Page MenuHomeMusing Studio

No OneTemporary

diff --git a/account.go b/account.go
index ae8e21c..3adb7f7 100644
--- a/account.go
+++ b/account.go
@@ -1,1196 +1,1196 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"encoding/json"
"fmt"
"html/template"
"net/http"
"regexp"
"strings"
"sync"
"time"
"github.com/gorilla/mux"
"github.com/gorilla/sessions"
"github.com/guregu/null/zero"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/data"
"github.com/writeas/web-core/log"
"github.com/writeas/writefreely/author"
"github.com/writeas/writefreely/config"
"github.com/writeas/writefreely/page"
)
type (
userSettings struct {
Username string `schema:"username" json:"username"`
Email string `schema:"email" json:"email"`
NewPass string `schema:"new-pass" json:"new_pass"`
OldPass string `schema:"current-pass" json:"current_pass"`
IsLogOut bool `schema:"logout" json:"logout"`
}
UserPage struct {
page.StaticPage
PageTitle string
Separator template.HTML
IsAdmin bool
CanInvite bool
}
)
func NewUserPage(app *App, r *http.Request, u *User, title string, flashes []string) *UserPage {
up := &UserPage{
StaticPage: pageForReq(app, r),
PageTitle: title,
}
up.Username = u.Username
up.Flashes = flashes
up.Path = r.URL.Path
up.IsAdmin = u.IsAdmin()
up.CanInvite = canUserInvite(app.cfg, up.IsAdmin)
return up
}
func canUserInvite(cfg *config.Config, isAdmin bool) bool {
return cfg.App.UserInvites != "" &&
(isAdmin || cfg.App.UserInvites != "admin")
}
func (up *UserPage) SetMessaging(u *User) {
// up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID)
}
const (
loginAttemptExpiration = 3 * time.Second
)
var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead")
func apiSignup(app *App, w http.ResponseWriter, r *http.Request) error {
_, err := signup(app, w, r)
return err
}
func signup(app *App, w http.ResponseWriter, r *http.Request) (*AuthUser, error) {
if app.cfg.App.DisablePasswordAuth {
err := ErrDisabledPasswordAuth
return nil, err
}
reqJSON := IsJSON(r)
// Get params
var ur userRegistration
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&ur)
if err != nil {
log.Error("Couldn't parse signup JSON request: %v\n", err)
return nil, ErrBadJSON
}
} else {
// Check if user is already logged in
u := getUserSession(app, r)
if u != nil {
return &AuthUser{User: u}, nil
}
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse signup form request: %v\n", err)
return nil, ErrBadFormData
}
err = app.formDecoder.Decode(&ur, r.PostForm)
if err != nil {
log.Error("Couldn't decode signup form request: %v\n", err)
return nil, ErrBadFormData
}
}
return signupWithRegistration(app, ur, w, r)
}
func signupWithRegistration(app *App, signup userRegistration, w http.ResponseWriter, r *http.Request) (*AuthUser, error) {
reqJSON := IsJSON(r)
// Validate required params (alias)
if signup.Alias == "" {
return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."}
}
if signup.Pass == "" {
return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."}
}
var desiredUsername string
if signup.Normalize {
// With this option we simply conform the username to what we expect
// without complaining. Since they might've done something funny, like
// enter: write.as/Way Out There, we'll use their raw input for the new
// collection name and sanitize for the slug / username.
desiredUsername = signup.Alias
signup.Alias = getSlug(signup.Alias, "")
}
if !author.IsValidUsername(app.cfg, signup.Alias) {
// Ensure the username is syntactically correct.
return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."}
}
// Handle empty optional params
// TODO: remove this var
createdWithPass := true
hashedPass, err := auth.HashPass([]byte(signup.Pass))
if err != nil {
return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
// Create struct to insert
u := &User{
Username: signup.Alias,
HashedPass: hashedPass,
HasPass: createdWithPass,
Email: prepareUserEmail(signup.Email, app.keys.EmailKey),
Created: time.Now().Truncate(time.Second).UTC(),
}
// Create actual user
if err := app.db.CreateUser(app.cfg, u, desiredUsername); err != nil {
return nil, err
}
// Log invite if needed
if signup.InviteCode != "" {
err = app.db.CreateInvitedUser(signup.InviteCode, u.ID)
if err != nil {
return nil, err
}
}
// Add back unencrypted data for response
if signup.Email != "" {
u.Email.String = signup.Email
}
resUser := &AuthUser{
User: u,
}
if !createdWithPass {
resUser.Password = signup.Pass
}
title := signup.Alias
if signup.Normalize {
title = desiredUsername
}
resUser.Collections = &[]Collection{
{
Alias: signup.Alias,
Title: title,
},
}
var token string
if reqJSON && !signup.Web {
token, err = app.db.GetAccessToken(u.ID)
if err != nil {
return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
}
resUser.AccessToken = token
} else {
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
// Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144
log.Error("Session: %v; ignoring", err)
}
session.Values[cookieUserVal] = resUser.User.Cookie()
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session: %v", err)
return nil, err
}
}
if reqJSON {
return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated)
}
return resUser, nil
}
func viewLogout(app *App, w http.ResponseWriter, r *http.Request) error {
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
return ErrInternalCookieSession
}
// Ensure user has an email or password set before they go, so they don't
// lose access to their account.
val := session.Values[cookieUserVal]
var u = &User{}
var ok bool
if u, ok = val.(*User); !ok {
log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values)
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session on logout: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
}
return impart.HTTPError{http.StatusFound, "/"}
}
u, err = app.db.GetUserByID(u.ID)
if err != nil && err != ErrUserNotFound {
return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."}
}
session.Options.MaxAge = -1
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't save session on logout: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."}
}
return impart.HTTPError{http.StatusFound, "/"}
}
func handleAPILogout(app *App, w http.ResponseWriter, r *http.Request) error {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
t := auth.GetToken(accessToken)
if len(t) == 0 {
return ErrNoAccessToken
}
err := app.db.DeleteToken(t)
if err != nil {
return err
}
return impart.HTTPError{Status: http.StatusNoContent}
}
func viewLogin(app *App, w http.ResponseWriter, r *http.Request) error {
var earlyError string
oneTimeToken := r.FormValue("with")
if oneTimeToken != "" {
log.Info("Calling login with one-time token.")
err := login(app, w, r)
if err != nil {
log.Info("Received error: %v", err)
earlyError = fmt.Sprintf("%s", err)
}
}
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session; ignoring: %v", err)
}
p := &struct {
page.StaticPage
To string
Message template.HTML
Flashes []template.HTML
LoginUsername string
OauthSlack bool
OauthWriteAs bool
OauthGitlab bool
GitlabDisplayName string
OauthGeneric bool
OauthGenericDisplayName string
OauthGitea bool
GiteaDisplayName string
}{
pageForReq(app, r),
r.FormValue("to"),
template.HTML(""),
[]template.HTML{},
getTempInfo(app, "login-user", r, w),
app.Config().SlackOauth.ClientID != "",
app.Config().WriteAsOauth.ClientID != "",
app.Config().GitlabOauth.ClientID != "",
config.OrDefaultString(app.Config().GenericOauth.DisplayName, genericOauthDisplayName),
app.Config().GenericOauth.ClientID != "",
config.OrDefaultString(app.Config().GitlabOauth.DisplayName, gitlabDisplayName),
app.Config().GiteaOauth.ClientID != "",
config.OrDefaultString(app.Config().GiteaOauth.DisplayName, giteaDisplayName),
}
if earlyError != "" {
p.Flashes = append(p.Flashes, template.HTML(earlyError))
}
// Display any error messages
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
err = pages["login.tmpl"].ExecuteTemplate(w, "base", p)
if err != nil {
log.Error("Unable to render login: %v", err)
return err
}
return nil
}
func webLogin(app *App, w http.ResponseWriter, r *http.Request) error {
err := login(app, w, r)
if err != nil {
username := r.FormValue("alias")
// Login request was unsuccessful; save the error in the session and redirect them
if err, ok := err.(impart.HTTPError); ok {
session, _ := app.sessionStore.Get(r, cookieName)
if session != nil {
session.AddFlash(err.Message)
session.Save(r, w)
}
if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 {
// Retain fixed username recommendation for the login form
username = m[1]
}
}
// Pass along certain information
saveTempInfo(app, "login-user", username, r, w)
// Retain post-login URL if one was given
redirectTo := "/login"
postLoginRedirect := r.FormValue("to")
if postLoginRedirect != "" {
redirectTo += "?to=" + postLoginRedirect
}
log.Error("Unable to login: %v", err)
return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo}
}
return nil
}
var loginAttemptUsers = sync.Map{}
func login(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
oneTimeToken := r.FormValue("with")
verbose := r.FormValue("all") == "true" || r.FormValue("verbose") == "1" || r.FormValue("verbose") == "true" || (reqJSON && oneTimeToken != "")
redirectTo := r.FormValue("to")
if redirectTo == "" {
if app.cfg.App.SingleUser {
redirectTo = "/me/new"
} else {
redirectTo = "/"
}
}
var u *User
var err error
var signin userCredentials
if app.cfg.App.DisablePasswordAuth {
err := ErrDisabledPasswordAuth
return err
}
// Log in with one-time token if one is given
if oneTimeToken != "" {
log.Info("Login: Logging user in via token.")
userID := app.db.GetUserID(oneTimeToken)
if userID == -1 {
log.Error("Login: Got user -1 from token")
err := ErrBadAccessToken
err.Message = "Expired or invalid login code."
return err
}
log.Info("Login: Found user %d.", userID)
u, err = app.db.GetUserByID(userID)
if err != nil {
log.Error("Unable to fetch user on one-time token login: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."}
}
log.Info("Login: Got user via token")
} else {
// Get params
if reqJSON {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&signin)
if err != nil {
log.Error("Couldn't parse signin JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse signin form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&signin, r.PostForm)
if err != nil {
log.Error("Couldn't decode signin form request: %v\n", err)
return ErrBadFormData
}
}
log.Info("Login: Attempting login for '%s'", signin.Alias)
// Validate required params (all)
if signin.Alias == "" {
msg := "Parameter `alias` required."
if signin.Web {
msg = "A username is required."
}
return impart.HTTPError{http.StatusBadRequest, msg}
}
if !signin.EmailLogin && signin.Pass == "" {
msg := "Parameter `pass` required."
if signin.Web {
msg = "A password is required."
