibility" id="visibility-protected" value="4" {{if .IsProtected}}checked="checked"{{end}} />
	Password-protected: <input type="password" class="low-profile" name="password" id="collection-pass" autocomplete="new-password" placeholder="{{if .IsProtected}}xxxxxxxxxxxxxxxx{{else}}a memorable password{{end}}" />
	</label>
	<p>A password is required to read this blog.</p>
	</li>
	{{if not .SingleUser}}
	<li>
	<label class="option-text{{if not .LocalTimeline}} disabled{{end}}"><input type="radio" name="visibility" id="visibility-public" value="1" {{if .IsPublic}}checked="checked"{{end}} {{if not .LocalTimeline}}disabled="disabled"{{end}} />
	Public
	</label>
	{{if .LocalTimeline}}<p>This blog is displayed on the public <a href="/read">reader</a>, and is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.</p>
	{{else}}<p>The public reader is currently turned off for this community.</p>{{end}}
	</li>
	{{end}}
	</ul>
	</div>
	</div>

	<div class="option">
	<h2 id="updates">Updates</h2>
	<div class="section">
	<p class="explain">Keep readers updated with your latest posts wherever they are.</p>
	<ul style="list-style:none">
	<li>
	<label class="option-text"><input type="checkbox" checked="checked" disabled />
	RSS feed
	</label>
	<p class="describe">Readers can subscribe to your blog's <a href="{{.CanonicalURL}}feed/" target="feed">RSS feed</a> with their favorite RSS reader.</p>
	</li>
	{{if .LettersCfg.Enabled}}
	<li>
	<label class="option-text" id="email-sub-label"><input type="checkbox" name="email_subs" id="email_subs" {{if .EmailSubsEnabled}}checked="checked"{{end}} />
	Email subscriptions
	</label>
	<p class="describe">
	Let readers subscribe to your blog via email, and optionally accept private replies.
	</p>
	<div id="custom-letter-reply" style="font-size: .8em; margin-top: -0.5em; margin-left: 1.8em; margin-bottom: 1em;" {{if not .EmailSubsEnabled}}style="display:none"{{end}}>
	Allow replies to this address:
	<input type="email" name="letter_reply" id="letter_reply" placeholder="me@example.com" value="{{.LetterReplyTo}}" {{if not .EmailSubsEnabled}}disabled{{end}} />
	</div>
	</li>
	{{end}}
	{{if .Federation}}
	<li>
	<label class="option-text" id="federate-label"><input type="checkbox" name="federate" id="federate" {{if .Federation}}checked="checked"{{end}} disabled />
	Federation
	</label>
	<strong id="normal-handle-env" class="fedi-handle">@<span id="fedi-handle">{{.Alias}}</span>@<span id="fedi-domain">{{.FriendlyHost}}</span></strong>
	<p class="describe">Allow others to follow your blog and interact with your posts in the fediverse. <a href="https://video.writeas.org/videos/watch/cc55e615-d204-417c-9575-7b57674cc6f3" target="video">See how it works</a>.</p>
	</li>
	{{end}}
	</ul>
	</div>
	</div>

	<div class="option">
	<h2>Display Format</h2>
	<div class="section">
	<p class="explain">Customize how your posts display on your page.
	</p>
	<ul style="list-style:none">
	<li>
	<label><input type="radio" name="format" id="format-blog" value="blog" {{if or (not .Format) (eq .Format "blog")}}checked="checked"{{end}} />
	Blog
	</label>
	<p>Dates are shown. Latest posts listed first.</p>
	</li>
	<li>
	<label class="option-text"><input type="radio" name="format" id="format-novel" value="novel" {{if eq .Format "novel"}}checked="checked"{{end}} />
	Novel
	</label>
	<p>No dates shown. Oldest posts first.</p>
	</li>
	<li>
	<label class="option-text"><input type="radio" name="format" id="format-notebook" value="notebook" {{if eq .Format "notebook"}}checked="checked"{{end}} />
	Notebook
	</label>
	<p>No dates shown. Latest posts first.</p>
	</li>
	</ul>
	</div>
	</div>

	<div class="option">
	<h2>Text Rendering</h2>
	<div class="section">
	<p class="explain">Customize how plain text renders on your blog.</p>
	<ul style="list-style:none">
	<li>
	<label class="option-text disabled"><input type="checkbox" name="markdown" checked="checked" disabled />
	Markdown
	</label>
	</li>
	<li>
	<label><input type="checkbox" name="mathjax" {{if .RenderMathJax}}checked="checked"{{end}} />
	MathJax
	</label>
	</li>
	</ul>
	</div>
	</div>

