Page MenuHomeMusing Studio

No OneTemporary

This file is larger than 256 KB, so syntax highlighting was skipped.
diff --git a/Makefile b/Makefile
index 9f9ae97..d925a8d 100644
--- a/Makefile
+++ b/Makefile
@@ -1,149 +1,149 @@
GITREV=`git describe | cut -c 2-`
LDFLAGS=-ldflags="-s -w -X 'github.com/writefreely/writefreely.softwareVer=$(GITREV)' -extldflags '-static'"
GOCMD=go
GOINSTALL=$(GOCMD) install $(LDFLAGS)
GOBUILD=$(GOCMD) build $(LDFLAGS)
GOTEST=$(GOCMD) test $(LDFLAGS)
GOGET=$(GOCMD) get
BINARY_NAME=writefreely
BUILDPATH=build/$(BINARY_NAME)
DOCKERCMD=docker
IMAGE_NAME=writeas/writefreely
TMPBIN=./tmp
all : build
ci: deps
cd cmd/writefreely; $(GOBUILD) -v
build: deps
cd cmd/writefreely; $(GOBUILD) -v -tags='netgo sqlite'
build-no-sqlite: deps-no-sqlite
cd cmd/writefreely; $(GOBUILD) -v -tags='netgo' -o $(BINARY_NAME)
build-linux: deps
@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
$(GOCMD) install src.techknowlogick.com/xgo@latest; \
fi
xgo --targets=linux/amd64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.21.x -out writefreely -pkg ./cmd/writefreely .
build-windows: deps
@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
$(GOCMD) install src.techknowlogick.com/xgo@latest; \
fi
xgo --targets=windows/amd64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.21.x -out writefreely -pkg ./cmd/writefreely .
build-darwin: deps
@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
$(GOCMD) install src.techknowlogick.com/xgo@latest; \
fi
xgo --targets=darwin/amd64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.21.x -out writefreely -pkg ./cmd/writefreely .
build-arm6: deps
@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
$(GOCMD) install src.techknowlogick.com/xgo@latest; \
fi
xgo --targets=linux/arm-6, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.21.x -out writefreely -pkg ./cmd/writefreely .
build-arm7: deps
@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
$(GOCMD) install src.techknowlogick.com/xgo@latest; \
fi
xgo --targets=linux/arm-7, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.21.x -out writefreely -pkg ./cmd/writefreely .
build-arm64: deps
@hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \
$(GOCMD) install src.techknowlogick.com/xgo@latest; \
fi
xgo --targets=linux/arm64, -dest build/ $(LDFLAGS) -tags='netgo sqlite' -go go-1.21.x -out writefreely -pkg ./cmd/writefreely .
build-docker :
$(DOCKERCMD) build -t $(IMAGE_NAME):latest -t $(IMAGE_NAME):$(GITREV) .
test:
$(GOTEST) -v ./...
run:
$(GOINSTALL) -tags='netgo sqlite' ./...
$(BINARY_NAME) --debug
deps :
$(GOGET) -tags='sqlite' -d -v ./...
deps-no-sqlite:
$(GOGET) -d -v ./...
install : build
cmd/writefreely/$(BINARY_NAME) --config
cmd/writefreely/$(BINARY_NAME) --gen-keys
cmd/writefreely/$(BINARY_NAME) --init-db
cd less/; $(MAKE) install $(MFLAGS)
release : clean ui
mkdir -p $(BUILDPATH)
- cp -r templates $(BUILDPATH)
- cp -r pages $(BUILDPATH)
- cp -r static $(BUILDPATH)
+ rsync -av --exclude=".*" templates $(BUILDPATH)
+ rsync -av --exclude=".*" pages $(BUILDPATH)
+ rsync -av --exclude=".*" static $(BUILDPATH)
rm -r $(BUILDPATH)/static/local
scripts/invalidate-css.sh $(BUILDPATH)
mkdir $(BUILDPATH)/keys
$(MAKE) build-linux
mv build/$(BINARY_NAME)-linux-amd64 $(BUILDPATH)/$(BINARY_NAME)
tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME)
rm $(BUILDPATH)/$(BINARY_NAME)
$(MAKE) build-arm6
mv build/$(BINARY_NAME)-linux-arm-6 $(BUILDPATH)/$(BINARY_NAME)
tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm6.tar.gz -C build $(BINARY_NAME)
rm $(BUILDPATH)/$(BINARY_NAME)
$(MAKE) build-arm7
mv build/$(BINARY_NAME)-linux-arm-7 $(BUILDPATH)/$(BINARY_NAME)
tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm7.tar.gz -C build $(BINARY_NAME)
rm $(BUILDPATH)/$(BINARY_NAME)
$(MAKE) build-arm64
mv build/$(BINARY_NAME)-linux-arm64 $(BUILDPATH)/$(BINARY_NAME)
tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm64.tar.gz -C build $(BINARY_NAME)
rm $(BUILDPATH)/$(BINARY_NAME)
$(MAKE) build-darwin
mv build/$(BINARY_NAME)-darwin-10.12-amd64 $(BUILDPATH)/$(BINARY_NAME)
tar -cvzf $(BINARY_NAME)_$(GITREV)_macos_amd64.tar.gz -C build $(BINARY_NAME)
rm $(BUILDPATH)/$(BINARY_NAME)
$(MAKE) build-windows
mv build/$(BINARY_NAME)-windows-4.0-amd64.exe $(BUILDPATH)/$(BINARY_NAME).exe
cd build; zip -r ../$(BINARY_NAME)_$(GITREV)_windows_amd64.zip ./$(BINARY_NAME)
rm $(BUILDPATH)/$(BINARY_NAME).exe
$(MAKE) build-docker
$(MAKE) release-docker
# This assumes you're on linux/amd64
release-linux : clean ui
mkdir -p $(BUILDPATH)
cp -r templates $(BUILDPATH)
cp -r pages $(BUILDPATH)
cp -r static $(BUILDPATH)
mkdir $(BUILDPATH)/keys
$(MAKE) build-no-sqlite
mv cmd/writefreely/$(BINARY_NAME) $(BUILDPATH)/$(BINARY_NAME)
tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME)
release-docker :
$(DOCKERCMD) push $(IMAGE_NAME)
ui : force_look
cd less/; $(MAKE) $(MFLAGS)
cd prose/; $(MAKE) $(MFLAGS)
$(TMPBIN):
mkdir -p $(TMPBIN)
$(TMPBIN)/xgo: deps $(TMPBIN)
$(GOBUILD) -o $(TMPBIN)/xgo src.techknowlogick.com/xgo
clean :
-rm -rf build
-rm -rf tmp
cd less/; $(MAKE) clean $(MFLAGS)
force_look :
true
diff --git a/README.md b/README.md
index 7831e57..afb4796 100644
--- a/README.md
+++ b/README.md
@@ -1,89 +1,90 @@
 
<p align="center">
<a href="https://writefreely.org"><img src="https://writefreely.org/img/writefreely.svg" width="350px" alt="WriteFreely" /></a>
</p>
<hr />
<p align="center">
<a href="https://github.com/writefreely/writefreely/releases/">
<img src="https://img.shields.io/github/release/writefreely/writefreely.svg" alt="Latest release" />
</a>
<a href="https://travis-ci.org/writeas/writefreely">
<img src="https://travis-ci.org/writefreely/writefreely.svg" alt="Build status" />
</a>
<a href="https://github.com/writefreely/writefreely/releases/latest">
<img src="https://img.shields.io/github/downloads/writefreely/writefreely/total.svg" />
</a>
<a href="https://goreportcard.com/report/github.com/writefreely/writefreely">
<img src="https://goreportcard.com/badge/github.com/writefreely/writefreely" alt="Go Report Card" />
</a>
<a href="https://hub.docker.com/r/writeas/writefreely/">
<img src="https://img.shields.io/docker/pulls/writeas/writefreely.svg" />
</a>
</p>
&nbsp;
WriteFreely is a clean, minimalist publishing platform made for writers. Start a blog, share knowledge within your organization, or build a community around the shared act of writing.
![](https://writefreely.org/img/screens/pencil-reader.png)
[Try the writing experience](https://write.as/new)
[Find an instance](https://writefreely.org/instances)
## Features
### Made for writing
Built on a plain, auto-saving editor, WriteFreely gives you a distraction-free writing environment. Once published, your words are front and center, and easy to read.
### A connected community
Start writing together, publicly or privately. Connect with other communities, whether running WriteFreely, [Plume](https://joinplu.me/), or other ActivityPub-powered software. And bring members on board from your existing platforms, thanks to our OAuth 2.0 support.
### Intuitive organization
Categorize articles [with hashtags](https://writefreely.org/docs/latest/writer/hashtags), and create static pages from normal posts by [_pinning_ them](https://writefreely.org/docs/latest/writer/static) to your blog. Create draft posts and publish to multiple blogs from one account.
### International
Blog elements are localized in 20+ languages, and WriteFreely includes first-class support for non-Latin and right-to-left (RTL) script languages.
### Private by default
WriteFreely collects minimal data, and never publicizes more than a writer consents to. Writers can seamlessly create multiple blogs from a single account for different pen names or purposes without publicly revealing their association.
<h2><a href="https://write.as/writefreely"><img src="https://writefreely.org/img/writeas-readme.png" height="32px" alt="Write.as" /></a></h2>
The quickest way to deploy WriteFreely is with [Write.as](https://write.as/writefreely), a hosted service from the team behind WriteFreely. You'll get fully-managed installation, backup, upgrades, and maintenance — and directly fund our free software work ❤️
[**Learn more on Write.as**](https://write.as/writefreely).
## Quick start
WriteFreely deploys as a static binary on any platform and architecture that Go supports. Just use our built-in SQLite support, or add a MySQL database, and you'll be up and running!
For common platforms, start with our [pre-built binaries](https://github.com/writefreely/writefreely/releases/) and head over to our [installation guide](https://writefreely.org/start) to get started.
### Packages
You can also find WriteFreely in these package repositories, thanks to our wonderful community!
* [Arch User Repository](https://aur.archlinux.org/packages/writefreely/)
+* [Nanos Repository](https://repo.ops.city/v2/packages/eyberg/writefreely/show)
## Documentation
Read our full [documentation on WriteFreely.org](https://writefreely.org/docs) &mdash;️ and help us improve by contributing to the [writefreely/documentation](https://github.com/writefreely/documentation) repo.
## Development
Start hacking on WriteFreely with our [developer setup guide](https://writefreely.org/docs/latest/developer/setup). For Docker support, see our [Docker guide](https://writefreely.org/docs/latest/admin/docker).
## Contributing
We gladly welcome contributions to WriteFreely, whether in the form of [code](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely), [bug reports](https://github.com/writefreely/writefreely/issues/new?template=bug_report.md), [feature requests](https://discuss.write.as/c/feedback/feature-requests), [translations](https://poeditor.com/join/project/TIZ6HFRFdE), or [documentation](https://github.com/writefreely/documentation) improvements.
Before contributing anything, please read our [Contributing Guide](https://github.com/writefreely/writefreely/blob/master/CONTRIBUTING.md#contributing-to-writefreely). It describes the correct channels for submitting contributions and any potential requirements.
## License
-Copyright © 2018-2022 [Musing Studio LLC](https://musing.studio) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE).
+Copyright © 2018-2025 [Musing Studio LLC](https://musing.studio) and contributing authors. Licensed under the [AGPL](https://github.com/writefreely/writefreely/blob/develop/LICENSE).
diff --git a/activitypub.go b/activitypub.go
index 6a3b0a1..f6f8792 100644
--- a/activitypub.go
+++ b/activitypub.go
@@ -1,969 +1,1157 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"bytes"
"crypto/sha256"
"database/sql"
"encoding/base64"
"encoding/json"
"fmt"
"io"
"net/http"
"net/http/httputil"
"net/url"
"path/filepath"
+ "regexp"
"strconv"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/writeas/activity/streams"
"github.com/writeas/activityserve"
"github.com/writeas/httpsig"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitypub"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/id"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/silobridge"
)
const (
// TODO: delete. don't use this!
apCustomHandleDefault = "blog"
apCacheTime = time.Minute
)
+var (
+ apCollectionPostIRIRegex = regexp.MustCompile("/api/collections/([a-z0-9\\-]+)/posts/([a-z0-9\\-]+)$")
+ apDraftPostIRIRegex = regexp.MustCompile("/api/posts/([a-z0-9\\-]+)$")
+)
+
var instanceColl *Collection
func initActivityPub(app *App) {
ur, _ := url.Parse(app.cfg.App.Host)
instanceColl = &Collection{
ID: 0,
Alias: ur.Host,
Title: ur.Host,
db: app.db,
hostName: app.cfg.App.Host,
}
}
type RemoteUser struct {
ID int64
ActorID string
Inbox string
SharedInbox string
URL string
Handle string
Created time.Time
}
func (ru *RemoteUser) CreatedFriendly() string {
return ru.Created.Format("January 2, 2006")
}
func (ru *RemoteUser) EstimatedHandle() string {
if ru.Handle != "" {
return ru.Handle
}
username := filepath.Base(ru.ActorID)
host, _ := url.Parse(ru.ActorID)
return username + "@" + host.Host
}
func (ru *RemoteUser) AsPerson() *activitystreams.Person {
return &activitystreams.Person{
BaseObject: activitystreams.BaseObject{
Type: "Person",
Context: []interface{}{
activitystreams.Namespace,
},
ID: ru.ActorID,
},
Inbox: ru.Inbox,
Endpoints: activitystreams.Endpoints{
SharedInbox: ru.SharedInbox,
},
}
}
func activityPubClient() *http.Client {
return &http.Client{
Timeout: 15 * time.Second,
}
}
func handleFetchCollectionActivities(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
if alias == "" {
alias = filepath.Base(r.RequestURI)
}
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if alias == r.Host {
c = instanceColl
} else if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
if !c.IsInstanceColl() {
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection activities: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
}
p := c.PersonObject()
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, p, http.StatusOK)
}
func handleFetchCollectionOutbox(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection outbox: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if app.cfg.App.SingleUser {
if alias != c.Alias {
return ErrCollectionNotFound
}
}
res := &CollectionObj{Collection: *c}
app.db.GetPostsCount(res, false)
accountRoot := c.FederatedAccount()
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "outbox", res.TotalPosts)
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "outbox", res.TotalPosts, p)
ocp.OrderedItems = []interface{}{}
- posts, err := app.db.GetPosts(app.cfg, c, p, false, true, false)
+ posts, err := app.db.GetPosts(app.cfg, c, p, false, true, false, "")
for _, pp := range *posts {
pp.Collection = res
o := pp.ActivityObject(app)
a := activitystreams.NewCreateActivity(o)
a.Context = nil
ocp.OrderedItems = append(ocp.OrderedItems, *a)
}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionFollowers(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection followers: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
accountRoot := c.FederatedAccount()
folls, err := app.db.GetAPFollowers(c)
if err != nil {
return err
}
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "followers", len(*folls))
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "followers", len(*folls), p)
ocp.OrderedItems = []interface{}{}
/*
for _, f := range *folls {
ocp.OrderedItems = append(ocp.OrderedItems, f.ActorID)
}
*/
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionFollowing(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: enforce visibility
// Get base Collection data
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection following: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
accountRoot := c.FederatedAccount()
page := r.FormValue("page")
p, err := strconv.Atoi(page)
if err != nil || p < 1 {
// Return outbox
oc := activitystreams.NewOrderedCollection(accountRoot, "following", 0)
return impart.RenderActivityJSON(w, oc, http.StatusOK)
}
// Return outbox page
ocp := activitystreams.NewOrderedCollectionPage(accountRoot, "following", 0, p)
ocp.OrderedItems = []interface{}{}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ocp, http.StatusOK)
}
func handleFetchCollectionInbox(app *App, w http.ResponseWriter, r *http.Request) error {
w.Header().Set("Server", serverSoftware)
vars := mux.Vars(r)
alias := vars["alias"]
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
// TODO: return Reject?
return err
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("fetch collection inbox: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if debugging {
dump, err := httputil.DumpRequest(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("Rec'd! %q", dump)
}
}
var m map[string]interface{}
if err := json.NewDecoder(r.Body).Decode(&m); err != nil {
return err
}
a := streams.NewAccept()
p := c.PersonObject()
var to *url.URL
- var isFollow, isUnfollow bool
+ var isFollow, isUnfollow, isLike, isUnlike bool
+ var likePostID, unlikePostID string
fullActor := &activitystreams.Person{}
var remoteUser *RemoteUser
res := &streams.Resolver{
+ LikeCallback: func(l *streams.Like) error {
+ isLike = true
+
+ // 1) Use the Like concrete type here
+ // 2) Errors are propagated to res.Deserialize call below
+ m["@context"] = []string{activitystreams.Namespace}
+ b, _ := json.Marshal(m)
+ if debugging {
+ log.Info("Like: %s", b)
+ }
+
+ _, likeID := l.GetId()
+ if likeID == nil {
+ log.Error("Didn't resolve Like ID")
+ }
+ if p := l.HasObject(0); p == streams.NoPresence {
+ return fmt.Errorf("no object for Like activity at index 0")
+ }
+
+ obj := l.Raw().GetObjectIRI(0)
+ /*
+ // TODO: handle this more robustly
+ l.ResolveObject(&streams.Resolver{
+ LinkCallback: func(link *streams.Link) error {
+ return nil
+ },
+ }, 0)
+ */
+
+ if obj == nil {
+ return fmt.Errorf("didn't get ObjectIRI to Like")
+ }
+ likePostID, err = parsePostIDFromURL(app, obj)
+ if err != nil {
+ return err
+ }
+
+ // Finally, get actor information
+ _, from := l.GetActor(0)
+ if from == nil {
+ return fmt.Errorf("No valid actor string")
+ }
+ fullActor, remoteUser, err = getActor(app, from.String())
+ if err != nil {
+ return err
+ }
+ return nil
+ },
FollowCallback: func(f *streams.Follow) error {
isFollow = true
// 1) Use the Follow concrete type here
// 2) Errors are propagated to res.Deserialize call below
m["@context"] = []string{activitystreams.Namespace}
b, _ := json.Marshal(m)
if debugging {
log.Info("Follow: %s", b)
}
_, followID := f.GetId()
if followID == nil {
log.Error("Didn't resolve follow ID")
} else {
aID := c.FederatedAccount() + "#accept-" + id.GenerateFriendlyRandomString(20)
acceptID, err := url.Parse(aID)
if err != nil {
log.Error("Couldn't parse generated Accept URL '%s': %v", aID, err)
}
a.SetId(acceptID)
}
a.AppendObject(f.Raw())
_, to = f.GetActor(0)
obj := f.Raw().GetObjectIRI(0)
a.AppendActor(obj)
// First get actor information
if to == nil {
return fmt.Errorf("No valid `to` string")
}
fullActor, remoteUser, err = getActor(app, to.String())
if err != nil {
return err
}
return impart.RenderActivityJSON(w, m, http.StatusOK)
},
UndoCallback: func(u *streams.Undo) error {
- isUnfollow = true
-
m["@context"] = []string{activitystreams.Namespace}
b, _ := json.Marshal(m)
if debugging {
log.Info("Undo: %s", b)
}
a.AppendObject(u.Raw())
+
+ // Check type -- we handle Undo:Like and Undo:Follow
+ _, err := u.ResolveObject(&streams.Resolver{
+ LikeCallback: func(like *streams.Like) error {
+ isUnlike = true
+
+ _, from := like.GetActor(0)
+ obj := like.Raw().GetObjectIRI(0)
+ if obj == nil {
+ return fmt.Errorf("didn't get ObjectIRI for Undo Like")
+ }
+ unlikePostID, err = parsePostIDFromURL(app, obj)
+ if err != nil {
+ return err
+ }
+ fullActor, remoteUser, err = getActor(app, from.String())
+ if err != nil {
+ return err
+ }
+ return nil
+ },
+ // TODO: add FollowCallback for more robust handling
+ }, 0)
+ if err != nil {
+ return err
+ }
+ if isUnlike {
+ return nil
+ }
+
+ isUnfollow = true
_, to = u.GetActor(0)
// TODO: get actor from object.object, not object
obj := u.Raw().GetObjectIRI(0)
a.AppendActor(obj)
if to != nil {
// Populate fullActor from DB?
remoteUser, err = getRemoteUser(app, to.String())
if err != nil {
if iErr, ok := err.(*impart.HTTPError); ok {
if iErr.Status == http.StatusNotFound {
log.Error("No remoteuser info for Undo event!")
}
}
return err
} else {
fullActor = remoteUser.AsPerson()
}
} else {
log.Error("No to on Undo!")
}
return impart.RenderActivityJSON(w, m, http.StatusOK)
},
}
if err := res.Deserialize(m); err != nil {
// 3) Any errors from #2 can be handled, or the payload is an unknown type.
log.Error("Unable to resolve Follow: %v", err)
if debugging {
log.Error("Map: %s", m)
}
return err
}
+ // Handle synchronous activities
+ if isLike {
+ t, err := app.db.Begin()
+ if err != nil {
+ log.Error("Unable to start transaction: %v", err)
+ return fmt.Errorf("unable to start transaction: %v", err)
+ }
+
+ var remoteUserID int64
+ if remoteUser != nil {
+ remoteUserID = remoteUser.ID
+ } else {
+ remoteUserID, err = apAddRemoteUser(app, t, fullActor)
+ }
+
+ // Add like
+ _, err = t.Exec("INSERT INTO remote_likes (post_id, remote_user_id, created) VALUES (?, ?, "+app.db.now()+")", likePostID, remoteUserID)
+ if err != nil {
+ if !app.db.isDuplicateKeyErr(err) {
+ t.Rollback()
+ log.Error("Couldn't add like in DB: %v\n", err)
+ return fmt.Errorf("Couldn't add like in DB: %v", err)
+ } else {
+ t.Rollback()
+ log.Error("Couldn't add like in DB: %v\n", err)
+ return fmt.Errorf("Couldn't add like in DB: %v", err)
+ }
+ }
+
+ err = t.Commit()
+ if err != nil {
+ t.Rollback()
+ log.Error("Rolling back after Commit(): %v\n", err)
+ return fmt.Errorf("Rolling back after Commit(): %v\n", err)
+ }
+
+ if debugging {
+ log.Info("Successfully liked post %s by remote user %s", likePostID, remoteUser.URL)
+ }
+ return impart.RenderActivityJSON(w, "", http.StatusOK)
+ } else if isUnlike {
+ t, err := app.db.Begin()
+ if err != nil {
+ log.Error("Unable to start transaction: %v", err)
+ return fmt.Errorf("unable to start transaction: %v", err)
+ }
+
+ var remoteUserID int64
+ if remoteUser != nil {
+ remoteUserID = remoteUser.ID
+ } else {
+ remoteUserID, err = apAddRemoteUser(app, t, fullActor)
+ }
+
+ // Remove like
+ _, err = t.Exec("DELETE FROM remote_likes WHERE post_id = ? AND remote_user_id = ?", unlikePostID, remoteUserID)
+ if err != nil {
+ t.Rollback()
+ log.Error("Couldn't delete Like from DB: %v\n", err)
+ return fmt.Errorf("Couldn't delete Like from DB: %v", err)
+ }
+
+ err = t.Commit()
+ if err != nil {
+ t.Rollback()
+ log.Error("Rolling back after Commit(): %v\n", err)
+ return fmt.Errorf("Rolling back after Commit(): %v\n", err)
+ }
+
+ if debugging {
+ log.Info("Successfully un-liked post %s by remote user %s", unlikePostID, remoteUser.URL)
+ }
+ return impart.RenderActivityJSON(w, "", http.StatusOK)
+ }
+
go func() {
if to == nil {
if debugging {
log.Error("No `to` value!")
}
return
}
time.Sleep(2 * time.Second)
am, err := a.Serialize()
if err != nil {
log.Error("Unable to serialize Accept: %v", err)
return
}
am["@context"] = []string{activitystreams.Namespace}
err = makeActivityPost(app.cfg.App.Host, p, fullActor.Inbox, am)
if err != nil {
log.Error("Unable to make activity POST: %v", err)
return
}
if isFollow {
t, err := app.db.Begin()
if err != nil {
log.Error("Unable to start transaction: %v", err)
return
}
var followerID int64
if remoteUser != nil {
followerID = remoteUser.ID
} else {
+ // TODO: use apAddRemoteUser() here, instead!
// Add follower locally, since it wasn't found before
res, err := t.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, url) VALUES (?, ?, ?, ?)", fullActor.ID, fullActor.Inbox, fullActor.Endpoints.SharedInbox, fullActor.URL)
if err != nil {
// if duplicate key, res will be nil and panic on
// res.LastInsertId below
t.Rollback()
log.Error("Couldn't add new remoteuser in DB: %v\n", err)
return
}
followerID, err = res.LastInsertId()
if err != nil {
t.Rollback()
log.Error("no lastinsertid for followers, rolling back: %v", err)
return
}
// Add in key
_, err = t.Exec("INSERT INTO remoteuserkeys (id, remote_user_id, public_key) VALUES (?, ?, ?)", fullActor.PublicKey.ID, followerID, fullActor.PublicKey.PublicKeyPEM)
if err != nil {
if !app.db.isDuplicateKeyErr(err) {
t.Rollback()
log.Error("Couldn't add follower keys in DB: %v\n", err)
return
}
}
}
// Add follow
_, err = t.Exec("INSERT INTO remotefollows (collection_id, remote_user_id, created) VALUES (?, ?, "+app.db.now()+")", c.ID, followerID)
if err != nil {
if !app.db.isDuplicateKeyErr(err) {
t.Rollback()
log.Error("Couldn't add follower in DB: %v\n", err)
return
}
}
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return
}
} else if isUnfollow {
// Remove follower locally
_, err = app.db.Exec("DELETE FROM remotefollows WHERE collection_id = ? AND remote_user_id = (SELECT id FROM remoteusers WHERE actor_id = ?)", c.ID, to.String())
if err != nil {
log.Error("Couldn't remove follower from DB: %v\n", err)
}
}
}()
return nil
}
func makeActivityPost(hostName string, p *activitystreams.Person, url string, m interface{}) error {
log.Info("POST %s", url)
b, err := json.Marshal(m)
if err != nil {
return err
}
r, _ := http.NewRequest("POST", url, bytes.NewBuffer(b))
r.Header.Add("Content-Type", "application/activity+json")
r.Header.Set("User-Agent", ServerUserAgent(hostName))
h := sha256.New()
h.Write(b)
r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil)))
// Sign using the 'Signature' header
privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey())
if err != nil {
return err
}
signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"})
err = signer.SignSigHeader(r)
if err != nil {
log.Error("Can't sign: %v", err)
}
if debugging {
dump, err := httputil.DumpRequestOut(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("%s", dump)
}
}
resp, err := activityPubClient().Do(r)
if err != nil {
return err
}
if resp != nil && resp.Body != nil {
defer resp.Body.Close()
}
body, err := io.ReadAll(resp.Body)
if err != nil {
return err
}
if debugging {
log.Info("Status : %s", resp.Status)
log.Info("Response: %s", body)
}
return nil
}
func resolveIRI(hostName, url string) ([]byte, error) {
log.Info("GET %s", url)
r, _ := http.NewRequest("GET", url, nil)
r.Header.Add("Accept", "application/activity+json")
r.Header.Set("User-Agent", ServerUserAgent(hostName))
p := instanceColl.PersonObject()
h := sha256.New()
h.Write([]byte{})
r.Header.Add("Digest", "SHA-256="+base64.StdEncoding.EncodeToString(h.Sum(nil)))
// Sign using the 'Signature' header
privKey, err := activitypub.DecodePrivateKey(p.GetPrivKey())
if err != nil {
return nil, err
}
signer := httpsig.NewSigner(p.PublicKey.ID, privKey, httpsig.RSASHA256, []string{"(request-target)", "date", "host", "digest"})
err = signer.SignSigHeader(r)
if err != nil {
log.Error("Can't sign: %v", err)
}
if debugging {
dump, err := httputil.DumpRequestOut(r, true)
if err != nil {
log.Error("Can't dump: %v", err)
} else {
log.Info("%s", dump)
}
}
resp, err := activityPubClient().Do(r)
if err != nil {
return nil, err
}
if resp != nil && resp.Body != nil {
defer resp.Body.Close()
}
body, err := io.ReadAll(resp.Body)
if err != nil {
return nil, err
}
if debugging {
log.Info("Status : %s", resp.Status)
log.Info("Response: %s", body)
}
return body, nil
}
func deleteFederatedPost(app *App, p *PublicPost, collID int64) error {
if debugging {
log.Info("Deleting federated post!")
}
p.Collection.hostName = app.cfg.App.Host
actor := p.Collection.PersonObject(collID)
na := p.ActivityObject(app)
// Add followers
p.Collection.ID = collID
followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
if err != nil {
log.Error("Couldn't delete post (get followers)! %v", err)
return err
}
inboxes := map[string][]string{}
for _, f := range *followers {
inbox := f.SharedInbox
if inbox == "" {
inbox = f.Inbox
}
if _, ok := inboxes[inbox]; ok {
inboxes[inbox] = append(inboxes[inbox], f.ActorID)
} else {
inboxes[inbox] = []string{f.ActorID}
}
}
for si, instFolls := range inboxes {
na.CC = []string{}
na.CC = append(na.CC, instFolls...)
da := activitystreams.NewDeleteActivity(na)
// Make the ID unique to ensure it works in Pleroma
// See: https://git.pleroma.social/pleroma/pleroma/issues/1481
da.ID += "#Delete"
err = makeActivityPost(app.cfg.App.Host, actor, si, da)
if err != nil {
log.Error("Couldn't delete post! %v", err)
}
}
return nil
}
func federatePost(app *App, p *PublicPost, collID int64, isUpdate bool) error {
// If app is private, do not federate
if app.cfg.App.Private {
return nil
}
// Do not federate posts from private or protected blogs
if p.Collection.Visibility == CollPrivate || p.Collection.Visibility == CollProtected {
return nil
}
if debugging {
if isUpdate {
log.Info("Federating updated post!")
} else {
log.Info("Federating new post!")
}
}
actor := p.Collection.PersonObject(collID)
na := p.ActivityObject(app)
// Add followers
p.Collection.ID = collID
followers, err := app.db.GetAPFollowers(&p.Collection.Collection)
if err != nil {
log.Error("Couldn't post! %v", err)
return err
}
log.Info("Followers for %d: %+v", collID, followers)
inboxes := map[string][]string{}
for _, f := range *followers {
inbox := f.SharedInbox
if inbox == "" {
inbox = f.Inbox
}
if _, ok := inboxes[inbox]; ok {
// check if we're already sending to this shared inbox
inboxes[inbox] = append(inboxes[inbox], f.ActorID)
} else {
// add the new shared inbox to the list
inboxes[inbox] = []string{f.ActorID}
}
}
var activity *activitystreams.Activity
// for each one of the shared inboxes
for si, instFolls := range inboxes {
// add all followers from that instance
// to the CC field
na.CC = []string{}
na.CC = append(na.CC, instFolls...)
// create a new "Create" activity
// with our article as object
if isUpdate {
na.Updated = &p.Updated
activity = activitystreams.NewUpdateActivity(na)
} else {
activity = activitystreams.NewCreateActivity(na)
activity.To = na.To
activity.CC = na.CC
}
// and post it to that sharedInbox
err = makeActivityPost(app.cfg.App.Host, actor, si, activity)
if err != nil {
log.Error("Couldn't post! %v", err)
}
}
// re-create the object so that the CC list gets reset and has
// the mentioned users. This might seem wasteful but the code is
// cleaner than adding the mentioned users to CC here instead of
// in p.ActivityObject()
na = p.ActivityObject(app)
for _, tag := range na.Tag {
if tag.Type == "Mention" {
activity = activitystreams.NewCreateActivity(na)
activity.To = na.To
activity.CC = na.CC
// This here might be redundant in some cases as we might have already
// sent this to the sharedInbox of this instance above, but we need too
// much logic to catch this at the expense of the odd extra request.
// I don't believe we'd ever have too many mentions in a single post that this
// could become a burden.
remoteUser, err := getRemoteUser(app, tag.HRef)
if err != nil {
log.Error("Unable to find remote user %s. Skipping: %v", tag.HRef, err)
continue
}
err = makeActivityPost(app.cfg.App.Host, actor, remoteUser.Inbox, activity)
if err != nil {
log.Error("Couldn't post! %v", err)
}
}
}
return nil
}
func getRemoteUser(app *App, actorID string) (*RemoteUser, error) {
u := RemoteUser{ActorID: actorID}
var urlVal, handle sql.NullString
err := app.db.QueryRow("SELECT id, inbox, shared_inbox, url, handle FROM remoteusers WHERE actor_id = ?", actorID).Scan(&u.ID, &u.Inbox, &u.SharedInbox, &urlVal, &handle)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "No remote user with that ID."}
case err != nil:
log.Error("Couldn't get remote user %s: %v", actorID, err)
return nil, err
}
u.URL = urlVal.String
u.Handle = handle.String
return &u, nil
}
// getRemoteUserFromHandle retrieves the profile page of a remote user
// from the @user@server.tld handle
func getRemoteUserFromHandle(app *App, handle string) (*RemoteUser, error) {
u := RemoteUser{Handle: handle}
var urlVal sql.NullString
err := app.db.QueryRow("SELECT id, actor_id, inbox, shared_inbox, url FROM remoteusers WHERE handle = ?", handle).Scan(&u.ID, &u.ActorID, &u.Inbox, &u.SharedInbox, &urlVal)
switch {
case err == sql.ErrNoRows:
return nil, ErrRemoteUserNotFound
case err != nil:
log.Error("Couldn't get remote user %s: %v", handle, err)
return nil, err
}
u.URL = urlVal.String
return &u, nil
}
func getActor(app *App, actorIRI string) (*activitystreams.Person, *RemoteUser, error) {
log.Info("Fetching actor %s locally", actorIRI)
actor := &activitystreams.Person{}
remoteUser, err := getRemoteUser(app, actorIRI)
if err != nil {
if iErr, ok := err.(impart.HTTPError); ok {
if iErr.Status == http.StatusNotFound {
// Fetch remote actor
log.Info("Not found; fetching actor %s remotely", actorIRI)
actorResp, err := resolveIRI(app.cfg.App.Host, actorIRI)
if err != nil {
log.Error("Unable to get base actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't fetch actor."}
}
if err := unmarshalActor(actorResp, actor); err != nil {
log.Error("Unable to unmarshal base actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't parse actor."}
}
baseActor := &activitystreams.Person{}
if err := unmarshalActor(actorResp, baseActor); err != nil {
log.Error("Unable to unmarshal actual actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't parse actual actor."}
}
// Fetch the actual actor using the owner field from the publicKey object
actualActorResp, err := resolveIRI(app.cfg.App.Host, baseActor.PublicKey.Owner)
if err != nil {
log.Error("Unable to get actual actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't fetch actual actor."}
}
if err := unmarshalActor(actualActorResp, actor); err != nil {
log.Error("Unable to unmarshal actual actor! %v", err)
return nil, nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't parse actual actor."}
}
} else {
return nil, nil, err
}
} else {
return nil, nil, err
}
} else {
actor = remoteUser.AsPerson()
}
return actor, remoteUser, nil
}
func GetProfileURLFromHandle(app *App, handle string) (string, error) {
handle = strings.TrimLeft(handle, "@")
actorIRI := ""
parts := strings.Split(handle, "@")
if len(parts) != 2 {
return "", fmt.Errorf("invalid handle format")
}
domain := parts[1]
// Check non-AP instances
if siloProfileURL := silobridge.Profile(parts[0], domain); siloProfileURL != "" {
return siloProfileURL, nil
}
remoteUser, err := getRemoteUserFromHandle(app, handle)
if err != nil {
// can't find using handle in the table but the table may already have this user without
// handle from a previous version
// TODO: Make this determination. We should know whether a user exists without a handle, or doesn't exist at all
actorIRI = RemoteLookup(handle)
_, errRemoteUser := getRemoteUser(app, actorIRI)
// if it exists then we need to update the handle
if errRemoteUser == nil {
_, err := app.db.Exec("UPDATE remoteusers SET handle = ? WHERE actor_id = ?", handle, actorIRI)
if err != nil {
log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI)
}
} else {
// this probably means we don't have the user in the table so let's try to insert it
// here we need to ask the server for the inboxes
remoteActor, err := activityserve.NewRemoteActor(actorIRI)
if err != nil {
log.Error("Couldn't fetch remote actor: %v", err)
}
if debugging {
log.Info("Got remote actor: %s %s %s %s %s", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), remoteActor.URL(), handle)
}
_, err = app.db.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, url, handle) VALUES(?, ?, ?, ?, ?)", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), remoteActor.URL(), handle)
if err != nil {
log.Error("Couldn't insert remote user: %v", err)
return "", err
}
actorIRI = remoteActor.URL()
}
} else if remoteUser.URL == "" {
log.Info("Remote user %s URL empty, fetching", remoteUser.ActorID)
newRemoteActor, err := activityserve.NewRemoteActor(remoteUser.ActorID)
if err != nil {
log.Error("Couldn't fetch remote actor: %v", err)
} else {
_, err := app.db.Exec("UPDATE remoteusers SET url = ? WHERE actor_id = ?", newRemoteActor.URL(), remoteUser.ActorID)
if err != nil {
log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI)
} else {
actorIRI = newRemoteActor.URL()
}
}
} else {
actorIRI = remoteUser.URL
}
return actorIRI, nil
}
// unmarshal actor normalizes the actor response to conform to
// the type Person from github.com/writeas/web-core/activitysteams
//
// some implementations return different context field types
// this converts any non-slice contexts into a slice
func unmarshalActor(actorResp []byte, actor *activitystreams.Person) error {
// FIXME: Hubzilla has an object for the Actor's url: cannot unmarshal object into Go struct field Person.url of type string
// flexActor overrides the Context field to allow
// all valid representations during unmarshal
flexActor := struct {
activitystreams.Person
Context json.RawMessage `json:"@context,omitempty"`
}{}
if err := json.Unmarshal(actorResp, &flexActor); err != nil {
return err
}
actor.Endpoints = flexActor.Endpoints
actor.Followers = flexActor.Followers
actor.Following = flexActor.Following
actor.ID = flexActor.ID
actor.Icon = flexActor.Icon
actor.Inbox = flexActor.Inbox
actor.Name = flexActor.Name
actor.Outbox = flexActor.Outbox
actor.PreferredUsername = flexActor.PreferredUsername
actor.PublicKey = flexActor.PublicKey
actor.Summary = flexActor.Summary
actor.Type = flexActor.Type
actor.URL = flexActor.URL
func(val interface{}) {
switch val.(type) {
case []interface{}:
// already a slice, do nothing
actor.Context = val.([]interface{})
default:
actor.Context = []interface{}{val}
}
}(flexActor.Context)
return nil
}
+func parsePostIDFromURL(app *App, u *url.URL) (string, error) {
+ // Get post ID from URL
+ var collAlias, slug, postID string
+ if m := apCollectionPostIRIRegex.FindStringSubmatch(u.String()); len(m) == 3 {
+ collAlias = m[1]
+ slug = m[2]
+ } else if m = apDraftPostIRIRegex.FindStringSubmatch(u.String()); len(m) == 2 {
+ postID = m[1]
+ } else {
+ return "", fmt.Errorf("unable to match objectIRI: %s", u)
+ }
+
+ // Get postID if all we have is collection and slug
+ if collAlias != "" && slug != "" {
+ c, err := app.db.GetCollection(collAlias)
+ if err != nil {
+ return "", err
+ }
+ p, err := app.db.GetPost(slug, c.ID)
+ if err != nil {
+ return "", err
+ }
+ postID = p.ID
+ }
+
+ return postID, nil
+}
+
func setCacheControl(w http.ResponseWriter, ttl time.Duration) {
w.Header().Set("Cache-Control", fmt.Sprintf("public, max-age=%.0f", ttl.Seconds()))
}
diff --git a/admin.go b/admin.go
index 258d0b8..6e0f3d5 100644
--- a/admin.go
+++ b/admin.go
@@ -1,693 +1,693 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"fmt"
"html/template"
"net/http"
"runtime"
"strconv"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/passgen"
"github.com/writefreely/writefreely/appstats"
"github.com/writefreely/writefreely/config"
)
var (
appStartTime = time.Now()
sysStatus systemStatus
)
const adminUsersPerPage = 30
type systemStatus struct {
Uptime string
NumGoroutine int
// General statistics.
MemAllocated string // bytes allocated and still in use
MemTotal string // bytes allocated (even if freed)
MemSys string // bytes obtained from system (sum of XxxSys below)
Lookups uint64 // number of pointer lookups
MemMallocs uint64 // number of mallocs
MemFrees uint64 // number of frees
// Main allocation heap statistics.
HeapAlloc string // bytes allocated and still in use
HeapSys string // bytes obtained from system
HeapIdle string // bytes in idle spans
HeapInuse string // bytes in non-idle span
HeapReleased string // bytes released to the OS
HeapObjects uint64 // total number of allocated objects
// Low-level fixed-size structure allocator statistics.
// Inuse is bytes used now.
// Sys is bytes obtained from system.
StackInuse string // bootstrap stacks
StackSys string
MSpanInuse string // mspan structures
MSpanSys string
MCacheInuse string // mcache structures
MCacheSys string
BuckHashSys string // profiling bucket hash table
GCSys string // GC metadata
OtherSys string // other system allocations
// Garbage collector statistics.