}
return impart.HTTPError{http.StatusBadRequest, msg}
}
// Prevent excessive login attempts on the same account
// Skip this check in dev environment
if !app.cfg.Server.Dev {
now := time.Now()
attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration))
if att {
if attemptExpTime, ok := attemptExp.(time.Time); ok {
if attemptExpTime.After(now) {
// This user attempted previously, and the period hasn't expired yet
return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."}
} else {
// This user attempted previously, but the time expired; free up space
loginAttemptUsers.Delete(signin.Alias)
}
} else {
log.Error("Unable to cast expiration to time")
}
}
}
// Retrieve password
u, err = app.db.GetUserForAuth(signin.Alias)
if err != nil {
log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err)
if strings.IndexAny(signin.Alias, "@") > 0 {
log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message)
return ErrUserNotFoundEmail
}
return err
}
// Authenticate
if u.Email.String == "" {
// User has no email set, so check if they haven't added a password, either,
// so we can return a more helpful error message.
if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass {
log.Info("Tried logging in to %s, but no password or email.", signin.Alias)
return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."}
}
}
if len(u.HashedPass) == 0 {
return impart.HTTPError{http.StatusUnauthorized, "This user never set a password. Perhaps try logging in via OAuth?"}
}
if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
}
if reqJSON && !signin.Web {
var token string
if r.Header.Get("User-Agent") == "" {
// Get last created token when User-Agent is empty
token = app.db.FetchLastAccessToken(u.ID)
if token == "" {
token, err = app.db.GetAccessToken(u.ID)
}
} else {
token, err = app.db.GetAccessToken(u.ID)
}
if err != nil {
log.Error("Login: Unable to create access token: %v", err)
return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."}
}
resUser := getVerboseAuthUser(app, token, u, verbose)
return impart.WriteSuccess(w, resUser, http.StatusOK)
}
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
log.Error("Login: Session: %v; ignoring", err)
}
// Remove unwanted data
session.Values[cookieUserVal] = u.Cookie()
err = session.Save(r, w)
if err != nil {
log.Error("Login: Couldn't save session: %v", err)
// TODO: return error
}
// Send success
if reqJSON {
return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK)
}
log.Info("Login: Redirecting to %s", redirectTo)
w.Header().Set("Location", redirectTo)
w.WriteHeader(http.StatusFound)
return nil
}
func getVerboseAuthUser(app *App, token string, u *User, verbose bool) *AuthUser {
resUser := &AuthUser{
AccessToken: token,
User: u,
}
// Fetch verbose user data if requested
if verbose {
posts, err := app.db.GetUserPosts(u)
if err != nil {
log.Error("Login: Unable to get user posts: %v", err)
}
colls, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("Login: Unable to get user collections: %v", err)
}
passIsSet, err := app.db.IsUserPassSet(u.ID)
if err != nil {
// TODO: correct error meesage
log.Error("Login: Unable to get user collections: %v", err)
}
resUser.Posts = posts
resUser.Collections = colls
resUser.User.HasPass = passIsSet
}
return resUser
}
func viewExportOptions(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
// Fetch extra user data
p := NewUserPage(app, r, u, "Export", nil)
showUserPage(w, "export", p)
return nil
}
func viewExportPosts(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) {
var filename string
var u = &User{}
reqJSON := IsJSON(r)
if reqJSON {
// Use given Authorization header
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return nil, filename, ErrNoAccessToken
}
userID := app.db.GetUserID(accessToken)
if userID == -1 {
return nil, filename, ErrBadAccessToken
}
var err error
u, err = app.db.GetUserByID(userID)
if err != nil {
return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."}
}
} else {
// Use user cookie
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// The cookie should still save, even if there's an error.
log.Error("Session: %v; ignoring", err)
}
val := session.Values[cookieUserVal]
var ok bool
if u, ok = val.(*User); !ok {
return nil, filename, ErrNotLoggedIn
}
}
filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")
// Fetch data we're exporting
var err error
var data []byte
posts, err := app.db.GetUserPosts(u)
if err != nil {
return data, filename, err
}
// Export as CSV
if strings.HasSuffix(r.URL.Path, ".csv") {
data = exportPostsCSV(app.cfg.App.Host, u, posts)
return data, filename, err
}
if strings.HasSuffix(r.URL.Path, ".zip") {
data = exportPostsZip(u, posts)
return data, filename, err
}
if r.FormValue("pretty") == "1" {
data, err = json.MarshalIndent(posts, "", "\t")
} else {
data, err = json.Marshal(posts)
}
return data, filename, err
}
func viewExportFull(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) {
var err error
filename := ""
u := getUserSession(app, r)
if u == nil {
return nil, filename, ErrNotLoggedIn
}
filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504")
exportUser := compileFullExport(app, u)
var data []byte
if r.FormValue("pretty") == "1" {
data, err = json.MarshalIndent(exportUser, "", "\t")
} else {
data, err = json.Marshal(exportUser)
}
return data, filename, err
}
func viewMeAPI(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
uObj := struct {
ID int64 `json:"id,omitempty"`
Username string `json:"username,omitempty"`
}{}
var err error
if reqJSON {
_, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization"))
if err != nil {
return err
}
} else {
u := getUserSession(app, r)
if u == nil {
return impart.WriteSuccess(w, uObj, http.StatusOK)
}
uObj.Username = u.Username
}
return impart.WriteSuccess(w, uObj, http.StatusOK)
}
func viewMyPostsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
if !reqJSON {
return ErrBadRequestedType
}
var err error
p := GetPostsCache(u.ID)
if p == nil {
userPostsCache.Lock()
if userPostsCache.users[u.ID].ready == nil {
userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})}
userPostsCache.Unlock()
p, err = app.db.GetUserPosts(u)
if err != nil {
return err
}
CachePosts(u.ID, p)
} else {
userPostsCache.Unlock()
<-userPostsCache.users[u.ID].ready
p = GetPostsCache(u.ID)
}
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func viewMyCollectionsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
if !reqJSON {
return ErrBadRequestedType
}
p, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
return err
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func viewArticles(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p, err := app.db.GetAnonymousPosts(u)
if err != nil {
log.Error("unable to fetch anon posts: %v", err)
}
// nil-out AnonymousPosts slice for easy detection in the template
if p != nil && len(*p) == 0 {
p = nil
}
f, err := getSessionFlashes(app, w, r, nil)
if err != nil {
log.Error("unable to fetch flashes: %v", err)
}
c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view articles: %v", err)
}
d := struct {
*UserPage
AnonymousPosts *[]PublicPost
Collections *[]Collection
Silenced bool
}{
UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f),
AnonymousPosts: p,
Collections: c,
Silenced: silenced,
}
d.UserPage.SetMessaging(u)
w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate")
w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT")
showUserPage(w, "articles", d)
return nil
}
func viewCollections(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
c, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
return fmt.Errorf("No collections")
}
f, _ := getSessionFlashes(app, w, r, nil)
uc, _ := app.db.GetUserCollectionCount(u.ID)
// TODO: handle any errors
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view collections %v", err)
return fmt.Errorf("view collections: %v", err)
}
d := struct {
*UserPage
Collections *[]Collection
UsedCollections, TotalCollections int
NewBlogsDisabled bool
Silenced bool
}{
UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f),
Collections: c,
UsedCollections: int(uc),
NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc),
Silenced: silenced,
}
d.UserPage.SetMessaging(u)
showUserPage(w, "collections", d)
return nil
}
func viewEditCollection(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
c, err := app.db.GetCollection(vars["collection"])
if err != nil {
return err
}
if c.OwnerID != u.ID {
return ErrCollectionNotFound
}
// Add collection properties
- c.Monetization = app.db.GetCollectionAttribute(c.ID, "monetization_pointer")
+ c.MonetizationPointer = app.db.GetCollectionAttribute(c.ID, "monetization_pointer")
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view edit collection %v", err)
return fmt.Errorf("view edit collection: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, nil)
obj := struct {
*UserPage
*Collection
Silenced bool
}{
UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes),
Collection: c,
Silenced: silenced,
}
showUserPage(w, "collection", obj)
return nil
}
func updateSettings(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
var s userSettings
var u *User
var sess *sessions.Session
var err error
if reqJSON {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
u, err = app.db.GetAPIUser(accessToken)
if err != nil {
return ErrBadAccessToken
}
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&s)
if err != nil {
log.Error("Couldn't parse settings JSON request: %v\n", err)
return ErrBadJSON
}
// Prevent all username updates
// TODO: support changing username via JSON API request
s.Username = ""
} else {
u, sess = getUserAndSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse settings form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&s, r.PostForm)
if err != nil {
log.Error("Couldn't decode settings form request: %v\n", err)
return ErrBadFormData
}
}
// Do update
postUpdateReturn := r.FormValue("return")
redirectTo := "/me/settings"
if s.IsLogOut {
redirectTo += "?logout=1"
} else if postUpdateReturn != "" {
redirectTo = postUpdateReturn
}
// Only do updates on values we need
if s.Username != "" && s.Username == u.Username {
// Username hasn't actually changed; blank it out
s.Username = ""
}
err = app.db.ChangeSettings(app, u, &s)
if err != nil {
if reqJSON {
return err
}
if err, ok := err.(impart.HTTPError); ok {
addSessionFlash(app, w, r, err.Message, nil)
}
} else {
// Successful update.
if reqJSON {
return impart.WriteSuccess(w, u, http.StatusOK)
}
if s.IsLogOut {
redirectTo = "/me/logout"
} else {
sess.Values[cookieUserVal] = u.Cookie()
addSessionFlash(app, w, r, "Account updated.", nil)
}
}
w.Header().Set("Location", redirectTo)
w.WriteHeader(http.StatusFound)
return nil
}
func updatePassphrase(app *App, w http.ResponseWriter, r *http.Request) error {
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
curPass := r.FormValue("current")
newPass := r.FormValue("new")
// Ensure a new password is given (always required)
if newPass == "" {
return impart.HTTPError{http.StatusBadRequest, "Provide a new password."}
}
userID, sudo := app.db.GetUserIDPrivilege(accessToken)
if userID == -1 {
return ErrBadAccessToken
}
// Ensure a current password is given if the access token doesn't have sudo
// privileges.