	<div class="option">
	<h2>Custom CSS</h2>
	<div class="section">
	<textarea id="css-editor" class="section codable" name="style_sheet">{{.StyleSheet}}</textarea>
	<p class="explain">See our guide on <a href="https://guides.write.as/customizing/#custom-css">customization</a>.</p>
	</div>
	</div>

	<div class="option">
	<h2>Post Signature</h2>
	<div class="section">
	<p class="explain">This content will be added to the end of every post on this blog, as if it were part of the post itself. Markdown, HTML, and shortcodes are allowed.</p>
	<textarea id="signature" class="section norm" name="signature">{{.Signature}}</textarea>
	</div>
	</div>

	{{if .UserPage.StaticPage.AppCfg.Monetization}}
	<div class="option">
	<h2>Web Monetization</h2>
	<div class="section">
	<p class="explain">Web Monetization enables you to receive micropayments from readers that have a <a href="https://coil.com">Coil membership</a>. Add your payment pointer to enable Web Monetization on your blog.</p>
	<input type="text" name="monetization_pointer" style="width:100%" value="{{.Collection.Monetization}}" placeholder="$wallet.example.com/alice" />
	</div>
	</div>
	{{end}}

	<div class="option" style="text-align: center; margin-top: 4em;">
	<input type="submit" id="save-changes" value="Save changes" />
	<p><a href="{{if .SingleUser}}/{{else}}/{{.Alias}}/{{end}}">View Blog</a></p>
	{{if ne .Alias .Username}}<p><a class="danger" href="#modal-delete" onclick="promptDelete();">Delete Blog...</a></p>{{end}}
	</div>
	</div>
	</form>
	</div>

	<div id="modal-delete" class="modal">
	<h2>Are you sure you want to delete this blog?</h2>
	<div class="body short">
	<p style="text-align:left">This will permanently erase <strong>{{.DisplayTitle}}</strong> ({{.FriendlyHost}}/{{.Alias}}) from the internet. Any posts on this blog will be saved and made into drafts (found on your <a href="/me/posts/">Drafts</a> page).</p>
	<p>If you're sure you want to delete this blog, enter its name in the box below and press <strong>Delete</strong>.</p>

	<ul id="delete-errors" class="errors"></ul>

	<input id="confirm-text" placeholder="{{.Alias}}" type="text" class="boxy" style="margin-top: 0.5em;" />
	<div style="text-align:right; margin-top: 1em;">
	<a id="cancel-delete" style="margin-right:2em" href="#">Cancel</a>
	<button id="btn-delete" class="danger" onclick="deleteBlog(); return false;">Delete</button>
	</div>
	</div>
	</div>

	<script src="/js/h.js"></script>
	<script src="/js/modals.js"></script>
	<script src="/js/ace.js" type="text/javascript" charset="utf-8"></script>
	<script>
	H.getEl('cancel-delete').on('click', closeModals);
	var deleteBlog = function(e) {
	if (document.getElementById('confirm-text').value != '{{.Alias}}') {
	document.getElementById('delete-errors').innerHTML = '<li class="urgent">Enter <strong>{{.Alias}}</strong> in the box below.</li>';
	return;
	}
	// Clear errors
	document.getElementById('delete-errors').innerHTML = '';
	document.getElementById('btn-delete').innerHTML = 'Deleting...';

	var http = new XMLHttpRequest();
	var url = "/api/collections/{{.Alias}}?web=1";
	http.open("DELETE", url, true);
	http.setRequestHeader("Content-type", "application/json");
	http.onreadystatechange = function() {
	if (http.readyState == 4) {
	if (http.status == 204) {
	window.location = '/me/c/';
	} else {
	var data = JSON.parse(http.responseText);
	document.getElementById('delete-errors').innerHTML = '<li class="urgent">'+data.error_msg+'</li>';
	document.getElementById('btn-delete').innerHTML = 'Delete';
	}
	}
	};
	http.send(null);
	};

	function createHidden(theForm, key, value) {
	var input = document.createElement('input');
	input.type = 'hidden';
	input.name = key;
	input.value = value;
	theForm.appendChild(input);
	}
	function disableSubmit() {
	var $form = document.forms['customize-form'];
	createHidden($form, 'style_sheet', cssEditor.getSession().getValue());
	var $btn = document.getElementById("save-changes");
	$btn.value = "Saving changes...";
	$btn.disabled = true;
	return true;
	}
	function promptDelete() {
	showModal("delete");
	}