NextGC string // next run in HeapAlloc time (bytes)
LastGC string // last run in absolute time (ns)
PauseTotalNs string
PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256]
NumGC uint32
}
type inspectedCollection struct {
CollectionObj
Followers int
LastPost string
}
type instanceContent struct {
ID string
Type string
Title sql.NullString
Content string
Updated time.Time
}
type AdminPage struct {
UpdateAvailable bool
}
func NewAdminPage(app *App) *AdminPage {
ap := &AdminPage{}
if app.updates != nil {
ap.UpdateAvailable = app.updates.AreAvailableNoCheck()
}
return ap
}
func (c instanceContent) UpdatedFriendly() template.HTML {
/*
// TODO: accept a locale in this method and use that for the format
var loc monday.Locale = monday.LocaleEnUS
return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc)
*/
if c.Updated.IsZero() {
return "<em>Never</em>"
}
return template.HTML(c.Updated.Format("January 2, 2006, 3:04 PM"))
}
func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Message string
UsersCount, CollectionsCount, PostsCount int64
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
Message: r.FormValue("m"),
}
// Get user stats
p.UsersCount = app.db.GetAllUsersCount()
var err error
p.CollectionsCount, err = app.db.GetTotalCollections()
if err != nil {
return err
}
p.PostsCount, err = app.db.GetTotalPosts()
if err != nil {
return err
}
showUserPage(w, "admin", p)
return nil
}
func handleViewAdminMonitor(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
updateAppStats()
p := struct {
*UserPage
*AdminPage
SysStatus systemStatus
Config config.AppCfg
Message, ConfigMessage string
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
SysStatus: sysStatus,
Config: app.cfg.App,
Message: r.FormValue("m"),
ConfigMessage: r.FormValue("cm"),
}
showUserPage(w, "monitor", p)
return nil
}
func handleViewAdminSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message, ConfigMessage string
}{
UserPage: NewUserPage(app, r, u, "Admin", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
ConfigMessage: r.FormValue("cm"),
}
showUserPage(w, "app-settings", p)
return nil
}
func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Flashes []string
Users *[]User
CurPage int
TotalUsers int64
TotalPages []int
}{
UserPage: NewUserPage(app, r, u, "Users", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
p.Flashes, _ = getSessionFlashes(app, w, r, nil)
p.TotalUsers = app.db.GetAllUsersCount()
- ttlPages := p.TotalUsers / adminUsersPerPage
+ ttlPages := (p.TotalUsers - 1) / adminUsersPerPage + 1
p.TotalPages = []int{}
for i := 1; i <= int(ttlPages); i++ {
p.TotalPages = append(p.TotalPages, i)
}
var err error
p.CurPage, err = strconv.Atoi(r.FormValue("p"))
if err != nil || p.CurPage < 1 {
p.CurPage = 1
} else if p.CurPage > int(ttlPages) {
p.CurPage = int(ttlPages)
}
p.Users, err = app.db.GetAllUsers(uint(p.CurPage))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)}
}
showUserPage(w, "users", p)
return nil
}
func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
User *User
Colls []inspectedCollection
LastPost string
NewPassword string
TotalPosts int64
ClearEmail string
}{
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
Colls: []inspectedCollection{},
}
var err error
p.User, err = app.db.GetUserForAuth(username)
if err != nil {
if err == ErrUserNotFound {
return err
}
log.Error("Could not get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, err.Error()}
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
if strings.HasPrefix(flash, "SUCCESS: ") {
p.NewPassword = strings.TrimPrefix(flash, "SUCCESS: ")
p.ClearEmail = p.User.EmailClear(app.keys)
}
}
p.UserPage = NewUserPage(app, r, u, p.User.Username, nil)
p.TotalPosts = app.db.GetUserPostsCount(p.User.ID)
lp, err := app.db.GetUserLastPostTime(p.User.ID)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)}
}
if lp != nil {
p.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
colls, err := app.db.GetCollections(p.User, app.cfg.App.Host)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)}
}
for _, c := range *colls {
ic := inspectedCollection{
CollectionObj: CollectionObj{Collection: c},
}
if app.cfg.App.Federation {
folls, err := app.db.GetAPFollowers(&c)
if err == nil {
// TODO: handle error here (at least log it)
ic.Followers = len(*folls)
}
}
app.db.GetPostsCount(&ic.CollectionObj, true)
lp, err := app.db.GetCollectionLastPostTime(c.ID)
if err != nil {
log.Error("Didn't get last post time for collection %d: %v", c.ID, err)
}
if lp != nil {
ic.LastPost = lp.Format("January 2, 2006, 3:04 PM")
}
p.Colls = append(p.Colls, ic)
}
showUserPage(w, "view-user", p)
return nil
}
func handleAdminDeleteUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
if !u.IsAdmin() {
return impart.HTTPError{http.StatusForbidden, "Administrator privileges required for this action"}
}
vars := mux.Vars(r)
username := vars["username"]
confirmUsername := r.PostFormValue("confirm-username")
if confirmUsername != username {
return impart.HTTPError{http.StatusBadRequest, "Username was not confirmed"}
}
user, err := app.db.GetUserForAuth(username)
if err == ErrUserNotFound {
return impart.HTTPError{http.StatusNotFound, fmt.Sprintf("User '%s' was not found", username)}
} else if err != nil {
log.Error("get user for deletion: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user with username '%s': %v", username, err)}
}
err = app.db.DeleteAccount(user.ID)
if err != nil {
log.Error("delete user %s: %v", user.Username, err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not delete user account for '%s': %v", username, err)}
}
_ = addSessionFlash(app, w, r, fmt.Sprintf("User \"%s\" was deleted successfully.", username), nil)
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
func handleAdminToggleUserStatus(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
user, err := app.db.GetUserForAuth(username)
if err != nil {
log.Error("failed to get user: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user from username: %v", err)}
}
if user.IsSilenced() {
err = app.db.SetUserStatus(user.ID, UserActive)
} else {
err = app.db.SetUserStatus(user.ID, UserSilenced)
// reset the cache to removed silence user posts
updateTimelineCache(app.timeline, true)
}
if err != nil {
log.Error("toggle user silenced: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not toggle user status: %v", err)}
}
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s#status", username)}
}
func handleAdminResetUserPass(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
username := vars["username"]
if username == "" {
return impart.HTTPError{http.StatusFound, "/admin/users"}
}
// Generate new random password since none supplied
pass := passgen.NewWordish()
hashedPass, err := auth.HashPass([]byte(pass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
userIDVal := r.FormValue("user")
log.Info("ADMIN: Changing user %s password", userIDVal)
id, err := strconv.Atoi(userIDVal)
if err != nil {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid user ID: %v", err)}
}
err = app.db.ChangePassphrase(int64(id), true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
log.Info("ADMIN: Successfully changed.")
addSessionFlash(app, w, r, fmt.Sprintf("SUCCESS: %s", pass), nil)
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/admin/user/%s", username)}
}
func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Pages []*instanceContent
}{
UserPage: NewUserPage(app, r, u, "Pages", nil),
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
p.Pages, err = app.db.GetInstancePages()
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)}
}
// Add in default pages
var hasAbout, hasContact, hasPrivacy bool
for i, c := range p.Pages {
if hasAbout && hasContact && hasPrivacy {
break
}
if c.ID == "about" {
hasAbout = true
if !c.Title.Valid {
p.Pages[i].Title = defaultAboutTitle(app.cfg)
}
} else if c.ID == "contact" {
hasContact = true
if !c.Title.Valid {
p.Pages[i].Title = defaultContactTitle()
}
} else if c.ID == "privacy" {
hasPrivacy = true
if !c.Title.Valid {
p.Pages[i].Title = defaultPrivacyTitle()
}
}
}
if !hasAbout {
p.Pages = append(p.Pages, &instanceContent{
ID: "about",
Title: defaultAboutTitle(app.cfg),
Content: defaultAboutPage(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
if !hasContact {
p.Pages = append(p.Pages, &instanceContent{
ID: "contact",
Title: defaultContactTitle(),
Content: defaultContactPage(app),
})
}
if !hasPrivacy {
p.Pages = append(p.Pages, &instanceContent{
ID: "privacy",
Title: defaultPrivacyTitle(),
Content: defaultPrivacyPolicy(app.cfg),
Updated: defaultPageUpdatedTime,
})
}
showUserPage(w, "pages", p)
return nil
}
func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
if slug == "" {
return impart.HTTPError{http.StatusFound, "/admin/pages"}
}
p := struct {
*UserPage
*AdminPage
Config config.AppCfg
Message string
Banner *instanceContent
Content *instanceContent
}{
AdminPage: NewAdminPage(app),
Config: app.cfg.App,
Message: r.FormValue("m"),
}
var err error
// Get pre-defined pages, or select slug
if slug == "about" {
p.Content, err = getAboutPage(app)
} else if slug == "contact" {
p.Content, err = getContactPage(app)
} else if slug == "privacy" {
p.Content, err = getPrivacyPage(app)
} else if slug == "landing" {
p.Banner, err = getLandingBanner(app)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
}
p.Content, err = getLandingBody(app)
p.Content.ID = "landing"
} else if slug == "reader" {
p.Content, err = getReaderSection(app)
} else {
p.Content, err = app.db.GetDynamicContent(slug)
}
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)}
}
title := "New page"
if p.Content != nil {
title = "Edit " + p.Content.ID
} else {
p.Content = &instanceContent{}
}
p.UserPage = NewUserPage(app, r, u, title, nil)
showUserPage(w, "view-page", p)
return nil
}
func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
id := vars["page"]
// Validate
if id != "about" && id != "contact" && id != "privacy" && id != "landing" && id != "reader" {
return impart.HTTPError{http.StatusNotFound, "No such page."}
}
var err error
m := ""
if id == "landing" {
// Handle special landing page
err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section")
if err != nil {
m = "?m=" + err.Error()
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section")
} else if id == "reader" {
// Update sections with titles
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section")
} else {
// Update page
err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page")
}
if err != nil {
m = "?m=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m}
}
func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error {
apper.App().cfg.App.SiteName = r.FormValue("site_name")
apper.App().cfg.App.SiteDesc = r.FormValue("site_desc")
apper.App().cfg.App.Landing = r.FormValue("landing")
apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on"
apper.App().cfg.App.OpenDeletion = r.FormValue("open_deletion") == "on"
mul, err := strconv.Atoi(r.FormValue("min_username_len"))
if err == nil {
apper.App().cfg.App.MinUsernameLen = mul
}
mb, err := strconv.Atoi(r.FormValue("max_blogs"))
if err == nil {
apper.App().cfg.App.MaxBlogs = mb
}
apper.App().cfg.App.Federation = r.FormValue("federation") == "on"
apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on"
apper.App().cfg.App.Monetization = r.FormValue("monetization") == "on"
apper.App().cfg.App.Private = r.FormValue("private") == "on"
apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on"
if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil {
log.Info("Initializing local timeline...")
initLocalTimeline(apper.App())
}
apper.App().cfg.App.UserInvites = r.FormValue("user_invites")
if apper.App().cfg.App.UserInvites == "none" {
apper.App().cfg.App.UserInvites = ""
}
apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility")
m := "?cm=Configuration+saved."
err = apper.SaveConfig(apper.App().cfg)
if err != nil {
m = "?cm=" + err.Error()
}
return impart.HTTPError{http.StatusFound, "/admin/settings" + m + "#config"}
}
func updateAppStats() {
sysStatus.Uptime = appstats.TimeSincePro(appStartTime)
m := new(runtime.MemStats)
runtime.ReadMemStats(m)
sysStatus.NumGoroutine = runtime.NumGoroutine()
sysStatus.MemAllocated = appstats.FileSize(int64(m.Alloc))
sysStatus.MemTotal = appstats.FileSize(int64(m.TotalAlloc))
sysStatus.MemSys = appstats.FileSize(int64(m.Sys))
sysStatus.Lookups = m.Lookups
sysStatus.MemMallocs = m.Mallocs
sysStatus.MemFrees = m.Frees
sysStatus.HeapAlloc = appstats.FileSize(int64(m.HeapAlloc))
sysStatus.HeapSys = appstats.FileSize(int64(m.HeapSys))
sysStatus.HeapIdle = appstats.FileSize(int64(m.HeapIdle))
sysStatus.HeapInuse = appstats.FileSize(int64(m.HeapInuse))
sysStatus.HeapReleased = appstats.FileSize(int64(m.HeapReleased))
sysStatus.HeapObjects = m.HeapObjects
sysStatus.StackInuse = appstats.FileSize(int64(m.StackInuse))
sysStatus.StackSys = appstats.FileSize(int64(m.StackSys))
sysStatus.MSpanInuse = appstats.FileSize(int64(m.MSpanInuse))
sysStatus.MSpanSys = appstats.FileSize(int64(m.MSpanSys))
sysStatus.MCacheInuse = appstats.FileSize(int64(m.MCacheInuse))
sysStatus.MCacheSys = appstats.FileSize(int64(m.MCacheSys))
sysStatus.BuckHashSys = appstats.FileSize(int64(m.BuckHashSys))
sysStatus.GCSys = appstats.FileSize(int64(m.GCSys))
sysStatus.OtherSys = appstats.FileSize(int64(m.OtherSys))
sysStatus.NextGC = appstats.FileSize(int64(m.NextGC))
sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000)
sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000)
sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000)
sysStatus.NumGC = m.NumGC
}
func adminResetPassword(app *App, u *User, newPass string) error {
hashedPass, err := auth.HashPass([]byte(newPass))
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)}
}
err = app.db.ChangePassphrase(u.ID, true, "", hashedPass)
if err != nil {
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)}
}
return nil
}
func handleViewAdminUpdates(app *App, u *User, w http.ResponseWriter, r *http.Request) error {
check := r.URL.Query().Get("check")
if check == "now" && app.cfg.App.UpdateChecks {
app.updates.CheckNow()
}
p := struct {
*UserPage
*AdminPage
CurReleaseNotesURL string
LastChecked string
LastChecked8601 string
LatestVersion string
LatestReleaseURL string
LatestReleaseNotesURL string
CheckFailed bool
}{
UserPage: NewUserPage(app, r, u, "Updates", nil),
AdminPage: NewAdminPage(app),
}
p.CurReleaseNotesURL = wfReleaseNotesURL(p.Version)
if app.cfg.App.UpdateChecks {
p.LastChecked = app.updates.lastCheck.Format("January 2, 2006, 3:04 PM")
p.LastChecked8601 = app.updates.lastCheck.Format("2006-01-02T15:04:05Z")
p.LatestVersion = app.updates.LatestVersion()
p.LatestReleaseURL = app.updates.ReleaseURL()
p.LatestReleaseNotesURL = app.updates.ReleaseNotesURL()
p.UpdateAvailable = app.updates.AreAvailable()
p.CheckFailed = app.updates.checkError != nil
}
showUserPage(w, "app-updates", p)
return nil
}
diff --git a/app.go b/app.go
index 7630254..93d359c 100644
--- a/app.go
+++ b/app.go
@@ -1,1003 +1,1004 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"crypto/tls"
"database/sql"
_ "embed"
"fmt"
"html/template"
"net"
"net/http"
"net/url"
"os"
"os/signal"
"path/filepath"
"regexp"
"strings"
"syscall"
"time"
"github.com/gorilla/mux"
"github.com/gorilla/schema"
"github.com/gorilla/sessions"
"github.com/manifoldco/promptui"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/impart"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/converter"
"github.com/writeas/web-core/log"
"golang.org/x/crypto/acme/autocert"
"github.com/writefreely/writefreely/author"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/key"
"github.com/writefreely/writefreely/migrations"
"github.com/writefreely/writefreely/page"
)
const (
- staticDir = "static"
- assumedTitleLen = 80
- postsPerPage = 10
+ staticDir = "static"
+ assumedTitleLen = 80
+ postsPerPage = 10
+ postsPerArchPage = 40
serverSoftware = "WriteFreely"
softwareURL = "https://writefreely.org"
)
var (
debugging bool
// Software version can be set from git env using -ldflags
softwareVer = "0.15.1"
// DEPRECATED VARS
isSingleUser bool
)
// App holds data and configuration for an individual WriteFreely instance.
type App struct {
router *mux.Router
shttp *http.ServeMux
db *datastore
cfg *config.Config
cfgFile string
keys *key.Keychain
sessionStore sessions.Store
formDecoder *schema.Decoder
updates *updatesCache
timeline *localTimeline
}
// DB returns the App's datastore
func (app *App) DB() *datastore {
return app.db
}
// Router returns the App's router
func (app *App) Router() *mux.Router {
return app.router
}
// Config returns the App's current configuration.
func (app *App) Config() *config.Config {
return app.cfg
}
// SetConfig updates the App's Config to the given value.
func (app *App) SetConfig(cfg *config.Config) {
app.cfg = cfg
}
// SetKeys updates the App's Keychain to the given value.
func (app *App) SetKeys(k *key.Keychain) {
app.keys = k
}
func (app *App) SessionStore() sessions.Store {
return app.sessionStore
}
func (app *App) SetSessionStore(s sessions.Store) {
app.sessionStore = s
}
// Apper is the interface for getting data into and out of a WriteFreely
// instance (or "App").
//
// App returns the App for the current instance.
//
// LoadConfig reads an app configuration into the App, returning any error
// encountered.
//
// SaveConfig persists the current App configuration.
//
// LoadKeys reads the App's encryption keys and loads them into its
// key.Keychain.
type Apper interface {
App() *App
LoadConfig() error
SaveConfig(*config.Config) error
LoadKeys() error
ReqLog(r *http.Request, status int, timeSince time.Duration) string
}
// App returns the App
func (app *App) App() *App {
return app
}
// LoadConfig loads and parses a config file.
func (app *App) LoadConfig() error {
log.Info("Loading %s configuration...", app.cfgFile)
cfg, err := config.Load(app.cfgFile)
if err != nil {
log.Error("Unable to load configuration: %v", err)
os.Exit(1)
return err
}
app.cfg = cfg
return nil
}
// SaveConfig saves the given Config to disk -- namely, to the App's cfgFile.
func (app *App) SaveConfig(c *config.Config) error {
return config.Save(c, app.cfgFile)
}
// LoadKeys reads all needed keys from disk into the App. In order to use the
// configured `Server.KeysParentDir`, you must call initKeyPaths(App) before
// this.
func (app *App) LoadKeys() error {
var err error
app.keys = &key.Keychain{}
if debugging {
log.Info(" %s", emailKeyPath)
}
executable, err := os.Executable()
if err != nil {
executable = "writefreely"
} else {
executable = filepath.Base(executable)
}
app.keys.EmailKey, err = os.ReadFile(emailKeyPath)
if err != nil {
return err
}
if debugging {
log.Info(" %s", cookieAuthKeyPath)
}
app.keys.CookieAuthKey, err = os.ReadFile(cookieAuthKeyPath)
if err != nil {
return err
}
if debugging {
log.Info(" %s", cookieKeyPath)
}
app.keys.CookieKey, err = os.ReadFile(cookieKeyPath)
if err != nil {
return err
}
if debugging {
log.Info(" %s", csrfKeyPath)
}
app.keys.CSRFKey, err = os.ReadFile(csrfKeyPath)
if err != nil {
if os.IsNotExist(err) {
log.Error(`Missing key: %s.
Run this command to generate missing keys:
%s keys generate
`, csrfKeyPath, executable)
}
return err
}
return nil
}
func (app *App) ReqLog(r *http.Request, status int, timeSince time.Duration) string {
return fmt.Sprintf("\"%s %s\" %d %s \"%s\"", r.Method, r.RequestURI, status, timeSince, r.UserAgent())
}
// handleViewHome shows page at root path. It checks the configuration and
// authentication state to show the correct page.
func handleViewHome(app *App, w http.ResponseWriter, r *http.Request) error {
if app.cfg.App.SingleUser {
// Render blog index
return handleViewCollection(app, w, r)
}
// Multi-user instance
forceLanding := r.FormValue("landing") == "1"
if !forceLanding {
// Show correct page based on user auth status and configured landing path
u := getUserSession(app, r)
if app.cfg.App.Chorus {
// This instance is focused on reading, so show Reader on home route if not
// private or a private-instance user is logged in.
if !app.cfg.App.Private || u != nil {
return viewLocalTimeline(app, w, r)
}
}
if u != nil {
// User is logged in, so show the Pad
return handleViewPad(app, w, r)
}
if app.cfg.App.Private {
return viewLogin(app, w, r)
}
if land := app.cfg.App.LandingPath(); land != "/" {
return impart.HTTPError{http.StatusFound, land}
}
}
return handleViewLanding(app, w, r)
}
func handleViewLanding(app *App, w http.ResponseWriter, r *http.Request) error {
forceLanding := r.FormValue("landing") == "1"
p := struct {
page.StaticPage
*OAuthButtons
Flashes []template.HTML
Banner template.HTML
Content template.HTML
ForcedLanding bool
}{
StaticPage: pageForReq(app, r),
OAuthButtons: NewOAuthButtons(app.Config()),
ForcedLanding: forceLanding,
}
banner, err := getLandingBanner(app)
if err != nil {
log.Error("unable to get landing banner: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)}
}
p.Banner = template.HTML(applyMarkdown([]byte(banner.Content), "", app.cfg))
content, err := getLandingBody(app)
if err != nil {
log.Error("unable to get landing content: %v", err)
return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get content: %v", err)}
}
p.Content = template.HTML(applyMarkdown([]byte(content.Content), "", app.cfg))
// Get error messages
session, err := app.sessionStore.Get(r, cookieName)
if err != nil {
// Ignore this
log.Error("Unable to get session in handleViewHome; ignoring: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, session)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
// Show landing page
return renderPage(w, "landing.tmpl", p)
}
func handleTemplatedPage(app *App, w http.ResponseWriter, r *http.Request, t *template.Template) error {
p := struct {
page.StaticPage
ContentTitle string
Content template.HTML
PlainContent string
Updated string
AboutStats *InstanceStats
}{
StaticPage: pageForReq(app, r),
}
if r.URL.Path == "/about" || r.URL.Path == "/contact" || r.URL.Path == "/privacy" {
var c *instanceContent
var err error
if r.URL.Path == "/about" {
c, err = getAboutPage(app)
// Fetch stats
p.AboutStats = &InstanceStats{}
p.AboutStats.NumPosts, _ = app.db.GetTotalPosts()
p.AboutStats.NumBlogs, _ = app.db.GetTotalCollections()
} else if r.URL.Path == "/contact" {
c, err = getContactPage(app)
if c.Updated.IsZero() {
// Page was never set up, so return 404
return ErrPostNotFound
}
} else {
c, err = getPrivacyPage(app)
}
if err != nil {
return err
}
p.ContentTitle = c.Title.String
p.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg))
p.PlainContent = shortPostDescription(stripmd.Strip(c.Content))
if !c.Updated.IsZero() {
p.Updated = c.Updated.Format("January 2, 2006")
}
}
// Serve templated page
err := t.ExecuteTemplate(w, "base", p)
if err != nil {
log.Error("Unable to render page: %v", err)
}
return nil
}
func pageForReq(app *App, r *http.Request) page.StaticPage {
p := page.StaticPage{
AppCfg: app.cfg.App,
Path: r.URL.Path,
Version: "v" + softwareVer,
}
// Use custom style, if file exists
if _, err := os.Stat(filepath.Join(app.cfg.Server.StaticParentDir, staticDir, "local", "custom.css")); err == nil {
p.CustomCSS = true
}
// Add user information, if given
var u *User
accessToken := r.FormValue("t")
if accessToken != "" {
userID := app.db.GetUserID(accessToken)
if userID != -1 {
var err error
u, err = app.db.GetUserByID(userID)
if err == nil {
p.Username = u.Username
}
}
} else {
u = getUserSession(app, r)
if u != nil {
p.Username = u.Username
p.IsAdmin = u != nil && u.IsAdmin()
p.CanInvite = canUserInvite(app.cfg, p.IsAdmin)
}
}
p.CanViewReader = !app.cfg.App.Private || u != nil
return p
}
var fileRegex = regexp.MustCompile("/([^/]*\\.[^/]*)$")
// Initialize loads the app configuration and initializes templates, keys,
// session, route handlers, and the database connection.
func Initialize(apper Apper, debug bool) (*App, error) {
debugging = debug
apper.LoadConfig()
// Load templates
err := InitTemplates(apper.App().Config())
if err != nil {
return nil, fmt.Errorf("load templates: %s", err)
}
// Load keys and set up session
initKeyPaths(apper.App()) // TODO: find a better way to do this, since it's unneeded in all Apper implementations
err = InitKeys(apper)
if err != nil {
return nil, fmt.Errorf("init keys: %s", err)
}
apper.App().InitUpdates()
apper.App().InitSession()
apper.App().InitDecoder()
err = ConnectToDatabase(apper.App())
if err != nil {
return nil, fmt.Errorf("connect to DB: %s", err)
}
initActivityPub(apper.App())
if apper.App().cfg.Email.Domain != "" || apper.App().cfg.Email.MailgunPrivate != "" {
if apper.App().cfg.Email.Domain == "" {
log.Error("[FAILED] Starting publish jobs queue: no [letters]domain config value set.")
} else if apper.App().cfg.Email.MailgunPrivate == "" {
log.Error("[FAILED] Starting publish jobs queue: no [letters]mailgun_private config value set.")
} else {
log.Info("Starting publish jobs queue...")
go startPublishJobsQueue(apper.App())
}
}
// Handle local timeline, if enabled
if apper.App().cfg.App.LocalTimeline {
log.Info("Initializing local timeline...")
initLocalTimeline(apper.App())
}
return apper.App(), nil
}
func Serve(app *App, r *mux.Router) {
log.Info("Going to serve...")
isSingleUser = app.cfg.App.SingleUser
app.cfg.Server.Dev = debugging
// Handle shutdown
c := make(chan os.Signal, 2)
signal.Notify(c, os.Interrupt, syscall.SIGTERM)
go func() {
<-c
log.Info("Shutting down...")
shutdown(app)
log.Info("Done.")
os.Exit(0)
}()
// Start gopher server
if app.cfg.Server.GopherPort > 0 && !app.cfg.App.Private {
go initGopher(app)
}
// Start web application server
var bindAddress = app.cfg.Server.Bind
if bindAddress == "" {
bindAddress = "localhost"
}
var err error
if app.cfg.IsSecureStandalone() {
if app.cfg.Server.Autocert {
m := &autocert.Manager{
Prompt: autocert.AcceptTOS,
Cache: autocert.DirCache(app.cfg.Server.TLSCertPath),
}
host, err := url.Parse(app.cfg.App.Host)
if err != nil {
log.Error("[WARNING] Unable to parse configured host! %s", err)
log.Error(`[WARNING] ALL hosts are allowed, which can open you to an attack where
clients connect to a server by IP address and pretend to be asking for an
incorrect host name, and cause you to reach the CA's rate limit for certificate
requests. We recommend supplying a valid host name.`)
log.Info("Using autocert on ANY host")
} else {
log.Info("Using autocert on host %s", host.Host)
m.HostPolicy = autocert.HostWhitelist(host.Host)
}
s := &http.Server{
Addr: ":https",
Handler: r,
TLSConfig: &tls.Config{
GetCertificate: m.GetCertificate,
},
}
s.SetKeepAlivesEnabled(false)
go func() {
log.Info("Serving redirects on http://%s:80", bindAddress)
err = http.ListenAndServe(":80", m.HTTPHandler(nil))
log.Error("Unable to start redirect server: %v", err)
}()
log.Info("Serving on https://%s:443", bindAddress)
log.Info("---")
err = s.ListenAndServeTLS("", "")
} else {
go func() {
log.Info("Serving redirects on http://%s:80", bindAddress)
err = http.ListenAndServe(fmt.Sprintf("%s:80", bindAddress), http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
http.Redirect(w, r, app.cfg.App.Host, http.StatusMovedPermanently)
}))
log.Error("Unable to start redirect server: %v", err)
}()
log.Info("Serving on https://%s:443", bindAddress)
log.Info("Using manual certificates")
log.Info("---")
err = http.ListenAndServeTLS(fmt.Sprintf("%s:443", bindAddress), app.cfg.Server.TLSCertPath, app.cfg.Server.TLSKeyPath, r)
}
} else {
network := "tcp"
protocol := "http"
if strings.HasPrefix(bindAddress, "/") {
network = "unix"
protocol = "http+unix"
// old sockets will remain after server closes;
// we need to delete them in order to open new ones
err = os.Remove(bindAddress)
if err != nil && !os.IsNotExist(err) {
log.Error("%s already exists but could not be removed: %v", bindAddress, err)
os.Exit(1)
}
} else {
bindAddress = fmt.Sprintf("%s:%d", bindAddress, app.cfg.Server.Port)
}
log.Info("Serving on %s://%s", protocol, bindAddress)
log.Info("---")
listener, err := net.Listen(network, bindAddress)
if err != nil {
log.Error("Could not bind to address: %v", err)
os.Exit(1)
}
if network == "unix" {
err = os.Chmod(bindAddress, 0o666)
if err != nil {
log.Error("Could not update socket permissions: %v", err)
os.Exit(1)
}
}
defer listener.Close()
err = http.Serve(listener, r)
}
if err != nil {
log.Error("Unable to start: %v", err)
os.Exit(1)
}
}
func (app *App) InitDecoder() {
// TODO: do this at the package level, instead of the App level
// Initialize modules
app.formDecoder = schema.NewDecoder()
app.formDecoder.RegisterConverter(converter.NullJSONString{}, converter.ConvertJSONNullString)
app.formDecoder.RegisterConverter(converter.NullJSONBool{}, converter.ConvertJSONNullBool)
app.formDecoder.RegisterConverter(sql.NullString{}, converter.ConvertSQLNullString)
app.formDecoder.RegisterConverter(sql.NullBool{}, converter.ConvertSQLNullBool)
app.formDecoder.RegisterConverter(sql.NullInt64{}, converter.ConvertSQLNullInt64)
app.formDecoder.RegisterConverter(sql.NullFloat64{}, converter.ConvertSQLNullFloat64)
}
// ConnectToDatabase validates and connects to the configured database, then
// tests the connection.
func ConnectToDatabase(app *App) error {
// Check database configuration
if app.cfg.Database.Type == driverMySQL && app.cfg.Database.User == "" {
return fmt.Errorf("Database user not set.")
}
if app.cfg.Database.Host == "" {
app.cfg.Database.Host = "localhost"
}
if app.cfg.Database.Database == "" {
app.cfg.Database.Database = "writefreely"
}
// TODO: check err
connectToDatabase(app)
// Test database connection
err := app.db.Ping()
if err != nil {
return fmt.Errorf("Database ping failed: %s", err)
}
return nil
}
// FormatVersion constructs the version string for the application
func FormatVersion() string {
return serverSoftware + " " + softwareVer
}
// OutputVersion prints out the version of the application.
func OutputVersion() {
fmt.Println(FormatVersion())
}
// NewApp creates a new app instance.
func NewApp(cfgFile string) *App {
return &App{
cfgFile: cfgFile,
}
}
// CreateConfig creates a default configuration and saves it to the app's cfgFile.
func CreateConfig(app *App) error {
log.Info("Creating configuration...")
c := config.New()
log.Info("Saving configuration %s...", app.cfgFile)
err := config.Save(c, app.cfgFile)
if err != nil {
return fmt.Errorf("Unable to save configuration: %v", err)
}
return nil
}
// DoConfig runs the interactive configuration process.
func DoConfig(app *App, configSections string) {
if configSections == "" {
configSections = "server db app"
}
// let's check there aren't any garbage in the list
configSectionsArray := strings.Split(configSections, " ")
for _, element := range configSectionsArray {
if element != "server" && element != "db" && element != "app" {
log.Error("Invalid argument to --sections. Valid arguments are only \"server\", \"db\" and \"app\"")
os.Exit(1)
}
}
d, err := config.Configure(app.cfgFile, configSections)
if err != nil {
log.Error("Unable to configure: %v", err)
os.Exit(1)
}
app.cfg = d.Config
connectToDatabase(app)
defer shutdown(app)
if !app.db.DatabaseInitialized() {
err = adminInitDatabase(app)
if err != nil {
log.Error(err.Error())
os.Exit(1)
}
} else {
log.Info("Database already initialized.")
}
if d.User != nil {
u := &User{
Username: d.User.Username,
HashedPass: d.User.HashedPass,
Created: time.Now().Truncate(time.Second).UTC(),
}
// Create blog
log.Info("Creating user %s...\n", u.Username)
err = app.db.CreateUser(app.cfg, u, app.cfg.App.SiteName, "")
if err != nil {
log.Error("Unable to create user: %s", err)
os.Exit(1)
}
log.Info("Done!")
}
os.Exit(0)
}
// GenerateKeyFiles creates app encryption keys and saves them into the configured KeysParentDir.
func GenerateKeyFiles(app *App) error {
// Read keys path from config
app.LoadConfig()
// Create keys dir if it doesn't exist yet
fullKeysDir := filepath.Join(app.cfg.Server.KeysParentDir, keysDir)
if _, err := os.Stat(fullKeysDir); os.IsNotExist(err) {
err = os.Mkdir(fullKeysDir, 0700)
if err != nil {
return err
}
}
// Generate keys
initKeyPaths(app)
// TODO: use something like https://github.com/hashicorp/go-multierror to return errors
var keyErrs error
err := generateKey(emailKeyPath)
if err != nil {
keyErrs = err
}
err = generateKey(cookieAuthKeyPath)
if err != nil {
keyErrs = err
}
err = generateKey(cookieKeyPath)
if err != nil {
keyErrs = err
}
err = generateKey(csrfKeyPath)
if err != nil {
keyErrs = err
}
return keyErrs
}
// CreateSchema creates all database tables needed for the application.
func CreateSchema(apper Apper) error {
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
err := adminInitDatabase(apper.App())
if err != nil {
return err
}
return nil
}
// Migrate runs all necessary database migrations.
func Migrate(apper Apper) error {
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
err := migrations.Migrate(migrations.NewDatastore(apper.App().db.DB, apper.App().db.driverName))
if err != nil {
return fmt.Errorf("migrate: %s", err)
}
return nil
}
// ResetPassword runs the interactive password reset process.
func ResetPassword(apper Apper, username string) error {
// Connect to the database
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
// Fetch user
u, err := apper.App().db.GetUserForAuth(username)
if err != nil {
log.Error("Get user: %s", err)
os.Exit(1)
}
// Prompt for new password
prompt := promptui.Prompt{
Templates: &promptui.PromptTemplates{
Success: "{{ . | bold | faint }}: ",
},
Label: "New password",
Mask: '*',
}
newPass, err := prompt.Run()
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
// Do the update
log.Info("Updating...")
err = adminResetPassword(apper.App(), u, newPass)
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
log.Info("Success.")
return nil
}
// DoDeleteAccount runs the confirmation and account delete process.
func DoDeleteAccount(apper Apper, username string) error {
// Connect to the database
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
// check user exists
u, err := apper.App().db.GetUserForAuth(username)
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
userID := u.ID
// do not delete the admin account
// TODO: check for other admins and skip?
if u.IsAdmin() {
log.Error("Can not delete admin account")
os.Exit(1)
}
// confirm deletion, w/ w/out posts
prompt := promptui.Prompt{
Templates: &promptui.PromptTemplates{
Success: "{{ . | bold | faint }}: ",
},
Label: fmt.Sprintf("Really delete user : %s", username),
IsConfirm: true,
}
_, err = prompt.Run()
if err != nil {
log.Info("Aborted...")
os.Exit(0)
}
log.Info("Deleting...")
err = apper.App().db.DeleteAccount(userID)
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
log.Info("Success.")
return nil
}
func connectToDatabase(app *App) {
log.Info("Connecting to %s database...", app.cfg.Database.Type)
var db *sql.DB
var err error
if app.cfg.Database.Type == driverMySQL {
db, err = sql.Open(app.cfg.Database.Type, fmt.Sprintf("%s:%s@tcp(%s:%d)/%s?charset=utf8mb4&parseTime=true&loc=%s&tls=%t", app.cfg.Database.User, app.cfg.Database.Password, app.cfg.Database.Host, app.cfg.Database.Port, app.cfg.Database.Database, url.QueryEscape(time.Local.String()), app.cfg.Database.TLS))
db.SetMaxOpenConns(50)
} else if app.cfg.Database.Type == driverSQLite {
if !SQLiteEnabled {
log.Error("Invalid database type '%s'. Binary wasn't compiled with SQLite3 support.", app.cfg.Database.Type)
os.Exit(1)
}
if app.cfg.Database.FileName == "" {
log.Error("SQLite database filename value in config.ini is empty.")
os.Exit(1)
}
db, err = sql.Open("sqlite3_with_regex", app.cfg.Database.FileName+"?parseTime=true&cached=shared")
db.SetMaxOpenConns(2)
} else {
log.Error("Invalid database type '%s'. Only 'mysql' and 'sqlite3' are supported right now.", app.cfg.Database.Type)
os.Exit(1)
}
if err != nil {
log.Error("%s", err)
os.Exit(1)
}
app.db = &datastore{db, app.cfg.Database.Type}
}
func shutdown(app *App) {
log.Info("Closing database connection...")
app.db.Close()
if strings.HasPrefix(app.cfg.Server.Bind, "/") {
// Clean up socket
log.Info("Removing socket file...")
err := os.Remove(app.cfg.Server.Bind)
if err != nil {
log.Error("Unable to remove socket: %s", err)
os.Exit(1)
}
log.Info("Success.")
}
}
// CreateUser creates a new admin or normal user from the given credentials.
func CreateUser(apper Apper, username, password string, isAdmin bool) error {
// Create an admin user with --create-admin
apper.LoadConfig()
connectToDatabase(apper.App())
defer shutdown(apper.App())
// Ensure an admin / first user doesn't already exist
firstUser, _ := apper.App().db.GetUserByID(1)
if isAdmin {
// Abort if trying to create admin user, but one already exists
if firstUser != nil {
- return fmt.Errorf("Admin user already exists (%s). Create a regular user with: writefreely --create-user", firstUser.Username)
+ return fmt.Errorf("Admin user already exists (%s). Create a regular user with: writefreely user create [USER]:[PASSWORD]", firstUser.Username)
}
} else {
// Abort if trying to create regular user, but no admin exists yet
if firstUser == nil {
- return fmt.Errorf("No admin user exists yet. Create an admin first with: writefreely --create-admin")
+ return fmt.Errorf("No admin user exists yet. Create an admin first with: writefreely user create --admin [USER]:[PASSWORD]")
}
}
// Create the user
// Normalize and validate username
desiredUsername := username
username = getSlug(username, "")
usernameDesc := username
if username != desiredUsername {
usernameDesc += " (originally: " + desiredUsername + ")"
}
if !author.IsValidUsername(apper.App().cfg, username) {
return fmt.Errorf("Username %s is invalid, reserved, or shorter than configured minimum length (%d characters).", usernameDesc, apper.App().cfg.App.MinUsernameLen)
}
// Hash the password
hashedPass, err := auth.HashPass([]byte(password))
if err != nil {
return fmt.Errorf("Unable to hash password: %v", err)
}
u := &User{
Username: username,
HashedPass: hashedPass,
Created: time.Now().Truncate(time.Second).UTC(),
}
userType := "user"
if isAdmin {
userType = "admin"
}
log.Info("Creating %s %s...", userType, usernameDesc)
err = apper.App().db.CreateUser(apper.App().Config(), u, desiredUsername, "")
if err != nil {
return fmt.Errorf("Unable to create user: %s", err)
}
log.Info("Done!")
return nil
}
//go:embed schema.sql
var schemaSql string
//go:embed sqlite.sql
var sqliteSql string
func adminInitDatabase(app *App) error {
var schema string
if app.cfg.Database.Type == driverSQLite {
schema = sqliteSql
} else {
schema = schemaSql
}
tblReg := regexp.MustCompile("CREATE TABLE (IF NOT EXISTS )?`([a-z_]+)`")
queries := strings.Split(string(schema), ";\n")
for _, q := range queries {
if strings.TrimSpace(q) == "" {
continue
}
parts := tblReg.FindStringSubmatch(q)
if len(parts) >= 3 {
log.Info("Creating table %s...", parts[2])
} else {
log.Info("Creating table ??? (Weird query) No match in: %v", parts)
}
_, err := app.db.Exec(q)
if err != nil {
log.Error("%s", err)
} else {
log.Info("Created.")