if !sudo && curPass == "" {
return impart.HTTPError{http.StatusBadRequest, "Provide current password."}
}
// Hash the new password
hashedPass, err := auth.HashPass([]byte(newPass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
// Do update
err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass)
if err != nil {
return err
}
return impart.WriteSuccess(w, struct{}{}, http.StatusOK)
}
func viewStats(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
var c *Collection
var err error
vars := mux.Vars(r)
alias := vars["collection"]
if alias != "" {
c, err = app.db.GetCollection(alias)
if err != nil {
return err
}
if c.OwnerID != u.ID {
return ErrCollectionNotFound
}
}
topPosts, err := app.db.GetTopPosts(u, alias)
if err != nil {
log.Error("Unable to get top posts: %v", err)
return err
}
flashes, _ := getSessionFlashes(app, w, r, nil)
titleStats := ""
if c != nil {
titleStats = c.DisplayTitle() + " "
}
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("view stats: %v", err)
return err
}
obj := struct {
*UserPage
VisitsBlog string
Collection *Collection
TopPosts *[]PublicPost
APFollowers int
Silenced bool
}{
UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes),
VisitsBlog: alias,
Collection: c,
TopPosts: topPosts,
Silenced: silenced,
}
if app.cfg.App.Federation {
folls, err := app.db.GetAPFollowers(c)
if err != nil {
return err
}
obj.APFollowers = len(*folls)
}
showUserPage(w, "stats", obj)
return nil
}
func viewSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
fullUser, err := app.db.GetUserByID(u.ID)
if err != nil {
log.Error("Unable to get user for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
passIsSet, err := app.db.IsUserPassSet(u.ID)
if err != nil {
log.Error("Unable to get isUserPassSet for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
flashes, _ := getSessionFlashes(app, w, r, nil)
enableOauthSlack := app.Config().SlackOauth.ClientID != ""
enableOauthWriteAs := app.Config().WriteAsOauth.ClientID != ""
enableOauthGitLab := app.Config().GitlabOauth.ClientID != ""
enableOauthGeneric := app.Config().GenericOauth.ClientID != ""
enableOauthGitea := app.Config().GiteaOauth.ClientID != ""
oauthAccounts, err := app.db.GetOauthAccounts(r.Context(), u.ID)
if err != nil {
log.Error("Unable to get oauth accounts for settings: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."}
}
for idx, oauthAccount := range oauthAccounts {
switch oauthAccount.Provider {
case "slack":
enableOauthSlack = false
case "write.as":
enableOauthWriteAs = false
case "gitlab":
enableOauthGitLab = false
case "generic":
oauthAccounts[idx].DisplayName = app.Config().GenericOauth.DisplayName
oauthAccounts[idx].AllowDisconnect = app.Config().GenericOauth.AllowDisconnect
enableOauthGeneric = false
case "gitea":
enableOauthGitea = false
}
}
displayOauthSection := enableOauthSlack || enableOauthWriteAs || enableOauthGitLab || enableOauthGeneric || enableOauthGitea || len(oauthAccounts) > 0
obj := struct {
*UserPage
Email string
HasPass bool
IsLogOut bool
Silenced bool
OauthSection bool
OauthAccounts []oauthAccountInfo
OauthSlack bool
OauthWriteAs bool
OauthGitLab bool
GitLabDisplayName string
OauthGeneric bool
OauthGenericDisplayName string
OauthGitea bool
GiteaDisplayName string
}{
UserPage: NewUserPage(app, r, u, "Account Settings", flashes),
Email: fullUser.EmailClear(app.keys),
HasPass: passIsSet,
IsLogOut: r.FormValue("logout") == "1",
Silenced: fullUser.IsSilenced(),
OauthSection: displayOauthSection,
OauthAccounts: oauthAccounts,
OauthSlack: enableOauthSlack,
OauthWriteAs: enableOauthWriteAs,
OauthGitLab: enableOauthGitLab,
GitLabDisplayName: config.OrDefaultString(app.Config().GitlabOauth.DisplayName, gitlabDisplayName),
OauthGeneric: enableOauthGeneric,
OauthGenericDisplayName: config.OrDefaultString(app.Config().GenericOauth.DisplayName, genericOauthDisplayName),
OauthGitea: enableOauthGitea,
GiteaDisplayName: config.OrDefaultString(app.Config().GiteaOauth.DisplayName, giteaDisplayName),
}
showUserPage(w, "settings", obj)
return nil
}
func saveTempInfo(app *App, key, val string, r *http.Request, w http.ResponseWriter) error {
session, err := app.sessionStore.Get(r, "t")
if err != nil {
return ErrInternalCookieSession
}
session.Values[key] = val
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err)
}
return err
}
func getTempInfo(app *App, key string, r *http.Request, w http.ResponseWriter) string {
session, err := app.sessionStore.Get(r, "t")
if err != nil {
return ""
}
// Get the information
var s = ""
var ok bool
if s, ok = session.Values[key].(string); !ok {
return ""
}
// Delete cookie
session.Options.MaxAge = -1
err = session.Save(r, w)
if err != nil {
log.Error("Couldn't erase temp data for key %s: %v", key, err)
}
// Return value
return s
}
func removeOauth(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
provider := r.FormValue("provider")
clientID := r.FormValue("client_id")
remoteUserID := r.FormValue("remote_user_id")
err := app.db.RemoveOauth(r.Context(), u.ID, provider, clientID, remoteUserID)
if err != nil {
return impart.HTTPError{Status: http.StatusInternalServerError, Message: err.Error()}
}
return impart.HTTPError{Status: http.StatusFound, Message: "/me/settings"}
}
func prepareUserEmail(input string, emailKey []byte) zero.String {
email := zero.NewString("", input != "")
if len(input) > 0 {
encEmail, err := data.Encrypt(emailKey, input)
if err != nil {
log.Error("Unable to encrypt email: %s\n", err)
} else {
email.String = string(encEmail)
}
}
return email
}
diff --git a/admin.go b/admin.go
index 457b384..a0d10eb 100644
--- a/admin.go
+++ b/admin.go
@@ -1,637 +1,638 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"fmt"
"net/http"
"runtime"
"strconv"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/passgen"
"github.com/writeas/writefreely/appstats"
"github.com/writeas/writefreely/config"
)
var (
appStartTime = time.Now()
sysStatus systemStatus
)
const adminUsersPerPage = 30
type systemStatus struct {
Uptime string
NumGoroutine int
// General statistics.
MemAllocated string // bytes allocated and still in use
MemTotal string // bytes allocated (even if freed)
MemSys string // bytes obtained from system (sum of XxxSys below)
Lookups uint64 // number of pointer lookups
MemMallocs uint64 // number of mallocs
MemFrees uint64 // number of frees
// Main allocation heap statistics.
HeapAlloc string // bytes allocated and still in use
HeapSys string // bytes obtained from system
HeapIdle string // bytes in idle spans
HeapInuse string // bytes in non-idle span
HeapReleased string // bytes released to the OS
HeapObjects uint64 // total number of allocated objects
// Low-level fixed-size structure allocator statistics.
// Inuse is bytes used now.
// Sys is bytes obtained from system.
StackInuse string // bootstrap stacks
StackSys string
MSpanInuse string // mspan structures
MSpanSys string
MCacheInuse string // mcache structures
MCacheSys string
BuckHashSys string // profiling bucket hash table
GCSys string // GC metadata
OtherSys string // other system allocations
// Garbage collector statistics.
NextGC string // next run in HeapAlloc time (bytes)
LastGC string // last run in absolute time (ns)
PauseTotalNs string
PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256]
NumGC uint32
}
type inspectedCollection struct {
CollectionObj
Followers int
LastPost string
}
type instanceContent struct {
ID string
Type string
Title sql.NullString
Content string
Updated time.Time
}
type AdminPage struct {
UpdateAvailable bool
}
func NewAdminPage(app *App) *AdminPage {
ap := &AdminPage{}
if app.updates != nil {
ap.UpdateAvailable = app.updates.AreAvailableNoCheck()
}
return ap
}
func (c instanceContent) UpdatedFriendly() string {
/*
// TODO: accept a locale in this method and use that for the format
var loc monday.Locale = monday.LocaleEnUS
return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc)
*/
return c.Updated.Format("January 2, 2006, 3:04 PM")
}
func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Message string
UsersCount, CollectionsCount, PostsCount int64
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
Message: r.FormValue("m"),
}
// Get user stats
p.UsersCount = app.db.GetAllUsersCount()
var err error
p.CollectionsCount, err = app.db.GetTotalCollections()
if err != nil {
return err
}
p.PostsCount, err = app.db.GetTotalPosts()
if err != nil {
return err
}
showUserPage(w, "admin", p)
return nil
}
func handleViewAdminMonitor(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
updateAppStats()
p := struct {
*UserPage
*AdminPage
SysStatus systemStatus
Config config.AppCfg
Message, ConfigMessage string
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
SysStatus: sysStatus,
Config: app.cfg.App,
Message: r.FormValue("m"),
ConfigMessage: r.FormValue("cm"),
}
showUserPage(w, "monitor", p)
return nil
}
func handleViewAdminSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message, ConfigMessage string
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
ConfigMessage: r.FormValue("cm"),
}
showUserPage(w, "app-settings", p)
return nil
}
func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Users *[]User
CurPage int
TotalUsers int64
TotalPages []int
}{
UserPage: NewUserPage(app, r, u, "Users", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
p.TotalUsers = app.db.GetAllUsersCount()
ttlPages := p.TotalUsers / adminUsersPerPage
p.TotalPages = []int{}
for i := 1; i <= int(ttlPages); i++ {
p.TotalPages = append(p.TotalPages, i)
}
var err error
p.CurPage, err = strconv.Atoi(r.FormValue("p"))
if err != nil || p.CurPage < 1 {
p.CurPage = 1
} else if p.CurPage > int(ttlPages) {
p.CurPage = int(ttlPages)
}
p.Users, err = app.db.GetAllUsers(uint(p.CurPage))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)}
}
showUserPage(w, "users", p)
return nil
}
func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
User *User
Colls []inspectedCollection
LastPost string
NewPassword string
TotalPosts int64
ClearEmail string
}{
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
Colls: []inspectedCollection{},
}
var err error
p.User, err = app.db.GetUserForAuth(username)
if err != nil {
if err == ErrUserNotFound {
return err
}
log.Error("Could not get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
if strings.HasPrefix(flash, "SUCCESS: ") {
p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ")
p.ClearEmail = p.User.EmailClear(app.keys)
}
}
p.UserPage = NewUserPage(app, r, u, p.User.Username, nil)
p.TotalPosts = app.db.GetUserPostsCount(p.User.ID)
lp, err := app.db.GetUserLastPostTime(p.User.ID)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)}
}
if lp != nil {
p.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
colls, err := app.db.GetCollections(p.User, app.cfg.App.Host)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)}
}
for _, c := range *colls {
ic := inspectedCollection{
CollectionObj: CollectionObj{Collection: c},
}
if app.cfg.App.Federation {
folls, err := app.db.GetAPFollowers(&c)
if err == nil {
// TODO: handle error here (at least log it)
ic.Followers = len(*folls)
}
}
app.db.GetPostsCount(&ic.CollectionObj, true)
lp, err := app.db.GetCollectionLastPostTime(c.ID)
if err != nil {
log.Error("Didn't get last post time for collection %d: %v", c.ID, err)
}
if lp != nil {
ic.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
p.Colls = append(p.Colls, ic)
}
showUserPage(w, "view-user", p)
return nil
}
func handleAdminToggleUserStatus(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
user, err := app.db.GetUserForAuth(username)
if err != nil {
log.Error("failed to get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)}
}
if user.IsSilenced() {
err = app.db.SetUserStatus(user.ID, UserActive)
} else {
err = app.db.SetUserStatus(user.ID, UserSilenced)
}
if err != nil {
log.Error("toggle user silenced: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)}
}
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)}
}
func handleAdminResetUserPass(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
// Generate new random password since none supplied
pass := passgen.NewWordish()
hashedPass, err := auth.HashPass([]byte(pass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
userIDVal := r.FormValue("user")
log.Info("ADMIN: Changing user %s password", userIDVal)
id, err := strconv.Atoi(userIDVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)}
}
err = app.db.ChangePassphrase(int64(id), true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
log.Info("ADMIN: Successfully changed.")
addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil)
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)}
}
func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Pages []*instanceContent
}{
UserPage: NewUserPage(app, r, u, "Pages", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
p.Pages, err = app.db.GetInstancePages()
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)}
}
// Add in default pages
var hasAbout, hasPrivacy bool
for i, c := range p.Pages {
if hasAbout && hasPrivacy {
break
}
if c.ID == "about" {
hasAbout = true
if !c.Title.Valid {
p.Pages[i].Title = defaultAboutTitle(app.cfg)
}
} else if c.ID == "privacy" {
hasPrivacy = true
if !c.Title.Valid {
p.Pages[i].Title = defaultPrivacyTitle()
}
}
}
if !hasAbout {
p.Pages = append(p.Pages, &instanceContent{
ID: "about",
Title: defaultAboutTitle(app.cfg),
Content: defaultAboutPage(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
if !hasPrivacy {
p.Pages = append(p.Pages, &instanceContent{
ID: "privacy",
Title: defaultPrivacyTitle(),
Content: defaultPrivacyPolicy(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
showUserPage(w, "pages", p)
return nil
}
func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
if slug == "" {
return impart.HTTPError{http.StatusFound, "/admin/pages"}
}
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Banner *instanceContent
Content *instanceContent
}{
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
// Get pre-defined pages, or select slug
if slug == "about" {
p.Content, err = getAboutPage(app)
} else if slug == "privacy" {
p.Content, err = getPrivacyPage(app)
} else if slug == "landing" {
p.Banner, err = getLandingBanner(app)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
}
p.Content, err = getLandingBody(app)
p.Content.ID = "landing"
} else if slug == "reader" {
p.Content, err = getReaderSection(app)
} else {
p.Content, err = app.db.GetDynamicContent(slug)
}
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)}
}
title := "New page"
if p.Content != nil {
title = "Edit " + p.Content.ID
} else {
p.Content = &instanceContent{}
}
p.UserPage = NewUserPage(app, r, u, title, nil)
showUserPage(w, "view-page", p)
return nil
}
func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
id := vars["page"]
// Validate
if id != "about" && id != "privacy" && id != "landing" && id != "reader" {
return impart.HTTPError{http.StatusNotFound, "No such page."}
}
var err error
m := ""
if id == "landing" {
// Handle special landing page
err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section")
if err != nil {
m = "?m=" + err.Error()
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section")
} else if id == "reader" {
// Update sections with titles
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section")
} else {
// Update page
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page")
}
if err != nil {
m = "?m=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error {
apper.App().cfg.App.SiteName = r.FormValue("site_name")
apper.App().cfg.App.SiteDesc = r.FormValue("site_desc")
apper.App().cfg.App.Landing = r.FormValue("landing")
apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on"
mul, err := strconv.Atoi(r.FormValue("min_username_len"))
if err == nil {
apper.App().cfg.App.MinUsernameLen = mul
}
mb, err := strconv.Atoi(r.FormValue("max_blogs"))
if err == nil {
apper.App().cfg.App.MaxBlogs = mb
}
apper.App().cfg.App.Federation = r.FormValue("federation") == "on"
apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on"
+ apper.App().cfg.App.Monetization = r.FormValue("monetization") == "on"
apper.App().cfg.App.Private = r.FormValue("private") == "on"
apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on"
if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil {
log.Info("Initializing local timeline...")
initLocalTimeline(apper.App())
}
apper.App().cfg.App.UserInvites = r.FormValue("user_invites")
if apper.App().cfg.App.UserInvites == "none" {
apper.App().cfg.App.UserInvites = ""
}
apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility")
m := "?cm=Configuration+saved."
err = apper.SaveConfig(apper.App().cfg)
if err != nil {
m = "?cm=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin/settings" + m + "#config"}
}
func updateAppStats() {
sysStatus.Uptime = appstats.TimeSincePro(appStartTime)
m := new(runtime.MemStats)
runtime.ReadMemStats(m)
sysStatus.NumGoroutine = runtime.NumGoroutine()
sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc))
sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc))
sysStatus.MemSys = appstats.FileSize(int64(m.Sys))
sysStatus.Lookups = m.Lookups
sysStatus.MemMallocs = m.Mallocs
sysStatus.MemFrees = m.Frees
sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc))
sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys))
sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle))
sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse))
sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased))
sysStatus.HeapObjects = m.HeapObjects
sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse))
sysStatus.StackSys = appstats.FileSize(int64(m.StackSys))
sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse))
sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys))
sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse))
sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys))
sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys))
sysStatus.GCSys = appstats.FileSize(int64(m.GCSys))
sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys))
sysStatus.NextGC = appstats.FileSize(int64(m.NextGC))
sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000)
sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000)
sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000)
sysStatus.NumGC = m.NumGC
}
func adminResetPassword(app *App, u *User, newPass string) error {
hashedPass, err := auth.HashPass([]byte(newPass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
err = app.db.ChangePassphrase(u.ID, true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
return nil
}
func handleViewAdminUpdates(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
check := r.URL.Query().Get("check")
if check == "now" && app.cfg.App.UpdateChecks {
app.updates.CheckNow()
}
p := struct {
*UserPage
*AdminPage
CurReleaseNotesURL string
LastChecked string
LastChecked8601 string
LatestVersion string
LatestReleaseURL string
LatestReleaseNotesURL string
CheckFailed bool
}{
UserPage: NewUserPage(app, r, u, "Updates", nil),
AdminPage: NewAdminPage(app),
}
p.CurReleaseNotesURL = wfReleaseNotesURL(p.Version)
if app.cfg.App.UpdateChecks {
p.LastChecked = app.updates.lastCheck.Format("January 2, 2006, 3:04 PM")
p.LastChecked8601 = app.updates.lastCheck.Format("2006-01-02T15:04:05Z")
p.LatestVersion = app.updates.LatestVersion()
p.LatestReleaseURL = app.updates.ReleaseURL()
p.LatestReleaseNotesURL = app.updates.ReleaseNotesURL()
p.UpdateAvailable = app.updates.AreAvailable()
p.CheckFailed = app.updates.checkError != nil
}
showUserPage(w, "app-updates", p)
return nil
}
diff --git a/collections.go b/collections.go
index ad9cd87..f2958fd 100644
--- a/collections.go
+++ b/collections.go
@@ -1,1160 +1,1160 @@
/*
* Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"fmt"
"html/template"
"math"
"net/http"
"net/url"
"regexp"
"strconv"
"strings"
"unicode"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/bots"
"github.com/writeas/web-core/log"
waposts "github.com/writeas/web-core/posts"
"github.com/writeas/writefreely/author"
"github.com/writeas/writefreely/config"
"github.com/writeas/writefreely/page"
)
type (
// TODO: add Direction to db
// TODO: add Language to db
Collection struct {
ID int64 `datastore:"id" json:"-"`
Alias string `datastore:"alias" schema:"alias" json:"alias"`
Title string `datastore:"title" schema:"title" json:"title"`
Description string `datastore:"description" schema:"description" json:"description"`
Direction string `schema:"dir" json:"dir,omitempty"`
Language string `schema:"lang" json:"lang,omitempty"`
StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"`
Script string `datastore:"script" schema:"script" json:"script,omitempty"`
Signature string `datastore:"post_signature" schema:"signature" json:"-"`
Public bool `datastore:"public" json:"public"`
Visibility collVisibility `datastore:"private" json:"-"`
Format string `datastore:"format" json:"format,omitempty"`
Views int64 `json:"views"`
OwnerID int64 `datastore:"owner_id" json:"-"`
PublicOwner bool `datastore:"public_owner" json:"-"`
URL string `json:"url,omitempty"`
- Monetization string `json:"monetization_pointer,omitempty"`
+ MonetizationPointer string `json:"monetization_pointer,omitempty"`
db *datastore
hostName string
}
CollectionObj struct {
Collection
TotalPosts int `json:"total_posts"`
Owner *User `json:"owner,omitempty"`
Posts *[]PublicPost `json:"posts,omitempty"`
Format *CollectionFormat
}
DisplayCollection struct {
*CollectionObj
Prefix string
IsTopLevel bool
CurrentPage int
TotalPages int
Silenced bool
}
SubmittedCollection struct {
// Data used for updating a given collection
ID int64
OwnerID uint64
// Form helpers
PreferURL string `schema:"prefer_url" json:"prefer_url"`
Privacy int `schema:"privacy" json:"privacy"`
Pass string `schema:"password" json:"password"`
MathJax bool `schema:"mathjax" json:"mathjax"`
Handle string `schema:"handle" json:"handle"`
// Actual collection values updated in the DB
Alias *string `schema:"alias" json:"alias"`
Title *string `schema:"title" json:"title"`
Description *string `schema:"description" json:"description"`
StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"`
Script *sql.NullString `schema:"script" json:"script"`
Signature *sql.NullString `schema:"signature" json:"signature"`
Monetization *string `schema:"monetization_pointer" json:"monetization_pointer"`
Visibility *int `schema:"visibility" json:"public"`
Format *sql.NullString `schema:"format" json:"format"`
}
CollectionFormat struct {
Format string
}
collectionReq struct {
// Information about the collection request itself
prefix, alias, domain string
isCustomDomain bool
// User-related fields
isCollOwner bool
}
)
func (sc *SubmittedCollection) FediverseHandle() string {
if sc.Handle == "" {
return apCustomHandleDefault
}
return getSlug(sc.Handle, "")
}
// collVisibility represents the visibility level for the collection.