	var $fediDomain = document.getElementById('fedi-domain');
	var $fediCustomDomain = document.getElementById('fedi-custom-domain');
	var $customDomain = document.getElementById('domain-alias');
	var $customHandleEnv = document.getElementById('custom-handle-env');
	var $normalHandleEnv = document.getElementById('normal-handle-env');

	var $emailSubsCheck = document.getElementById('email_subs');
	var $letterReply = document.getElementById('letter_reply');
	H.getEl('email_subs').on('click', function() {
	let show = $emailSubsCheck.checked
	$letterReply.disabled = !show
	})

	if (matchMedia('(pointer:fine)').matches) {
	// Only initialize Ace editor on devices with a mouse
	var opt = {
	showLineNumbers: false,
	showPrintMargin: 0,
	minLines: 10,
	maxLines: 40,
	};
	var theme = "ace/theme/chrome";
	var cssEditor = ace.edit("css-editor");
	cssEditor.setTheme(theme);
	cssEditor.session.setMode("ace/mode/css");
	cssEditor.setOptions(opt);
	cssEditor.resize(true);
	}
	</script>

	{{template "footer" .}}
	{{end}}
	diff --git a/templates/user/include/header.tmpl b/templates/user/include/header.tmpl
	index 9c4effa..66a2a84 100644
	--- a/templates/user/include/header.tmpl
	+++ b/templates/user/include/header.tmpl
	@@ -1,115 +1,116 @@
	{{define "user-navigation"}}
	<header class="{{if .SingleUser}}singleuser{{else}}multiuser{{end}}">
	<nav id="full-nav">
	{{if .SingleUser}}
	<nav id="user-nav">
	<nav class="dropdown-nav">
	<ul><li><a href="/" title="View blog" class="title">{{.SiteName}}</a> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" />
	<ul>
	{{if .IsAdmin}}<li><a href="/admin">Admin dashboard</a></li>{{end}}
	<li><a href="/me/settings">Account settings</a></li>
	<li><a href="/me/import">Import posts</a></li>
	<li><a href="/me/export">Export</a></li>
	<li class="separator"><hr /></li>
	<li><a href="/me/logout">Log out</a></li>
	</ul></li>
	</ul>
	</nav>
	<nav class="tabs">
	<a href="/me/c/{{.Username}}" {{if and (hasPrefix .Path "/me/c/") (hasSuffix .Path .Username)}}class="selected"{{end}}>Customize</a>
	<a href="/me/c/{{.Username}}/stats" {{if hasSuffix .Path "/stats"}}class="selected"{{end}}>Stats</a>
	<a href="/me/posts/"{{if eq .Path "/me/posts/"}} class="selected"{{end}}>Drafts</a>
	</nav>
	</nav>
	<div class="right-side">
	<a class="simple-btn" href="/me/new">New Post</a>
	</div>
	{{else}}
	<div class="left-side">
	<h1><a href="/" title="Return to editor">{{.SiteName}}</a></h1>
	</div>
	<nav id="user-nav">
	{{if .Username}}
	<nav class="dropdown-nav">
	<ul><li class="has-submenu"><a>{{.Username}}</a> <img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" /><ul>
	{{if .IsAdmin}}<li><a href="/admin">Admin dashboard</a></li>{{end}}
	<li><a href="/me/settings">Account settings</a></li>
	<li><a href="/me/import">Import posts</a></li>
	<li><a href="/me/export">Export</a></li>
	{{if .CanInvite}}<li><a href="/me/invites">Invite people</a></li>{{end}}
	<li class="separator"><hr /></li>
	<li><a href="/me/logout">Log out</a></li>
	</ul></li>
	</ul>
	</nav>
	{{end}}
	<nav class="tabs">
	{{if .SimpleNav}}
	{{ if not .SingleUser }}
	{{if and (and .LocalTimeline .CanViewReader) .Chorus}}<a href="/"{{if eq .Path "/"}} class="selected"{{end}}>Home</a>{{end}}
	{{ end }}
	<a href="/about">About</a>
	{{ if not .SingleUser }}
	{{ if .Username }}
	{{if gt .MaxBlogs 1}}<a href="/me/c/"{{if eq .Path "/me/c/"}} class="selected"{{end}}>Blogs</a>{{end}}
	{{if and .Chorus (eq .MaxBlogs 1)}}<a href="/{{.Username}}/"{{if eq .Path (printf "/%s/" .Username)}} class="selected"{{end}}>My Posts</a>{{end}}
	{{if not .DisableDrafts}}<a href="/me/posts/"{{if eq .Path "/me/posts/"}} class="selected"{{end}}>Drafts</a>{{end}}
	{{ end }}
	{{if and (and .LocalTimeline .CanViewReader) (not .Chorus)}}<a href="/read">Reader</a>{{end}}
	{{if and (and (and .Chorus .OpenRegistration) (not .Username)) (or (not .Private) (ne .Landing ""))}}<a href="/signup"{{if eq .Path "/signup"}} class="selected"{{end}}>Sign up</a>{{end}}
	{{if .Username}}<a href="/me/logout">Log out</a>{{else}}<a href="/login">Log in</a>{{end}}
	{{ end }}
	{{else}}
	<a href="/me/c/"{{if eq .Path "/me/c/"}} class="selected"{{end}}>Blogs</a>
	{{if not .DisableDrafts}}<a href="/me/posts/"{{if eq .Path "/me/posts/"}} class="selected"{{end}}>Drafts</a>{{end}}
	{{if and (and .LocalTimeline .CanViewReader) (not .Chorus)}}<a href="/read">Reader</a>{{end}}
	{{end}}
	</nav>
	</nav>
	{{if .Username}}
	<div class="right-side">
	<a class="simple-btn" href="/{{if .CollAlias}}#{{.CollAlias}}{{end}}">New Post</a>
	</div>
	{{end}}
	{{end}}
	</nav>
	</header>
	{{end}}
	{{define "header"}}<!DOCTYPE HTML>
	<html>
	<head>
	<meta charset="utf-8">