}
}
// Set up migrations table
log.Info("Initializing appmigrations table...")
err := migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName))
if err != nil {
return fmt.Errorf("Unable to set initial migrations: %v", err)
}
log.Info("Running migrations...")
err = migrations.Migrate(migrations.NewDatastore(app.db.DB, app.db.driverName))
if err != nil {
return fmt.Errorf("migrate: %s", err)
}
log.Info("Done.")
return nil
}
// ServerUserAgent returns a User-Agent string to use in external requests. The
// hostName parameter may be left empty.
func ServerUserAgent(hostName string) string {
hostUAStr := ""
if hostName != "" {
hostUAStr = "; +" + hostName
}
return "Go (" + serverSoftware + "/" + softwareVer + hostUAStr + ")"
}
diff --git a/collections.go b/collections.go
index 0ccca2e..90e02ba 100644
--- a/collections.go
+++ b/collections.go
@@ -1,1438 +1,1462 @@
/*
* Copyright © 2018-2022 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"fmt"
"html/template"
"math"
"net/http"
"net/url"
"regexp"
"strconv"
"strings"
"unicode"
"github.com/gorilla/mux"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/bots"
"github.com/writeas/web-core/i18n"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/posts"
"github.com/writefreely/writefreely/author"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/page"
"github.com/writefreely/writefreely/spam"
"golang.org/x/net/idna"
)
const (
collAttrLetterReplyTo = "letter_reply_to"
collMaxLengthTitle = 255
collMaxLengthDescription = 160
)
type (
// TODO: add Direction to db
// TODO: add Language to db
Collection struct {
ID int64 `datastore:"id" json:"-"`
Alias string `datastore:"alias" schema:"alias" json:"alias"`
Title string `datastore:"title" schema:"title" json:"title"`
Description string `datastore:"description" schema:"description" json:"description"`
Direction string `schema:"dir" json:"dir,omitempty"`
Language string `schema:"lang" json:"lang,omitempty"`
StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"`
Script string `datastore:"script" schema:"script" json:"script,omitempty"`
Signature string `datastore:"post_signature" schema:"signature" json:"-"`
Public bool `datastore:"public" json:"public"`
Visibility collVisibility `datastore:"private" json:"-"`
Format string `datastore:"format" json:"format,omitempty"`
Views int64 `json:"views"`
OwnerID int64 `datastore:"owner_id" json:"-"`
PublicOwner bool `datastore:"public_owner" json:"-"`
URL string `json:"url,omitempty"`
Monetization string `json:"monetization_pointer,omitempty"`
Verification string `json:"verification_link"`
db *datastore
hostName string
}
CollectionObj struct {
Collection
TotalPosts int `json:"total_posts"`
Owner *User `json:"owner,omitempty"`
Posts *[]PublicPost `json:"posts,omitempty"`
Format *CollectionFormat
}
DisplayCollection struct {
*CollectionObj
Prefix string
NavSuffix string
IsTopLevel bool
CurrentPage int
TotalPages int
Silenced bool
}
CollectionNav struct {
*Collection
Path string
SingleUser bool
CanPost bool
}
SubmittedCollection struct {
// Data used for updating a given collection
ID int64
OwnerID uint64
// Form helpers
PreferURL string `schema:"prefer_url" json:"prefer_url"`
Privacy int `schema:"privacy" json:"privacy"`
Pass string `schema:"password" json:"password"`
MathJax bool `schema:"mathjax" json:"mathjax"`
EmailSubs bool `schema:"email_subs" json:"email_subs"`
Handle string `schema:"handle" json:"handle"`
// Actual collection values updated in the DB
Alias *string `schema:"alias" json:"alias"`
Title *string `schema:"title" json:"title"`
Description *string `schema:"description" json:"description"`
StyleSheet *string `schema:"style_sheet" json:"style_sheet"`
Script *string `schema:"script" json:"script"`
Signature *string `schema:"signature" json:"signature"`
Monetization *string `schema:"monetization_pointer" json:"monetization_pointer"`
Verification *string `schema:"verification_link" json:"verification_link"`
LetterReply *string `schema:"letter_reply" json:"letter_reply"`
Visibility *int `schema:"visibility" json:"public"`
Format *sql.NullString `schema:"format" json:"format"`
}
CollectionFormat struct {
Format string
}
collectionReq struct {
// Information about the collection request itself
prefix, alias, domain string
isCustomDomain bool
// User-related fields
isCollOwner bool
isAuthorized bool
}
)
func (sc *SubmittedCollection) FediverseHandle() string {
if sc.Handle == "" {
return apCustomHandleDefault
}
return getSlug(sc.Handle, "")
}
// collVisibility represents the visibility level for the collection.
type collVisibility int
// Visibility levels. Values are bitmasks, stored in the database as
// decimal numbers. If adding types, append them to this list. If removing,
// replace the desired visibility with a new value.
const CollUnlisted collVisibility = 0
const (
CollPublic collVisibility = 1 << iota
CollPrivate
CollProtected
)
var collVisibilityStrings = map[string]collVisibility{
"unlisted": CollUnlisted,
"public": CollPublic,
"private": CollPrivate,
"protected": CollProtected,
}
func defaultVisibility(cfg *config.Config) collVisibility {
vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility]
if !ok {
vis = CollUnlisted
}
return vis
}
func (cf *CollectionFormat) Ascending() bool {
return cf.Format == "novel"
}
func (cf *CollectionFormat) ShowDates() bool {
return cf.Format == "blog"
}
func (cf *CollectionFormat) PostsPerPage() int {
if cf.Format == "novel" {
return postsPerPage
}
return postsPerPage
}
// Valid returns whether or not a format value is valid.
func (cf *CollectionFormat) Valid() bool {
return cf.Format == "blog" ||
cf.Format == "novel" ||
cf.Format == "notebook"
}
// NewFormat creates a new CollectionFormat object from the Collection.
func (c *Collection) NewFormat() *CollectionFormat {
cf := &CollectionFormat{Format: c.Format}
// Fill in default format
if cf.Format == "" {
cf.Format = "blog"
}
return cf
}
func (c *Collection) IsInstanceColl() bool {
ur, _ := url.Parse(c.hostName)
return c.Alias == ur.Host
}
func (c *Collection) IsUnlisted() bool {
return c.Visibility == 0
}
func (c *Collection) IsPrivate() bool {
return c.Visibility&CollPrivate != 0
}
func (c *Collection) IsProtected() bool {
return c.Visibility&CollProtected != 0
}
func (c *Collection) IsPublic() bool {
return c.Visibility&CollPublic != 0
}
func (c *Collection) FriendlyVisibility() string {
if c.IsPrivate() {
return "Private"
}
if c.IsPublic() {
return "Public"
}
if c.IsProtected() {
return "Password-protected"
}
return "Unlisted"
}
func (c *Collection) ShowFooterBranding() bool {
// TODO: implement this setting
return true
}
// CanonicalURL returns a fully-qualified URL to the collection.
func (c *Collection) CanonicalURL() string {
return c.RedirectingCanonicalURL(false)
}
func (c *Collection) DisplayCanonicalURL() string {
us := c.CanonicalURL()
u, err := url.Parse(us)
if err != nil {
return us
}
p := u.Path
if p == "/" {
p = ""
}
d := u.Hostname()
d, _ = idna.ToUnicode(d)
return d + p
}
// RedirectingCanonicalURL returns the fully-qualified canonical URL for the Collection, with a trailing slash. The
// hostName field needs to be populated for this to work correctly.
func (c *Collection) RedirectingCanonicalURL(isRedir bool) string {
if c.hostName == "" {
// If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail
log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writefreely/writefreely/issues/new?template=bug_report.md")
}
if isSingleUser {
return c.hostName + "/"
}
return fmt.Sprintf("%s/%s/", c.hostName, c.Alias)
}
// PrevPageURL provides a full URL for the previous page of collection posts,
// returning a /page/N result for pages >1
func (c *Collection) PrevPageURL(prefix, navSuffix string, n int, tl bool) string {
u := ""
if n == 2 {
// Previous page is 1; no need for /page/ prefix
if prefix == "" {
u = navSuffix + "/"
}
// Else leave off trailing slash
} else {
u = fmt.Sprintf("%s/page/%d", navSuffix, n-1)
}
if tl {
return u
}
return "/" + prefix + c.Alias + u
}
// NextPageURL provides a full URL for the next page of collection posts
func (c *Collection) NextPageURL(prefix, navSuffix string, n int, tl bool) string {
if tl {
return fmt.Sprintf("%s/page/%d", navSuffix, n+1)
}
return fmt.Sprintf("/%s%s%s/page/%d", prefix, c.Alias, navSuffix, n+1)
}
func (c *Collection) DisplayTitle() string {
if c.Title != "" {
return c.Title
}
return c.Alias
}
func (c *Collection) StyleSheetDisplay() template.CSS {
return template.CSS(c.StyleSheet)
}
// ForPublic modifies the Collection for public consumption, such as via
// the API.
func (c *Collection) ForPublic() {
c.URL = c.CanonicalURL()
}
var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString
func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person {
accountRoot := c.FederatedAccount()
p := activitystreams.NewPerson(accountRoot)
p.URL = c.CanonicalURL()
uname := c.Alias
p.PreferredUsername = uname
p.Name = c.DisplayTitle()
p.Summary = c.Description
if p.Name != "" {
if av := c.AvatarURL(); av != "" {
p.Icon = activitystreams.Image{
Type: "Image",
MediaType: "image/png",
URL: av,
}
}
}
collID := c.ID
if len(ids) > 0 {
collID = ids[0]
}
pub, priv := c.db.GetAPActorKeys(collID)
if pub != nil {
p.AddPubKey(pub)
p.SetPrivKey(priv)
}
return p
}
func (c *Collection) AvatarURL() string {
fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0]))
if !isAvatarChar(fl) {
return ""
}
return c.hostName + "/img/avatars/" + fl + ".png"
}
func (c *Collection) FederatedAPIBase() string {
return c.hostName + "/"
}
func (c *Collection) FederatedAccount() string {
accountUser := c.Alias
return c.FederatedAPIBase() + "api/collections/" + accountUser
}
func (c *Collection) RenderMathJax() bool {
return c.db.CollectionHasAttribute(c.ID, "render_mathjax")
}
func (c *Collection) EmailSubsEnabled() bool {
return c.db.CollectionHasAttribute(c.ID, "email_subs")
}
func (c *Collection) MonetizationURL() string {
if c.Monetization == "" {
return ""
}
return strings.Replace(c.Monetization, "$", "https://", 1)
}
// DisplayDescription returns the description with rendered Markdown and HTML.
func (c *Collection) DisplayDescription() *template.HTML {
if c.Description == "" {
s := template.HTML("")
return &s
}
t := template.HTML(posts.ApplyBasicAccessibleMarkdown([]byte(c.Description)))
return &t
}
// PlainDescription returns the description with all Markdown and HTML removed.
func (c *Collection) PlainDescription() string {
if c.Description == "" {
return ""
}
desc := stripHTMLWithoutEscaping(c.Description)
desc = stripmd.Strip(desc)
return desc
}
func (c CollectionPage) DisplayMonetization() string {
return displayMonetization(c.Monetization, c.Alias)
}
func (c *DisplayCollection) Direction() string {
if c.Language == "" {
return "auto"
}
if i18n.LangIsRTL(c.Language) {
return "rtl"
}
return "ltr"
}
func newCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
alias := r.FormValue("alias")
title := r.FormValue("title")
var missingParams, accessToken string
var u *User
c := struct {
Alias string `json:"alias" schema:"alias"`
Title string `json:"title" schema:"title"`
Web bool `json:"web" schema:"web"`
}{}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse post update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
// TODO: move form parsing to formDecoder
c.Alias = alias
c.Title = title
}
if c.Alias == "" {
if c.Title != "" {
// If only a title was given, just use it to generate the alias.
c.Alias = getSlug(c.Title, "")
} else {
missingParams += "`alias` "
}
}
if c.Title == "" {
missingParams += "`title` "
}
if missingParams != "" {
return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)}
}
var userID int64
var err error
if reqJSON && !c.Web {
accessToken = r.Header.Get("Authorization")
if accessToken == "" {
return ErrNoAccessToken
}
userID = app.db.GetUserID(accessToken)
if userID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
userID = u.ID
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("new collection: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrUserSilenced
}
if !author.IsValidUsername(app.cfg, c.Alias) {
return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."}
}
coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID)
if err != nil {
// TODO: handle this
return err
}
res := &CollectionObj{Collection: *coll}
if reqJSON {
return impart.WriteSuccess(w, res, http.StatusCreated)
}
redirectTo := "/me/c/"
// TODO: redirect to pad when necessary
return impart.HTTPError{http.StatusFound, redirectTo}
}
func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) {
accessToken := r.Header.Get("Authorization")
var userID int64 = -1
if accessToken != "" {
userID = app.db.GetUserID(accessToken)
}
isCollOwner := userID == c.OwnerID
if c.IsPrivate() && !isCollOwner {
// Collection is private, but user isn't authenticated
return -1, ErrCollectionNotFound
}
if c.IsProtected() {
// TODO: check access token
return -1, ErrCollectionUnauthorizedRead
}
return userID, nil
}
// fetchCollection handles the API endpoint for retrieving collection data.
func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error {
if IsActivityPubRequest(r) {
return handleFetchCollectionActivities(app, w, r)
}
vars := mux.Vars(r)
alias := vars["alias"]
// TODO: move this logic into a common getCollection function
// Get base Collection data
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Redirect users who aren't requesting JSON
reqJSON := IsJSON(r)
if !reqJSON {
return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
}
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Fetch extra data about the Collection
res := &CollectionObj{Collection: *c}
if c.PublicOwner {
u, err := app.db.GetUserByID(res.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
res.Owner = u
}
}
// TODO: check status for silenced
app.db.GetPostsCount(res, isCollOwner)
// Strip non-public information
res.Collection.ForPublic()
return impart.WriteSuccess(w, res, http.StatusOK)
}
// fetchCollectionPosts handles an API endpoint for retrieving a collection's
// posts.
func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
alias := vars["alias"]
c, err := app.db.GetCollection(alias)
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
// Check permissions
userID, err := apiCheckCollectionPermissions(app, r, c)
if err != nil {
return err
}
isCollOwner := userID == c.OwnerID
// Get page
page := 1
if p := r.FormValue("page"); p != "" {
pInt, _ := strconv.Atoi(p)
if pInt > 0 {
page = pInt
}
}
- ps, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false)
+ ps, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false, "")
if err != nil {
return err
}
coll := &CollectionObj{Collection: *c, Posts: ps}
app.db.GetPostsCount(coll, isCollOwner)
// Strip non-public information
coll.Collection.ForPublic()
// Transform post bodies if needed
if r.FormValue("body") == "html" {
for _, p := range *coll.Posts {
p.Content = posts.ApplyMarkdown([]byte(p.Content))
}
}
return impart.WriteSuccess(w, coll, http.StatusOK)
}
type CollectionPage struct {
page.StaticPage
*DisplayCollection
IsCustomDomain bool
IsWelcome bool
IsOwner bool
IsCollLoggedIn bool
Honeypot string
IsSubscriber bool
CanPin bool
Username string
Monetization string
Flash template.HTML
Collections *[]Collection
PinnedPosts *[]PublicPost
IsAdmin bool
CanInvite bool
// Helper field for Chorus mode
CollAlias string
}
type TagCollectionPage struct {
CollectionPage
Tag string
}
func (tcp TagCollectionPage) PrevPageURL(prefix string, n int, tl bool) string {
u := fmt.Sprintf("/tag:%s", tcp.Tag)
if n > 2 {
u += fmt.Sprintf("/page/%d", n-1)
}
if tl {
return u
}
return "/" + prefix + tcp.Alias + u
}
func (tcp TagCollectionPage) NextPageURL(prefix string, n int, tl bool) string {
if tl {
return fmt.Sprintf("/tag:%s/page/%d", tcp.Tag, n+1)
}
return fmt.Sprintf("/%s%s/tag:%s/page/%d", prefix, tcp.Alias, tcp.Tag, n+1)
}
func NewCollectionObj(c *Collection) *CollectionObj {
return &CollectionObj{
Collection: *c,
Format: c.NewFormat(),
}
}
func (c *CollectionObj) ScriptDisplay() template.JS {
return template.JS(c.Script)
}
var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$")
func (c *CollectionObj) ExternalScripts() []template.URL {
scripts := []template.URL{}
if c.Script == "" {
return scripts
}
matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1)
for _, m := range matches {
scripts = append(scripts, template.URL(strings.TrimSpace(m[1])))
}
return scripts
}
func (c *CollectionObj) CanShowScript() bool {
return false
}
func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error {
cr.prefix = vars["prefix"]
cr.alias = vars["collection"]
// Normalize the URL, redirecting user to consistent post URL
if cr.alias != strings.ToLower(cr.alias) {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))}
}
return nil
}
// processCollectionPermissions checks the permissions for the given
// collectionReq, returning a Collection if access is granted; otherwise this
// renders any necessary collection pages, for example, if requesting a custom
// domain that doesn't yet have a collection associated, or if a collection
// requires a password. In either case, this will return nil, nil -- thus both
// values should ALWAYS be checked to determine whether or not to continue.
func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) {
// Display collection if this is a collection
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(cr.alias)
}
// TODO: verify we don't reveal the existence of a private collection with redirection
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
if cr.isCustomDomain {
// User is on the site from a custom domain
//tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r))
//if tErr != nil {
//log.Error("Unable to render 404-domain page: %v", err)
//}
return nil, nil
}
if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen {
// Alias is within post ID range, so just be sure this isn't a post
if app.db.PostIDExists(cr.alias) {
// TODO: use StatusFound for vanity post URLs when we implement them
return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias}
}
}
// Redirect if necessary
newAlias := app.db.GetCollectionRedirect(cr.alias)
if newAlias != "" {
return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"}
}
}
}
return nil, err
}
c.hostName = app.cfg.App.Host
// Update CollectionRequest to reflect owner status
cr.isCollOwner = u != nil && u.ID == c.OwnerID
// Check permissions
if !cr.isCollOwner {
if c.IsPrivate() {
return nil, ErrCollectionNotFound
} else if c.IsProtected() {
uname := ""
if u != nil {
uname = u.Username
}
// TODO: move this to all permission checks?
suspended, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("process protected collection permissions: %v", err)
return nil, err
}
if suspended {
return nil, ErrCollectionNotFound
}
// See if we've authorized this collection
cr.isAuthorized = isAuthorizedForCollection(app, c.Alias, r)
if !cr.isAuthorized {
p := struct {
page.StaticPage
*CollectionObj
Username string
Next string
Flashes []template.HTML
}{
StaticPage: pageForReq(app, r),
CollectionObj: &CollectionObj{Collection: *c},
Username: uname,
Next: r.FormValue("g"),
Flashes: []template.HTML{},
}
// Get owner information
p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, flash := range flashes {
p.Flashes = append(p.Flashes, template.HTML(flash))
}
err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p)
if err != nil {
log.Error("Unable to render password-collection: %v", err)
return nil, err
}
return nil, nil
}
}
}
return c, nil
}
func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) {
u := getUserSession(app, r)
return u, nil
}
-func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection {
+func newDisplayCollection(c *Collection, cr *collectionReq, page int) (*DisplayCollection, error) {
coll := &DisplayCollection{
CollectionObj: NewCollectionObj(c),
CurrentPage: page,
Prefix: cr.prefix,
IsTopLevel: isSingleUser,
}
- c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner)
- return coll
+ err := c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner)
+ if err != nil {
+ return nil, err
+ }
+ return coll, nil
}
// getCollectionPage returns the collection page as an int. If the parsed page value is not
// greater than 0 then the default value of 1 is returned.
func getCollectionPage(vars map[string]string) int {
if p, _ := strconv.Atoi(vars["page"]); p > 0 {
return p
}
return 1
}
// handleViewCollection displays the requested Collection
func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
c.hostName = app.cfg.App.Host
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view collection: %v", err)
return ErrInternalGeneral
}
// Serve ActivityStreams data now, if requested
if IsActivityPubRequest(r) {
ac := c.PersonObject()
ac.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ac, http.StatusOK)
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
- coll := newDisplayCollection(c, cr, page)
+ coll, err := newDisplayCollection(c, cr, page)
+ if err != nil {
+ return err
+ }
- coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage())))
+ var ct PostType
+ if isArchiveView(r) {
+ ct = postArch
+ }
+
+ // FIXME: this number will be off when user has pinned posts but isn't a Pro user
+ ppp := coll.Format.PostsPerPage()
+ if ct == postArch {
+ ppp = postsPerArchPage
+ }
+
+ coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(ppp)))
if coll.TotalPages > 0 && page > coll.TotalPages {
redirURL := fmt.Sprintf("/page/%d", coll.TotalPages)
if !app.cfg.App.SingleUser {
redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL)
}
return impart.HTTPError{http.StatusFound, redirURL}
}
- coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false)
+ coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false, "")
// Serve collection
displayPage := CollectionPage{
DisplayCollection: coll,
IsCollLoggedIn: cr.isAuthorized,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
IsWelcome: r.FormValue("greeting") != "",
Honeypot: spam.HoneypotFieldName(),
CollAlias: c.Alias,
}
flashes, _ := getSessionFlashes(app, w, r, nil)
for _, f := range flashes {
displayPage.Flash = template.HTML(f)
}
displayPage.IsAdmin = u != nil && u.IsAdmin()
displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin)
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
displayPage.IsSubscriber = u.IsEmailSubscriber(app, coll.ID)
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
}
if !isOwner && silenced {
return ErrCollectionNotFound
}
displayPage.Silenced = isOwner && silenced
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
collTmpl := "collection"
if app.cfg.App.Chorus {
collTmpl = "chorus-collection"
+ } else if isArchiveView(r) {
+ displayPage.NavSuffix = "/archive/"
+ collTmpl = "collection-archive"
}
err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage)
if err != nil {
log.Error("Unable to render collection index: %v", err)
}
// Update collection view count
go func() {
// Don't update if owner is viewing the collection.
if u != nil && u.ID == coll.OwnerID {
return
}
// Only update for human views
if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) {
return
}
_, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID)
if err != nil {
log.Error("Unable to update collections count: %v", err)
}
}()
return err
}
+func isArchiveView(r *http.Request) bool {
+ return strings.HasSuffix(r.RequestURI, "/archive/") || mux.Vars(r)["archive"] == "archive"
+}
+
func handleViewMention(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
handle := vars["handle"]
remoteUser, err := app.db.GetProfilePageFromHandle(app, handle)
if err != nil || remoteUser == "" {
log.Error("Couldn't find user %s: %v", handle, err)
return ErrRemoteUserNotFound
}
return impart.HTTPError{Status: http.StatusFound, Message: remoteUser}
}
func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
tag := vars["tag"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
- coll := newDisplayCollection(c, cr, page)
+ coll, _ := newDisplayCollection(c, cr, page)
taggedPostIDs, err := app.db.GetAllPostsTaggedIDs(c, tag, cr.isCollOwner)
if err != nil {
return err
}
ttlPosts := len(taggedPostIDs)
pagePosts := coll.Format.PostsPerPage()
coll.TotalPages = int(math.Ceil(float64(ttlPosts) / float64(pagePosts)))
if coll.TotalPages > 0 && page > coll.TotalPages {
redirURL := fmt.Sprintf("/page/%d", coll.TotalPages)
if !app.cfg.App.SingleUser {
redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL)
}
return impart.HTTPError{http.StatusFound, redirURL}
}
coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner)
if coll.Posts != nil && len(*coll.Posts) == 0 {
return ErrCollectionPageNotFound
}
// Serve collection
displayPage := TagCollectionPage{
CollectionPage: CollectionPage{
DisplayCollection: coll,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
},
Tag: tag,
}
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
if owner.IsSilenced() {
return ErrCollectionNotFound
}
}
displayPage.Silenced = owner != nil && owner.IsSilenced()
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage)
if err != nil {
log.Error("Unable to render collection tag page: %v", err)
}
return nil
}
func handleViewCollectionLang(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
lang := vars["lang"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
u, err := checkUserForCollection(app, cr, r, false)
if err != nil {
return err
}
page := getCollectionPage(vars)
c, err := processCollectionPermissions(app, cr, u, w, r)
if c == nil || err != nil {
return err
}
- coll := newDisplayCollection(c, cr, page)
+ coll, _ := newDisplayCollection(c, cr, page)
coll.Language = lang
coll.NavSuffix = fmt.Sprintf("/lang:%s", lang)
ttlPosts, err := app.db.GetCollLangTotalPosts(coll.ID, lang)
if err != nil {
log.Error("Unable to getCollLangTotalPosts: %s", err)
}
pagePosts := coll.Format.PostsPerPage()
coll.TotalPages = int(math.Ceil(float64(ttlPosts) / float64(pagePosts)))
if coll.TotalPages > 0 && page > coll.TotalPages {
redirURL := fmt.Sprintf("/lang:%s/page/%d", lang, coll.TotalPages)
if !app.cfg.App.SingleUser {
redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL)
}
return impart.HTTPError{http.StatusFound, redirURL}
}
coll.Posts, _ = app.db.GetLangPosts(app.cfg, c, lang, page, cr.isCollOwner)
if err != nil {
return ErrCollectionPageNotFound
}
// Serve collection
displayPage := struct {
CollectionPage
Tag string
}{
CollectionPage: CollectionPage{
DisplayCollection: coll,
StaticPage: pageForReq(app, r),
IsCustomDomain: cr.isCustomDomain,
},
Tag: lang,
}
var owner *User
if u != nil {
displayPage.Username = u.Username
displayPage.IsOwner = u.ID == coll.OwnerID
if displayPage.IsOwner {
// Add in needed information for users viewing their own collection
owner = u
displayPage.CanPin = true
pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
displayPage.Collections = pubColls
}
}
isOwner := owner != nil
if !isOwner {
// Current user doesn't own collection; retrieve owner information
owner, err = app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
}
if owner.IsSilenced() {
return ErrCollectionNotFound
}
}
displayPage.Silenced = owner != nil && owner.IsSilenced()
displayPage.Owner = owner
coll.Owner = displayPage.Owner
// Add more data
// TODO: fix this mess of collections inside collections
displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj, isOwner)
displayPage.Monetization = app.db.GetCollectionAttribute(coll.ID, "monetization_pointer")
collTmpl := "collection"
if app.cfg.App.Chorus {
collTmpl = "chorus-collection"
}
err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage)
if err != nil {
log.Error("Unable to render collection lang page: %v", err)
}
return nil
}
func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
// Normalize the URL, redirecting user to consistent post URL
loc := fmt.Sprintf("/%s", slug)
if !app.cfg.App.SingleUser {
loc = fmt.Sprintf("/%s/%s", cr.alias, slug)
}
return impart.HTTPError{http.StatusFound, loc}
}
func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
collAlias := vars["alias"]
isWeb := r.FormValue("web") == "1"
u := &User{}
if reqJSON && !isWeb {
// Ensure an access token was given
accessToken := r.Header.Get("Authorization")
u.ID = app.db.GetUserID(accessToken)
if u.ID == -1 {
return ErrBadAccessToken
}
} else {
u = getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
}
silenced, err := app.db.IsUserSilenced(u.ID)
if err != nil {
log.Error("existing collection: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrUserSilenced
}
if r.Method == "DELETE" {
err := app.db.DeleteCollection(collAlias, u.ID)
if err != nil {
// TODO: if not HTTPError, report error to admin
log.Error("Unable to delete collection: %s", err)
return err
}
addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil)
return impart.HTTPError{Status: http.StatusNoContent}
}
c := SubmittedCollection{OwnerID: uint64(u.ID)}
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&c)
if err != nil {
log.Error("Couldn't parse collection update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err = r.ParseForm()
if err != nil {
log.Error("Couldn't parse collection update form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&c, r.PostForm)
if err != nil {
log.Error("Couldn't decode collection update form request: %v\n", err)
return ErrBadFormData
}
}
err = app.db.UpdateCollection(app, &c, collAlias)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if reqJSON {
return err
}
addSessionFlash(app, w, r, err.Message, nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
} else {
log.Error("Couldn't update collection: %v\n", err)
return err
}
}
if reqJSON {
return impart.WriteSuccess(w, struct {
}{}, http.StatusOK)
}
addSessionFlash(app, w, r, "Blog updated!", nil)
return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias}
}
// collectionAliasFromReq takes a request and returns the collection alias
// if it can be ascertained, as well as whether or not the collection uses a
// custom domain.
func collectionAliasFromReq(r *http.Request) string {
vars := mux.Vars(r)
alias := vars["subdomain"]
isSubdomain := alias != ""
if !isSubdomain {
// Fall back to write.as/{collection} since this isn't a custom domain
alias = vars["collection"]
}
return alias
}
func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error {
var readReq struct {
Alias string `schema:"alias" json:"alias"`
Pass string `schema:"password" json:"password"`
Next string `schema:"to" json:"to"`
}
// Get params
if impart.ReqJSON(r) {
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&readReq)
if err != nil {
log.Error("Couldn't parse readReq JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err := r.ParseForm()
if err != nil {
log.Error("Couldn't parse readReq form request: %v\n", err)
return ErrBadFormData
}
err = app.formDecoder.Decode(&readReq, r.PostForm)
if err != nil {
log.Error("Couldn't decode readReq form request: %v\n", err)
return ErrBadFormData
}
}
if readReq.Alias == "" {
return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."}
}
if readReq.Pass == "" {
return impart.HTTPError{http.StatusBadRequest, "Please supply a password."}
}
var collHashedPass []byte
err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass)
if err != nil {
if err == sql.ErrNoRows {
log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias)
return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."}
}
return err
}
if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
// Success; set cookie
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
session.Values[readReq.Alias] = true
err = session.Save(r, w)
if err != nil {
log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err)
}
}
next := "/" + readReq.Next
if !app.cfg.App.SingleUser {
next = "/" + readReq.Alias + next
}
return impart.HTTPError{http.StatusFound, next}
}
func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool {
authd := false
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err == nil {
_, authd = session.Values[alias]
}
return authd
}
func logOutCollection(app *App, alias string, w http.ResponseWriter, r *http.Request) error {
session, err := app.sessionStore.Get(r, blogPassCookieName)
if err != nil {
return err
}
// Remove this from map of blogs logged into
delete(session.Values, alias)
// If not auth'd with any blog, delete entire cookie
if len(session.Values) == 0 {
session.Options.MaxAge = -1
}
return session.Save(r, w)
}
func handleLogOutCollection(app *App, w http.ResponseWriter, r *http.Request) error {
alias := collectionAliasFromReq(r)
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
if !c.IsProtected() {
// Invalid to log out of this collection
return ErrCollectionPageNotFound
}
err = logOutCollection(app, c.Alias, w, r)
if err != nil {
addSessionFlash(app, w, r, "Logging out failed. Try clearing cookies for this site, instead.", nil)
}
return impart.HTTPError{http.StatusFound, c.CanonicalURL()}
}
diff --git a/database.go b/database.go
index c5f239f..84898e0 100644
--- a/database.go
+++ b/database.go
@@ -1,3297 +1,3330 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"context"
"database/sql"
"fmt"
"net/http"
"net/url"
"strings"
"time"
+ "github.com/writeas/monday"
+
"github.com/go-sql-driver/mysql"
"github.com/writeas/web-core/silobridge"
wf_db "github.com/writefreely/writefreely/db"
"github.com/writefreely/writefreely/parse"
"github.com/guregu/null"
"github.com/guregu/null/zero"
uuid "github.com/nu7hatch/gouuid"
"github.com/writeas/activityserve"
"github.com/writeas/impart"
"github.com/writeas/web-core/activitypub"
"github.com/writeas/web-core/auth"
"github.com/writeas/web-core/data"
"github.com/writeas/web-core/id"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/query"
"github.com/writefreely/writefreely/author"
"github.com/writefreely/writefreely/config"
"github.com/writefreely/writefreely/key"
)
const (
mySQLErrDuplicateKey = 1062
mySQLErrCollationMix = 1267
mySQLErrTooManyConns = 1040
mySQLErrMaxUserConns = 1203
driverMySQL = "mysql"
driverSQLite = "sqlite3"
)
var (
SQLiteEnabled bool
)
type writestore interface {
CreateUser(*config.Config, *User, string, string) error
UpdateUserEmail(keys *key.Keychain, userID int64, email string) error
UpdateEncryptedUserEmail(int64, []byte) error
GetUserByID(int64) (*User, error)
GetUserForAuth(string) (*User, error)
GetUserForAuthByID(int64) (*User, error)
GetUserNameFromToken(string) (string, error)
GetUserDataFromToken(string) (int64, string, error)
GetAPIUser(header string) (*User, error)
GetUserID(accessToken string) int64
GetUserIDPrivilege(accessToken string) (userID int64, sudo bool)
DeleteToken(accessToken []byte) error
FetchLastAccessToken(userID int64) string
GetAccessToken(userID int64) (string, error)
GetTemporaryAccessToken(userID int64, validSecs int) (string, error)
GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error)
DeleteAccount(userID int64) error
ChangeSettings(app *App, u *User, s *userSettings) error
ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error
GetCollections(u *User, hostName string) (*[]Collection, error)
GetPublishableCollections(u *User, hostName string) (*[]Collection, error)
GetMeStats(u *User) userMeStats
GetTotalCollections() (int64, error)
GetTotalPosts() (int64, error)
GetTopPosts(u *User, alias string, hostName string) (*[]PublicPost, error)
GetAnonymousPosts(u *User, page int) (*[]PublicPost, error)
GetUserPosts(u *User) (*[]PublicPost, error)
CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error)
CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error)
UpdateOwnedPost(post *AuthenticatedPost, userID int64) error
GetEditablePost(id, editToken string) (*PublicPost, error)
PostIDExists(id string) bool
GetPost(id string, collectionID int64) (*PublicPost, error)
GetOwnedPost(id string, ownerID int64) (*PublicPost, error)
GetPostProperty(id string, collectionID int64, property string) (interface{}, error)
CreateCollectionFromToken(*config.Config, string, string, string) (*Collection, error)
CreateCollection(*config.Config, string, string, int64) (*Collection, error)
GetCollectionBy(condition string, value interface{}) (*Collection, error)
GetCollection(alias string) (*Collection, error)
GetCollectionForPad(alias string) (*Collection, error)
GetCollectionByID(id int64) (*Collection, error)
UpdateCollection(app *App, c *SubmittedCollection, alias string) error
DeleteCollection(alias string, userID int64) error
UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error
GetLastPinnedPostPos(collID int64) int64
GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error)
RemoveCollectionRedirect(t *sql.Tx, alias string) error
GetCollectionRedirect(alias string) (new string)
IsCollectionAttributeOn(id int64, attr string) bool
CollectionHasAttribute(id int64, attr string) bool
CanCollect(cpr *ClaimPostRequest, userID int64) bool
AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error)
DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error)
ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error)
- GetPostsCount(c *CollectionObj, includeFuture bool)
- GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error)
+ GetPostLikeCounts(postID string) (int64, error)
+ GetPostsCount(c *CollectionObj, includeFuture bool) error
+ GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool, contentType PostType) (*[]PublicPost, error)
GetAllPostsTaggedIDs(c *Collection, tag string, includeFuture bool) ([]string, error)
GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error)
GetAPFollowers(c *Collection) (*[]RemoteUser, error)
GetAPActorKeys(collectionID int64) ([]byte, []byte)
CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error
GetUserInvites(userID int64) (*[]Invite, error)
GetUserInvite(id string) (*Invite, error)
GetUsersInvitedCount(id string) int64
CreateInvitedUser(inviteID string, userID int64) error
GetDynamicContent(id string) (*instanceContent, error)
UpdateDynamicContent(id, title, content, contentType string) error
GetAllUsers(page uint) (*[]User, error)
GetAllUsersCount() int64
GetUserLastPostTime(id int64) (*time.Time, error)
GetCollectionLastPostTime(id int64) (*time.Time, error)
GetIDForRemoteUser(context.Context, string, string, string) (int64, error)
RecordRemoteUserID(context.Context, int64, string, string, string, string) error
ValidateOAuthState(context.Context, string) (string, string, int64, string, error)
GenerateOAuthState(context.Context, string, string, int64, string) (string, error)
GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error)
RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error
DatabaseInitialized() bool
}
type datastore struct {
*sql.DB
driverName string
}
var _ writestore = &datastore{}
func (db *datastore) now() string {
if db.driverName == driverSQLite {
return "strftime('%Y-%m-%d %H:%M:%S','now')"
}
return "NOW()"
}
func (db *datastore) clip(field string, l int) string {
if db.driverName == driverSQLite {
return fmt.Sprintf("SUBSTR(%s, 0, %d)", field, l)
}
return fmt.Sprintf("LEFT(%s, %d)", field, l)
}
func (db *datastore) upsert(indexedCols ...string) string {
if db.driverName == driverSQLite {
// NOTE: SQLite UPSERT syntax only works in v3.24.0 (2018-06-04) or later
// Leaving this for whenever we can upgrade and include it in our binary
cc := strings.Join(indexedCols, ", ")
return "ON CONFLICT(" + cc + ") DO UPDATE SET"
}
return "ON DUPLICATE KEY UPDATE"
}
func (db *datastore) dateAdd(l int, unit string) string {
if db.driverName == driverSQLite {
return fmt.Sprintf("DATETIME('now', '%d %s')", l, unit)
}
return fmt.Sprintf("DATE_ADD(NOW(), INTERVAL %d %s)", l, unit)
}
func (db *datastore) dateSub(l int, unit string) string {
if db.driverName == driverSQLite {
return fmt.Sprintf("DATETIME('now', '-%d %s')", l, unit)
}
return fmt.Sprintf("DATE_SUB(NOW(), INTERVAL %d %s)", l, unit)
}
// CreateUser creates a new user in the database from the given User, UPDATING it in the process with the user's ID.
func (db *datastore) CreateUser(cfg *config.Config, u *User, collectionTitle string, collectionDesc string) error {
if db.PostIDExists(u.Username) {
return impart.HTTPError{http.StatusConflict, "Invalid collection name."}
}
// New users get a `users` and `collections` row.
t, err := db.Begin()
if err != nil {
return err
}
// 1. Add to `users` table
// NOTE: Assumes User's Password is already hashed!
res, err := t.Exec("INSERT INTO users (username, password, email) VALUES (?, ?, ?)", u.Username, u.HashedPass, u.Email)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Rolling back users INSERT: %v\n", err)
return err
}
u.ID, err = res.LastInsertId()
if err != nil {
t.Rollback()
log.Error("Rolling back after LastInsertId: %v\n", err)
return err
}
// 2. Create user's Collection
if collectionTitle == "" {
collectionTitle = u.Username
}
res, err = t.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", u.Username, collectionTitle, collectionDesc, defaultVisibility(cfg), u.ID, 0)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Rolling back collections INSERT: %v\n", err)
return err
}
db.RemoveCollectionRedirect(t, u.Username)
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return err
}
return nil
}
// FIXME: We're returning errors inconsistently in this file. Do we use Errorf
// for returned value, or impart?
func (db *datastore) UpdateUserEmail(keys *key.Keychain, userID int64, email string) error {
encEmail, err := data.Encrypt(keys.EmailKey, email)
if err != nil {
return fmt.Errorf("Couldn't encrypt email %s: %s\n", email, err)
}
return db.UpdateEncryptedUserEmail(userID, encEmail)
}
func (db *datastore) UpdateEncryptedUserEmail(userID int64, encEmail []byte) error {
_, err := db.Exec("UPDATE users SET email = ? WHERE id = ?", encEmail, userID)
if err != nil {
return fmt.Errorf("Unable to update user email: %s", err)
}
return nil
}
func (db *datastore) CreateCollectionFromToken(cfg *config.Config, alias, title, accessToken string) (*Collection, error) {
userID := db.GetUserID(accessToken)
if userID == -1 {
return nil, ErrBadAccessToken
}
return db.CreateCollection(cfg, alias, title, userID)
}
func (db *datastore) GetUserCollectionCount(userID int64) (uint64, error) {
var collCount uint64
err := db.QueryRow("SELECT COUNT(*) FROM collections WHERE owner_id = ?", userID).Scan(&collCount)
switch {
case err == sql.ErrNoRows:
return 0, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user from database."}
case err != nil:
log.Error("Couldn't get collections count for user %d: %v", userID, err)
return 0, err
}
return collCount, nil
}
func (db *datastore) CreateCollection(cfg *config.Config, alias, title string, userID int64) (*Collection, error) {
if db.PostIDExists(alias) {
return nil, impart.HTTPError{http.StatusConflict, "Invalid collection name."}
}
// All good, so create new collection
res, err := db.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", alias, title, "", defaultVisibility(cfg), userID, 0)
if err != nil {
if db.isDuplicateKeyErr(err) {
return nil, impart.HTTPError{http.StatusConflict, "Collection already exists."}
}
log.Error("Couldn't add to collections: %v\n", err)
return nil, err
}
c := &Collection{
Alias: alias,
Title: title,
OwnerID: userID,
PublicOwner: false,
Public: defaultVisibility(cfg) == CollPublic,
}
c.ID, err = res.LastInsertId()
if err != nil {
log.Error("Couldn't get collection LastInsertId: %v\n", err)
}
return c, nil
}
func (db *datastore) GetUserByID(id int64) (*User, error) {
u := &User{ID: id}
err := db.QueryRow("SELECT username, password, email, created, status FROM users WHERE id = ?", id).Scan(&u.Username, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password: %v", err)
return nil, err
}
return u, nil
}
// IsUserSilenced returns true if the user account associated with id is
// currently silenced.
func (db *datastore) IsUserSilenced(id int64) (bool, error) {
u := &User{ID: id}
err := db.QueryRow("SELECT status FROM users WHERE id = ?", id).Scan(&u.Status)
switch {
case err == sql.ErrNoRows:
return false, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user status: %v", err)
return false, fmt.Errorf("is user silenced: %v", err)
}
return u.IsSilenced(), nil
}
// DoesUserNeedAuth returns true if the user hasn't provided any methods for
// authenticating with the account, such a passphrase or email address.