type collVisibility int
// Visibility levels. Values are bitmasks, stored in the database as
// decimal numbers. If adding types, append them to this list. If removing,
// replace the desired visibility with a new value.
const CollUnlisted collVisibility = 0
const (
CollPublic collVisibility = 1 << iota
CollPrivate
CollProtected
)
var collVisibilityStrings = map[string]collVisibility{
"unlisted": CollUnlisted,
"public": CollPublic,
"private": CollPrivate,
"protected": CollProtected,
}
func defaultVisibility(cfg *config.Config) collVisibility {
vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility]
if !ok {
vis = CollUnlisted
}
return vis
}
func (cf *CollectionFormat) Ascending() bool {
return cf.Format == "novel"
}
func (cf *CollectionFormat) ShowDates() bool {
return cf.Format == "blog"
}
func (cf *CollectionFormat) PostsPerPage() int {
if cf.Format == "novel" {
return postsPerPage
}
return postsPerPage
}
// Valid returns whether or not a format value is valid.
func (cf *CollectionFormat) Valid() bool {
return cf.Format == "blog" ||
cf.Format == "novel" ||
cf.Format == "notebook"
}
// NewFormat creates a new CollectionFormat object from the Collection.
func (c *Collection) NewFormat() *CollectionFormat {
cf := &CollectionFormat{Format: c.Format}
// Fill in default format
if cf.Format == "" {
cf.Format = "blog"
}
return cf
}
func (c *Collection) IsUnlisted() bool {
return c.Visibility == 0
}
func (c *Collection) IsPrivate() bool {
return c.Visibility&CollPrivate != 0
}
func (c *Collection) IsProtected() bool {
return c.Visibility&CollProtected != 0
}
func (c *Collection) IsPublic() bool {
return c.Visibility&CollPublic != 0
}
func (c *Collection) FriendlyVisibility() string {
if c.IsPrivate() {
return "Private"
}
if c.IsPublic() {
return "Public"
}
if c.IsProtected() {
return "Password-protected"
}
return "Unlisted"
}
func (c *Collection) ShowFooterBranding() bool {
// TODO: implement this setting
return true
}
// CanonicalURL returns a fully-qualified URL to the collection.
func (c *Collection) CanonicalURL() string {
return c.RedirectingCanonicalURL(false)
}
func (c *Collection) DisplayCanonicalURL() string {
us := c.CanonicalURL()
u, err := url.Parse(us)
if err != nil {
return us
}
p := u.Path
if p == "/" {
p = ""
}
return u.Hostname() + p
}
func (c *Collection) RedirectingCanonicalURL(isRedir bool) string {
if c.hostName == "" {
// If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail
log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writeas/writefreely/issues/new?template=bug_report.md")
}
if isSingleUser {
return c.hostName + "/"
}
return fmt.Sprintf("%s/%s/", c.hostName, c.Alias)
}
// PrevPageURL provides a full URL for the previous page of collection posts,
// returning a /page/N result for pages >1
func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string {
u := ""
if n == 2 {
// Previous page is 1; no need for /page/ prefix
if prefix == "" {
u = "/"
}
// Else leave off trailing slash
} else {
u = fmt.Sprintf("/page/%d", n-1)
}
if tl {
return u
}
return "/" + prefix + c.Alias + u
}
// NextPageURL provides a full URL for the next page of collection posts
func (c *Collection) NextPageURL(prefix string, n int, tl bool) string {
if tl {
return fmt.Sprintf("/page/%d", n+1)
}
return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1)
}
func (c *Collection) DisplayTitle() string {
if c.Title != "" {
return c.Title
}
return c.Alias
}
func (c *Collection) StyleSheetDisplay() template.CSS {
return template.CSS(c.StyleSheet)
}
// ForPublic modifies the Collection for public consumption, such as via
// the API.
func (c *Collection) ForPublic() {
c.URL = c.CanonicalURL()
}
var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString
func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person {
accountRoot := c.FederatedAccount()
p := activitystreams.NewPerson(accountRoot)
p.URL = c.CanonicalURL()
uname := c.Alias
p.PreferredUsername = uname
p.Name = c.DisplayTitle()
p.Summary = c.Description
if p.Name != "" {
if av := c.AvatarURL(); av != "" {
p.Icon = activitystreams.Image{
Type: "Image",
MediaType: "image/png",
URL: av,
}
}
}
collID := c.ID
if len(ids) > 0 {
collID = ids[0]
}
pub, priv := c.db.GetAPActorKeys(collID)
if pub != nil {
p.AddPubKey(pub)
p.SetPrivKey(priv)
}
return p
}
func (c *Collection) AvatarURL() string {
fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0]))
if !isAvatarChar(fl) {
return ""
}
return c.hostName + "/img/avatars/" + fl + ".png"
}
func (c *Collection) FederatedAPIBase() string {
return c.hostName + "/"
}
func (c *Collection) FederatedAccount() string {
accountUser := c.Alias
return c.FederatedAPIBase() + "api/collections/" + accountUser
}
func (c *Collection) RenderMathJax() bool {
return c.db.CollectionHasAttribute(c.ID, "render_mathjax")
}
func newCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
alias := r.FormValue("alias")
title := r.FormValue("title")
var missingParams, accessToken string
var u *User
c := struct {
Alias string `json:"alias" schema:"alias"`
Title string `json:"title" schema:"title"`
Web bool `json:"web" schema:"web"`
}{}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse post update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
// TODO: move form parsing to formDecoder
c.Alias = alias
c.Title = title
}
if c.Alias == "" {
if c.Title != "" {
// If only a title was given, just use it to generate the alias.
c.Alias = getSlug(c.Title, "")
} else {
missingParams += "`alias` "
}
}
if c.Title == "" {
missingParams += "`title` "
}
if missingParams != "" {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)}
}
var userID int64
var err error
if reqJSON && !c.Web {
accessToken = r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
userID = app.db.GetUserID(accessToken)
if userID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
userID = u.ID
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("new collection: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrUserSilenced
}
if !author.IsValidUsername(app.cfg, c.Alias) {
return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."}
}
coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID)
if err != nil {
// TODO: handle this
return err
}
res := &CollectionObj{Collection: *coll}
if reqJSON {
return impart.WriteSuccess(w, res, http.StatusCreated)
}
redirectTo := "/me/c/"
// TODO: redirect to pad when necessary
return impart.HTTPError{http.StatusFound, redirectTo}
}
func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) {
accessToken := r.Header.Get("Authorization")
var userID int64 = -1
if accessToken != "" {
userID = app.db.GetUserID(accessToken)
}
isCollOwner := userID == c.OwnerID
if c.IsPrivate() && !isCollOwner {
// Collection is private, but user isn't authenticated
return -1, ErrCollectionNotFound
}
if c.IsProtected() {
// TODO: check access token
return -1, ErrCollectionUnauthorizedRead
}
return userID, nil
}
// fetchCollection handles the API endpoint for retrieving collection data.
func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error {
accept := r.Header.Get("Accept")
if strings.Contains(accept, "application/activity+json") {
return handleFetchCollectionActivities(app, w, r)
}
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: move this logic into a common getCollection function
// Get base Collection data
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Redirect users who aren't requesting JSON
reqJSON := IsJSON(r)
if !reqJSON {
return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
}
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Fetch extra data about the Collection
res := &CollectionObj{Collection: *c}
if c.PublicOwner {
u, err := app.db.GetUserByID(res.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
res.Owner = u
}
}
// TODO: check status for silenced
app.db.GetPostsCount(res, isCollOwner)
// Strip non-public information
res.Collection.ForPublic()
return impart.WriteSuccess(w, res, http.StatusOK)
}
// fetchCollectionPosts handles an API endpoint for retrieving a collection's
// posts.
func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
alias := vars["alias"]
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Get page
page := 1
if p := r.FormValue("page"); p != "" {
pInt, _ := strconv.Atoi(p)
if pInt > 0 {
page = pInt
}
}
posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false)
if err != nil {
return err
}
coll := &CollectionObj{Collection: *c, Posts: posts}
app.db.GetPostsCount(coll, isCollOwner)
// Strip non-public information
coll.Collection.ForPublic()
// Transform post bodies if needed
if r.FormValue("body") == "html" {
for _, p := range *coll.Posts {
p.Content = waposts.ApplyMarkdown([]byte(p.Content))
}
}
return impart.WriteSuccess(w, coll, http.StatusOK)
}
type CollectionPage struct {
page.StaticPage
*DisplayCollection
IsCustomDomain bool
IsWelcome bool
IsOwner bool
CanPin bool
Username string
Monetization string
Collections *[]Collection
PinnedPosts *[]PublicPost
IsAdmin bool
CanInvite bool
}
func NewCollectionObj(c *Collection) *CollectionObj {
return &CollectionObj{
Collection: *c,
Format: c.NewFormat(),
}
}
func (c *CollectionObj) ScriptDisplay() template.JS {
return template.JS(c.Script)
}
var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$")
func (c *CollectionObj) ExternalScripts() []template.URL {
scripts := []template.URL{}
if c.Script == "" {
return scripts
}
matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1)
for _, m := range matches {
scripts = append(scripts, template.URL(strings.TrimSpace(m[1])))
}
return scripts
}
func (c *CollectionObj) CanShowScript() bool {
return false
}
func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error {
cr.prefix = vars["prefix"]
cr.alias = vars["collection"]
// Normalize the URL, redirecting user to consistent post URL
if cr.alias != strings.ToLower(cr.alias) {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))}
}
return nil
}
// processCollectionPermissions checks the permissions for the given
// collectionReq, returning a Collection if access is granted; otherwise this
// renders any necessary collection pages, for example, if requesting a custom
// domain that doesn't yet have a collection associated, or if a collection
// requires a password. In either case, this will return nil, nil -- thus both
// values should ALWAYS be checked to determine whether or not to continue.