	<title>{{.PageTitle}} {{if .Separator}}{{.Separator}}{{else}}—{{end}} {{.SiteName}}</title>

	<link rel="stylesheet" type="text/css" href="/css/write.css" />
	+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
	<link rel="shortcut icon" href="/favicon.ico" />
	<meta name="viewport" content="width=device-width, initial-scale=1.0" />
	<meta name="theme-color" content="#888888" />
	<meta name="apple-mobile-web-app-title" content="{{.SiteName}}">
	<link rel="apple-touch-icon" sizes="152x152" href="/img/touch-icon-152.png">
	<link rel="apple-touch-icon" sizes="167x167" href="/img/touch-icon-167.png">
	<link rel="apple-touch-icon" sizes="180x180" href="/img/touch-icon-180.png">
	</head>
	<body id="me">
	{{template "user-navigation" .}}
	<div id="official-writing">
	{{end}}

	{{define "admin-header"}}
	<header class="admin">
	<h1>Admin</h1>
	<nav id="admin" class="pager">
	<a href="/admin" {{if eq .Path "/admin"}}class="selected"{{end}}>Dashboard</a>
	<a href="/admin/settings" {{if eq .Path "/admin/settings"}}class="selected"{{end}}>Settings</a>
	{{if not .SingleUser}}
	<a href="/admin/users" {{if eq .Path "/admin/users"}}class="selected"{{end}}>Users</a>
	<a href="/admin/pages" {{if eq .Path "/admin/pages"}}class="selected"{{end}}>Pages</a>
	{{if .UpdateChecks}}<a href="/admin/updates" {{if eq .Path "/admin/updates"}}class="selected"{{end}}>Updates{{if .UpdateAvailable}}<span class="blip">!</span>{{end}}</a>{{end}}
	{{end}}
	{{if not .Forest}}
	<a href="/admin/monitor" {{if eq .Path "/admin/monitor"}}class="selected"{{end}}>Monitor</a>
	{{end}}
	</nav>
	</header>
	{{end}}
	diff --git a/templates/user/stats.tmpl b/templates/user/stats.tmpl
	index f3e3dce..0791f77 100644
	--- a/templates/user/stats.tmpl
	+++ b/templates/user/stats.tmpl
	@@ -1,63 +1,63 @@
	{{define "stats"}}
	{{template "header" .}}
	<style>
	table.classy th { text-align: left }
	table.classy th.num { text-align: right }
	td + td {
	padding-left: 0.5em;
	padding-right: 0.5em;
	}
	td.num {
	text-align: right;
	}
	table.classy.export a { text-transform: inherit; }
	td.none {
	font-style: italic;
	}
	</style>

	<div class="content-container snug">
	{{if .Silenced}}
	{{template "user-silenced"}}
	{{end}}

	{{template "collection-breadcrumbs" .}}

	<h1 id="posts-header">Stats</h1>

	{{if .Collection}}
	{{template "collection-nav" (dict "Alias" .Collection.Alias "Path" .Path "SingleUser" .SingleUser)}}
	{{end}}

	<p>Stats for all time.</p>

	{{if .Federation}}
	<h3>Fediverse stats</h3>
	<table id="fediverse" class="classy export">
	<tr>
	<th>Followers</th>
	</tr>
	<tr>
	<td>{{.APFollowers}}</td>
	</tr>
	</table>
	{{end}}