// Any errors are reported to admin and silently quashed, returning false as the
// result.
func (db *datastore) DoesUserNeedAuth(id int64) bool {
var pass, email []byte
// Find out if user has an email set first
err := db.QueryRow("SELECT password, email FROM users WHERE id = ?", id).Scan(&pass, &email)
switch {
case err == sql.ErrNoRows:
// ERROR. Don't give false positives on needing auth methods
return false
case err != nil:
// ERROR. Don't give false positives on needing auth methods
log.Error("Couldn't SELECT user %d from users: %v", id, err)
return false
}
// User doesn't need auth if there's an email
return len(email) == 0 && len(pass) == 0
}
func (db *datastore) IsUserPassSet(id int64) (bool, error) {
var pass []byte
err := db.QueryRow("SELECT password FROM users WHERE id = ?", id).Scan(&pass)
switch {
case err == sql.ErrNoRows:
return false, nil
case err != nil:
log.Error("Couldn't SELECT user %d from users: %v", id, err)
return false, err
}
return len(pass) > 0, nil
}
func (db *datastore) GetUserForAuth(username string) (*User, error) {
u := &User{Username: username}
err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE username = ?", username).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
// Check if they've entered the wrong, unnormalized username
username = getSlug(username, "")
if username != u.Username {
err = db.QueryRow("SELECT id FROM users WHERE username = ? LIMIT 1", username).Scan(&u.ID)
if err == nil {
return db.GetUserForAuth(username)
}
}
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password: %v", err)
return nil, err
}
return u, nil
}
func (db *datastore) GetUserForAuthByID(userID int64) (*User, error) {
u := &User{ID: userID}
err := db.QueryRow("SELECT id, password, email, created, status FROM users WHERE id = ?", u.ID).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created, &u.Status)
switch {
case err == sql.ErrNoRows:
return nil, ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT userForAuthByID: %v", err)
return nil, err
}
return u, nil
}
func (db *datastore) GetUserNameFromToken(accessToken string) (string, error) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return "", ErrNoAccessToken
}
var oneTime bool
var username string
err := db.QueryRow("SELECT username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&username, &oneTime)
switch {
case err == sql.ErrNoRows:
return "", ErrBadAccessToken
case err != nil:
return "", ErrInternalGeneral
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return username, nil
}
func (db *datastore) GetUserDataFromToken(accessToken string) (int64, string, error) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return 0, "", ErrNoAccessToken
}
var userID int64
var oneTime bool
var username string
err := db.QueryRow("SELECT user_id, username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &username, &oneTime)
switch {
case err == sql.ErrNoRows:
return 0, "", ErrBadAccessToken
case err != nil:
return 0, "", ErrInternalGeneral
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return userID, username, nil
}
func (db *datastore) GetAPIUser(header string) (*User, error) {
uID := db.GetUserID(header)
if uID == -1 {
return nil, fmt.Errorf(ErrUserNotFound.Error())
}
return db.GetUserByID(uID)
}
// GetUserID takes a hexadecimal accessToken, parses it into its binary
// representation, and gets any user ID associated with the token. If no user
// is associated, -1 is returned.
func (db *datastore) GetUserID(accessToken string) int64 {
i, _ := db.GetUserIDPrivilege(accessToken)
return i
}
func (db *datastore) GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) {
t := auth.GetToken(accessToken)
if len(t) == 0 {
return -1, false
}
var oneTime bool
err := db.QueryRow("SELECT user_id, sudo, one_time FROM accesstokens WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &sudo, &oneTime)
switch {
case err == sql.ErrNoRows:
return -1, false
case err != nil:
return -1, false
}
// Delete token if it was one-time
if oneTime {
db.DeleteToken(t[:])
}
return
}
func (db *datastore) DeleteToken(accessToken []byte) error {
res, err := db.Exec("DELETE FROM accesstokens WHERE token LIKE ?", accessToken)
if err != nil {
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
return impart.HTTPError{http.StatusNotFound, "Token is invalid or doesn't exist"}
}
return nil
}
// FetchLastAccessToken creates a new non-expiring, valid access token for the given
// userID.
func (db *datastore) FetchLastAccessToken(userID int64) string {
var t []byte
err := db.QueryRow("SELECT token FROM accesstokens WHERE user_id = ? AND (expires IS NULL OR expires > "+db.now()+") ORDER BY created DESC LIMIT 1", userID).Scan(&t)
switch {
case err == sql.ErrNoRows:
return ""
case err != nil:
log.Error("Failed selecting from accesstoken: %v", err)
return ""
}
u, err := uuid.Parse(t)
if err != nil {
return ""
}
return u.String()
}
// GetAccessToken creates a new non-expiring, valid access token for the given
// userID.
func (db *datastore) GetAccessToken(userID int64) (string, error) {
return db.GetTemporaryOneTimeAccessToken(userID, 0, false)
}
// GetTemporaryAccessToken creates a new valid access token for the given
// userID that remains valid for the given time in seconds. If validSecs is 0,
// the access token doesn't automatically expire.
func (db *datastore) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) {
return db.GetTemporaryOneTimeAccessToken(userID, validSecs, false)
}
// GetTemporaryOneTimeAccessToken creates a new valid access token for the given
// userID that remains valid for the given time in seconds and can only be used
// once if oneTime is true. If validSecs is 0, the access token doesn't
// automatically expire.
func (db *datastore) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) {
u, err := uuid.NewV4()
if err != nil {
log.Error("Unable to generate token: %v", err)
return "", err
}
// Insert UUID to `accesstokens`
binTok := u[:]
expirationVal := "NULL"
if validSecs > 0 {
expirationVal = db.dateAdd(validSecs, "SECOND")
}
_, err = db.Exec("INSERT INTO accesstokens (token, user_id, one_time, expires) VALUES (?, ?, ?, "+expirationVal+")", string(binTok), userID, oneTime)
if err != nil {
log.Error("Couldn't INSERT accesstoken: %v", err)
return "", err
}
return u.String(), nil
}
func (db *datastore) CreatePasswordResetToken(userID int64) (string, error) {
t := id.Generate62RandomString(32)
_, err := db.Exec("INSERT INTO password_resets (user_id, token, used, created) VALUES (?, ?, 0, "+db.now()+")", userID, t)
if err != nil {
log.Error("Couldn't INSERT password_resets: %v", err)
return "", err
}
return t, nil
}
func (db *datastore) GetUserFromPasswordReset(token string) int64 {
var userID int64
err := db.QueryRow("SELECT user_id FROM password_resets WHERE token = ? AND used = 0 AND created > "+db.dateSub(3, "HOUR"), token).Scan(&userID)
if err != nil {
return 0
}
return userID
}
func (db *datastore) ConsumePasswordResetToken(t string) error {
_, err := db.Exec("UPDATE password_resets SET used = 1 WHERE token = ?", t)
if err != nil {
log.Error("Couldn't UPDATE password_resets: %v", err)
return err
}
return nil
}
func (db *datastore) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) {
var userID, collID int64 = -1, -1
var coll *Collection
var err error
if accessToken != "" {
userID = db.GetUserID(accessToken)
if userID == -1 {
return nil, ErrBadAccessToken
}
if collAlias != "" {
coll, err = db.GetCollection(collAlias)
if err != nil {
return nil, err
}
coll.hostName = hostName
if coll.OwnerID != userID {
return nil, ErrForbiddenCollection
}
collID = coll.ID
}
}
rp := &PublicPost{}
rp.Post, err = db.CreatePost(userID, collID, post)
if err != nil {
return rp, err
}
if coll != nil {
coll.ForPublic()
rp.Collection = &CollectionObj{Collection: *coll}
}
return rp, nil
}
func (db *datastore) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) {
idLen := postIDLen
friendlyID := id.GenerateFriendlyRandomString(idLen)
// Handle appearance / font face
appearance := post.Font
if !post.isFontValid() {
appearance = "norm"
}
var err error
ownerID := sql.NullInt64{
Valid: false,
}
ownerCollID := sql.NullInt64{
Valid: false,
}
slug := sql.NullString{"", false}
// If an alias was supplied, we'll add this to the collection as well.
if userID > 0 {
ownerID.Int64 = userID
ownerID.Valid = true
if collID > 0 {
ownerCollID.Int64 = collID
ownerCollID.Valid = true
var slugVal string
if post.Slug != nil && *post.Slug != "" {
slugVal = *post.Slug
} else {
if post.Title != nil && *post.Title != "" {
slugVal = getSlug(*post.Title, post.Language.String)
if slugVal == "" {
slugVal = getSlug(*post.Content, post.Language.String)
}
} else {
slugVal = getSlug(*post.Content, post.Language.String)
}
}
if slugVal == "" {
slugVal = friendlyID
}
slug = sql.NullString{slugVal, true}
}
}
created := time.Now()
if db.driverName == driverSQLite {
// SQLite stores datetimes in UTC, so convert time.Now() to it here
created = created.UTC()
}
if post.Created != nil && *post.Created != "" {
created, err = time.Parse("2006-01-02T15:04:05Z", *post.Created)
if err != nil {
log.Error("Unable to parse Created time '%s': %v", *post.Created, err)
created = time.Now()
if db.driverName == driverSQLite {
// SQLite stores datetimes in UTC, so convert time.Now() to it here
created = created.UTC()
}
}
}
stmt, err := db.Prepare("INSERT INTO posts (id, slug, title, content, text_appearance, language, rtl, privacy, owner_id, collection_id, created, updated, view_count) VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?, ?, " + db.now() + ", ?)")
if err != nil {
return nil, err
}
defer stmt.Close()
_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
if err != nil {
if db.isDuplicateKeyErr(err) {
// Duplicate entry error; try a new slug
// TODO: make this a little more robust
slug = sql.NullString{id.GenSafeUniqueSlug(slug.String), true}
_, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0)
if err != nil {
return nil, handleFailedPostInsert(fmt.Errorf("Retried slug generation, still failed: %v", err))
}
} else {
return nil, handleFailedPostInsert(err)
}
}
// TODO: return Created field in proper format
return &Post{
ID: friendlyID,
Slug: null.NewString(slug.String, slug.Valid),
Font: appearance,
Language: zero.NewString(post.Language.String, post.Language.Valid),
RTL: zero.NewBool(post.IsRTL.Bool, post.IsRTL.Valid),
OwnerID: null.NewInt(userID, true),
CollectionID: null.NewInt(userID, true),
Created: created.Truncate(time.Second).UTC(),
Updated: time.Now().Truncate(time.Second).UTC(),
Title: zero.NewString(*(post.Title), true),
Content: *(post.Content),
}, nil
}
// UpdateOwnedPost updates an existing post with only the given fields in the
// supplied AuthenticatedPost.
func (db *datastore) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error {
params := []interface{}{}
var queryUpdates, sep, authCondition string
if post.Slug != nil && *post.Slug != "" {
queryUpdates += sep + "slug = ?"
sep = ", "
params = append(params, getSlug(*post.Slug, ""))
}
if post.Content != nil {
queryUpdates += sep + "content = ?"
sep = ", "
params = append(params, post.Content)
}
if post.Title != nil {
queryUpdates += sep + "title = ?"
sep = ", "
params = append(params, post.Title)
}
if post.Language.Valid {
queryUpdates += sep + "language = ?"
sep = ", "
params = append(params, post.Language.String)
}
if post.IsRTL.Valid {
queryUpdates += sep + "rtl = ?"
sep = ", "
params = append(params, post.IsRTL.Bool)
}
if post.Font != "" {
queryUpdates += sep + "text_appearance = ?"
sep = ", "
params = append(params, post.Font)
}
if post.Created != nil {
createTime, err := time.Parse(postMetaDateFormat, *post.Created)
if err != nil {
log.Error("Unable to parse Created date: %v", err)
return fmt.Errorf("That's the incorrect format for Created date.")
}
queryUpdates += sep + "created = ?"
sep = ", "
params = append(params, createTime)
}
// WHERE parameters...
// id = ?
params = append(params, post.ID)
// AND owner_id = ?
authCondition = "(owner_id = ?)"
params = append(params, userID)
if queryUpdates == "" {
return ErrPostNoUpdatableVals
}
queryUpdates += sep + "updated = " + db.now()
res, err := db.Exec("UPDATE posts SET "+queryUpdates+" WHERE id = ? AND "+authCondition, params...)
if err != nil {
log.Error("Unable to update owned post: %v", err)
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND "+authCondition, post.ID, params[len(params)-1]).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedEditPost
case err != nil:
log.Error("Failed selecting from posts: %v", err)
}
return nil
}
return nil
}
func (db *datastore) GetCollectionBy(condition string, value interface{}) (*Collection, error) {
c := &Collection{}
// FIXME: change Collection to reflect database values. Add helper functions to get actual values
var styleSheet, script, signature, format zero.String
row := db.QueryRow("SELECT id, alias, title, description, style_sheet, script, post_signature, format, owner_id, privacy, view_count FROM collections WHERE "+condition, value)
err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &styleSheet, &script, &signature, &format, &c.OwnerID, &c.Visibility, &c.Views)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
case db.isHighLoadError(err):
return nil, ErrUnavailable
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
c.StyleSheet = styleSheet.String
c.Script = script.String
c.Signature = signature.String
c.Format = format.String
c.Public = c.IsPublic()
c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")
c.Verification = db.GetCollectionAttribute(c.ID, "verification_link")
c.db = db
return c, nil
}
func (db *datastore) GetCollection(alias string) (*Collection, error) {
return db.GetCollectionBy("alias = ?", alias)
}
func (db *datastore) GetCollectionForPad(alias string) (*Collection, error) {
c := &Collection{Alias: alias}
row := db.QueryRow("SELECT id, alias, title, description, privacy FROM collections WHERE alias = ?", alias)
err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility)
switch {
case err == sql.ErrNoRows:
return c, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."}
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return c, ErrInternalGeneral
}
c.Public = c.IsPublic()
return c, nil
}
func (db *datastore) GetCollectionByID(id int64) (*Collection, error) {
return db.GetCollectionBy("id = ?", id)
}
func (db *datastore) GetCollectionFromDomain(host string) (*Collection, error) {
return db.GetCollectionBy("host = ?", host)
}
func (db *datastore) UpdateCollection(app *App, c *SubmittedCollection, alias string) error {
// Truncate fields correctly, so we don't get "Data too long for column" errors in MySQL (writefreely#600)
if c.Title != nil {
*c.Title = parse.Truncate(*c.Title, collMaxLengthTitle)
}
if c.Description != nil {
*c.Description = parse.Truncate(*c.Description, collMaxLengthDescription)
}
q := query.NewUpdate().
SetStringPtr(c.Title, "title").
SetStringPtr(c.Description, "description").
SetStringPtr(c.StyleSheet, "style_sheet").
SetStringPtr(c.Script, "script").
SetStringPtr(c.Signature, "post_signature")
if c.Format != nil {
cf := &CollectionFormat{Format: c.Format.String}
if cf.Valid() {
q.SetNullString(c.Format, "format")
}
}
var updatePass bool
if c.Visibility != nil && (collVisibility(*c.Visibility)&CollProtected == 0 || c.Pass != "") {
q.SetIntPtr(c.Visibility, "privacy")
if c.Pass != "" {
updatePass = true
}
}
// WHERE values
q.Where("alias = ? AND owner_id = ?", alias, c.OwnerID)
if q.Updates == "" && c.Monetization == nil {
return ErrPostNoUpdatableVals
}
// Find any current domain
var collID int64
var rowsAffected int64
var changed bool
var res sql.Result
err := db.QueryRow("SELECT id FROM collections WHERE alias = ?", alias).Scan(&collID)
if err != nil {
log.Error("Failed selecting from collections: %v. Some things won't work.", err)
}
// Update MathJax value
if c.MathJax {
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", collID, "render_mathjax", "1")
} else {
_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "render_mathjax", "1", "1")
}
if err != nil {
log.Error("Unable to insert render_mathjax value: %v", err)
return err
}
} else {
_, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "render_mathjax")
if err != nil {
log.Error("Unable to delete render_mathjax value: %v", err)
return err
}
}
// Update Verification link value
if c.Verification != nil {
skipUpdate := false
if *c.Verification != "" {
// Strip away any excess spaces
trimmed := strings.TrimSpace(*c.Verification)
if strings.HasPrefix(trimmed, "@") && strings.Count(trimmed, "@") == 2 {
// This looks like a fediverse handle, so resolve profile URL
profileURL, err := GetProfileURLFromHandle(app, trimmed)
if err != nil || profileURL == "" {
log.Error("Couldn't find user %s: %v", trimmed, err)
skipUpdate = true
} else {
c.Verification = &profileURL
}
} else {
if !strings.HasPrefix(trimmed, "http") {
trimmed = "https://" + trimmed
}
vu, err := url.Parse(trimmed)
if err != nil {
// Value appears invalid, so don't update
skipUpdate = true
} else {
s := vu.String()
c.Verification = &s
}
}
}
if !skipUpdate {
err = db.SetCollectionAttribute(collID, "verification_link", *c.Verification)
if err != nil {
log.Error("Unable to insert verification_link value: %v", err)
return err
}
}
}
// Update Monetization value
if c.Monetization != nil {
skipUpdate := false
if *c.Monetization != "" {
// Strip away any excess spaces
trimmed := strings.TrimSpace(*c.Monetization)
// Only update value when it starts with "$", per spec: https://paymentpointers.org
if strings.HasPrefix(trimmed, "$") {
c.Monetization = &trimmed
} else {
// Value appears invalid, so don't update
skipUpdate = true
}
}
if !skipUpdate {
_, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "monetization_pointer", *c.Monetization, *c.Monetization)
if err != nil {
log.Error("Unable to insert monetization_pointer value: %v", err)
return err
}
}
}
// Update EmailSub value
if c.EmailSubs {
err = db.SetCollectionAttribute(collID, "email_subs", "1")
if err != nil {
log.Error("Unable to insert email_subs value: %v", err)
return err
}
skipUpdate := false
if c.LetterReply != nil {
// Strip away any excess spaces
trimmed := strings.TrimSpace(*c.LetterReply)
// Only update value when it contains "@"
if strings.IndexRune(trimmed, '@') > 0 {
c.LetterReply = &trimmed
} else {
// Value appears invalid, so don't update
skipUpdate = true
}
if !skipUpdate {
err = db.SetCollectionAttribute(collID, collAttrLetterReplyTo, *c.LetterReply)
if err != nil {
log.Error("Unable to insert %s value: %v", collAttrLetterReplyTo, err)
return err
}
}
}
} else {
_, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "email_subs")
if err != nil {
log.Error("Unable to delete email_subs value: %v", err)
return err
}
}
// Update rest of the collection data
if q.Updates != "" {
res, err = db.Exec("UPDATE collections SET "+q.Updates+" WHERE "+q.Conditions, q.Params...)
if err != nil {
log.Error("Unable to update collection: %v", err)
return err
}
}
rowsAffected, _ = res.RowsAffected()
if !changed || rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM collections WHERE alias = ? AND owner_id = ?", alias, c.OwnerID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedEditPost
case err != nil:
log.Error("Failed selecting from collections: %v", err)
}
if !updatePass {
return nil
}
}
if updatePass {
hashedPass, err := auth.HashPass([]byte(c.Pass))
if err != nil {
log.Error("Unable to create hash: %s", err)
return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
}
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?)", alias, hashedPass)
} else {
_, err = db.Exec("INSERT INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?) "+db.upsert("collection_id")+" password = ?", alias, hashedPass, hashedPass)
}
if err != nil {
return err
}
}
return nil
}
const postCols = "id, slug, text_appearance, language, rtl, privacy, owner_id, collection_id, pinned_position, created, updated, view_count, title, content"
// getEditablePost returns a PublicPost with the given ID only if the given
// edit token is valid for the post.
func (db *datastore) GetEditablePost(id, editToken string) (*PublicPost, error) {
// FIXME: code duplicated from getPost()
// TODO: add slight logic difference to getPost / one func
var ownerName sql.NullString
p := &Post{}
row := db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE id = ? LIMIT 1", id)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
switch {
case err == sql.ErrNoRows:
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
if ownerName.Valid {
res.Owner = &PublicUser{Username: ownerName.String}
}
return &res, nil
}
func (db *datastore) PostIDExists(id string) bool {
var dummy bool
err := db.QueryRow("SELECT 1 FROM posts WHERE id = ?", id).Scan(&dummy)
return err == nil && dummy
}
// GetPost gets a public-facing post object from the database. If collectionID
// is > 0, the post will be retrieved by slug and collection ID, rather than
// post ID.
// TODO: break this into two functions:
// - GetPost(id string)
// - GetCollectionPost(slug string, collectionID int64)
func (db *datastore) GetPost(id string, collectionID int64) (*PublicPost, error) {
var ownerName sql.NullString
p := &Post{}
var row *sql.Row
var where string
params := []interface{}{id}
if collectionID > 0 {
where = "slug = ? AND collection_id = ?"
params = append(params, collectionID)
} else {
where = "id = ?"
}
row = db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE "+where+" LIMIT 1", params...)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName)
switch {
case err == sql.ErrNoRows:
if collectionID > 0 {
return nil, ErrCollectionPageNotFound
}
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
+ // Get additional information needed before processing post data
+ p.LikeCount, err = db.GetPostLikeCounts(p.ID)
+ if err != nil {
+ return nil, err
+ }
+
res := p.processPost()
if ownerName.Valid {
res.Owner = &PublicUser{Username: ownerName.String}
}
return &res, nil
}
// TODO: don't duplicate getPost() functionality
func (db *datastore) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) {
p := &Post{}
var row *sql.Row
where := "id = ? AND owner_id = ?"
params := []interface{}{id, ownerID}
row = db.QueryRow("SELECT "+postCols+" FROM posts WHERE "+where+" LIMIT 1", params...)
err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
switch {
case err == sql.ErrNoRows:
return nil, ErrPostNotFound
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return nil, err
}
if p.Content == "" && p.Title.String == "" {
return nil, ErrPostUnpublished
}
res := p.processPost()
return &res, nil
}
func (db *datastore) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) {
propSelects := map[string]string{
"views": "view_count AS views",
}
selectQuery, ok := propSelects[property]
if !ok {
return nil, impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid property: %s.", property)}
}
var res interface{}
var row *sql.Row
if collectionID != 0 {
row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE slug = ? AND collection_id = ? LIMIT 1", id, collectionID)
} else {
row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE id = ? LIMIT 1", id)
}
err := row.Scan(&res)
switch {
case err == sql.ErrNoRows:
return nil, impart.HTTPError{http.StatusNotFound, "Post not found."}
case err != nil:
log.Error("Failed selecting post: %v", err)
return nil, err
}
return res, nil
}
+func (db *datastore) GetPostLikeCounts(postID string) (int64, error) {
+ var count int64
+ err := db.QueryRow("SELECT COUNT(*) FROM remote_likes WHERE post_id = ?", postID).Scan(&count)
+ switch {
+ case err == sql.ErrNoRows:
+ count = 0
+ case err != nil:
+ return 0, err
+ }
+ return count, nil
+}
+
// GetPostsCount modifies the CollectionObj to include the correct number of
// standard (non-pinned) posts. It will return future posts if `includeFuture`
// is true.
-func (db *datastore) GetPostsCount(c *CollectionObj, includeFuture bool) {
+func (db *datastore) GetPostsCount(c *CollectionObj, includeFuture bool) error {
var count int64
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND pinned_position IS NULL "+timeCondition, c.ID).Scan(&count)
switch {
case err == sql.ErrNoRows:
c.TotalPosts = 0
case err != nil:
log.Error("Failed selecting from collections: %v", err)
c.TotalPosts = 0
+ return err
}
c.TotalPosts = int(count)
+ return nil
}
// GetPosts retrieves all posts for the given Collection.
// It will return future posts if `includeFuture` is true.
// It will include only standard (non-pinned) posts unless `includePinned` is true.
// TODO: change includeFuture to isOwner, since that's how it's used
-func (db *datastore) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) {
+func (db *datastore) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool, contentType PostType) (*[]PublicPost, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() && !forceRecentFirst {
order = "ASC"
}
pagePosts := cf.PostsPerPage()
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
+ } else if contentType == postArch {
+ pagePosts = postsPerArchPage
+ start = page*pagePosts - pagePosts
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
pinnedCondition := ""
if !includePinned {
pinnedCondition = "AND pinned_position IS NULL"
}
+ // FUTURE: handle different post contentType's here
rows, err := db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? "+pinnedCondition+" "+timeCondition+" ORDER BY created "+order+limitStr, collID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
}
defer rows.Close()
// TODO: extract this common row scanning logic for queries using `postCols`
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.augmentContent(c)
p.formatContent(cfg, c, includeFuture, false)
- posts = append(posts, p.processPost())
+ pubPost := p.processPost()
+ if contentType == postArch {
+ // Overwrite DisplayDate with special Archive page version
+ loc := monday.FuzzyLocale(pubPost.Language.String)
+ pubPost.DisplayDate = monday.Format(pubPost.Created, monday.LongNoYrFormatsByLocale[loc], loc)
+ }
+ posts = append(posts, pubPost)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetAllPostsTaggedIDs(c *Collection, tag string, includeFuture bool) ([]string, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() {
order = "ASC"
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
var rows *sql.Rows
var err error
if db.driverName == driverSQLite {
rows, err = db.Query("SELECT id FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order, collID, `.*#`+strings.ToLower(tag)+`\b.*`)
} else {
rows, err = db.Query("SELECT id FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order, collID, "#"+strings.ToLower(tag)+"[[:>:]]")
}
if err != nil {
log.Error("Failed selecting tagged posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve tagged collection posts."}
}
defer rows.Close()
ids := []string{}
for rows.Next() {
var id string
err = rows.Scan(&id)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
ids = append(ids, id)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return ids, nil
}
// GetPostsTagged retrieves all posts on the given Collection that contain the
// given tag.
// It will return future posts if `includeFuture` is true.
// TODO: change includeFuture to isOwner, since that's how it's used
func (db *datastore) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() {
order = "ASC"
}
pagePosts := cf.PostsPerPage()
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
var rows *sql.Rows
var err error
if db.driverName == driverSQLite {
rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, `.*#`+strings.ToLower(tag)+`\b.*`)
} else {
rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, "#"+strings.ToLower(tag)+"[[:>:]]")
}
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
}
defer rows.Close()
// TODO: extract this common row scanning logic for queries using `postCols`
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.augmentContent(c)
p.formatContent(cfg, c, includeFuture, false)
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetCollLangTotalPosts(collID int64, lang string) (uint64, error) {
var articles uint64
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND language = ? AND created <= "+db.now(), collID, lang).Scan(&articles)
if err != nil && err != sql.ErrNoRows {
log.Error("Couldn't get total lang posts count for collection %d: %v", collID, err)
return 0, err
}
return articles, nil
}
func (db *datastore) GetLangPosts(cfg *config.Config, c *Collection, lang string, page int, includeFuture bool) (*[]PublicPost, error) {
collID := c.ID
cf := c.NewFormat()
order := "DESC"
if cf.Ascending() {
order = "ASC"
}
pagePosts := cf.PostsPerPage()
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
rows, err := db.Query(`SELECT `+postCols+`
FROM posts
WHERE collection_id = ? AND language = ? `+timeCondition+`
ORDER BY created `+order+limitStr, collID, lang)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."}
}
defer rows.Close()
// TODO: extract this common row scanning logic for queries using `postCols`
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.augmentContent(c)
p.formatContent(cfg, c, includeFuture, false)
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetAPFollowers(c *Collection) (*[]RemoteUser, error) {
rows, err := db.Query("SELECT actor_id, inbox, shared_inbox, f.created FROM remotefollows f INNER JOIN remoteusers u ON f.remote_user_id = u.id WHERE collection_id = ?", c.ID)
if err != nil {
log.Error("Failed selecting from followers: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve followers."}
}
defer rows.Close()
followers := []RemoteUser{}
for rows.Next() {
f := RemoteUser{}
err = rows.Scan(&f.ActorID, &f.Inbox, &f.SharedInbox, &f.Created)
followers = append(followers, f)
}
return &followers, nil
}
// CanCollect returns whether or not the given user can add the given post to a
// collection. This is true when a post is already owned by the user.
// NOTE: this is currently only used to potentially add owned posts to a
// collection. This has the SIDE EFFECT of also generating a slug for the post.
// FIXME: make this side effect more explicit (or extract it)
func (db *datastore) CanCollect(cpr *ClaimPostRequest, userID int64) bool {
var title, content string
var lang sql.NullString
err := db.QueryRow("SELECT title, content, language FROM posts WHERE id = ? AND owner_id = ?", cpr.ID, userID).Scan(&title, &content, &lang)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Failed on post CanCollect(%s, %d): %v", cpr.ID, userID, err)
return false
}
// Since we have the post content and the post is collectable, generate the
// post's slug now.
cpr.Slug = getSlugFromPost(title, content, lang.String)
return true
}
func (db *datastore) AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) {
qRes, err := db.Exec(query, params...)
if err != nil {
if db.isDuplicateKeyErr(err) && slugIdx > -1 {
s := id.GenSafeUniqueSlug(p.Slug)
if s == p.Slug {
// Sanity check to prevent infinite recursion
return qRes, fmt.Errorf("GenSafeUniqueSlug generated nothing unique: %s", s)
}
p.Slug = s
params[slugIdx] = p.Slug
return db.AttemptClaim(p, query, params, slugIdx)
}
return qRes, fmt.Errorf("attemptClaim: %s", err)
}
return qRes, nil
}
func (db *datastore) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) {
postClaimReqs := map[string]bool{}
res := []ClaimPostResult{}
for i := range postIDs {
postID := postIDs[i]
r := ClaimPostResult{Code: 0, ErrorMessage: ""}
// Perform post validation
if postID == "" {
r.ErrorMessage = "Missing post ID. "
}
if _, ok := postClaimReqs[postID]; ok {
r.Code = 429
r.ErrorMessage = "You've already tried anonymizing this post."
r.ID = postID
res = append(res, r)
continue
}
postClaimReqs[postID] = true
var err error
// Get full post information to return
var fullPost *PublicPost
fullPost, err = db.GetPost(postID, 0)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
r.ID = postID
res = append(res, r)
continue
} else {
log.Error("Error getting post in dispersePosts: %v", err)
}
}
if fullPost.OwnerID.Int64 != userID {
r.Code = http.StatusConflict
r.ErrorMessage = "Post is already owned by someone else."
r.ID = postID
res = append(res, r)
continue
}
var qRes sql.Result
var query string
var params []interface{}
// Do AND owner_id = ? for sanity.
// This should've been caught and returned with a good error message
// just above.
query = "UPDATE posts SET collection_id = NULL WHERE id = ? AND owner_id = ?"
params = []interface{}{postID, userID}
qRes, err = db.Exec(query, params...)
if err != nil {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "A glitch happened on our end."
r.ID = postID
res = append(res, r)
log.Error("dispersePosts (post %s): %v", postID, err)
continue
}
// Post was successfully dispersed
r.Code = http.StatusOK
r.Post = fullPost
rowsAffected, _ := qRes.RowsAffected()
if rowsAffected == 0 {
// This was already claimed, but return 200
r.Code = http.StatusOK
}
res = append(res, r)
}
return &res, nil
}
func (db *datastore) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) {
postClaimReqs := map[string]bool{}
res := []ClaimPostResult{}
postCollAlias := collAlias
for i := range *posts {
p := (*posts)[i]
if &p == nil {
continue
}
r := ClaimPostResult{Code: 0, ErrorMessage: ""}
// Perform post validation
if p.ID == "" {
r.ErrorMessage = "Missing post ID `id`. "
}
if _, ok := postClaimReqs[p.ID]; ok {
r.Code = 429
r.ErrorMessage = "You've already tried claiming this post."
r.ID = p.ID
res = append(res, r)
continue
}
postClaimReqs[p.ID] = true
canCollect := db.CanCollect(&p, userID)
if !canCollect && p.Token == "" {
// TODO: ensure post isn't owned by anyone else when a valid modify
// token is given.
r.ErrorMessage += "Missing post Edit Token `token`."
}
if r.ErrorMessage != "" {
// Post validate failed
r.Code = http.StatusBadRequest
r.ID = p.ID
res = append(res, r)
continue
}
var err error
var qRes sql.Result
var query string
var params []interface{}
var slugIdx int = -1
var coll *Collection
if collAlias == "" {
// Posts are being claimed at /posts/claim, not
// /collections/{alias}/collect, so use given individual collection
// to associate post with.
postCollAlias = p.CollectionAlias
}
if postCollAlias != "" {
// Associate this post with a collection
if p.CreateCollection {
// This is a new collection
// TODO: consider removing this. This seriously complicates this
// method and adds another (unnecessary?) logic path.
coll, err = db.CreateCollection(cfg, postCollAlias, "", userID)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
} else {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "Unknown error occurred creating collection"
}
r.ID = p.ID
res = append(res, r)
continue
}
} else {
// Attempt to add to existing collection
coll, err = db.GetCollection(postCollAlias)
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
// Show obfuscated "forbidden" response, as if attempting to add to an
// unowned blog.
r.Code = ErrForbiddenCollection.Status
r.ErrorMessage = ErrForbiddenCollection.Message
} else {
r.Code = err.Status
r.ErrorMessage = err.Message
}
} else {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "Unknown error occurred claiming post with collection"
}
r.ID = p.ID
res = append(res, r)
continue
}
if coll.OwnerID != userID {
r.Code = ErrForbiddenCollection.Status
r.ErrorMessage = ErrForbiddenCollection.Message
r.ID = p.ID
res = append(res, r)
continue
}
}
if p.Slug == "" {
p.Slug = p.ID
}
if canCollect {
// User already owns this post, so just add it to the given
// collection.
query = "UPDATE posts SET collection_id = ?, slug = ? WHERE id = ? AND owner_id = ?"
params = []interface{}{coll.ID, p.Slug, p.ID, userID}
slugIdx = 1
} else {
query = "UPDATE posts SET owner_id = ?, collection_id = ?, slug = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
params = []interface{}{userID, coll.ID, p.Slug, p.ID, p.Token}
slugIdx = 2
}
} else {
query = "UPDATE posts SET owner_id = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL"
params = []interface{}{userID, p.ID, p.Token}
}
qRes, err = db.AttemptClaim(&p, query, params, slugIdx)
if err != nil {
r.Code = http.StatusInternalServerError
r.ErrorMessage = "An unknown error occurred."
r.ID = p.ID
res = append(res, r)
log.Error("claimPosts (post %s): %v", p.ID, err)
continue
}
// Get full post information to return
var fullPost *PublicPost
if p.Token != "" {
fullPost, err = db.GetEditablePost(p.ID, p.Token)
} else {
fullPost, err = db.GetPost(p.ID, 0)
}
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
r.Code = err.Status
r.ErrorMessage = err.Message
r.ID = p.ID
res = append(res, r)
continue
}
}
if fullPost.OwnerID.Int64 != userID {
r.Code = http.StatusConflict
r.ErrorMessage = "Post is already owned by someone else."
r.ID = p.ID
res = append(res, r)
continue
}
// Post was successfully claimed
r.Code = http.StatusOK
r.Post = fullPost
if coll != nil {
r.Post.Collection = &CollectionObj{Collection: *coll}
}
rowsAffected, _ := qRes.RowsAffected()
if rowsAffected == 0 {
// This was already claimed, but return 200
r.Code = http.StatusOK
}
res = append(res, r)
}
return &res, nil
}
func (db *datastore) UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error {
if pos <= 0 || pos > 20 {
pos = db.GetLastPinnedPostPos(collID) + 1
if pos == -1 {
pos = 1
}
}
var err error
if pinned {
_, err = db.Exec("UPDATE posts SET pinned_position = ? WHERE id = ?", pos, postID)
} else {
_, err = db.Exec("UPDATE posts SET pinned_position = NULL WHERE id = ?", postID)
}
if err != nil {
log.Error("Unable to update pinned post: %v", err)
return err
}
return nil
}
func (db *datastore) GetLastPinnedPostPos(collID int64) int64 {
var lastPos sql.NullInt64
err := db.QueryRow("SELECT MAX(pinned_position) FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL", collID).Scan(&lastPos)
switch {
case err == sql.ErrNoRows:
return -1
case err != nil:
log.Error("Failed selecting from posts: %v", err)
return -1
}
if !lastPos.Valid {
return -1
}
return lastPos.Int64
}
func (db *datastore) GetPinnedPosts(coll *CollectionObj, includeFuture bool) (*[]PublicPost, error) {
// FIXME: sqlite-backed instances don't include ellipsis on truncated titles
timeCondition := ""
if !includeFuture {
timeCondition = "AND created <= " + db.now()
}
rows, err := db.Query("SELECT id, slug, title, "+db.clip("content", 80)+", pinned_position FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL "+timeCondition+" ORDER BY pinned_position ASC", coll.ID)
if err != nil {
log.Error("Failed selecting pinned posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve pinned posts."}
}
defer rows.Close()
posts := []PublicPost{}
for rows.Next() {
p := &Post{}
err = rows.Scan(&p.ID, &p.Slug, &p.Title, &p.Content, &p.PinnedPosition)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
p.augmentContent(&coll.Collection)
pp := p.processPost()
pp.Collection = coll
posts = append(posts, pp)
}
return &posts, nil
}
func (db *datastore) GetCollections(u *User, hostName string) (*[]Collection, error) {
rows, err := db.Query("SELECT id, alias, title, description, privacy, view_count FROM collections WHERE owner_id = ? ORDER BY id ASC", u.ID)
if err != nil {
log.Error("Failed selecting from collections: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user collections."}
}
defer rows.Close()
colls := []Collection{}
for rows.Next() {
c := Collection{}
err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
c.hostName = hostName
c.URL = c.CanonicalURL()
c.Public = c.IsPublic()
/*
// NOTE: future functionality
if visibility != nil { // TODO: && visibility == CollPublic {
// Add Monetization info when retrieving all public collections
c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")
}
*/
colls = append(colls, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &colls, nil
}
func (db *datastore) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) {
c, err := db.GetCollections(u, hostName)
if err != nil {
return nil, err
}
if len(*c) == 0 {
return nil, impart.HTTPError{http.StatusInternalServerError, "You don't seem to have any blogs; they might've moved to another account. Try logging out and logging into your other account."}
}
return c, nil
}
func (db *datastore) GetPublicCollections(hostName string) (*[]Collection, error) {
rows, err := db.Query(`SELECT c.id, alias, title, description, privacy, view_count
FROM collections c
LEFT JOIN users u ON u.id = c.owner_id
WHERE c.privacy = 1 AND u.status = 0
ORDER BY title ASC`)
if err != nil {
log.Error("Failed selecting public collections: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve public collections."}
}
defer rows.Close()
colls := []Collection{}
for rows.Next() {
c := Collection{}
err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
c.hostName = hostName
c.URL = c.CanonicalURL()
c.Public = c.IsPublic()
// Add Monetization information
c.Monetization = db.GetCollectionAttribute(c.ID, "monetization_pointer")
colls = append(colls, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &colls, nil
}
func (db *datastore) GetMeStats(u *User) userMeStats {
s := userMeStats{}
// User counts
colls, _ := db.GetUserCollectionCount(u.ID)
s.TotalCollections = colls
var articles, collPosts uint64
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NULL", u.ID).Scan(&articles)
if err != nil && err != sql.ErrNoRows {
log.Error("Couldn't get articles count for user %d: %v", u.ID, err)
}
s.TotalArticles = articles
err = db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NOT NULL", u.ID).Scan(&collPosts)
if err != nil && err != sql.ErrNoRows {
log.Error("Couldn't get coll posts count for user %d: %v", u.ID, err)
}
s.CollectionPosts = collPosts
return s
}
func (db *datastore) GetTotalCollections() (collCount int64, err error) {
err = db.QueryRow(`
- SELECT COUNT(*)
+ SELECT COUNT(*)
FROM collections c
LEFT JOIN users u ON u.id = c.owner_id
WHERE u.status = 0`).Scan(&collCount)
if err != nil {
log.Error("Unable to fetch collections count: %v", err)
}
return
}
func (db *datastore) GetTotalPosts() (postCount int64, err error) {
err = db.QueryRow(`
SELECT COUNT(*)
FROM posts p
LEFT JOIN users u ON u.id = p.owner_id
WHERE u.status = 0`).Scan(&postCount)
if err != nil {
log.Error("Unable to fetch posts count: %v", err)
}
return
}
func (db *datastore) GetTopPosts(u *User, alias string, hostName string) (*[]PublicPost, error) {
params := []interface{}{u.ID}
where := ""
if alias != "" {
where = " AND alias = ?"
params = append(params, alias)
}
rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.content, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user top posts."}
}
defer rows.Close()
posts := []PublicPost{}
var gotErr bool
for rows.Next() {
p := Post{}
c := Collection{}
var alias, title, description sql.NullString
var views sql.NullInt64
err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Content, &alias, &title, &description, &views)
if err != nil {
log.Error("Failed scanning User.getPosts() row: %v", err)
gotErr = true
break
}
p.extractData()
pubPost := p.processPost()
if alias.Valid && alias.String != "" {
c.Alias = alias.String
c.Title = title.String
c.Description = description.String
c.Views = views.Int64
c.hostName = hostName
pubPost.Collection = &CollectionObj{Collection: c}
}
posts = append(posts, pubPost)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
if gotErr && len(posts) == 0 {
// There were a lot of errors
return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
}
return &posts, nil
}
func (db *datastore) GetAnonymousPosts(u *User, page int) (*[]PublicPost, error) {
pagePosts := 10
start := page*pagePosts - pagePosts
if page == 0 {
start = 0
pagePosts = 1000
}
limitStr := ""
if page > 0 {
limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts)
}
rows, err := db.Query("SELECT id, view_count, title, language, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC"+limitStr, u.ID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user anonymous posts."}
}
defer rows.Close()
posts := []PublicPost{}
for rows.Next() {
p := Post{}
err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Language, &p.Created, &p.Updated, &p.Content)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
p.extractData()
posts = append(posts, p.processPost())
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return &posts, nil
}
func (db *datastore) GetUserPosts(u *User) (*[]PublicPost, error) {
rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.created, p.updated, p.content, p.text_appearance, p.language, p.rtl, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON collection_id = c.id WHERE p.owner_id = ? ORDER BY created ASC", u.ID)
if err != nil {
log.Error("Failed selecting from posts: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."}
}
defer rows.Close()
posts := []PublicPost{}
var gotErr bool
for rows.Next() {
p := Post{}
c := Collection{}
var alias, title, description sql.NullString
var views sql.NullInt64
err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content, &p.Font, &p.Language, &p.RTL, &alias, &title, &description, &views)
if err != nil {
log.Error("Failed scanning User.getPosts() row: %v", err)
gotErr = true
break
}
p.extractData()
pubPost := p.processPost()
if alias.Valid && alias.String != "" {
c.Alias = alias.String
c.Title = title.String
c.Description = description.String
c.Views = views.Int64
pubPost.Collection = &CollectionObj{Collection: c}
}
posts = append(posts, pubPost)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
if gotErr && len(posts) == 0 {
// There were a lot of errors
return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."}
}
return &posts, nil
}
func (db *datastore) GetUserPostsCount(userID int64) int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ?", userID).Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting posts count for user %d: %v", userID, err)
return 0
}
return count
}
// ChangeSettings takes a User and applies the changes in the given
// userSettings, MODIFYING THE USER with successful changes.
func (db *datastore) ChangeSettings(app *App, u *User, s *userSettings) error {
var errPass error
q := query.NewUpdate()
// Update email if given
if s.Email != "" {
encEmail, err := data.Encrypt(app.keys.EmailKey, s.Email)
if err != nil {
log.Error("Couldn't encrypt email %s: %s\n", s.Email, err)
return impart.HTTPError{http.StatusInternalServerError, "Unable to encrypt email address."}
}
q.SetBytes(encEmail, "email")
// Update the email if something goes awry updating the password
defer func() {
if errPass != nil {
db.UpdateEncryptedUserEmail(u.ID, encEmail)
}
}()
u.Email = zero.StringFrom(s.Email)
}
// Update username if given
var newUsername string
if s.Username != "" {
var ie *impart.HTTPError
newUsername, ie = getValidUsername(app, s.Username, u.Username)
if ie != nil {
// Username is invalid
return *ie
}
if !author.IsValidUsername(app.cfg, newUsername) {
// Ensure the username is syntactically correct.
return impart.HTTPError{http.StatusPreconditionFailed, "Username isn't valid."}
}
t, err := db.Begin()
if err != nil {
log.Error("Couldn't start username change transaction: %v", err)
return err
}
_, err = t.Exec("UPDATE users SET username = ? WHERE id = ?", newUsername, u.ID)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Unable to update users table: %v", err)
return ErrInternalGeneral
}
_, err = t.Exec("UPDATE collections SET alias = ? WHERE alias = ? AND owner_id = ?", newUsername, u.Username, u.ID)
if err != nil {
t.Rollback()
if db.isDuplicateKeyErr(err) {
return impart.HTTPError{http.StatusConflict, "Username is already taken."}
}
log.Error("Unable to update collection: %v", err)
return ErrInternalGeneral
}
// Keep track of name changes for redirection
db.RemoveCollectionRedirect(t, newUsername)
_, err = t.Exec("UPDATE collectionredirects SET new_alias = ? WHERE new_alias = ?", newUsername, u.Username)
if err != nil {
log.Error("Unable to update collectionredirects: %v", err)
}
_, err = t.Exec("INSERT INTO collectionredirects (prev_alias, new_alias) VALUES (?, ?)", u.Username, newUsername)
if err != nil {
log.Error("Unable to add new collectionredirect: %v", err)
}
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Rolling back after Commit(): %v\n", err)
return err
}
u.Username = newUsername
}
// Update passphrase if given
if s.NewPass != "" {
// Check if user has already set a password
var err error
u.HasPass, err = db.IsUserPassSet(u.ID)
if err != nil {
errPass = impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data."}
return errPass
}
if u.HasPass {
// Check if currently-set password is correct
hashedPass := u.HashedPass
if len(hashedPass) == 0 {
authUser, err := db.GetUserForAuthByID(u.ID)
if err != nil {
errPass = err
return errPass
}
hashedPass = authUser.HashedPass
}
if !auth.Authenticated(hashedPass, []byte(s.OldPass)) {
errPass = impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
return errPass
}
}
hashedPass, err := auth.HashPass([]byte(s.NewPass))
if err != nil {
errPass = impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."}
return errPass
}
q.SetBytes(hashedPass, "password")
}
// WHERE values
q.Append(u.ID)
if q.Updates == "" {
if s.Username == "" {
return ErrPostNoUpdatableVals
}
// Nothing to update except username. That was successful, so return now.