func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) {
// Display collection if this is a collection
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(cr.alias)
}
// TODO: verify we don't reveal the existence of a private collection with redirection
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
if cr.isCustomDomain {
// User is on the site from a custom domain
//tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r))
//if tErr != nil {
//log.Error("Unable to render 404-domain page: %v", err)
//}
return nil, nil
}
if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen {
// Alias is within post ID range, so just be sure this isn't a post
if app.db.PostIDExists(cr.alias) {
// TODO: use StatusFound for vanity post URLs when we implement them
return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias}
}
}
// Redirect if necessary
newAlias := app.db.GetCollectionRedirect(cr.alias)
if newAlias != "" {
return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"}
}
}
}
return nil, err
}
c.hostName = app.cfg.App.Host
// Update CollectionRequest to reflect owner status
cr.isCollOwner = u != nil && u.ID == c.OwnerID
// Check permissions
if !cr.isCollOwner {
if c.IsPrivate() {
return nil, ErrCollectionNotFound
} else if c.IsProtected() {
uname := ""
if u != nil {
uname = u.Username
}
// TODO: move this to all permission checks?
suspended, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("process protected collection permissions: %v", err)
return nil, err
}
if suspended {
return nil, ErrCollectionNotFound
}
// See if we've authorized this collection
authd := isAuthorizedForCollection(app, c.Alias, r)
if !authd {
p := struct {
page.StaticPage
*CollectionObj
Username string
Next string
Flashes []template.HTML
}{
StaticPage: pageForReq(app, r),
CollectionObj: &CollectionObj{Collection: *c},
Username: uname,
Next: r.FormValue("g"),
Flashes: []template.HTML{},
}
// Get owner information
p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p)
if err != nil {
log.Error("Unable to render password-collection: %v", err)
return nil, err
}
return nil, nil
}
}
}
return c, nil
}
func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) {
u := getUserSession(app, r)
return u, nil
}
func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection {
coll := &DisplayCollection{
CollectionObj: NewCollectionObj(c),
CurrentPage: page,
Prefix: cr.prefix,
IsTopLevel: isSingleUser,
}
c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner)
return coll
}
func getCollectionPage(vars map[string]string) int {
page := 1
var p int
p, _ = strconv.Atoi(vars["page"])
if p > 0 {
page = p
}
return page
}
// handleViewCollection displays the requested Collection
func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
c.hostName = app.cfg.App.Host
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view collection: %v", err)
return ErrInternalGeneral
}
// Serve ActivityStreams data now, if requested
if strings.Contains(r.Header.Get("Accept"), "application/activity+json") {
ac := c.PersonObject()
ac.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ac, http.StatusOK)
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := newDisplayCollection(c, cr, page)
coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage())))
if coll.TotalPages > 0 && page > coll.TotalPages {
redirURL := fmt.Sprintf("/page/%d", coll.TotalPages)
if !app.cfg.App.SingleUser {
redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL)
}
return impart.HTTPError{http.StatusFound, redirURL}
}
coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false)
// Serve collection
displayPage := CollectionPage{
DisplayCollection: coll,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
IsWelcome: r.FormValue("greeting") != "",
}
displayPage.IsAdmin = u != nil && u.IsAdmin()
displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin)
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
}
if !isOwner && silenced {
return ErrCollectionNotFound
}
displayPage.Silenced = isOwner && silenced
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
collTmpl := "collection"
if app.cfg.App.Chorus {
collTmpl = "chorus-collection"
}
err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage)
if err != nil {
log.Error("Unable to render collection index: %v", err)
}
// Update collection view count
go func() {
// Don't update if owner is viewing the collection.
if u != nil && u.ID == coll.OwnerID {
return
}
// Only update for human views
if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) {
return
}
_, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID)
if err != nil {
log.Error("Unable to update collections count: %v", err)
}
}()
return err
}
func handleViewMention(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
handle := vars["handle"]
remoteUser, err := app.db.GetProfilePageFromHandle(app, handle)
if err != nil || remoteUser == "" {
log.Error("Couldn't find user %s: %v", handle, err)
return ErrRemoteUserNotFound
}
return impart.HTTPError{Status: http.StatusFound, Message: remoteUser}
}
func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
tag := vars["tag"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
coll := newDisplayCollection(c, cr, page)
coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner)
if coll.Posts != nil && len(*coll.Posts) == 0 {
return ErrCollectionPageNotFound
}
// Serve collection
displayPage := struct {
CollectionPage
Tag string
}{
CollectionPage: CollectionPage{
DisplayCollection: coll,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
},
Tag: tag,
}
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
if owner.IsSilenced() {
return ErrCollectionNotFound
}
}
displayPage.Silenced = owner != nil && owner.IsSilenced()
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage)
if err != nil {
log.Error("Unable to render collection tag page: %v", err)
}
return nil
}
func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
// Normalize the URL, redirecting user to consistent post URL
loc := fmt.Sprintf("/%s", slug)
if !app.cfg.App.SingleUser {
loc = fmt.Sprintf("/%s/%s", cr.alias, slug)
}
return impart.HTTPError{http.StatusFound, loc}
}
func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
collAlias := vars["alias"]
isWeb := r.FormValue("web") == "1"
u := &User{}
if reqJSON && !isWeb {
// Ensure an access token was given
accessToken := r.Header.Get("Authorization")
u.ID = app.db.GetUserID(accessToken)
if u.ID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
}
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("existing collection: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrUserSilenced
}
if r.Method == "DELETE" {
err := app.db.DeleteCollection(collAlias, u.ID)
if err != nil {
// TODO: if not HTTPError, report error to admin
log.Error("Unable to delete collection: %s", err)
return err
}
addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil)
return impart.HTTPError{Status: http.StatusNoContent}
}
c := SubmittedCollection{OwnerID: uint64(u.ID)}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse collection update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err = r.ParseForm()
if err != nil {
log.Error("Couldn't parse collection update form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&c, r.PostForm)
if err != nil {
log.Error("Couldn't decode collection update form request: %v\n", err)
return ErrBadFormData
}
}
err = app.db.UpdateCollection(&c, collAlias)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if reqJSON {
return err
}
addSessionFlash(app, w, r, err.Message, nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
} else {
log.Error("Couldn't update collection: %v\n", err)
return err
}
}
if reqJSON {
return impart.WriteSuccess(w, struct {
}{}, http.StatusOK)
}
addSessionFlash(app, w, r, "Blog updated!", nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
}
// collectionAliasFromReq takes a request and returns the collection alias
// if it can be ascertained, as well as whether or not the collection uses a
// custom domain.
func collectionAliasFromReq(r *http.Request) string {
vars := mux.Vars(r)
alias := vars["subdomain"]
isSubdomain := alias != ""
if !isSubdomain {
// Fall back to write.as/{collection} since this isn't a custom domain
alias = vars["collection"]
}
return alias
}
func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error {
var readReq struct {
Alias string `schema:"alias" json:"alias"`
Pass string `schema:"password" json:"password"`
Next string `schema:"to" json:"to"`
}
// Get params
if impart.ReqJSON(r) {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&readReq)
if err != nil {
log.Error("Couldn't parse readReq JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse readReq form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&readReq, r.PostForm)
if err != nil {
log.Error("Couldn't decode readReq form request: %v\n", err)
return ErrBadFormData
}
}
if readReq.Alias == "" {
return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."}
}
if readReq.Pass == "" {
return impart.HTTPError{http.StatusBadRequest, "Please supply a password."}
}
var collHashedPass []byte
err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass)
if err != nil {
if err == sql.ErrNoRows {
log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias)
return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."}
}
return err
}
if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
// Success; set cookie
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
session.Values[readReq.Alias] = true
err = session.Save(r, w)
if err != nil {
log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err)
}
}
next := "/" + readReq.Next
if !app.cfg.App.SingleUser {
next = "/" + readReq.Alias + next
}
return impart.HTTPError{http.StatusFound, next}
}
func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool {
authd := false
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
_, authd = session.Values[alias]
}
return authd
}
diff --git a/config/config.go b/config/config.go
index 9ff13f8..39e461b 100644
--- a/config/config.go
+++ b/config/config.go
@@ -1,266 +1,268 @@
/*
- * Copyright © 2018-2019 A Bunch Tell LLC.
+ * Copyright © 2018-2020 A Bunch Tell LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// Package config holds and assists in the configuration of a writefreely instance.
package config
import (
"strings"
"gopkg.in/ini.v1"
)
const (
// FileName is the default configuration file name
FileName = "config.ini"
UserNormal UserType = "user"
UserAdmin = "admin"
)
type (
UserType string
// ServerCfg holds values that affect how the HTTP server runs
ServerCfg struct {
HiddenHost string `ini:"hidden_host"`
Port int `ini:"port"`
Bind string `ini:"bind"`
TLSCertPath string `ini:"tls_cert_path"`
TLSKeyPath string `ini:"tls_key_path"`
Autocert bool `ini:"autocert"`
TemplatesParentDir string `ini:"templates_parent_dir"`
StaticParentDir string `ini:"static_parent_dir"`
PagesParentDir string `ini:"pages_parent_dir"`
KeysParentDir string `ini:"keys_parent_dir"`
HashSeed string `ini:"hash_seed"`
GopherPort int `ini:"gopher_port"`
Dev bool `ini:"-"`
}
// DatabaseCfg holds values that determine how the application connects to a datastore
DatabaseCfg struct {
Type string `ini:"type"`
FileName string `ini:"filename"`
User string `ini:"username"`
Password string `ini:"password"`
Database string `ini:"database"`
Host string `ini:"host"`
Port int `ini:"port"`
TLS bool `ini:"tls"`
}
WriteAsOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
AuthLocation string `ini:"auth_location"`
TokenLocation string `ini:"token_location"`
InspectLocation string `ini:"inspect_location"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
GitlabOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
Host string `ini:"host"`
DisplayName string `ini:"display_name"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
SlackOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
TeamID string `ini:"team_id"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
GenericOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
Host string `ini:"host"`
DisplayName string `ini:"display_name"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
TokenEndpoint string `ini:"token_endpoint"`
InspectEndpoint string `ini:"inspect_endpoint"`
AuthEndpoint string `ini:"auth_endpoint"`
AllowDisconnect bool `ini:"allow_disconnect"`
}
GiteaOauthCfg struct {
ClientID string `ini:"client_id"`
ClientSecret string `ini:"client_secret"`
Host string `ini:"host"`
DisplayName string `ini:"display_name"`
CallbackProxy string `ini:"callback_proxy"`
CallbackProxyAPI string `ini:"callback_proxy_api"`
}
// AppCfg holds values that affect how the application functions
AppCfg struct {
SiteName string `ini:"site_name"`
SiteDesc string `ini:"site_description"`
Host string `ini:"host"`
// Site appearance
Theme string `ini:"theme"`
Editor string `ini:"editor"`
JSDisabled bool `ini:"disable_js"`
WebFonts bool `ini:"webfonts"`
Landing string `ini:"landing"`
SimpleNav bool `ini:"simple_nav"`
WFModesty bool `ini:"wf_modesty"`
// Site functionality
Chorus bool `ini:"chorus"`
Forest bool `ini:"forest"` // The admin cares about the forest, not the trees. Hide unnecessary technical info.