	<h3>Top {{len .TopPosts}} posts</h3>
	<table class="classy export">
	<tr>
	<th>Post</th>
	{{if not .Collection}}<th>Blog</th>{{end}}
	<th class="num">Total Views</th>
	</tr>
	{{range .TopPosts}}<tr>
	- <td style="word-break: break-all;"><a href="{{if .Collection}}{{.Collection.CanonicalURL}}{{.Slug.String}}{{else}}/{{.ID}}{{end}}">{{if ne .Title.String ""}}{{.Title.String}}{{else}}<em>{{.ID}}</em>{{end}}</a></td>
	+ <td style="word-break: break-all;"><a href="{{if .Collection}}{{.Collection.CanonicalURL}}{{.Slug.String}}{{else}}/{{.ID}}{{end}}">{{if ne .DisplayTitle ""}}{{.DisplayTitle}}{{else}}<em>{{.ID}}</em>{{end}}</a></td>
	{{ if not $.Collection }}<td>{{if .Collection}}<a href="{{.Collection.CanonicalURL}}">{{.Collection.Title}}</a>{{else}}<em>Draft</em>{{end}}</td>{{ end }}
	<td class="num">{{.ViewCount}}</td>
	</tr>{{end}}
	</table>

	</div>

	{{template "footer" .}}
	{{end}}
	diff --git a/unregisteredusers.go b/unregisteredusers.go
	index b6f6ce6..9473c89 100644
	--- a/unregisteredusers.go
	+++ b/unregisteredusers.go
	@@ -1,148 +1,148 @@
	/*
	- * Copyright © 2018-2019 A Bunch Tell LLC.
	+ * Copyright © 2018-2019 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"database/sql"
	"encoding/json"
	"net/http"

	"github.com/writeas/impart"
	"github.com/writeas/web-core/log"
	)

	func handleWebSignup(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)

	// Get params
	var ur userRegistration
	if reqJSON {
	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&ur)
	if err != nil {
	log.Error("Couldn't parse signup JSON request: %v\n", err)
	return ErrBadJSON
	}
	} else {
	err := r.ParseForm()
	if err != nil {
	log.Error("Couldn't parse signup form request: %v\n", err)
	return ErrBadFormData
	}

	err = app.formDecoder.Decode(&ur, r.PostForm)
	if err != nil {
	log.Error("Couldn't decode signup form request: %v\n", err)
	return ErrBadFormData
	}
	}
	ur.Web = true
	ur.Normalize = true

	to := "/"
	if app.cfg.App.SimpleNav {
	to = "/new"
	}
	if ur.InviteCode != "" {
	to = "/invite/" + ur.InviteCode
	}
	_, err := signupWithRegistration(app, ur, w, r)
	if err != nil {
	if err, ok := err.(impart.HTTPError); ok {
	session, _ := app.sessionStore.Get(r, cookieName)
	if session != nil {
	session.AddFlash(err.Message)
	session.Save(r, w)
	return impart.HTTPError{http.StatusFound, to}
	}
	}
	return err
	}
	return impart.HTTPError{http.StatusFound, to}
	}

	// { "username": "asdf" }
	// result: { code: 204 }
	func handleUsernameCheck(app App, w http.ResponseWriter, r http.Request) error {
	reqJSON := IsJSON(r)

	// Get params
	var d struct {
	Username string `json:"username"`
	}
	if reqJSON {
	decoder := json.NewDecoder(r.Body)
	err := decoder.Decode(&d)
	if err != nil {
	log.Error("Couldn't decode username check: %v\n", err)
	return ErrBadFormData
	}
	} else {
	return impart.HTTPError{http.StatusNotAcceptable, "Must be JSON request"}
	}

	// Check if username is okay
	finalUsername := getSlug(d.Username, "")
	if finalUsername == "" {
	errMsg := "Invalid username"
	if d.Username != "" {
	// Username was provided, but didn't convert into valid latin characters
	errMsg += " - must have at least 2 letters or numbers"
	}
	return impart.HTTPError{http.StatusBadRequest, errMsg + "."}
	}
	if app.db.PostIDExists(finalUsername) {
	return impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}
	var un string
	err := app.db.QueryRow("SELECT username FROM users WHERE username = ?", finalUsername).Scan(&un)
	switch {
	case err == sql.ErrNoRows:
	return impart.WriteSuccess(w, finalUsername, http.StatusOK)
	case err != nil:
	log.Error("Couldn't SELECT username: %v", err)
	return impart.HTTPError{http.StatusInternalServerError, "We messed up."}
	}