return nil
}
res, err := db.Exec("UPDATE users SET "+q.Updates+" WHERE id = ?", q.Params...)
if err != nil {
log.Error("Unable to update collection: %v", err)
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
// Show the correct error message if nothing was updated
var dummy int
err := db.QueryRow("SELECT 1 FROM users WHERE id = ?", u.ID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return ErrUnauthorizedGeneral
case err != nil:
log.Error("Failed selecting from users: %v", err)
}
return nil
}
if s.NewPass != "" && !u.HasPass {
u.HasPass = true
}
return nil
}
func (db *datastore) ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error {
var dbPass []byte
err := db.QueryRow("SELECT password FROM users WHERE id = ?", userID).Scan(&dbPass)
switch {
case err == sql.ErrNoRows:
return ErrUserNotFound
case err != nil:
log.Error("Couldn't SELECT user password for change: %v", err)
return err
}
if !sudo && !auth.Authenticated(dbPass, []byte(curPass)) {
return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."}
}
_, err = db.Exec("UPDATE users SET password = ? WHERE id = ?", hashedPass, userID)
if err != nil {
log.Error("Could not update passphrase: %v", err)
return err
}
return nil
}
func (db *datastore) RemoveCollectionRedirect(t *sql.Tx, alias string) error {
_, err := t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ?", alias)
if err != nil {
log.Error("Unable to delete from collectionredirects: %v", err)
return err
}
return nil
}
func (db *datastore) GetCollectionRedirect(alias string) (new string) {
row := db.QueryRow("SELECT new_alias FROM collectionredirects WHERE prev_alias = ?", alias)
err := row.Scan(&new)
if err != nil && err != sql.ErrNoRows && !db.isIgnorableError(err) {
log.Error("Failed selecting from collectionredirects: %v", err)
}
return
}
func (db *datastore) DeleteCollection(alias string, userID int64) error {
c := &Collection{Alias: alias}
var username string
row := db.QueryRow("SELECT username FROM users WHERE id = ?", userID)
err := row.Scan(&username)
if err != nil {
return err
}
// Ensure user isn't deleting their main blog
if alias == username {
return impart.HTTPError{http.StatusForbidden, "You cannot currently delete your primary blog."}
}
row = db.QueryRow("SELECT id FROM collections WHERE alias = ? AND owner_id = ?", alias, userID)
err = row.Scan(&c.ID)
switch {
case err == sql.ErrNoRows:
return impart.HTTPError{http.StatusNotFound, "Collection doesn't exist or you're not allowed to delete it."}
case err != nil:
log.Error("Failed selecting from collections: %v", err)
return ErrInternalGeneral
}
t, err := db.Begin()
if err != nil {
return err
}
// Float all collection's posts
_, err = t.Exec("UPDATE posts SET collection_id = NULL WHERE collection_id = ? AND owner_id = ?", c.ID, userID)
if err != nil {
t.Rollback()
return err
}
// Remove redirects to or from this collection
_, err = t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ? OR new_alias = ?", alias, alias)
if err != nil {
t.Rollback()
return err
}
// Remove any optional collection password
_, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
return err
}
// Finally, delete collection itself
_, err = t.Exec("DELETE FROM collections WHERE id = ?", c.ID)
if err != nil {
t.Rollback()
return err
}
err = t.Commit()
if err != nil {
t.Rollback()
return err
}
return nil
}
func (db *datastore) IsCollectionAttributeOn(id int64, attr string) bool {
var v string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SELECT value in isCollectionAttributeOn for attribute '%s': %v", attr, err)
return false
}
return v == "1"
}
func (db *datastore) CollectionHasAttribute(id int64, attr string) bool {
var dummy string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SELECT value in collectionHasAttribute for attribute '%s': %v", attr, err)
return false
}
return true
}
func (db *datastore) GetCollectionAttribute(id int64, attr string) string {
var v string
err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v)
switch {
case err == sql.ErrNoRows:
return ""
case err != nil:
log.Error("Couldn't SELECT value in getCollectionAttribute for attribute '%s': %v", attr, err)
return ""
}
return v
}
func (db *datastore) SetCollectionAttribute(id int64, attr, v string) error {
_, err := db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", id, attr, v, v)
if err != nil {
log.Error("Unable to INSERT into collectionattributes: %v", err)
return err
}
return nil
}
// DeleteAccount will delete the entire account for userID
func (db *datastore) DeleteAccount(userID int64) error {
// Get all collections
rows, err := db.Query("SELECT id, alias FROM collections WHERE owner_id = ?", userID)
if err != nil {
log.Error("Unable to get collections: %v", err)
return err
}
defer rows.Close()
colls := []Collection{}
var c Collection
for rows.Next() {
err = rows.Scan(&c.ID, &c.Alias)
if err != nil {
log.Error("Unable to scan collection cols: %v", err)
return err
}
colls = append(colls, c)
}
// Start transaction
t, err := db.Begin()
if err != nil {
log.Error("Unable to begin: %v", err)
return err
}
// Clean up all collection related information
var res sql.Result
for _, c := range colls {
// Delete tokens
res, err = t.Exec("DELETE FROM collectionattributes WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete attributes on %s: %v", c.Alias, err)
return err
}
rs, _ := res.RowsAffected()
log.Info("Deleted %d for %s from collectionattributes", rs, c.Alias)
// Remove any optional collection password
res, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete passwords on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionpasswords", rs, c.Alias)
// Remove redirects to this collection
res, err = t.Exec("DELETE FROM collectionredirects WHERE new_alias = ?", c.Alias)
if err != nil {
t.Rollback()
log.Error("Unable to delete redirects on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionredirects", rs, c.Alias)
// Remove any collection keys
res, err = t.Exec("DELETE FROM collectionkeys WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete keys on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from collectionkeys", rs, c.Alias)
// TODO: federate delete collection
// Remove remote follows
res, err = t.Exec("DELETE FROM remotefollows WHERE collection_id = ?", c.ID)
if err != nil {
t.Rollback()
log.Error("Unable to delete remote follows on %s: %v", c.Alias, err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d for %s from remotefollows", rs, c.Alias)
}
// Delete collections
res, err = t.Exec("DELETE FROM collections WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete collections: %v", err)
return err
}
rs, _ := res.RowsAffected()
log.Info("Deleted %d from collections", rs)
// Delete tokens
res, err = t.Exec("DELETE FROM accesstokens WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete access tokens: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from accesstokens", rs)
// Delete user attributes
res, err = t.Exec("DELETE FROM oauth_users WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete oauth_users: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from oauth_users", rs)
// Delete posts
// TODO: should maybe get each row so we can federate a delete
// if so needs to be outside of transaction like collections
res, err = t.Exec("DELETE FROM posts WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete posts: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from posts", rs)
// Delete user attributes
res, err = t.Exec("DELETE FROM userattributes WHERE user_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete attributes: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from userattributes", rs)
// Delete user invites
res, err = t.Exec("DELETE FROM userinvites WHERE owner_id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete invites: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from userinvites", rs)
// Delete the user
res, err = t.Exec("DELETE FROM users WHERE id = ?", userID)
if err != nil {
t.Rollback()
log.Error("Unable to delete user: %v", err)
return err
}
rs, _ = res.RowsAffected()
log.Info("Deleted %d from users", rs)
// Commit all changes to the database
err = t.Commit()
if err != nil {
t.Rollback()
log.Error("Unable to commit: %v", err)
return err
}
// TODO: federate delete actor
return nil
}
func (db *datastore) GetAPActorKeys(collectionID int64) ([]byte, []byte) {
var pub, priv []byte
err := db.QueryRow("SELECT public_key, private_key FROM collectionkeys WHERE collection_id = ?", collectionID).Scan(&pub, &priv)
switch {
case err == sql.ErrNoRows:
// Generate keys
pub, priv = activitypub.GenerateKeys()
_, err = db.Exec("INSERT INTO collectionkeys (collection_id, public_key, private_key) VALUES (?, ?, ?)", collectionID, pub, priv)
if err != nil {
log.Error("Unable to INSERT new activitypub keypair: %v", err)
return nil, nil
}
case err != nil:
log.Error("Couldn't SELECT collectionkeys: %v", err)
return nil, nil
}
return pub, priv
}
func (db *datastore) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error {
_, err := db.Exec("INSERT INTO userinvites (id, owner_id, max_uses, created, expires, inactive) VALUES (?, ?, ?, "+db.now()+", ?, 0)", id, userID, maxUses, expires)
return err
}
func (db *datastore) GetUserInvites(userID int64) (*[]Invite, error) {
rows, err := db.Query("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE owner_id = ? ORDER BY created DESC", userID)
if err != nil {
log.Error("Failed selecting from userinvites: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user invites."}
}
defer rows.Close()
is := []Invite{}
for rows.Next() {
i := Invite{}
err = rows.Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
is = append(is, i)
}
return &is, nil
}
func (db *datastore) GetUserInvite(id string) (*Invite, error) {
var i Invite
err := db.QueryRow("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE id = ?", id).Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive)
switch {
case err == sql.ErrNoRows, db.isIgnorableError(err):
return nil, impart.HTTPError{http.StatusNotFound, "Invite doesn't exist."}
case err != nil:
log.Error("Failed selecting invite: %v", err)
return nil, err
}
return &i, nil
}
// IsUsersInvite returns true if the user with ID created the invite with code
// and an error other than sql no rows, if any. Will return false in the event
// of an error.
func (db *datastore) IsUsersInvite(code string, userID int64) (bool, error) {
var id string
err := db.QueryRow("SELECT id FROM userinvites WHERE id = ? AND owner_id = ?", code, userID).Scan(&id)
if err != nil && err != sql.ErrNoRows {
log.Error("Failed selecting invite: %v", err)
return false, err
}
return id != "", nil
}
func (db *datastore) GetUsersInvitedCount(id string) int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM usersinvited WHERE invite_id = ?", id).Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting users invited count: %v", err)
return 0
}
return count
}
func (db *datastore) CreateInvitedUser(inviteID string, userID int64) error {
_, err := db.Exec("INSERT INTO usersinvited (invite_id, user_id) VALUES (?, ?)", inviteID, userID)
return err
}
func (db *datastore) GetInstancePages() ([]*instanceContent, error) {
return db.GetAllDynamicContent("page")
}
func (db *datastore) GetAllDynamicContent(t string) ([]*instanceContent, error) {
where := ""
params := []interface{}{}
if t != "" {
where = " WHERE content_type = ?"
params = append(params, t)
}
rows, err := db.Query("SELECT id, title, content, updated, content_type FROM appcontent"+where, params...)
if err != nil {
log.Error("Failed selecting from appcontent: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve instance pages."}
}
defer rows.Close()
pages := []*instanceContent{}
for rows.Next() {
c := &instanceContent{}
err = rows.Scan(&c.ID, &c.Title, &c.Content, &c.Updated, &c.Type)
if err != nil {
log.Error("Failed scanning row: %v", err)
break
}
pages = append(pages, c)
}
err = rows.Err()
if err != nil {
log.Error("Error after Next() on rows: %v", err)
}
return pages, nil
}
func (db *datastore) GetDynamicContent(id string) (*instanceContent, error) {
c := &instanceContent{
ID: id,
}
err := db.QueryRow("SELECT title, content, updated, content_type FROM appcontent WHERE id = ?", id).Scan(&c.Title, &c.Content, &c.Updated, &c.Type)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Couldn't SELECT FROM appcontent for id '%s': %v", id, err)
return nil, err
}
return c, nil
}
func (db *datastore) UpdateDynamicContent(id, title, content, contentType string) error {
var err error
if db.driverName == driverSQLite {
_, err = db.Exec("INSERT OR REPLACE INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?)", id, title, content, contentType)
} else {
_, err = db.Exec("INSERT INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?) "+db.upsert("id")+" title = ?, content = ?, updated = "+db.now(), id, title, content, contentType, title, content)
}
if err != nil {
log.Error("Unable to INSERT appcontent for '%s': %v", id, err)
}
return err
}
func (db *datastore) GetAllUsers(page uint) (*[]User, error) {
limitStr := fmt.Sprintf("0, %d", adminUsersPerPage)
if page > 1 {
limitStr = fmt.Sprintf("%d, %d", (page-1)*adminUsersPerPage, adminUsersPerPage)
}
rows, err := db.Query("SELECT id, username, created, status FROM users ORDER BY created DESC LIMIT " + limitStr)
if err != nil {
log.Error("Failed selecting from users: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve all users."}
}
defer rows.Close()
users := []User{}
for rows.Next() {
u := User{}
err = rows.Scan(&u.ID, &u.Username, &u.Created, &u.Status)
if err != nil {
log.Error("Failed scanning GetAllUsers() row: %v", err)
break
}
users = append(users, u)
}
return &users, nil
}
func (db *datastore) GetAllUsersCount() int64 {
var count int64
err := db.QueryRow("SELECT COUNT(*) FROM users").Scan(&count)
switch {
case err == sql.ErrNoRows:
return 0
case err != nil:
log.Error("Failed selecting all users count: %v", err)
return 0
}
return count
}
func (db *datastore) GetUserLastPostTime(id int64) (*time.Time, error) {
var t time.Time
err := db.QueryRow("SELECT created FROM posts WHERE owner_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Failed selecting last post time from posts: %v", err)
return nil, err
}
return &t, nil
}
// SetUserStatus changes a user's status in the database. see Users.UserStatus
func (db *datastore) SetUserStatus(id int64, status UserStatus) error {
_, err := db.Exec("UPDATE users SET status = ? WHERE id = ?", status, id)
if err != nil {
return fmt.Errorf("failed to update user status: %v", err)
}
return nil
}
func (db *datastore) GetCollectionLastPostTime(id int64) (*time.Time, error) {
var t time.Time
err := db.QueryRow("SELECT created FROM posts WHERE collection_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
log.Error("Failed selecting last post time from posts: %v", err)
return nil, err
}
return &t, nil
}
func (db *datastore) GenerateOAuthState(ctx context.Context, provider string, clientID string, attachUser int64, inviteCode string) (string, error) {
state := id.Generate62RandomString(24)
attachUserVal := sql.NullInt64{Valid: attachUser > 0, Int64: attachUser}
inviteCodeVal := sql.NullString{Valid: inviteCode != "", String: inviteCode}
_, err := db.ExecContext(ctx, "INSERT INTO oauth_client_states (state, provider, client_id, used, created_at, attach_user_id, invite_code) VALUES (?, ?, ?, FALSE, "+db.now()+", ?, ?)", state, provider, clientID, attachUserVal, inviteCodeVal)
if err != nil {
return "", fmt.Errorf("unable to record oauth client state: %w", err)
}
return state, nil
}
func (db *datastore) ValidateOAuthState(ctx context.Context, state string) (string, string, int64, string, error) {
var provider string
var clientID string
var attachUserID sql.NullInt64
var inviteCode sql.NullString
err := wf_db.RunTransactionWithOptions(ctx, db.DB, &sql.TxOptions{}, func(ctx context.Context, tx *sql.Tx) error {
err := tx.
QueryRowContext(ctx, "SELECT provider, client_id, attach_user_id, invite_code FROM oauth_client_states WHERE state = ? AND used = FALSE", state).
Scan(&provider, &clientID, &attachUserID, &inviteCode)
if err != nil {
return err
}
res, err := tx.ExecContext(ctx, "UPDATE oauth_client_states SET used = TRUE WHERE state = ?", state)
if err != nil {
return err
}
rowsAffected, err := res.RowsAffected()
if err != nil {
return err
}
if rowsAffected != 1 {
return fmt.Errorf("state not found")
}
return nil
})
if err != nil {
return "", "", 0, "", nil
}
return provider, clientID, attachUserID.Int64, inviteCode.String, nil
}
func (db *datastore) RecordRemoteUserID(ctx context.Context, localUserID int64, remoteUserID, provider, clientID, accessToken string) error {
var err error
if db.driverName == driverSQLite {
_, err = db.ExecContext(ctx, "INSERT OR REPLACE INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?)", localUserID, remoteUserID, provider, clientID, accessToken)
} else {
_, err = db.ExecContext(ctx, "INSERT INTO oauth_users (user_id, remote_user_id, provider, client_id, access_token) VALUES (?, ?, ?, ?, ?) "+db.upsert("user")+" access_token = ?", localUserID, remoteUserID, provider, clientID, accessToken, accessToken)
}
if err != nil {
log.Error("Unable to INSERT oauth_users for '%d': %v", localUserID, err)
}
return err
}
// GetIDForRemoteUser returns a user ID associated with a remote user ID.
func (db *datastore) GetIDForRemoteUser(ctx context.Context, remoteUserID, provider, clientID string) (int64, error) {
var userID int64 = -1
err := db.
QueryRowContext(ctx, "SELECT user_id FROM oauth_users WHERE remote_user_id = ? AND provider = ? AND client_id = ?", remoteUserID, provider, clientID).
Scan(&userID)
// Not finding a record is OK.
if err != nil && err != sql.ErrNoRows {
return -1, err
}
return userID, nil
}
type oauthAccountInfo struct {
Provider string
ClientID string
RemoteUserID string
DisplayName string
AllowDisconnect bool
}
func (db *datastore) GetOauthAccounts(ctx context.Context, userID int64) ([]oauthAccountInfo, error) {
rows, err := db.QueryContext(ctx, "SELECT provider, client_id, remote_user_id FROM oauth_users WHERE user_id = ? ", userID)
if err != nil {
log.Error("Failed selecting from oauth_users: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user oauth accounts."}
}
defer rows.Close()
var records []oauthAccountInfo
for rows.Next() {
info := oauthAccountInfo{}
err = rows.Scan(&info.Provider, &info.ClientID, &info.RemoteUserID)
if err != nil {
log.Error("Failed scanning GetAllUsers() row: %v", err)
break
}
records = append(records, info)
}
return records, nil
}
// DatabaseInitialized returns whether or not the current datastore has been
// initialized with the correct schema.
// Currently, it checks to see if the `users` table exists.
func (db *datastore) DatabaseInitialized() bool {
var dummy string
var err error
if db.driverName == driverSQLite {
err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = 'users'").Scan(&dummy)
} else {
err = db.QueryRow("SHOW TABLES LIKE 'users'").Scan(&dummy)
}
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SHOW TABLES: %v", err)
return false
}
return true
}
func (db *datastore) RemoveOauth(ctx context.Context, userID int64, provider string, clientID string, remoteUserID string) error {
_, err := db.ExecContext(ctx, `DELETE FROM oauth_users WHERE user_id = ? AND provider = ? AND client_id = ? AND remote_user_id = ?`, userID, provider, clientID, remoteUserID)
return err
}
func stringLogln(log *string, s string, v ...interface{}) {
*log += fmt.Sprintf(s+"\n", v...)
}
func handleFailedPostInsert(err error) error {
log.Error("Couldn't insert into posts: %v", err)
return err
}
// Deprecated: use GetProfileURLFromHandle() instead, which returns user-facing URL instead of actor_id
func (db *datastore) GetProfilePageFromHandle(app *App, handle string) (string, error) {
handle = strings.TrimLeft(handle, "@")
actorIRI := ""
parts := strings.Split(handle, "@")
if len(parts) != 2 {
return "", fmt.Errorf("invalid handle format")
}
domain := parts[1]
// Check non-AP instances
if siloProfileURL := silobridge.Profile(parts[0], domain); siloProfileURL != "" {
return siloProfileURL, nil
}
remoteUser, err := getRemoteUserFromHandle(app, handle)
if err != nil {
// can't find using handle in the table but the table may already have this user without
// handle from a previous version
// TODO: Make this determination. We should know whether a user exists without a handle, or doesn't exist at all
actorIRI = RemoteLookup(handle)
_, errRemoteUser := getRemoteUser(app, actorIRI)
// if it exists then we need to update the handle
if errRemoteUser == nil {
_, err := app.db.Exec("UPDATE remoteusers SET handle = ? WHERE actor_id = ?", handle, actorIRI)
if err != nil {
log.Error("Couldn't update handle '%s' for user %s", handle, actorIRI)
}
} else {
// this probably means we don't have the user in the table so let's try to insert it
// here we need to ask the server for the inboxes
remoteActor, err := activityserve.NewRemoteActor(actorIRI)
if err != nil {
log.Error("Couldn't fetch remote actor: %v", err)
}
if debugging {
log.Info("%s %s %s %s", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
}
_, err = app.db.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, handle) VALUES(?, ?, ?, ?)", actorIRI, remoteActor.GetInbox(), remoteActor.GetSharedInbox(), handle)
if err != nil {
log.Error("Couldn't insert remote user: %v", err)
return "", err
}
}
} else {
actorIRI = remoteUser.ActorID
}
return actorIRI, nil
}
func (db *datastore) AddEmailSubscription(collID, userID int64, email string, confirmed bool) (*EmailSubscriber, error) {
friendlyChars := "0123456789BCDFGHJKLMNPQRSTVWXYZbcdfghjklmnpqrstvwxyz"
subID := id.GenerateRandomString(friendlyChars, 8)
token := id.GenerateRandomString(friendlyChars, 16)
emailVal := sql.NullString{
String: email,
Valid: email != "",
}
userIDVal := sql.NullInt64{
Int64: userID,
Valid: userID > 0,
}
_, err := db.Exec("INSERT INTO emailsubscribers (id, collection_id, user_id, email, subscribed, token, confirmed) VALUES (?, ?, ?, ?, "+db.now()+", ?, ?)", subID, collID, userIDVal, emailVal, token, confirmed)
if err != nil {
if mysqlErr, ok := err.(*mysql.MySQLError); ok {
if mysqlErr.Number == mySQLErrDuplicateKey {
// Duplicate, so just return existing subscriber information
log.Info("Duplicate subscriber for email %s, user %d; returning existing subscriber", email, userID)
return db.FetchEmailSubscriber(email, userID, collID)
}
}
return nil, err
}
return &EmailSubscriber{
ID: subID,
CollID: collID,
UserID: userIDVal,
Email: emailVal,
Token: token,
}, nil
}
func (db *datastore) IsEmailSubscriber(email string, userID, collID int64) bool {
var dummy int
var err error
if email != "" {
err = db.QueryRow("SELECT 1 FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID).Scan(&dummy)
} else {
err = db.QueryRow("SELECT 1 FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID).Scan(&dummy)
}
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
return false
}
return true
}
func (db *datastore) GetEmailSubscribers(collID int64, reqConfirmed bool) ([]*EmailSubscriber, error) {
cond := ""
if reqConfirmed {
cond = " AND confirmed = 1"
}
- rows, err := db.Query(`SELECT s.id, collection_id, user_id, s.email, u.email, subscribed, token, confirmed, allow_export
-FROM emailsubscribers s
-LEFT JOIN users u
- ON u.id = user_id
+ rows, err := db.Query(`SELECT s.id, collection_id, user_id, s.email, u.email, subscribed, token, confirmed, allow_export
+FROM emailsubscribers s
+LEFT JOIN users u
+ ON u.id = user_id
WHERE collection_id = ?`+cond+`
ORDER BY subscribed DESC`, collID)
if err != nil {
log.Error("Failed selecting email subscribers for collection %d: %v", collID, err)
return nil, err
}
defer rows.Close()
var subs []*EmailSubscriber
for rows.Next() {
s := &EmailSubscriber{}
err = rows.Scan(&s.ID, &s.CollID, &s.UserID, &s.Email, &s.acctEmail, &s.Subscribed, &s.Token, &s.Confirmed, &s.AllowExport)
if err != nil {
log.Error("Failed scanning row from email subscribers: %v", err)
continue
}
subs = append(subs, s)
}
return subs, nil
}
func (db *datastore) FetchEmailSubscriberEmail(subID, token string) (string, error) {
var email sql.NullString
// TODO: return user email if there's a user_id ?
err := db.QueryRow("SELECT email FROM emailsubscribers WHERE id = ? AND token = ?", subID, token).Scan(&email)
switch {
case err == sql.ErrNoRows:
return "", fmt.Errorf("Subscriber doesn't exist or token is invalid.")
case err != nil:
log.Error("Couldn't SELECT email from emailsubscribers: %v", err)
return "", fmt.Errorf("Something went very wrong.")
}
return email.String, nil
}
func (db *datastore) FetchEmailSubscriber(email string, userID, collID int64) (*EmailSubscriber, error) {
const emailSubCols = "id, collection_id, user_id, email, subscribed, token, confirmed, allow_export"
s := &EmailSubscriber{}
var row *sql.Row
if email != "" {
row = db.QueryRow("SELECT "+emailSubCols+" FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID)
} else {
row = db.QueryRow("SELECT "+emailSubCols+" FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID)
}
err := row.Scan(&s.ID, &s.CollID, &s.UserID, &s.Email, &s.Subscribed, &s.Token, &s.Confirmed, &s.AllowExport)
switch {
case err == sql.ErrNoRows:
return nil, nil
case err != nil:
return nil, err
}
return s, nil
}
func (db *datastore) DeleteEmailSubscriber(subID, token string) error {
res, err := db.Exec("DELETE FROM emailsubscribers WHERE id = ? AND token = ?", subID, token)
if err != nil {
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
return impart.HTTPError{http.StatusNotFound, "Invalid token, or subscriber doesn't exist"}
}
return nil
}
func (db *datastore) DeleteEmailSubscriberByUser(email string, userID, collID int64) error {
var res sql.Result
var err error
if email != "" {
res, err = db.Exec("DELETE FROM emailsubscribers WHERE email = ? AND collection_id = ?", email, collID)
} else {
res, err = db.Exec("DELETE FROM emailsubscribers WHERE user_id = ? AND collection_id = ?", userID, collID)
}
if err != nil {
return err
}
rowsAffected, _ := res.RowsAffected()
if rowsAffected == 0 {
return impart.HTTPError{http.StatusNotFound, "Subscriber doesn't exist"}
}
return nil
}
func (db *datastore) UpdateSubscriberConfirmed(subID, token string) error {
email, err := db.FetchEmailSubscriberEmail(subID, token)
if err != nil {
log.Error("Didn't fetch email subscriber: %v", err)
return err
}
// TODO: ensure all addresses with original name are also confirmed, e.g. matt+fake@write.as and matt@write.as are now confirmed
_, err = db.Exec("UPDATE emailsubscribers SET confirmed = 1 WHERE email = ?", email)
if err != nil {
log.Error("Could not update email subscriber confirmation status: %v", err)
return err
}
return nil
}
func (db *datastore) IsSubscriberConfirmed(email string) bool {
var dummy int64
err := db.QueryRow("SELECT 1 FROM emailsubscribers WHERE email = ? AND confirmed = 1", email).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SELECT in isSubscriberConfirmed: %v", err)
return false
}
return true
}
func (db *datastore) InsertJob(j *PostJob) error {
res, err := db.Exec("INSERT INTO publishjobs (post_id, action, delay) VALUES (?, ?, ?)", j.PostID, j.Action, j.Delay)
if err != nil {
return err
}
jobID, err := res.LastInsertId()
if err != nil {
log.Error("[jobs] Couldn't get last insert ID! %s", err)
}
log.Info("[jobs] Queued %s job #%d for post %s, delayed %d minutes", j.Action, jobID, j.PostID, j.Delay)
return nil
}
func (db *datastore) UpdateJobForPost(postID string, delay int64) error {
_, err := db.Exec("UPDATE publishjobs SET delay = ? WHERE post_id = ?", delay, postID)
if err != nil {
return fmt.Errorf("Unable to update publish job: %s", err)
}
log.Info("Updated job for post %s: delay %d", postID, delay)
return nil
}
func (db *datastore) DeleteJob(id int64) error {
_, err := db.Exec("DELETE FROM publishjobs WHERE id = ?", id)
if err != nil {
return err
}
log.Info("[job #%d] Deleted.", id)
return nil
}
func (db *datastore) DeleteJobByPost(postID string) error {
_, err := db.Exec("DELETE FROM publishjobs WHERE post_id = ?", postID)
if err != nil {
return err
}
log.Info("[job] Deleted job for post %s", postID)
return nil
}
func (db *datastore) GetJobsToRun(action string) ([]*PostJob, error) {
timeWhere := "created < DATE_SUB(NOW(), INTERVAL delay MINUTE) AND created > DATE_SUB(NOW(), INTERVAL delay + 5 MINUTE)"
if db.driverName == driverSQLite {
timeWhere = "created < DATETIME('now', '-' || delay || ' MINUTE') AND created > DATETIME('now', '-' || (delay+5) || ' MINUTE')"
}
rows, err := db.Query(`SELECT pj.id, post_id, action, delay
FROM publishjobs pj
INNER JOIN posts p
ON post_id = p.id
WHERE action = ? AND `+timeWhere+`
ORDER BY created ASC`, action)
if err != nil {
log.Error("Failed selecting from publishjobs: %v", err)
return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve publish jobs."}
}
defer rows.Close()
jobs := []*PostJob{}
for rows.Next() {
j := &PostJob{}
err = rows.Scan(&j.ID, &j.PostID, &j.Action, &j.Delay)
jobs = append(jobs, j)
}
return jobs, nil
}
diff --git a/database_activitypub.go b/database_activitypub.go
new file mode 100644
index 0000000..9df3724
--- /dev/null
+++ b/database_activitypub.go
@@ -0,0 +1,49 @@
+/*
+ * Copyright © 2024 Musing Studio LLC.
+ *
+ * This file is part of WriteFreely.
+ *
+ * WriteFreely is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License, included
+ * in the LICENSE file in this source code package.
+ */
+
+package writefreely
+
+import (
+ "database/sql"
+ "fmt"
+ "github.com/writeas/web-core/activitystreams"
+ "github.com/writeas/web-core/log"
+)
+
+func apAddRemoteUser(app *App, t *sql.Tx, fullActor *activitystreams.Person) (int64, error) {
+ // Add remote user locally, since it wasn't found before
+ res, err := t.Exec("INSERT INTO remoteusers (actor_id, inbox, shared_inbox, url) VALUES (?, ?, ?, ?)", fullActor.ID, fullActor.Inbox, fullActor.Endpoints.SharedInbox, fullActor.URL)
+ if err != nil {
+ t.Rollback()
+ return -1, fmt.Errorf("couldn't add new remoteuser in DB: %v", err)
+ }
+
+ remoteUserID, err := res.LastInsertId()
+ if err != nil {
+ t.Rollback()
+ return -1, fmt.Errorf("no lastinsertid for followers, rolling back: %v", err)
+ }
+
+ // Add in key
+ _, err = t.Exec("INSERT INTO remoteuserkeys (id, remote_user_id, public_key) VALUES (?, ?, ?)", fullActor.PublicKey.ID, remoteUserID, fullActor.PublicKey.PublicKeyPEM)
+ if err != nil {
+ if !app.db.isDuplicateKeyErr(err) {
+ t.Rollback()
+ log.Error("Couldn't add follower keys in DB: %v\n", err)
+ return -1, fmt.Errorf("couldn't add follower keys in DB: %v", err)
+ } else {
+ t.Rollback()
+ log.Error("Couldn't add follower keys in DB: %v\n", err)
+ return -1, fmt.Errorf("couldn't add follower keys in DB: %v", err)
+ }
+ }
+
+ return remoteUserID, nil
+}
diff --git a/export.go b/export.go
index e6a09c1..a89ed7d 100644
--- a/export.go
+++ b/export.go
@@ -1,132 +1,132 @@
/*
* Copyright © 2018-2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"archive/zip"
"bytes"
"encoding/csv"
"strings"
"time"
"github.com/writeas/web-core/log"
)
func exportPostsCSV(hostName string, u *User, posts *[]PublicPost) []byte {
var b bytes.Buffer
r := [][]string{
{"id", "slug", "blog", "url", "created", "title", "body"},
}
for _, p := range *posts {
var blog string
if p.Collection != nil {
blog = p.Collection.Alias
p.Collection.hostName = hostName
}
f := []string{p.ID, p.Slug.String, blog, p.CanonicalURL(hostName), p.Created8601(), p.Title.String, strings.Replace(p.Content, "\n", "\\n", -1)}
r = append(r, f)
}
w := csv.NewWriter(&b)
w.WriteAll(r) // calls Flush internally
if err := w.Error(); err != nil {
log.Info("error writing csv: %v", err)
}
return b.Bytes()
}
type exportedTxt struct {
Name, Title, Body string
Mod time.Time
}
func exportPostsZip(u *User, posts *[]PublicPost) []byte {
// Create a buffer to write our archive to.
b := new(bytes.Buffer)
// Create a new zip archive.
w := zip.NewWriter(b)
// Add some files to the archive.
var filename string
files := []exportedTxt{}
for _, p := range *posts {
filename = ""
if p.Collection != nil {
filename += p.Collection.Alias + "/"
}
if p.Slug.String != "" {
filename += p.Slug.String + "_"
}
filename += p.ID + ".txt"
files = append(files, exportedTxt{filename, p.Title.String, p.Content, p.Created})
}
for _, file := range files {
head := &zip.FileHeader{Name: file.Name}
head.SetModTime(file.Mod)
f, err := w.CreateHeader(head)
if err != nil {
log.Error("export zip header: %v", err)
}
var fullPost string
if file.Title != "" {
fullPost = "# " + file.Title + "\n\n"
}
fullPost += file.Body
_, err = f.Write([]byte(fullPost))
if err != nil {
log.Error("export zip write: %v", err)
}
}
// Make sure to check the error on Close.