DisableDrafts bool `ini:"disable_drafts"`
// Users
SingleUser bool `ini:"single_user"`
OpenRegistration bool `ini:"open_registration"`
MinUsernameLen int `ini:"min_username_len"`
MaxBlogs int `ini:"max_blogs"`
+ // Options for public instances
// Federation
- Federation bool `ini:"federation"`
- PublicStats bool `ini:"public_stats"`
+ Federation bool `ini:"federation"`
+ PublicStats bool `ini:"public_stats"`
+ Monetization bool `ini:"monetization"`
// Access
Private bool `ini:"private"`
// Additional functions
LocalTimeline bool `ini:"local_timeline"`
UserInvites string `ini:"user_invites"`
// Defaults
DefaultVisibility string `ini:"default_visibility"`
// Check for Updates
UpdateChecks bool `ini:"update_checks"`
// Disable password authentication if use only Oauth
DisablePasswordAuth bool `ini:"disable_password_auth"`
}
// Config holds the complete configuration for running a writefreely instance
Config struct {
Server ServerCfg `ini:"server"`
Database DatabaseCfg `ini:"database"`
App AppCfg `ini:"app"`
SlackOauth SlackOauthCfg `ini:"oauth.slack"`
WriteAsOauth WriteAsOauthCfg `ini:"oauth.writeas"`
GitlabOauth GitlabOauthCfg `ini:"oauth.gitlab"`
GenericOauth GenericOauthCfg `ini:"oauth.generic"`
GiteaOauth GiteaOauthCfg `ini:"oauth.gitea"`
}
)
// New creates a new Config with sane defaults
func New() *Config {
c := &Config{
Server: ServerCfg{
Port: 8080,
Bind: "localhost", /* IPV6 support when not using localhost? */
},
App: AppCfg{
Host: "http://localhost:8080",
Theme: "write",
WebFonts: true,
SingleUser: true,
MinUsernameLen: 3,
MaxBlogs: 1,
Federation: true,
PublicStats: true,
},
}
c.UseMySQL(true)
return c
}
// UseMySQL resets the Config's Database to use default values for a MySQL setup.
func (cfg *Config) UseMySQL(fresh bool) {
cfg.Database.Type = "mysql"
if fresh {
cfg.Database.Host = "localhost"
cfg.Database.Port = 3306
}
}
// UseSQLite resets the Config's Database to use default values for a SQLite setup.
func (cfg *Config) UseSQLite(fresh bool) {
cfg.Database.Type = "sqlite3"
if fresh {
cfg.Database.FileName = "writefreely.db"
}
}
// IsSecureStandalone returns whether or not the application is running as a
// standalone server with TLS enabled.
func (cfg *Config) IsSecureStandalone() bool {
return cfg.Server.Port == 443 && cfg.Server.TLSCertPath != "" && cfg.Server.TLSKeyPath != ""
}
func (ac *AppCfg) LandingPath() string {
if !strings.HasPrefix(ac.Landing, "/") {
return "/" + ac.Landing
}
return ac.Landing
}
func (ac AppCfg) SignupPath() string {
if !ac.OpenRegistration {
return ""
}
if ac.Chorus || ac.Private || (ac.Landing != "" && ac.Landing != "/") {
return "/signup"
}
return "/"
}
// Load reads the given configuration file, then parses and returns it as a Config.
func Load(fname string) (*Config, error) {
if fname == "" {
fname = FileName
}
cfg, err := ini.Load(fname)
if err != nil {
return nil, err
}
// Parse INI file
uc := &Config{}
err = cfg.MapTo(uc)
if err != nil {
return nil, err
}
return uc, nil
}
// Save writes the given Config to the given file.
func Save(uc *Config, fname string) error {
cfg := ini.Empty()
err := ini.ReflectFrom(cfg, uc)
if err != nil {
return err
}
if fname == "" {
fname = FileName
}
return cfg.SaveTo(fname)
}
diff --git a/templates/user/admin/app-settings.tmpl b/templates/user/admin/app-settings.tmpl
index 4bd87da..9142dcc 100644
--- a/templates/user/admin/app-settings.tmpl
+++ b/templates/user/admin/app-settings.tmpl
@@ -1,161 +1,168 @@
{{define "app-settings"}}
{{template "header" .}}
<style type="text/css">
h2 {font-weight: normal;}
form {
margin: 0 0 2em;
}
form dt {
line-height: inherit;
}
.invisible {
display: none;
}
p.docs {
font-size: 0.86em;
}
input[type=checkbox] {
height: 1em;
width: 1em;
}
select {
font-size: 1em;
}
</style>
<div class="content-container snug">
{{template "admin-header" .}}
{{if .Message}}<p><a name="config"></a>{{.Message}}</p>{{end}}
{{if .ConfigMessage}}<p class="success" style="text-align: center">{{.ConfigMessage}}</p>{{end}}
<form action="/admin/update/config" method="post">
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}>
Site Title
<p>Your public site name.</p>
</div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}><input type="text" name="site_name" id="site_name" class="inline" value="{{.Config.SiteName}}" style="width: 14em;"/></div>
</div>
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}>
Site Description
<p>Describe your site &mdash; this shows in your site's metadata.</p>
</div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}><input type="text" name="site_desc" id="site_desc" class="inline" value="{{.Config.SiteDesc}}" style="width: 14em;"/></div>
</div>
<div class="features row">
<div>
Host
<p>The public address where users will access your site, starting with <code>http://</code> or <code>https://</code>.</p>
</div>
<div>{{.Config.Host}}</div>
</div>
<div class="features row">
<div>
Community Mode
<p>Whether your site is made for one person or many.</p>
</div>
<div>{{if .Config.SingleUser}}Single user{{else}}Multiple users{{end}}</div>
</div>
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}>
Landing Page
<p>The page that logged-out visitors will see first. This should be an absolute path like: <code>/read</code></p>
</div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}><input type="text" name="landing" id="landing" class="inline" value="{{.Config.Landing}}" style="width: 14em;"/></div>
</div>
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}><label for="open_registration">
Open Registrations
<p>Allow anyone who visits the site to create an account.</p>
</label></div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}><input type="checkbox" name="open_registration" id="open_registration" {{if .Config.OpenRegistration}}checked="checked"{{end}} />
</div>
</div>
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}><label for="user_invites">
Allow invitations from...
<p>Choose who is allowed to invite new people.</p>
</label></div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}>
<select name="user_invites" id="user_invites">
<option value="none" {{if eq .Config.UserInvites ""}}selected="selected"{{end}}>No one</option>
<option value="admin" {{if eq .Config.UserInvites "admin"}}selected="selected"{{end}}>Only Admins</option>
<option value="user" {{if eq .Config.UserInvites "user"}}selected="selected"{{end}}>All Users</option>
</select>
</div>
</div>
<div class="features row">
<div><label for="private">
Private Instance
<p>Limit site access to people with an account.</p>
</label></div>
<div><input type="checkbox" name="private" id="private" {{if .Config.Private}}checked="checked"{{end}} /></div>
</div>
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}><label for="local_timeline">
Reader
<p>Show a feed of user posts for anyone who chooses to share there.</p>
</label></div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}><input type="checkbox" name="local_timeline" id="local_timeline" {{if .Config.LocalTimeline}}checked="checked"{{end}} /></div>
</div>
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}><label for="default_visibility">
Default blog visibility
<p>The default setting for new accounts and blogs.</p>
</label></div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}>
<select name="default_visibility" id="default_visibility">
<option value="unlisted" {{if eq .Config.DefaultVisibility "unlisted"}}selected="selected"{{end}}>Unlisted</option>
<option value="public" {{if eq .Config.DefaultVisibility "public"}}selected="selected"{{end}}>Public</option>
<option value="private" {{if eq .Config.DefaultVisibility "private"}}selected="selected"{{end}}>Private</option>
</select>
</div>
</div>
<div class="features row">
<div{{if .Config.SingleUser}} class="invisible"{{end}}><label for="max_blogs">
Maximum Blogs per User
<p>Keep things simple by setting this to <strong>1</strong>, unlimited by setting to <strong>0</strong>, or pick another amount.</p>
</label></div>
<div{{if .Config.SingleUser}} class="invisible"{{end}}><input type="number" name="max_blogs" id="max_blogs" class="inline" min="0" value="{{.Config.MaxBlogs}}"/></div>
</div>
<div class="features row">
<div><label for="federation">
Federation
<p>Enable accounts on this site to propagate their posts via the ActivityPub protocol.</p>
</label></div>
<div><input type="checkbox" name="federation" id="federation" {{if .Config.Federation}}checked="checked"{{end}} /></div>
</div>
<div class="features row">
<div><label for="public_stats">
Public Stats
<p>Publicly display the number of users and posts on your <strong>About</strong> page.</p>
</label></div>
<div><input type="checkbox" name="public_stats" id="public_stats" {{if .Config.PublicStats}}checked="checked"{{end}} /></div>
</div>
+ <div class="features row">
+ <div><label for="monetization">
+ Monetization
+ <p>Enable blogs on this site to receive micro&shy;pay&shy;ments from readers via <a target="wm" href="https://webmonetization.org/">Web Monetization</a>.</p>
+ </label></div>
+ <div><input type="checkbox" name="monetization" id="monetization" {{if .Config.Monetization}}checked="checked"{{end}} /></div>
+ </div>
<div class="features row">
<div><label for="min_username_len">
Minimum Username Length
<p>The minimum number of characters allowed in a username. (Recommended: 2 or more.)</p>
</label></div>
<div><input type="number" name="min_username_len" id="min_username_len" class="inline" min="1" max="100" value="{{.Config.MinUsernameLen}}"/></div>
</div>
<div class="features row">
<input type="submit" value="Save Settings" />
</div>
</form>
<p class="docs">Still have questions? Read more details in the <a href="https://writefreely.org/docs/{{.OfficialVersion}}/admin/config">configuration docs</a>.</p>
</div>
<script>
history.replaceState(null, "", "/admin/settings"+window.location.hash);
</script>
{{template "footer" .}}
{{template "body-end" .}}
{{end}}