	// Username was found, so it's taken
	return impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}

	func getValidUsername(app App, reqName, prevName string) (string, impart.HTTPError) {
	// Check if username is okay
	finalUsername := getSlug(reqName, "")
	if finalUsername == "" {
	errMsg := "Invalid username"
	if reqName != "" {
	// Username was provided, but didn't convert into valid latin characters
	errMsg += " - must have at least 2 letters or numbers"
	}
	return "", &impart.HTTPError{http.StatusBadRequest, errMsg + "."}
	}
	if finalUsername == prevName {
	return "", &impart.HTTPError{http.StatusNotModified, "Username unchanged."}
	}
	if app.db.PostIDExists(finalUsername) {
	return "", &impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}
	var un string
	err := app.db.QueryRow("SELECT username FROM users WHERE username = ?", finalUsername).Scan(&un)
	switch {
	case err == sql.ErrNoRows:
	return finalUsername, nil
	case err != nil:
	log.Error("Couldn't SELECT username: %v", err)
	return "", &impart.HTTPError{http.StatusInternalServerError, "We messed up."}
	}

	// Username was found, so it's taken
	return "", &impart.HTTPError{http.StatusConflict, "Username is already taken."}
	}
	diff --git a/updates.go b/updates.go
	index 8ecccf6..574a91c 100644
	--- a/updates.go
	+++ b/updates.go
	@@ -1,131 +1,131 @@
	/*
	- * Copyright © 2019-2020 A Bunch Tell LLC.
	+ * Copyright © 2019-2020 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"github.com/writeas/web-core/log"
	"io/ioutil"
	"net/http"
	"strings"
	"sync"
	"time"
	)

	// updatesCacheTime is the default interval between cache updates for new
	// software versions
	const defaultUpdatesCacheTime = 12 * time.Hour

	// updatesCache holds data about current and new releases of the writefreely
	// software
	type updatesCache struct {
	mu sync.Mutex
	frequency time.Duration
	lastCheck time.Time
	latestVersion string
	currentVersion string
	checkError error
	}

	// CheckNow asks for the latest released version of writefreely and updates
	// the cache last checked time. If the version postdates the current 'latest'
	// the version value is replaced.
	func (uc *updatesCache) CheckNow() error {
	if debugging {
	log.Info("[update check] Checking for update now.")
	}
	uc.mu.Lock()
	defer uc.mu.Unlock()
	uc.lastCheck = time.Now()
	latestRemote, err := newVersionCheck()
	if err != nil {
	log.Error("[update check] Failed: %v", err)
	uc.checkError = err
	return err
	}
	if CompareSemver(latestRemote, uc.latestVersion) == 1 {
	uc.latestVersion = latestRemote
	}
	return nil
	}

	// AreAvailable updates the cache if the frequency duration has passed
	// then returns if the latest release is newer than the current running version.
	func (uc updatesCache) AreAvailable() bool {
	if time.Since(uc.lastCheck) > uc.frequency {
	uc.CheckNow()
	}
	return CompareSemver(uc.latestVersion, uc.currentVersion) == 1
	}

	// AreAvailableNoCheck returns if the latest release is newer than the current
	// running version.
	func (uc updatesCache) AreAvailableNoCheck() bool {
	return CompareSemver(uc.latestVersion, uc.currentVersion) == 1
	}

	// LatestVersion returns the latest stored version available.
	func (uc updatesCache) LatestVersion() string {
	return uc.latestVersion
	}

	func (uc updatesCache) ReleaseURL() string {
	return "https://writefreely.org/releases/" + uc.latestVersion
	}

	// ReleaseNotesURL returns the full URL to the blog.writefreely.org release notes
	// for the latest version as stored in the cache.
	func (uc updatesCache) ReleaseNotesURL() string {
	return wfReleaseNotesURL(uc.latestVersion)
	}

	func wfReleaseNotesURL(v string) string {
	ver := strings.TrimPrefix(v, "v")
	ver = strings.TrimSuffix(ver, ".0")
	// hack until go 1.12 in build/travis
	seg := strings.Split(ver, ".")
	return "https://blog.writefreely.org/version-" + strings.Join(seg, "-")
	}

	// newUpdatesCache returns an initialized updates cache
	func newUpdatesCache(expiry time.Duration) *updatesCache {
	cache := updatesCache{
	frequency: expiry,
	currentVersion: "v" + softwareVer,
	}
	go cache.CheckNow()
	return &cache
	}