err := w.Close()
if err != nil {
log.Error("export zip close: %v", err)
}
return b.Bytes()
}
func compileFullExport(app *App, u *User) *ExportUser {
exportUser := &ExportUser{
User: u,
}
colls, err := app.db.GetCollections(u, app.cfg.App.Host)
if err != nil {
log.Error("unable to fetch collections: %v", err)
}
posts, err := app.db.GetAnonymousPosts(u, 0)
if err != nil {
log.Error("unable to fetch anon posts: %v", err)
}
exportUser.AnonymousPosts = *posts
var collObjs []CollectionObj
for _, c := range *colls {
co := &CollectionObj{Collection: c}
- co.Posts, err = app.db.GetPosts(app.cfg, &c, 0, true, false, true)
+ co.Posts, err = app.db.GetPosts(app.cfg, &c, 0, true, false, true, "")
if err != nil {
log.Error("unable to get collection posts: %v", err)
}
app.db.GetPostsCount(co, true)
collObjs = append(collObjs, *co)
}
exportUser.Collections = &collObjs
return exportUser
}
diff --git a/feed.go b/feed.go
index 68dd2c0..ae27b3a 100644
--- a/feed.go
+++ b/feed.go
@@ -1,125 +1,125 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"fmt"
"net/http"
"time"
"github.com/gorilla/feeds"
"github.com/gorilla/mux"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/web-core/log"
)
func ViewFeed(app *App, w http.ResponseWriter, req *http.Request) error {
alias := collectionAliasFromReq(req)
// Display collection if this is a collection
var c *Collection
var err error
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return nil
}
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view feed: get user: %v", err)
return ErrInternalGeneral
}
if silenced {
return ErrCollectionNotFound
}
c.hostName = app.cfg.App.Host
if c.IsPrivate() || c.IsProtected() {
return ErrCollectionNotFound
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := &DisplayCollection{CollectionObj: &CollectionObj{Collection: *c}}
if c.PublicOwner {
u, err := app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
coll.Owner = u
}
}
tag := mux.Vars(req)["tag"]
if tag != "" {
coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, 1, false)
} else {
- coll.Posts, _ = app.db.GetPosts(app.cfg, c, 1, false, true, false)
+ coll.Posts, _ = app.db.GetPosts(app.cfg, c, 1, false, true, false, "")
}
author := ""
if coll.Owner != nil {
author = coll.Owner.Username
}
collectionTitle := coll.DisplayTitle()
if tag != "" {
collectionTitle = tag + " &mdash; " + collectionTitle
}
baseUrl := coll.CanonicalURL()
basePermalinkUrl := baseUrl
siteURL := baseUrl
if tag != "" {
siteURL += "tag:" + tag
}
feed := &feeds.Feed{
Title: collectionTitle,
Link: &feeds.Link{Href: siteURL},
Description: coll.Description,
Author: &feeds.Author{author, ""},
Created: time.Now(),
}
var title, permalink string
for _, p := range *coll.Posts {
// Add necessary path back to the web browser for Web Monetization if needed
p.Collection = coll.CollectionObj // augmentReadingDestination requires a populated Collection field
p.augmentReadingDestination()
// Create the item for the feed
title = p.PlainDisplayTitle()
permalink = fmt.Sprintf("%s%s", baseUrl, p.Slug.String)
feed.Items = append(feed.Items, &feeds.Item{
Id: fmt.Sprintf("%s%s", basePermalinkUrl, p.Slug.String),
Title: title,
Link: &feeds.Link{Href: permalink},
Description: "<![CDATA[" + stripmd.Strip(p.Content) + "]]>",
Content: string(p.HTMLContent),
Author: &feeds.Author{author, ""},
Created: p.Created,
Updated: p.Updated,
})
}
rss, err := feed.ToRss()
if err != nil {
return err
}
fmt.Fprint(w, rss)
return nil
}
diff --git a/gopher.go b/gopher.go
index 2ac1590..45bbec4 100644
--- a/gopher.go
+++ b/gopher.go
@@ -1,167 +1,167 @@
/*
* Copyright © 2020 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"bytes"
"fmt"
"io"
"net/url"
"regexp"
"strings"
"github.com/writeas/web-core/log"
"github.com/writefreely/go-gopher"
)
func initGopher(apper Apper) {
handler := NewWFHandler(apper)
gopher.HandleFunc("/", handler.Gopher(handleGopher))
log.Info("Serving on gopher://localhost:%d", apper.App().Config().Server.GopherPort)
gopher.ListenAndServe(fmt.Sprintf(":%d", apper.App().Config().Server.GopherPort), nil)
}
// Utility function to strip the URL from the hostname provided by app.cfg.App.Host
func stripHostProtocol(app *App) string {
u, err := url.Parse(app.cfg.App.Host)
if err != nil {
// Fall back to host, with scheme stripped
return string(regexp.MustCompile("^.*://").ReplaceAll([]byte(app.cfg.App.Host), []byte("")))
}
return u.Hostname()
}
func handleGopher(app *App, w gopher.ResponseWriter, r *gopher.Request) error {
parts := strings.Split(r.Selector, "/")
if app.cfg.App.SingleUser {
if parts[1] != "" {
return handleGopherCollectionPost(app, w, r)
}
return handleGopherCollection(app, w, r)
}
// Show all public collections (a gopher Reader view, essentially)
if len(parts) == 3 {
return handleGopherCollection(app, w, r)
}
w.WriteInfo(fmt.Sprintf("Welcome to %s", app.cfg.App.SiteName))
colls, err := app.db.GetPublicCollections(app.cfg.App.Host)
if err != nil {
return err
}
for _, c := range *colls {
w.WriteItem(&gopher.Item{
Host: stripHostProtocol(app),
Port: app.cfg.Server.GopherPort,
Type: gopher.DIRECTORY,
Description: c.DisplayTitle(),
Selector: "/" + c.Alias + "/",
})
}
return w.End()
}
func handleGopherCollection(app *App, w gopher.ResponseWriter, r *gopher.Request) error {
var collAlias, slug string
var c *Collection
var err error
var baseSel = "/"
parts := strings.Split(r.Selector, "/")
if app.cfg.App.SingleUser {
// sanity check
slug = parts[1]
if slug != "" {
return handleGopherCollectionPost(app, w, r)
}
c, err = app.db.GetCollectionByID(1)
if err != nil {
return err
}
} else {
collAlias = parts[1]
slug = parts[2]
if slug != "" {
return handleGopherCollectionPost(app, w, r)
}
c, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
baseSel = "/" + c.Alias + "/"
}
c.hostName = app.cfg.App.Host
w.WriteInfo(c.DisplayTitle())
if c.Description != "" {
w.WriteInfo(c.Description)
}
- posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false)
+ posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false, "")
if err != nil {
return err
}
for _, p := range *posts {
w.WriteItem(&gopher.Item{
Port: app.cfg.Server.GopherPort,
Host: stripHostProtocol(app),
Type: gopher.FILE,
Description: p.CreatedDate() + " - " + p.DisplayTitle(),
Selector: baseSel + p.Slug.String,
})
}
return w.End()
}
func handleGopherCollectionPost(app *App, w gopher.ResponseWriter, r *gopher.Request) error {
var collAlias, slug string
var c *Collection
var err error
parts := strings.Split(r.Selector, "/")
if app.cfg.App.SingleUser {
slug = parts[1]
c, err = app.db.GetCollectionByID(1)
if err != nil {
return err
}
} else {
collAlias = parts[1]
slug = parts[2]
c, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
}
c.hostName = app.cfg.App.Host
p, err := app.db.GetPost(slug, c.ID)
if err != nil {
return err
}
b := bytes.Buffer{}
if p.Title.String != "" {
b.WriteString(p.Title.String + "\n")
}
b.WriteString(p.DisplayDate + "\n\n")
b.WriteString(p.Content)
io.Copy(w, &b)
return w.End()
}
diff --git a/less/core.less b/less/core.less
index a64056a..6dde923 100644
--- a/less/core.less
+++ b/less/core.less
@@ -1,1640 +1,1660 @@
body {
font-family: @serifFont;
font-size-adjust: 0.5;
-webkit-font-smoothing: antialiased;
-moz-osx-font-smoothing: grayscale;
background-color: white;
color: #111;
-
+
h1, header h2 {
a {
color: @headerTextColor;
.transition-duration(0.2s);
&:hover {
color: #303030;
text-decoration: none;
}
}
}
h1, h2, h3 {
line-height: 1.2;
}
&#post article, &#collection article p, &#subpage article p {
display: block;
unicode-bidi: embed;
white-space: pre;
}
&#post {
#wrapper, pre {
max-width: 40em;
margin: 0 auto;
a:hover {
text-decoration: underline;
}
}
blockquote {
p + p {
margin: -2em 0 0.5em;
}
}
article {
margin-bottom: 2em !important;
h1, h2, h3, h4, h5, h6, p, ul, ol, code {
display: inline;
margin: 0;
}
hr + p, ol, ul {
display: block;
margin-top: -1rem;
margin-bottom: -1rem;
}
ol, ul {
margin: 2rem 0 -1rem;
ol, ul {
margin: 1.25rem 0 -0.5rem;
}
}
li {
margin-top: -0.5rem;
margin-bottom: -0.5rem;
}
h2#title {
.article-title;
}
h1 {
font-size: 1.5em;
}
h2 {
font-size: 1.4em;
}
}
header {
nav {
span, a {
&.pinned {
&.selected {
font-weight: bold;
}
&+.views {
margin-left: 2em;
}
}
}
}
}
.owner-visible {
display: none;
}
}
&#post, &#collection, &#subpage {
code {
.article-code;
}
img, video, audio {
max-width: 100%;
}
audio {
width: 100%;
white-space: initial;
}
pre {
.code-block;
code {
background: transparent;
border: 0;
padding: 0;
font-size: 1em;
white-space: pre-wrap; /* CSS 3 */
white-space: -moz-pre-wrap; /* Mozilla, since 1999 */
white-space: -pre-wrap; /* Opera 4-6 */
white-space: -o-pre-wrap; /* Opera 7 */
word-wrap: break-word; /* Internet Explorer 5.5+ */
}
}
blockquote {
.article-blockquote;
}
article {
hr {
margin-top: 0;
margin-bottom: 0;
}
p.badge {
background-color: #aaa;
display: inline-block;
padding: 0.25em 0.5em;
margin: 0;
float: right;
color: white;
.rounded(.25em);
}
}
header {
nav {
span, a {
&.pinned {
&+.pinned {
margin-left: 1.5em;
}
}
}
}
}
footer {
nav {
a {
margin-top: 0;
}
}
}
}
&#collection {
#welcome, .access {
margin: 0 auto;
max-width: 35em;
h2 {
font-weight: normal;
margin-bottom: 1em;
}
p {
font-size: 1.2em;
line-height: 1.6;
}
}
.access {
margin: 8em auto;
text-align: center;
h2, ul.errors {
font-size: 1.2em;
margin-bottom: 1.5em !important;
}
}
header {
padding: 0 1em;
text-align: center;
max-width: 50em;
margin: 3em auto 4em;
.writeas-prefix {
a {
color: #aaa;
}
display: block;
margin-bottom: 0.5em;
}
nav {
display: block;
margin: 1em 0;
a:first-child {
margin: 0;
}
}
}
nav#manage {
position: absolute;
top: 1em;
left: 1.5em;
li a.write {
font-family: @serifFont;
padding-top: 0.2em;
padding-bottom: 0.2em;
}
}
pre {
line-height: 1.5;
}
.flash {
text-align: center;
margin-bottom: 4em;
}
}
&#subpage {
#wrapper {
h1 {
font-size: 2.5em;
letter-spacing: -2px;
padding: 0 2rem 2rem;
}
}
}
&#post {
pre {
font-size: 0.75em;
}
}
&#collection, &#subpage {
#wrapper {
margin-left: auto;
margin-right: auto;
article {
margin-bottom: 4em;
&:hover {
.hidden {
.opacity(1);
}
}
}
h2 {
margin-top: 0em;
margin-bottom: 0.25em;
&+time {
display: block;
margin-top: 0.25em;
margin-bottom: 0.25em;
}
}
time {
font-size: 1.1em;
&+p {
margin-top: 0.25em;
}
}
footer {
text-align: left;
padding: 0;
}
}
#paging {
overflow: visible;
padding: 1em 6em 0;
}
a.read-more {
color: #666;
}
}
&#me #official-writing {
h2 {
font-weight: normal;
a {
font-size: 0.6em;
margin-left: 1em;
}
a[name] {
margin-left: 0;
}
a:link, a:visited {
color: @textLinkColor;
}
a:hover {
text-decoration: underline;
}
}
}
&#promo {
div.heading {
margin: 8em 0;
}
div.heading, div.attention-form {
h1 {
font-size: 3.5em;
}
input {
padding-left: 0.75em;
padding-right: 0.75em;
&[type=email] {
max-width: 16em;
}
&[type=submit] {
padding-left: 1.5em;
padding-right: 1.5em;
}
}
}
h2 {
margin-bottom: 0;
font-size: 1.8em;
font-weight: normal;
span.write-as {
color: black;
}
&.soon {
color: lighten(@subheaders, 50%);
span {
&.write-as {
color: lighten(#000, 50%);
}
&.note {
color: lighten(#333, 50%);
font-variant: small-caps;
margin-left: 0.5em;
}
}
}
}
.half-col a {
margin-left: 1em;
margin-right: 1em;
}
}
nav#top-nav {
display: inline;
position: absolute;
top: 1.5em;
right: 1.5em;
font-size: 0.95rem;
font-family: @sansFont;
text-transform: uppercase;
a {
color: #777;
}
a + a {
margin-left: 1em;
}
}
footer {
nav, ul {
a {
display: inline-block;
margin-top: 0.8em;
.transition-duration(0.1s);
text-decoration: none;
+ a {
margin-left: 0.8em;
}
&:link, &:visited {
color: #999;
}
&:hover {
color: #666;
text-decoration: none;
}
}
}
a.home {
&:link, &:visited {
color: #333;
}
font-weight: bold;
text-decoration: none;
&:hover {
color: #000;
}
}
ul {
list-style: none;
text-align: left;
padding-left: 0 !important;
margin-left: 0 !important;
.icons img {
height: 16px;
width: 16px;
fill: #999;
}
}
}
}
img {
&.paid {
height: 0.86em;
vertical-align: middle;
margin-bottom: 0.1em;
}
}
nav#full-nav {
margin: 0;
.left-side {
display: inline-block;
a:first-child {
margin-left: 0;
}
}
.right-side {
float: right;
}
}
nav#full-nav a.simple-btn, .tool button {
font-family: @sansFont;
border: 1px solid #ccc !important;
padding: .5rem 1rem;
margin: 0;
.rounded(.25em);
text-decoration: none;
}
.post-title {
a {
&:link {
color: #333;
}
&:visited {
color: #444;
}
}
time, time a:link, time a:visited, &+.time {
color: #999;
}
}
.hidden {
-moz-transition-property: opacity;
-webkit-transition-property: opacity;
-o-transition-property: opacity;
transition-property: opacity;
.transition-duration(0.4s);
.opacity(0);
}
a {
text-decoration: none;
&:hover {
text-decoration: underline;
}
&.subdued {
color: #999;
&:hover {
border-bottom: 1px solid #999;
text-decoration: none;
}
}
&.danger {
color: @dangerCol;
font-size: 0.86em;
}
&.simple-cta {
text-decoration: none;
border-bottom: 1px solid #ccc;
color: #333;
padding-bottom: 2px;
&:hover {
text-decoration: none;
}
}
&.action-btn {
font-family: @sansFont;
text-transform: uppercase;
.rounded(.25em);
background-color: red;
color: white;
font-weight: bold;
padding: 0.5em 0.75em;
&:hover {
background-color: lighten(#f00, 5%);
text-decoration: none;
}
}
&.hashtag:hover {
text-decoration: none;
span + span {
text-decoration: underline;
}
}
&.hashtag {
span:first-child {
color: #999;
margin-right: 0.1em;
font-size: 0.86em;
text-decoration: none;
}
}
}
abbr {
border-bottom: 1px dotted #999;
text-decoration: none;
cursor: help;
}
body#collection article p, body#subpage article p {
.article-p;
}
pre, body#post article, #post .alert, #subpage .alert, body#collection article, body#subpage article, body#subpage #wrapper h1 {
max-width: 40rem;
margin: 0 auto;
}
#collection header .alert, #post .alert, #subpage .alert {
margin-bottom: 1em;
p {
text-align: left;
line-height: 1.5;
}
}
textarea, input#title, pre, body#post article, body#collection article p {
&.norm, &.sans, &.wrap {
line-height: 1.5;
white-space: pre-wrap; /* CSS 3 */
white-space: -moz-pre-wrap; /* Mozilla, since 1999 */
white-space: -pre-wrap; /* Opera 4-6 */
white-space: -o-pre-wrap; /* Opera 7 */
word-wrap: break-word; /* Internet Explorer 5.5+ */
}
}
textarea, input#title, pre, body#post article, body#collection article, body#subpage article, span, .font {
&.norm {
font-family: @serifFont;
}
&.sans {
font-family: @sansFont;
}
&.mono, &.wrap, &.code {
font-family: @monoFont;
}
&.mono, &.code {
max-width: none !important;
}
}
textarea {
&.section {
border: 1px solid #ccc;
padding: 0.65em 0.75em;
.rounded(.25em);
&.codable {
height: 12em;
resize: vertical;
}
}
}
.ace_editor {
height: 12em;
border: 1px solid #333;
max-width: initial;
width: 100%;
font-size: 0.86em !important;
border: 1px solid #ccc;
padding: 0.65em 0.75em;
margin: 0;
.rounded(.25em);
}
p {
-webkit-font-smoothing: antialiased;
-moz-osx-font-smoothing: grayscale;
&.intro {
font-size: 1.25em;
text-align: center;
}
&.upgrade-prompt {
font-size: 0.9em;
color: #444;
}
&.text-cta {
font-size: 1.2em;
text-align: center;
margin-bottom: 0.5em;
&+ p {
text-align: center;
font-size: 0.7em;
margin-top: 0;
color: #666;
}
}
&.error {
font-style: italic;
color: @errUrgentCol;
}
&.headeresque {
font-size: 2em;
}
}
table.classy {
width: 95%;
border-collapse: collapse;
margin-bottom: 2em;
tr + tr {
border-top: 1px solid #ccc;
}
th {
text-transform: uppercase;
font-weight: normal;
font-size: 95%;
font-family: @sansFont;
padding: 1rem 0.75rem;
text-align: center;
}
td {
height: 3.5rem;
}
p {
margin-top: 0 !important;
margin-bottom: 0 !important;
}
&.export {
.disabled {
color: #999;
}
.disabled, a {
text-transform: lowercase;
}
}
}
article table {
border-spacing: 0;
border-collapse: collapse;
width: 100%;
th {
border-width: 1px 1px 2px 1px;
border-style: solid;
border-color: #ccc;
}
td {
border-width: 0 1px 1px 1px;
border-style: solid;
border-color: #ccc;
padding: .25rem .5rem;
}
}
body#collection article, body#subpage article {
padding-top: 0;
padding-bottom: 0;
.book {
h2 {
font-size: 1.4em;
}
a.hidden.action {
color: #666;
float: right;
font-size: 1em;
margin-left: 1em;
margin-bottom: 1em;
}
}
}
+#wrapper.archive {
+ h1 {
+ margin: 0 !important;
+ }
+ ul {
+ list-style: none;
+
+ li {
+ display: flex;
+ justify-content: space-between;
+ line-height: 1.4;
+ margin: 0.5em 0;
+ }
+
+ .year {
+ font-weight: bold;
+ font-size: 1.5em;
+ }
+ }
+}
body#post article {
p.badge {
font-size: 0.9em;
}
}
article {
h2.post-title a[rel=nofollow]::after {
content: '\a0 \2934';
}
}
table.downloads {
width: 100%;
td {
text-align: center;
}
img.os {
width: 48px;
vertical-align: middle;
margin-bottom: 6px;
}
}
select.inputform, textarea.inputform {
border: 1px solid #999;
background: white;
}
input, button, select.inputform, textarea.inputform, a.btn {
padding: 0.5em;
font-family: @serifFont;
font-size: 100%;
.rounded(.25em);
&[type=submit], &.submit, &.cta {
border: 1px solid @primary;
background: @primary;
color: white;
.transition(0.2s);
&:hover {
background-color: lighten(@primary, 3%);
text-decoration: none;
}
&:disabled {
cursor: default;
background-color: desaturate(@primary, 100%) !important;
border-color: desaturate(@primary, 100%) !important;
}
}
&.error[type=text], textarea.error {
-webkit-transition: all 0.30s ease-in-out;
-moz-transition: all 0.30s ease-in-out;
-ms-transition: all 0.30s ease-in-out;
-o-transition: all 0.30s ease-in-out;
outline: none;
}
&.danger {
border: 1px solid @dangerCol;
background: @dangerCol;
color: white;
&:hover {
background-color: lighten(@dangerCol, 3%);
}
}
&.error[type=text]:focus, textarea.error:focus {
box-shadow: 0 0 5px @errUrgentCol;
border: 1px solid @errUrgentCol;
}
}
.btn.pager {
border: 1px solid @lightNavBorder;
font-size: .86em;
padding: .5em 1em;
white-space: nowrap;
font-family: @sansFont;
&:hover {
text-decoration: none;
background: @lightNavBorder;
}
}
.btn.cta.secondary, input[type=submit].secondary {
background: transparent;
color: @primary;
&:hover {
background-color: #f9f9f9;
}
}
.btn.cta.disabled {
background-color: desaturate(@primary, 100%) !important;
border-color: desaturate(@primary, 100%) !important;
}
div.flat-select {
display: inline-block;
position: relative;
select {
border: 0;
background: 0;
-webkit-appearance: none;
-moz-appearance: none;
appearance: none;
position: absolute;
top: 0;
left: 0;
right: 0;
bottom: 0;
width: 100%;
height: 100%;
opacity: 0;
}
&.action {
&:hover {
label {
text-decoration: underline;
}
}
label, select {
cursor: pointer;
}
}
}
input {
&.underline{
border: none;
border-bottom: 1px solid #ccc;
padding: 0 .2em .2em;
font-size: 0.9em;
color: #333;
}
&.inline {
padding: 0.2rem 0.2rem;
margin-left: 0;
font-size: 1em;
border: 0 !important;
border-bottom: 1px solid #999 !important;
width: 7em;
.rounded(0);
}
&[type=tel], &[type=text], &[type=email], &[type=password] {
border: 1px solid #999;
}
&.boxy {
border: 1px solid #999 !important;
}
}
#beta, .content-container {
max-width: 50em;
margin: 0 auto 3em;
font-size: 1.2em;
&.toosmall {
max-width: 25em;
}
&.tight {
max-width: 30em;
}
&.snug {
max-width: 40em;
}
.app {
+ .app {
margin-top: 1.5em;
}
h2 {
margin-bottom: 0.25em;
}
p {
margin-top: 0.25em;
}
}
h2.intro {
font-weight: normal;
}
p {
line-height: 1.5;
}
li {
margin: 0.3em 0;
}
h2 {
&.light {
font-weight: normal;
}
a {
.transition-duration(0.2s);
-moz-transition-property: color;
-webkit-transition-property: color;
-o-transition-property: color;
transition-property: color;
&:link, &:visited, &:hover {
color: @subheaders;
}
&:hover {
color: lighten(@subheaders, 10%);
text-decoration: none;
}
}
}
}
.content-container {
&#pricing {
button {
cursor: pointer;
color: white;
margin-top: 1em;
margin-bottom: 1em;
padding-left: 1.5em;
padding-right: 1.5em;
border: 0;
background: @primary;
.rounded(.25em);
.transition(0.2s);
&:hover {
background-color: lighten(@primary, 5%);
}
&.unselected {
cursor: pointer;
}
}
h2 span {
font-weight: normal;
}
.half {
margin: 0 0 1em 0;
text-align: center;
}
}
div.blurbs {
>h2 {
text-align: center;
color: #333;
font-weight: normal;
}
p.price {
font-size: 1.2em;
margin-bottom: 0;
color: #333;
margin-top: 0.5em;
&+p {
margin-top: 0;
font-size: 0.8em;
}
}
p.text-cta {
font-size: 1em;
}
}
}
footer div.blurbs {
display: flex;
flex-flow: row;
flex-wrap: wrap;
}
div.blurbs {
.half, .third, .fourth {
font-size: 0.86em;
h3 {
font-weight: normal;
}
p, ul {
color: #595959;
}
hr {
margin: 1em 0;
}
}
.half {
padding: 0 1em 0 0;
width: ~"calc(50% - 1em)";
&+.half {
padding: 0 0 0 1em;
}
}
.third {
padding: 0;
width: ~"calc(33% - 1em)";
&+.third {
padding: 0 0 0 1em;
}
}
.fourth {
flex: 1 1 25%;
-webkit-flex: 1 1 25%;
h3 {
margin-bottom: 0.5em;
}
ul {
margin-top: 0.5em;
}
}
}
.contain-me {
text-align: left;
margin: 0 auto 4em;
max-width: 50em;
h2 + p, h2 + p + p, p.describe-me {
margin-left: 1.5em;
margin-right: 1.5em;
color: #333;
}
}
footer.contain-me {
font-size: 1.1em;
}
#official-writing, #wrapper {
h2, h3, h4 {
color: @subheaders;
}
ul {
&.collections {
padding-left: 0;
margin-left: 0;
h3 {
margin-top: 0;
font-weight: normal;
}
li {
&.collection {
a.title {
&:link, &:visited {
color: @headerTextColor;
}
}
}
a.create {
color: #444;
}
}
& + p {
margin-top: 2em;
margin-left: 1em;
}
}
}
}
#official-writing, #wrapper {
h2 {
&.major {
color: #222;
}
&.bugfix {
color: #666;
}
+.android-version {
a {
color: #999;
&:hover {
text-decoration: underline;
}
}
}
}
}
li {
line-height: 1.5;
.item-desc, .prog-lang {
font-size: 0.6em;
font-family: 'Open Sans', sans-serif;
font-weight: bold;
margin-left: 0.5em;
margin-right: 0.5em;
text-transform: uppercase;
color: #999;
}
}
.success {
color: darken(@proSelectedCol, 20%);
}
.alert {
padding: 1em;
margin-bottom: 1.25em;
border: 1px solid transparent;
.rounded(.25em);
&.info {
color: #31708f;
background-color: #d9edf7;
border-color: #bce8f1;
}
&.success {
color: #3c763d;
background-color: #dff0d8;
border-color: #d6e9c6;
}
&.danger {
border-color: #856404;
background-color: white;
h3 {
margin: 0 0 0.5em 0;
font-size: 1em;
font-weight: bold;
color: black !important;
}
h3 + p, button {
font-size: 0.86em;
}
}
p {
margin: 0;
&+p {
margin-top: 0.5em;
}
}
p.dismiss {
font-family: @sansFont;
text-align: right;
font-size: 0.86em;
text-transform: uppercase;
}
}
-ul.errors {
+ul.errors {
padding: 0;
text-indent: 0;
li.urgent {
list-style: none;
font-style: italic;
text-align: center;
color: @errUrgentCol;
a:link, a:visited {
color: purple;
}
}
li.info {
list-style: none;
font-size: 1.1em;
text-align: center;
}
}
body#pad #target a.upgrade-prompt {
padding-left: 1em;
padding-right: 1em;
text-align: center;
font-style: italic;
color: @primary;
}
body#pad-sub #posts, .atoms {
margin-top: 1.5em;
h3 {
margin-bottom: 0.25em;
&+ h4 {
margin-top: 0.25em;
margin-bottom: 0.5em;
&+ p {
margin-top: 0.5em;
}
}
.electron {
font-weight: normal;
font-size: 0.86em;
margin-left: 0.75rem;
}
}
h3, h4 {
a {
.transition-duration(0.2s);
-moz-transition-property: color;
-webkit-transition-property: color;
-o-transition-property: color;
transition-property: color;
}
}
h4 {
font-size: 0.9em;
font-weight: normal;
}
date, .electron {
margin-right: 0.5em;
}
.action {
font-size: 1em;
}
#more-posts p {
text-align: center;
font-size: 1.1em;
}
p {
font-size: 0.86em;
}
.error {
display: inline-block;
font-size: 0.8em;
font-style: italic;
color: @errUrgentCol;
strong {
font-style: normal;
}
}
.error + nav {
display: inline-block;
font-size: 0.8em;
margin-left: 1em;
a + a {
margin-left: 0.75em;
}
}
}
h2 {
a, time {
&+.action {
margin-left: 0.5em;
}
}
}
.action {
font-size: 0.7em;
font-weight: normal;
font-family: @serifFont;
&+ .action {
margin-left: 0.5em;
}
&.new-post {
font-weight: bold;
}
}
article.moved {
p {
font-size: 1.2em;
color: #999;
}
}
span.as {
.opacity(0.2);
font-weight: normal;
}
span.ras {
.opacity(0.6);
font-weight: normal;
}
header {
nav {
.username {
font-size: 2em;
font-weight: normal;
color: #555;
}
&#user-nav {
margin-left: 0;
& > a, .tabs > a {
&.selected {
cursor: default;
font-weight: bold;
&:hover {
text-decoration: none;
}
}
& + a {
margin-left: 2em;
}
}
a {
font-size: 1.2em;
font-family: @sansFont;
span {
font-size: 0.7em;
color: #999;
text-transform: uppercase;
margin-left: 0.5em;
margin-right: 0.5em;
}
&.title {
font-size: 1.6em;
font-family: @serifFont;
font-weight: bold;
}
}
nav > ul > li:first-child {
&> a {
display: inline-block;
}
img {
position: relative;
top: -0.5em;
right: 0.3em;
}
}
ul ul {
font-size: 0.8em;
a {
padding-top: 0.25em;
padding-bottom: 0.25em;
}
}
li {
line-height: 1.5;
}
}
&.tabs {
margin: 0 0 0 1em;
}
&+ nav.tabs {
margin: 0;
}
}
&.singleuser {
margin: 0.5em 1em 0.5em 0.25em;
nav#user-nav {
nav > ul > li:first-child {
img {
top: -0.75em;
}
}
}
.right-side {
padding-top: 0.5em;
}
}
.dash-nav {
font-weight: bold;
}
}
li#create-collection {
display: none;
h4 {
margin-top: 0px;
margin-bottom: 0px;
}
input[type=submit] {
margin-left: 0.5em;
}
}
#collection-options {
.option {
textarea {
font-size: 0.86em;
font-family: @monoFont;
}
.section > p.explain {
font-size: 0.8em;
}
}
}
.img-placeholder {
text-align: center;
img {
max-width: 100%;
}
}
dl {
&.admin-dl-horizontal {
dt {
font-weight: bolder;
width: 360px;
}
dd {
line-height: 1.5;
}
}
}
dt {
float: left;
clear: left;
overflow: hidden;
text-overflow: ellipsis;
white-space: nowrap;
}
form {
dt, dd {
padding: 0.5rem 0;
}
dt {
line-height: 1.8;
}
dd {
font-size: 0.86em;
line-height: 2;
}
&.prominent {
margin: 1em 0;
label {
font-weight: bold;
}
input, select {
width: 100%;
}
select {
font-size: 1em;
padding: 0.5rem;
display: block;
border-radius: 0.25rem;
margin: 0.5rem 0;
}
}
}
div.row {
display: flex;
align-items: center;
> div {
flex: 1;
}
}
.check, .blip {
font-size: 1.125em;
color: #71D571;
}
.ex.failure {
font-weight: bold;
color: @dangerCol;
}
@media all and (max-width: 450px) {
body#post {
header {
nav {
.xtra-feature {
display: none;
}
}
}
}
}
@media all and (min-width: 1280px) {
body#promo {
div.heading {
margin: 10em 0;
}
}
}
@media all and (min-width: 1600px) {
body#promo {
div.heading {
margin: 14em 0;
}
}
}
@media all and (max-width: 900px) {
.half.big {
padding: 0 !important;
width: 100% !important;
}
.third {
padding: 0 !important;
float: none;
width: 100% !important;
p.introduction {
font-size: 0.86em;
}
}
div.blurbs {
.fourth {
flex: 1 1 15em;
-webkit-flex: 1 1 15em;
}
}
.blurbs .third, .blurbs .half {
p, ul {
text-align: left;
}
}
.half-col, .big {
float: none;
text-align: center;
&+.half-col, &+.big {
margin-top: 4em !important;
margin-left: 0;
}
}
#beta, .content-container {
font-size: 1.15em;
}
}
@media all and (max-width: 600px) {
div.row:not(.admin-actions) {
flex-direction: column;
}
.half {
padding: 0 !important;
width: 100% !important;
}
.third {
width: 100% !important;
float: none;
}
body#promo {
div.heading {
margin: 6em 0;
}
h2 {
font-size: 1.6em;
}
.half-col a + a {
margin-left: 1em;
}
.half-col a.channel {
margin-left: auto !important;
margin-right: auto !important;
}
}
ul.add-integrations {
li {
display: list-item;
&+ li {
margin-left: 0;
}
}
}
}
@media all and (max-height: 500px) {
body#promo {
div.heading {
margin: 5em 0;
}
}
}
@media all and (max-height: 400px) {
body#promo {
div.heading {
margin: 0em 0;
}
}
}
/* Smartphones (portrait and landscape) ----------- */
@media only screen and (min-device-width : 320px) and (max-device-width : 480px) {
header {
.opacity(1);
}
}
/* Smartphones (portrait) ----------- */
@media only screen and (max-width : 320px) {
.content-container#pricing {
.half {
float: none;
width: 100%;
}
}
header {
.opacity(1);
}
}
/* iPads (portrait and landscape) ----------- */
@media only screen and (min-device-width : 768px) and (max-device-width : 1024px) {
header {
.opacity(1);
}
}
@media (pointer: coarse) {
body footer nav a:not(.pubd) {
padding: 0.8em 1em;
margin-left: 0;
margin-top: 0;
}
article {
.hidden {
.opacity(1);
}
}
}
@media print {
h1 {
page-break-before: always;
}
h1, h2, h3, h4, h5, h6 {
page-break-after: avoid;
}
table, figure {
page-break-inside: avoid;
}
header, footer {
display: none;
}
article#post-body {
margin-top: 2em;
margin-left: 0;
margin-right: 0;
}
hr {
border: 1px solid #ccc;
}
}
.code-block {
padding: 0;
max-width: 100%;
margin: 0;
background: #f8f8f8;
border: 1px solid #ccc;
padding: 0.375em 0.625em;
font-size: 0.86em;
.rounded(.25em);
}
pre.code-block {
overflow-x: auto;
}
#emailsub {
text-align: center;
}
p#emailsub {
display: inline-block !important;
width: 100%;
font-style: italic;
}
#subscribe-btn {
margin-left: 0.5em;
}
#org-nav {
font-family: @sansFont;
font-size: 1.1em;
color: #888;
em, strong {
color: #000;
}
&+h1 {
margin-top: 0.5em;
}
a:link, a:visited, a:hover {
color: @accent;
}
a:first-child {
margin-right: 0.25em;
}
a.coll-name {
font-weight: bold;
margin-left: 0.25em;
}
-}
\ No newline at end of file
+}
diff --git a/less/post-temp.less b/less/post-temp.less
index aec7d26..bb818c1 100644
--- a/less/post-temp.less
+++ b/less/post-temp.less
@@ -1,97 +1,97 @@
body {
&#post, &#subpage {
header {
margin: 0 auto;
padding: 1em 2rem;
.opacity(0.4);
-moz-transition-property: opacity;
-webkit-transition-property: opacity;
-o-transition-property: opacity;
transition-property: opacity;
.transition-duration(.4s);
&:hover {
.opacity(1);
}
-
+
h1 {
font-size: 1.6em;
}
}
article {
h2#title.dated {
margin-bottom: 0.5em;
}
time.dt-published {
display: block;
color: #666;
margin-bottom: 1em;
}
}
}
}
-article, pre, .hljs {
+article, pre, .hljs, #wrapper.archive ul {
padding: 0.5em 2rem 1.5em;
}
body#post article, pre, .hljs {
font-size: 1.2em;
}
p.split {
color: #6161FF;
font-style: italic;
font-size: 0.86em;
}
#readmore-sell {
padding: 1em 1em 2em;
background-color: #fafafa;
p.split {
color: black;
font-style: normal;
font-size: 1.4em;
}
.cta + .cta {
margin-left: 0.5em;
}
}
/* Post mixins */
.article-code() {
background-color: #f8f8f8;
border: 1px solid #ccc;
padding: 0.2em 0.4em;
font-size: 0.86em;
.rounded(.25em);
}
.article-blockquote() {
border-left: 4px solid #ddd;
padding: 0 1em;
margin: 0.5em;
color: #767676;
display: inline-block;
p {
display: block;
margin: 0.5em 0;
}
}
.article-p() {
line-height: 1.5;
white-space: pre-wrap; /* CSS 3 */
white-space: -moz-pre-wrap; /* Mozilla, since 1999 */
white-space: -pre-wrap; /* Opera 4-6 */
white-space: -o-pre-wrap; /* Opera 7 */
word-wrap: break-word; /* Internet Explorer 5.5+ */
}
.article-title() {
font-size: 1.5em;
display: block;
margin-top: 0;
margin-bottom: 1em;
}
.hljs {
overflow-x: inherit;
background: transparent;
}
diff --git a/migrations/migrations.go b/migrations/migrations.go
index fc638ee..6b5b094 100644
--- a/migrations/migrations.go
+++ b/migrations/migrations.go
@@ -1,150 +1,151 @@
/*
* Copyright © 2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
// Package migrations contains database migrations for WriteFreely
package migrations
import (
"database/sql"
"github.com/writeas/web-core/log"
)
// TODO: refactor to use the datastore struct from writefreely pkg
type datastore struct {
*sql.DB
driverName string
}
func NewDatastore(db *sql.DB, dn string) *datastore {
return &datastore{db, dn}
}
// TODO: use these consts from writefreely pkg
const (
driverMySQL = "mysql"
driverSQLite = "sqlite3"
)
type Migration interface {
Description() string
Migrate(db *datastore) error
}
type migration struct {
description string
migrate func(db *datastore) error
}
func New(d string, fn func(db *datastore) error) Migration {
return &migration{d, fn}
}
func (m *migration) Description() string {
return m.description
}
func (m *migration) Migrate(db *datastore) error {
return m.migrate(db)
}
var migrations = []Migration{
New("support user invites", supportUserInvites), // -> V1 (v0.8.0)
New("support dynamic instance pages", supportInstancePages), // V1 -> V2 (v0.9.0)
New("support users suspension", supportUserStatus), // V2 -> V3 (v0.11.0)
New("support oauth", oauth), // V3 -> V4
New("support slack oauth", oauthSlack), // V4 -> v5
New("support ActivityPub mentions", supportActivityPubMentions), // V5 -> V6
New("support oauth attach", oauthAttach), // V6 -> V7
New("support oauth via invite", oauthInvites), // V7 -> V8 (v0.12.0)
New("optimize drafts retrieval", optimizeDrafts), // V8 -> V9
New("support post signatures", supportPostSignatures), // V9 -> V10 (v0.13.0)
New("Widen oauth_users.access_token", widenOauthAcceesToken), // V10 -> V11
New("support verifying fedi profile", fediverseVerifyProfile), // V11 -> V12 (v0.14.0)
New("support newsletters", supportLetters), // V12 -> V13
New("support password resetting", supportPassReset), // V13 -> V14
New("speed up blog post retrieval", addPostRetrievalIndex), // V14 -> V15
+ New("support ActivityPub likes", supportRemoteLikes), // V15 -> V16 (v0.16.0)
}
// CurrentVer returns the current migration version the application is on
func CurrentVer() int {
return len(migrations)
}
func SetInitialMigrations(db *datastore) error {
// Included schema files represent changes up to V1, so note that in the database
_, err := db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", 1, "")
if err != nil {
return err
}
return nil
}
func Migrate(db *datastore) error {
var version int
var err error
if db.tableExists("appmigrations") {
err = db.QueryRow("SELECT MAX(version) FROM appmigrations").Scan(&version)
if err != nil {
return err
}
} else {
log.Info("Initializing appmigrations table...")
version = 0
_, err = db.Exec(`CREATE TABLE appmigrations (
version ` + db.typeInt() + ` NOT NULL,
migrated ` + db.typeDateTime() + ` NOT NULL,
result ` + db.typeText() + ` NOT NULL
) ` + db.engine() + `;`)
if err != nil {
return err
}
}
if len(migrations[version:]) > 0 {
for i, m := range migrations[version:] {
curVer := version + i + 1
log.Info("Migrating to V%d: %s", curVer, m.Description())
err = m.Migrate(db)
if err != nil {
return err
}
// Update migrations table
_, err = db.Exec("INSERT INTO appmigrations (version, migrated, result) VALUES (?, "+db.now()+", ?)", curVer, "")
if err != nil {
return err
}
}
} else {
log.Info("Database up-to-date. No migrations to run.")
}
return nil
}
func (db *datastore) tableExists(t string) bool {
var dummy string
var err error
if db.driverName == driverSQLite {
err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = ?", t).Scan(&dummy)
} else {
err = db.QueryRow("SHOW TABLES LIKE '" + t + "'").Scan(&dummy)
}
switch {
case err == sql.ErrNoRows:
return false
case err != nil:
log.Error("Couldn't SHOW TABLES: %v", err)
return false
}
return true
}
diff --git a/migrations/v16.go b/migrations/v16.go
new file mode 100644
index 0000000..03ce78a
--- /dev/null
+++ b/migrations/v16.go
@@ -0,0 +1,38 @@
+/*
+ * Copyright © 2024 Musing Studio LLC.
+ *
+ * This file is part of WriteFreely.
+ *
+ * WriteFreely is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License, included
+ * in the LICENSE file in this source code package.
+ */
+
+package migrations
+
+func supportRemoteLikes(db *datastore) error {
+ t, err := db.Begin()
+ if err != nil {
+ t.Rollback()
+ return err
+ }
+
+ _, err = t.Exec(`CREATE TABLE remote_likes (
+ post_id ` + db.typeChar(16) + ` NOT NULL,
+ remote_user_id ` + db.typeInt() + ` NOT NULL,
+ created ` + db.typeDateTime() + ` NOT NULL,
+ PRIMARY KEY (post_id,remote_user_id)
+)`)
+ if err != nil {
+ t.Rollback()
+ return err
+ }
+
+ err = t.Commit()
+ if err != nil {
+ t.Rollback()
+ return err
+ }
+
+ return nil
+}
diff --git a/posts.go b/posts.go
index 19f01fd..f4ab8b1 100644
--- a/posts.go
+++ b/posts.go
@@ -1,1702 +1,1715 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"database/sql"
"encoding/json"
"fmt"
"github.com/writefreely/writefreely/spam"
"html/template"
"net/http"
"net/url"
"regexp"
"strings"
"time"
"github.com/gorilla/mux"
"github.com/gosimple/slug"
"github.com/guregu/null"
"github.com/guregu/null/zero"
"github.com/kylemcc/twitter-text-go/extract"
"github.com/microcosm-cc/bluemonday"
stripmd "github.com/writeas/go-strip-markdown/v2"
"github.com/writeas/impart"
"github.com/writeas/monday"
"github.com/writeas/web-core/activitystreams"
"github.com/writeas/web-core/bots"
"github.com/writeas/web-core/converter"
"github.com/writeas/web-core/i18n"
"github.com/writeas/web-core/log"
"github.com/writeas/web-core/tags"
"github.com/writefreely/writefreely/page"
"github.com/writefreely/writefreely/parse"
)
const (
// Post ID length bounds
minIDLen = 10
maxIDLen = 10
userPostIDLen = 10
postIDLen = 10
postMetaDateFormat = "2006-01-02 15:04:05"
+)
+
+type PostType string
+
+const (
+ postArch PostType = "archive"
shortCodePaid = "<!--paid-->"
)
type (
AnonymousPost struct {
ID string
Content string
HTMLContent template.HTML
Font string
Language string
Direction string
Title string
GenTitle string
Description string
Author string
Views int64
Images []string
IsPlainText bool
IsCode bool
IsLinkable bool
}
AuthenticatedPost struct {
ID string `json:"id" schema:"id"`
Web bool `json:"web" schema:"web"`
*SubmittedPost
}
// SubmittedPost represents a post supplied by a client for publishing or
// updating. Since Title and Content can be updated to "", they are
// pointers that can be easily tested to detect changes.
SubmittedPost struct {
Slug *string `json:"slug" schema:"slug"`
Title *string `json:"title" schema:"title"`
Content *string `json:"body" schema:"body"`
Font string `json:"font" schema:"font"`
IsRTL converter.NullJSONBool `json:"rtl" schema:"rtl"`
Language converter.NullJSONString `json:"lang" schema:"lang"`
Created *string `json:"created" schema:"created"`
}
// Post represents a post as found in the database.
Post struct {
ID string `db:"id" json:"id"`
Slug null.String `db:"slug" json:"slug,omitempty"`
Font string `db:"text_appearance" json:"appearance"`
Language zero.String `db:"language" json:"language"`
RTL zero.Bool `db:"rtl" json:"rtl"`
Privacy int64 `db:"privacy" json:"-"`
OwnerID null.Int `db:"owner_id" json:"-"`
CollectionID null.Int `db:"collection_id" json:"-"`
PinnedPosition null.Int `db:"pinned_position" json:"-"`
Created time.Time `db:"created" json:"created"`
Updated time.Time `db:"updated" json:"updated"`
ViewCount int64 `db:"view_count" json:"-"`
+ LikeCount int64 `db:"like_count" json:"likes"`
Title zero.String `db:"title" json:"title"`
HTMLTitle template.HTML `db:"title" json:"-"`
Content string `db:"content" json:"body"`
HTMLContent template.HTML `db:"content" json:"-"`
HTMLExcerpt template.HTML `db:"content" json:"-"`
Tags []string `json:"tags"`
Images []string `json:"images,omitempty"`
IsPaid bool `json:"paid"`
OwnerName string `json:"owner,omitempty"`
}
// PublicPost holds properties for a publicly returned post, i.e. a post in
// a context where the viewer may not be the owner. As such, sensitive
// metadata for the post is hidden and properties supporting the display of
// the post are added.
PublicPost struct {
*Post
IsSubdomain bool `json:"-"`
IsTopLevel bool `json:"-"`
DisplayDate string `json:"-"`
Views int64 `json:"views"`
+ Likes int64 `json:"likes"`
Owner *PublicUser `json:"-"`
IsOwner bool `json:"-"`
URL string `json:"url,omitempty"`
Collection *CollectionObj `json:"collection,omitempty"`
}
CollectionPostPage struct {
*PublicPost
page.StaticPage
IsOwner bool
IsPinned bool
IsCustomDomain bool
Monetization string
Verification string
PinnedPosts *[]PublicPost
IsFound bool
IsAdmin bool
CanInvite bool
Silenced bool
// Helper field for Chorus mode
CollAlias string
}
RawPost struct {
Id, Slug string
Title string
Content string
Views int64
Font string
Created time.Time
Updated time.Time
IsRTL sql.NullBool
Language sql.NullString
OwnerID int64
CollectionID sql.NullInt64
Found bool
Gone bool
}
AnonymousAuthPost struct {
ID string `json:"id"`
Token string `json:"token"`
}
ClaimPostRequest struct {
*AnonymousAuthPost
CollectionAlias string `json:"collection"`
CreateCollection bool `json:"create_collection"`
// Generated properties
Slug string `json:"-"`
}
ClaimPostResult struct {
ID string `json:"id,omitempty"`
Code int `json:"code,omitempty"`
ErrorMessage string `json:"error_msg,omitempty"`
Post *PublicPost `json:"post,omitempty"`
}
)
func (p *Post) Direction() string {
if p.RTL.Valid {
if p.RTL.Bool {
return "rtl"
}
return "ltr"
}
return "auto"
}
// DisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) DisplayTitle() string {
if p.Title.String != "" {
return p.Title.String
}
t := friendlyPostTitle(p.Content, p.ID)
return t
}
// PlainDisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) PlainDisplayTitle() string {
if t := stripmd.Strip(p.DisplayTitle()); t != "" {
return t
}
return p.ID
}
// FormattedDisplayTitle dynamically generates a title from the Post's contents if it
// doesn't already have an explicit title.
func (p *Post) FormattedDisplayTitle() template.HTML {
if p.HTMLTitle != "" {
return p.HTMLTitle
}
return template.HTML(p.DisplayTitle())
}
// Summary gives a shortened summary of the post based on the post's title,
// especially for display in a longer list of posts. It extracts a summary for
// posts in the Title\n\nBody format, returning nothing if the entire was short
// enough that the extracted title == extracted summary.
func (p Post) Summary() string {
if p.Content == "" {
return ""
}
p.Content = stripHTMLWithoutEscaping(p.Content)
// and Markdown
p.Content = stripmd.StripOptions(p.Content, stripmd.Options{SkipImages: true})
title := p.Title.String
var desc string
if title == "" {
// No title, so generate one
title = friendlyPostTitle(p.Content, p.ID)
desc = postDescription(p.Content, title, p.ID)
if desc == title {
return ""
}
return desc
}
return shortPostDescription(p.Content)
}
func (p Post) SummaryHTML() template.HTML {
return template.HTML(p.Summary())
}
// Excerpt shows any text that comes before a (more) tag.
// TODO: use HTMLExcerpt in templates instead of this method
func (p *Post) Excerpt() template.HTML {
return p.HTMLExcerpt
}
func (p *Post) CreatedDate() string {
return p.Created.Format("2006-01-02")
}
func (p *Post) Created8601() string {
return p.Created.Format("2006-01-02T15:04:05Z")
}
func (p *Post) IsScheduled() bool {
return p.Created.After(time.Now())
}
func (p *Post) HasTag(tag string) bool {
// Regexp looks for tag and has a non-capturing group at the end looking
// for the end of the word.
// Assisted by: https://stackoverflow.com/a/35192941/1549194
hasTag, _ := regexp.MatchString("#"+tag+`(?:[[:punct:]]|\s|\z)`, p.Content)
return hasTag
}
func (p *Post) HasTitleLink() bool {
if p.Title.String == "" {
return false
}
hasLink, _ := regexp.MatchString(`([^!]+|^)\[.+\]\(.+\)`, p.Title.String)
return hasLink
}
func (c CollectionPostPage) DisplayMonetization() string {
if c.Collection == nil {
log.Info("CollectionPostPage.DisplayMonetization: c.Collection is nil")
return ""
}
return displayMonetization(c.Monetization, c.Collection.Alias)
}
func handleViewPost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
friendlyID := vars["post"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw() and viewCollectionPost()
isJSON := strings.HasSuffix(friendlyID, ".json")
isXML := strings.HasSuffix(friendlyID, ".xml")
isCSS := strings.HasSuffix(friendlyID, ".css")
isMarkdown := strings.HasSuffix(friendlyID, ".md")
isRaw := strings.HasSuffix(friendlyID, ".txt") || isJSON || isXML || isCSS || isMarkdown
// Display reserved page if that is requested resource
if t, ok := pages[r.URL.Path[1:]+".tmpl"]; ok {
return handleTemplatedPage(app, w, r, t)
} else if r.URL.Path == "/sitemap.xml" && !app.cfg.App.SingleUser {
return impart.HTTPError{Status: http.StatusNotFound, Message: "Page not found."}
} else if (strings.Contains(r.URL.Path, ".") && !isRaw && !isMarkdown) || r.URL.Path == "/robots.txt" || r.URL.Path == "/manifest.json" {
// Serve static file
app.shttp.ServeHTTP(w, r)
return nil
}
// Display collection if this is a collection
c, _ := app.db.GetCollection(friendlyID)
if c != nil {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", friendlyID)}
}
// Normalize the URL, redirecting user to consistent post URL
if friendlyID != strings.ToLower(friendlyID) {
return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s", strings.ToLower(friendlyID))}
}
ext := ""
if isRaw {
parts := strings.Split(friendlyID, ".")
friendlyID = parts[0]
if len(parts) > 1 {
ext = "." + parts[1]
}
}
var ownerID sql.NullInt64
var collectionID sql.NullInt64
var title string
var content string
var font string
var language []byte
var rtl []byte
var views int64
var post *AnonymousPost
var found bool
var gone bool
fixedID := slug.Make(friendlyID)
if fixedID != friendlyID {
return impart.HTTPError{http.StatusFound, fmt.Sprintf("/%s%s", fixedID, ext)}
}
err := app.db.QueryRow("SELECT owner_id, collection_id, title, content, text_appearance, view_count, language, rtl FROM posts WHERE id = ?", friendlyID).Scan(&ownerID, &collectionID, &title, &content, &font, &views, &language, &rtl)
switch {
case err == sql.ErrNoRows:
found = false
// Output the error in the correct format
if isJSON {
content = "{\"error\": \"Post not found.\"}"
} else if isRaw {
content = "Post not found."