diff --git a/templates/user/collection.tmpl b/templates/user/collection.tmpl
index 5c0a793..35ee45a 100644
--- a/templates/user/collection.tmpl
+++ b/templates/user/collection.tmpl
@@ -1,266 +1,268 @@
{{define "upgrade"}}
<p><a href="/me/plan?to=/me/c/{{.Alias}}">Upgrade</a> for <span>$40 / year</span> to edit.</p>
{{end}}
{{define "collection"}}
{{template "header" .}}
<style>
textarea.section.norm {
font-family: Lora,'Palatino Linotype','Book Antiqua','New York','DejaVu serif',serif !important;
min-height: 10em;
max-height: 20em;
resize: vertical;
}
</style>
<div class="content-container snug">
<div id="overlay"></div>
{{if .Silenced}}
{{template "user-silenced"}}
{{end}}
<h2>Customize {{.DisplayTitle}} <a href="{{if .SingleUser}}/{{else}}/{{.Alias}}/{{end}}">view blog</a></h2>
{{if .Flashes}}<ul class="errors">
{{range .Flashes}}<li class="urgent">{{.}}</li>{{end}}
</ul>{{end}}
<form name="customize-form" action="/api/collections/{{.Alias}}" method="post" onsubmit="return disableSubmit()">
<div id="collection-options">
<div style="text-align:center">
<h1><input type="text" name="title" id="title" value="{{.DisplayTitle}}" placeholder="Title" /></h1>
<p><input type="text" name="description" id="description" value="{{.Description}}" placeholder="Description" /></p>
</div>
<div class="option">
<h2><a name="preferred-url"></a>URL</h2>
<div class="section">
{{if eq .Alias .Username}}<p style="font-size: 0.8em">This blog uses your username in its URL{{if .Federation}} and fediverse handle{{end}}. You can change it in your <a href="/me/settings">Account Settings</a>.</p>{{end}}
<ul style="list-style:none">
<li>
{{.FriendlyHost}}/<strong>{{.Alias}}</strong>/
</li>
<li>
<strong id="normal-handle-env" class="fedi-handle" {{if not .Federation}}style="display:none"{{end}}>@<span id="fedi-handle">{{.Alias}}</span>@<span id="fedi-domain">{{.FriendlyHost}}</span></strong>
</li>
</ul>
</div>
</div>
<div class="option">
<h2>Publicity</h2>
<div class="section">
<ul style="list-style:none">
<li>
<label><input type="radio" name="visibility" id="visibility-unlisted" value="0" {{if .IsUnlisted}}checked="checked"{{end}} />
Unlisted
</label>
<p>This blog is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.</p>
</li>
<li>
<label class="option-text"><input type="radio" name="visibility" id="visibility-private" value="2" {{if .IsPrivate}}checked="checked"{{end}} />
Private
</label>
<p>Only you may read this blog (while you're logged in).</p>
</li>
<li>
<label class="option-text"><input type="radio" name="visibility" id="visibility-protected" value="4" {{if .IsProtected}}checked="checked"{{end}} />
Password-protected: <input type="password" class="low-profile" name="password" id="collection-pass" autocomplete="new-password" placeholder="{{if .IsProtected}}xxxxxxxxxxxxxxxx{{else}}a memorable password{{end}}" />
</label>
<p>A password is required to read this blog.</p>
</li>
{{if not .SingleUser}}
<li>
<label class="option-text{{if not .LocalTimeline}} disabled{{end}}"><input type="radio" name="visibility" id="visibility-public" value="1" {{if .IsPublic}}checked="checked"{{end}} {{if not .LocalTimeline}}disabled="disabled"{{end}} />
Public
</label>
{{if .LocalTimeline}}<p>This blog is displayed on the public <a href="/read">reader</a>, and is visible to {{if .Private}}any registered user on this instance{{else}}anyone with its link{{end}}.</p>
{{else}}<p>The public reader is currently turned off for this community.</p>{{end}}
</li>
{{end}}
</ul>
</div>
</div>
<div class="option">
<h2>Display Format</h2>
<div class="section">
<p class="explain">Customize how your posts display on your page.
</p>
<ul style="list-style:none">
<li>
<label><input type="radio" name="format" id="format-blog" value="blog" {{if or (not .Format) (eq .Format "blog")}}checked="checked"{{end}} />
Blog
</label>
<p>Dates are shown. Latest posts listed first.</p>
</li>
<li>
<label class="option-text"><input type="radio" name="format" id="format-novel" value="novel" {{if eq .Format "novel"}}checked="checked"{{end}} />
Novel
</label>
<p>No dates shown. Oldest posts first.</p>
</li>
<li>
<label class="option-text"><input type="radio" name="format" id="format-notebook" value="notebook" {{if eq .Format "notebook"}}checked="checked"{{end}} />
Notebook
</label>
<p>No dates shown. Latest posts first.</p>
</li>
</ul>
</div>
</div>
<div class="option">
<h2>Text Rendering</h2>
<div class="section">
<p class="explain">Customize how plain text renders on your blog.</p>
<ul style="list-style:none">
<li>
<label class="option-text disabled"><input type="checkbox" name="markdown" checked="checked" disabled />
Markdown
</label>
</li>
<li>
<label><input type="checkbox" name="mathjax" {{if .RenderMathJax}}checked="checked"{{end}} />
MathJax
</label>
</li>
</ul>
</div>
</div>
<div class="option">
<h2>Custom CSS</h2>
<div class="section">
<textarea id="css-editor" class="section codable" name="style_sheet">{{.StyleSheet}}</textarea>
<p class="explain">See our guide on <a href="https://guides.write.as/customizing/#custom-css">customization</a>.</p>
</div>
</div>
<div class="option">
<h2>Post Signature</h2>
<div class="section">
<p class="explain">This content will be added to the end of every post on this blog, as if it were part of the post itself. Markdown, HTML, and shortcodes are allowed.</p>
<textarea id="signature" class="section norm" name="signature">{{.Signature}}</textarea>
</div>
</div>
+ {{if .Monetization}}
<div class="option">
<h2>Web Monetization</h2>
<div class="section">
<p class="explain">Web Monetization enables you to receive micropayments from readers that have a <a href="https://coil.com">Coil membership</a>. Add your payment pointer to enable Web Monetization on your blog.</p>
- <input type="text" name="monetization_pointer" style="width:100%" value="{{.Monetization}}" placeholder="$wallet.example.com/alice" />
+ <input type="text" name="monetization_pointer" style="width:100%" value="{{.MonetizationPointer}}" placeholder="$wallet.example.com/alice" />
</div>
</div>
+ {{end}}
<div class="option" style="text-align: center; margin-top: 4em;">
<input type="submit" id="save-changes" value="Save changes" />
<p><a href="{{if .SingleUser}}/{{else}}/{{.Alias}}/{{end}}">View Blog</a></p>
{{if ne .Alias .Username}}<p><a class="danger" href="#modal-delete" onclick="promptDelete();">Delete Blog...</a></p>{{end}}
</div>
</div>
</form>
</div>
<div id="modal-delete" class="modal">
<h2>Are you sure you want to delete this blog?</h2>
<div class="body short">
<p style="text-align:left">This will permanently erase <strong>{{.DisplayTitle}}</strong> ({{.FriendlyHost}}/{{.Alias}}) from the internet. Any posts on this blog will be saved and made into drafts (found on your <a href="/me/posts/">Drafts</a> page).</p>
<p>If you're sure you want to delete this blog, enter its name in the box below and press <strong>Delete</strong>.</p>
<ul id="delete-errors" class="errors"></ul>
<input id="confirm-text" placeholder="{{.Alias}}" type="text" class="boxy" style="margin-top: 0.5em;" />
<div style="text-align:right; margin-top: 1em;">
<a id="cancel-delete" style="margin-right:2em" href="#">Cancel</a>
<button id="btn-delete" class="danger" onclick="deleteBlog(); return false;">Delete</button>
</div>
</div>
</div>
<script src="/js/h.js"></script>
<script src="/js/ace.js" type="text/javascript" charset="utf-8"></script>
<script>
// Begin shared modal code
function showModal(id) {
document.getElementById('overlay').style.display = 'block';
document.getElementById('modal-'+id).style.display = 'block';
}
var closeModals = function(e) {
e.preventDefault();
document.getElementById('overlay').style.display = 'none';
var modals = document.querySelectorAll('.modal');
for (var i=0; i<modals.length; i++) {
modals[i].style.display = 'none';
}
};
H.getEl('overlay').on('click', closeModals);
H.getEl('cancel-delete').on('click', closeModals);
// end
var deleteBlog = function(e) {
if (document.getElementById('confirm-text').value != '{{.Alias}}') {
document.getElementById('delete-errors').innerHTML = '<li class="urgent">Enter <strong>{{.Alias}}</strong> in the box below.</li>';
return;
}
// Clear errors
document.getElementById('delete-errors').innerHTML = '';
document.getElementById('btn-delete').innerHTML = 'Deleting...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Alias}}?web=1";
http.open("DELETE", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
if (http.status == 204) {
window.location = '/me/c/';
} else {
var data = JSON.parse(http.responseText);
document.getElementById('delete-errors').innerHTML = '<li class="urgent">'+data.error_msg+'</li>';
document.getElementById('btn-delete').innerHTML = 'Delete';
}
}
};
http.send(null);
};
function createHidden(theForm, key, value) {
var input = document.createElement('input');
input.type = 'hidden';
input.name = key;
input.value = value;
theForm.appendChild(input);
}
function disableSubmit() {
var $form = document.forms['customize-form'];
createHidden($form, 'style_sheet', cssEditor.getSession().getValue());
var $btn = document.getElementById("save-changes");
$btn.value = "Saving changes...";
$btn.disabled = true;
return true;
}
function promptDelete() {
showModal("delete");
}
var $fediDomain = document.getElementById('fedi-domain');
var $fediCustomDomain = document.getElementById('fedi-custom-domain');
var $customDomain = document.getElementById('domain-alias');
var $customHandleEnv = document.getElementById('custom-handle-env');
var $normalHandleEnv = document.getElementById('normal-handle-env');
var opt = {
showLineNumbers: false,
showPrintMargin: 0,
};
var theme = "ace/theme/chrome";
var cssEditor = ace.edit("css-editor");
cssEditor.setTheme(theme);
cssEditor.session.setMode("ace/mode/css");
cssEditor.setOptions(opt);
</script>
{{template "footer" .}}
{{end}}

File Metadata

Mime Type
text/x-diff
Expires
Thu, Dec 4, 9:39 PM (19 h, 52 m)
Storage Engine
blob
Storage Format
Raw Data
Storage Handle
3523360

Event Timeline