	// InitUpdates initializes the updates cache, if the config value is set
	// It uses the defaultUpdatesCacheTime for the cache expiry
	func (app *App) InitUpdates() {
	if app.cfg.App.UpdateChecks {
	app.updates = newUpdatesCache(defaultUpdatesCacheTime)
	}
	}

	func newVersionCheck() (string, error) {
	res, err := http.Get("https://version.writefreely.org")
	if debugging {
	log.Info("[update check] GET https://version.writefreely.org")
	}
	// TODO: return error if statusCode != OK
	if err == nil && res.StatusCode == http.StatusOK {
	defer res.Body.Close()

	body, err := ioutil.ReadAll(res.Body)
	if err != nil {
	return "", err
	}
	return string(body), nil
	}
	return "", err
	}
	diff --git a/users.go b/users.go
	index 1e18e24..449427d 100644
	--- a/users.go
	+++ b/users.go
	@@ -1,140 +1,140 @@
	/*
	- * Copyright © 2018-2019, 2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2019, 2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"time"

	"github.com/guregu/null/zero"
	"github.com/writeas/web-core/data"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/key"
	)

	type UserStatus int

	const (
	UserActive = iota
	UserSilenced
	)

	type (
	userCredentials struct {
	Alias string `json:"alias" schema:"alias"`
	Pass string `json:"pass" schema:"pass"`
	Email string `json:"email" schema:"email"`
	Web bool `json:"web" schema:"-"`
	To string `json:"-" schema:"to"`

	EmailLogin bool `json:"via_email" schema:"via_email"`
	}

	userRegistration struct {
	userCredentials
	InviteCode string `json:"invite_code" schema:"invite_code"`
	Honeypot string `json:"fullname" schema:"fullname"`
	Normalize bool `json:"normalize" schema:"normalize"`
	Signup bool `json:"signup" schema:"signup"`

	// Feature fields
	Description string `json:"description" schema:"description"`
	Monetization string `json:"monetization" schema:"monetization"`
	}

	// AuthUser contains information for a newly authenticated user (either
	// from signing up or logging in).
	AuthUser struct {
	AccessToken string `json:"access_token,omitempty"`
	Password string `json:"password,omitempty"`
	User *User `json:"user"`

	// Verbose user data
	Posts *[]PublicPost `json:"posts,omitempty"`
	Collections *[]Collection `json:"collections,omitempty"`
	}

	// User is a consistent user object in the database and all contexts (auth
	// and non-auth) in the API.
	User struct {
	ID int64 `json:"-"`
	Username string `json:"username"`
	HashedPass []byte `json:"-"`
	HasPass bool `json:"has_pass"`
	Email zero.String `json:"email"`
	Created time.Time `json:"created"`
	Status UserStatus `json:"status"`

	clearEmail string `json:"email"`
	}

	userMeStats struct {
	TotalCollections, TotalArticles, CollectionPosts uint64
	}

	ExportUser struct {
	*User
	Collections *[]CollectionObj `json:"collections"`
	AnonymousPosts []PublicPost `json:"posts"`
	}

	PublicUser struct {
	Username string `json:"username"`
	}
	)

	// EmailClear decrypts and returns the user's email, caching it in the user
	// object.
	func (u User) EmailClear(keys key.Keychain) string {
	if u.clearEmail != "" {
	return u.clearEmail
	}

	if u.Email.Valid && u.Email.String != "" {
	email, err := data.Decrypt(keys.EmailKey, []byte(u.Email.String))
	if err != nil {
	log.Error("Error decrypting user email: %v", err)
	} else {
	u.clearEmail = string(email)
	return u.clearEmail
	}
	}
	return ""
	}

	func (u User) CreatedFriendly() string {
	/*
	// TODO: accept a locale in this method and use that for the format
	var loc monday.Locale = monday.LocaleEnUS
	return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc)
	*/
	return u.Created.Format("January 2, 2006, 3:04 PM")
	}

	// Cookie strips down an AuthUser to contain only information necessary for
	// cookies.
	func (u User) Cookie() *User {
	u.HashedPass = []byte{}

	return &u
	}

	func (u *User) IsAdmin() bool {
	// TODO: get this from database
	return u.ID == 1
	}

	func (u *User) IsSilenced() bool {
	return u.Status&UserSilenced != 0
	}

	func (u User) IsEmailSubscriber(app App, collID int64) bool {
	return app.db.IsEmailSubscriber("", u.ID, collID)
	}
	diff --git a/webfinger.go b/webfinger.go
	index 6c1341f..023c8a5 100644
	--- a/webfinger.go
	+++ b/webfinger.go
	@@ -1,145 +1,145 @@
	/*
	- * Copyright © 2018-2021 A Bunch Tell LLC.
	+ * Copyright © 2018-2021 Musing Studio LLC.
	*
	* This file is part of WriteFreely.
	*
	* WriteFreely is free software: you can redistribute it and/or modify
	* it under the terms of the GNU Affero General Public License, included
	* in the LICENSE file in this source code package.
	*/

	package writefreely

	import (
	"encoding/json"
	"io/ioutil"
	"net/http"
	"strings"