} else {
return ErrPostNotFound
}
case err != nil:
found = false
log.Error("Post loading err: %s\n", err)
return ErrInternalGeneral
default:
found = true
var d string
if len(rtl) == 0 {
d = "auto"
} else if rtl[0] == 49 {
// TODO: find a cleaner way to get this (possibly NULL) value
d = "rtl"
} else {
d = "ltr"
}
generatedTitle := friendlyPostTitle(content, friendlyID)
sanitizedContent := content
if font != "code" {
sanitizedContent = template.HTMLEscapeString(content)
}
var desc string
if title == "" {
desc = postDescription(content, title, friendlyID)
} else {
desc = shortPostDescription(content)
}
post = &AnonymousPost{
ID: friendlyID,
Content: sanitizedContent,
Title: title,
GenTitle: generatedTitle,
Description: desc,
Author: "",
Font: font,
IsPlainText: isRaw,
IsCode: font == "code",
IsLinkable: font != "code",
Views: views,
Language: string(language),
Direction: d,
}
if !isRaw {
post.HTMLContent = template.HTML(applyMarkdown([]byte(content), "", app.cfg))
post.Images = extractImages(post.Content)
}
}
var silenced bool
if found {
silenced, err = app.db.IsUserSilenced(ownerID.Int64)
if err != nil {
log.Error("view post: %v", err)
}
}
var protectDraft bool
if found && collectionID.Valid {
collection, err := app.db.GetCollectionByID(collectionID.Int64)
if err != nil {
log.Error("view post: %v", err)
}
protectDraft = collection.IsPrivate() || collection.IsProtected()
}
// Check if post has been unpublished
if title == "" && content == "" {
gone = true
if isJSON {
content = "{\"error\": \"Post was unpublished.\"}"
} else if isCSS {
content = ""
} else if isRaw {
content = "Post was unpublished."
} else {
return ErrPostUnpublished
}
}
var u = &User{}
if isRaw {
contentType := "text/plain"
if isJSON {
contentType = "application/json"
} else if isCSS {
contentType = "text/css"
} else if isXML {
contentType = "application/xml"
} else if isMarkdown {
contentType = "text/markdown"
}
w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
if isMarkdown && post.Title != "" {
fmt.Fprintf(w, "%s\n", post.Title)
for i := 1; i <= len(post.Title); i++ {
fmt.Fprintf(w, "=")
}
fmt.Fprintf(w, "\n\n")
}
fmt.Fprint(w, content)
if !found {
return ErrPostNotFound
} else if gone {
return ErrPostUnpublished
}
} else {
var err error
page := struct {
*AnonymousPost
page.StaticPage
Username string
IsOwner bool
SiteURL string
Silenced bool
}{
AnonymousPost: post,
StaticPage: pageForReq(app, r),
SiteURL: app.cfg.App.Host,
}
if u = getUserSession(app, r); u != nil {
page.Username = u.Username
page.IsOwner = ownerID.Valid && ownerID.Int64 == u.ID
}
if !page.IsOwner && silenced {
return ErrPostNotFound
}
if !page.IsOwner && protectDraft {
return ErrPostNotFound
}
page.Silenced = silenced
err = templates["post"].ExecuteTemplate(w, "post", page)
if err != nil {
log.Error("Post template execute error: %v", err)
}
}
go func() {
if u != nil && ownerID.Valid && ownerID.Int64 == u.ID {
// Post is owned by someone; skip view increment since that person is viewing this post.
return
}
// Update stats for non-raw post views
if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE id = ?", friendlyID)
if err != nil {
log.Error("Unable to update posts count: %v", err)
}
}
}()
return nil
}
// API v2 funcs
// newPost creates a new post with or without an owning Collection.
//
// Endpoints:
// - /posts
// - /posts?collection={alias}
// - ? /collections/{alias}/posts
func newPost(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
collAlias := vars["alias"]
if collAlias == "" {
collAlias = r.FormValue("collection")
}
accessToken := r.Header.Get("Authorization")
if accessToken == "" {
// TODO: remove this
accessToken = r.FormValue("access_token")
}
// FIXME: determine web submission with Content-Type header
var u *User
var userID int64 = -1
var username string
if accessToken == "" {
u = getUserSession(app, r)
if u != nil {
userID = u.ID
username = u.Username
}
} else {
userID = app.db.GetUserID(accessToken)
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("new post: %v", err)
}
if silenced {
return ErrUserSilenced
}
if userID == -1 {
return ErrNotLoggedIn
}
if accessToken == "" && u == nil && collAlias != "" {
return impart.HTTPError{http.StatusBadRequest, "Parameter `access_token` required."}
}
// Get post data
var p *SubmittedPost
if reqJSON {
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&p)
if err != nil {
log.Error("Couldn't parse new post JSON request: %v\n", err)
return ErrBadJSON
}
if p.Title == nil {
t := ""
p.Title = &t
}
if strings.TrimSpace(*(p.Title)) == "" && (p.Content == nil || strings.TrimSpace(*(p.Content)) == "") {
return ErrNoPublishableContent
}
if p.Content == nil {
c := ""
p.Content = &c
}
} else {
post := r.FormValue("body")
appearance := r.FormValue("font")
title := r.FormValue("title")
rtlValue := r.FormValue("rtl")
langValue := r.FormValue("lang")
if strings.TrimSpace(post) == "" {
return ErrNoPublishableContent
}
var isRTL, rtlValid bool
if rtlValue == "auto" && langValue != "" {
isRTL = i18n.LangIsRTL(langValue)
rtlValid = true
} else {
isRTL = rtlValue == "true"
rtlValid = rtlValue != "" && langValue != ""
}
// Create a new post
p = &SubmittedPost{
Title: &title,
Content: &post,
Font: appearance,
IsRTL: converter.NullJSONBool{sql.NullBool{Bool: isRTL, Valid: rtlValid}},
Language: converter.NullJSONString{sql.NullString{String: langValue, Valid: langValue != ""}},
}
}
if !p.isFontValid() {
p.Font = "norm"
}
var newPost *PublicPost = &PublicPost{}
var coll *Collection
if accessToken != "" {
newPost, err = app.db.CreateOwnedPost(p, accessToken, collAlias, app.cfg.App.Host)
} else {
//return ErrNotLoggedIn
// TODO: verify user is logged in
var collID int64
if collAlias != "" {
coll, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
coll.hostName = app.cfg.App.Host
if coll.OwnerID != u.ID {
return ErrForbiddenCollection
}
collID = coll.ID
}
// TODO: return PublicPost from createPost
newPost.Post, err = app.db.CreatePost(userID, collID, p)
}
if err != nil {
return err
}
if coll != nil {
coll.ForPublic()
newPost.Collection = &CollectionObj{Collection: *coll}
}
newPost.extractData()
newPost.OwnerName = username
newPost.URL = newPost.CanonicalURL(app.cfg.App.Host)
// Write success now
response := impart.WriteSuccess(w, newPost, http.StatusCreated)
if newPost.Collection != nil {
if !app.cfg.App.Private && app.cfg.App.Federation && !newPost.Created.After(time.Now()) {
go federatePost(app, newPost, newPost.Collection.ID, false)
}
if app.cfg.Email.Enabled() && newPost.Collection.EmailSubsEnabled() {
go app.db.InsertJob(&PostJob{
PostID: newPost.ID,
Action: "email",
Delay: emailSendDelay,
})
}
}
return response
}
func existingPost(app *App, w http.ResponseWriter, r *http.Request) error {
reqJSON := IsJSON(r)
vars := mux.Vars(r)
postID := vars["post"]
p := AuthenticatedPost{ID: postID}
var err error
if reqJSON {
// Decode JSON request
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&p)
if err != nil {
log.Error("Couldn't parse post update JSON request: %v\n", err)
return ErrBadJSON
}
} else {
err = r.ParseForm()
if err != nil {
log.Error("Couldn't parse post update form request: %v\n", err)
return ErrBadFormData
}
// Can't decode to a nil SubmittedPost property, so create instance now
p.SubmittedPost = &SubmittedPost{}
err = app.formDecoder.Decode(&p, r.PostForm)
if err != nil {
log.Error("Couldn't decode post update form request: %v\n", err)
return ErrBadFormData
}
}
if p.Web {
p.IsRTL.Valid = true
}
if p.SubmittedPost == nil {
return ErrPostNoUpdatableVals
}
// Ensure an access token was given
accessToken := r.Header.Get("Authorization")
// Get user's cookie session if there's no token
var u *User
//var username string
if accessToken == "" {
u = getUserSession(app, r)
if u != nil {
//username = u.Username
}
}
if u == nil && accessToken == "" {
return ErrNoAccessToken
}
// Get user ID from current session or given access token, if one was given.
var userID int64
if u != nil {
userID = u.ID
} else if accessToken != "" {
userID, err = AuthenticateUser(app.db, accessToken)
if err != nil {
return err
}
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("existing post: %v", err)
}
if silenced {
return ErrUserSilenced
}
// Modify post struct
p.ID = postID
err = app.db.UpdateOwnedPost(&p, userID)
if err != nil {
if reqJSON {
return err
}
if err, ok := err.(impart.HTTPError); ok {
addSessionFlash(app, w, r, err.Message, nil)
} else {
addSessionFlash(app, w, r, err.Error(), nil)
}
}
var pRes *PublicPost
pRes, err = app.db.GetPost(p.ID, 0)
if reqJSON {
if err != nil {
return err
}
pRes.extractData()
}
if pRes.CollectionID.Valid {
coll, err := app.db.GetCollectionBy("id = ?", pRes.CollectionID.Int64)
if err == nil && !app.cfg.App.Private && app.cfg.App.Federation {
coll.hostName = app.cfg.App.Host
pRes.Collection = &CollectionObj{Collection: *coll}
go federatePost(app, pRes, pRes.Collection.ID, true)
}
}
// Write success now
if reqJSON {
return impart.WriteSuccess(w, pRes, http.StatusOK)
}
addSessionFlash(app, w, r, "Changes saved.", nil)
collectionAlias := vars["alias"]
redirect := "/" + postID + "/meta"
if collectionAlias != "" {
collPre := "/" + collectionAlias
if app.cfg.App.SingleUser {
collPre = ""
}
redirect = collPre + "/" + pRes.Slug.String + "/edit/meta"
} else {
if app.cfg.App.SingleUser {
redirect = "/d" + redirect
}
}
w.Header().Set("Location", redirect)
w.WriteHeader(http.StatusFound)
return nil
}
func deletePost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
friendlyID := vars["post"]
editToken := r.FormValue("token")
var ownerID int64
var u *User
accessToken := r.Header.Get("Authorization")
if accessToken == "" && editToken == "" {
u = getUserSession(app, r)
if u == nil {
return ErrNoAccessToken
}
}
var res sql.Result
var t *sql.Tx
var err error
var collID sql.NullInt64
var coll *Collection
var pp *PublicPost
if editToken != "" {
// TODO: SELECT owner_id, as well, and return appropriate error if NULL instead of running two queries
var dummy int64
err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ?", friendlyID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
return impart.HTTPError{http.StatusNotFound, "Post not found."}
}
err = app.db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND owner_id IS NULL", friendlyID).Scan(&dummy)
switch {
case err == sql.ErrNoRows:
// Post already has an owner. This could provide a bad experience
// for the user, but it's more important to ensure data isn't lost
// unexpectedly. So prevent deletion via token.
return impart.HTTPError{http.StatusConflict, "This post belongs to some user (hopefully yours). Please log in and delete it from that user's account."}
}
res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND modify_token = ? AND owner_id IS NULL", friendlyID, editToken)
} else if accessToken != "" || u != nil {
// Caller provided some way to authenticate; assume caller expects the
// post to be deleted based on a specific post owner, thus we should
// return corresponding errors.
if accessToken != "" {
ownerID = app.db.GetUserID(accessToken)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
ownerID = u.ID
}
// TODO: don't make two queries
var realOwnerID sql.NullInt64
err = app.db.QueryRow("SELECT collection_id, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&collID, &realOwnerID)
if err != nil {
return err
}
if !collID.Valid {
// There's no collection; simply delete the post
res, err = app.db.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
} else {
// Post belongs to a collection; do any additional clean up
coll, err = app.db.GetCollectionBy("id = ?", collID.Int64)
if err != nil {
log.Error("Unable to get collection: %v", err)
return err
}
if app.cfg.App.Federation {
// First fetch full post for federation
pp, err = app.db.GetOwnedPost(friendlyID, ownerID)
if err != nil {
log.Error("Unable to get owned post: %v", err)
return err
}
collObj := &CollectionObj{Collection: *coll}
pp.Collection = collObj
}
t, err = app.db.Begin()
if err != nil {
log.Error("No begin: %v", err)
return err
}
res, err = t.Exec("DELETE FROM posts WHERE id = ? AND owner_id = ?", friendlyID, ownerID)
}
} else {
return impart.HTTPError{http.StatusBadRequest, "No authenticated user or post token given."}
}
if err != nil {
return err
}
affected, err := res.RowsAffected()
if err != nil {
if t != nil {
t.Rollback()
log.Error("Rows affected err! Rolling back")
}
return err
} else if affected == 0 {
if t != nil {
t.Rollback()
log.Error("No rows affected! Rolling back")
}
return impart.HTTPError{http.StatusForbidden, "Post not found, or you're not the owner."}
}
if t != nil {
t.Commit()
}
if coll != nil && !app.cfg.App.Private && app.cfg.App.Federation {
go deleteFederatedPost(app, pp, collID.Int64)
}
return impart.HTTPError{Status: http.StatusNoContent}
}
// addPost associates a post with the authenticated user.
func addPost(app *App, w http.ResponseWriter, r *http.Request) error {
var ownerID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
ownerID = app.db.GetUserID(at)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
ownerID = u.ID
}
silenced, err := app.db.IsUserSilenced(ownerID)
if err != nil {
log.Error("add post: %v", err)
}
if silenced {
return ErrUserSilenced
}
// Parse claimed posts in format:
// [{"id": "...", "token": "..."}]
var claims *[]ClaimPostRequest
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&claims)
if err != nil {
return ErrBadJSONArray
}
vars := mux.Vars(r)
collAlias := vars["alias"]
// Update all given posts
res, err := app.db.ClaimPosts(app.cfg, ownerID, collAlias, claims)
if err != nil {
return err
}
for _, pRes := range *res {
if pRes.Code != http.StatusOK {
continue
}
if !app.cfg.App.Private && app.cfg.App.Federation {
if !pRes.Post.Created.After(time.Now()) {
pRes.Post.Collection.hostName = app.cfg.App.Host
go federatePost(app, pRes.Post, pRes.Post.Collection.ID, false)
}
}
if app.cfg.Email.Enabled() && pRes.Post.Collection.EmailSubsEnabled() {
go app.db.InsertJob(&PostJob{
PostID: pRes.Post.ID,
Action: "email",
Delay: emailSendDelay,
})
}
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
func dispersePost(app *App, w http.ResponseWriter, r *http.Request) error {
var ownerID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
ownerID = app.db.GetUserID(at)
if ownerID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
ownerID = u.ID
}
// Parse posts in format:
// ["..."]
var postIDs []string
decoder := json.NewDecoder(r.Body)
err := decoder.Decode(&postIDs)
if err != nil {
return ErrBadJSONArray
}
// Update all given posts
res, err := app.db.DispersePosts(ownerID, postIDs)
if err != nil {
return err
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
type (
PinPostResult struct {
ID string `json:"id,omitempty"`
Code int `json:"code,omitempty"`
ErrorMessage string `json:"error_msg,omitempty"`
}
)
// pinPost pins a post to a blog
func pinPost(app *App, w http.ResponseWriter, r *http.Request) error {
var userID int64
// Authenticate user
at := r.Header.Get("Authorization")
if at != "" {
userID = app.db.GetUserID(at)
if userID == -1 {
return ErrBadAccessToken
}
} else {
u := getUserSession(app, r)
if u == nil {
return ErrNotLoggedIn
}
userID = u.ID
}
silenced, err := app.db.IsUserSilenced(userID)
if err != nil {
log.Error("pin post: %v", err)
}
if silenced {
return ErrUserSilenced
}
// Parse request
var posts []struct {
ID string `json:"id"`
Position int64 `json:"position"`
}
decoder := json.NewDecoder(r.Body)
err = decoder.Decode(&posts)
if err != nil {
return ErrBadJSONArray
}
// Validate data
vars := mux.Vars(r)
collAlias := vars["alias"]
coll, err := app.db.GetCollection(collAlias)
if err != nil {
return err
}
if coll.OwnerID != userID {
return ErrForbiddenCollection
}
// Do (un)pinning
isPinning := r.URL.Path[strings.LastIndex(r.URL.Path, "/"):] == "/pin"
res := []PinPostResult{}
for _, p := range posts {
err = app.db.UpdatePostPinState(isPinning, p.ID, coll.ID, userID, p.Position)
ppr := PinPostResult{ID: p.ID}
if err != nil {
ppr.Code = http.StatusInternalServerError
// TODO: set error message
} else {
ppr.Code = http.StatusOK
}
res = append(res, ppr)
}
return impart.WriteSuccess(w, res, http.StatusOK)
}
func fetchPost(app *App, w http.ResponseWriter, r *http.Request) error {
var collID int64
var coll *Collection
var err error
vars := mux.Vars(r)
if collAlias := vars["alias"]; collAlias != "" {
// Fetch collection information, since an alias is provided
coll, err = app.db.GetCollection(collAlias)
if err != nil {
return err
}
collID = coll.ID
}
p, err := app.db.GetPost(vars["post"], collID)
if err != nil {
return err
}
if coll == nil && p.CollectionID.Valid {
// Collection post is getting fetched by post ID, not coll alias + post slug, so get coll info now.
coll, err = app.db.GetCollectionByID(p.CollectionID.Int64)
if err != nil {
return err
}
}
if coll != nil {
coll.hostName = app.cfg.App.Host
_, err = apiCheckCollectionPermissions(app, r, coll)
if err != nil {
return err
}
}
silenced, err := app.db.IsUserSilenced(p.OwnerID.Int64)
if err != nil {
log.Error("fetch post: %v", err)
}
if silenced {
return ErrPostNotFound
}
p.extractData()
if IsActivityPubRequest(r) {
if coll == nil {
// This is a draft post; 404 for now
// TODO: return ActivityObject
return impart.HTTPError{http.StatusNotFound, ""}
}
p.Collection = &CollectionObj{Collection: *coll}
po := p.ActivityObject(app)
po.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, po, http.StatusOK)
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func fetchPostProperty(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
p, err := app.db.GetPostProperty(vars["post"], 0, vars["property"])
if err != nil {
return err
}
return impart.WriteSuccess(w, p, http.StatusOK)
}
func (p *Post) processPost() PublicPost {
res := &PublicPost{Post: p, Views: 0}
res.Views = p.ViewCount
+ res.Likes = p.LikeCount
// TODO: move to own function
loc := monday.FuzzyLocale(p.Language.String)
res.DisplayDate = monday.Format(p.Created, monday.LongFormatsByLocale[loc], loc)
return *res
}
func (p *PublicPost) CanonicalURL(hostName string) string {
if p.Collection == nil || p.Collection.Alias == "" {
return hostName + "/" + p.ID + ".md"
}
return p.Collection.CanonicalURL() + p.Slug.String
}
func (pp *PublicPost) DisplayCanonicalURL() string {
us := pp.CanonicalURL(pp.Collection.hostName)
u, err := url.Parse(us)
if err != nil {
return us
}
return u.Hostname() + u.Path
}
func (p *PublicPost) ActivityObject(app *App) *activitystreams.Object {
cfg := app.cfg
var o *activitystreams.Object
if cfg.App.NotesOnly || strings.Index(p.Content, "\n\n") == -1 {
o = activitystreams.NewNoteObject()
} else {
o = activitystreams.NewArticleObject()
}
o.ID = p.Collection.FederatedAPIBase() + "api/posts/" + p.ID
o.Published = p.Created
o.URL = p.CanonicalURL(cfg.App.Host)
o.AttributedTo = p.Collection.FederatedAccount()
o.CC = []string{
p.Collection.FederatedAccount() + "/followers",
}
o.Name = p.DisplayTitle()
p.augmentContent()
if p.HTMLContent == template.HTML("") {
p.formatContent(cfg, false, false)
p.augmentReadingDestination()
}
o.Content = string(p.HTMLContent)
if p.Language.Valid {
o.ContentMap = map[string]string{
p.Language.String: string(p.HTMLContent),
}
}
if len(p.Tags) == 0 {
o.Tag = []activitystreams.Tag{}
} else {
var tagBaseURL string
if isSingleUser {
tagBaseURL = p.Collection.CanonicalURL() + "tag:"
} else {
if cfg.App.Chorus {
tagBaseURL = fmt.Sprintf("%s/read/t/", p.Collection.hostName)
} else {
tagBaseURL = fmt.Sprintf("%s/%s/tag:", p.Collection.hostName, p.Collection.Alias)
}
}
for _, t := range p.Tags {
o.Tag = append(o.Tag, activitystreams.Tag{
Type: activitystreams.TagHashtag,
HRef: tagBaseURL + t,
Name: "#" + t,
})
}
}
if len(p.Images) > 0 {
for _, i := range p.Images {
o.Attachment = append(o.Attachment, activitystreams.NewImageAttachment(i))
}
}
// Find mentioned users
mentionedUsers := make(map[string]string)
stripper := bluemonday.StrictPolicy()
content := stripper.Sanitize(p.Content)
mentions := mentionReg.FindAllString(content, -1)
for _, handle := range mentions {
actorIRI, err := app.db.GetProfilePageFromHandle(app, handle)
if err != nil {
log.Info("Couldn't find user '%s' locally or remotely", handle)
continue
}
mentionedUsers[handle] = actorIRI
}
for handle, iri := range mentionedUsers {
o.CC = append(o.CC, iri)
o.Tag = append(o.Tag, activitystreams.Tag{Type: "Mention", HRef: iri, Name: handle})
}
return o
}
// TODO: merge this into getSlugFromPost or phase it out
func getSlug(title, lang string) string {
return getSlugFromPost("", title, lang)
}
func getSlugFromPost(title, body, lang string) string {
if title == "" {
// Remove Markdown, so e.g. link URLs and image alt text don't make it into the slug
body = strings.TrimSpace(stripmd.StripOptions(body, stripmd.Options{SkipImages: true}))
title = postTitle(body, body)
}
title = parse.PostLede(title, false)
// Truncate lede if needed
title, _ = parse.TruncToWord(title, 80)
var s string
if lang != "" && len(lang) == 2 {
s = slug.MakeLang(title, lang)
} else {
s = slug.Make(title)
}
// Transliteration may cause the slug to expand past the limit, so truncate again
s, _ = parse.TruncToWord(s, 80)
return strings.TrimFunc(s, func(r rune) bool {
// TruncToWord doesn't respect words in a slug, since spaces are replaced
// with hyphens. So remove any trailing hyphens.
return r == '-'
})
}
// isFontValid returns whether or not the submitted post's appearance is valid.
func (p *SubmittedPost) isFontValid() bool {
validFonts := map[string]bool{
"norm": true,
"sans": true,
"mono": true,
"wrap": true,
"code": true,
}
_, valid := validFonts[p.Font]
return valid
}
func getRawPost(app *App, friendlyID string) *RawPost {
var content, font, title string
var isRTL sql.NullBool
var lang sql.NullString
var ownerID sql.NullInt64
var created, updated time.Time
err := app.db.QueryRow("SELECT title, content, text_appearance, language, rtl, created, updated, owner_id FROM posts WHERE id = ?", friendlyID).Scan(&title, &content, &font, &lang, &isRTL, &created, &updated, &ownerID)
switch {
case err == sql.ErrNoRows:
return &RawPost{Content: "", Found: false, Gone: false}
case err != nil:
log.Error("Unable to fetch getRawPost: %s", err)
return &RawPost{Content: "", Found: true, Gone: false}
}
return &RawPost{
Title: title,
Content: content,
Font: font,
Created: created,
Updated: updated,
IsRTL: isRTL,
Language: lang,
OwnerID: ownerID.Int64,
Found: true,
Gone: content == "" && title == "",
}
}
// TODO; return a Post!
func getRawCollectionPost(app *App, slug, collAlias string) *RawPost {
var id, title, content, font string
var isRTL sql.NullBool
var lang sql.NullString
var created, updated time.Time
var ownerID null.Int
var views int64
var err error
if app.cfg.App.SingleUser {
err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = 1", slug).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID)
} else {
err = app.db.QueryRow("SELECT id, title, content, text_appearance, language, rtl, view_count, created, updated, owner_id FROM posts WHERE slug = ? AND collection_id = (SELECT id FROM collections WHERE alias = ?)", slug, collAlias).Scan(&id, &title, &content, &font, &lang, &isRTL, &views, &created, &updated, &ownerID)
}
switch {
case err == sql.ErrNoRows:
return &RawPost{Content: "", Found: false, Gone: false}
case err != nil:
log.Error("Unable to fetch getRawCollectionPost: %s", err)
return &RawPost{Content: "", Found: true, Gone: false}
}
return &RawPost{
Id: id,
Slug: slug,
Title: title,
Content: content,
Font: font,
Created: created,
Updated: updated,
IsRTL: isRTL,
Language: lang,
OwnerID: ownerID.Int64,
Found: true,
Gone: content == "" && title == "",
Views: views,
}
}
func isRaw(r *http.Request) bool {
vars := mux.Vars(r)
slug := vars["slug"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw in viewCollectionPost() and handleViewPost()
isJSON := strings.HasSuffix(slug, ".json")
isXML := strings.HasSuffix(slug, ".xml")
isMarkdown := strings.HasSuffix(slug, ".md")
return strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown
}
func viewCollectionPost(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
slug := vars["slug"]
// NOTE: until this is done better, be sure to keep this in parity with
// isRaw() and handleViewPost()
isJSON := strings.HasSuffix(slug, ".json")
isXML := strings.HasSuffix(slug, ".xml")
isMarkdown := strings.HasSuffix(slug, ".md")
isRaw := strings.HasSuffix(slug, ".txt") || isJSON || isXML || isMarkdown
cr := &collectionReq{}
err := processCollectionRequest(cr, vars, w, r)
if err != nil {
return err
}
// Check for hellbanned users
u, err := checkUserForCollection(app, cr, r, true)
if err != nil {
return err
}
// Normalize the URL, redirecting user to consistent post URL
if slug != strings.ToLower(slug) {
loc := fmt.Sprintf("/%s", strings.ToLower(slug))
if !app.cfg.App.SingleUser {
loc = "/" + cr.alias + loc
}
return impart.HTTPError{http.StatusMovedPermanently, loc}
}
// Display collection if this is a collection
var c *Collection
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(cr.alias)
}
if err != nil {
if err, ok := err.(impart.HTTPError); ok {
if err.Status == http.StatusNotFound {
// Redirect if necessary
newAlias := app.db.GetCollectionRedirect(cr.alias)
if newAlias != "" {
return impart.HTTPError{http.StatusFound, "/" + newAlias + "/" + slug}
}
}
}
return err
}
c.hostName = app.cfg.App.Host
silenced, err := app.db.IsUserSilenced(c.OwnerID)
if err != nil {
log.Error("view collection post: %v", err)
}
// Check collection permissions
if c.IsPrivate() && (u == nil || u.ID != c.OwnerID) {
return ErrPostNotFound
}
if c.IsProtected() && (u == nil || u.ID != c.OwnerID) {
if silenced {
return ErrPostNotFound
} else if !isAuthorizedForCollection(app, c.Alias, r) {
return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "/?g=" + slug}
}
}
cr.isCollOwner = u != nil && c.OwnerID == u.ID
if isRaw {
slug = strings.Split(slug, ".")[0]
}
// Fetch extra data about the Collection
// TODO: refactor out this logic, shared in collection.go:fetchCollection()
coll := NewCollectionObj(c)
owner, err := app.db.GetUserByID(coll.OwnerID)
if err != nil {
// Log the error and just continue
log.Error("Error getting user for collection: %v", err)
} else {
coll.Owner = owner
}
postFound := true
p, err := app.db.GetPost(slug, coll.ID)
if err != nil {
if err == ErrCollectionPageNotFound {
postFound = false
if slug == "feed" {
// User tried to access blog feed without a trailing slash, and
// there's no post with a slug "feed"
return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "feed/"}
+ } else if slug == "archive" {
+ // User tried to access blog Archive without a trailing slash, and
+ // there's no post with a slug "archive"
+ return impart.HTTPError{http.StatusFound, c.CanonicalURL() + "archive/"}
}
po := &Post{
Slug: null.NewString(slug, true),
Font: "norm",
Language: zero.NewString("en", true),
RTL: zero.NewBool(false, true),
Content: `<p class="msg">This page is missing.</p>
Are you sure it was ever here?`,
}
pp := po.processPost()
p = &pp
} else {
return err
}
}
// Check if the authenticated user is the post owner
p.IsOwner = u != nil && u.ID == p.OwnerID.Int64
p.Collection = coll
p.IsTopLevel = app.cfg.App.SingleUser
// Only allow a post owner or admin to view a post for silenced collections
if silenced && !p.IsOwner && (u == nil || !u.IsAdmin()) {
return ErrPostNotFound
}
// Check if post has been unpublished
if p.Content == "" && p.Title.String == "" {
return impart.HTTPError{http.StatusGone, "Post was unpublished."}
}
p.augmentContent()
// Serve collection post
if isRaw {
contentType := "text/plain"
if isJSON {
contentType = "application/json"
} else if isXML {
contentType = "application/xml"
} else if isMarkdown {
contentType = "text/markdown"
}
w.Header().Set("Content-Type", fmt.Sprintf("%s; charset=utf-8", contentType))
if !postFound {
w.WriteHeader(http.StatusNotFound)
fmt.Fprintf(w, "Post not found.")
// TODO: return error instead, so status is correctly reflected in logs
return nil
}
if isMarkdown && p.Title.String != "" {
fmt.Fprintf(w, "# %s\n\n", p.Title.String)
}
fmt.Fprint(w, p.Content)
} else if IsActivityPubRequest(r) {
if !postFound {
return ErrCollectionPageNotFound
}
p.extractData()
ap := p.ActivityObject(app)
ap.Context = []interface{}{activitystreams.Namespace}
setCacheControl(w, apCacheTime)
return impart.RenderActivityJSON(w, ap, http.StatusOK)
} else {
p.extractData()
p.Content = strings.Replace(p.Content, "<!--more-->", "", 1)
if app.cfg.Email.Enabled() && c.EmailSubsEnabled() {
// TODO: indicate plan is inactive or subs disabled when OWNER is viewing their own post.
if u != nil && u.IsEmailSubscriber(app, c.ID) {
p.Content = strings.Replace(p.Content, "<!--emailsub-->", `<p id="emailsub">You're subscribed to email updates. <a href="/api/collections/`+c.Alias+`/email/unsubscribe?slug=`+p.Slug.String+`">Unsubscribe</a>.</p>`, -1)
} else {
p.Content = strings.Replace(p.Content, "<!--emailsub-->", `<form method="post" id="emailsub" action="/api/collections/`+c.Alias+`/email/subscribe"><input type="hidden" name="slug" value="`+p.Slug.String+`" /><input type="hidden" name="web" value="1" /><div style="position: absolute; left: -5000px;" aria-hidden="true"><input type="email" name="`+spam.HoneypotFieldName()+`" tabindex="-1" value="" /><input type="password" name="fake_password" tabindex="-1" placeholder="password" autocomplete="new-password" /></div><input type="email" name="email" placeholder="me@example.com" /><input type="submit" id="subscribe-btn" value="Subscribe" /></form>`, -1)
}
}
p.Content = strings.Replace(p.Content, "&lt;!--emailsub-->", "<!--emailsub-->", 1)
// TODO: move this to function
p.formatContent(app.cfg, cr.isCollOwner, true)
tp := CollectionPostPage{
PublicPost: p,
StaticPage: pageForReq(app, r),
IsOwner: cr.isCollOwner,
IsCustomDomain: cr.isCustomDomain,
IsFound: postFound,
Silenced: silenced,
CollAlias: c.Alias,
}
tp.IsAdmin = u != nil && u.IsAdmin()
tp.CanInvite = canUserInvite(app.cfg, tp.IsAdmin)
tp.PinnedPosts, _ = app.db.GetPinnedPosts(coll, p.IsOwner)
tp.IsPinned = len(*tp.PinnedPosts) > 0 && PostsContains(tp.PinnedPosts, p)
tp.Monetization = coll.Monetization
tp.Verification = coll.Verification
if !postFound {
w.WriteHeader(http.StatusNotFound)
}
postTmpl := "collection-post"
if app.cfg.App.Chorus {
postTmpl = "chorus-collection-post"
}
if err := templates[postTmpl].ExecuteTemplate(w, "post", tp); err != nil {
log.Error("Error in %s template: %v", postTmpl, err)
}
}
go func() {
if p.OwnerID.Valid {
// Post is owned by someone. Don't update stats if owner is viewing the post.
if u != nil && p.OwnerID.Int64 == u.ID {
return
}
}
// Update stats for non-raw post views
if !isRaw && r.Method != "HEAD" && !bots.IsBot(r.UserAgent()) {
_, err := app.db.Exec("UPDATE posts SET view_count = view_count + 1 WHERE slug = ? AND collection_id = ?", slug, coll.ID)
if err != nil {
log.Error("Unable to update posts count: %v", err)
}
}
}()
return nil
}
// TODO: move this to utils after making it more generic
func PostsContains(sl *[]PublicPost, s *PublicPost) bool {
for _, e := range *sl {
if e.ID == s.ID {
return true
}
}
return false
}
func (p *Post) extractData() {
p.Tags = tags.Extract(p.Content)
p.extractImages()
}
func (p *Post) IsSans() bool {
return p.Font == "sans"
}
func (p *Post) IsMonospace() bool {
return p.Font == "mono"
}
func (rp *RawPost) UserFacingCreated() string {
return rp.Created.Format(postMetaDateFormat)
}
func (rp *RawPost) Created8601() string {
return rp.Created.Format("2006-01-02T15:04:05Z")
}
func (rp *RawPost) Updated8601() string {
if rp.Updated.IsZero() {
return ""
}
return rp.Updated.Format("2006-01-02T15:04:05Z")
}
var imageURLRegex = regexp.MustCompile(`(?i)[^ ]+\.(gif|png|jpg|jpeg|avif|avifs|webp|jxl|image)$`)
func (p *Post) extractImages() {
p.Images = extractImages(p.Content)
}
func extractImages(content string) []string {
matches := extract.ExtractUrls(content)
urls := map[string]bool{}
for i := range matches {
uRaw := matches[i].Text
// Parse the extracted text so we can examine the path
u, err := url.Parse(uRaw)
if err != nil {
continue
}
// Ensure the path looks like it leads to an image file
if !imageURLRegex.MatchString(u.Path) {
continue
}
urls[uRaw] = true
}
resURLs := make([]string, 0)
for k := range urls {
resURLs = append(resURLs, k)
}
return resURLs
}
diff --git a/routes.go b/routes.go
index efa79ea..a5b0f2f 100644
--- a/routes.go
+++ b/routes.go
@@ -1,247 +1,249 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"net/http"
"net/url"
"path/filepath"
"strings"
"github.com/gorilla/csrf"
"github.com/gorilla/mux"
"github.com/writeas/go-webfinger"
"github.com/writeas/web-core/log"
"github.com/writefreely/go-nodeinfo"
)
// InitStaticRoutes adds routes for serving static files.