	"github.com/writeas/go-webfinger"
	"github.com/writeas/impart"
	"github.com/writeas/web-core/log"
	"github.com/writefreely/writefreely/config"
	)

	type wfResolver struct {
	db *datastore
	cfg *config.Config
	}

	var wfUserNotFoundErr = impart.HTTPError{http.StatusNotFound, "User not found."}

	func (wfr wfResolver) FindUser(username string, host, requestHost string, r []webfinger.Rel) (*webfinger.Resource, error) {
	var c *Collection
	var err error
	if username == host {
	c = instanceColl
	} else if wfr.cfg.App.SingleUser {
	c, err = wfr.db.GetCollectionByID(1)
	} else {
	c, err = wfr.db.GetCollection(username)
	}
	if err != nil {
	log.Error("Unable to get blog: %v", err)
	return nil, err
	}
	c.hostName = wfr.cfg.App.Host

	if !c.IsInstanceColl() {
	silenced, err := wfr.db.IsUserSilenced(c.OwnerID)
	if err != nil {
	log.Error("webfinger find user: check is silenced: %v", err)
	return nil, err
	}
	if silenced {
	return nil, wfUserNotFoundErr
	}
	}
	if wfr.cfg.App.SingleUser {
	// Ensure handle matches user-chosen one on single-user blogs
	if username != c.Alias {
	log.Info("Username '%s' is not handle '%s'", username, c.Alias)
	return nil, wfUserNotFoundErr
	}
	}
	// Only return information if site has federation enabled.
	// TODO: enable two levels of federation? Unlisted or Public on timelines?
	if !wfr.cfg.App.Federation {
	return nil, wfUserNotFoundErr
	}

	res := webfinger.Resource{
	Subject: "acct:" + username + "@" + host,
	Aliases: []string{
	c.CanonicalURL(),
	c.FederatedAccount(),
	},
	Links: []webfinger.Link{
	{
	HRef: c.CanonicalURL(),
	Type: "text/html",
	Rel: "https://webfinger.net/rel/profile-page",
	},
	{
	HRef: c.FederatedAccount(),
	Type: "application/activity+json",
	Rel: "self",
	},
	},
	}
	return &res, nil
	}

	func (wfr wfResolver) DummyUser(username string, hostname string, r []webfinger.Rel) (*webfinger.Resource, error) {
	return nil, wfUserNotFoundErr
	}

	func (wfr wfResolver) IsNotFoundError(err error) bool {
	return err == wfUserNotFoundErr
	}

	// RemoteLookup looks up a user by handle at a remote server
	// and returns the actor URL
	func RemoteLookup(handle string) string {
	handle = strings.TrimLeft(handle, "@")
	// let's take the server part of the handle
	parts := strings.Split(handle, "@")
	resp, err := http.Get("https://" + parts[1] + "/.well-known/webfinger?resource=acct:" + handle)
	if err != nil {
	log.Error("Error on webfinger request: %v", err)
	return ""
	}

	body, err := ioutil.ReadAll(resp.Body)
	if err != nil {
	log.Error("Error on webfinger response: %v", err)
	return ""
	}

	var result webfinger.Resource
	err = json.Unmarshal(body, &result)
	if err != nil {
	log.Error("Unable to parse webfinger response: %v", err)
	return ""
	}

	var href string
	// iterate over webfinger links and find the one with
	// a self "rel"
	for _, link := range result.Links {
	if link.Rel == "self" {
	href = link.HRef
	}
	}

	// if we didn't find it with the above then
	// try using aliases
	if href == "" {
	// take the last alias because mastodon has the
	// https://instance.tld/@user first which
	// doesn't work as an href
	href = result.Aliases[len(result.Aliases)-1]
	}

	return href
	}

File Metadata

Mime Type: text/x-diff
Expires: Fri, May 16, 1:00 AM (1 d, 11 h)
Storage Engine: local-disk
Storage Format: Raw Data
Storage Handle: e2/a7/97d6d7ad9e7af8360a1f5bed9efb

No OneTemporaryActions

View Options

File Metadata

Event Timeline

No OneTemporary
Actions