// TODO: this should just be a func, not method
func (app *App) InitStaticRoutes(r *mux.Router) {
// Handle static files
fs := http.FileServer(http.Dir(filepath.Join(app.cfg.Server.StaticParentDir, staticDir)))
fs = cacheControl(fs)
app.shttp = http.NewServeMux()
app.shttp.Handle("/", fs)
r.PathPrefix("/").Handler(fs)
}
// InitRoutes adds dynamic routes for the given mux.Router.
func InitRoutes(apper Apper, r *mux.Router) *mux.Router {
// Create handler
handler := NewWFHandler(apper)
// Set up routes
hostSubroute := apper.App().cfg.App.Host[strings.Index(apper.App().cfg.App.Host, "://")+3:]
if apper.App().cfg.App.SingleUser {
hostSubroute = "{domain}"
} else {
if strings.HasPrefix(hostSubroute, "localhost") {
hostSubroute = "localhost"
}
}
if apper.App().cfg.App.SingleUser {
log.Info("Adding %s routes (single user)...", hostSubroute)
} else {
log.Info("Adding %s routes (multi-user)...", hostSubroute)
}
// Primary app routes
write := r.PathPrefix("/").Subrouter()
// Federation endpoint configurations
wf := webfinger.Default(wfResolver{apper.App().db, apper.App().cfg})
wf.NoTLSHandler = nil
// Federation endpoints
// host-meta
write.HandleFunc("/.well-known/host-meta", handler.Web(handleViewHostMeta, UserLevelReader))
// webfinger
write.HandleFunc(webfinger.WebFingerPath, handler.LogHandlerFunc(http.HandlerFunc(wf.Webfinger)))
// nodeinfo
niCfg := nodeInfoConfig(apper.App().db, apper.App().cfg)
ni := nodeinfo.NewService(*niCfg, nodeInfoResolver{apper.App().cfg, apper.App().db})
write.HandleFunc(nodeinfo.NodeInfoPath, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfoDiscover)))
write.HandleFunc(niCfg.InfoURL, handler.LogHandlerFunc(http.HandlerFunc(ni.NodeInfo)))
// handle mentions
write.HandleFunc("/@/{handle}", handler.Web(handleViewMention, UserLevelReader))
configureSlackOauth(handler, write, apper.App())
configureWriteAsOauth(handler, write, apper.App())
configureGitlabOauth(handler, write, apper.App())
configureGenericOauth(handler, write, apper.App())
configureGiteaOauth(handler, write, apper.App())
// Set up dynamic page handlers
// Handle auth
auth := write.PathPrefix("/api/auth/").Subrouter()
if apper.App().cfg.App.OpenRegistration {
auth.HandleFunc("/signup", handler.All(apiSignup)).Methods("POST")
}
auth.HandleFunc("/login", handler.All(login)).Methods("POST")
auth.HandleFunc("/read", handler.WebErrors(handleWebCollectionUnlock, UserLevelNone)).Methods("POST")
auth.HandleFunc("/me", handler.All(handleAPILogout)).Methods("DELETE")
// Handle logged in user sections
me := write.PathPrefix("/me").Subrouter()
me.HandleFunc("/", handler.Redirect("/me", UserLevelUser))
me.HandleFunc("/c", handler.Redirect("/me/c/", UserLevelUser)).Methods("GET")
me.HandleFunc("/c/", handler.User(viewCollections)).Methods("GET")
me.HandleFunc("/c/{collection}", handler.User(viewEditCollection)).Methods("GET")
me.HandleFunc("/c/{collection}/stats", handler.User(viewStats)).Methods("GET")
me.HandleFunc("/c/{collection}/subscribers", handler.User(handleViewSubscribers)).Methods("GET")
me.Path("/delete").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(handleUserDelete))).Methods("POST")
me.HandleFunc("/posts", handler.Redirect("/me/posts/", UserLevelUser)).Methods("GET")
me.HandleFunc("/posts/", handler.User(viewArticles)).Methods("GET")
me.HandleFunc("/posts/export.csv", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
me.HandleFunc("/posts/export.zip", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
me.HandleFunc("/posts/export.json", handler.Download(viewExportPosts, UserLevelUser)).Methods("GET")
me.HandleFunc("/export", handler.User(viewExportOptions)).Methods("GET")
me.HandleFunc("/export.json", handler.Download(viewExportFull, UserLevelUser)).Methods("GET")
me.HandleFunc("/import", handler.User(viewImport)).Methods("GET")
me.Path("/settings").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.User(viewSettings))).Methods("GET")
me.HandleFunc("/invites", handler.User(handleViewUserInvites)).Methods("GET")
me.HandleFunc("/logout", handler.Web(viewLogout, UserLevelNone)).Methods("GET")
write.HandleFunc("/api/me", handler.All(viewMeAPI)).Methods("GET")
apiMe := write.PathPrefix("/api/me/").Subrouter()
apiMe.HandleFunc("/", handler.All(viewMeAPI)).Methods("GET")
apiMe.HandleFunc("/posts", handler.UserWebAPI(viewMyPostsAPI)).Methods("GET")
apiMe.HandleFunc("/collections", handler.UserAPI(viewMyCollectionsAPI)).Methods("GET")
apiMe.HandleFunc("/password", handler.All(updatePassphrase)).Methods("POST")
apiMe.HandleFunc("/self", handler.All(updateSettings)).Methods("POST")
apiMe.HandleFunc("/invites", handler.User(handleCreateUserInvite)).Methods("POST")
apiMe.HandleFunc("/import", handler.User(handleImport)).Methods("POST")
apiMe.HandleFunc("/oauth/remove", handler.User(removeOauth)).Methods("POST")
// Sign up validation
write.HandleFunc("/api/alias", handler.All(handleUsernameCheck)).Methods("POST")
write.HandleFunc("/api/markdown", handler.All(handleRenderMarkdown)).Methods("POST")
instanceURL, _ := url.Parse(apper.App().Config().App.Host)
host := instanceURL.Host
// Handle collections
write.HandleFunc("/api/collections", handler.All(newCollection)).Methods("POST")
apiColls := write.PathPrefix("/api/collections/").Subrouter()
apiColls.HandleFunc("/monetization-pointer", handler.PlainTextAPI(handleSPSPEndpoint)).Methods("GET")
apiColls.HandleFunc("/"+host, handler.AllReader(fetchCollection)).Methods("GET")
apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.AllReader(fetchCollection)).Methods("GET")
apiColls.HandleFunc("/{alias:[0-9a-zA-Z\\-]+}", handler.All(existingCollection)).Methods("POST", "DELETE")
apiColls.HandleFunc("/{alias}/posts", handler.AllReader(fetchCollectionPosts)).Methods("GET")
apiColls.HandleFunc("/{alias}/posts", handler.All(newPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/posts/{post}", handler.AllReader(fetchPost)).Methods("GET")
apiColls.HandleFunc("/{alias}/posts/{post:[a-zA-Z0-9]{10}}", handler.All(existingPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/posts/{post}/splitcontent", handler.AllReader(handleGetSplitContent)).Methods("GET", "POST")
apiColls.HandleFunc("/{alias}/posts/{post}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET")
apiColls.HandleFunc("/{alias}/collect", handler.All(addPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/pin", handler.All(pinPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/unpin", handler.All(pinPost)).Methods("POST")
apiColls.HandleFunc("/{alias}/email/subscribe", handler.All(handleCreateEmailSubscription)).Methods("POST")
apiColls.HandleFunc("/{alias}/email/subscribe", handler.All(handleDeleteEmailSubscription)).Methods("DELETE")
apiColls.HandleFunc("/{collection}/email/unsubscribe", handler.All(handleDeleteEmailSubscription)).Methods("GET")
apiColls.HandleFunc("/{alias}/inbox", handler.All(handleFetchCollectionInbox)).Methods("POST")
apiColls.HandleFunc("/{alias}/outbox", handler.AllReader(handleFetchCollectionOutbox)).Methods("GET")
apiColls.HandleFunc("/{alias}/following", handler.AllReader(handleFetchCollectionFollowing)).Methods("GET")
apiColls.HandleFunc("/{alias}/followers", handler.AllReader(handleFetchCollectionFollowers)).Methods("GET")
// Handle posts
write.HandleFunc("/api/posts", handler.All(newPost)).Methods("POST")
posts := write.PathPrefix("/api/posts/").Subrouter()
+ posts.HandleFunc("/claim", handler.All(addPost)).Methods("POST")
+ posts.HandleFunc("/disperse", handler.All(dispersePost)).Methods("POST")
posts.HandleFunc("/{post:[a-zA-Z0-9]+}", handler.AllReader(fetchPost)).Methods("GET")
posts.HandleFunc("/{post:[a-zA-Z0-9]+}", handler.All(existingPost)).Methods("POST", "PUT")
posts.HandleFunc("/{post:[a-zA-Z0-9]+}", handler.All(deletePost)).Methods("DELETE")
posts.HandleFunc("/{post:[a-zA-Z0-9]+}/{property}", handler.AllReader(fetchPostProperty)).Methods("GET")
- posts.HandleFunc("/claim", handler.All(addPost)).Methods("POST")
- posts.HandleFunc("/disperse", handler.All(dispersePost)).Methods("POST")
write.HandleFunc("/auth/signup", handler.Web(handleWebSignup, UserLevelNoneRequired)).Methods("POST")
write.HandleFunc("/auth/login", handler.Web(webLogin, UserLevelNoneRequired)).Methods("POST")
write.HandleFunc("/admin", handler.Admin(handleViewAdminDash)).Methods("GET")
write.HandleFunc("/admin/monitor", handler.Admin(handleViewAdminMonitor)).Methods("GET")
write.HandleFunc("/admin/settings", handler.Admin(handleViewAdminSettings)).Methods("GET")
write.HandleFunc("/admin/users", handler.Admin(handleViewAdminUsers)).Methods("GET")
write.HandleFunc("/admin/user/{username}", handler.Admin(handleViewAdminUser)).Methods("GET")
write.HandleFunc("/admin/user/{username}/delete", handler.Admin(handleAdminDeleteUser)).Methods("POST")
write.HandleFunc("/admin/user/{username}/status", handler.Admin(handleAdminToggleUserStatus)).Methods("POST")
write.HandleFunc("/admin/user/{username}/passphrase", handler.Admin(handleAdminResetUserPass)).Methods("POST")
write.HandleFunc("/admin/pages", handler.Admin(handleViewAdminPages)).Methods("GET")
write.HandleFunc("/admin/page/{slug}", handler.Admin(handleViewAdminPage)).Methods("GET")
write.HandleFunc("/admin/update/config", handler.AdminApper(handleAdminUpdateConfig)).Methods("POST")
write.HandleFunc("/admin/update/{page}", handler.Admin(handleAdminUpdateSite)).Methods("POST")
write.HandleFunc("/admin/updates", handler.Admin(handleViewAdminUpdates)).Methods("GET")
// Handle special pages first
write.Path("/reset").Handler(csrf.Protect(apper.App().keys.CSRFKey)(handler.Web(viewResetPassword, UserLevelNoneRequired)))
write.HandleFunc("/login", handler.Web(viewLogin, UserLevelNoneRequired))
write.HandleFunc("/signup", handler.Web(handleViewLanding, UserLevelNoneRequired))
write.HandleFunc("/invite/{code:[a-zA-Z0-9]+}", handler.Web(handleViewInvite, UserLevelOptional)).Methods("GET")
// TODO: show a reader-specific 404 page if the function is disabled
write.HandleFunc("/read", handler.Web(viewLocalTimeline, UserLevelReader))
RouteRead(handler, UserLevelReader, write.PathPrefix("/read").Subrouter())
draftEditPrefix := ""
if apper.App().cfg.App.SingleUser {
draftEditPrefix = "/d"
write.HandleFunc("/me/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
} else {
write.HandleFunc("/new", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
}
// All the existing stuff
write.HandleFunc(draftEditPrefix+"/{action}/edit", handler.Web(handleViewPad, UserLevelUser)).Methods("GET")
write.HandleFunc(draftEditPrefix+"/{action}/meta", handler.Web(handleViewMeta, UserLevelUser)).Methods("GET")
// Collections
if apper.App().cfg.App.SingleUser {
RouteCollections(handler, write.PathPrefix("/").Subrouter())
} else {
write.HandleFunc("/{prefix:[@~$!\\-+]}{collection}", handler.Web(handleViewCollection, UserLevelReader))
write.HandleFunc("/{collection}/", handler.Web(handleViewCollection, UserLevelReader))
RouteCollections(handler, write.PathPrefix("/{prefix:[@~$!\\-+]?}{collection}").Subrouter())
// Posts
}
write.HandleFunc(draftEditPrefix+"/{post}", handler.Web(handleViewPost, UserLevelOptional))
write.HandleFunc("/", handler.Web(handleViewHome, UserLevelOptional))
return r
}
func RouteCollections(handler *Handler, r *mux.Router) {
r.HandleFunc("/logout", handler.Web(handleLogOutCollection, UserLevelOptional))
r.HandleFunc("/page/{page:[0-9]+}", handler.Web(handleViewCollection, UserLevelReader))
+ r.HandleFunc("/archive/", handler.Web(handleViewCollection, UserLevelReader))
+ r.HandleFunc("/{archive:archive}/page/{page:[0-9]+}", handler.Web(handleViewCollection, UserLevelReader))
r.HandleFunc("/lang:{lang:[a-z]{2}}", handler.Web(handleViewCollectionLang, UserLevelOptional))
r.HandleFunc("/lang:{lang:[a-z]{2}}/page/{page:[0-9]+}", handler.Web(handleViewCollectionLang, UserLevelOptional))
r.HandleFunc("/tag:{tag}", handler.Web(handleViewCollectionTag, UserLevelReader))
r.HandleFunc("/tag:{tag}/page/{page:[0-9]+}", handler.Web(handleViewCollectionTag, UserLevelReader))
r.HandleFunc("/tag:{tag}/feed/", handler.Web(ViewFeed, UserLevelReader))
r.HandleFunc("/sitemap.xml", handler.AllReader(handleViewSitemap))
r.HandleFunc("/feed/", handler.AllReader(ViewFeed))
r.HandleFunc("/email/confirm/{subscriber}", handler.All(handleConfirmEmailSubscription)).Methods("GET")
r.HandleFunc("/email/unsubscribe/{subscriber}", handler.All(handleDeleteEmailSubscription)).Methods("GET")
r.HandleFunc("/{slug}", handler.CollectionPostOrStatic)
r.HandleFunc("/{slug}/edit", handler.Web(handleViewPad, UserLevelUser))
r.HandleFunc("/{slug}/edit/meta", handler.Web(handleViewMeta, UserLevelUser))
r.HandleFunc("/{slug}/", handler.Web(handleCollectionPostRedirect, UserLevelReader)).Methods("GET")
}
func RouteRead(handler *Handler, readPerm UserLevelFunc, r *mux.Router) {
r.HandleFunc("/api/posts", handler.Web(viewLocalTimelineAPI, readPerm))
r.HandleFunc("/p/{page}", handler.Web(viewLocalTimeline, readPerm))
r.HandleFunc("/feed/", handler.Web(viewLocalTimelineFeed, readPerm))
r.HandleFunc("/t/{tag}", handler.Web(viewLocalTimeline, readPerm))
r.HandleFunc("/a/{post}", handler.Web(handlePostIDRedirect, readPerm))
r.HandleFunc("/{author}", handler.Web(viewLocalTimeline, readPerm))
r.HandleFunc("/", handler.Web(viewLocalTimeline, readPerm))
}
diff --git a/sitemap.go b/sitemap.go
index 0bbcefb..22e4bb4 100644
--- a/sitemap.go
+++ b/sitemap.go
@@ -1,109 +1,109 @@
/*
* Copyright © 2018-2019 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"fmt"
"net/http"
"time"
"github.com/gorilla/mux"
"github.com/ikeikeikeike/go-sitemap-generator/v2/stm"
"github.com/writeas/web-core/log"
)
func buildSitemap(host, alias string) *stm.Sitemap {
sm := stm.NewSitemap(0)
sm.SetDefaultHost(host)
if alias != "/" {
sm.SetSitemapsPath(alias)
}
sm.Create()
// Note: Do not call `sm.Finalize()` because it flushes
// the underlying datastructure from memory to disk.
return sm
}
func handleViewSitemap(app *App, w http.ResponseWriter, r *http.Request) error {
vars := mux.Vars(r)
// Determine canonical blog URL
alias := vars["collection"]
subdomain := vars["subdomain"]
isSubdomain := subdomain != ""
if isSubdomain {
alias = subdomain
}
host := fmt.Sprintf("%s/%s/", app.cfg.App.Host, alias)
var c *Collection
var err error
pre := "/"
if app.cfg.App.SingleUser {
c, err = app.db.GetCollectionByID(1)
} else {
c, err = app.db.GetCollection(alias)
}
if err != nil {
return err
}
c.hostName = app.cfg.App.Host
if !isSubdomain {
pre += alias + "/"
}
host = c.CanonicalURL()
sm := buildSitemap(host, pre)
- posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false)
+ posts, err := app.db.GetPosts(app.cfg, c, 0, false, false, false, "")
if err != nil {
log.Error("Error getting posts: %v", err)
return err
}
lastSiteMod := time.Now()
for i, p := range *posts {
if i == 0 {
lastSiteMod = p.Updated
}
u := stm.URL{
{"loc", p.Slug.String},
{"changefreq", "weekly"},
{"mobile", true},
{"lastmod", p.Updated},
}
if len(p.Images) > 0 {
imgs := []stm.URL{}
for _, i := range p.Images {
imgs = append(imgs, stm.URL{
{"loc", i},
{"title", ""},
})
}
u = append(u, []interface{}{"image", imgs})
}
sm.Add(u)
}
// Add top URL
sm.Add(stm.URL{
{"loc", pre},
{"changefreq", "daily"},
{"priority", "1.0"},
{"lastmod", lastSiteMod},
})
w.Write(sm.XMLContent())
return nil
}
diff --git a/templates.go b/templates.go
index 3bb7d13..484bb99 100644
--- a/templates.go
+++ b/templates.go
@@ -1,240 +1,240 @@
/*
* Copyright © 2018-2021 Musing Studio LLC.
*
* This file is part of WriteFreely.
*
* WriteFreely is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, included
* in the LICENSE file in this source code package.
*/
package writefreely
import (
"errors"
"html/template"
"io"
- "os"
"net/http"
+ "os"
"path/filepath"
"strings"
"github.com/dustin/go-humanize"
"github.com/writeas/web-core/l10n"
"github.com/writeas/web-core/log"
"github.com/writefreely/writefreely/config"
)
var (
templates = map[string]*template.Template{}
pages = map[string]*template.Template{}
userPages = map[string]*template.Template{}
funcMap = template.FuncMap{
"largeNumFmt": largeNumFmt,
"pluralize": pluralize,
"isRTL": isRTL,
"isLTR": isLTR,
"localstr": localStr,
"localhtml": localHTML,
"tolower": strings.ToLower,
"title": strings.Title,
"hasPrefix": strings.HasPrefix,
"hasSuffix": strings.HasSuffix,
"dict": dict,
}
)
const (
templatesDir = "templates"
pagesDir = "pages"
)
func showUserPage(w http.ResponseWriter, name string, obj interface{}) {
if obj == nil {
log.Error("showUserPage: data is nil!")
return
}
if err := userPages[filepath.Join("user", name+".tmpl")].ExecuteTemplate(w, name, obj); err != nil {
log.Error("Error parsing %s: %v", name, err)
}
}
func initTemplate(parentDir, name string) {
if debugging {
log.Info(" " + filepath.Join(parentDir, templatesDir, name+".tmpl"))
}
files := []string{
filepath.Join(parentDir, templatesDir, name+".tmpl"),
filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "base.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
}
- if name == "collection" || name == "collection-tags" || name == "chorus-collection" || name == "read" {
+ if name == "collection" || name == "collection-tags" || name == "collection-archive" || name == "chorus-collection" || name == "read" {
// These pages list out collection posts, so we also parse templatesDir + "include/posts.tmpl"
files = append(files, filepath.Join(parentDir, templatesDir, "include", "posts.tmpl"))
}
if name == "chorus-collection" || name == "chorus-collection-post" {
files = append(files, filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"))
}
- if name == "collection" || name == "collection-tags" || name == "collection-post" || name == "post" || name == "chorus-collection" || name == "chorus-collection-post" {
+ if name == "collection" || name == "collection-tags" || name == "collection-archive" || name == "collection-post" || name == "post" || name == "chorus-collection" || name == "chorus-collection-post" {
files = append(files, filepath.Join(parentDir, templatesDir, "include", "post-render.tmpl"))
}
templates[name] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...))
}
func initPage(parentDir, path, key string) {
if debugging {
log.Info(" [%s] %s", key, path)
}
files := []string{
path,
filepath.Join(parentDir, templatesDir, "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "base.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
}
if key == "login.tmpl" || key == "landing.tmpl" || key == "signup.tmpl" {
files = append(files, filepath.Join(parentDir, templatesDir, "include", "oauth.tmpl"))
}
pages[key] = template.Must(template.New("").Funcs(funcMap).ParseFiles(files...))
}
func initUserPage(parentDir, path, key string) {
if debugging {
log.Info(" [%s] %s", key, path)
}
userPages[key] = template.Must(template.New(key).Funcs(funcMap).ParseFiles(
path,
filepath.Join(parentDir, templatesDir, "user", "include", "header.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "footer.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "silenced.tmpl"),
filepath.Join(parentDir, templatesDir, "user", "include", "nav.tmpl"),
))
}
// InitTemplates loads all template files from the configured parent dir.
func InitTemplates(cfg *config.Config) error {
log.Info("Loading templates...")
tmplFiles, err := os.ReadDir(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir))
if err != nil {
return err
}
for _, f := range tmplFiles {
if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
parts := strings.Split(f.Name(), ".")
key := parts[0]
initTemplate(cfg.Server.TemplatesParentDir, key)
}
}
log.Info("Loading pages...")
// Initialize all static pages that use the base template
err = filepath.Walk(filepath.Join(cfg.Server.PagesParentDir, pagesDir), func(path string, i os.FileInfo, err error) error {
if err != nil {
return err
}
if !i.IsDir() && !strings.HasPrefix(i.Name(), ".") {
key := i.Name()
initPage(cfg.Server.PagesParentDir, path, key)
}
return nil
})
if err != nil {
return err
}
log.Info("Loading user pages...")
// Initialize all user pages that use base templates
err = filepath.Walk(filepath.Join(cfg.Server.TemplatesParentDir, templatesDir, "user"), func(path string, f os.FileInfo, err error) error {
if err != nil {
return err
}
if !f.IsDir() && !strings.HasPrefix(f.Name(), ".") {
corePath := path
if cfg.Server.TemplatesParentDir != "" {
corePath = corePath[len(cfg.Server.TemplatesParentDir)+1:]
}
parts := strings.Split(corePath, string(filepath.Separator))
key := f.Name()
if len(parts) > 2 {
key = filepath.Join(parts[1], f.Name())
}
initUserPage(cfg.Server.TemplatesParentDir, path, key)
}
return nil
})
if err != nil {
return err
}
return nil
}
// renderPage retrieves the given template and renders it to the given io.Writer.
// If something goes wrong, the error is logged and returned.
func renderPage(w io.Writer, tmpl string, data interface{}) error {
err := pages[tmpl].ExecuteTemplate(w, "base", data)
if err != nil {
log.Error("%v", err)
}
return err
}
func largeNumFmt(n int64) string {
return humanize.Comma(n)
}
func pluralize(singular, plural string, n int64) string {
if n == 1 {
return singular
}
return plural
}
func isRTL(d string) bool {
return d == "rtl"
}
func isLTR(d string) bool {
return d == "ltr" || d == "auto"
}
func localStr(term, lang string) string {
s := l10n.Strings(lang)[term]
if s == "" {
s = l10n.Strings("")[term]
}
return s
}
func localHTML(term, lang string) template.HTML {
s := l10n.Strings(lang)[term]
if s == "" {
s = l10n.Strings("")[term]
}
s = strings.Replace(s, "write.as", "<a href=\"https://writefreely.org\">writefreely</a>", 1)
return template.HTML(s)
}
// from: https://stackoverflow.com/a/18276968/1549194
func dict(values ...interface{}) (map[string]interface{}, error) {
if len(values)%2 != 0 {
return nil, errors.New("dict: invalid number of parameters")
}
dict := make(map[string]interface{}, len(values)/2)
for i := 0; i < len(values); i += 2 {
key, ok := values[i].(string)
if !ok {
return nil, errors.New("dict: keys must be strings")
}
dict[key] = values[i+1]
}
return dict, nil
}
diff --git a/templates/collection-archive.tmpl b/templates/collection-archive.tmpl
new file mode 100644
index 0000000..5256c58
--- /dev/null
+++ b/templates/collection-archive.tmpl
@@ -0,0 +1,118 @@
+{{define "collection"}}<!DOCTYPE HTML>
+<html>
+<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
+ <meta charset="utf-8">
+
+ <title>Archive &mdash; {{.Collection.DisplayTitle}}</title>
+
+ <link rel="stylesheet" type="text/css" href="/css/write.css" />
+ {{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
+ <link rel="shortcut icon" href="/favicon.ico" />
+ <link rel="canonical" href="{{.CanonicalURL}}">
+ {{if gt .CurrentPage 1}}<link rel="prev" href="{{.PrevPageURL .Prefix .NavSuffix .CurrentPage .IsTopLevel}}">{{end}}
+ {{if lt .CurrentPage .TotalPages}}<link rel="next" href="{{.NextPageURL .Prefix .NavSuffix .CurrentPage .IsTopLevel}}">{{end}}
+ {{if not .IsPrivate}}<link rel="alternate" type="application/rss+xml" title="{{.DisplayTitle}} &raquo; Feed" href="{{.CanonicalURL}}feed/" />{{end}}
+ <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+
+ <meta name="generator" content="WriteFreely">
+ <meta name="description" content="{{.PlainDescription}}">
+ <meta itemprop="name" content="{{.DisplayTitle}}">
+ <meta itemprop="description" content="{{.PlainDescription}}">
+ <meta name="twitter:card" content="summary">
+ <meta name="twitter:title" content="{{.DisplayTitle}}">
+ <meta name="twitter:image" content="{{.AvatarURL}}">
+ <meta name="twitter:description" content="{{.PlainDescription}}">
+ <meta property="og:title" content="{{.DisplayTitle}}" />
+ <meta property="og:site_name" content="{{.DisplayTitle}}" />
+ <meta property="og:type" content="article" />
+ <meta property="og:url" content="{{.CanonicalURL}}" />
+ <meta property="og:description" content="{{.PlainDescription}}" />
+ <meta property="og:image" content="{{.AvatarURL}}">
+ {{template "collection-meta" .}}
+ {{if .StyleSheet}}<style type="text/css">{{.StyleSheetDisplay}}</style>{{end}}
+
+</head>
+<body id="subpage">
+
+<div id="overlay"></div>
+
+<header>
+ <h1 dir="{{.Direction}}" id="blog-title"><a href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a></h1>
+ <nav>
+ {{if .PinnedPosts}}
+ {{range .PinnedPosts}}<a class="pinned" href="{{if $.IsOwner}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL}}{{end}}">{{.DisplayTitle}}</a>{{end}}
+ {{end}}
+ </nav>
+</header>
+
+{{if .Posts -}}
+<section id="wrapper" class="archive" itemscope itemtype="http://schema.org/Blog">
+ {{- else -}}
+ <div id="wrapper" class="archive">
+ {{- end}}
+
+ <h1>Archive</h1>
+
+ {{if .Flash}}
+ <div class="alert success flash">
+ <p>{{.Flash}}</p>
+ </div>
+ {{end}}
+
+ <ul>
+ {{ $curYear := 0 }}
+ {{ range $el := .Posts }}
+ {{if ne $curYear .Created.Year}}<li class="year">{{.Created.Year}}</li>{{ $curYear = .Created.Year }}{{end}}
+ <li>
+ {{if .HasTitleLink -}}
+ {{.HTMLTitleArrow}}
+ {{- else -}}
+ <a href="{{if $.SingleUser}}/{{else}}/{{$.Alias}}/{{end}}{{.Slug.String}}" itemprop="url" class="u-url">
+ {{- if .DisplayTitle -}}
+ {{- .DisplayTitle -}}
+ {{- else -}}
+ (Untitled)
+ {{end}}
+ </a>
+ {{- end}}
+ {{if .IsScheduled}}[Scheduled]{{end}}
+ {{if $.Format.ShowDates -}}
+ <time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}">
+ {{- if .HasTitleLink -}}
+ <a href="{{if $.SingleUser}}/{{else}}/{{$.Alias}}/{{end}}{{.Slug.String}}" itemprop="url">
+ {{- end -}}
+ {{.DisplayDate}}
+ {{- if .HasTitleLink -}}
+ {{- if .IsPaid}}{{template "paid-badge" (dict "CDNHost" $.CDNHost)}}{{end -}}</a>
+ {{- end -}}
+ </time>
+ {{- else -}}
+ {{- if .HasTitleLink -}}
+ <a href="{{if $.SingleUser}}/{{else}}/{{$.Alias}}/{{end}}{{.Slug.String}}" itemprop="url">view</a>
+ {{- end -}}
+ {{- end}}
+ </li>
+ {{end}}
+ </ul>
+
+ {{template "paging" .}}
+
+ {{if .Posts}}</section>{{else}}</div>{{end}}
+
+ {{if .ShowFooterBranding }}
+ <footer>
+ <hr />
+ <nav dir="ltr">
+ {{if not .SingleUser}}<a class="home pubd" href="/">{{.SiteName}}</a> &middot; {{end}}powered by <a style="margin-left:0" href="https://writefreely.org">writefreely</a>
+ </nav>
+ </footer>
+ {{ end }}
+
+</body>
+
+{{if .CanShowScript}}
+ {{range .ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
+ {{if .Collection.Script}}<script type="text/javascript">{{.ScriptDisplay}}</script>{{end}}
+{{end}}
+<script src="/js/localdate.js"></script>
+</html>{{end}}
diff --git a/templates/collection-post.tmpl b/templates/collection-post.tmpl
index e742f8c..3d3132d 100644
--- a/templates/collection-post.tmpl
+++ b/templates/collection-post.tmpl
@@ -1,145 +1,146 @@
{{define "post"}}<!DOCTYPE HTML>
<html {{if .Language.Valid}}lang="{{.Language.String}}"{{end}} dir="{{.Direction}}">
<head prefix="og: http://ogp.me/ns# article: http://ogp.me/ns/article#">
<meta charset="utf-8">
<title>{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{.Collection.DisplayTitle}}</title>
-
+
<link rel="stylesheet" type="text/css" href="/css/write.css" />
{{if .CustomCSS}}<link rel="stylesheet" type="text/css" href="/local/custom.css" />{{end}}
<link rel="shortcut icon" href="/favicon.ico" />
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
{{ if .IsFound }}
<link rel="canonical" href="{{.CanonicalURL .Host}}" />
<meta name="generator" content="WriteFreely">
<meta name="title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
<meta name="description" content="{{.Summary}}">
{{if gt .Views 1}}<meta name="twitter:label1" value="Views">
<meta name="twitter:data1" value="{{largeNumFmt .Views}}">{{end}}
<meta name="author" content="{{.Collection.Title}}" />
<meta itemprop="description" content="{{.Summary}}">
<meta itemprop="datePublished" content="{{.CreatedDate}}" />
<meta name="twitter:card" content="summary">
<meta name="twitter:description" content="{{.Summary}}">
<meta name="twitter:title" content="{{.PlainDisplayTitle}} {{localhtml "title dash" .Language.String}} {{if .Collection.Title}}{{.Collection.Title}}{{else}}{{.Collection.Alias}}{{end}}">
{{if gt (len .Images) 0}}<meta name="twitter:image" content="{{index .Images 0}}">{{else}}<meta name="twitter:image" content="{{.Collection.AvatarURL}}">{{end}}
<meta property="og:title" content="{{.PlainDisplayTitle}}" />
<meta property="og:description" content="{{.Summary}}" />
<meta property="og:site_name" content="{{.Collection.DisplayTitle}}" />
<meta property="og:type" content="article" />
<meta property="og:url" content="{{.CanonicalURL .Host}}" />
<meta property="og:updated_time" content="{{.Created8601}}" />
{{range .Images}}<meta property="og:image" content="{{.}}" />{{else}}<meta property="og:image" content="{{.Collection.AvatarURL}}">{{end}}
<meta property="article:published_time" content="{{.Created8601}}">
{{ end }}
{{template "collection-meta" .}}
{{if .Collection.StyleSheet}}<style type="text/css">{{.Collection.StyleSheetDisplay}}</style>{{end}}
{{if .Collection.RenderMathJax}}
<!-- Add mathjax logic -->
{{template "mathjax" . }}
{{end}}
<!-- Add highlighting logic -->
{{template "highlighting" .}}
</head>
<body id="post">
-
+
<div id="overlay"></div>
<header>
<h1 dir="{{.Direction}}" id="blog-title"><a rel="author" href="{{if .IsTopLevel}}/{{else}}/{{.Collection.Alias}}/{{end}}" class="h-card p-author">{{.Collection.DisplayTitle}}</a></h1>
<nav>
{{if .PinnedPosts}}
{{range .PinnedPosts}}<a class="pinned{{if eq .Slug.String $.Slug.String}} selected{{end}}" href="{{if not $.SingleUser}}/{{$.Collection.Alias}}/{{.Slug.String}}{{else}}{{.CanonicalURL $.Host}}{{end}}">{{.PlainDisplayTitle}}</a>{{end}}
{{end}}
{{ if and .IsOwner .IsFound }}<span class="views" dir="ltr"><strong>{{largeNumFmt .Views}}</strong> {{pluralize "view" "views" .Views}}</span>
+ {{if .Likes}}<span class="views" dir="ltr"><strong>{{largeNumFmt .Likes}}</strong> {{pluralize "like" "likes" .Likes}}</span>{{end}}
<a href="/{{if not .SingleUser}}{{.Collection.Alias}}/{{end}}{{.Slug.String}}/edit" dir="{{.Direction}}">Edit</a>
{{if .IsPinned}}<a class="xtra-feature unpin" href="/{{.Collection.Alias}}/{{.Slug.String}}/unpin" dir="{{.Direction}}" onclick="unpinPost(event, '{{.ID}}')">Unpin</a>{{end}}
{{ end }}
</nav>
</header>
-
+
{{if .Silenced}}
{{template "user-silenced"}}
{{end}}
<article id="post-body" class="{{.Font}} h-entry {{if not .IsFound}}error-page{{end}}">{{if .IsScheduled}}<p class="badge">Scheduled</p>{{end}}{{if .Title.String}}<h2 id="title" class="p-name{{if and $.Collection.Format.ShowDates (not .IsPinned)}} dated{{end}}">{{.FormattedDisplayTitle}}</h2>{{end}}{{if and $.Collection.Format.ShowDates (not .IsPinned) .IsFound}}<time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}">{{.DisplayDate}}</time>{{end}}<div class="e-content">{{.HTMLContent}}</div></article>
{{ if .Collection.ShowFooterBranding }}
<footer dir="ltr"><hr><nav><p style="font-size: 0.9em">{{localhtml "published with write.as" .Language.String}}</p></nav></footer>
{{ end }}
</body>
-
+
{{if .Collection.CanShowScript}}
{{range .Collection.ExternalScripts}}<script type="text/javascript" src="{{.}}" async></script>{{end}}
{{if .Collection.Script}}<script type="text/javascript">{{.Collection.ScriptDisplay}}</script>{{end}}
{{end}}
<script src="/js/localdate.js"></script>
<script type="text/javascript">
var pinning = false;
function unpinPost(e, postID) {
e.preventDefault();
if (pinning) {
return;
}
pinning = true;
var $header = document.getElementsByTagName('header')[0];
var callback = function() {
// Hide current page
var $pinnedNavLink = $header.getElementsByTagName('nav')[0].querySelector('.pinned.selected');
$pinnedNavLink.style.display = 'none';
};
var $pinBtn = $header.getElementsByClassName('unpin')[0];
$pinBtn.innerHTML = '...';
var http = new XMLHttpRequest();
var url = "/api/collections/{{.Collection.Alias}}/unpin";
var params = [ { "id": postID } ];
http.open("POST", url, true);
http.setRequestHeader("Content-type", "application/json");
http.onreadystatechange = function() {
if (http.readyState == 4) {
pinning = false;
if (http.status == 200) {
callback();
$pinBtn.style.display = 'none';
$pinBtn.innerHTML = 'Pin';
} else if (http.status == 409) {
$pinBtn.innerHTML = 'Unpin';
} else {
$pinBtn.innerHTML = 'Unpin';
alert("Failed to unpin." + (http.status>=500?" Please try again.":""));
}
}
}
http.send(JSON.stringify(params));
};
try { // Fonts
WebFontConfig = {
custom: { families: [ 'Lora:400,700:latin', 'Open+Sans:400,700:latin' ], urls: [ '/css/fonts.css' ] }
};
(function() {
var wf = document.createElement('script');
wf.src = '/js/webfont.js';
wf.type = 'text/javascript';
wf.async = 'true';
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(wf, s);
})();
} catch (e) { /* ¯\_(ツ)_/¯ */ }
</script>
{{if and .Monetization (not .IsOwner)}}
<script src="/js/webmonetization.js"></script>
<script>
window.collAlias = '{{.Collection.Alias}}'
window.postSlug = '{{.Slug.String}}'
initMonetization()
</script>
{{end}}
</html>{{end}}
diff --git a/templates/include/posts.tmpl b/templates/include/posts.tmpl
index c3401fa..6a0d847 100644
--- a/templates/include/posts.tmpl
+++ b/templates/include/posts.tmpl
@@ -1,64 +1,76 @@
{{ define "posts" }}
{{ range $el := .Posts }}<article id="post-{{.ID}}" class="{{.Font}} h-entry" itemscope itemtype="http://schema.org/BlogPosting">
{{if .IsScheduled}}<p class="badge">Scheduled</p>{{end}}
{{if .Title.String}}<h2 class="post-title" itemprop="name" class="p-name">
{{- if .HasTitleLink -}}
{{.HTMLTitle}} <a class="user hidden action" href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{$.CanonicalURL}}{{.Slug.String}}{{end}}">view{{if .IsPaid}} {{template "paid-badge" .}}{{end}}</a>
{{- else -}}
{{- if .IsPaid}}{{template "paid-badge" .}}{{end -}}
<a href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{$.CanonicalURL}}{{.Slug.String}}{{end}}" itemprop="url" class="u-url">{{.HTMLTitle}}</a>
{{- end}}
{{if $.IsOwner}}
<a class="user hidden action" href="/{{if not $.SingleUser}}{{$.Alias}}/{{end}}{{.Slug.String}}/edit">edit</a>
{{if $.CanPin}}<a class="user hidden pin action" href="/{{$.Alias}}/{{.Slug.String}}/pin" onclick="pinPost(event, '{{.ID}}', '{{.Slug.String}}', '{{.PlainDisplayTitle}}')">pin</a>{{end}}
<a class="user hidden delete action" onclick="delPost(event, '{{.ID}}')" href="/{{$.Alias}}/{{.Slug.String}}/delete">delete</a>
{{if gt (len $.Collections) 1}}<div class="user hidden action flat-select">
<select id="move-{{.ID}}" onchange="postActions.multiMove(this, '{{.ID}}', {{if $.SingleUser}}true{{else}}false{{end}})" title="Move this post to another blog">
<option style="display:none"></option>
<option value="|anonymous|" style="font-style:italic">Draft</option>
{{range $.Collections}}{{if ne .Alias $.Alias}}<option value="{{.Alias}}">{{.DisplayTitle}}</option>{{end}}{{end}}
</select>
<label for="move-{{.ID}}">move to...</label>
<img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" />
</div>{{else}}
{{range $.Collections}}
<a class="user hidden action" href="/{{$el.ID}}" title="Change to a draft" onclick="postActions.move(this, '{{$el.ID}}', '|anonymous|', {{if $.SingleUser}}true{{else}}false{{end}});return false">change to <em>draft</em></a>
{{end}}
{{end}}
{{end}}
</h2>
{{if $.Format.ShowDates}}<time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}">{{if not .Title.String}}<a href="{{$.CanonicalURL}}{{.Slug.String}}" itemprop="url">{{end}}{{.DisplayDate}}{{if not .Title.String}}</a>{{end}}</time>{{end}}
{{else}}
<h2 class="post-title" itemprop="name">
{{if $.Format.ShowDates -}}
{{- if .IsPaid}}{{template "paid-badge" .}}{{end -}}
<time class="dt-published" datetime="{{.Created8601}}" pubdate itemprop="datePublished" content="{{.Created}}"><a href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{$.CanonicalURL}}{{.Slug.String}}{{end}}" itemprop="url" class="u-url">{{.DisplayDate}}</a></time>
{{- end}}
{{if $.IsOwner}}
{{if not $.Format.ShowDates}}<a class="user hidden action" href="{{if not $.SingleUser}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{$.CanonicalURL}}{{.Slug.String}}{{end}}">view</a>{{end}}
<a class="user hidden action" href="/{{if not $.SingleUser}}{{$.Alias}}/{{end}}{{.Slug.String}}/edit">edit</a>
{{if $.CanPin}}<a class="user hidden pin action" href="/{{if not $.SingleUser}}{{$.Alias}}/{{end}}{{.Slug.String}}/pin" onclick="pinPost(event, '{{.ID}}', '{{.Slug.String}}', '{{.PlainDisplayTitle}}')">pin</a>{{end}}
<a class="user hidden delete action" onclick="delPost(event, '{{.ID}}')" href="/{{$.Alias}}/{{.Slug.String}}/delete">delete</a>
{{if gt (len $.Collections) 1}}<div class="user hidden action flat-select">
<select id="move-{{.ID}}" onchange="postActions.multiMove(this, '{{.ID}}', {{if $.SingleUser}}true{{else}}false{{end}})" title="Move this post to another blog">
<option style="display:none"></option>
<option value="|anonymous|" style="font-style:italic">Draft</option>
{{range $.Collections}}{{if ne .Alias $.Alias}}<option value="{{.Alias}}">{{.DisplayTitle}}</option>{{end}}{{end}}
</select>
<label for="move-{{.ID}}">move to...</label>
<img class="ic-18dp" src="/img/ic_down_arrow_dark@2x.png" />
</div>{{else}}
{{range $.Collections}}
<a class="user hidden action" href="/{{$el.ID}}" title="Change to a draft" onclick="postActions.move(this, '{{$el.ID}}', '|anonymous|', {{if $.SingleUser}}true{{else}}false{{end}});return false">change to <em>draft</em></a>
{{end}}
{{end}}
{{end}}
</h2>
{{end}}
{{if .Excerpt}}<div {{if .Language}}lang="{{.Language.String}}"{{end}} dir="{{.Direction}}" class="book p-summary">{{if and (and (not $.IsOwner) (not $.Format.ShowDates)) (not .Title.String)}}<a class="hidden action" href="{{if $.IsOwner}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{$.CanonicalURL}}{{.Slug.String}}{{end}}">view</a>{{end}}{{.Excerpt}}</div>
<a class="read-more" href="{{$.CanonicalURL}}{{.Slug.String}}">{{localstr "Read more..." .Language.String}}</a>{{else}}<div {{if .Language}}lang="{{.Language.String}}"{{end}} dir="{{.Direction}}" class="book e-content">{{if and (and (not $.IsOwner) (not $.Format.ShowDates)) (not .Title.String)}}<a class="hidden action" href="{{if $.IsOwner}}/{{$.Alias}}/{{.Slug.String}}{{else}}{{$.CanonicalURL}}{{.Slug.String}}{{end}}">view</a>{{end}}{{.HTMLContent}}</div>{{end}}</article>{{ end }}
{{ end }}
-{{define "paid-badge"}}<img class="paid" alt="Paid article" src="/img/paidarticle.svg" /> {{end}}
\ No newline at end of file
+{{define "paid-badge"}}<img class="paid" alt="Paid article" src="/img/paidarticle.svg" /> {{end}}
+
+{{define "paging"}}
+ {{if gt .TotalPages 1}}<nav id="paging" class="content-container clearfix">
+ {{if or (and .Format.Ascending (le .CurrentPage .TotalPages)) (isRTL .Direction)}}
+ {{if gt .CurrentPage 1}}<a href="{{.PrevPageURL .Prefix .NavSuffix .CurrentPage .IsTopLevel}}">&#8672; {{if and .Format.Ascending (le .CurrentPage .TotalPages)}}Previous{{else}}Newer{{end}}</a>{{end}}
+ {{if lt .CurrentPage .TotalPages}}<a style="float:right;" href="{{.NextPageURL .Prefix .NavSuffix .CurrentPage .IsTopLevel}}">{{if and .Format.Ascending (lt .CurrentPage .TotalPages)}}Next{{else}}Older{{end}} &#8674;</a>{{end}}
+ {{else}}
+ {{if lt .CurrentPage .TotalPages}}<a href="{{.NextPageURL .Prefix .NavSuffix .CurrentPage .IsTopLevel}}">&#8672; Older</a>{{end}}
+ {{if gt .CurrentPage 1}}<a style="float:right;" href="{{.PrevPageURL .Prefix .NavSuffix .CurrentPage .IsTopLevel}}">Newer &#8674;</a>{{end}}
+ {{end}}
+ </nav>{{end}}
+{{end}}
diff --git a/templates/user/stats.tmpl b/templates/user/stats.tmpl
index b7f3322..a0c08ec 100644
--- a/templates/user/stats.tmpl
+++ b/templates/user/stats.tmpl
@@ -1,65 +1,67 @@
{{define "stats"}}
{{template "header" .}}
<style>
table.classy th { text-align: left }
table.classy th.num { text-align: right }
td + td {
padding-left: 0.5em;
padding-right: 0.5em;
}
td.num {
text-align: right;
}
table.classy.export a { text-transform: inherit; }
td.none {
font-style: italic;
}
</style>
<div class="content-container snug">
{{if .Silenced}}
{{template "user-silenced"}}
{{end}}
{{template "collection-breadcrumbs" .}}
<h1 id="posts-header">Stats</h1>
{{if .Collection}}
{{template "collection-nav" (dict "Alias" .Collection.Alias "Path" .Path "SingleUser" .SingleUser)}}
{{end}}
<p>Stats for all time.</p>
{{if or .Federation .EmailEnabled}}
<h3>Subscribers</h3>
<table id="fediverse" class="classy export">
<tr>
{{if .Federation}}<th>Fediverse Followers</th>{{end}}
{{if .EmailEnabled}}<th>Email Subscribers</th>{{end}}
</tr>
<tr>
{{if .Federation}}<td><a href="/me/c/{{.Collection.Alias}}/subscribers?filter=fediverse">{{.APFollowers}}</a></td>{{end}}
{{if .EmailEnabled}}<td><a href="/me/c/{{.Collection.Alias}}/subscribers">{{.EmailSubscribers}}</a></td>{{end}}
</tr>
</table>
{{end}}
<h3>Top {{len .TopPosts}} posts</h3>
<table class="classy export">
<tr>
<th>Post</th>
{{if not .Collection}}<th>Blog</th>{{end}}
<th class="num">Total Views</th>
+ {{if .Federation}}<th class="num">Likes</th>{{end}}
</tr>
{{range .TopPosts}}<tr>
<td style="word-break: break-all;"><a href="{{if .Collection}}{{.Collection.CanonicalURL}}{{.Slug.String}}{{else}}/{{.ID}}{{end}}">{{if ne .DisplayTitle ""}}{{.DisplayTitle}}{{else}}<em>{{.ID}}</em>{{end}}</a></td>
{{ if not $.Collection }}<td>{{if .Collection}}<a href="{{.Collection.CanonicalURL}}">{{.Collection.Title}}</a>{{else}}<em>Draft</em>{{end}}</td>{{ end }}
<td class="num">{{.ViewCount}}</td>
+ {{if $.Federation}}<td class="num">{{.LikeCount}}</td>{{end}}
</tr>{{end}}
</table>
</div>
{{template "footer" .}}
{{end}}

File Metadata

Mime Type
text/x-diff
Expires
Thu, Mar 12, 12:57 PM (1 d, 5 h)
Storage Engine
blob
Storage Format
Raw Data
Storage Handle
3653251

Event Timeline